Adenosine diphosphate (BioDeep_00000001284)
Secondary id: BioDeep_00000400395, BioDeep_00001890787
natural product human metabolite PANOMIX_OTCML-2023 Endogenous blood metabolite BioNovoGene_Lab2019
代谢物信息卡片
[({[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy]phosphonic acid
化学式: C10H15N5O10P2 (427.0294)
中文名称: 二磷酸腺苷, 腺苷-5'-二磷酸 钠盐, 腺苷二磷酸, 腺苷-5'-二磷酸
谱图信息:
最多检出来源 Homo sapiens(blood) 10.54%
Reviewed
Last reviewed on 2024-09-14.
Cite this Page
Adenosine diphosphate. BioDeep Database v3. PANOMIX ltd, a top metabolomics service provider from China.
https://query.biodeep.cn/s/adenosine_diphosphate (retrieved
2024-12-22) (BioDeep RN: BioDeep_00000001284). Licensed
under the Attribution-Noncommercial 4.0 International License (CC BY-NC 4.0).
分子结构信息
SMILES: C([C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)O)OP(=O)(O)OP(=O)(O)O
InChI: InChI=1S/C10H15N5O10P2/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(24-10)1-23-27(21,22)25-26(18,19)20/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1
描述信息
Adenosine diphosphate (ADP), also known as adenosine pyrophosphate (APP), is an important organic compound in metabolism and is essential to the flow of energy in living cells. ADP consists of three important structural components: a sugar backbone attached to adenine and two phosphate groups bonded to the 5 carbon atom of ribose. The diphosphate group of ADP is attached to the 5’ carbon of the sugar backbone, while the adenine attaches to the 1’ carbon. ADP belongs to the class of organic compounds known as purine ribonucleoside diphosphates. These are purine ribobucleotides with diphosphate group linked to the ribose moiety. It is an ester of pyrophosphoric acid with the nucleotide adenine. Adenosine diphosphate is a nucleotide. ADP exists in all living species, ranging from bacteria to humans. In humans, ADP is involved in d4-gdi signaling pathway. ADP is the product of ATP dephosphorylation by ATPases. ADP is converted back to ATP by ATP synthases. ADP consists of the pyrophosphate group, the pentose sugar ribose, and the nucleobase adenine.
Adenosine diphosphate, abbreviated ADP, is a nucleotide. It is an ester of pyrophosphoric acid with the nucleotide adenine. ADP consists of the pyrophosphate group, the pentose sugar ribose, and the nucleobase adenine.
5′-ADP. CAS Common Chemistry. CAS, a division of the American Chemical Society, n.d. https://commonchemistry.cas.org/detail?cas_rn=58-64-0 (retrieved 2024-07-01) (CAS RN: 58-64-0). Licensed under the Attribution-Noncommercial 4.0 International License (CC BY-NC 4.0).
Adenosine 5'-diphosphate (Adenosine diphosphate) is a nucleoside diphosphate. Adenosine 5'-diphosphate is the product of ATP dephosphorylation by ATPases. Adenosine 5'-diphosphate induces human platelet aggregation and inhibits stimulated adenylate cyclase by an action at P2T-purinoceptors.
Adenosine 5'-diphosphate (Adenosine diphosphate) is a nucleoside diphosphate. Adenosine 5'-diphosphate is the product of ATP dephosphorylation by ATPases. Adenosine 5'-diphosphate induces human platelet aggregation and inhibits stimulated adenylate cyclase by an action at P2T-purinoceptors.
同义名列表
28 个代谢物同义名
[({[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy]phosphonic acid; Adenosine-5-diphosphate Di(monocyclohexylammonium)salt; Adenosine 5-diphosphoric acid; ADENOSINE-5-diphosphoric acid; Adenosine diphosphoric acid; 5-Pyrophosphate, adenosine; Adenosine 5-pyrophosphate; Adenosine diphosphate;ADP; Adenosine 5 pyrophosphate; Adenosindiphosphorsaeure; Pyrophosphate, adenosine; Adenosine pyrophosphate; 5-Adenylphosphoric acid; ADENOSINE-5-diphosphATE; Adenosine-5-diphosphate; Adenosine 5-diphosphate; Diphosphate, adenosine; Adenosine diphosphate; Adenosine-diphosphate; 5-Adenylphosphate; ADP, Magnesium; Magnesium ADP; MgADP; H3ADP; ADP; Adenosine-5'-diphosphate(ADP); Adenosine 5'-diphosphate; ADP
数据库引用编号
37 个数据库交叉引用编号
- ChEBI: CHEBI:16761
- KEGG: C00008
- PubChem: 6022
- PubChem: 197
- HMDB: HMDB0001341
- Metlin: METLIN34522
- ChEMBL: CHEMBL14830
- Wikipedia: Adenosine_diphosphate
- MeSH: Adenosine Diphosphate
- MetaCyc: ADP
- KNApSAcK: C00019353
- foodb: FDB021817
- chemspider: 5800
- CAS: 58-64-0
- MoNA: PS010907
- MoNA: KNA00824
- MoNA: PS010902
- MoNA: PS010905
- MoNA: PS010906
- MoNA: PS010904
- MoNA: PS010901
- MoNA: KNA00825
- MoNA: PS010903
- MoNA: PR100514
- MoNA: PS010908
- PMhub: MS000000263
- PDB-CCD: ADP
- 3DMET: B01130
- NIKKAJI: J10.683F
- RefMet: ADP
- medchemexpress: HY-W010918
- BioNovoGene_Lab2019: BioNovoGene_Lab2019-122
- BioNovoGene_Lab2019: BioNovoGene_Lab2019-980
- PubChem: 3310
- KNApSAcK: 16761
- LOTUS: LTS0160855
- LOTUS: LTS0045850
分类词条
相关代谢途径
Reactome(7)
BioCyc(83)
- superpathway of ribose and deoxyribose phosphate degradation
- purine and pyrimidine metabolism
- superpathway of sterol biosynthesis
- superpathway of citrulline metabolism
- L-Nδ-acetylornithine biosynthesis
- superpathway of arginine and ornithine degradation
- superpathway of arginine, putrescine, and 4-aminobutyrate degradation
- formaldehyde oxidation V (tetrahydrofolate pathway)
- formaldehyde assimilation II (RuMP Cycle)
- salvage pathways of purine nucleosides
- purine nucleotide metabolism (phosphotransfer and nucleotide modification)
- salvage pathways of adenine, hypoxanthine, and their nucleosides
- purine nucleotides de novo biosynthesis I
- superpathway of histidine, purine, and pyrimidine biosynthesis
- purine nucleotides de novo biosynthesis II
- salvage pathways of purine nucleosides I
- acidification and chitin degradation (in carnivorous plants)
- TCA cycle, aerobic respiration
- oxidative ethanol degradation
- N-acetylglucosamine , N-acetylmannosamine and N-acetylneuraminic acid dissimilation
- pantothenate and coenzyme A biosynthesis
- superpathway of central carbon metabolism
- pyridoxamine anabolism
- peptidoglycan and lipid A precursor biosynthesis
- UDP-N-acetylmuramoyl-pentapeptide biosynthesis III (meso-DAP-containing)
- nicotinamide riboside salvage pathway
- galactose degradation IV
- galactose degradation I
- itaconate biosynthesis
- sulfate assimilation
- superpathway of histidine, purine and pyrimidine biosynthesis
- riboflavin and FMN and FAD biosynthesis
- N-acetylglucosamine degradation
- allantoin degradation
- pyridoxal 5'-phosphate (vitamin B6) biosynthesis
- glutamine biosynthesis II
- methionine biosynthesis
- arginine biosynthesis IV
- purine nucleotides degradation III (anaerobic)
- purine nucleotides degradation IV (anaerobic)
- folate transformations II (plants)
- glycine degradation I
- lysine fermentation to acetate and butyrate
- glutamate degradation VII (to butanoate)
- superpathway of glutamate biosynthesis
- TCA cycle VI (obligate autotrophs)
- glutamine biosynthesis III
- superpathway of threonine metabolism
- superpathway of lysine, threonine and methionine biosynthesis II
- isoleucine biosynthesis I
- superpathway of lysine, threonine and methionine biosynthesis I
- formylTHF biosynthesis II
- formylTHF biosynthesis I
- salvage pathways of guanine, xanthine, and their nucleosides
- methionine biosynthesis II
- thiamin (vitamin B1) biosynthesis
- acetyl-CoA degradation to acetate
- glycolysis I
- superpathway of glycolysis, pyruvate dehydrogenase and TCA cycle
- superpathway of glyoxylate cycle
- superpathway of glycolysis and Entner-Doudoroff
- glycolysis II
- arginine biosynthesis I
- tetrahydrofolate biosynthesis I
- folate polyglutamylation I
- sphingolipid metabolism
- superpathway of phospholipid biosynthesis
- ester phospholipid biosynthesis
- UDP-galactose biosynthesis
- trehalose degradation II (trehalase)
- lactate oxidation
- folate metabolism
- PIP metabolism
- UDP-D-glucuronate biosynthesis (from myo-inositol)
- proline biosynthesis II
- biotin biosynthesis
- D-arabinose degradation
- fatty acid biosynthesis -- elongase pathway
- respiration (anaerobic)
- threonine biosynthesis
- lysine biosynthesis VI
- lysine biosynthesis I
- ornithine biosynthesis
PlantCyc(0)
代谢反应
14593 个相关的代谢反应过程信息。
Reactome(1363)
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of polyamines:
GAA + SAM ⟶ CRET + H+ + SAH - Creatine metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Glucose metabolism:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Glycolysis:
ATP + Fru(6)P ⟶ ADP + D-Fructose 1,6-bisphosphate - Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Glucose metabolism:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Glycolysis:
ATP + Fru(6)P ⟶ ADP + D-Fructose 1,6-bisphosphate - Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Glucose metabolism:
ADP + Glc ⟶ AMP + G6P - Glycolysis:
ADP + Glc ⟶ AMP + G6P - The citric acid (TCA) cycle and respiratory electron transport:
ETF:FAD + FADH2 ⟶ ETF:FADH2 + FAD - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism:
GSH + MGXL ⟶ (R)-S-LGSH - Regulation of pyruvate dehydrogenase (PDH) complex:
DCA + H2O ⟶ HCl + glyoxylate - Signaling Pathways:
AMP + p-AMPK heterotrimer ⟶ p-AMPK heterotrimer:AMP - Signaling by Nuclear Receptors:
ATP + MYB gene:hypophosphorylated RNA polymerase II:TFIIF:ESR1:ESTG:P-TEFb ⟶ ADP + MYB gene:hyperphosphorylated RNA polymerase II:TFIIF:ESR1:ESTG:P-TEFb - Signaling by Retinoic Acid:
ATP + lipo-PDH ⟶ ADP + p-lipo-PDH - The citric acid (TCA) cycle and respiratory electron transport:
ETF:FAD + FADH2 ⟶ ETF:FADH2 + FAD - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism:
GSH + MGXL ⟶ (R)-S-LGSH - Regulation of pyruvate dehydrogenase (PDH) complex:
DCA + H2O ⟶ HCl + glyoxylate - Signaling Pathways:
AMP + p-AMPK heterotrimer ⟶ p-AMPK heterotrimer:AMP - Signaling by Nuclear Receptors:
ATP + MYB gene:hypophosphorylated RNA polymerase II:TFIIF:ESR1:ESTG:P-TEFb ⟶ ADP + MYB gene:hyperphosphorylated RNA polymerase II:TFIIF:ESR1:ESTG:P-TEFb - Signaling by Retinoic Acid:
ATP + lipo-PDH ⟶ ADP + p-lipo-PDH - Regulation of pyruvate dehydrogenase (PDH) complex:
ATP + lipo-PDH ⟶ ADP + p-lipo-PDH - Signaling Pathways:
AMP + p-AMPK heterotrimer ⟶ p-AMPK heterotrimer:AMP - Signaling by Nuclear Receptors:
ESR1:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + H0ZSE5 + H0ZZA2 + HSP90-beta dimer + Pi - Signaling by Retinoic Acid:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN - The citric acid (TCA) cycle and respiratory electron transport:
CoQ + ETF:FADH2 ⟶ ETF:FAD + ubiquinol - Pyruvate metabolism and Citric Acid (TCA) cycle:
CIT ⟶ ISCIT - Pyruvate metabolism:
GSH + MGXL ⟶ (R)-S-LGSH - Regulation of pyruvate dehydrogenase (PDH) complex:
DCA + H2O ⟶ HCl + glyoxylate - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of folate and pterines:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of folate and pterines:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of folate and pterines:
FOLA + Homologues of FOLR2 ⟶ FOLR2:FOLA - Vitamin B5 (pantothenate) metabolism:
ATP + L-Cys + PPanK ⟶ AMP + PPC + PPi - Coenzyme A biosynthesis:
ATP + L-Cys + PPanK ⟶ AMP + PPC + PPi - Inositol phosphate metabolism:
ATP + I(3,4,5,6)P4 ⟶ ADP + I(1,3,4,5,6)P5 - Synthesis of pyrophosphates in the cytosol:
ATP + I(3,4,5,6)P4 ⟶ ADP + I(1,3,4,5,6)P5 - Hemostasis:
2AG + H2O ⟶ AA + Glycerol + H+ - Factors involved in megakaryocyte development and platelet production:
ATP + I(3,4,5,6)P4 ⟶ ADP + I(1,3,4,5,6)P5 - Inositol phosphate metabolism:
ATP + I(1,3,4)P3 ⟶ ADP + I(1,3,4,5)P4 - Synthesis of pyrophosphates in the cytosol:
ATP + I(3,4,5,6)P4 ⟶ ADP + I(1,3,4,5,6)P5 - Hemostasis:
2AG + H2O ⟶ AA + Glycerol + H+ - Factors involved in megakaryocyte development and platelet production:
ATP + I(3,4,5,6)P4 ⟶ ADP + I(1,3,4,5,6)P5 - Hemostasis:
AMP + GTP ⟶ ADP + GDP - Factors involved in megakaryocyte development and platelet production:
AMP + GTP ⟶ ADP + GDP - Inositol phosphate metabolism:
H2O + I4P ⟶ Ins + Pi - Synthesis of pyrophosphates in the cytosol:
ATP + I(3,4,5,6)P4 ⟶ ADP + I(1,3,4,5,6)P5 - Nucleotide metabolism:
H2O + XTP ⟶ PPi + XMP - Nucleobase biosynthesis:
ATP + H2O + L-Gln + XMP ⟶ AMP + GMP + L-Glu + PPi - Pyrimidine biosynthesis:
CAP + L-Asp ⟶ N-carbamoyl-L-aspartate + Pi - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of polyamines:
GAA + SAM ⟶ CRET + H+ + SAH - Urea cycle:
CAP + L-Orn ⟶ L-Cit + Pi - De novo synthesis of UMP:
CAP + L-Asp ⟶ N-carbamoyl-L-aspartate + Pi - Nucleotide metabolism:
H2O + XTP ⟶ PPi + XMP - Nucleobase biosynthesis:
ATP + H2O + L-Gln + XMP ⟶ AMP + GMP + L-Glu + PPi - Pyrimidine biosynthesis:
CAP + L-Asp ⟶ N-carbamoyl-L-aspartate + Pi - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of polyamines:
GAA + SAM ⟶ CRET + H+ + SAH - Urea cycle:
CAP + L-Orn ⟶ L-Cit + Pi - Urea cycle:
ATP + L-Asp + L-Cit ⟶ AMP + ARSUA + PPi - Gluconeogenesis:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Gluconeogenesis:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Gluconeogenesis:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Signaling by GPCR:
2AG + H2O ⟶ AA + Glycerol + H+ - GPCR downstream signalling:
2AG + H2O ⟶ AA + Glycerol + H+ - G alpha (i) signalling events:
ATP + H2O + atRAL ⟶ ADP + Pi + atRAL - Visual phototransduction:
ATP + H2O + atRAL ⟶ ADP + Pi + atRAL - The canonical retinoid cycle in rods (twilight vision):
ATP + H2O + atRAL ⟶ ADP + Pi + atRAL - Transport of small molecules:
ATP + CHOL + H2O ⟶ ADP + CHOL + Pi - ABC-family proteins mediated transport:
ATP + CHOL + H2O ⟶ ADP + CHOL + Pi - Transport of small molecules:
ATP + CHOL + H2O ⟶ ADP + CHOL + Pi - ABC-family proteins mediated transport:
ATP + CHOL + H2O ⟶ ADP + CHOL + Pi - Signaling by GPCR:
2AG + H2O ⟶ AA + Glycerol + H+ - GPCR downstream signalling:
2AG + H2O ⟶ AA + Glycerol + H+ - G alpha (i) signalling events:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - Visual phototransduction:
ATP + H2O + atRAL ⟶ ADP + Pi + atRAL - The canonical retinoid cycle in rods (twilight vision):
ATP + H2O + atRAL ⟶ ADP + Pi + atRAL - Transport of small molecules:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN - ABC-family proteins mediated transport:
ATP + CHOL + H2O ⟶ ADP + CHOL + Pi - Signaling by GPCR:
H2O + cAMP ⟶ AMP - GPCR downstream signalling:
H2O + cAMP ⟶ AMP - G alpha (i) signalling events:
H2O + cAMP ⟶ AMP - Visual phototransduction:
H+ + RBP2:atRAL + TPNH ⟶ RBP2:atROL + TPN - The canonical retinoid cycle in rods (twilight vision):
RLBP1:11cROL + TPN ⟶ H+ + RLBP1:11cRAL + TPNH - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Mitochondrial Fatty Acid Beta-Oxidation:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Propionyl-CoA catabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - G alpha (q) signalling events:
Heterotrimeric G-protein Gq/11 (inactive) + Ligand:GPCR complexes that activate Gq/11 ⟶ Ligand:GPCR complexes that activate Gq/11:Heterotrimeric G-protein Gq (inactive) - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
CIT ⟶ ISCIT - Ion channel transport:
ATP + Cu2+ + H2O ⟶ ADP + Cu2+ + Pi - Ion transport by P-type ATPases:
ATP + Cu2+ + H2O ⟶ ADP + Cu2+ + Pi - Metabolism of lipids:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN - Fatty acid metabolism:
Ac-CoA + H2O ⟶ CH3COO- + CoA-SH - Fatty acyl-CoA biosynthesis:
ATP + CoA-SH + VLCFA ⟶ AMP + PPi + VLCFA-CoA - Import of palmitoyl-CoA into the mitochondrial matrix:
ATP + Ac-CoA + HCO3- ⟶ ADP + Mal-CoA + Pi - Metabolism of lipids:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN - Fatty acid metabolism:
Ac-CoA + H2O ⟶ CH3COO- + CoA-SH - Fatty acyl-CoA biosynthesis:
ATP + CoA-SH + VLCFA ⟶ AMP + PPi + VLCFA-CoA - Import of palmitoyl-CoA into the mitochondrial matrix:
ATP + Ac-CoA + HCO3- ⟶ ADP + Mal-CoA + Pi - Fatty acyl-CoA biosynthesis:
ATP + CoA + VLCFA ⟶ AMP + PPi + VLCFA-CoA - Import of palmitoyl-CoA into the mitochondrial matrix:
ATP + Ac-CoA + HCO3- ⟶ ADP + Mal-CoA + Pi - Biological oxidations:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN - Phase II - Conjugation of compounds:
H2O + SAH ⟶ Ade-Rib + HCYS - Glutathione conjugation:
GSH + H2O ⟶ CysGly + L-Glu - Glutathione synthesis and recycling:
GSH + H2O ⟶ CysGly + L-Glu - Biological oxidations:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN - Phase II - Conjugation of compounds:
H2O + SAH ⟶ Ade-Rib + HCYS - Glutathione conjugation:
GSH + H2O ⟶ CysGly + L-Glu - Glutathione synthesis and recycling:
GSH + H2O ⟶ CysGly + L-Glu - Biological oxidations:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN - Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP - Glutathione conjugation:
GSH + H2O ⟶ CysGly + L-Glu - Glutathione synthesis and recycling:
GSH + H2O ⟶ CysGly + L-Glu - eNOS activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - eNOS activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - eNOS activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - eNOS activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - eNOS activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - eNOS activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - eNOS activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - eNOS activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - eNOS activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - DNA Repair:
MUTYH:(OGUA:Ade)-dsDNA ⟶ Ade + MUTYH:AP-dsDNA - DNA Double-Strand Break Repair:
ATP + DNA DSBs:MRN:Ac-K3016-ATM dimer:KAT5 ⟶ ADP + DNA DSBs:MRN:p-S1981,Ac-K3016-ATM:KAT5 + phospho-p-S1981,Ac-K3016-ATM - DNA Double Strand Break Response:
ATP + DNA DSBs:MRN:Ac-K3016-ATM dimer:KAT5 ⟶ ADP + DNA DSBs:MRN:p-S1981,Ac-K3016-ATM:KAT5 + phospho-p-S1981,Ac-K3016-ATM - Recruitment and ATM-mediated phosphorylation of repair and signaling proteins at DNA double strand breaks:
ATP + DNA DNA DSBs:p-MRN:p-S1981,Ac-K3016-ATM:KAT5:K63PolyUb-K14,K16,p-S139-H2AFX,Me2K21-HIST1H4A-Nucleosome:p-5T-MDC1:p-S102-WHSC1:RNF8:Zn2+:SUMO1:p-T4827-HERC2:UBE2N:UBE2V2:RNF168:PIAS4:p-S25,S1778-TP53BP1:p-4S,2T-BRCA1-A complex:CHEK2 ⟶ ADP + DNA DNA DSBs:p-MRN:p-S1981,Ac-K3016-ATM:KAT5:K63PolyUb-K14,K16,p-S139-H2AFX,Me2K21-HIST1H4A-Nucleosome:p-5T-MDC1:p-S102-WHSC1:RNF8:Zn2+:SUMO1:p-T4827-HERC2:UBE2N:UBE2V2:RNF168:PIAS4:p-S25,S1778-TP53BP1:p-4S,2T-BRCA1-A complex + phospho-p-T68-CHEK2 - Integration of energy metabolism:
AMP + AMPK heterotrimer (inactive) ⟶ AMPK heterotrimer:AMP - Regulation of insulin secretion:
Homologues of RAPGEF4 + cAMP ⟶ RAPGEF4:cAMP Complex - Metabolism of cofactors:
ISCIT + TPN ⟶ 2OG + H+ + TPNH + carbon dioxide - Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation:
GTP + H2O ⟶ DHNTP + HCOOH - Vitamins B6 activation to pyridoxal phosphate:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Vitamins B6 activation to pyridoxal phosphate:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Vitamins B6 activation to pyridoxal phosphate:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Nicotinamide salvaging:
AMP + H2O + NADH ⟶ H+ + NMNH - Nicotinamide salvaging:
AMP + H2O + NADH ⟶ H+ + NMNH - Nicotinamide salvaging:
AMP + H2O + NADH ⟶ H+ + NMNH - Branched-chain amino acid catabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Branched-chain amino acid catabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Branched-chain amino acid catabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Vitamin B2 (riboflavin) metabolism:
FAD + H2O ⟶ AMP + FMN - Sphingolipid metabolism:
H2O + dehydroepiandrosterone sulfate ⟶ DHEA + SO4(2-) - Sphingolipid de novo biosynthesis:
3-ketosphinganine + H+ + TPNH ⟶ SPA + TPN - Immune System:
ATP + Ag-substrate:E3:E2:Ub ⟶ AMP + E3:Ub:substrate + PPi - Innate Immune System:
ATP + DAG:p-5Y-PKC-theta:CBM oligomer:TRAF6 oligomer + UBE2N:UBE2V1 ⟶ AMP + DAG:p-5Y-PKC-theta:CBM oligomer:oligo-K63-poly Ub-TRAF6 + PPi + UBE2N:UBE2V1 - Antimicrobial peptides:
ATOX1:Cu1+ + ATP + H2O ⟶ ADP + Cu1+ + Homologues of ATOX1 + Pi - Ion influx/efflux at host-pathogen interface:
ATOX1:Cu1+ + ATP + H2O ⟶ ADP + Cu1+ + Homologues of ATOX1 + Pi - alpha-linolenic (omega3) and linoleic (omega6) acid metabolism:
ALA + ATP + CoA-SH ⟶ ALA-CoA + AMP + PPi - alpha-linolenic acid (ALA) metabolism:
ALA + ATP + CoA-SH ⟶ ALA-CoA + AMP + PPi - alpha-linolenic (omega3) and linoleic (omega6) acid metabolism:
ALA + ATP + CoA-SH ⟶ ALA-CoA + AMP + PPi - alpha-linolenic acid (ALA) metabolism:
ALA + ATP + CoA-SH ⟶ ALA-CoA + AMP + PPi - alpha-linolenic (omega3) and linoleic (omega6) acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - alpha-linolenic acid (ALA) metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Platelet activation, signaling and aggregation:
2AG + H2O ⟶ AA + Glycerol + H+ - Signal amplification:
ADP:P2RY12:G-protein Gi (active) ⟶ ADP + G alpha (i): GTP + G-protein beta-gamma complex + P2RY12 - ADP signalling through P2Y purinoceptor 12:
ADP:P2RY12:G-protein Gi (active) ⟶ ADP + G alpha (i): GTP + G-protein beta-gamma complex + P2RY12 - Metabolism of RNA:
H2O ⟶ AMP + CMP + GMP + UMP - Nonsense-Mediated Decay (NMD):
ATP + SMG1:UPF1:EJC:Translated mRNP ⟶ ADP + SMG1:Phosphorylated UPF1:EJC:Translated mRNP - Mycobacterium tuberculosis biological processes:
CYSTA + H2O ⟶ 2OBUTA + L-Cys + ammonia - Sulfur compound metabolism:
CYSTA + H2O ⟶ 2OBUTA + L-Cys + ammonia - Sulfate assimilation:
ATP + H2O + SubI--sulfate complex ⟶ ADP + Pi + SO4(2-) + SubI - Metabolism of RNA:
H2O ⟶ AMP + CMP + GMP + UMP - Nonsense-Mediated Decay (NMD):
ATP + SMG1:UPF1:EJC:Translated mRNP ⟶ ADP + SMG1:Phosphorylated UPF1:EJC:Translated mRNP - mTOR signalling:
AMP + p-AMPK heterotrimer ⟶ p-AMPK heterotrimer:AMP - Metabolism of RNA:
H2O + Translatable mRNA Complex ⟶ AMP + Partially Deadenylated mRNA Complex - Nonsense-Mediated Decay (NMD):
ATP + SMG1:UPF1:EJC:Translated mRNP ⟶ ADP + SMG1:Phosphorylated UPF1:EJC:Translated mRNP - Vesicle-mediated transport:
ATP + RAB1:GTP:GBF1:USO1:ARF:GDP ⟶ ADP + RAB1:GTP:GBF1:USO1:ARF:GTP - Membrane Trafficking:
ATP + RAB1:GTP:GBF1:USO1:ARF:GDP ⟶ ADP + RAB1:GTP:GBF1:USO1:ARF:GTP - Clathrin-mediated endocytosis:
ATP + AVPR2:AVP(20-28) ⟶ ADP + p-AVPR2:AVP(20-28) - Vesicle-mediated transport:
ATP + RAB1:GTP:GBF1:USO1:ARF:GDP ⟶ ADP + RAB1:GTP:GBF1:USO1:ARF:GTP - Membrane Trafficking:
ATP + RAB1:GTP:GBF1:USO1:ARF:GDP ⟶ ADP + RAB1:GTP:GBF1:USO1:ARF:GTP - ER to Golgi Anterograde Transport:
ATP + RAB1:GTP:GBF1:USO1:ARF:GDP ⟶ ADP + RAB1:GTP:GBF1:USO1:ARF:GTP - COPI-mediated anterograde transport:
ATP + RAB1:GTP:GBF1:USO1:ARF:GDP ⟶ ADP + RAB1:GTP:GBF1:USO1:ARF:GTP - Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Transport to the Golgi and subsequent modification:
ATP + RAB1:GTP:GBF1:USO1:ARF:GDP ⟶ ADP + RAB1:GTP:GBF1:USO1:ARF:GTP - Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Transport to the Golgi and subsequent modification:
ATP + RAB1:GTP:GBF1:USO1:ARF:GDP ⟶ ADP + RAB1:GTP:GBF1:USO1:ARF:GTP - ER to Golgi Anterograde Transport:
ATP + RAB1:GTP:GBF1:USO1:ARF:GDP ⟶ ADP + RAB1:GTP:GBF1:USO1:ARF:GTP - COPI-mediated anterograde transport:
ATP + RAB1:GTP:GBF1:USO1:ARF:GDP ⟶ ADP + RAB1:GTP:GBF1:USO1:ARF:GTP - Vesicle-mediated transport:
ATP + RAB1:GTP:GBF1:USO1:ARF:GDP ⟶ ADP + RAB1:GTP:GBF1:USO1:ARF:GTP - Membrane Trafficking:
ATP + RAB1:GTP:GBF1:USO1:ARF:GDP ⟶ ADP + RAB1:GTP:GBF1:USO1:ARF:GTP - Metabolism of proteins:
EIF5A2 + NAD + SPM ⟶ 1,3-diaminopropane + H+ + H0ZKZ7 + NADH - Post-translational protein modification:
EIF5A2 + NAD + SPM ⟶ 1,3-diaminopropane + H+ + H0ZKZ7 + NADH - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Transport to the Golgi and subsequent modification:
HNK1 carbohydrate + PAPS ⟶ PAP + S-HNK1 carbohydrate - ER to Golgi Anterograde Transport:
ATP + RAB1:GTP:GBF1:USO1:ARF:GDP ⟶ ADP + RAB1:GTP:GBF1:USO1:ARF:GTP - COPI-mediated anterograde transport:
ATP + RAB1:GTP:GBF1:USO1:ARF:GDP ⟶ ADP + RAB1:GTP:GBF1:USO1:ARF:GTP - Galactose catabolism:
ATP + Gal ⟶ ADP + Gal1P - Amino acid synthesis and interconversion (transamination):
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Amino acid synthesis and interconversion (transamination):
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid synthesis and interconversion (transamination):
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid synthesis and interconversion (transamination):
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Amino acid synthesis and interconversion (transamination):
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Amino acid synthesis and interconversion (transamination):
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Chorismate via Shikimate Pathway:
ATP + SKM ⟶ ADP + SKMP - Nucleotide metabolism:
H2O + XTP ⟶ PPi + XMP - Nucleobase biosynthesis:
ATP + H2O + L-Gln + XMP ⟶ AMP + GMP + L-Glu + PPi - Purine ribonucleoside monophosphate biosynthesis:
ATP + H2O + L-Gln + XMP ⟶ AMP + GMP + L-Glu + PPi - Arachidonic acid metabolism:
H2O + leukotriene A4 ⟶ leukotriene B4 - Synthesis of Leukotrienes (LT) and Eoxins (EX):
H2O + leukotriene A4 ⟶ leukotriene B4 - Translation:
48S complex + ATP ⟶ 48S complex + ADP + Pi - Eukaryotic Translation Initiation:
48S complex + ATP ⟶ 48S complex + ADP + Pi - Cap-dependent Translation Initiation:
48S complex + ATP ⟶ 48S complex + ADP + Pi - Integrin signaling:
ATP + Talin:RIAM complex:ECM ligands: 2X(Integrin alphaIIb beta3:SRC) ⟶ ADP + Talin:RIAM complex:ECM ligands:2X(Integrin alphaIIb beta3:Active p-Y419-SRC) - Integrin signaling:
ATP + Talin:RIAM complex:ECM ligands: 2X(Integrin alphaIIb beta3:SRC) ⟶ ADP + Talin:RIAM complex:ECM ligands:2X(Integrin alphaIIb beta3:Active p-Y419-SRC) - Integrin signaling:
ATP + Talin:RIAM complex:ECM ligands: 2X(Integrin alphaIIb beta3:SRC) ⟶ ADP + Talin:RIAM complex:ECM ligands:2X(Integrin alphaIIb beta3:Active p-Y419-SRC) - CDO in myogenesis:
ATP + p38 alpha/beta/gamma:ABL1:JLP:CDO complex ⟶ ADP + pp38 alpha/beta/gamma:ABL1:JLP:CDO complex - Integrin signaling:
ATP + Talin:RIAM complex:ECM ligands: 2X(Integrin alphaIIb beta3:SRC) ⟶ ADP + Talin:RIAM complex:ECM ligands:2X(Integrin alphaIIb beta3:Active p-Y419-SRC) - Integrin signaling:
ATP + Talin:RIAM complex:ECM ligands: 2X(Integrin alphaIIb beta3:SRC) ⟶ ADP + Talin:RIAM complex:ECM ligands:2X(Integrin alphaIIb beta3:Active p-Y419-SRC) - Translation:
48S complex + ATP ⟶ 48S complex + ADP + Pi - Eukaryotic Translation Initiation:
48S complex + ATP ⟶ 48S complex + ADP + Pi - Cap-dependent Translation Initiation:
48S complex + ATP ⟶ 48S complex + ADP + Pi - Integrin signaling:
ATP + Talin:RIAM complex:ECM ligands: 2X(Integrin alphaIIb beta3:SRC) ⟶ ADP + Talin:RIAM complex:ECM ligands:2X(Integrin alphaIIb beta3:Active p-Y419-SRC) - Signaling by Receptor Tyrosine Kinases:
H2O + cAMP ⟶ AMP - Signaling by VEGF:
ATP + H0Z2U9 ⟶ ADP + phospho-p-S,2T-MAPKAPK3 - VEGFA-VEGFR2 Pathway:
ATP + H0Z2U9 ⟶ ADP + phospho-p-S,2T-MAPKAPK3 - VEGFR2 mediated vascular permeability:
ATP + p-VAV family:PIP3:RAC1:GTP:PAK 1-3 ⟶ ADP + p-VAV family:PIP3:RAC1:GTP - VEGFR2 mediated cell proliferation:
ATP + VEGFA dimer:p-6Y-VEGFR2 dimer:PLCG1 ⟶ ADP + VEGFA dimer:p-6Y-VEGFR2 dimer:p-4Y-PLCG1 - Integrin signaling:
ATP + Talin:RIAM complex:ECM ligands: 2X(Integrin alphaIIb beta3:SRC) ⟶ ADP + Talin:RIAM complex:ECM ligands:2X(Integrin alphaIIb beta3:Active (p-Y419)-SRC) - Integrin alphaIIb beta3 signaling:
ATP + Talin:RIAM complex:ECM ligands: 2X(Integrin alphaIIb beta3:SRC) ⟶ ADP + Talin:RIAM complex:ECM ligands:2X(Integrin alphaIIb beta3:Active (p-Y419)-SRC) - MAPK family signaling cascades:
ATP + KSR1:MARK3 ⟶ ADP + p-S311,S406 KSR1:MARK3 - ERK1/ERK2 pathway:
ATP + KSR1:MARK3 ⟶ ADP + p-S311,S406 KSR1:MARK3 - RAF/MAP kinase cascade:
ATP + KSR1:MARK3 ⟶ ADP + p-S311,S406 KSR1:MARK3 - MAP2K and MAPK activation:
ATP + activated RAF:scaffold:MAP2K:MAPK complex ⟶ ADP + activated RAF:scaffold:p-2S MAP2K:MAPK complex - MAPK6/MAPK4 signaling:
ATP + CDC42:GTP,RAC1:GTP:PAK1,PAK2,PAK3 ⟶ ADP + Active RAC1/CDC42 - Signaling by Rho GTPases:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + Homologues of KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPase Effectors:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + Homologues of KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPases activate PAKs:
ATP + CDC42:GTP,RAC1:GTP:PAK1,PAK2,PAK3 ⟶ ADP + Active RAC1/CDC42 - RHO GTPases activate PKNs:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + Homologues of KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPases Activate WASPs and WAVEs:
ATP + CDC42:GTP:WASP/N-WASP:WIP:SH3 proteins ⟶ ADP + CDC42:GTP:p-Y-WASP/p-Y-WASL:WIP:SH3 proteins - RHO GTPases Activate Formins:
ATP + Kinetochore:CDC42:GTP:DIAPH2-2 ⟶ ADP + Kinetochore:CDC42:GTP:p-S196-DIAPH2-2 - Energy dependent regulation of mTOR by LKB1-AMPK:
AMP + p-AMPK heterotrimer ⟶ p-AMPK heterotrimer:AMP - Cellular responses to external stimuli:
HSP90:ATP:PTGES3:FKBP52:SHR:SH ⟶ ADP + H0ZSE5 + H0ZZA2 + HSP90-beta dimer + Pi + SHR:SH - Macroautophagy:
ULK1:ATG13:RB1CC1:ATG101 + p-AMPK heterotrimer:AMP ⟶ p-AMPK heterotrimer:AMP:ULK1:ATG13:RB1CC1:ATG101 - Fcgamma receptor (FCGR) dependent phagocytosis:
ATP + Mother filament:branching complex:daughter filament + Myosin-X dimer + PI(3,4)P2 ⟶ Actin filament bound Myosin-X + Pi - Regulation of actin dynamics for phagocytic cup formation:
ATP + Mother filament:branching complex:daughter filament + Myosin-X dimer + PI(3,4)P2 ⟶ Actin filament bound Myosin-X + Pi - Fc epsilon receptor (FCERI) signaling:
ATP + DAG:p-5Y-PKC-theta:CBM oligomer:TRAF6 oligomer + UBE2N:UBE2V1 ⟶ AMP + DAG:p-5Y-PKC-theta:CBM oligomer:oligo-K63-poly Ub-TRAF6 + PPi + UBE2N:UBE2V1 - FCERI mediated MAPK activation:
ATP ⟶ ADP - C-type lectin receptors (CLRs):
ATP + UBE2N:UBE2V1 + p-T231-CARD9:BCL10:MALT1:TRAF6 oligomers ⟶ AMP + PPi + UBE2N:UBE2V1 + p-T231-CARD9:BCL10:MALT1:K63polyUb-TRAF6 oligomers - CD209 (DC-SIGN) signaling:
ATP + p21 RAS:GTP:RAF1 ⟶ ADP + p21 RAS:GTP:p-S338-RAF1 - Cell Cycle:
ATP + p21,p27 ⟶ ADP + p-T-CDKN1A/B - Cell Cycle, Mitotic:
ATP + p21,p27 ⟶ ADP + p-T-CDKN1A/B - Mitotic G2-G2/M phases:
ATP + CCNA:p-T14-CDK1 ⟶ ADP + CCNA:p-T14,T161-CDK1 - G2/M Transition:
ATP + CCNA:p-T14-CDK1 ⟶ ADP + CCNA:p-T14,T161-CDK1 - Regulation of PLK1 Activity at G2/M Transition:
ATP + BORA ⟶ ADP + phospho-p-S252-BORA - M Phase:
ATP + p-T216,S274,S373-GORASP1:p-S37-GOLGA2:p-RAB1:GTP:p-T210-PLK1 ⟶ ADP + p-T216,S189,S274,S373-GORASP1:p-S37-GOLGA2:p-RAB1:GTP:p-T210-PLK1 - Mitotic Prophase:
ATP + p-T216,S274,S373-GORASP1:p-S37-GOLGA2:p-RAB1:GTP:p-T210-PLK1 ⟶ ADP + p-T216,S189,S274,S373-GORASP1:p-S37-GOLGA2:p-RAB1:GTP:p-T210-PLK1 - Golgi Cisternae Pericentriolar Stack Reorganization:
ATP + p-T216,S274,S373-GORASP1:p-S37-GOLGA2:p-RAB1:GTP:p-T210-PLK1 ⟶ ADP + p-T216,S189,S274,S373-GORASP1:p-S37-GOLGA2:p-RAB1:GTP:p-T210-PLK1 - ADP signalling through P2Y purinoceptor 1:
ADP:P2RY1:G-protein Gq (active) ⟶ ADP + G-protein alpha (q/11): GTP + G-protein beta-gamma complex + P2RY1 - Platelet Aggregation (Plug Formation):
ATP + Talin:RIAM complex:ECM ligands: 2X(Integrin alphaIIb beta3:SRC) ⟶ ADP + Talin:RIAM complex:ECM ligands:2X(Integrin alphaIIb beta3:Active (p-Y419)-SRC) - Intra-Golgi and retrograde Golgi-to-ER traffic:
ATP + RAB6:GTP:BICD dimer:COPI-independent retrograde cargo:Dynein:Dynactin:microtubules ⟶ ADP + BICD dimer + Dynein:Dynactin:microtubule + RAB6:GTP:COPI-independent retrograde Golgi-to-ER cargo - Retrograde transport at the Trans-Golgi-Network:
RAB9:GTP:PLIN3:p-RABEPK:late-endosome-to-TGN cargo:VAMP3 + RHOBTB3:ATP ⟶ RAB9:GTP:PLIN3:p-RABEPK:late-endosome-to-TGN cargo:VAMP3:RHOBTB3:ATP - Golgi-to-ER retrograde transport:
ATP + RAB6:GTP:BICD dimer:COPI-independent retrograde cargo:Dynein:Dynactin:microtubules ⟶ ADP + BICD dimer + Dynein:Dynactin:microtubule + RAB6:GTP:COPI-independent retrograde Golgi-to-ER cargo - COPI-independent Golgi-to-ER retrograde traffic:
ATP + RAB6:GTP:BICD dimer:COPI-independent retrograde cargo:Dynein:Dynactin:microtubules ⟶ ADP + BICD dimer + Dynein:Dynactin:microtubule + RAB6:GTP:COPI-independent retrograde Golgi-to-ER cargo - Developmental Biology:
ATP + H0YPU3 ⟶ NCAM-1:ATP - Axon guidance:
ATP + H0YPU3 ⟶ NCAM-1:ATP - Semaphorin interactions:
ATP + pLIMK dimer:HSP-90 ⟶ ADP + Active LIMK1 + Homologues of HSP90AB1 - Sema3A PAK dependent Axon repulsion:
ATP + pLIMK dimer:HSP-90 ⟶ ADP + Active LIMK1 + Homologues of HSP90AB1 - L1CAM interactions:
ATP + p-S,T-MAP2K2:MAPK1 ⟶ ADP + p-S,T-MAP2K2:p-T,Y-MAPK1 - Signal transduction by L1:
ATP + p-S,T-MAP2K2:MAPK1 ⟶ ADP + p-S,T-MAP2K2:p-T,Y-MAPK1 - EPH-Ephrin signaling:
ATP ⟶ ADP - EPHB-mediated forward signaling:
ATP + RAC1:GTP:PAK1 dimer:RAC1:GTP ⟶ ADP + RAC1-GTP:p-S144,T423-PAK1 - Ephrin signaling:
ATP + EPHBs:p-3Y-EFNBs:SRC,FYN:GRB4:p-GIT1:ARHGEF7:RAC1:GTP:PAK1,3 ⟶ ADP + EPHBs:p-3Y-EFNBs:SRC,FYN:GRB4:p-GIT1:ARHGEF7:RAC1:GTP:p-PAK1,3 - Integrin signaling:
ATP + Talin:RIAM complex:ECM ligands: 2X(Integrin alphaIIb beta3:SRC) ⟶ ADP + Talin:RIAM complex:ECM ligands:2X(Integrin alphaIIb beta3:Active p-Y419-SRC) - Phospholipid metabolism:
H2O + lysoPC ⟶ GPCho + LCFA(-) - PI Metabolism:
ATP + PI ⟶ ADP + PI4P - Synthesis of PIPs at the Golgi membrane:
ATP + PI ⟶ ADP + PI4P - RAC1 signalling:
ATP + HEP ⟶ ADP + Phospho HEP - Intracellular signaling by second messengers:
H2O + cAMP ⟶ AMP - PI3K/AKT Signaling:
ATP + PI(4,5)P2 ⟶ ADP + PI(3,4,5)P3 - mTORC1-mediated signalling:
ATP + H1A3C1 ⟶ ADP + phospho-p-S371,T389-RPS6KB1 - Death Receptor Signalling:
ATP + Homologues of MAPK8 ⟶ ADP + Homologues of p-T,Y-MAPK8 - p75 NTR receptor-mediated signalling:
ATP + Homologues of MAPK8 ⟶ ADP + Homologues of p-T,Y-MAPK8 - Cell death signalling via NRAGE, NRIF and NADE:
ATP + Homologues of MAPK8 ⟶ ADP + Homologues of p-T,Y-MAPK8 - NRAGE signals death through JNK:
ATP + Homologues of MAPK8 ⟶ ADP + Homologues of p-T,Y-MAPK8 - Platelet homeostasis:
H0ZG60 + LDL ⟶ LDL:LRP8 - Platelet sensitization by LDL:
H0ZG60 + LDL ⟶ LDL:LRP8 - Phospholipid metabolism:
H2O + PETA ⟶ CH3CHO + Pi + ammonia - PI Metabolism:
GroPIns + H2O ⟶ G3P + Ins - Synthesis of PIPs at the Golgi membrane:
ATP + PI ⟶ ADP + PI4P - Netrin-1 signaling:
ATP + NTN1:DCC oligomer:p-Y397-PTK2:MyrG-p-Y419-SRC,MyrG-p-Y420-FYN ⟶ ADP + NTN1:p-Y1420-DCC oligomer:p-Y397-PTK2:MyrG-p-Y419-SRC,MyrG-p-Y420-FYN - DSCAM interactions:
ATP + Homologues of MAPK8 ⟶ ADP + Homologues of p-T,Y-MAPK8 - Glycosaminoglycan metabolism:
H2O + linker chain(2) ⟶ D-xylose + Gal - Transport and synthesis of PAPS:
ATP + SO4(2-) ⟶ APS + PPi - Cytosolic sulfonation of small molecules:
3,5,3'-triiodothyronine + PAPS ⟶ 3,5,3'-triiodothyronine 4-sulfate + PAP - Glycosaminoglycan metabolism:
H2O + linker chain(2) ⟶ D-xylose + Gal - Transport and synthesis of PAPS:
ATP + SO4(2-) ⟶ APS + PPi - Cytosolic sulfonation of small molecules:
3,5,3'-triiodothyronine + PAPS ⟶ 3,5,3'-triiodothyronine 4-sulfate + PAP - Glycosaminoglycan metabolism:
H2O ⟶ CH3COO- - Transport and synthesis of PAPS:
APS + ATP ⟶ ADP + PAPS - Cytosolic sulfonation of small molecules:
H2O + PNPB ⟶ BUT + PNP - Triglyceride metabolism:
ATP + Glycerol ⟶ ADP + G3P - Triglyceride biosynthesis:
ATP + Glycerol ⟶ ADP + G3P - Triglyceride metabolism:
ATP + Glycerol ⟶ ADP + G3P - Triglyceride biosynthesis:
ATP + Glycerol ⟶ ADP + G3P - Triglyceride metabolism:
Oxygen + Tetrahydrobiopterin + alkylglycerol ⟶ Glycerol + H2O + dihydrobiopterin + fatty aldehyde - Triglyceride biosynthesis:
Oxygen + Tetrahydrobiopterin + alkylglycerol ⟶ Glycerol + H2O + dihydrobiopterin + fatty aldehyde - Synthesis of IPs in the nucleus:
ATP + I(1,4,5)P3 ⟶ ADP + I(1,3,4,5)P4 - Synthesis of IPs in the nucleus:
ATP + I(1,4,5)P3 ⟶ ADP + I(1,3,4,5)P4 - Synthesis of IP3 and IP4 in the cytosol:
ATP + I(1,4,5)P3 ⟶ ADP + I(1,3,4,5)P4 - Synthesis of IPs in the nucleus:
ATP + I(1,4,5)P3 ⟶ ADP + I(1,3,4,5)P4 - Cellular responses to stress:
HSP90:ATP:PTGES3:FKBP52:SHR:SH ⟶ ADP + H0ZSE5 + H0ZZA2 + HSP90-beta dimer + Pi + SHR:SH - HSP90 chaperone cycle for SHRs:
HSP90:ATP:PTGES3:FKBP52:SHR:SH ⟶ ADP + H0ZSE5 + H0ZZA2 + HSP90-beta dimer + Pi + SHR:SH - Metabolism of steroids:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN - Cholesterol biosynthesis:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN - Metabolism of steroids:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN - Cholesterol biosynthesis:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN - Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Cholesterol biosynthesis:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN - Mitochondrial ABC transporters:
ATP + H2O + heme ⟶ ADP + Pi + heme - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Synthesis of Dolichyl-phosphate:
ATP + MVA5PP ⟶ ADP + IPPP + Pi + carbon dioxide - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Synthesis of Dolichyl-phosphate:
ATP + MVA5PP ⟶ ADP + IPPP + Pi + carbon dioxide - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Synthesis of Dolichyl-phosphate:
ATP + MVA5PP ⟶ ADP + IPPP + Pi + carbon dioxide - GDP-fucose biosynthesis:
ATP + beta-Fuc ⟶ ADP + Fuc1P - GDP-fucose biosynthesis:
ATP + beta-Fuc ⟶ ADP + Fuc1P - GDP-fucose biosynthesis:
GDP-KDGal + H+ + TPNH ⟶ GDP-Fuc + TPN - Synthesis of IP3 and IP4 in the cytosol:
ATP + I(1,3,4)P3 ⟶ ADP + I(1,3,4,5)P4 - Synthesis of IP3 and IP4 in the cytosol:
ATP + I(1,3,4)P3 ⟶ ADP + I(1,3,4,5)P4 - Fructose metabolism:
ATP + GA ⟶ ADP + GA3P - Fructose catabolism:
ATP + GA ⟶ ADP + GA3P - Fructose metabolism:
ATP + GA ⟶ ADP + GA3P - Fructose catabolism:
ATP + GA ⟶ ADP + GA3P - Fructose metabolism:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN - Fructose catabolism:
ATP + GA ⟶ ADP + GA3P - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
ATP + L-His + b-Ala ⟶ ADP + CARN + Pi - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Pentose phosphate pathway:
ATP + R5P ⟶ AMP + PRPP - ABC transporters in lipid homeostasis:
ATP + CHOL + H2O ⟶ ADP + CHOL + Pi - Lipoprotein metabolism:
ATP + CHOL + H2O ⟶ ADP + CHOL + Pi - Plasma lipoprotein remodeling:
ATP + CHOL + H2O ⟶ ADP + CHOL + Pi - HDL remodeling:
ATP + CHOL + H2O ⟶ ADP + CHOL + Pi - ABC transporters in lipid homeostasis:
ATP + CHOL + H2O ⟶ ADP + CHOL + Pi - Lipoprotein metabolism:
ATP + CHOL + H2O ⟶ ADP + CHOL + Pi - Plasma lipoprotein remodeling:
ATP + CHOL + H2O ⟶ ADP + CHOL + Pi - HDL remodeling:
ATP + CHOL + H2O ⟶ ADP + CHOL + Pi - ABC transporters in lipid homeostasis:
ATP + CHOL + H2O ⟶ ADP + CHOL + Pi - Lipoprotein metabolism:
ATP + CHOL + H2O ⟶ ADP + CHOL + Pi - Plasma lipoprotein remodeling:
ATP + CHOL + H2O ⟶ ADP + CHOL + Pi - HDL remodeling:
ATP + CHOL + H2O ⟶ ADP + CHOL + Pi - Ion channel transport:
ATP + Cu2+ + H2O ⟶ ADP + Cu2+ + Pi - Ion transport by P-type ATPases:
ATP + Cu2+ + H2O ⟶ ADP + Cu2+ + Pi - Ion channel transport:
ATP + Cu2+ + H2O ⟶ ADP + Cu2+ + Pi - Ion transport by P-type ATPases:
ATP + Cu2+ + H2O ⟶ ADP + Cu2+ + Pi - Synthesis of PIPs at the early endosome membrane:
ATP + PI ⟶ ADP + PI3P - Synthesis of PIPs at the late endosome membrane:
ATP + PI ⟶ ADP + PI3P - Pentose phosphate pathway:
ATP + R5P ⟶ AMP + PRPP - Pentose phosphate pathway:
ATP + R5P ⟶ AMP + PRPP - Interconversion of nucleotide di- and triphosphates:
AMP + ATP ⟶ ADP - Interconversion of nucleotide di- and triphosphates:
AMP + ATP ⟶ ADP - Interconversion of nucleotide di- and triphosphates:
AMP + ATP ⟶ ADP - Nucleotide salvage:
Ade + PRPP ⟶ AMP + PPi - Pyrimidine salvage:
ATP + Thy-dRib ⟶ ADP + TMP - Nucleotide salvage:
Ade + PRPP ⟶ AMP + PPi - Pyrimidine salvage:
ATP + Thy-dRib ⟶ ADP + TMP - Nucleotide salvage:
Ade + PRPP ⟶ AMP + PPi - Pyrimidine salvage:
ATP + dC, Thy-dRib, dU ⟶ ADP + dCMP, TMP, dUMP - ESR-mediated signaling:
ESR1:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + H0ZSE5 + H0ZZA2 + HSP90-beta dimer + Pi - Estrogen-dependent gene expression:
ESR1:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + H0ZSE5 + H0ZZA2 + HSP90-beta dimer + Pi - Neuronal System:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Transmission across Chemical Synapses:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Neuronal System:
HCN channels + cAMP ⟶ HCN channel bound to cAMP - Transmission across Chemical Synapses:
ATP ⟶ ADP - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Ribosomal scanning and start codon recognition:
48S complex + ATP ⟶ 48S complex + ADP + Pi - Protein folding:
ATP + Unfolded G-protein beta subunit:CCT/TRiC:ADP ⟶ ADP + Unfolded G-protein beta subunit:CCT/TRiC:ATP - Chaperonin-mediated protein folding:
ATP + Unfolded G-protein beta subunit:CCT/TRiC:ADP ⟶ ADP + Unfolded G-protein beta subunit:CCT/TRiC:ATP - Cooperation of PDCL (PhLP1) and TRiC/CCT in G-protein beta folding:
ATP + Unfolded G-protein beta subunit:CCT/TRiC:ADP ⟶ ADP + Unfolded G-protein beta subunit:CCT/TRiC:ATP - DNA Repair:
MUTYH:(OGUA:Ade)-dsDNA ⟶ Ade + MUTYH:AP-dsDNA - MMR:
ATP ⟶ AMP + PPi - Mismatch repair (MMR) directed by MSH2:MSH6 (MutSalpha):
ATP ⟶ AMP + PPi - Cellular responses to external stimuli:
GSSG + H+ + TPNH ⟶ GSH + TPN - Cellular responses to stress:
GSSG + H+ + TPNH ⟶ GSH + TPN - Cellular response to heat stress:
ATP + HSP70s:ADP ⟶ ADP + HSP70s:ATP - Regulation of HSF1-mediated heat shock response:
ATP + HSP70s:ADP ⟶ ADP + HSP70s:ATP - HSP90 chaperone cycle for SHRs:
ATP + HSP90:STIP1:HSP70:nascent protein ⟶ HSP90:ATP:STIP1:HSP70:nascent protein - DNA Repair:
MUTYH:(OGUA:Ade)-dsDNA ⟶ Ade + MUTYH:AP-dsDNA - MMR:
ATP ⟶ AMP + PPi - Mismatch repair (MMR) directed by MSH2:MSH6 (MutSalpha):
ATP ⟶ AMP + PPi - Cellular responses to external stimuli:
GSSG + H+ + TPNH ⟶ GSH + TPN - Cellular responses to stress:
GSSG + H+ + TPNH ⟶ GSH + TPN - Cellular response to heat stress:
ATP + HSP70s:ADP ⟶ ADP + HSP70s:ATP - Regulation of HSF1-mediated heat shock response:
ATP + HSP70s:ADP ⟶ ADP + HSP70s:ATP - HSP90 chaperone cycle for SHRs:
ATP + HSP90:STIP1:HSP70:nascent protein ⟶ HSP90:ATP:STIP1:HSP70:nascent protein - Ribosomal scanning and start codon recognition:
48S complex + ATP ⟶ 48S complex + ADP + Pi - Protein folding:
ATP + Unfolded G-protein beta subunit:CCT/TRiC:ADP ⟶ ADP + Unfolded G-protein beta subunit:CCT/TRiC:ATP - Chaperonin-mediated protein folding:
ATP + Unfolded G-protein beta subunit:CCT/TRiC:ADP ⟶ ADP + Unfolded G-protein beta subunit:CCT/TRiC:ATP - Cooperation of PDCL (PhLP1) and TRiC/CCT in G-protein beta folding:
ATP + Unfolded G-protein beta subunit:CCT/TRiC:ADP ⟶ ADP + Unfolded G-protein beta subunit:CCT/TRiC:ATP - Protein folding:
ATP + Unfolded G-protein beta subunit:CCT/TRiC:ADP ⟶ ADP + Unfolded G-protein beta subunit:CCT/TRiC:ATP - Chaperonin-mediated protein folding:
ATP + Unfolded G-protein beta subunit:CCT/TRiC:ADP ⟶ ADP + Unfolded G-protein beta subunit:CCT/TRiC:ATP - Cooperation of PDCL (PhLP1) and TRiC/CCT in G-protein beta folding:
ATP + Unfolded G-protein beta subunit:CCT/TRiC:ADP ⟶ ADP + Unfolded G-protein beta subunit:CCT/TRiC:ATP - MMR:
ATP + MSH2:MSH6:ADP:DNA containing 1-2 base mismatch ⟶ ADP + MSH2:MSH6:ATP:DNA containing 1-2 base mismatch - Mismatch repair (MMR) directed by MSH2:MSH6 (MutSalpha):
ATP + MSH2:MSH6:ADP:DNA containing 1-2 base mismatch ⟶ ADP + MSH2:MSH6:ATP:DNA containing 1-2 base mismatch - Formation of xylulose-5-phosphate:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Linoleic acid (LA) metabolism:
ATP + CoA-SH + LA ⟶ AMP + LA-CoA + PPi - Glycerophospholipid biosynthesis:
H2O + lysoPC ⟶ GPCho + LCFA(-) - Synthesis of PE:
ATP + ETA ⟶ ADP + PETA - Synthesis of PC:
ATP + Cho ⟶ ADP + PCho - Synthesis of PIPs at the ER membrane:
ATP + PI ⟶ ADP + PI4P - Synthesis of PIPs at the plasma membrane:
ATP + PI4P ⟶ ADP + PI(4,5)P2 - Sphingolipid metabolism:
3-ketosphinganine + H+ + TPNH ⟶ SPA + TPN - Glycosphingolipid metabolism:
GM1 ganglioside + H2O ⟶ GM2 ganglioside + Gal - Bile acid and bile salt metabolism:
CHOL + H+ + Oxygen + TPNH ⟶ 24OH-CHOL + H2O + TPN - Synthesis of bile acids and bile salts:
CHOL + H+ + Oxygen + TPNH ⟶ 24OH-CHOL + H2O + TPN - Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
25(S) THCA-CoA + Oxygen ⟶ H2O2 + THCA-CoA - Recycling of bile acids and salts:
ATP + H2O + bile salts ⟶ ADP + Pi + bile salts - Purine ribonucleoside monophosphate biosynthesis:
ATP + H2O + L-Gln + XMP ⟶ AMP + GMP + L-Glu + PPi - Purine salvage:
Ade + PRPP ⟶ AMP + PPi - Immune System:
ATP + Mg2+ ⟶ AMP + E1 bound ubiquitin + Mg2+ + PPi - Adaptive Immune System:
ATP + Mg2+ ⟶ AMP + E1 bound ubiquitin + Mg2+ + PPi - Class I MHC mediated antigen processing & presentation:
ATP + Mg2+ ⟶ AMP + E1 bound ubiquitin + Mg2+ + PPi - Antigen Presentation: Folding, assembly and peptide loading of class I MHC:
ATP + H2O + oligopeptide ⟶ ADP + Pi + oligopeptide - Innate Immune System:
H2O + PC ⟶ Cho + PA - Toll-like Receptor Cascades:
ATP ⟶ ADP - Toll Like Receptor 10 (TLR10) Cascade:
ATP ⟶ ADP - MyD88 cascade initiated on plasma membrane:
ATP ⟶ ADP - MAP kinase activation:
ATP ⟶ ADP - JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1:
ATP ⟶ ADP - activated TAK1 mediates p38 MAPK activation:
ATP ⟶ ADP - MAPK targets/ Nuclear events mediated by MAP kinases:
ATP ⟶ ADP - ERK/MAPK targets:
ATP ⟶ ADP - Toll Like Receptor 3 (TLR3) Cascade:
ATP ⟶ ADP - Toll Like Receptor 5 (TLR5) Cascade:
ATP ⟶ ADP - Toll Like Receptor 7/8 (TLR7/8) Cascade:
ATP ⟶ ADP - MyD88 dependent cascade initiated on endosome:
ATP ⟶ ADP - TRAF6 mediated induction of NFkB and MAP kinases upon TLR7/8 or 9 activation:
ATP ⟶ ADP - Toll Like Receptor 9 (TLR9) Cascade:
ATP ⟶ ADP - Toll Like Receptor 4 (TLR4) Cascade:
ATP ⟶ ADP - MyD88:MAL(TIRAP) cascade initiated on plasma membrane:
ATP ⟶ ADP - MyD88-independent TLR4 cascade:
ATP ⟶ ADP - TRIF(TICAM1)-mediated TLR4 signaling:
ATP ⟶ ADP - Toll Like Receptor 2 (TLR2) Cascade:
ATP ⟶ ADP - Toll Like Receptor TLR1:TLR2 Cascade:
ATP ⟶ ADP - Toll Like Receptor TLR6:TLR2 Cascade:
ATP ⟶ ADP - Fcgamma receptor (FCGR) dependent phagocytosis:
H2O + PC ⟶ Cho + PA - Regulation of actin dynamics for phagocytic cup formation:
G-actin + Mother filament:ARP2/3:actin:ADP ⟶ Mother filament:branching complex:daughter filament - Fc epsilon receptor (FCERI) signaling:
ATP + Homologues of MAP2K4 ⟶ ADP + Homologues of p-S257,T261-MAP2K4 - FCERI mediated MAPK activation:
ATP + Homologues of MAP2K4 ⟶ ADP + Homologues of p-S257,T261-MAP2K4 - Cytokine Signaling in Immune system:
H2O ⟶ AMP + ATP + H+ - Signaling by Interleukins:
ATP ⟶ ADP - Interleukin-17 signaling:
ATP ⟶ ADP - Nonsense Mediated Decay (NMD) enhanced by the Exon Junction Complex (EJC):
ATP + SMG1:UPF1:EJC:Translated mRNP ⟶ ADP + SMG1:Phosphorylated UPF1:EJC:Translated mRNP - Neurotransmitter receptors and postsynaptic signal transmission:
ATP ⟶ ADP - Activation of NMDA receptors and postsynaptic events:
ATP ⟶ ADP - Post NMDA receptor activation events:
ATP ⟶ ADP - CREB phosphorylation through the activation of Ras:
ATP ⟶ ADP - RSK activation:
ATP ⟶ ADP - CREB phosphorylation through the activation of CaMKK:
ATP + Homologues of CAMKK1 ⟶ ADP + Homologues of p-CAMKK1 - Activation of CaMK IV:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - Clathrin-mediated endocytosis:
ATP + PI4P ⟶ ADP + PI(4,5)P2 - Gamma carboxylation, hypusine formation and arylsulfatase activation:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Unfolded Protein Response (UPR):
ATP + IRE1 dimer ⟶ ADP + p-S724-IRE1 dimer - IRE1alpha activates chaperones:
ATP + IRE1 dimer ⟶ ADP + p-S724-IRE1 dimer - XBP1(S) activates chaperone genes:
ATP + H2O + SEC translocon ⟶ ADP + PPi + SEC translocon - Surfactant metabolism:
ATP + H2O + PC, PG ⟶ ADP + PC, PG + Pi - Signaling by Receptor Tyrosine Kinases:
ATP ⟶ ADP - Signaling by NTRKs:
ATP ⟶ ADP - Signaling by NTRK1 (TRKA):
ATP ⟶ ADP - Nuclear Events (kinase and transcription factor activation):
ATP ⟶ ADP - Opioid Signalling:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - G-protein mediated events:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - PLC beta mediated events:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - Ca-dependent events:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - CaM pathway:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - Calmodulin induced events:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - CaMK IV-mediated phosphorylation of CREB:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - G alpha (q) signalling events:
2AG + H2O ⟶ AA + Glycerol + H+ - Effects of PIP2 hydrolysis:
2AG + H2O ⟶ AA + Glycerol + H+ - Gastrin-CREB signalling pathway via PKC and MAPK:
ATP ⟶ ADP - Signaling by WNT:
ATP + Homologues of NLK ⟶ ADP + pT298-NLK dimer - Beta-catenin independent WNT signaling:
ATP + Homologues of NLK ⟶ ADP + pT298-NLK dimer - Ca2+ pathway:
ATP + Homologues of NLK ⟶ ADP + pT298-NLK dimer - ESR-mediated signaling:
ATP + MYB gene:hypophosphorylated RNA polymerase II:TFIIF:ESR1:ESTG:P-TEFb ⟶ ADP + MYB gene:hyperphosphorylated RNA polymerase II:TFIIF:ESR1:ESTG:P-TEFb - Estrogen-dependent gene expression:
ATP + MYB gene:hypophosphorylated RNA polymerase II:TFIIF:ESR1:ESTG:P-TEFb ⟶ ADP + MYB gene:hyperphosphorylated RNA polymerase II:TFIIF:ESR1:ESTG:P-TEFb - MAPK family signaling cascades:
ATP ⟶ ADP - ERK1/ERK2 pathway:
ATP ⟶ ADP - RAF-independent MAPK1/3 activation:
ATP ⟶ ADP - MAPK3 (ERK1) activation:
ATP ⟶ ADP - MAPK6/MAPK4 signaling:
ATP + Homologues of MAPK6 ⟶ ADP + Homologues of p-3S,T MAPK6 - Intracellular signaling by second messengers:
ATP + PI4P ⟶ ADP + PI(4,5)P2 - PI3K/AKT Signaling:
ATP + PI4P ⟶ ADP + PI(4,5)P2 - Negative regulation of the PI3K/AKT network:
ATP + PI4P ⟶ ADP + PI(4,5)P2 - PI5P, PP2A and IER3 Regulate PI3K/AKT Signaling:
ATP + PI4P ⟶ ADP + PI(4,5)P2 - DAG and IP3 signaling:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - Signaling by Rho GTPases:
ATP + PI ⟶ ADP + PI3P - RHO GTPase Effectors:
ATP + PI ⟶ ADP + PI3P - RHO GTPases Activate WASPs and WAVEs:
G-actin + Mother filament:ARP2/3:actin:ADP ⟶ Mother filament:branching complex:daughter filament - RHO GTPases Activate NADPH Oxidases:
ATP + PI ⟶ ADP + PI3P - mTOR signalling:
AMP + p-AMPK heterotrimer ⟶ p-AMPK heterotrimer:AMP - mTORC1-mediated signalling:
ATP + Homologues of RPS6 ⟶ ADP + Homologues of p-5S-RPS6 - Gene expression (Transcription):
ATP + pol II transcription complex containing 3 Nucleotide long transcript ⟶ AMP + PPi + pol II transcription complex containing 3 Nucleotide long transcript - RNA Polymerase II Transcription:
ATP + pol II transcription complex containing 3 Nucleotide long transcript ⟶ AMP + PPi + pol II transcription complex containing 3 Nucleotide long transcript - Generic Transcription Pathway:
GSSG + H+ + TPNH ⟶ GSH + TPN - Transcriptional Regulation by TP53:
GSSG + H+ + TPNH ⟶ GSH + TPN - TP53 Regulates Transcription of Cell Death Genes:
ATP + Homologues of PIDD1 ⟶ ADP + Homologues of p-T788-PIDD1 - TP53 Regulates Transcription of Caspase Activators and Caspases:
ATP + Homologues of PIDD1 ⟶ ADP + Homologues of p-T788-PIDD1 - TP53 Regulates Transcription of DNA Repair Genes:
ATP + CCNK:CDK12:Elongation Complex at DNA Repair Genes ⟶ ADP + CCNK:CDK12:CDK12-Phosphorylated Elongation Complex at DNA repair genes - Regulation of TP53 Activity:
ATP + Homologues of DYRK2 ⟶ ADP + Homologues of p-T106,S442-DYRK2 - Regulation of TP53 Activity through Phosphorylation:
ATP + Homologues of DYRK2 ⟶ ADP + Homologues of p-T106,S442-DYRK2 - Transcriptional Regulation by E2F6:
ATP + Homologues of E2F6 ⟶ ADP + Homologues of p-S12-E2F6 - RNA Polymerase II Transcription Initiation And Promoter Clearance:
ATP + pol II transcription complex containing 3 Nucleotide long transcript ⟶ AMP + PPi + pol II transcription complex containing 3 Nucleotide long transcript - RNA Pol II CTD phosphorylation and interaction with CE:
ATP + Pol II transcription complex containing extruded transcript to +30 ⟶ ADP + Pol II transcription complex with (ser5) phosphorylated CTD containing extruded transcript to +30 - DNA Replication:
ATP + pre-replicative complex ⟶ ADP + Homologues of p-S,T-ORC1 + pre-replicative complex (Orc1-minus) - Synthesis of DNA:
ATP + pre-replicative complex ⟶ ADP + Homologues of p-S,T-ORC1 + pre-replicative complex (Orc1-minus) - Switching of origins to a post-replicative state:
ATP + pre-replicative complex ⟶ ADP + Homologues of p-S,T-ORC1 + pre-replicative complex (Orc1-minus) - Orc1 removal from chromatin:
ATP + pre-replicative complex ⟶ ADP + Homologues of p-S,T-ORC1 + pre-replicative complex (Orc1-minus) - CDK-mediated phosphorylation and removal of Cdc6:
ATP + Homologues of CDC6 ⟶ ADP + Homologues of p-CDC6 - DNA strand elongation:
ATP + PCNA homotrimer + RFC Heteropentamer:RNA primer-DNA primer:origin duplex ⟶ ADP + RFC Heteropentamer:RNA primer-DNA primer:origin duplex:PCNA homotrimer - Leading Strand Synthesis:
ATP + PCNA homotrimer + RFC Heteropentamer:RNA primer-DNA primer:origin duplex ⟶ ADP + RFC Heteropentamer:RNA primer-DNA primer:origin duplex:PCNA homotrimer - Polymerase switching:
ATP + PCNA homotrimer + RFC Heteropentamer:RNA primer-DNA primer:origin duplex ⟶ ADP + RFC Heteropentamer:RNA primer-DNA primer:origin duplex:PCNA homotrimer - Lagging Strand Synthesis:
ATP + PCNA homotrimer + RFC Heteropentamer:RNA primer-DNA primer:origin duplex ⟶ ADP + RFC Heteropentamer:RNA primer-DNA primer:origin duplex:PCNA homotrimer - Mitochondrial ABC transporters:
ATP + H2O + heme ⟶ ADP + Pi + heme - Iron uptake and transport:
CIT ⟶ ISCIT - Transferrin endocytosis and recycling:
ATP + H+ + H2O ⟶ ADP + H+ + Pi - DNA Damage Bypass:
ATP + NPLOC4:UFD1L:VCP:SPRTN:POLH:MonoUb:K164-PCNA:RPA:RFC:(TT-CPD:AA-polydNMP)-DNA Template ⟶ ADP + NPLOC4:UFD1L:VPC:SPRTN:MonoUb:K164-PCNA:RPA:RFC:(TT-CPD:AA-polydNMP)-Template DNA + POLH - Translesion synthesis by Y family DNA polymerases bypasses lesions on DNA template:
ATP + NPLOC4:UFD1L:VCP:SPRTN:POLH:MonoUb:K164-PCNA:RPA:RFC:(TT-CPD:AA-polydNMP)-DNA Template ⟶ ADP + NPLOC4:UFD1L:VPC:SPRTN:MonoUb:K164-PCNA:RPA:RFC:(TT-CPD:AA-polydNMP)-Template DNA + POLH - Translesion Synthesis by POLH:
ATP + NPLOC4:UFD1L:VCP:SPRTN:POLH:MonoUb:K164-PCNA:RPA:RFC:(TT-CPD:AA-polydNMP)-DNA Template ⟶ ADP + NPLOC4:UFD1L:VPC:SPRTN:MonoUb:K164-PCNA:RPA:RFC:(TT-CPD:AA-polydNMP)-Template DNA + POLH - DNA Double-Strand Break Repair:
ATP + DNA DSBs:MRN:Ac-K3016-ATM dimer:KAT5 ⟶ ADP + DNA DSBs:MRN:p-S1981,Ac-K3016-ATM:KAT5 + Homologues of p-S1981,Ac-K3016-ATM - DNA Double Strand Break Response:
ATP + DNA DSBs:MRN:Ac-K3016-ATM dimer:KAT5 ⟶ ADP + DNA DSBs:MRN:p-S1981,Ac-K3016-ATM:KAT5 + Homologues of p-S1981,Ac-K3016-ATM - Sensing of DNA Double Strand Breaks:
ATP + DNA DSBs:MRN:Ac-K3016-ATM dimer:KAT5 ⟶ ADP + DNA DSBs:MRN:p-S1981,Ac-K3016-ATM:KAT5 + Homologues of p-S1981,Ac-K3016-ATM - Recruitment and ATM-mediated phosphorylation of repair and signaling proteins at DNA double strand breaks:
ATP + DNA DSBs:MRN:p-S1981,Ac-K3016-ATM:KAT5 ⟶ ADP + DNA DSB:p-MRN:p-S1981,Ac-K3016-ATM:KAT5 - Homology Directed Repair:
ATP + DNA DSBs:p-MRN:p-S1981,Ac-K3016-ATM:KAT5:CCNA:p-T160-CDK2:RBBP8 ⟶ ADP + CCNA:p-T160-CDK2 + DNA DSBs:p-MRN:p-S327,T847-RBBP8:p-S1981,Ac-K3016-ATM:KAT5 - HDR through Homologous Recombination (HRR) or Single Strand Annealing (SSA):
ATP + DNA DSBs:p-MRN:p-S1981,Ac-K3016-ATM:KAT5:CCNA:p-T160-CDK2:RBBP8 ⟶ ADP + CCNA:p-T160-CDK2 + DNA DSBs:p-MRN:p-S327,T847-RBBP8:p-S1981,Ac-K3016-ATM:KAT5 - Processing of DNA double-strand break ends:
ATP + DNA DSBs:p-MRN:p-S1981,Ac-K3016-ATM:KAT5:CCNA:p-T160-CDK2:RBBP8 ⟶ ADP + CCNA:p-T160-CDK2 + DNA DSBs:p-MRN:p-S327,T847-RBBP8:p-S1981,Ac-K3016-ATM:KAT5 - HDR through Homologous Recombination (HRR):
ATP + RAD51 ⟶ ADP + phospho-p-T309-RAD51 - Homologous DNA Pairing and Strand Exchange:
ATP + RAD51 ⟶ ADP + phospho-p-T309-RAD51 - Presynaptic phase of homologous DNA pairing and strand exchange:
ATP + RAD51 ⟶ ADP + phospho-p-T309-RAD51 - Nonhomologous End-Joining (NHEJ):
ATP + p-T2609,S2612,T2638,T2647-PRKDC:XRCC5:XRCC6:p-S645-DCLRE1C:DNA DSB ends ⟶ ADP + p-T2609,S2612,T2638,T2647-PRKDC:XRCC5:XRCC6:p-S516,S645-DCLRE1C:DNA DSB ends - Nucleotide Excision Repair:
ATP + Ub:XPC:RAD23:CETN2:Distorted dsDNA:PAR-UV-DDB:TFIIH Core:XPA:PAR-PARP1,PAR-PARP2:CHD1L ⟶ ADP + Pi + Ub:XPC:RAD23:CETN2:Open bubble-dsDNA:PAR-UV-DDB:TFIIH Core:XPA:PAR-PARP1,PAR-PARP2:CHD1L - Global Genome Nucleotide Excision Repair (GG-NER):
ATP + Ub:XPC:RAD23:CETN2:Distorted dsDNA:PAR-UV-DDB:TFIIH Core:XPA:PAR-PARP1,PAR-PARP2:CHD1L ⟶ ADP + Pi + Ub:XPC:RAD23:CETN2:Open bubble-dsDNA:PAR-UV-DDB:TFIIH Core:XPA:PAR-PARP1,PAR-PARP2:CHD1L - Formation of Incision Complex in GG-NER:
ATP + Ub:XPC:RAD23:CETN2:Distorted dsDNA:PAR-UV-DDB:TFIIH Core:XPA:PAR-PARP1,PAR-PARP2:CHD1L ⟶ ADP + Pi + Ub:XPC:RAD23:CETN2:Open bubble-dsDNA:PAR-UV-DDB:TFIIH Core:XPA:PAR-PARP1,PAR-PARP2:CHD1L - Transcription-Coupled Nucleotide Excision Repair (TC-NER):
ATP + TC-NER pre-incision complex ⟶ ADP + Pi + TC-NER pre-incision complex:Open bubble damaged DNA template:trimmed nascent mRNA - Dual incision in TC-NER:
ATP + TC-NER pre-incision complex ⟶ ADP + Pi + TC-NER pre-incision complex:Open bubble damaged DNA template:trimmed nascent mRNA - Cell Cycle:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Cell Cycle Checkpoints:
ATP + p-T68-CHEK2 dimer ⟶ ADP + Homologues of p-S,3T-CHEK2 - G1/S DNA Damage Checkpoints:
ATP + Homologues of RFWD2 ⟶ ADP + Homologues of p-S387-RFWD2 - p53-Dependent G1/S DNA damage checkpoint:
ATP + Homologues of RFWD2 ⟶ ADP + Homologues of p-S387-RFWD2 - p53-Dependent G1 DNA Damage Response:
ATP + Homologues of RFWD2 ⟶ ADP + Homologues of p-S387-RFWD2 - Stabilization of p53:
ATP + Homologues of RFWD2 ⟶ ADP + Homologues of p-S387-RFWD2 - Autodegradation of the E3 ubiquitin ligase COP1:
ATP + Homologues of RFWD2 ⟶ ADP + Homologues of p-S387-RFWD2 - G2/M Checkpoints:
ATP + p-T68-CHEK2 dimer ⟶ ADP + Homologues of p-S,3T-CHEK2 - G2/M DNA damage checkpoint:
ATP + p-T68-CHEK2 dimer ⟶ ADP + Homologues of p-S,3T-CHEK2 - Cell Cycle, Mitotic:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Mitotic G1-G1/S phases:
ATP + CCNE:CDK2 ⟶ ADP + Cyclin E:p-CDK2 - G1/S Transition:
ATP + CCNE:CDK2 ⟶ ADP + Cyclin E:p-CDK2 - Cyclin E associated events during G1/S transition:
ATP + CCNE:CDK2 ⟶ ADP + Cyclin E:p-CDK2 - Phosphorylation of proteins involved in G1/S transition by active Cyclin E:Cdk2 complexes:
ATP + Cyclin E:p-T160-CDK2:RB1 ⟶ ADP + Cyclin E:p-T160-CDK2:p-RB1 - S Phase:
ATP + pre-replicative complex ⟶ ADP + Homologues of p-S,T-ORC1 + pre-replicative complex (Orc1-minus) - Cyclin A:Cdk2-associated events at S phase entry:
ATP + CCNA:CDK2 ⟶ ADP + CCNA:p-Y15-CDK2 - Mitotic G2-G2/M phases:
ATP + CCNA:p-T160-CDK2:E2F1/E2F3 ⟶ ADP + CCNA:p-T160-CDK2:p-E2F1/p-E2F3 - G2 Phase:
ATP + CCNA:p-T160-CDK2:E2F1/E2F3 ⟶ ADP + CCNA:p-T160-CDK2:p-E2F1/p-E2F3 - G2/M Transition:
ATP + CCNA:p-T14-CDK1 ⟶ ADP + CCNA:p-T14,T161-CDK1 - Cyclin A/B1/B2 associated events during G2/M transition:
ATP + CCNA:p-T14-CDK1 ⟶ ADP + CCNA:p-T14,T161-CDK1 - M Phase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Mitotic Prophase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Condensation of Prophase Chromosomes:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Mitotic Prometaphase:
ATP + Condensin I ⟶ ADP + CK2 Phosphorylated Condensin I - Condensation of Prometaphase Chromosomes:
ATP + Condensin I ⟶ ADP + CK2 Phosphorylated Condensin I - Chromosome Maintenance:
ATP + PCNA homotrimer + RFC Heteropentamer:RNA primer-DNA primer:G-strand extended telomere end ⟶ ADP + RFC Heteropentamer:RNA primer-DNA primer:G-strand extended telomere end duplex:PCNA homotrimer - Telomere Maintenance:
ATP + PCNA homotrimer + RFC Heteropentamer:RNA primer-DNA primer:G-strand extended telomere end ⟶ ADP + RFC Heteropentamer:RNA primer-DNA primer:G-strand extended telomere end duplex:PCNA homotrimer - Extension of Telomeres:
ATP + PCNA homotrimer + RFC Heteropentamer:RNA primer-DNA primer:G-strand extended telomere end ⟶ ADP + RFC Heteropentamer:RNA primer-DNA primer:G-strand extended telomere end duplex:PCNA homotrimer - Telomere C-strand (Lagging Strand) Synthesis:
ATP + PCNA homotrimer + RFC Heteropentamer:RNA primer-DNA primer:G-strand extended telomere end ⟶ ADP + RFC Heteropentamer:RNA primer-DNA primer:G-strand extended telomere end duplex:PCNA homotrimer - Polymerase switching on the C-strand of the telomere:
ATP + PCNA homotrimer + RFC Heteropentamer:RNA primer-DNA primer:G-strand extended telomere end ⟶ ADP + RFC Heteropentamer:RNA primer-DNA primer:G-strand extended telomere end duplex:PCNA homotrimer - Macroautophagy:
ATP + PI ⟶ ADP + PI3P - HSF1-dependent transactivation:
ATP + HSF1 trimer ⟶ ADP + p-S326-HSF1 trimer - Cellular Senescence:
ATP + DNA DSBs:MRN:Ac-K3016-ATM dimer:KAT5 ⟶ ADP + DNA DSBs:MRN:p-S1981,Ac-K3016-ATM:KAT5 + Homologues of p-S1981,Ac-K3016-ATM - Oxidative Stress Induced Senescence:
ATP ⟶ ADP - DNA Damage/Telomere Stress Induced Senescence:
ATP + DNA DSBs:MRN:Ac-K3016-ATM dimer:KAT5 ⟶ ADP + DNA DSBs:MRN:p-S1981,Ac-K3016-ATM:KAT5 + Homologues of p-S1981,Ac-K3016-ATM - Senescence-Associated Secretory Phenotype (SASP):
ATP ⟶ ADP - Platelet activation, signaling and aggregation:
2AG + H2O ⟶ AA + Glycerol + H+ - Kinesins:
ATP + Kinesins:microtubule ⟶ ADP + Kinesins:microtubule - XBP1(S) activates chaperone genes:
ATP + H2O ⟶ ADP + PPi - Clearance of Nuclear Envelope Membranes from Chromatin:
ATP + EMD/TMPO/LEMD3/LEMD2:Lamin filaments:BANF1:Chromatin ⟶ ADP + EMD/TMPO/LEMD3/LEMD2:Lamin filaments + p-T2,T3,S4-BANF1 - ROBO receptors bind AKAP5:
ATP + ROBO3.1:AKAP5:p-T497,T638,S657-PRKCA ⟶ ADP + p-S1330-ROBO3.1:AKAP5:p-T497,T638,S657-PRKCA - CDO in myogenesis:
ATP + MEF2 proteins + phospho-p38 alpha/beta/gamma MAPK ⟶ ADP + phospho p38:phospho MEF2 - Resolution of D-loop Structures through Synthesis-Dependent Strand Annealing (SDSA):
ATP + Extended D-Loop:p-MRN:p-S1981,Ac-K3016-ATM:KAT5:EXO1,DNA2:BLM,WRN:p-S990,Ac-K1249-BRIP1:p-BRCA1-C complex:PALB2:p-T3387-BRCA2:p-T309-RAD51:RAD51AP1:CX3 complex + H2O ⟶ ADP + BCDX2 complex + CX3 complex + E1BL90 + E1BMS5 + EXO1,DNA2:BLM,WRN + Homologues of p-S990,Ac-K1249-BRIP1 + Pi + Q0VCU5 + p-5S-BRCA1:p-2T-BARD1 + p-MRN + p-S327,T847,T859-RBBP8 homotetramer + p-T3387-BRCA2:p-T309-RAD51 complex + phospho-p-S1981,Ac-K3016-ATM - Clathrin derived vesicle budding:
ATP + Cargo:AP-1:Beta-arrestin:Clathrin Triskelion:Vamp Complex + HSC70:Auxillin Complex ⟶ ADP + AP-1 Complex + ARRB1 + Clathrin Triskelion + HSC70:Auxillin Complex + Pi + Vamp - c-src mediated regulation of Cx43 function and closure of gap junctions:
ATP + Cx43:ZO-1:c-src gap junction ⟶ ADP + phospho-Y265 Cx43:ZO-1 gap junction - CREB phosphorylation through the activation of CaMKK:
ATP + E1BIP3 ⟶ ADP + phospho-p-CAMKK1 - Activation of CaMK IV:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - Negative regulation of NOTCH4 signaling:
ATP + G3X812 ⟶ ADP + phospho-p-4S-NICD4 - AKT phosphorylates targets in the cytosol:
ATP + p21,p27 ⟶ ADP + p-T-CDKN1A/B - AKT phosphorylates targets in the nucleus:
ATP + Q0V7N6 ⟶ ADP + phospho-p-S133-CREB1 - CREB phosphorylation through the activation of CaMKK:
ATP + Q3Y416 ⟶ ADP + phospho-p-CAMKK1 - p130Cas linkage to MAPK signaling for integrins:
ATP + FADK1 bound p130Cas complex ⟶ ADP + Phosphorylated p130Cas in complex with FADK1 - HuR (ELAVL1) binds and stabilizes mRNA:
ATP + ELAVL1 ⟶ ADP + phospho-p-S158,S221-ELAVL1 - XBP1(S) activates chaperone genes:
ATP + H2O ⟶ ADP + PPi - Signal attenuation:
ATP + GRB2-1:SOS1:p-Y427-SHC1 ⟶ ADP + GRB2-1:p-4S-SOS1:p-Y427-SHC1 - Resolution of D-loop Structures through Synthesis-Dependent Strand Annealing (SDSA):
ATP + Extended D-Loop:p-MRN:p-S1981,Ac-K3016-ATM:KAT5:EXO1,DNA2:BLM,WRN:p-S990,Ac-K1249-BRIP1:p-BRCA1-C complex:PALB2:p-T3387-BRCA2:p-T309-RAD51:RAD51AP1:CX3 complex + H2O ⟶ ADP + BCDX2 complex + CX3 complex + EXO1,DNA2:BLM,WRN + Homologues of KAT5 + Homologues of RAD51AP1 + Homologues of p-S1981,Ac-K3016-ATM + Homologues of p-S990,Ac-K1249-BRIP1 + J9NVL4 + Pi + p-5S-BRCA1:p-2T-BARD1 + p-MRN + p-S327,T847,T859-RBBP8 homotetramer + p-T3387-BRCA2:p-T309-RAD51 complex - XBP1(S) activates chaperone genes:
ATP + H2O + SEC translocon ⟶ ADP + PPi + SEC translocon - Signaling by NOTCH3:
ATP + EGF:p-6Y-EGFR dimer:NICD3 ⟶ ADP + EGF:p-6Y-EGFR dimer + phospho-p-Y-NICD3 - NOTCH3 Activation and Transmission of Signal to the Nucleus:
ATP + EGF:p-6Y-EGFR dimer:NICD3 ⟶ ADP + EGF:p-6Y-EGFR dimer + phospho-p-Y-NICD3 - Role of ABL in ROBO-SLIT signaling:
ATP + SLIT2:ROBO1:ABL ⟶ ADP + SLIT2:p-Y1073-ROBO1:ABL - CDO in myogenesis:
ATP ⟶ ADP + phospho p38:phospho MEF2 - CREB phosphorylation through the activation of CaMKK:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - Activation of CaMK IV:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - c-src mediated regulation of Cx43 function and closure of gap junctions:
ATP + Cx43:ZO-1:c-src gap junction ⟶ ADP + phospho-Y265 Cx43:ZO-1 gap junction - Clathrin derived vesicle budding:
ATP + Cargo:AP-1:Beta-arrestin:Clathrin Triskelion:Vamp Complex + HSC70:Auxillin Complex ⟶ ADP + AP-1 Complex + C3PTE8 + Clathrin Triskelion + HSC70:Auxillin Complex + Pi - c-src mediated regulation of Cx43 function and closure of gap junctions:
ATP + Cx43:ZO-1:c-src gap junction ⟶ ADP + phospho-Y265 Cx43:ZO-1 gap junction - Signaling by NOTCH3:
ATP + EGF:p-6Y-EGFR dimer:NICD3 ⟶ ADP + EGF:p-6Y-EGFR dimer + phospho-p-Y-NICD3 - NOTCH3 Activation and Transmission of Signal to the Nucleus:
ATP + EGF:p-6Y-EGFR dimer:NICD3 ⟶ ADP + EGF:p-6Y-EGFR dimer + phospho-p-Y-NICD3 - CREB phosphorylation through the activation of CaMKK:
ATP + Homologues of CAMKK1 ⟶ ADP + Homologues of p-CAMKK1 - Activation of CaMK IV:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - CDO in myogenesis:
ATP ⟶ ADP + phospho p38:phospho MEF2 - XBP1(S) activates chaperone genes:
ATP + H2O ⟶ ADP + PPi - XBP1(S) activates chaperone genes:
ATP + H2O + SEC translocon ⟶ ADP + PPi + SEC translocon - Activation of NIMA Kinases NEK9, NEK6, NEK7:
ATP + p-3S,T-NEK9 ⟶ ADP + p-3S,2T-NEK9 - CREB phosphorylation through the activation of CaMKK:
ATP + Q54WW7 ⟶ ADP + phospho-p-CAMKK1 - XBP1(S) activates chaperone genes:
ATP + H2O ⟶ ADP + PPi - CREB phosphorylation through the activation of CaMKK:
ATP + Homologues of CAMKK1 ⟶ ADP + Homologues of p-CAMKK1 - CDO in myogenesis:
ATP + MEF2 proteins ⟶ ADP + phospho p38:phospho MEF2 - Nonhomologous End-Joining (NHEJ):
ATP + p-T2609,S2612,T2638,T2647-PRKDC:XRCC5:XRCC6:p-S645-DCLRE1C:DNA DSB ends ⟶ ADP + p-T2609,S2612,T2638,T2647-PRKDC:XRCC5:XRCC6:p-S516,S645-DCLRE1C:DNA DSB ends - Negative regulation of TH:
ATP + TH ⟶ ADP + Phospho TH - DINR-mediated activation:
ATP + DILP:DINR ⟶ ADP + Activated DINR:DILP complex - CREB phosphorylation through the activation of CaMKK:
ATP + F1NKZ8 ⟶ ADP + phospho-p-CAMKK1 - Activation of CaMK IV:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - ERK2 activation:
ATP + phospho MEK2 : ERK2 ⟶ ADP + phospho ERK2 : phospho MEK2 - c-src mediated regulation of Cx43 function and closure of gap junctions:
ATP + Cx43:ZO-1:c-src gap junction ⟶ ADP + phospho-Y265 Cx43:ZO-1 gap junction - MAPK1 (ERK2) activation:
ATP + p-S,T-MAP2K2:MAPK1 ⟶ ADP + p-S,T-MAP2K2:p-T,Y-MAPK1 - Inhibition of TSC complex formation by PKB:
ATP + Homologues of TSC2 ⟶ ADP + Homologues of p-S939,S1130,T1462-TSC2 - Signaling by Erythropoietin:
ATP + PI(4,5)P2 ⟶ ADP + PI(3,4,5)P3 - Erythropoietin activates Phosphoinositide-3-kinase (PI3K):
ATP + PI(4,5)P2 ⟶ ADP + PI(3,4,5)P3 - Resolution of D-loop Structures through Synthesis-Dependent Strand Annealing (SDSA):
ATP + Extended D-Loop:p-MRN:p-S1981,Ac-K3016-ATM:KAT5:EXO1,DNA2:BLM,WRN:p-S990,Ac-K1249-BRIP1:p-BRCA1-C complex:PALB2:p-T3387-BRCA2:p-T309-RAD51:RAD51AP1:CX3 complex + H2O ⟶ A0A1D5NYS8 + ADP + BCDX2 complex + CX3 complex + E1C6H8 + EXO1,DNA2:BLM,WRN + F1NAU2 + Pi + p-5S-BRCA1:p-2T-BARD1 + p-MRN + p-S327,T847,T859-RBBP8 homotetramer + p-T3387-BRCA2:p-T309-RAD51 complex + phospho-p-S1981,Ac-K3016-ATM + phospho-p-S990,Ac-K1249-BRIP1 - Role of ABL in ROBO-SLIT signaling:
ATP + SLIT2:ROBO1:ABL ⟶ ADP + SLIT2:p-Y1073-ROBO1:ABL - CDO in myogenesis:
ATP ⟶ ADP + phospho p38:phospho MEF2 - XBP1(S) activates chaperone genes:
ATP + H2O ⟶ ADP + PPi - Clathrin derived vesicle budding:
ATP + Cargo:AP-1:Beta-arrestin:Clathrin Triskelion:Vamp Complex + HSC70:Auxillin Complex ⟶ ADP + AP-1 Complex + ARRB1_HUMAN + Clathrin Triskelion + Golgi-associated Vesicle Cargo + HSC70:Auxillin Complex + Pi + Vamp - c-src mediated regulation of Cx43 function and closure of gap junctions:
ATP + Cx43:ZO-1:c-src gap junction ⟶ ADP + phospho-Y265 Cx43:ZO-1 gap junction - CREB phosphorylation through the activation of CaMKK:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - Activation of CaMK IV:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - Ubiquitin-dependent degradation of Cyclin D1:
ATP + CCND1:CDK4 ⟶ ADP + phospho(T286)-Cyclin D1:Cdk4 - Clearance of Nuclear Envelope Membranes from Chromatin:
ATP + EMD/TMPO/LEMD3/LEMD2:Lamin filaments:BANF1:Chromatin ⟶ ADP + EMD/TMPO/LEMD3/LEMD2:Lamin filaments + p-T2,T3,S4-BANF1 - ROBO receptors bind AKAP5:
ATP + ROBO3.1:AKAP5:p-T497,T638,S657-PRKCA ⟶ ADP + p-S1330-ROBO3.1:AKAP5:p-T497,T638,S657-PRKCA - CDO in myogenesis:
ATP + MEF2 proteins + phospho-p38 alpha/beta/gamma MAPK ⟶ ADP + phospho p38:phospho MEF2 - XBP1(S) activates chaperone genes:
ATP + H2O ⟶ ADP + PPi - c-src mediated regulation of Cx43 function and closure of gap junctions:
ATP + Cx43:ZO-1:c-src gap junction ⟶ ADP + phospho-Y265 Cx43:ZO-1 gap junction - CREB phosphorylation through the activation of CaMKK:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - Activation of CaMK IV:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - DNA Damage Bypass:
ATP + NPLOC4:UFD1L:VCP:SPRTN:POLH:MonoUb:K164-PCNA:RPA:RFC:(TT-CPD:AA-polydNMP)-DNA Template ⟶ ADP + Homologues of POLH + NPLOC4:UFD1L:VPC:SPRTN:MonoUb:K164-PCNA:RPA:RFC:(TT-CPD:AA-polydNMP)-Template DNA - Translesion synthesis by Y family DNA polymerases bypasses lesions on DNA template:
ATP + NPLOC4:UFD1L:VCP:SPRTN:POLH:MonoUb:K164-PCNA:RPA:RFC:(TT-CPD:AA-polydNMP)-DNA Template ⟶ ADP + Homologues of POLH + NPLOC4:UFD1L:VPC:SPRTN:MonoUb:K164-PCNA:RPA:RFC:(TT-CPD:AA-polydNMP)-Template DNA - Translesion Synthesis by POLH:
ATP + NPLOC4:UFD1L:VCP:SPRTN:POLH:MonoUb:K164-PCNA:RPA:RFC:(TT-CPD:AA-polydNMP)-DNA Template ⟶ ADP + Homologues of POLH + NPLOC4:UFD1L:VPC:SPRTN:MonoUb:K164-PCNA:RPA:RFC:(TT-CPD:AA-polydNMP)-Template DNA - DNA Double-Strand Break Repair:
ATP + p-T2609,S2612,T2638,T2647-PRKDC:XRCC5:XRCC6:p-S645-DCLRE1C:DNA DSB ends ⟶ ADP + p-T2609,S2612,T2638,T2647-PRKDC:XRCC5:XRCC6:p-S516,S645-DCLRE1C:DNA DSB ends - DNA Double Strand Break Response:
ATP + DNA DSBs:MRN:Ac-K3016-ATM dimer:KAT5 ⟶ ADP + DNA DSBs:MRN:p-S1981,Ac-K3016-ATM:KAT5 + phospho-p-S1981,Ac-K3016-ATM - Sensing of DNA Double Strand Breaks:
ATP + DNA DSBs:MRN:Ac-K3016-ATM dimer:KAT5 ⟶ ADP + DNA DSBs:MRN:p-S1981,Ac-K3016-ATM:KAT5 + phospho-p-S1981,Ac-K3016-ATM - Recruitment and ATM-mediated phosphorylation of repair and signaling proteins at DNA double strand breaks:
ATP + DNA DSBs:MRN:p-S1981,Ac-K3016-ATM:KAT5 ⟶ ADP + DNA DSB:p-MRN:p-S1981,Ac-K3016-ATM:KAT5 - Homology Directed Repair:
ATP + DNA DSBs:p-MRN:p-S1981,Ac-K3016-ATM:KAT5:CCNA:p-T160-CDK2:RBBP8 ⟶ ADP + CCNA:p-T160-CDK2 + DNA DSBs:p-MRN:p-S327,T847-RBBP8:p-S1981,Ac-K3016-ATM:KAT5 - HDR through Homologous Recombination (HRR) or Single Strand Annealing (SSA):
ATP + DNA DSBs:p-MRN:p-S1981,Ac-K3016-ATM:KAT5:CCNA:p-T160-CDK2:RBBP8 ⟶ ADP + CCNA:p-T160-CDK2 + DNA DSBs:p-MRN:p-S327,T847-RBBP8:p-S1981,Ac-K3016-ATM:KAT5 - Processing of DNA double-strand break ends:
ATP + DNA DSBs:p-MRN:p-S1981,Ac-K3016-ATM:KAT5:CCNA:p-T160-CDK2:RBBP8 ⟶ ADP + CCNA:p-T160-CDK2 + DNA DSBs:p-MRN:p-S327,T847-RBBP8:p-S1981,Ac-K3016-ATM:KAT5 - HDR through Homologous Recombination (HRR):
ATP + Homologues of RAD51 ⟶ ADP + Homologues of p-T309-RAD51 - Homologous DNA Pairing and Strand Exchange:
ATP + Homologues of RAD51 ⟶ ADP + Homologues of p-T309-RAD51 - Presynaptic phase of homologous DNA pairing and strand exchange:
ATP + Homologues of RAD51 ⟶ ADP + Homologues of p-T309-RAD51 - Nonhomologous End-Joining (NHEJ):
ATP + p-T2609,S2612,T2638,T2647-PRKDC:XRCC5:XRCC6:p-S645-DCLRE1C:DNA DSB ends ⟶ ADP + p-T2609,S2612,T2638,T2647-PRKDC:XRCC5:XRCC6:p-S516,S645-DCLRE1C:DNA DSB ends - Nucleotide Excision Repair:
ATP + Ub:XPC:RAD23:CETN2:Distorted dsDNA:PAR-UV-DDB:TFIIH Core:XPA:PAR-PARP1,PAR-PARP2:CHD1L ⟶ ADP + Pi + Ub:XPC:RAD23:CETN2:Open bubble-dsDNA:PAR-UV-DDB:TFIIH Core:XPA:PAR-PARP1,PAR-PARP2:CHD1L - Global Genome Nucleotide Excision Repair (GG-NER):
ATP + Ub:XPC:RAD23:CETN2:Distorted dsDNA:PAR-UV-DDB:TFIIH Core:XPA:PAR-PARP1,PAR-PARP2:CHD1L ⟶ ADP + Pi + Ub:XPC:RAD23:CETN2:Open bubble-dsDNA:PAR-UV-DDB:TFIIH Core:XPA:PAR-PARP1,PAR-PARP2:CHD1L - Formation of Incision Complex in GG-NER:
ATP + Ub:XPC:RAD23:CETN2:Distorted dsDNA:PAR-UV-DDB:TFIIH Core:XPA:PAR-PARP1,PAR-PARP2:CHD1L ⟶ ADP + Pi + Ub:XPC:RAD23:CETN2:Open bubble-dsDNA:PAR-UV-DDB:TFIIH Core:XPA:PAR-PARP1,PAR-PARP2:CHD1L - Transcription-Coupled Nucleotide Excision Repair (TC-NER):
ATP + TC-NER pre-incision complex ⟶ ADP + Pi + TC-NER pre-incision complex:Open bubble damaged DNA template:trimmed nascent mRNA - Dual incision in TC-NER:
ATP + TC-NER pre-incision complex ⟶ ADP + Pi + TC-NER pre-incision complex:Open bubble damaged DNA template:trimmed nascent mRNA - Macroautophagy:
ATP + PI ⟶ ADP + PI3P - HSF1-dependent transactivation:
ATP + HSF1 trimer ⟶ ADP + p-S326-HSF1 trimer - Cellular Senescence:
ATP ⟶ ADP - Oxidative Stress Induced Senescence:
ATP ⟶ ADP - DNA Damage/Telomere Stress Induced Senescence:
ATP + Shortened telomere:MRN:Ac-K3016-ATM dimer:KAT5 ⟶ ADP + Shortened telomere:MRN:KAT5:p-S1981,Ac-K3016-ATM + phospho-p-S1981,Ac-K3016-ATM - Senescence-Associated Secretory Phenotype (SASP):
ATP ⟶ ADP - DNA Replication:
ATP + Q5N897 ⟶ ADP + phospho-p-CDC6 - Synthesis of DNA:
ATP + Q5N897 ⟶ ADP + phospho-p-CDC6 - Switching of origins to a post-replicative state:
ATP + Q5N897 ⟶ ADP + phospho-p-CDC6 - CDK-mediated phosphorylation and removal of Cdc6:
ATP + Q5N897 ⟶ ADP + phospho-p-CDC6 - DNA strand elongation:
ATP + PCNA homotrimer + RFC Heteropentamer:RNA primer-DNA primer:origin duplex ⟶ ADP + RFC Heteropentamer:RNA primer-DNA primer:origin duplex:PCNA homotrimer - Leading Strand Synthesis:
ATP + PCNA homotrimer + RFC Heteropentamer:RNA primer-DNA primer:origin duplex ⟶ ADP + RFC Heteropentamer:RNA primer-DNA primer:origin duplex:PCNA homotrimer - Polymerase switching:
ATP + PCNA homotrimer + RFC Heteropentamer:RNA primer-DNA primer:origin duplex ⟶ ADP + RFC Heteropentamer:RNA primer-DNA primer:origin duplex:PCNA homotrimer - Lagging Strand Synthesis:
ATP + PCNA homotrimer + RFC Heteropentamer:RNA primer-DNA primer:origin duplex ⟶ ADP + RFC Heteropentamer:RNA primer-DNA primer:origin duplex:PCNA homotrimer - Cell Cycle:
ATP + Q5N897 ⟶ ADP + phospho-p-CDC6 - Cell Cycle Checkpoints:
ATP + Homologues of RFWD2 ⟶ ADP + Homologues of p-S387-RFWD2 - G1/S DNA Damage Checkpoints:
ATP + Homologues of RFWD2 ⟶ ADP + Homologues of p-S387-RFWD2 - p53-Dependent G1/S DNA damage checkpoint:
ATP + Homologues of RFWD2 ⟶ ADP + Homologues of p-S387-RFWD2 - p53-Dependent G1 DNA Damage Response:
ATP + Homologues of RFWD2 ⟶ ADP + Homologues of p-S387-RFWD2 - Stabilization of p53:
ATP + Homologues of RFWD2 ⟶ ADP + Homologues of p-S387-RFWD2 - Autodegradation of the E3 ubiquitin ligase COP1:
ATP + Homologues of RFWD2 ⟶ ADP + Homologues of p-S387-RFWD2 - G2/M Checkpoints:
ATP + p-T68-CHEK2 dimer ⟶ ADP + Homologues of p-S,3T-CHEK2 - G2/M DNA damage checkpoint:
ATP + p-T68-CHEK2 dimer ⟶ ADP + Homologues of p-S,3T-CHEK2 - Cell Cycle, Mitotic:
ATP + Q5N897 ⟶ ADP + phospho-p-CDC6 - Mitotic G1-G1/S phases:
ATP + CCNE:CDK2 ⟶ ADP + Cyclin E:p-CDK2 - G1/S Transition:
ATP + CCNE:CDK2 ⟶ ADP + Cyclin E:p-CDK2 - Cyclin E associated events during G1/S transition:
ATP + CCNE:CDK2 ⟶ ADP + Cyclin E:p-CDK2 - Phosphorylation of proteins involved in G1/S transition by active Cyclin E:Cdk2 complexes:
ATP + Cyclin E:p-T160-CDK2:RB1 ⟶ ADP + Cyclin E:p-T160-CDK2:p-RB1 - S Phase:
ATP + Q5N897 ⟶ ADP + phospho-p-CDC6 - Cyclin A:Cdk2-associated events at S phase entry:
ATP + CCNA:CDK2 ⟶ ADP + CCNA:p-Y15-CDK2 - Mitotic G2-G2/M phases:
ATP + CCNA:p-T160-CDK2:E2F1/E2F3 ⟶ ADP + CCNA:p-T160-CDK2:p-E2F1/p-E2F3 - G2 Phase:
ATP + CCNA:p-T160-CDK2:E2F1/E2F3 ⟶ ADP + CCNA:p-T160-CDK2:p-E2F1/p-E2F3 - M Phase:
ATP + p-T210-PLK1:Phosphorylated Condensin II:Nucleosome ⟶ ADP + Hyperphosphorylated Condensin II:Nucleosome - Mitotic Prophase:
ATP + p-T210-PLK1:Phosphorylated Condensin II:Nucleosome ⟶ ADP + Hyperphosphorylated Condensin II:Nucleosome - Condensation of Prophase Chromosomes:
ATP + p-T210-PLK1:Phosphorylated Condensin II:Nucleosome ⟶ ADP + Hyperphosphorylated Condensin II:Nucleosome - Mitotic Prometaphase:
ATP + Condensin I ⟶ ADP + CK2 Phosphorylated Condensin I - Condensation of Prometaphase Chromosomes:
ATP + Condensin I ⟶ ADP + CK2 Phosphorylated Condensin I - Chromosome Maintenance:
ATP + PCNA homotrimer + RFC Heteropentamer:RNA primer-DNA primer:G-strand extended telomere end ⟶ ADP + RFC Heteropentamer:RNA primer-DNA primer:G-strand extended telomere end duplex:PCNA homotrimer - Telomere Maintenance:
ATP + PCNA homotrimer + RFC Heteropentamer:RNA primer-DNA primer:G-strand extended telomere end ⟶ ADP + RFC Heteropentamer:RNA primer-DNA primer:G-strand extended telomere end duplex:PCNA homotrimer - Extension of Telomeres:
ATP + PCNA homotrimer + RFC Heteropentamer:RNA primer-DNA primer:G-strand extended telomere end ⟶ ADP + RFC Heteropentamer:RNA primer-DNA primer:G-strand extended telomere end duplex:PCNA homotrimer - Telomere C-strand (Lagging Strand) Synthesis:
ATP + PCNA homotrimer + RFC Heteropentamer:RNA primer-DNA primer:G-strand extended telomere end ⟶ ADP + RFC Heteropentamer:RNA primer-DNA primer:G-strand extended telomere end duplex:PCNA homotrimer - Polymerase switching on the C-strand of the telomere:
ATP + PCNA homotrimer + RFC Heteropentamer:RNA primer-DNA primer:G-strand extended telomere end ⟶ ADP + RFC Heteropentamer:RNA primer-DNA primer:G-strand extended telomere end duplex:PCNA homotrimer - Regulation of mRNA stability by proteins that bind AU-rich elements:
ATP + BRF1:mRNA Complex ⟶ ADP + Phosphorylated BRF1 (Ser54, Ser92, Ser203):mRNA Complex - Butyrate Response Factor 1 (BRF1) binds and destabilizes mRNA:
ATP + BRF1:mRNA Complex ⟶ ADP + Phosphorylated BRF1 (Ser54, Ser92, Ser203):mRNA Complex - Nonsense Mediated Decay (NMD) enhanced by the Exon Junction Complex (EJC):
ATP + SMG1:UPF1:EJC:Translated mRNP ⟶ ADP + SMG1:Phosphorylated UPF1:EJC:Translated mRNP - Formation of xylulose-5-phosphate:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Linoleic acid (LA) metabolism:
ATP + CoA-SH + LA ⟶ AMP + LA-CoA + PPi - Phospholipid metabolism:
H2O + lysoPC ⟶ GPCho + LCFA(-) - Glycerophospholipid biosynthesis:
H2O + lysoPC ⟶ GPCho + LCFA(-) - Synthesis of PE:
ATP + ETA ⟶ ADP + PETA - Synthesis of PC:
ATP + Cho ⟶ ADP + PCho - PI Metabolism:
ATP + PI ⟶ ADP + PI4P - Synthesis of PIPs at the ER membrane:
ATP + PI ⟶ ADP + PI4P - Synthesis of PIPs at the Golgi membrane:
ATP + PI ⟶ ADP + PI4P - Synthesis of PIPs at the plasma membrane:
ATP + PI4P ⟶ ADP + PI(4,5)P2 - Synthesis of PIPs at the early endosome membrane:
ATP + PI ⟶ ADP + PI3P - Synthesis of PIPs at the late endosome membrane:
ATP + PI ⟶ ADP + PI3P - Sphingolipid metabolism:
3-ketosphinganine + H+ + TPNH ⟶ SPA + TPN - Glycosphingolipid metabolism:
GM1 ganglioside + H2O ⟶ GM2 ganglioside + Gal - Bile acid and bile salt metabolism:
CHOL + H+ + Oxygen + TPNH ⟶ 24OH-CHOL + H2O + TPN - Synthesis of bile acids and bile salts:
CHOL + H+ + Oxygen + TPNH ⟶ 24OH-CHOL + H2O + TPN - Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
25(S) THCA-CoA + Oxygen ⟶ H2O2 + THCA-CoA - Recycling of bile acids and salts:
ATP + H2O + bile salts ⟶ ADP + Pi + bile salts - Purine ribonucleoside monophosphate biosynthesis:
ATP + H2O + L-Gln + XMP ⟶ AMP + GMP + L-Glu + PPi - Purine salvage:
Ade + PRPP ⟶ AMP + PPi - Platelet activation, signaling and aggregation:
2AG + H2O ⟶ AA + Glycerol + H+ - Effects of PIP2 hydrolysis:
2AG + H2O ⟶ AA + Glycerol + H+ - Kinesins:
ATP + Kinesins:microtubule ⟶ ADP + Kinesins:microtubule - Neurotransmitter receptors and postsynaptic signal transmission:
ATP ⟶ ADP - Activation of NMDA receptors and postsynaptic events:
ATP ⟶ ADP - Post NMDA receptor activation events:
ATP ⟶ ADP - CREB phosphorylation through the activation of Ras:
ATP ⟶ ADP - RSK activation:
ATP ⟶ ADP - CREB phosphorylation through the activation of CaMKK:
ATP + Homologues of CAMKK1 ⟶ ADP + Homologues of p-CAMKK1 - Activation of CaMK IV:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - Gene expression (Transcription):
ATP + pol II transcription complex containing 3 Nucleotide long transcript ⟶ AMP + PPi + pol II transcription complex containing 3 Nucleotide long transcript - RNA Polymerase II Transcription:
ATP + pol II transcription complex containing 3 Nucleotide long transcript ⟶ AMP + PPi + pol II transcription complex containing 3 Nucleotide long transcript - Generic Transcription Pathway:
GSSG + H+ + TPNH ⟶ GSH + TPN - Transcriptional Regulation by TP53:
GSSG + H+ + TPNH ⟶ GSH + TPN - TP53 Regulates Transcription of Cell Death Genes:
ATP + Q7XNY1 ⟶ ADP + phospho-p-T788-PIDD1 - TP53 Regulates Transcription of Caspase Activators and Caspases:
ATP + Q7XNY1 ⟶ ADP + phospho-p-T788-PIDD1 - TP53 Regulates Transcription of DNA Repair Genes:
ATP + CCNK:CDK12:Elongation Complex at DNA Repair Genes ⟶ ADP + CCNK:CDK12:CDK12-Phosphorylated Elongation Complex at DNA repair genes - Regulation of TP53 Activity:
ATP + Homologues of DYRK2 ⟶ ADP + Homologues of p-T106,S442-DYRK2 - Regulation of TP53 Activity through Phosphorylation:
ATP + Homologues of DYRK2 ⟶ ADP + Homologues of p-T106,S442-DYRK2 - Regulation of TP53 Activity through Methylation:
ATP + Q5QN89 ⟶ ADP + phospho-p-S203-TTC5 - Transcriptional Regulation by E2F6:
ATP + Homologues of E2F6 ⟶ ADP + Homologues of p-S12-E2F6 - RNA Polymerase II Transcription Initiation And Promoter Clearance:
ATP + pol II transcription complex containing 3 Nucleotide long transcript ⟶ AMP + PPi + pol II transcription complex containing 3 Nucleotide long transcript - RNA Pol II CTD phosphorylation and interaction with CE:
ATP + Pol II transcription complex containing extruded transcript to +30 ⟶ ADP + Pol II transcription complex with (ser5) phosphorylated CTD containing extruded transcript to +30 - Immune System:
ATP + Mg2+ ⟶ AMP + E1 bound ubiquitin + Mg2+ + PPi - Adaptive Immune System:
ATP + Mg2+ ⟶ AMP + E1 bound ubiquitin + Mg2+ + PPi - Class I MHC mediated antigen processing & presentation:
ATP + Mg2+ ⟶ AMP + E1 bound ubiquitin + Mg2+ + PPi - Antigen Presentation: Folding, assembly and peptide loading of class I MHC:
ATP + H2O + oligopeptide ⟶ ADP + Pi + oligopeptide - Innate Immune System:
H2O + PC ⟶ Cho + PA - Toll-like Receptor Cascades:
ATP ⟶ ADP - Toll Like Receptor 10 (TLR10) Cascade:
ATP ⟶ ADP - MyD88 cascade initiated on plasma membrane:
ATP ⟶ ADP - MAP kinase activation:
ATP ⟶ ADP - JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1:
ATP ⟶ ADP - activated TAK1 mediates p38 MAPK activation:
ATP ⟶ ADP - MAPK targets/ Nuclear events mediated by MAP kinases:
ATP ⟶ ADP - ERK/MAPK targets:
ATP ⟶ ADP - Toll Like Receptor 3 (TLR3) Cascade:
ATP ⟶ ADP - Toll Like Receptor 5 (TLR5) Cascade:
ATP ⟶ ADP - Toll Like Receptor 7/8 (TLR7/8) Cascade:
ATP ⟶ ADP - MyD88 dependent cascade initiated on endosome:
ATP ⟶ ADP - TRAF6 mediated induction of NFkB and MAP kinases upon TLR7/8 or 9 activation:
ATP ⟶ ADP - Toll Like Receptor 9 (TLR9) Cascade:
ATP ⟶ ADP - Toll Like Receptor 4 (TLR4) Cascade:
ATP ⟶ ADP - MyD88:MAL(TIRAP) cascade initiated on plasma membrane:
ATP ⟶ ADP - MyD88-independent TLR4 cascade:
ATP ⟶ ADP - TRIF(TICAM1)-mediated TLR4 signaling:
ATP ⟶ ADP - Toll Like Receptor 2 (TLR2) Cascade:
ATP ⟶ ADP - Toll Like Receptor TLR1:TLR2 Cascade:
ATP ⟶ ADP - Toll Like Receptor TLR6:TLR2 Cascade:
ATP ⟶ ADP - Fcgamma receptor (FCGR) dependent phagocytosis:
H2O + PC ⟶ Cho + PA - Regulation of actin dynamics for phagocytic cup formation:
Activated WAVE2 and WASP/N-WASP:ARP2/3 complex:G-actin ⟶ Mother filament:branching complex - Fc epsilon receptor (FCERI) signaling:
ATP + Homologues of MAP2K4 ⟶ ADP + Homologues of p-S257,T261-MAP2K4 - FCERI mediated MAPK activation:
ATP + Homologues of MAP2K4 ⟶ ADP + Homologues of p-S257,T261-MAP2K4 - Cytokine Signaling in Immune system:
H2O ⟶ AMP + ATP + H+ - Signaling by Interleukins:
ATP ⟶ ADP - Interleukin-17 signaling:
ATP ⟶ ADP - Mitochondrial ABC transporters:
ATP + H2O + heme ⟶ ADP + Pi + heme - Gamma carboxylation, hypusine formation and arylsulfatase activation:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Unfolded Protein Response (UPR):
ATP + IRE1 dimer ⟶ ADP + p-S724-IRE1 dimer - IRE1alpha activates chaperones:
ATP + IRE1 dimer ⟶ ADP + p-S724-IRE1 dimer - XBP1(S) activates chaperone genes:
ATP + H2O + SEC translocon ⟶ ADP + PPi + SEC translocon - PERK regulates gene expression:
ATP + Homologues of EIF2S1 ⟶ ADP + Homologues of p-S52-EIF2S1 - Surfactant metabolism:
ATP + H2O + PC, PG ⟶ ADP + PC, PG + Pi - Signaling by Receptor Tyrosine Kinases:
ATP ⟶ ADP - Signaling by NTRKs:
ATP ⟶ ADP - Signaling by NTRK1 (TRKA):
ATP ⟶ ADP - Nuclear Events (kinase and transcription factor activation):
ATP ⟶ ADP - Opioid Signalling:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - G-protein mediated events:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - PLC beta mediated events:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - Ca-dependent events:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - CaM pathway:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - Calmodulin induced events:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - CaMK IV-mediated phosphorylation of CREB:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - G alpha (q) signalling events:
2AG + H2O ⟶ AA + Glycerol + H+ - Gastrin-CREB signalling pathway via PKC and MAPK:
ATP ⟶ ADP - Signaling by WNT:
ATP + Homologues of NLK ⟶ ADP + pT298-NLK dimer - Beta-catenin independent WNT signaling:
ATP + Homologues of NLK ⟶ ADP + pT298-NLK dimer - Ca2+ pathway:
ATP + Homologues of NLK ⟶ ADP + pT298-NLK dimer - ESR-mediated signaling:
ATP + MYB gene:hypophosphorylated RNA polymerase II:TFIIF:ESR1:ESTG:P-TEFb ⟶ ADP + MYB gene:hyperphosphorylated RNA polymerase II:TFIIF:ESR1:ESTG:P-TEFb - Estrogen-dependent gene expression:
ATP + MYB gene:hypophosphorylated RNA polymerase II:TFIIF:ESR1:ESTG:P-TEFb ⟶ ADP + MYB gene:hyperphosphorylated RNA polymerase II:TFIIF:ESR1:ESTG:P-TEFb - MAPK family signaling cascades:
ATP ⟶ ADP - ERK1/ERK2 pathway:
ATP ⟶ ADP - RAF-independent MAPK1/3 activation:
ATP ⟶ ADP - MAPK3 (ERK1) activation:
ATP ⟶ ADP - MAPK6/MAPK4 signaling:
ATP + Homologues of MAPK6 ⟶ ADP + Homologues of p-3S,T MAPK6 - Intracellular signaling by second messengers:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - PI3K/AKT Signaling:
ATP + PI4P ⟶ ADP + PI(4,5)P2 - Negative regulation of the PI3K/AKT network:
ATP + PI4P ⟶ ADP + PI(4,5)P2 - PI5P, PP2A and IER3 Regulate PI3K/AKT Signaling:
ATP + PI4P ⟶ ADP + PI(4,5)P2 - DAG and IP3 signaling:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - Signaling by Rho GTPases:
Activated WAVE2 and WASP/N-WASP:ARP2/3 complex:G-actin ⟶ Mother filament:branching complex - RHO GTPase Effectors:
Activated WAVE2 and WASP/N-WASP:ARP2/3 complex:G-actin ⟶ Mother filament:branching complex - RHO GTPases Activate WASPs and WAVEs:
Activated WAVE2 and WASP/N-WASP:ARP2/3 complex:G-actin ⟶ Mother filament:branching complex - RHO GTPases Activate NADPH Oxidases:
ATP + PI ⟶ ADP + PI3P - mTOR signalling:
AMP + p-AMPK heterotrimer ⟶ p-AMPK heterotrimer:AMP - mTORC1-mediated signalling:
ATP + Homologues of RPS6 ⟶ ADP + Homologues of p-5S-RPS6 - Clathrin-mediated endocytosis:
ATP + PI4P ⟶ ADP + PI(4,5)P2 - Activation of NIMA Kinases NEK9, NEK6, NEK7:
ATP + p-3S,T-NEK9 ⟶ ADP + p-3S,2T-NEK9 - cell division:
ATP + NUDC ⟶ ADP + Q8IDW4 - Interleukin-37 signaling:
ATP + Q8IL57 ⟶ ADP + phospho-Q8IL57 - CREB phosphorylation through the activation of CaMKK:
ATP + F1LQD2 ⟶ ADP + phospho-p-CAMKK1 - Activation of CaMK IV:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - XBP1(S) activates chaperone genes:
ATP + H2O ⟶ ADP + PPi - Clathrin derived vesicle budding:
ATP + Cargo:AP-1:Beta-arrestin:Clathrin Triskelion:Vamp Complex + HSC70:Auxillin Complex ⟶ ADP + AP-1 Complex + ARRB1 + Clathrin Triskelion + HSC70:Auxillin Complex + Pi + Vamp - c-src mediated regulation of Cx43 function and closure of gap junctions:
ATP + Cx43:ZO-1:c-src gap junction ⟶ ADP + phospho-Y265 Cx43:ZO-1 gap junction - Role of ABL in ROBO-SLIT signaling:
ATP + SLIT2:ROBO1:ABL ⟶ ADP + SLIT2:p-Y1073-ROBO1:ABL - ROBO receptors bind AKAP5:
ATP + ROBO3.1:AKAP5:p-T497,T638,S657-PRKCA ⟶ ADP + p-S1330-ROBO3.1:AKAP5:p-T497,T638,S657-PRKCA - CDO in myogenesis:
ATP ⟶ ADP + phospho p38:phospho MEF2 - CDO in myogenesis:
ATP + phospho-p38 alpha/beta/gamma MAPK ⟶ ADP + phospho p38:phospho MEF2 - Regulation of beta-cell development:
ATP + FOXO1 ⟶ ADP + phospho-p-T24,S256,S319-FOXO1 - Regulation of gene expression in beta cells:
ATP + FOXO1 ⟶ ADP + phospho-p-T24,S256,S319-FOXO1 - AKT-mediated inactivation of FOXO1A:
ATP + FOXO1 ⟶ ADP + phospho-p-T24,S256,S319-FOXO1 - CREB phosphorylation through the activation of CaMKK:
ATP + Homologues of CAMKK1 ⟶ ADP + Homologues of p-CAMKK1 - Activation of CaMK IV:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - G2/M DNA replication checkpoint:
ATP + CCNB1:p-T14,T161-CDK1 ⟶ ADP + CCNB1:p-T14,Y15,T161-CDK1 - Activation of NIMA Kinases NEK9, NEK6, NEK7:
ATP + p-T333-NEK9 ⟶ ADP + p-3S,T-NEK9 - XBP1(S) activates chaperone genes:
ATP + H2O + SEC translocon ⟶ ADP + PPi + SEC translocon - CDO in myogenesis:
ATP + MEF2 proteins + phospho-p38 alpha/beta/gamma MAPK ⟶ ADP + phospho p38:phospho MEF2 - G2/M DNA replication checkpoint:
ATP + CCNB:CDK1 ⟶ ADP + CCNB:p-T14-CDK1 - CREB phosphorylation through the activation of CaMKK:
ATP + Q9UU87 ⟶ ADP + phospho-p-CAMKK1 - XBP1(S) activates chaperone genes:
ATP + H2O + SEC translocon ⟶ ADP + PPi + SEC translocon - Hedgehog 'on' state:
ATP + GLI1,2,3 ⟶ ADP + p-GLI1,2,3 - DCC mediated attractive signaling:
ATP + NTN1:DCC oligomer:p-Y397-PTK2:MyrG-p-Y419-SRC,MyrG-p-Y420-FYN ⟶ ADP + NTN1:p-Y1420-DCC oligomer:p-Y397-PTK2:MyrG-p-Y419-SRC,MyrG-p-Y420-FYN - Role of ABL in ROBO-SLIT signaling:
ATP + SLIT2:ROBO1:ABL ⟶ ADP + SLIT2:p-Y1073-ROBO1:ABL - ROBO receptors bind AKAP5:
ATP + ROBO3.1:AKAP5:p-T497,T638,S657-PRKCA ⟶ ADP + p-S1330-ROBO3.1:AKAP5:p-T497,T638,S657-PRKCA - CDO in myogenesis:
ATP ⟶ ADP + phospho p38:phospho MEF2 - c-src mediated regulation of Cx43 function and closure of gap junctions:
ATP + Cx43:ZO-1:c-src gap junction ⟶ ADP + phospho-Y265 Cx43:ZO-1 gap junction - FGFR2c ligand binding and activation:
ATP + FGFR2c homodimer bound to FGF ⟶ ADP + Activated FGFR2c homodimer bound to FGF - Phospholipase C-mediated cascade; FGFR2:
ATP + activated FGFR2:PLCG1 ⟶ ADP + activated FGFR2:p-4Y-PLCG1 - FGFR3b ligand binding and activation:
ATP + FGFR3b homodimer bound to FGF ⟶ ADP + Activated FGFR3b homodimer - Phospholipase C-mediated cascade; FGFR3:
ATP + activated FGFR3:PLCG1 ⟶ ADP + activated FGFR3:p-4Y-PLCG1 - Signaling by NOTCH3:
ATP + EGF:p-6Y-EGFR dimer:NICD3 ⟶ ADP + EGF:p-6Y-EGFR dimer + phospho-p-Y-NICD3 - NOTCH3 Activation and Transmission of Signal to the Nucleus:
ATP + EGF:p-6Y-EGFR dimer:NICD3 ⟶ ADP + EGF:p-6Y-EGFR dimer + phospho-p-Y-NICD3 - MAPK3 (ERK1) activation:
ATP + p-2S-MAP2K1:MAPK3 ⟶ ADP + p-T,Y-MAPK3:p-2S-MAP2K1 - CREB phosphorylation through the activation of CaMKK:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - Activation of CaMK IV:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - XBP1(S) activates chaperone genes:
ATP + H2O ⟶ ADP + PPi - Aquaporin-mediated transport:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Vasopressin regulates renal water homeostasis via Aquaporins:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Iron uptake and transport:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN - Transferrin endocytosis and recycling:
ATP + H+ + H2O ⟶ ADP + H+ + Pi - Plasma lipoprotein assembly:
CHEST + CHOL + PL + TAG + pre-VLDL ⟶ VLDL - HDL assembly:
4xPALM-C-ABCA1 tetramer + ATP ⟶ 4xPALM-C-p-2S-ABCA1 tetramer + ADP - Signaling by EGFR:
ATP + EGF:EGFR dimer ⟶ ADP + EGF:p-6Y-EGFR dimer - EGFR interacts with phospholipase C-gamma:
ATP + EGF:p-6Y-EGFR:PLCG1 ⟶ ADP + EGF:p-6Y-EGFR:p-Y472,771,783,1254-PLCG1 - SHC1 events in EGFR signaling:
ATP + EGF:p-6Y-EGFR:SHC1 ⟶ ADP + EGF:p-6Y-EGFR:p-Y349,350-SHC1 - GAB1 signalosome:
ATP + EGF:p-6Y-EGFR:GRB2:GAB1 ⟶ ADP + EGF:p-6Y-EGFR:GRB2:p-5Y-GAB1 - EGFR downregulation:
ATP + EGF:p-6Y-EGFR:CBL ⟶ ADP + EGF:p-6Y-EGFR:p-Y371-CBL - Signaling by FGFR:
ATP + FGFR1b homodimer bound to FGF ⟶ ADP + Activated FGFR1b homodimer - Signaling by FGFR1:
ATP + FGFR1b homodimer bound to FGF ⟶ ADP + Activated FGFR1b homodimer - FGFR1 ligand binding and activation:
ATP + FGFR1b homodimer bound to FGF ⟶ ADP + Activated FGFR1b homodimer - FGFR1b ligand binding and activation:
ATP + FGFR1b homodimer bound to FGF ⟶ ADP + Activated FGFR1b homodimer - FGFR1c ligand binding and activation:
ATP + FGFR1c homodimer bound to FGF ⟶ ADP + Activated FGFR1c homodimer - FGFR1c and Klotho ligand binding and activation:
ATP + FGF23 bound to Klotho and FGFR1c ⟶ ADP + Activated FGFR1c bound to FGF23:Klotho - Downstream signaling of activated FGFR1:
ATP + Activated FGFR1:FRS2 ⟶ ADP + Activated FGFR1:p-FRS2 - FRS-mediated FGFR1 signaling:
ATP + Activated FGFR1:FRS2 ⟶ ADP + Activated FGFR1:p-FRS2 - Phospholipase C-mediated cascade: FGFR1:
ATP + activated FGFR1:PLCG1 ⟶ ADP + activated FGFR1:p-4Y-PLCG1 - SHC-mediated cascade:FGFR1:
ATP + Activated FGFR1:SHC1 ⟶ ADP + Activated FGFR1:p-SHC1 - PI-3K cascade:FGFR1:
ATP + PI(4,5)P2 ⟶ ADP + PI(3,4,5)P3 - Negative regulation of FGFR1 signaling:
ATP + Activated FGFR1:FRS2 ⟶ ADP + Activated FGFR1:p-8T-FRS2 - Spry regulation of FGF signaling:
ATP + PP2A(A:C):SPRY2 ⟶ ADP + PP2A(A:C):Y55/Y227-pSPRY2 - Signaling by FGFR2:
ATP + PP2A(A:C):SPRY2 ⟶ ADP + PP2A(A:C):Y55/Y227-pSPRY2 - FGFR2 ligand binding and activation:
ATP + FGFR2b homodimer bound to FGF ⟶ ADP + Activated FGFR2b homodimer bound to FGF - FGFR2b ligand binding and activation:
ATP + FGFR2b homodimer bound to FGF ⟶ ADP + Activated FGFR2b homodimer bound to FGF - FGFR2c ligand binding and activation:
ATP + FGFR2c homodimer bound to FGF ⟶ ADP + Activated FGFR2c homodimer bound to FGF - Downstream signaling of activated FGFR2:
ATP + Activated FGFR2:FRS2 ⟶ ADP + Activated FGFR2:p-FRS2 - FRS-mediated FGFR2 signaling:
ATP + Activated FGFR2:FRS2 ⟶ ADP + Activated FGFR2:p-FRS2 - Phospholipase C-mediated cascade; FGFR2:
ATP + activated FGFR2:PLCG1 ⟶ ADP + activated FGFR2:p-4Y-PLCG1 - SHC-mediated cascade:FGFR2:
ATP + Activated FGFR2:SHC1 ⟶ ADP + Activated FGFR2:pY-SHC1 - PI-3K cascade:FGFR2:
ATP + PI(4,5)P2 ⟶ ADP + PI(3,4,5)P3 - Negative regulation of FGFR2 signaling:
ATP + PP2A(A:C):SPRY2 ⟶ ADP + PP2A(A:C):Y55/Y227-pSPRY2 - Signaling by FGFR3:
ATP + PP2A(A:C):SPRY2 ⟶ ADP + PP2A(A:C):Y55/Y227-pSPRY2 - FGFR3 ligand binding and activation:
ATP + FGFR3b homodimer bound to FGF ⟶ ADP + Activated FGFR3b homodimer - FGFR3b ligand binding and activation:
ATP + FGFR3b homodimer bound to FGF ⟶ ADP + Activated FGFR3b homodimer - FGFR3c ligand binding and activation:
ATP + FGFR3c homodimer bound to FGF ⟶ ADP + Activated FGFR3c homodimer - Downstream signaling of activated FGFR3:
ATP + Activated FGFR3:FRS2 ⟶ ADP + Activated FGFR3:p-FRS2 - FRS-mediated FGFR3 signaling:
ATP + Activated FGFR3:FRS2 ⟶ ADP + Activated FGFR3:p-FRS2 - Phospholipase C-mediated cascade; FGFR3:
ATP + activated FGFR3:PLCG1 ⟶ ADP + activated FGFR3:p-4Y-PLCG1 - SHC-mediated cascade:FGFR3:
ATP + Activated FGFR3:SHC1 ⟶ ADP + Activated FGFR3:pY-SHC1 - PI-3K cascade:FGFR3:
ATP + PI(4,5)P2 ⟶ ADP + PI(3,4,5)P3 - Negative regulation of FGFR3 signaling:
ATP + PP2A(A:C):SPRY2 ⟶ ADP + PP2A(A:C):Y55/Y227-pSPRY2 - Signaling by FGFR4:
ATP + PP2A(A:C):SPRY2 ⟶ ADP + PP2A(A:C):Y55/Y227-pSPRY2 - FGFR4 ligand binding and activation:
ATP + FGFR4 homodimer bound to FGF ⟶ ADP + Activated FGFR4 homodimer - betaKlotho-mediated ligand binding:
ATP + FGFR4:HS:KLB:FGF19 ⟶ ADP + Activated FGFR4 bound to FGF19:BetaKlotho - Downstream signaling of activated FGFR4:
ATP + Activated FGFR4:FRS2 ⟶ ADP + Activated FGFR4:p-FRS2 - FRS-mediated FGFR4 signaling:
ATP + Activated FGFR4:FRS2 ⟶ ADP + Activated FGFR4:p-FRS2 - Phospholipase C-mediated cascade; FGFR4:
ATP + activated FGFR4:PLCG1 ⟶ ADP + activated FGFR4:p-4Y-PLCG1 - SHC-mediated cascade:FGFR4:
ATP + Activated FGFR4:SHC1 ⟶ ADP + Activated FGFR4:pY-SHC1 - PI-3K cascade:FGFR4:
ATP + PI(4,5)P2 ⟶ ADP + PI(3,4,5)P3 - Negative regulation of FGFR4 signaling:
ATP + PP2A(A:C):SPRY2 ⟶ ADP + PP2A(A:C):Y55/Y227-pSPRY2 - Signaling by NTRKs:
ATP + H0Z2U9 ⟶ ADP + phospho-p-S,2T-MAPKAPK3 - Signaling by NTRK1 (TRKA):
ATP + H0Z2U9 ⟶ ADP + phospho-p-S,2T-MAPKAPK3 - Signalling to ERKs:
ATP + H0Z2U9 ⟶ ADP + phospho-p-S,2T-MAPKAPK3 - Signalling to RAS:
ATP + H0Z2U9 ⟶ ADP + phospho-p-S,2T-MAPKAPK3 - p38MAPK events:
ATP + H0Z2U9 ⟶ ADP + phospho-p-S,2T-MAPKAPK3 - Prolonged ERK activation events:
ATP + Active TrkA receptor:ARMS:Crk complex ⟶ ADP + Active TrkA receptor:Phospho-ARMS:Crk complex - ARMS-mediated activation:
ATP + Active TrkA receptor:ARMS:Crk complex ⟶ ADP + Active TrkA receptor:Phospho-ARMS:Crk complex - PI3K/AKT activation:
ATP + PI(4,5)P2 ⟶ ADP + PI(3,4,5)P3 - Nuclear Events (kinase and transcription factor activation):
ATP + H0ZQJ7 ⟶ ADP + phospho-p-S212,S360,S376,T581-RPS6KA5 - ERK/MAPK targets:
ATP + H0ZQJ7 ⟶ ADP + phospho-p-S212,S360,S376,T581-RPS6KA5 - CREB phosphorylation:
ATP + H0ZIE4 ⟶ ADP + phospho-p-S133-CREB1 - Signaling by NTRK3 (TRKC):
ATP + NTF3:NTRK3 homodimer ⟶ ADP + NTF3:p-5Y-NTRK3 homodimer - NTF3 activates NTRK3 signaling:
ATP + NTF3:NTRK3 homodimer ⟶ ADP + NTF3:p-5Y-NTRK3 homodimer - Activated NTRK3 signals through PI3K:
ATP + NTF3:p-5Y-NTKR3 homodimer:MyrG-SRC ⟶ ADP + NTF3:p-5Y-NTRK3 homodimer:MyrG-p-Y419-SRC - Signaling by Insulin receptor:
H2O + cAMP ⟶ AMP - Insulin receptor signalling cascade:
H2O + cAMP ⟶ AMP - IRS activation:
ATP + IRS:Insulin:p-6Y-Insulin receptor ⟶ ADP + p-Y-IRS:Insulin:p-6Y-Insulin receptor - IRS-mediated signalling:
H2O + cAMP ⟶ AMP - PI3K Cascade:
H2O + cAMP ⟶ AMP - Activation of PKB:
AKT2:PIP3 + ATP ⟶ ADP + p-T309,S474-AKT2:PIP3 - Signaling by PDGF:
ATP + PDGF beta receptor:PDGF chain B homodimer ⟶ ADP + Phospho PDGF beta receptor: PDGF chain B homodimer - Downstream signal transduction:
ATP + PI(4,5)P2 ⟶ ADP + PI(3,4,5)P3 - Signaling by SCF-KIT:
ATP + KIT:sSCF dimer:KIT ⟶ ADP + p-7Y-KIT:sSCF dimer:p-7Y-KIT - Regulation of KIT signaling:
ATP + KIT + PRKCA ⟶ ADP + p-KIT (S741,746):PKC alpha - Signaling by ERBB2:
ATP ⟶ ADP - SHC1 events in ERBB2 signaling:
ATP + SHC1:Phosphorylated ERBB2 heterodimers ⟶ ADP + p-Y349,350-SHC1:Phosphorylated ERBB2 heterodimers - PI3K events in ERBB2 signaling:
ATP + PI(4,5)P2 ⟶ ADP + PI(3,4,5)P3 - Downregulation of ERBB2 signaling:
ATP + Homologues of USP8 ⟶ ADP + Homologues of p-T945-USP8 - Downregulation of ERBB2:ERBB3 signaling:
ATP + Homologues of USP8 ⟶ ADP + Homologues of p-T945-USP8 - Signaling by ERBB4:
ATP ⟶ ADP - SHC1 events in ERBB4 signaling:
ATP + SHC1:p-ERBB4 ⟶ ADP + p-Y349,350-SHC1:p-ERBB4 - PI3K events in ERBB4 signaling:
ATP + PI(4,5)P2 ⟶ ADP + PI(3,4,5)P3 - Signaling by Type 1 Insulin-like Growth Factor 1 Receptor (IGF1R):
H2O + cAMP ⟶ AMP - IGF1R signaling cascade:
H2O + cAMP ⟶ AMP - SHC-related events triggered by IGF1R:
ATP + IGF1,2:p-Y1161,1165,1166-IGF1R:SHC1 ⟶ ADP + IGF1,2:p-3Y-IGF1R:p-3Y-SHC1 - IRS-related events triggered by IGF1R:
H2O + cAMP ⟶ AMP - Signaling by MET:
ATP + HGF:MET dimer ⟶ ADP + HGF:p-Y1234,Y1235,Y1349,Y1356-MET dimer - MET Receptor Activation:
ATP + HGF:MET dimer ⟶ ADP + HGF:p-Y1234,Y1235,Y1349,Y1356-MET dimer - MET activates RAS signaling:
ATP + HGF:p-4Y-MET dimer:SHC1-2 ⟶ ADP + HGF:p-4Y-MET dimer:p-Y317-SHC1-2 - MET activates PI3K/AKT signaling:
ATP + HGF:p-4Y-MET dimer:GAB1,HGF:p-4Y-MET dimer:GRB2:GAB1 ⟶ ADP + HGF:p-4Y-MET:p-5Y-GAB1, HGF:p-4Y-MET:GRB2-1:p-5Y-GAB1 - MET promotes cell motility:
ATP + HGF:p-4Y-MET dimer:PTK2 ⟶ ADP + HGF:p-4Y-MET dimer:p-Y397-PTK2 - MET activates PTK2 signaling:
ATP + HGF:p-4Y-MET dimer:PTK2 ⟶ ADP + HGF:p-4Y-MET dimer:p-Y397-PTK2 - MET activates STAT3:
ATP + HGF:p-4Y-MET dimer:STAT3 ⟶ ADP + HGF:p-Y1234,Y1235,Y1349,Y1356-MET dimer + phospho-p-Y705-STAT3 - Negative regulation of MET activity:
ATP + HGF:p-4Y-MET dimer:GRB2:CBL,(HGF:p-Y1003,4Y-MET dimer:CBL) ⟶ ADP + HGF:p-4Y-MET dimer:GRB2:p-Y-CBL,(HGF:p-Y1003,4Y-MET dimer:p-Y-CBL) - Signaling by TGF-beta family members:
ATP + TGFB1:p-TGFBR:ZFYVE9:SMAD2/3 ⟶ ADP + TGFB1:p-TGFBR:ZFYVE9:p-2S-SMAD2/3 - Signaling by TGF-beta Receptor Complex:
ATP + TGFB1:p-TGFBR:ZFYVE9:SMAD2/3 ⟶ ADP + TGFB1:p-TGFBR:ZFYVE9:p-2S-SMAD2/3 - TGF-beta receptor signaling activates SMADs:
ATP + TGFB1:p-TGFBR:ZFYVE9:SMAD2/3 ⟶ ADP + TGFB1:p-TGFBR:ZFYVE9:p-2S-SMAD2/3 - Signaling by BMP:
ATP + BMP:BMPRII:BMPRI ⟶ ADP + BMP:BMPRII:p-4S-BMPRI - Signaling by Activin:
ATP + Activin A,AB,B:ACVR2A,B:ACVR1B ⟶ ADP + Activin A,AB,B:ACVR2A,B:p-ACVR1B - Opioid Signalling:
H2O + cAMP ⟶ AMP - G-protein mediated events:
H2O + cAMP ⟶ AMP - PLC beta mediated events:
H2O + cAMP ⟶ AMP - Ca-dependent events:
H2O + cAMP ⟶ AMP - phospho-PLA2 pathway:
ATP + H0YZ31 ⟶ ADP + phospho-p-S505,S727-PLA2G4A - CaM pathway:
H2O + cAMP ⟶ AMP - Calmodulin induced events:
H2O + cAMP ⟶ AMP - CaMK IV-mediated phosphorylation of CREB:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - DARPP-32 events:
H2O + cAMP ⟶ AMP - The phototransduction cascade:
ATP + Q9IA36 ⟶ ADP + phospho-p-S334,338,343-at-retinyl-RHO - Inactivation, recovery and regulation of the phototransduction cascade:
ATP + Q9IA36 ⟶ ADP + phospho-p-S334,338,343-at-retinyl-RHO - Effects of PIP2 hydrolysis:
2AG + H2O ⟶ AA + Glycerol + H+ - Gastrin-CREB signalling pathway via PKC and MAPK:
ATP + Ribosomal protein S6 kinase ⟶ ADP + Phospho-Ribosomal protein S6 kinase - G-protein beta:gamma signalling:
ATP + PI(4,5)P2 ⟶ ADP + PI(3,4,5)P3 - G beta:gamma signalling through PI3Kgamma:
ATP + PI(4,5)P2 ⟶ ADP + PI(3,4,5)P3 - Signaling by NOTCH:
ATP + H0YSH5 ⟶ ADP + H0YSH5 - Pre-NOTCH Expression and Processing:
ATP + H0YSH5 ⟶ ADP + H0YSH5 - Pre-NOTCH Transcription and Translation:
ATP + H0YSH5 ⟶ ADP + H0YSH5 - Signaling by WNT:
ATP + AXIN:GSK3:CK1alpha:ub-APC:PP2A:AMER1 complex ⟶ ADP + p-AXIN:GSK3:CK1alpha:ub-APC:PP2A:AMER1 complex - Degradation of beta-catenin by the destruction complex:
ATP + AXIN:GSK3:CK1alpha:ub-APC:PP2A:AMER1 complex ⟶ ADP + p-AXIN:GSK3:CK1alpha:ub-APC:PP2A:AMER1 complex - Beta-catenin phosphorylation cascade:
ATP + CTNNB1:p-AXIN:GSK3:CK1alpha:ub-APC:PP2A:AMER1 complex ⟶ ADP + p-S45 CTNNB1:p-Axin:GSK3:CK1alpha:ub-APC:PP2A:AMER1 complex - TCF dependent signaling in response to WNT:
ATP ⟶ ADP - WNT mediated activation of DVL:
ATP ⟶ ADP - Disassembly of the destruction complex and recruitment of AXIN to the membrane:
ATP + WNT:FZD:LRP5/6:DVL:AXIN:GSK3B ⟶ ADP + WNT:FZD:p5S/T-LRP5/6:DVL:AXIN:GSK3B - Deactivation of the beta-catenin transactivating complex:
ATP + CBY1:CTNNB1 ⟶ ADP + pS20-CBY1:CTNNB1 - Beta-catenin independent WNT signaling:
ATP + CAMK2:CaM ⟶ ADP + p-T286 CAMK2:CaM - Ca2+ pathway:
ATP + CAMK2:CaM ⟶ ADP + p-T286 CAMK2:CaM - Signaling by Hippo:
ATP + STK3:SAV1 ⟶ ADP + p-STK3:p-SAV1 - Signaling by Hedgehog:
PKA tetramer + cAMP ⟶ Homologues of PRKACB + PKA regulatory subunits:cAMP - Hedgehog ligand biogenesis:
CHOL + NglycoAsn-Hh precursors:P4HB ⟶ Hh-C + N-terminal CHOL-Hh fragments + P4HB - Hedgehog 'off' state:
PKA tetramer + cAMP ⟶ Homologues of PRKACB + PKA regulatory subunits:cAMP - GLI3 is processed to GLI3R by the proteasome:
ATP + GLI3:SUFU ⟶ ADP + p6S-GLI3:SUFU - Hedgehog 'on' state:
ATP + GLI1,2,3 ⟶ ADP + p-GLI1,2,3 - p130Cas linkage to MAPK signaling for integrins:
ATP + FADK1 bound p130Cas complex ⟶ ADP + Phosphorylated p130Cas in complex with FADK1 - RAF activation:
ATP + KSR1:MARK3 ⟶ ADP + p-S311,S406 KSR1:MARK3 - Negative regulation of MAPK pathway:
ATP + p-2S MAP2K1:p-2S MAPK2K2 heterodimer ⟶ ADP + p-2S,T MAP2K1:p-2S MAPK2K2 heterodimer - Negative feedback regulation of MAPK pathway:
ATP + p-2S MAP2K1:p-2S MAPK2K2 heterodimer ⟶ ADP + p-2S,T MAP2K1:p-2S MAPK2K2 heterodimer - RAF-independent MAPK1/3 activation:
ATP + MAP2K1 ⟶ ADP + p-2T-MAP2K1 - MAPK3 (ERK1) activation:
ATP + MAP2K1 ⟶ ADP + p-2T-MAP2K1 - MAPK1 (ERK2) activation:
ATP + p-S,T-MAP2K2:MAPK1 ⟶ ADP + p-S,T-MAP2K2:p-T,Y-MAPK1 - AKT phosphorylates targets in the cytosol:
ATP + H1A3I6 ⟶ ADP + phospho-p-S196-CASP9(1-416) - AKT phosphorylates targets in the nucleus:
ATP + H0ZIE4 ⟶ ADP + phospho-p-S133-CREB1 - Negative regulation of the PI3K/AKT network:
ATP + PI(4,5)P2 ⟶ ADP + PI(3,4,5)P3 - PI5P, PP2A and IER3 Regulate PI3K/AKT Signaling:
ATP + PI(4,5)P2 ⟶ ADP + PI(3,4,5)P3 - PTEN Regulation:
ATP + H0ZN53 ⟶ ADP + phospho-p-S109-MKRN1 - Regulation of PTEN stability and activity:
ATP + H0ZN53 ⟶ ADP + phospho-p-S109-MKRN1 - DAG and IP3 signaling:
H2O + cAMP ⟶ AMP - Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + Homologues of KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPases Activate NADPH Oxidases:
TPNH + dioxygen ⟶ H+ + O2.- + TPN - Signaling by Non-Receptor Tyrosine Kinases:
ATP + HBEGF:EGFR:GPNMB ⟶ ADP + HBEGF:EGFR:p-Y525-GPNMB - Signaling by PTK6:
ATP + HBEGF:EGFR:GPNMB ⟶ ADP + HBEGF:EGFR:p-Y525-GPNMB - PTK6 promotes HIF1A stabilization:
ATP + HBEGF:EGFR:GPNMB ⟶ ADP + HBEGF:EGFR:p-Y525-GPNMB - Inhibition of TSC complex formation by PKB:
ATP + H0Z827 ⟶ ADP + phospho-p-S939,S1130,T1462-TSC2 - Signaling by Erythropoietin:
ATP + PI(4,5)P2 ⟶ ADP + PI(3,4,5)P3 - Erythropoietin activates Phosphoinositide-3-kinase (PI3K):
ATP + PI(4,5)P2 ⟶ ADP + PI(3,4,5)P3 - Gamma carboxylation, hypusine formation and arylsulfatase activation:
EIF5A2 + NAD + SPM ⟶ 1,3-diaminopropane + H+ + H0ZKZ7 + NADH - Sialic acid metabolism:
ATP + ManNAc ⟶ ADP + ManNAc-6-P - O-linked glycosylation:
PAPS ⟶ PAP - Deubiquitination:
ATP + H0ZM28 ⟶ ADP + phospho-p-S131-VCPIP1 - Ovarian tumor domain proteases:
ATP + H0ZM28 ⟶ ADP + phospho-p-S131-VCPIP1 - Post-translational protein phosphorylation:
ATP + FAM20C:FAM20C substrates ⟶ ADP + FAM20C:Phosphorylated FAM20C substrates - Regulation of IGF Activity by IGFBP:
ATP + FAM20C:FAM20C substrates ⟶ ADP + FAM20C:Phosphorylated FAM20C substrates - Unfolded Protein Response (UPR):
ATP + IRE1 dimer ⟶ ADP + p-S724-IRE1 dimer - IRE1alpha activates chaperones:
ATP + IRE1 dimer ⟶ ADP + p-S724-IRE1 dimer - PERK regulates gene expression:
ATP + EIF2S1 ⟶ ADP + phospho-p-S52-EIF2S1 - Surfactant metabolism:
ADORA2A,B + Ade-Rib ⟶ ADORA2A,B:Ade-Rib - Muscle contraction:
ATP + Calcium Bound Sarcomere Protein Complex ⟶ ATP:Calcium Bound Sarcomere Protein Complex - Smooth Muscle Contraction:
ATP + Calcium Bound Myosin Actin Complex ⟶ ATP:Calcium Bound Myosin Actin Complex - Regulation of mRNA stability by proteins that bind AU-rich elements:
ATP + BRF1:mRNA Complex ⟶ ADP + Phosphorylated BRF1 (Ser92, Ser203):mRNA Complex - Butyrate Response Factor 1 (BRF1) binds and destabilizes mRNA:
ATP + BRF1:mRNA Complex ⟶ ADP + Phosphorylated BRF1 (Ser92, Ser203):mRNA Complex - HuR (ELAVL1) binds and stabilizes mRNA:
ATP + Homologues of ELAVL1 ⟶ ADP + Homologues of p-S158,S221-ELAVL1 - Nonsense Mediated Decay (NMD) enhanced by the Exon Junction Complex (EJC):
ATP + SMG1:UPF1:EJC:Translated mRNP ⟶ ADP + SMG1:Phosphorylated UPF1:EJC:Translated mRNP - Neurotransmitter receptors and postsynaptic signal transmission:
ATP + Ca2+ ⟶ Ca2+ + PPi + cAMP - Glutamate binding, activation of AMPA receptors and synaptic plasticity:
AP2 complex + ATP + Ca impermeable AMPA receptors + GRIP1/GRIP2 + Homologues of PICK1 ⟶ ADP + AP2 complex + Ca impermeable AMPA receptors + GRIP1/GRIP2 + Homologues of PICK1 + Pi - Trafficking of AMPA receptors:
AP2 complex + ATP + Ca impermeable AMPA receptors + GRIP1/GRIP2 + Homologues of PICK1 ⟶ ADP + AP2 complex + Ca impermeable AMPA receptors + GRIP1/GRIP2 + Homologues of PICK1 + Pi - Trafficking of GluR2-containing AMPA receptors:
AP2 complex + ATP + Ca impermeable AMPA receptors + GRIP1/GRIP2 + Homologues of PICK1 ⟶ ADP + AP2 complex + Ca impermeable AMPA receptors + GRIP1/GRIP2 + Homologues of PICK1 + Pi - Activation of NMDA receptors and postsynaptic events:
ATP + Ca2+ ⟶ Ca2+ + PPi + cAMP - Post NMDA receptor activation events:
ATP + Ca2+ ⟶ Ca2+ + PPi + cAMP - CREB phosphorylation through the activation of Ras:
ATP + H0ZE69 ⟶ ADP + phospho-p-T185,Y187-MAPK1 - RSK activation:
ATP + Ribosomal S6 kinase ⟶ ADP + Phospho(S363,S380,T573)-ribosomal S6 kinase - CREB phosphorylation through the activation of CaMKII:
ATP + H0ZIE4 ⟶ ADP + phospho-p-S133-CREB1 - CREB phosphorylation through the activation of CaMKK:
ATP + H0Z197 ⟶ ADP + phospho-p-CAMKK1 - Activation of CaMK IV:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - Cellular response to heat stress:
ATP + HSF1 trimer ⟶ ADP + p-S326-HSF1 trimer - HSF1-dependent transactivation:
ATP + HSF1 trimer ⟶ ADP + p-S326-HSF1 trimer - Regulation of HSF1-mediated heat shock response:
ATP + Homologues of HSF1 ⟶ ADP + Homologues of p-S307-HSF1 - Cellular Senescence:
ATP + H0YQQ4 ⟶ ADP + phospho-p-T38-ETS1 - Oncogene Induced Senescence:
ATP + H0YQQ4 ⟶ ADP + phospho-p-T38-ETS1 - Oxidative Stress Induced Senescence:
ATP + MKK3, MKK6 ⟶ ADP + p-MKK3,p-MKK6 - DNA Damage/Telomere Stress Induced Senescence:
ATP + DNA DSBs:MRN:Ac-K3016-ATM dimer:KAT5 ⟶ ADP + DNA DSBs:MRN:p-S1981,Ac-K3016-ATM:KAT5 + phospho-p-S1981,Ac-K3016-ATM - Senescence-Associated Secretory Phenotype (SASP):
ATP + Cyclin A:phospho-Cdk(Thr 160):Cdh1:phosho-APC/C complex ⟶ ADP + Cyclin A:phospho-Cdk2(Thr 160):phospho-Cdh1:phospho-APC/C complex - Protein localization:
ATP + PEX2:PEX10:PEX12:Ub:PEX5L:PEX7:PEX13:PEX14:PEX1:PEX6:PEX26:ZFAND6 ⟶ ADP + H0ZKT9 + Homologues of ZFAND6 + PEX13:PEX14:PEX2:PEX10:PEX12 + PEX1:PEX6:PEX26 + Ub:PEX5L - Peroxisomal protein import:
ATP + PEX2:PEX10:PEX12:Ub:PEX5L:PEX7:PEX13:PEX14:PEX1:PEX6:PEX26:ZFAND6 ⟶ ADP + H0ZKT9 + Homologues of ZFAND6 + PEX13:PEX14:PEX2:PEX10:PEX12 + PEX1:PEX6:PEX26 + Ub:PEX5L - Adaptive Immune System:
ATP + Ag-substrate:E3:E2:Ub ⟶ AMP + E3:Ub:substrate + PPi - TCR signaling:
ATP + PLCG1:p-3Y-SLP-76:Gads:LAT ⟶ ADP + phosphorylated PLC-gamma1 bound to SLP-76 - Generation of second messenger molecules:
ATP + PLCG1:p-3Y-SLP-76:Gads:LAT ⟶ ADP + phosphorylated PLC-gamma1 bound to SLP-76 - Downstream TCR signaling:
ATP + PI(4,5)P2 ⟶ ADP + PI(3,4,5)P3 - Costimulation by the CD28 family:
ATP + CD28:B7-1,B7-2 + Lck/Fyn ⟶ ADP + phospho CD28:B7-1/B7-2 - CD28 co-stimulation:
ATP + CD28:B7-1,B7-2 + Lck/Fyn ⟶ ADP + phospho CD28:B7-1/B7-2 - CD28 dependent PI3K/Akt signaling:
ATP + PI(4,5)P2 ⟶ ADP + PI(3,4,5)P3 - CD28 dependent Vav1 pathway:
ATP + VAV1:PIP3:CD28:GRB2 ⟶ ADP + p-Y142,160,174-VAV1:PIP3:CD28:GRB2 - CTLA4 inhibitory signaling:
ATP + PP2A:CTLA4:B7-1/B7-2 + Src family tyrosine kinases (SFKs) ⟶ ADP + PP2A + p-Y165,Y182-CTLA-4 dimer:SFKs - B Cell Activation:
ATP + H0YZ45 + PI(3,4,5)P3 ⟶ ADP + p-Y139-DAPP1:PIP3 - Antigen activates B Cell Receptor (BCR) leading to generation of second messengers:
ATP + H0YZ45 + PI(3,4,5)P3 ⟶ ADP + p-Y139-DAPP1:PIP3 - Downstream signaling events of B Cell Receptor (BCR):
ATP + CARMA1 oligomer ⟶ ADP + p-CARMA1 Oligomer - Activation of NF-kappaB in B cells:
ATP + CARMA1 oligomer ⟶ ADP + p-CARMA1 Oligomer - Rap1 signalling:
Homologues of RAPGEF4 + cAMP ⟶ Rap1 cAMP-GEFs:cAMP - Toll-like Receptor Cascades:
TLR4:TLR6 + oxLDL:CD36 ⟶ TLR4:TLR6:CD36:oxLDL - Toll Like Receptor 10 (TLR10) Cascade:
ATP + p38 MAPK:MAPKAPK2,3 ⟶ ADP + p-p38 MAPK: MAPKAPK2,3 - MyD88 cascade initiated on plasma membrane:
ATP + p38 MAPK:MAPKAPK2,3 ⟶ ADP + p-p38 MAPK: MAPKAPK2,3 - IRAK2 mediated activation of TAK1 complex:
ATP + p-IRAK2:K63-linked pUb oligo-TRAF6:free K63 pUb:TAK1 complex ⟶ ADP + p-IRAK2:K63-linked pUb oligo-TRAF6:free K63-linked pUb:p-TAK1complex - MAP kinase activation:
ATP + p38 MAPK:MAPKAPK2,3 ⟶ ADP + p-p38 MAPK: MAPKAPK2,3 - JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1:
ATP ⟶ ADP - activated TAK1 mediates p38 MAPK activation:
ATP + p38 MAPK:MAPKAPK2,3 ⟶ ADP + p-p38 MAPK: MAPKAPK2,3 - MAP3K8 (TPL2)-dependent MAPK1/3 activation:
ATP + NFKB1:MAP3K8:TNIP2 ⟶ ADP + NFKB1:p-T290-MAP3K8:TNIP2 - MAPK targets/ Nuclear events mediated by MAP kinases:
ATP + JUN ⟶ ADP + phospho-p-S63,S73-JUN - Activation of the AP-1 family of transcription factors:
ATP + JUN ⟶ ADP + phospho-p-S63,S73-JUN - Toll Like Receptor 3 (TLR3) Cascade:
ATP + p38 MAPK:MAPKAPK2,3 ⟶ ADP + p-p38 MAPK: MAPKAPK2,3 - Toll Like Receptor 5 (TLR5) Cascade:
ATP + p38 MAPK:MAPKAPK2,3 ⟶ ADP + p-p38 MAPK: MAPKAPK2,3 - Toll Like Receptor 7/8 (TLR7/8) Cascade:
ATP + p38 MAPK:MAPKAPK2,3 ⟶ ADP + p-p38 MAPK: MAPKAPK2,3 - MyD88 dependent cascade initiated on endosome:
ATP + p38 MAPK:MAPKAPK2,3 ⟶ ADP + p-p38 MAPK: MAPKAPK2,3 - TRAF6 mediated induction of NFkB and MAP kinases upon TLR7/8 or 9 activation:
ATP + p38 MAPK:MAPKAPK2,3 ⟶ ADP + p-p38 MAPK: MAPKAPK2,3 - IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation:
ATP + p-IRAK2:K63-linked pUb oligo-TRAF6:free K63 pUb:TAK1 complex ⟶ ADP + p-IRAK2:K63-linked pUb oligo-TRAF6:free K63-linked pUb:p-TAK1complex - TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling:
ATP + IRF7:TRAF6:p-3S,3T-IRAK1:p-S,2T-IRAK4:oligo-MyD88:activated TLR7/8 or 9 ⟶ ADP + TRAF6:p-3S,3T-IRAK1:p-S,2T-IRAK4:oligo-MyD88:activated TLR7/8 or 9 + phospho-p-S477,S479-IRF7 - Toll Like Receptor 9 (TLR9) Cascade:
ATP + p38 MAPK:MAPKAPK2,3 ⟶ ADP + p-p38 MAPK: MAPKAPK2,3 - Toll Like Receptor 4 (TLR4) Cascade:
ATP + p38 MAPK:MAPKAPK2,3 ⟶ ADP + p-p38 MAPK: MAPKAPK2,3 - MyD88:MAL(TIRAP) cascade initiated on plasma membrane:
ATP + p38 MAPK:MAPKAPK2,3 ⟶ ADP + p-p38 MAPK: MAPKAPK2,3 - MyD88-independent TLR4 cascade:
ATP + p38 MAPK:MAPKAPK2,3 ⟶ ADP + p-p38 MAPK: MAPKAPK2,3 - TRIF(TICAM1)-mediated TLR4 signaling:
ATP + p38 MAPK:MAPKAPK2,3 ⟶ ADP + p-p38 MAPK: MAPKAPK2,3 - Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon:
ATP + IKK related kinases TBK1/IKK epsilon + K63pUb-TANK:K63pUb-TRAF3:TICAM1:TRAM:TLR4:LY96:LPS:CD14 ⟶ ADP + activated TLR4:TRIF:K63polyUb-TRAF3:K63polyUb-TANK:p-TBK1/p-IKKi - TRAF6-mediated induction of TAK1 complex within TLR4 complex:
ATP + activated TLR4:TICAM1:K63pUb-TRAF6:free K63pUb:TAK1complex ⟶ ADP + activated TLR4:TICAM1:K63pUb-TRAF6:free K63pUb:activated TAK1 complex - Toll Like Receptor 2 (TLR2) Cascade:
ATP + p38 MAPK:MAPKAPK2,3 ⟶ ADP + p-p38 MAPK: MAPKAPK2,3 - Toll Like Receptor TLR1:TLR2 Cascade:
ATP + p38 MAPK:MAPKAPK2,3 ⟶ ADP + p-p38 MAPK: MAPKAPK2,3 - Toll Like Receptor TLR6:TLR2 Cascade:
ATP + p38 MAPK:MAPKAPK2,3 ⟶ ADP + p-p38 MAPK: MAPKAPK2,3 - Nucleotide-binding domain, leucine rich repeat containing receptor (NLR) signaling pathways:
ATP + MAP2K6 ⟶ ADP + phospho-p-S207,T211-MAP2K6 - NOD1/2 Signaling Pathway:
ATP + MAP2K6 ⟶ ADP + phospho-p-S207,T211-MAP2K6 - Cytosolic sensors of pathogen-associated DNA:
ATP + STING:TBK1:STAT6 ⟶ ADP + STING:p-S172-TBK1:STAT6 - STING mediated induction of host immune responses:
ATP + STING:TBK1:STAT6 ⟶ ADP + STING:p-S172-TBK1:STAT6 - STAT6-mediated induction of chemokines:
ATP + STING:TBK1:STAT6 ⟶ ADP + STING:p-S172-TBK1:STAT6 - FCGR activation:
ATP + clustered IgG-Ag:FCGRs ⟶ ADP + clustered IgG-Ag:p-FCGRs - Role of phospholipids in phagocytosis:
ATP + Homologues of PRKCD ⟶ ADP + Homologues of p-T507,S645,S664-PRKCD(1-676) - DAP12 interactions:
ATP + DAP12 receptors:p-DAP12:SYK ⟶ ADP + DAP12 Receptors:p-DAP12:p-6Y-SYK - DAP12 signaling:
ATP + DAP12 receptors:p-DAP12:SYK ⟶ ADP + DAP12 Receptors:p-DAP12:p-6Y-SYK - FCERI mediated Ca+2 mobilization:
ATP + p-5Y-LAT:p-SHC1:GRB2:SOS1:GADS:p-Y113,Y128,Y145-SLP-76:PLCG1:VAV:p-TEC kinases:PIP3 ⟶ ADP + p-5Y-LAT:p-SHC1:GRB2:SOS1:GADS:p-Y113,Y128,Y145-SLP-76:PLCG1:VAV:p-2Y-TEC kinases - FCERI mediated NF-kB activation:
ATP + DAG:p-5Y-PKC-theta:CBM oligomer:TRAF6 oligomer + UBE2N:UBE2V1 ⟶ AMP + DAG:p-5Y-PKC-theta:CBM oligomer:oligo-K63-poly Ub-TRAF6 + PPi + UBE2N:UBE2V1 - Role of LAT2/NTAL/LAB on calcium mobilization:
ATP + PI(4,5)P2 ⟶ ADP + PI(3,4,5)P3 - CLEC7A (Dectin-1) signaling:
ATP + UBE2N:UBE2V1 + p-T231-CARD9:BCL10:MALT1:TRAF6 oligomers ⟶ AMP + PPi + UBE2N:UBE2V1 + p-T231-CARD9:BCL10:MALT1:K63polyUb-TRAF6 oligomers - Dectin-1 mediated noncanonical NF-kB signaling:
ATP + H0YV52 + IKKA dimer ⟶ ADP + Active NIK:p-S176,180-IKKA dimer - Cytokine Signaling in Immune system:
H2O ⟶ AMP + ATP + H+ - Interferon Signaling:
H2O ⟶ AMP + ATP + H+ - Interferon gamma signaling:
ATP + IFNG:IFNGR1:JAK1:IFNGR2:JAK2 ⟶ ADP + IFNG:IFNGR1:JAK1:IFNGR2:p-JAK2 - Signaling by Interleukins:
ATP + p38 MAPK:MAPKAPK2,3 ⟶ ADP + p-p38 MAPK: MAPKAPK2,3 - Interleukin-1 family signaling:
ATP + NFKB1:MAP3K8:TNIP2 ⟶ ADP + NFKB1:p-T290-MAP3K8:TNIP2 - Interleukin-1 signaling:
ATP + NFKB1:MAP3K8:TNIP2 ⟶ ADP + NFKB1:p-T290-MAP3K8:TNIP2 - Interleukin-37 signaling:
ATP + H0Z7Z2 ⟶ ADP + phospho-H0Z7Z2 - Interleukin-38 signaling:
ATP + Homologues of MAPK8 ⟶ ADP + Homologues of p-T,Y-MAPK8 - Interleukin-2 family signaling:
ATP + IL9:IL9R:JAK1:IL2RG:JAK3 ⟶ ADP + IL9:IL9R:JAK1:IL2RG:p-Y904,939-JAK3 - Interleukin-9 signaling:
ATP + IL9:IL9R:JAK1:IL2RG:JAK3 ⟶ ADP + IL9:IL9R:JAK1:IL2RG:p-Y904,939-JAK3 - Interleukin-15 signaling:
ATP + IL15RA:IL15:IL2RB:JAK1:IL2RG:JAK3 ⟶ ADP + IL15:IL15RA:IL2RB:p-Y-JAK1:IL2RG:p-JAK3 - Interleukin-21 signaling:
ATP + IL21:IL21R:JAK1:IL2RG:JAK3 ⟶ ADP + IL21:IL21R:p-Y-JAK1:IL2RG:p-Y-JAK3 - Interleukin receptor SHC signaling:
ATP ⟶ ADP - Interleukin-3, Interleukin-5 and GM-CSF signaling:
ATP ⟶ ADP - Interleukin-4 and Interleukin-13 signaling:
ATP + IL4:IL4R:JAK2:IL2RG:JAK3:JAK1 ⟶ ADP + IL4:p-Y-IL4R:JAK2:p-Y-IL2RG:JAK3:p-Y-JAK1 - Interleukin-6 family signaling:
ATP + IL6 receptor hexamer:JAKs ⟶ ADP + IL6 receptor hexamer:Activated JAKs - Interleukin-6 signaling:
ATP + IL6 receptor hexamer:JAKs ⟶ ADP + IL6 receptor hexamer:Activated JAKs - Interleukin-7 signaling:
ATP + IL7:IL7R:JAK1:IL2RG:JAK3 ⟶ ADP + IL7:IL7R:JAK1:IL2RG:p-JAK3 - Interleukin-10 signaling:
ATP + IL10 dimer:2xIL10RA:JAK1:2xIL10RB:TYK2 ⟶ ADP + IL10 dimer:2xIL10RA:p-Y-JAK1:2xIL10RB:p-Y-TYK2 - Interleukin-12 family signaling:
ATP + IL-35:(IL6ST:JAK1:JAK2) dimer ⟶ ADP + IL35:(IL6ST:p-JAK1:p-JAK2:p-TYK2) dimer - Interleukin-35 Signalling:
ATP + IL-35:(IL6ST:JAK1:JAK2) dimer ⟶ ADP + IL35:(IL6ST:p-JAK1:p-JAK2:p-TYK2) dimer - Interleukin-17 signaling:
ATP + p38 MAPK:MAPKAPK2,3 ⟶ ADP + p-p38 MAPK: MAPKAPK2,3 - Interleukin-20 family signaling:
ATP + IL19:IL20RA:JAK1:IL20RB ⟶ ADP + IL19:IL20RA:p-JAK1:IL20RB - Growth hormone receptor signaling:
ATP + Activated cytokine-like hormone receptors ⟶ ADP + Activated cytokine-like hormone receptors, p-Y1007-JAK2 - Prolactin receptor signaling:
ATP + Activated cytokine-like hormone receptors ⟶ ADP + Activated cytokine-like hormone receptors, p-Y1007-JAK2 - TNFR2 non-canonical NF-kB pathway:
ATP + H0YV52 + IKKA dimer ⟶ ADP + Active NIK:p-S176,180-IKKA dimer - NIK-->noncanonical NF-kB signaling:
ATP + H0YV52 + IKKA dimer ⟶ ADP + Active NIK:p-S176,180-IKKA dimer - Cell Cycle Checkpoints:
ATP + phospho-p-S166,S188-MDM2 ⟶ ADP + phospho-p-5S,T-MDM2 - G1/S DNA Damage Checkpoints:
ATP + phospho-p-S166,S188-MDM2 ⟶ ADP + phospho-p-5S,T-MDM2 - p53-Dependent G1/S DNA damage checkpoint:
ATP + phospho-p-S166,S188-MDM2 ⟶ ADP + phospho-p-5S,T-MDM2 - p53-Dependent G1 DNA Damage Response:
ATP + phospho-p-S166,S188-MDM2 ⟶ ADP + phospho-p-5S,T-MDM2 - Stabilization of p53:
ATP + phospho-p-S166,S188-MDM2 ⟶ ADP + phospho-p-5S,T-MDM2 - Autodegradation of the E3 ubiquitin ligase COP1:
ATP + H1A481 ⟶ ADP + phospho-p-S387-RFWD2 - p53-Independent G1/S DNA damage checkpoint:
ATP + CDC25A ⟶ ADP + phospho-p-S123-CDC25A - p53-Independent DNA Damage Response:
ATP + CDC25A ⟶ ADP + phospho-p-S123-CDC25A - Ubiquitin Mediated Degradation of Phosphorylated Cdc25A:
ATP + CDC25A ⟶ ADP + phospho-p-S123-CDC25A - G2/M Checkpoints:
ATP + CDC25A ⟶ ADP + phospho-p-S123-CDC25A - G2/M DNA damage checkpoint:
ATP + H0YRA3 ⟶ ADP + phospho-p-S317,S345-CHEK1 - Activation of ATR in response to replication stress:
ATP + CDC25A ⟶ ADP + phospho-p-S123-CDC25A - Mitotic G1-G1/S phases:
ATP + p21,p27 ⟶ ADP + p-T-CDKN1A/B - G1/S Transition:
ATP + p21,p27 ⟶ ADP + p-T-CDKN1A/B - Cyclin E associated events during G1/S transition:
ATP + p21,p27 ⟶ ADP + p-T-CDKN1A/B - Activation of the pre-replicative complex:
ATP + MCM2-7 ⟶ ADP + p-MCM2-7 - S Phase:
ATP + p21,p27 ⟶ ADP + p-T-CDKN1A/B - Cyclin A:Cdk2-associated events at S phase entry:
ATP + p21,p27 ⟶ ADP + p-T-CDKN1A/B - Synthesis of DNA:
ATP + PCNA homotrimer + RFC Heteropentamer:RNA primer-DNA primer:origin duplex ⟶ ADP + RFC Heteropentamer:RNA primer-DNA primer:origin duplex:PCNA homotrimer - DNA strand elongation:
ATP + PCNA homotrimer + RFC Heteropentamer:RNA primer-DNA primer:origin duplex ⟶ ADP + RFC Heteropentamer:RNA primer-DNA primer:origin duplex:PCNA homotrimer - Leading Strand Synthesis:
ATP + PCNA homotrimer + RFC Heteropentamer:RNA primer-DNA primer:origin duplex ⟶ ADP + RFC Heteropentamer:RNA primer-DNA primer:origin duplex:PCNA homotrimer - Polymerase switching:
ATP + PCNA homotrimer + RFC Heteropentamer:RNA primer-DNA primer:origin duplex ⟶ ADP + RFC Heteropentamer:RNA primer-DNA primer:origin duplex:PCNA homotrimer - Lagging Strand Synthesis:
ATP + PCNA homotrimer + RFC Heteropentamer:RNA primer-DNA primer:origin duplex ⟶ ADP + RFC Heteropentamer:RNA primer-DNA primer:origin duplex:PCNA homotrimer - Cyclin A/B1/B2 associated events during G2/M transition:
ATP + CCNA:p-T14-CDK1 ⟶ ADP + CCNA:p-T14,T161-CDK1 - Polo-like kinase mediated events:
ATP + H0ZCT5 ⟶ ADP + phospho-p-S53-WEE1 - Centrosome maturation:
ATP + centrosome ⟶ ADP + centrosome containing phosphorylated Nlp - Loss of proteins required for interphase microtubule organization from the centrosome:
ATP + centrosome ⟶ ADP + centrosome containing phosphorylated Nlp - Loss of Nlp from mitotic centrosomes:
ATP + centrosome ⟶ ADP + centrosome containing phosphorylated Nlp - The role of GTSE1 in G2/M progression after G2 checkpoint:
ATP + GTSE1:p-T210-PLK1 ⟶ ADP + Homologues of p-S435-GTSE1 + phospho-p-T210-PLK1 - AURKA Activation by TPX2:
ATP + Centrosome:AURKA:TPX2:HMMR ⟶ ADP + Centrosome:p-T288-AURKA:TPX2:HMMR - Condensation of Prophase Chromosomes:
ATP + p-T210-PLK1:Phosphorylated Condensin II:Nucleosome ⟶ ADP + Hyperphosphorylated Condensin II:Nucleosome - MASTL Facilitates Mitotic Progression:
ATP + H0Z8C9 ⟶ ADP + phospho-p-S62-ARPP19 - Nuclear Envelope Breakdown:
ATP + p-T333-NEK9 ⟶ ADP + p-3S,T-NEK9 - Activation of NIMA Kinases NEK9, NEK6, NEK7:
ATP + p-T333-NEK9 ⟶ ADP + p-3S,T-NEK9 - Nuclear Pore Complex (NPC) Disassembly:
ATP + Nuclear Pore Complex (NPC) ⟶ ADP + Nuclear Pore Complex (p-2S,3T-NUP98) - Mitotic Prometaphase:
ATP + Sister Chromosomal Arms:Ac-Cohesin:PDS5:CDCA5:WAPAL ⟶ ADP + Sister Chromosomal Arms:Ac-Cohesin:PDS5:p-CDCA5:WAPAL - Resolution of Sister Chromatid Cohesion:
ATP + Sister Chromosomal Arms:Ac-Cohesin:PDS5:CDCA5:WAPAL ⟶ ADP + Sister Chromosomal Arms:Ac-Cohesin:PDS5:p-CDCA5:WAPAL - Mitotic Metaphase and Anaphase:
ATP + H0ZLQ5 ⟶ ADP + phospho-p-FBXO5 - Mitotic Metaphase/Anaphase Transition:
ATP + H0ZLQ5 ⟶ ADP + phospho-p-FBXO5 - cell division:
ATP + Homologues of KIF23 ⟶ ADP + Homologues of p-S904,S905-KIF23 - Regulation of mitotic cell cycle:
ATP + Cyclin A:phospho-Cdk(Thr 160):Cdh1:phosho-APC/C complex ⟶ ADP + Cyclin A:phospho-Cdk2(Thr 160):phospho-Cdh1:phospho-APC/C complex - APC/C-mediated degradation of cell cycle proteins:
ATP + Cyclin A:phospho-Cdk(Thr 160):Cdh1:phosho-APC/C complex ⟶ ADP + Cyclin A:phospho-Cdk2(Thr 160):phospho-Cdh1:phospho-APC/C complex - Regulation of APC/C activators between G1/S and early anaphase:
ATP + Cyclin A:phospho-Cdk(Thr 160):Cdh1:phosho-APC/C complex ⟶ ADP + Cyclin A:phospho-Cdk2(Thr 160):phospho-Cdh1:phospho-APC/C complex - Phosphorylation of Emi1:
ATP + Emi1:Cdc20/Cdh1 complex ⟶ ADP + phospho-Emi1(Ser 145, Ser 149):Cdc20/Cdh1 complexes - Chromosome Maintenance:
ATP + PCNA homotrimer + RFC Heteropentamer:RNA primer-DNA primer:G-strand extended telomere end ⟶ ADP + RFC Heteropentamer:RNA primer-DNA primer:G-strand extended telomere end duplex:PCNA homotrimer - Telomere Maintenance:
ATP + PCNA homotrimer + RFC Heteropentamer:RNA primer-DNA primer:G-strand extended telomere end ⟶ ADP + RFC Heteropentamer:RNA primer-DNA primer:G-strand extended telomere end duplex:PCNA homotrimer - Extension of Telomeres:
ATP + PCNA homotrimer + RFC Heteropentamer:RNA primer-DNA primer:G-strand extended telomere end ⟶ ADP + RFC Heteropentamer:RNA primer-DNA primer:G-strand extended telomere end duplex:PCNA homotrimer - Telomere C-strand (Lagging Strand) Synthesis:
ATP + PCNA homotrimer + RFC Heteropentamer:RNA primer-DNA primer:G-strand extended telomere end ⟶ ADP + RFC Heteropentamer:RNA primer-DNA primer:G-strand extended telomere end duplex:PCNA homotrimer - Polymerase switching on the C-strand of the telomere:
ATP + PCNA homotrimer + RFC Heteropentamer:RNA primer-DNA primer:G-strand extended telomere end ⟶ ADP + RFC Heteropentamer:RNA primer-DNA primer:G-strand extended telomere end duplex:PCNA homotrimer - GPVI-mediated activation cascade:
ATP + Homologues of LCP2 ⟶ ADP + Homologues of p-Y113,128,145-LCP2 - Response to elevated platelet cytosolic Ca2+:
ATP + Homologues of STXBP3 ⟶ ADP + Homologues of p-STXBP3 - Disinhibition of SNARE formation:
ATP + Homologues of STXBP3 ⟶ ADP + Homologues of p-STXBP3 - Cell surface interactions at the vascular wall:
ATP + PECAM1 dimer ⟶ ADP + p-Y663,Y686-PECAM1 dimer - PECAM1 interactions:
ATP + PECAM1 dimer ⟶ ADP + p-Y663,Y686-PECAM1 dimer - Gene expression (Transcription):
p-AMPK heterotrimer:AMP ⟶ SESN1,2,3:p-AMPK heterotrimer:AMP - RNA Polymerase II Transcription:
p-AMPK heterotrimer:AMP ⟶ SESN1,2,3:p-AMPK heterotrimer:AMP - Generic Transcription Pathway:
p-AMPK heterotrimer:AMP ⟶ SESN1,2,3:p-AMPK heterotrimer:AMP - Transcriptional Regulation by TP53:
p-AMPK heterotrimer:AMP ⟶ SESN1,2,3:p-AMPK heterotrimer:AMP - TP53 Regulates Metabolic Genes:
p-AMPK heterotrimer:AMP ⟶ SESN1,2,3:p-AMPK heterotrimer:AMP - TP53 Regulates Transcription of Cell Death Genes:
1,2-Naphthoquinone + H+ + TPNH ⟶ TPN + semiquinone - TP53 Regulates Transcription of Genes Involved in Cytochrome C Release:
ATP + Homologues of ZNF420 ⟶ ADP + Homologues of p-S68-ZNF420 - TP53 Regulates Transcription of Caspase Activators and Caspases:
ATP + H0ZHR4 ⟶ ADP + phospho-p-T788-PIDD1 - TP53 Regulates Transcription of Cell Cycle Genes:
ATP + Homologues of CENPJ ⟶ ADP + Homologues of p-S589,S595-CENPJ - TP53 regulates transcription of additional cell cycle genes whose exact role in the p53 pathway remain uncertain:
ATP + Homologues of CENPJ ⟶ ADP + Homologues of p-S589,S595-CENPJ - TP53 Regulates Transcription of DNA Repair Genes:
ATP + CCNK:CDK12:Elongation Complex at DNA Repair Genes ⟶ ADP + CCNK:CDK12:CDK12-Phosphorylated Elongation Complex at DNA repair genes - Regulation of TP53 Activity:
ATP + H0Z911 ⟶ ADP + phospho-p-S166,S188-MDM2 - Regulation of TP53 Expression and Degradation:
ATP + H0Z911 ⟶ ADP + phospho-p-S166,S188-MDM2 - Regulation of TP53 Degradation:
ATP + H0Z911 ⟶ ADP + phospho-p-S166,S188-MDM2 - Regulation of TP53 Activity through Phosphorylation:
ATP + H0Z8J7 ⟶ ADP + phospho-p-T106,S442-DYRK2 - Regulation of TP53 Activity through Association with Co-factors:
ATP + H0YY04 ⟶ ADP + phospho-p-S291-PHF20 - Regulation of TP53 Activity through Acetylation:
ATP + KAT6A:ING5:MEAF6:BRPF1,(2,3) ⟶ ADP + p-T369-KAT6A:ING5:MEAF6:BRPF1,(2,3) - PI5P Regulates TP53 Acetylation:
ATP + PI5P ⟶ ADP + PI(4,5)P2 - Transcriptional regulation by RUNX1:
ATP + Homologues of YAP1 ⟶ ADP + Homologues of p-Y407-YAP1 - RUNX1 regulates transcription of genes involved in differentiation of HSCs:
ATP + Homologues of YAP1 ⟶ ADP + Homologues of p-Y407-YAP1 - RUNX1 interacts with co-factors whose precise effect on RUNX1 targets is not known:
ATP + RUNX1:CBFB ⟶ ADP + p-S249,S273,T276-RUNX1:CBFB - Transcriptional regulation by RUNX3:
ATP + MyrG-p-Y419-SRC:RUNX3 ⟶ ADP + phospho-MyrG-p-Y419-SRC + phospho-p-Y-RUNX3 - Regulation of RUNX3 expression and activity:
ATP + MyrG-p-Y419-SRC:RUNX3 ⟶ ADP + phospho-MyrG-p-Y419-SRC + phospho-p-Y-RUNX3 - Transcriptional Regulation by E2F6:
ATP + E2F6 ⟶ ADP + phospho-p-S12-E2F6 - RNA Polymerase II Transcription Initiation And Promoter Clearance:
ATP + pol II transcription complex containing 3 Nucleotide long transcript ⟶ AMP + PPi + pol II transcription complex containing 3 Nucleotide long transcript - RNA Pol II CTD phosphorylation and interaction with CE:
ATP + Pol II transcription complex containing extruded transcript to +30 ⟶ ADP + Pol II transcription complex with (ser5) phosphorylated CTD containing extruded transcript to +30 - RNA polymerase II transcribes snRNA genes:
ATP + RNA polymerase II (unphosphorylated):Initiation factors at promoter of snRNA gene ⟶ ADP + RNA polymerase II (phosphoserine-5,7):Initiation factors:CDK7:snRNA gene - Mitophagy:
ATP + phospho-p-S13-FUNDC1 ⟶ ADP + phospho-p-S13,Y18-FUNDC1 - Receptor Mediated Mitophagy:
ATP + phospho-p-S13-FUNDC1 ⟶ ADP + phospho-p-S13,Y18-FUNDC1 - DNA Damage Bypass:
ATP + NPLOC4:UFD1L:VCP:SPRTN:POLH:MonoUb:K164-PCNA:RPA:RFC:(TT-CPD:AA-polydNMP)-DNA Template ⟶ ADP + NPLOC4:UFD1L:VPC:SPRTN:MonoUb:K164-PCNA:RPA:RFC:(TT-CPD:AA-polydNMP)-Template DNA + POLH - Translesion synthesis by Y family DNA polymerases bypasses lesions on DNA template:
ATP + NPLOC4:UFD1L:VCP:SPRTN:POLH:MonoUb:K164-PCNA:RPA:RFC:(TT-CPD:AA-polydNMP)-DNA Template ⟶ ADP + NPLOC4:UFD1L:VPC:SPRTN:MonoUb:K164-PCNA:RPA:RFC:(TT-CPD:AA-polydNMP)-Template DNA + POLH - Translesion Synthesis by POLH:
ATP + NPLOC4:UFD1L:VCP:SPRTN:POLH:MonoUb:K164-PCNA:RPA:RFC:(TT-CPD:AA-polydNMP)-DNA Template ⟶ ADP + NPLOC4:UFD1L:VPC:SPRTN:MonoUb:K164-PCNA:RPA:RFC:(TT-CPD:AA-polydNMP)-Template DNA + POLH - Sensing of DNA Double Strand Breaks:
ATP + DNA DSBs:MRN:Ac-K3016-ATM dimer:KAT5 ⟶ ADP + DNA DSBs:MRN:p-S1981,Ac-K3016-ATM:KAT5 + phospho-p-S1981,Ac-K3016-ATM - Homology Directed Repair:
ATP + DNA DSBs:p-MRN:p-S327,T847-RBBP8:p-S1981,Ac-K3016-ATM:KAT5 ⟶ ADP + DNA DSBs:p-MRN:p-S327,T847,T859-RBBP8:p-S1981,Ac-K3016-ATM:KAT5 - HDR through Homologous Recombination (HRR) or Single Strand Annealing (SSA):
ATP + DNA DSBs:p-MRN:p-S327,T847-RBBP8:p-S1981,Ac-K3016-ATM:KAT5 ⟶ ADP + DNA DSBs:p-MRN:p-S327,T847,T859-RBBP8:p-S1981,Ac-K3016-ATM:KAT5 - Processing of DNA double-strand break ends:
ATP + DNA DSBs:p-MRN:p-S327,T847-RBBP8:p-S1981,Ac-K3016-ATM:KAT5 ⟶ ADP + DNA DSBs:p-MRN:p-S327,T847,T859-RBBP8:p-S1981,Ac-K3016-ATM:KAT5 - HDR through Homologous Recombination (HRR):
ATP + H0ZAJ0 ⟶ ADP + phospho-p-T309-RAD51 - Homologous DNA Pairing and Strand Exchange:
ATP + H0ZAJ0 ⟶ ADP + phospho-p-T309-RAD51 - Presynaptic phase of homologous DNA pairing and strand exchange:
ATP + H0ZAJ0 ⟶ ADP + phospho-p-T309-RAD51 - HDR through Single Strand Annealing (SSA):
ATP + RAD52 heptamer ⟶ ADP + p-Y104-RAD52 heptamer - Nonhomologous End-Joining (NHEJ):
ATP + DNA DNA DSBs:p-MRN:p-S1981,Ac-K3016-ATM:KAT5:K63PolyUb-K14,K16,p-S139-H2AFX,Me2K21-HIST1H4A-Nucleosome:p-5T-MDC1:p-S102-WHSC1:RNF8:Zn2+:SUMO1:p-T4827-HERC2:UBE2N:UBE2V2:RNF168:PIAS4:p-S25,S1778-TP53BP1:RIF1:PAX1IP:DCLRE1C ⟶ ADP + DNA DNA DSBs:p-MRN:p-S1981,Ac-K3016-ATM:KAT5:K63PolyUb-K14,K16,p-S139-H2AFX,Me2K21-HIST1H4A-Nucleosome:p-5T-MDC1:p-S102-WHSC1:RNF8:Zn2+:SUMO1:p-T4827-HERC2:UBE2N:UBE2V2:RNF168:PIAS4:p-S25,S1778-TP53BP1:RIF1:PAXIP1 + Homologues of p-S645-DCLRE1C - Nucleotide Excision Repair:
ATP + Ub:XPC:RAD23:CETN2:Distorted dsDNA:PAR-UV-DDB:TFIIH Core:XPA:PAR-PARP1,PAR-PARP2:CHD1L ⟶ ADP + Pi + Ub:XPC:RAD23:CETN2:Open bubble-dsDNA:PAR-UV-DDB:TFIIH Core:XPA:PAR-PARP1,PAR-PARP2:CHD1L - Global Genome Nucleotide Excision Repair (GG-NER):
ATP + Ub:XPC:RAD23:CETN2:Distorted dsDNA:PAR-UV-DDB:TFIIH Core:XPA:PAR-PARP1,PAR-PARP2:CHD1L ⟶ ADP + Pi + Ub:XPC:RAD23:CETN2:Open bubble-dsDNA:PAR-UV-DDB:TFIIH Core:XPA:PAR-PARP1,PAR-PARP2:CHD1L - Formation of Incision Complex in GG-NER:
ATP + Ub:XPC:RAD23:CETN2:Distorted dsDNA:PAR-UV-DDB:TFIIH Core:XPA:PAR-PARP1,PAR-PARP2:CHD1L ⟶ ADP + Pi + Ub:XPC:RAD23:CETN2:Open bubble-dsDNA:PAR-UV-DDB:TFIIH Core:XPA:PAR-PARP1,PAR-PARP2:CHD1L - Transcription-Coupled Nucleotide Excision Repair (TC-NER):
ATP + TC-NER pre-incision complex ⟶ ADP + Pi + TC-NER pre-incision complex:Open bubble damaged DNA template:trimmed nascent mRNA - Dual incision in TC-NER:
ATP + TC-NER pre-incision complex ⟶ ADP + Pi + TC-NER pre-incision complex:Open bubble damaged DNA template:trimmed nascent mRNA - Fanconi Anemia Pathway:
ATP + FANCD2:FANCI:UBE2T:FA Core Complex:ICL-DNA:RPA:ATR:ATRIP ⟶ ADP + ATR:ATRIP + p-FANCD2:p-FANCI:UBE2T:p-FA Core Complex:ICL-DNA + p-RPA heterotrimer - Glycogen metabolism:
ATP + PGYL dimer b form ⟶ ADP + PGYL dimer a form - Glycogen breakdown (glycogenolysis):
ATP + PGYL dimer b form ⟶ ADP + PGYL dimer a form - Formation of xylulose-5-phosphate:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Linoleic acid (LA) metabolism:
ATP + CoA-SH + LA ⟶ AMP + LA-CoA + PPi - Glycerophospholipid biosynthesis:
H2O + PETA ⟶ CH3CHO + Pi + ammonia - Synthesis of PE:
H2O + PETA ⟶ CH3CHO + Pi + ammonia - Synthesis of PC:
Ac-CoA + Cho ⟶ AcCho + CoA-SH - Synthesis of PIPs at the ER membrane:
ATP + PI ⟶ ADP + PI4P - Synthesis of PIPs at the plasma membrane:
ATP + PI4P ⟶ ADP + PI(4,5)P2 - Synthesis of PIPs at the early endosome membrane:
ATP + PI ⟶ ADP + PI3P - Synthesis of PIPs at the late endosome membrane:
ATP + PI ⟶ ADP + PI3P - Synthesis of PIPs in the nucleus:
ATP + PI5P ⟶ ADP + PI(4,5)P2 - Glycosphingolipid metabolism:
H2O + dehydroepiandrosterone sulfate ⟶ DHEA + SO4(2-) - Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Recycling of bile acids and salts:
ATP + CoA-SH + cholate; chenodeoxycholate ⟶ AMP + H2O + PPi + choloyl-CoA; chenodeoxycholoyl-CoA - Purine salvage:
Ade + PRPP ⟶ AMP + PPi - Cobalamin (Cbl, vitamin B12) transport and metabolism:
Cbl + H+ + Homologues of MMACHC + TPNH ⟶ MMACHC:cob(II)alamin + TPN - trans-Golgi Network Vesicle Budding:
ATP + Cargo:AP-1:Beta-arrestin:Clathrin Triskelion:Vamp Complex + HSC70:Auxillin Complex ⟶ ADP + AP-1 Complex + Clathrin Triskelion + Golgi-associated Vesicle Cargo + H0ZTM5 + HSC70:Auxillin Complex + Pi - Clathrin derived vesicle budding:
ATP + Cargo:AP-1:Beta-arrestin:Clathrin Triskelion:Vamp Complex + HSC70:Auxillin Complex ⟶ ADP + AP-1 Complex + Clathrin Triskelion + Golgi-associated Vesicle Cargo + H0ZTM5 + HSC70:Auxillin Complex + Pi - Golgi Associated Vesicle Biogenesis:
ATP + Cargo:AP-1:Beta-arrestin:Clathrin Triskelion:Vamp Complex + HSC70:Auxillin Complex ⟶ ADP + AP-1 Complex + Clathrin Triskelion + Golgi-associated Vesicle Cargo + H0ZTM5 + HSC70:Auxillin Complex + Pi - Lysosome Vesicle Biogenesis:
ATP + HSC70:Auxillin Complex + Lysosome Cargo:AP-1:Beta-arrestin:Clathrin Triskelion:Vamp Complex ⟶ ADP + AP-1 Complex + Clathrin Triskelion + H0ZTM5 + HSC70:Auxillin Complex + Lysosome Cargo + Pi - Gap junction trafficking and regulation:
ATP + Cx43:ZO-1:c-src gap junction ⟶ ADP + phospho-Y265 Cx43:ZO-1 gap junction - Regulation of gap junction activity:
ATP + Cx43:ZO-1:c-src gap junction ⟶ ADP + phospho-Y265 Cx43:ZO-1 gap junction - c-src mediated regulation of Cx43 function and closure of gap junctions:
ATP + Cx43:ZO-1:c-src gap junction ⟶ ADP + phospho-Y265 Cx43:ZO-1 gap junction - Cargo recognition for clathrin-mediated endocytosis:
ATP + AVPR2:AVP(20-28) ⟶ ADP + p-AVPR2:AVP(20-28) - Endosomal Sorting Complex Required For Transport (ESCRT):
ATP + ESCRT-III/Cargo Complex ⟶ ADP + CHMP2 + CHMP4 + H0YXU4 + H0ZKP1 + H1A3V3 + Pi + Ubiquinated and PIP3 Endosmal Membrane Bound Cargo - Rab regulation of trafficking:
ATP + Homologues of DENND3 ⟶ ADP + Homologues of p-S472,S490-DENND3 - RAB GEFs exchange GTP for GDP on RABs:
ATP + Homologues of DENND3 ⟶ ADP + Homologues of p-S472,S490-DENND3 - Sema4D in semaphorin signaling:
ATP + Plexin-B1:Met + SEMA4D dimer ⟶ ADP + SEMA4D:MET:p-Y-PLXNB1 - Sema4D mediated inhibition of cell attachment and migration:
ATP + Plexin-B1:Met + SEMA4D dimer ⟶ ADP + SEMA4D:MET:p-Y-PLXNB1 - Sema4D induced cell migration and growth-cone collapse:
ATP + Plexin-B1:ErbB2 + SEMA4D dimer ⟶ ADP + SEMA4D:ERBB2:p-Y-PLXNB1 - CRMPs in Sema3A signaling:
ATP + CRMP's tetramers + Sema3A:NRP-1:pPlexin-A:Fyn:Fes ⟶ ADP + Sema3A:NP-1:Plexin-A:Fes:CRMP - NCAM signaling for neurite out-growth:
ATP + H0YPU3 ⟶ NCAM-1:ATP - DCC mediated attractive signaling:
ATP + NTN1:DCC oligomer:p-Y397-PTK2:MyrG-p-Y419-SRC,MyrG-p-Y420-FYN ⟶ ADP + NTN1:p-Y1420-DCC oligomer:p-Y397-PTK2:MyrG-p-Y419-SRC,MyrG-p-Y420-FYN - Signaling by ROBO receptors:
ATP + SLIT2:ROBO1:ABL ⟶ ADP + SLIT2:p-Y1073-ROBO1:ABL - Role of ABL in ROBO-SLIT signaling:
ATP + SLIT2:ROBO1:ABL ⟶ ADP + SLIT2:p-Y1073-ROBO1:ABL - Recycling pathway of L1:
ATP + L1:AP-2 Clathrin complex + phospho-p-T185,Y187-MAPK1 ⟶ ADP + pL1 (S1204, 1248):ERK2:clathrin-dynamin complex - EPH-ephrin mediated repulsion of cells:
ATP + EFNAs/EFNBs:p-EPHAs/p-EPHBs:SFKs:VAV2,VAV3 ⟶ ADP + EFNAs/EFNBs:p-EPHAs/p-EPHBs:SFKs:p-VAV2,VAV3 - RET signaling:
2x RET:GFRA:GDNF complexes + ATP ⟶ 2x p-5Y-RET:GDNF:GFRA complexes + ADP - Reelin signalling pathway:
ATP + RELN:VLDLR:DAB1:SH3KBP1 ⟶ ADP + RELN:VLDLR:p-Y198,220,232-DAB1:SH3KBP1 - Myogenesis:
ATP + MEF2 proteins + phospho-p38 alpha/beta/gamma MAPK ⟶ ADP + phospho p38:phospho MEF2 - CDO in myogenesis:
ATP + MEF2 proteins + phospho-p38 alpha/beta/gamma MAPK ⟶ ADP + phospho p38:phospho MEF2 - Regulation of beta-cell development:
ATP + H0ZP39 ⟶ ADP + phospho-p-T24,S256,S319-FOXO1 - Regulation of gene expression in beta cells:
ATP + H0ZP39 ⟶ ADP + phospho-p-T24,S256,S319-FOXO1 - AKT-mediated inactivation of FOXO1A:
ATP + H0ZP39 ⟶ ADP + phospho-p-T24,S256,S319-FOXO1 - Programmed Cell Death:
ATP + Apaf-1:Cytochrome C + H1A3I6 ⟶ Cytochrome C:Apaf-1:ATP:Procaspase-9 - Apoptosis:
ATP + Apaf-1:Cytochrome C + H1A3I6 ⟶ Cytochrome C:Apaf-1:ATP:Procaspase-9 - Intrinsic Pathway for Apoptosis:
ATP + Apaf-1:Cytochrome C + H1A3I6 ⟶ Cytochrome C:Apaf-1:ATP:Procaspase-9 - Activation of BH3-only proteins:
ATP + BMF sequestered to dynein (DLC2) ⟶ ADP + Dynein (DLC2) on microtubules + phospho-p-BMF(1-89) - Activation of BMF and translocation to mitochondria:
ATP + BMF sequestered to dynein (DLC2) ⟶ ADP + Dynein (DLC2) on microtubules + phospho-p-BMF(1-89) - Apoptotic factor-mediated response:
ATP + Apaf-1:Cytochrome C + H1A3I6 ⟶ Cytochrome C:Apaf-1:ATP:Procaspase-9 - Cytochrome c-mediated apoptotic response:
ATP + Apaf-1:Cytochrome C + H1A3I6 ⟶ Cytochrome C:Apaf-1:ATP:Procaspase-9 - Activation of caspases through apoptosome-mediated cleavage:
ATP + CASP3(1-277) dimer ⟶ ADP + Caspase-3 - DNA Replication:
ATP + MCM2-7 ⟶ ADP + p-MCM2-7 - DNA Replication Pre-Initiation:
ATP + MCM2-7 ⟶ ADP + p-MCM2-7 - Clathrin derived vesicle budding:
ATP + Cargo:AP-1:Beta-arrestin:Clathrin Triskelion:Vamp Complex + HSC70:Auxillin Complex ⟶ ADP + AP-1 Complex + Clathrin Triskelion + F6SKR5 + HSC70:Auxillin Complex + Pi + Vamp - c-src mediated regulation of Cx43 function and closure of gap junctions:
ATP + Cx43:ZO-1:c-src gap junction ⟶ ADP + phospho-Y265 Cx43:ZO-1 gap junction - CREB phosphorylation through the activation of CaMKK:
ATP + F6TJ34 ⟶ ADP + phospho-p-CAMKK1 - Activation of CaMK IV:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin - CDO in myogenesis:
ATP + phospho-p38 alpha/beta/gamma MAPK ⟶ ADP + phospho p38:phospho MEF2 - Clearance of Nuclear Envelope Membranes from Chromatin:
ATP + EMD/TMPO/LEMD3/LEMD2:Lamin filaments:BANF1:Chromatin ⟶ ADP + EMD/TMPO/LEMD3/LEMD2:Lamin filaments + p-T2,T3,S4-BANF1 - XBP1(S) activates chaperone genes:
ATP + H2O ⟶ ADP + PPi - Trafficking and processing of endosomal TLR:
ATP + Apo-GP96 dimer + Homologues of CNPY3 ⟶ ATP-bound Gp96 dimer:CNPY3:TLR7/8/9 - Striated Muscle Contraction:
ATP + Calcium Bound Sarcomere Protein Complex ⟶ ATP:Calcium Bound Sarcomere Protein Complex - Trafficking and processing of endosomal TLR:
ATP + Apo-GP96 dimer + H0Z482 + H0ZD35 ⟶ ATP-bound Gp96 dimer:CNPY3:TLR7/8/9 - Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins.:
ETF:FAD + FADH2 ⟶ ETF:FADH2 + FAD - Formation of ATP by chemiosmotic coupling:
ATPase:ATP + H+ ⟶ ATP + F1Fo ATP synthase + H+ - Formation of apoptosome:
ATP + Apaf-1:Cytochrome C + H1A3I6 ⟶ Cytochrome C:Apaf-1:ATP:Procaspase-9
BioCyc(655)
- TCA cycle, aerobic respiration:
H2O + cis-aconitate ⟶ isocitrate - gluconeogenesis:
NAD+ + malate ⟶ CO2 + NADH + pyruvate - aspartate biosynthesis:
α-ketoglutarate + L-aspartate ⟶ L-glutamate + oxaloacetate - glycolysis:
3-phosphoglycerate + ATP ⟶ 1,3-diphosphateglycerate + ADP - purine and pyrimidine metabolism:
AMP + diphosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + adenine - purine and pyrimidine metabolism:
adenosine + phosphate ⟶ α-D-ribose-1-phosphate + adenine - oxidative ethanol degradation:
H2O + NAD+ + acetaldehyde ⟶ NADH + acetate - formaldehyde assimilation I (serine pathway):
L-malyl-CoA ⟶ acetyl-CoA + glyoxylate - uridine-5'-phosphate biosynthesis:
H+ + orotidine-5'-phosphate ⟶ CO2 + UMP - pyrimidine ribonucleotides de novo biosynthesis:
H+ + orotidine-5'-phosphate ⟶ CO2 + UMP - urea cycle:
ATP + L-citrulline + asp ⟶ AMP + H+ + L-arginino-succinate + diphosphate - arginine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - superpathway of histidine, purine, and pyrimidine biosynthesis:
glt + imidazole acetol-phosphate ⟶ 2-oxoglutarate + L-histidinol-phosphate - superpathway of arginine and polyamine biosynthesis:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - pyrimidine ribonucleotides de novo biosynthesis:
H+ + orotidine-5'-phosphate ⟶ CO2 + UMP - uridine-5'-phosphate biosynthesis:
H+ + orotidine-5'-phosphate ⟶ CO2 + UMP - salvage pathways of adenine, hypoxanthine, and their nucleosides:
adenosine + phosphate ⟶ α-D-ribose-1-phosphate + adenine - salvage pathways of adenine, hypoxanthine, and their nucleosides:
adenosine + phosphate ⟶ α-D-ribose-1-phosphate + adenine - peptidoglycan and lipid A precursor biosynthesis:
ATP + UDP-N-acetylmuramate + ala ⟶ ADP + H+ + UDP-N-acetylmuramyl-L-Ala + phosphate - peptidoglycan biosynthesis I (meso-diaminopimelate containing):
ATP + UDP-N-acetylmuramate + ala ⟶ ADP + H+ + UDP-N-acetylmuramyl-L-Ala + phosphate - UDP-N-acetylmuramoyl-pentapeptide biosynthesis III (meso-DAP-containing):
ATP + UDP-N-acetylmuramate + ala ⟶ ADP + H+ + UDP-N-acetylmuramyl-L-Ala + phosphate - pyrimidine deoxyribonucleotides de novo biosynthesis I:
H2O + dCTP ⟶ ammonia + dUTP - pyrimidine deoxyribonucleotides de novo biosynthesis I:
H2O + dCTP ⟶ ammonia + dUTP - superpathway of central carbon metabolism:
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate - glycolysis I:
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate - gluconeogenesis I:
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate - superpathway of glycolysis, pyruvate dehydrogenase and TCA cycle:
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate - formaldehyde assimilation III (dihydroxyacetone cycle):
ATP + dihydroxy-acetone ⟶ ADP + H+ + dihydroxyacetone phosphate - Bifidobacterium shunt:
ATP + acetate ⟶ ADP + H+ + acetylphosphate - sucrose degradation to ethanol and lactate (anaerobic):
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - superpathway of glycolysis and Entner-Doudoroff:
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate - glycolysis II:
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate - glycolysis III:
β-D-glucose + ATP ⟶ β-D-glucose-6-phosphate + ADP + H+ - glycolysis I:
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate - superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate - heterolactic fermentation:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - gluconeogenesis I:
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate - pyrimidine nucleotide metabolism (phosphotransfer and nucleotide modification):
ATP + H2O + UTP + gln ⟶ ADP + CTP + H+ + glt + phosphate - pyrimidine ribonucleotides interconversion:
ATP + H2O + UTP + gln ⟶ ADP + CTP + H+ + glt + phosphate - purine and pyrimidine metabolism:
adenosine + phosphate ⟶ α-D-ribose-1-phosphate + adenine - pyrimidine ribonucleotides interconversion:
ATP + H2O + UTP + gln ⟶ ADP + CTP + H+ + glt + phosphate - superpathway of histidine, purine and pyrimidine biosynthesis:
ATP + D-ribose 5-phosphate ⟶ 5-phosphoribosyl 1-pyrophosphate + AMP - pyrimidine ribonucleotides de novo biosynthesis:
O2 + dihydroorotate ⟶ H2O2 + orotate - formaldehyde assimilation III (dihydroxyacetone cycle):
3-phospho-D-glycerate + ATP ⟶ 1,3-diphosphateglycerate + ADP + H+ - purine deoxyribonucleosides salvage:
2'-deoxyadenosine + ATP ⟶ ADP + H+ + dAMP - salvage pathways of pyrimidine deoxyribonucleotides:
H2O + deoxycytidine ⟶ ammonia + deoxyuridine - salvage pathways of pyrimidine deoxyribonucleotides:
ATP + deoxyuridine ⟶ ADP + H+ + dUMP - salvage pathways of pyrimidine deoxyribonucleotides:
H2O + deoxycytidine ⟶ ammonia + deoxyuridine - sphingolipid metabolism:
NADP+ + a sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH - sphingolipid metabolism:
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine + CO2 + coenzyme A - sphingolipid metabolism:
L-serine + palmitoyl CoA ⟶ 3-dehydrosphinganine + CO2 + coenzyme A - GDP-mannose metabolism:
ATP + D-mannose ⟶ ADP + D-mannose 6-phosphate + H+ - purine nucleotide metabolism (phosphotransfer and nucleotide modification):
AMP + ATP ⟶ ADP + H+ - purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine nucleotides de novo biosynthesis:
ATP + ammonia + xanthosine-5-phosphate ⟶ AMP + GMP + H+ + diphosphate - salvage pathways of guanine, xanthine, and their nucleosides:
H2O + guanine ⟶ ammonia + xanthine - salvage pathways of purine nucleosides I:
adenosine + phosphate ⟶ α-D-ribose-1-phosphate + adenine - methylmalonyl pathway:
ATP + bicarbonate + propanoyl-CoA ⟶ (S)-methylmalonyl-CoA + ADP + H+ + phosphate - galactitol degradation:
ATP + tagatose-6-phosphate ⟶ ADP + H+ + tagatose-1,6-bisphosphate - lactose and galactose degradation I:
H2O + lactose 6-phosphate ⟶ β-D-glucose + D-galactose 6-phosphate - N-acetylglucosamine degradation II:
D-glucosamine 6-phosphate + H2O ⟶ D-fructose-6-phosphate + H+ + ammonia - N-acetylglucosamine degradation II:
D-glucosamine 6-phosphate + H2O ⟶ D-fructose-6-phosphate + H+ + ammonia - chitin derivatives degradation:
D-glucosamine 6-phosphate + H2O ⟶ D-fructose-6-phosphate + H+ + ammonia - N-acetylglucosamine degradation II:
D-glucosamine 6-phosphate + H2O ⟶ D-fructose-6-phosphate + H+ + ammonia - isoleucine biosynthesis I:
thr ⟶ 2-oxobutanoate + H+ + ammonia - methionine biosynthesis II:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate - threonine biosynthesis:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - threonine biosynthesis from homoserine:
ATP + L-homoserine ⟶ ADP + H+ + O-phospho-L-homoserine - pantothenate and coenzyme A biosynthesis:
α-ketoglutarate + L-valine ⟶ 2-keto-isovalerate + L-glutamate - superpathway of glyoxylate bypass and TCA:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - TCA cycle:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - reductive TCA cycle I:
2-oxoglutarate + an oxidized ferredoxin [iron-sulfur] cluster + coenzyme A ⟶ CO2 + a reduced ferredoxin [iron-sulfur] cluster + succinyl-CoA - TCA cycle variation III (eukaryotic):
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - TCA cycle variation III (eukaryotic):
citrate ⟶ cis-aconitate + H2O - superpathway of ribose and deoxyribose phosphate degradation:
H2O + deoxycytidine ⟶ ammonia + deoxyuridine - ribose degradation:
ATP + D-ribose ⟶ ADP + D-ribose-5-phosphate + H+ - ribose degradation:
ATP + D-ribose ⟶ ADP + D-ribose 5-phosphate + H+ - superpathway of ribose and deoxyribose phosphate degradation:
deoxyuridine + phosphate ⟶ deoxyribose 1-phosphate + uracil - ribose degradation:
ATP + D-ribose ⟶ ADP + D-ribose 5-phosphate + H+ - glycolysis I (from glucose 6-phosphate):
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate - Rubisco shunt:
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate - glycolysis IV (plant cytosol):
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate - glycolysis II (from fructose 6-phosphate):
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate - glutathione biosynthesis:
ATP + L-γ-glutamylcysteine + gly ⟶ ADP + H+ + glutathione + phosphate - γ-glutamyl cycle:
a 5-L-glutamyl-L-amino acid + cysteinylglycine ⟶ a standard α amino acid + glutathione - purine nucleotides de novo biosynthesis II:
adenylo-succinate ⟶ AMP + fumarate - glutathione biosynthesis:
ATP + L-γ-glutamylcysteine + gly ⟶ ADP + H+ + glutathione + phosphate - 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosyl-amine + ATP + gly ⟶ 5-phospho-ribosyl-glycineamide + ADP + H+ + phosphate - 5-aminoimidazole ribonucleotide biosynthesis II:
5-phospho-β-D-ribosyl-amine + ATP + gly ⟶ 5-phospho-ribosyl-glycineamide + ADP + H+ + phosphate - sorbitol degradation:
ATP + D-fructose-6-phosphate ⟶ ADP + H+ + fructose-1,6-bisphosphate - homoserine biosynthesis:
ATP + L-aspartate ⟶ ADP + L-aspartyl-4-phosphate - purine nucleotides de novo biosynthesis:
ATP + XMP + ammonia ⟶ AMP + GMP + pyrophosphate - sphingolipid biosynthesis (plants):
H+ + O2 + a dihydroceramide + a ferrocytochrome b5 ⟶ H2O + a ferricytochrome b5 + a phytoceramide - superpathway of pyrimidine deoxyribonucleoside salvage:
ATP + thymidine ⟶ ADP + H+ + dTMP - pyrimidine deoxyribonucleosides salvage:
ATP + thymidine ⟶ ADP + H+ + dTMP - salvage pathways of pyrimidine deoxyribonucleotides:
ATP + deoxyuridine ⟶ ADP + H+ + dUMP - salvage pathways of pyrimidine deoxyribonucleotides:
H2O + deoxycytidine ⟶ ammonia + deoxyuridine - purine and pyrimidine metabolism:
adenosine + phosphate ⟶ α-D-ribose-1-phosphate + adenine - purine and pyrimidine metabolism:
AMP + diphosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + adenine - formylTHF biosynthesis I:
H+ + NAD+ + gly + tetrahydrofolate ⟶ 5,10-methylenetetrahydrofolate + CO2 + NADH + ammonia - formylTHF biosynthesis II:
H+ + NAD+ + gly + tetrahydrofolate ⟶ 5,10-methylenetetrahydrofolate + CO2 + NADH + ammonia - tetrahydrofolate biosynthesis:
7,8-dihydropteroate + ATP + glt ⟶ 7,8-dihydrofolate + ADP + H+ + phosphate - formylTHF biosynthesis I:
H+ + NAD+ + gly + tetrahydrofolate ⟶ 5,10-methylenetetrahydrofolate + CO2 + NADH + ammonia - tetrahydrofolate biosynthesis II:
ATP + glt + tetrahydrofolate ⟶ ADP + H+ + phosphate + tetrahydrofolate-L-glutamate - GDP-L-fucose biosynthesis II (from L-fucose):
ATP + L-fucopyranose ⟶ β-L-fucose 1-phosphate + ADP + H+ - GDP-L-fucose biosynthesis II (from L-fucose):
ATP + L-fucose ⟶ β-L-fucose 1-phosphate + ADP - GDP-L-fucose biosynthesis II (from L-fucose):
ATP + L-fucose ⟶ β-L-fucose 1-phosphate + ADP - GDP-L-fucose biosynthesis II (from L-fucose):
ATP + L-fucose ⟶ β-L-fucose 1-phosphate + ADP + H+ - threonine biosynthesis from homoserine:
H2O + O-phospho-L-homoserine ⟶ phosphate + thr - methionine biosynthesis:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate - aspartate superpathway:
ATP + ammonia + nicotinate adenine dinucleotide ⟶ AMP + H+ + NAD+ + diphosphate - superpathway of lysine, threonine and methionine biosynthesis II:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate - isoleucine biosynthesis I:
thr ⟶ 2-oxobutanoate + H+ + ammonia - superpathway of lysine, threonine and methionine biosynthesis I:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate - threonine biosynthesis:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - methionine biosynthesis II:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate - threonine biosynthesis from homoserine:
H2O + O-phospho-L-homoserine ⟶ phosphate + thr - aspartate superpathway:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate - threonine biosynthesis from homoserine:
ATP + L-homoserine ⟶ ADP + H+ + O-phospho-L-homoserine - superpathway of lysine, threonine and methionine biosynthesis I:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate - threonine biosynthesis:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - glutathionylspermidine biosynthesis:
ATP + glutathione + spermidine ⟶ ADP + H+ + glutathionylspermidine + phosphate - trypanothione biosynthesis:
ATP + glutathione + glutathionylspermidine ⟶ ADP + H+ + phosphate + trypanothione - trypanothione biosynthesis:
ATP + glutathione + glutathionylspermidine ⟶ ADP + H+ + phosphate + trypanothione - glutathione biosynthesis:
ATP + L-γ-glutamylcysteine + glycine ⟶ ADP + glutathione + phosphate - gamma-glutamyl cycle:
Cys-Gly + an α-(γ-L-glutamyl)-L-amino acid ⟶ an amino acid + glutathione - trehalose degradation II (trehalase):
H2O + trehalose ⟶ β-D-glucose - pyridoxal 5'-phosphate salvage I:
ATP + pyridoxal ⟶ ADP + H+ + PLP - pyridoxal 5'-phosphate salvage II (plants):
ATP + pyridoxal ⟶ ADP + H+ + PLP - ornithine biosynthesis:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - arginine biosynthesis:
ATP + L-aspartate + citrulline ⟶ AMP + L-arginino-succinate + pyrophosphate - pyridine nucleotide cycling (plants):
ATP + H2O + gln + nicotinate adenine dinucleotide ⟶ AMP + H+ + NAD+ + diphosphate + glt - NAD salvage pathway:
ATP + H2O + L-glutamine + deamido-NAD ⟶ AMP + L-glutamate + NAD+ + pyrophosphate - L-arginine biosynthesis II (acetyl cycle):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + Glu + H+ + carbamoyl phosphate + phosphate - UMP biosynthesis I:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + Glu + H+ + carbamoyl phosphate + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + Glu + H+ + carbamoyl phosphate + phosphate - urea cycle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + Glu + H+ + carbamoyl phosphate + phosphate - L-arginine biosynthesis I (via L-ornithine):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + Glu + H+ + carbamoyl phosphate + phosphate - L-leucine degradation I:
3-methylcrotonyl-CoA + ATP + hydrogencarbonate ⟶ 3-methylglutaconyl-CoA + ADP + H+ + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + Glu + H+ + carbamoyl phosphate + phosphate - gluconeogenesis III:
ATP + hydrogencarbonate + pyruvate ⟶ ADP + H+ + oxaloacetate + phosphate - fatty acid biosynthesis -- elongase pathway:
an acyl-CoA + malonyl-CoA ⟶ CO2 + a 3-oxoacyl-CoA + coenzyme A - superpathway of sterol biosynthesis:
4-methyl-2-oxopentanoate + NAD+ + coenzyme A ⟶ CO2 + NADH + isovaleryl-CoA - leucine degradation I:
4-methyl-2-oxopentanoate + NAD+ + coenzyme A ⟶ CO2 + NADH + isovaleryl-CoA - leucine degradation I:
2-oxoglutarate + leu ⟶ 4-methyl-2-oxopentanoate + glt - inosine-5'-phosphate biosynthesis I:
5'-phosphoribosyl-4-(N-succinocarboxamide)-5-aminoimidazole ⟶ aminoimidazole carboxamide ribonucleotide + fumarate - uridine-5'-phosphate biosynthesis:
H+ + orotidine-5'-phosphate ⟶ CO2 + UMP - pyrimidine ribonucleotides de novo biosynthesis:
H+ + orotidine-5'-phosphate ⟶ CO2 + UMP - superpathway of arginine and polyamine biosynthesis:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - arginine biosynthesis III:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - arginine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - inosine-5'-phosphate biosynthesis I:
5'-phosphoribosyl-4-(N-succinocarboxamide)-5-aminoimidazole ⟶ aminoimidazole carboxamide ribonucleotide + fumarate - superpathway of methionine degradation:
S-adenosyl-L-homocysteine + H2O ⟶ L-homocysteine + adenosine - methylmalonyl pathway:
ATP + bicarbonate + propanoyl-CoA ⟶ (S)-methylmalonyl-CoA + ADP + H+ + phosphate - isoleucine degradation:
2-oxoglutarate + ile ⟶ 2-keto-3-methyl-valerate + glt - Leucine Catabolism:
2-oxoglutarate + leu ⟶ 4-methyl-2-oxopentanoate + glt - aspartate biosynthesis:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - leucine degradation I:
4-methyl-2-oxopentanoate + NAD+ + coenzyme A ⟶ CO2 + NADH + isovaleryl-CoA - uridine-5'-phosphate biosynthesis:
ATP + H2O + bicarbonate + gln ⟶ ADP + H+ + carbamoyl-phosphate + glt + phosphate - pyrimidine ribonucleotides de novo biosynthesis:
ATP + CDP ⟶ ADP + CTP - valine degradation:
2-oxoisovalerate + an [apo BCAA dehydrogenase E2 protein] N6-lipoyl-L-lysine ⟶ CO2 + an [apo BCAA dehydrogenase E2 protein] N6-S-[2-methylpropanoyl]dihydrolipoyl-L-lysine - leucine degradation I:
2-oxoglutarate + leu ⟶ 4-methyl-2-oxopentanoate + glt - uridine-5'-phosphate biosynthesis:
ATP + H2O + bicarbonate + gln ⟶ ADP + H+ + carbamoyl-phosphate + glt + phosphate - pyrimidine ribonucleotides de novo biosynthesis:
ATP + UDP ⟶ ADP + H+ + UTP - arginine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - itaconate biosynthesis:
citrate ⟶ cis-aconitate + H2O - arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - uridine-5'-phosphate biosynthesis:
ATP + H2O + bicarbonate + gln ⟶ ADP + H+ + carbamoyl-phosphate + glt + phosphate - pyrimidine ribonucleotides de novo biosynthesis:
ATP + H2O + bicarbonate + gln ⟶ ADP + H+ + carbamoyl-phosphate + glt + phosphate - leucine degradation I:
2-oxoglutarate + leu ⟶ 4-methyl-2-oxopentanoate + glt - arginine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - uridine-5'-phosphate biosynthesis:
ATP + H2O + bicarbonate + gln ⟶ ADP + H+ + carbamoyl-phosphate + glt + phosphate - pyrimidine ribonucleotides de novo biosynthesis:
ATP + CMP ⟶ ADP + CDP - methylmalonyl pathway:
ATP + bicarbonate + propanoyl-CoA ⟶ (S)-methylmalonyl-CoA + ADP + H+ + phosphate - arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - itaconate biosynthesis:
citrate ⟶ cis-aconitate + H2O - 3-hydroxypropionate/4-hydroxybutyrate cycle:
ATP + bicarbonate + propanoyl-CoA ⟶ (S)-methylmalonyl-CoA + ADP + H+ + phosphate - sitosterol degradation to androstenedione:
NAD+ + sitosterol ⟶ 3-oxo-24-ethyl-cholest-5-ene + H+ + NADH - arginine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - pyrimidine ribonucleotides de novo biosynthesis:
ATP + CMP ⟶ ADP + CDP - ethylbenzene degradation (anaerobic):
ATP + H2O + acetophenone + bicarbonate ⟶ 3-oxo-3-phenylpropanoate + ADP + H+ + phosphate - incomplete reductive TCA cycle:
2-oxoglutarate + an oxidized ferredoxin [iron-sulfur] cluster + coenzyme A ⟶ CO2 + a reduced ferredoxin [iron-sulfur] cluster + succinyl-CoA - uridine-5'-phosphate biosynthesis:
ATP + H2O + bicarbonate + gln ⟶ ADP + H+ + carbamoyl-phosphate + glt + phosphate - methylmalonyl pathway:
ATP + bicarbonate + propanoyl-CoA ⟶ (S)-methylmalonyl-CoA + ADP + H+ + phosphate - leucine degradation I:
4-methyl-2-oxopentanoate + NAD+ + coenzyme A ⟶ CO2 + NADH + isovaleryl-CoA - 3-hydroxypropionate cycle:
ATP + bicarbonate + propanoyl-CoA ⟶ (S)-methylmalonyl-CoA + ADP + H+ + phosphate - flavin biosynthesis I (bacteria and plants):
2,5-diamino-6-(5-phospho-D-ribosylamino)pyrimidin-4(3H)-one + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - superpathway of ornithine degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ γ-glutamyl-γ-aminobutyraldehyde + ammonium + hydrogen peroxide - putrescine degradation II:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ γ-glutamyl-γ-aminobutyraldehyde + ammonium + hydrogen peroxide - superpathway of arginine and ornithine degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ γ-glutamyl-γ-aminobutyraldehyde + ammonium + hydrogen peroxide - superpathway of arginine, putrescine, and 4-aminobutyrate degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ γ-glutamyl-γ-aminobutyraldehyde + ammonium + hydrogen peroxide - xylitol degradation:
ATP + D-xylulose ⟶ ADP + D-xylulose-5-phosphate + H+ - D-arabitol degradation:
ATP + D-xylulose ⟶ ADP + D-xylulose-5-phosphate + H+ - xylose degradation I:
ATP + D-xylulose ⟶ ADP + D-xylulose-5-phosphate + H+ - xylitol degradation:
ATP + xylulose ⟶ ADP + D-xylulose-5-phosphate - homoserine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH - lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ H2O + H+ + glt + tetrahydrodipicolinate - lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt - homoserine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH - D-gluconate degradation:
ATP + D-gluconate ⟶ 6-phospho-D-gluconate + ADP + H+ - L-idonate degradation:
ATP + D-gluconate ⟶ 6-phospho-D-gluconate + ADP + H+ - sucrose biosynthesis II:
D-glucopyranose 6-phosphate ⟶ F6P - sucrose degradation III (sucrose invertase):
D-glucopyranose 6-phosphate ⟶ F6P - glucose and glucose-1-phosphate degradation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - trehalose degradation II (trehalase):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - GDP-glucose biosynthesis:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - superpathway of sucrose and starch metabolism I (non-photosynthetic tissue):
D-glucopyranose 6-phosphate ⟶ F6P - trehalose degradation V:
α-D-glucose ⟶ β-D-glucose - pseudouridine degradation:
D-ribofuranose 5-phosphate + uracil ⟶ H2O + pseudouridine 5'-phosphate - pseudouridine degradation:
ATP + pseudouridine ⟶ ADP + H+ + pseudouridine 5'-phosphate - GDP-arabinose biosynthesis:
D-glucose ⟶ D-arabinose - superpathway of pyrimidine ribonucleosides salvage:
UMP + diphosphate ⟶ PRPP + uracil - pyrimidine ribonucleosides salvage I:
H+ + H2O + cytidine ⟶ ammonium + uridine - threonine degradation I:
2-oxobutanoate + coenzyme A ⟶ formate + propanoyl-CoA - superpathway of threonine metabolism:
2-oxobutanoate + coenzyme A ⟶ formate + propanoyl-CoA - folate polyglutamylation I:
H+ + ser + tetrahydrofolate ⟶ 5,10-methylene-THF + H2O + gly - folate metabolism:
H+ + ser + tetrahydrofolate ⟶ 5,10-methylene-THF + H2O + gly - tetrahydrofolate biosynthesis I:
6-hydroxymethyl-7,8-dihydropterin + ATP ⟶ 6-hydroxymethyl-dihydropterin diphosphate + AMP + H+ - formylTHF biosynthesis II:
H+ + NAD+ + gly + tetrahydrofolate ⟶ 5,10-methylenetetrahydrofolate + CO2 + NADH + ammonia - formylTHF biosynthesis I:
H+ + NAD+ + gly + tetrahydrofolate ⟶ 5,10-methylenetetrahydrofolate + CO2 + NADH + ammonia - folate polyglutamylation I:
H+ + ser + tetrahydrofolate ⟶ 5,10-methylenetetrahydrofolate + H2O + gly - D-galactarate degradation I:
ATP + D-glycerate ⟶ 2-phospho-D-glycerate + ADP + H+ - D-glucarate degradation I:
ATP + D-glycerate ⟶ 2-phospho-D-glycerate + ADP + H+ - superpathway of D-glucarate and D-galactarate degradation:
ATP + D-glycerate ⟶ 2-phospho-D-glycerate + ADP + H+ - thiamine salvage IV (yeast):
4-amino-2-methyl-5-pyrimidinemethanol + ATP ⟶ ADP + H+ + HMP-P - hydroxymethylpyrimidine salvage:
4-amino-2-methyl-5-pyrimidinemethanol + ATP ⟶ ADP + H+ + HMP-P - salvage pathways of purine nucleosides:
H2O + adenine ⟶ ammonia + hypoxanthine - salvage pathways of adenine, hypoxanthine, and their nucleosides:
adenosine + phosphate ⟶ α-D-ribose-1-phosphate + adenine - pyruvate fermentation to butanoate:
an oxidized ferredoxin [iron-sulfur] cluster + coenzyme A + pyruvate ⟶ CO2 + a reduced ferredoxin [iron-sulfur] cluster + acetyl-CoA - glutamate degradation VII (to butanoate):
(2S, 3S)-3-methylaspartate ⟶ ammonia + mesaconate - pyruvate fermentation to butanoate:
ATP + n-butanoate ⟶ ADP + butanoyl phosphate - adenosine nucleotides de novo biosynthesis:
adenylo-succinate ⟶ AMP + fumarate - creatinine degradation II:
N-carbamoylsarcosine + H2O + H+ ⟶ CO2 + ammonia + sarcosine - creatinine degradation II:
N-carbamoylsarcosine + H2O + H+ ⟶ CO2 + ammonia + sarcosine - 1D-myo-inositol hexakisphosphate biosynthesis III (Spirodela polyrrhiza):
D-glucopyranose 6-phosphate ⟶ Ins(3)P - 1D-myo-inositol hexakisphosphate biosynthesis III (Spirodela polyrrhiza):
myo-inositol + ATP ⟶ 1D-myo-inositol (3)-monophosphate + ADP + H+ - 1D-myo-inositol hexakisphosphate biosynthesis III (Spirodela polyrrhiza):
myo-inositol + ATP ⟶ 1D-myo-inositol (3)-monophosphate + ADP + H+ - pyridoxal 5'-phosphate salvage pathway:
H2O + O2 + pyridoxamine 5'-phosphate ⟶ H+ + ammonia + hydrogen peroxide + pyridoxal-P - pyridoxal 5'-phosphate salvage pathway:
H2O + O2 + pyridoxamine 5'-phosphate ⟶ H+ + ammonia + hydrogen peroxide + pyridoxal-P - inosine-5'-phosphate biosynthesis II:
5'-phosphoribosyl-4-(N-succinocarboxamide)-5-aminoimidazole ⟶ aminoimidazole carboxamide ribonucleotide + fumarate - sulfate activation for sulfonation:
ATP + adenosine 5'-phosphosulfate ⟶ ADP + H+ + phosphoadenosine-5'-phosphosulfate - sulfate reduction I (assimilatory):
adenosine 3',5'-bisphosphate + an oxidized thioredoxin + sulfite ⟶ a reduced thioredoxin + phosphoadenosine-5'-phosphosulfate - sulfate assimilation:
SO3-2 + adenosine 3',5'-bisphosphate + an oxidized thioredoxin ⟶ PAPS + a reduced thioredoxin - GDP-mannose biosynthesis:
ATP + D-mannose ⟶ ADP + D-mannose 6-phosphate + H+ - GDP-mannose metabolism:
ATP + D-mannose ⟶ ADP + D-mannose 6-phosphate + H+ - UDP-D-galacturonate biosynthesis II (from D-galacturonate):
ATP + D-galactopyranuronate ⟶ α-D-galacturonate 1-phosphate + ADP + H+ - glycerol degradation I:
ATP + glycerol ⟶ sn-glycerol 3-phosphate + ADP + H+ - glycerol metabolism:
ATP + glycerol ⟶ sn-glycerol-3-phosphate + ADP + H+ - glycerol degradation I:
ATP + glycerol ⟶ sn-glycerol-3-phosphate + ADP + H+ - glycerol degradation I:
ATP + glycerol ⟶ sn-glycerol-3-phosphate + ADP + H+ - glycerol degradation IV:
ATP + glycerol ⟶ sn-glycerol-3-phosphate + ADP + H+ - glycerol degradation IV:
ATP + glycerol ⟶ sn-glycerol-3-phosphate + ADP + H+ - glycerol degradation I:
ATP + glycerol ⟶ sn-glycerol-3-phosphate + ADP + H+ - glycerol degradation IV:
ATP + glycerol ⟶ sn-glycerol-3-phosphate + ADP + H+ - glycerol degradation IV:
ATP + glycerol ⟶ sn-glycerol-3-phosphate + ADP + H+ - glycerol degradation I:
ATP + glycerol ⟶ sn-glycerol-3-phosphate + ADP + H+ - glycerol and glycerophosphodiester degradation:
ATP + glycerol ⟶ sn-glycerol-3-phosphate + ADP + H+ - glycerol degradation I:
ATP + glycerol ⟶ sn-glycerol-3-phosphate + ADP + H+ - lactate oxidation:
ATP + acetate ⟶ ADP + H+ + acetylphosphate - superpathway of acetate utilization and formation:
ATP + acetate ⟶ ADP + H+ + acetylphosphate - acetate formation from acetyl-CoA I:
ATP + acetate ⟶ ADP + H+ + acetylphosphate - salvage pathways of pyrimidine ribonucleotides:
H2O + cytidine ⟶ ammonia + uridine - salvage pathways of pyrimidine ribonucleotides:
H2O + cytidine ⟶ ammonia + uridine - mevalonate pathway I:
ATP + mevalonate-diphosphate ⟶ ADP + CO2 + H+ + isopentenyl diphosphate + phosphate - mevalonate pathway I:
ATP + mevalonate-diphosphate ⟶ ADP + CO2 + H+ + isopentenyl diphosphate + phosphate - mevalonate pathway I:
(R)-mevalonate + NADP+ + coenzyme A ⟶ 3-hydroxy-3-methyl-glutaryl-CoA + NADPH - superpathway of ergosterol biosynthesis:
H+ + NADPH + O2 + lanosterol ⟶ 4,4-dimethyl-5-α-cholesta-8,14,24-trien-3-β-ol + NADP+ + formate - Entner-Doudoroff pathway III (semi-phosphorylative):
α-D-glucose ⟶ β-D-glucose - pyridoxal 5'-phosphate salvage pathway:
H2O + O2 + pyridoxamine 5'-phosphate ⟶ H+ + ammonia + hydrogen peroxide + pyridoxal-P - pyridoxal 5'-phosphate salvage pathway:
H2O + O2 + pyridoxamine 5'-phosphate ⟶ H+ + ammonia + hydrogen peroxide + pyridoxal-P - pyridoxal 5'-phosphate salvage pathway:
H2O + O2 + pyridoxamine 5'-phosphate ⟶ H+ + ammonia + hydrogen peroxide + pyridoxal-P - superpathway of pyridoxal 5'-phosphate biosynthesis and salvage:
H2O + O2 + pyridoxamine 5'-phosphate ⟶ H+ + ammonia + hydrogen peroxide + pyridoxal-P - pyridoxal 5'-phosphate salvage pathway:
H2O + O2 + pyridoxamine 5'-phosphate ⟶ H+ + ammonia + hydrogen peroxide + pyridoxal-P - superpathway of pyridoxal 5'-phosphate biosynthesis and salvage:
H2O + O2 + pyridoxamine 5'-phosphate ⟶ H+ + ammonia + hydrogen peroxide + pyridoxal-P - pyridoxal 5'-phosphate salvage pathway:
H2O + O2 + pyridoxamine 5'-phosphate ⟶ H+ + ammonia + hydrogen peroxide + pyridoxal-P - superpathway of pyridoxal 5'-phosphate biosynthesis and salvage:
H2O + O2 + pyridoxamine 5'-phosphate ⟶ H+ + ammonia + hydrogen peroxide + pyridoxal-P - pyridoxal 5'-phosphate salvage pathway:
H2O + O2 + pyridoxamine 5'-phosphate ⟶ H+ + ammonia + hydrogen peroxide + pyridoxal-P - PRPP biosynthesis II:
α-D-ribose-1-phosphate + ATP ⟶ ADP + H+ + ribose-1,5-bisphosphate - UDP-galactose biosynthesis:
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP + H+ - sucrose degradation III:
β-D-fructofuranose + UDP-D-glucose ⟶ UDP + sucrose - starch degradation:
H2O + a 1,4-α-D-glucan ⟶ α-maltose + a 1,4-α-D-glucan - sucrose degradation III:
β-D-fructofuranose + UDP-D-glucose ⟶ UDP + sucrose - sucrose degradation III:
β-D-fructofuranose + UDP-D-glucose ⟶ UDP + sucrose - sucrose degradation:
H2O + sucrose ⟶ α-D-glucose + β-D-fructofuranose - starch degradation:
α-maltose + H2O ⟶ α-D-glucose - sucrose degradation III:
H2O + sucrose ⟶ α-D-glucose + β-D-fructofuranose - acetyl-CoA degradation to acetate:
ATP + acetate + coenzyme A ⟶ AMP + H+ + acetyl-CoA + diphosphate - TCA cycle:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - glutamine biosynthesis II:
ATP + ammonia + glt ⟶ ADP + H+ + gln + phosphate - TCA cycle:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - superpathway of glyoxylate bypass and TCA:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glt ⟶ ADP + a folylpolyglutamate(n) + phosphate - glutamine biosynthesis II:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + NAD(P)H + ammonia - glycine degradation:
a ferricytochrome b1 + formate ⟶ CO2 + a ferrocytochrome b1 - tetrahydrofolate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - folate transformations II:
L-serine + a tetrahydrofolate ⟶ H2O + a 5,10-methylenetetrahydrofolate + glycine - glutamine biosynthesis:
ATP + L-glutamate + ammonia ⟶ ADP + L-glutamine + phosphate - folate polyglutamylation:
L-serine + a tetrahydrofolate ⟶ H2O + a 5,10-methylenetetrahydrofolate + glycine - allantoin degradation:
H2O + urea-1-carboxylate ⟶ CO2 + ammonia - folate polyglutamylation I:
L-serine + a tetrahydrofolate ⟶ H2O + a 5,10-methylenetetrahydrofolate + glycine - biotin biosynthesis:
7,8-diaminononanoate + ATP + CO2 ⟶ ADP + dethiobiotin + phosphate - folate polyglutamylation II:
ATP + L-glutamate + a folylpolyglutamate(n) ⟶ ADP + a folylpolyglutamate(n+1) + phosphate - urea degradation I:
H2O + H+ + urea-1-carboxylate ⟶ CO2 + ammonia - urea degradation I:
H2O + H+ + urea-1-carboxylate ⟶ CO2 + ammonia - sucrose degradation II (sucrose synthase):
D-glucopyranose 6-phosphate ⟶ F6P - D-sorbitol degradation I:
D-sorbitol + NAD+ ⟶ keto-D-fructose + H+ + NADH - sucrose degradation I:
β-D-fructofuranose + ATP ⟶ ADP + D-fructose-6-phosphate + H+ - heterolactic fermentation:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - sucrose degradation to ethanol and lactate (anaerobic):
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - sucrose degradation V (mammalian):
α-D-glucose ⟶ β-D-glucose - sucrose degradation I:
β-D-fructofuranose + ATP ⟶ ADP + D-fructose-6-phosphate + H+ - sucrose degradation V (mammalian):
α-D-glucose ⟶ β-D-glucose - heterolactic fermentation:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - nicotinamide riboside salvage pathway:
ATP + nicotinamide riboside ⟶ ADP + nicotinamide mononucleotide - superpathway of phospholipid biosynthesis:
an L-1-phosphatidyl-glycerol ⟶ a cardiolipin + glycerol - ester phospholipid biosynthesis:
an L-1-phosphatidyl-glycerol ⟶ a cardiolipin + glycerol - phosphatidylcholine biosynthesis I:
ATP + choline ⟶ ADP + H+ + phosphoryl-choline - L-lysine biosynthesis VI:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate - superpathway of L-isoleucine biosynthesis I:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate - superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
N5-methyl--tetrahydropteroyl tri-L-glutamate + L-homocysteine ⟶ met + tetrahydropteroyl tri-L-glutamate - superpathway of L-threonine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate - L-homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate - homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate - lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt - lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt - homoserine and methionine biosynthesis:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate - homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate - superpathway of S-adenosyl-L-methionine biosynthesis:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate - superpathway of S-adenosyl-L-methionine biosynthesis:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate - homoserine and methionine biosynthesis:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate - superpathway of methionine biosynthesis (transsulfuration):
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate - lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H2O + H+ + glt - homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate - threonine biosynthesis:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - isoleucine biosynthesis I:
thr ⟶ 2-oxobutanoate + H+ + ammonia - ribose degradation:
ATP + D-ribose ⟶ ADP + D-ribose 5-phosphate - formaldehyde assimilation II (RuMP Cycle):
ATP + D-fructose-6-phosphate ⟶ ADP + H+ + fructose-1,6-bisphosphate - sucrose degradation:
α-D-glucose + ATP ⟶ α-D-glucose-6-phosphate + ADP - S-methyl-5'-thioadenosine degradation I:
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle I (bacteria and plants):
dAdoMet + putrescine ⟶ S-methyl-5'-thioadenosine + H+ + spermidine - adenosylcobalamin biosynthesis II (late cobalt incorporation):
(R)-1-amino-2-propanol O-2-phosphate + ATP + adenosyl-cobyrate ⟶ ADP + H+ + adenosyl-cobinamide phosphate + phosphate - 1D-myo-inositol hexakisphosphate biosynthesis V (from Ins(1,3,4)P3):
ATP + D-myo-inositol (1,3,4,5)-tetrakisphosphate ⟶ ADP + D-myo-inositol 1,3,4,5,6-pentakisphosphate + H+ - lipid-dependent phytate biosynthesis II (via Ins(1,3,4)P3):
ATP + D-myo-inositol (1,3,4,5)-tetrakisphosphate ⟶ ADP + D-myo-inositol 1,3,4,5,6-pentakisphosphate + H+ - lipid-dependent phytate biosynthesis I (via Ins(1,4,5)P3):
ATP + D-myo-inositol (1,4,5,6)-tetrakisphosphate ⟶ ADP + D-myo-inositol 1,3,4,5,6-pentakisphosphate + H+ - inositol pyrophosphates biosynthesis:
ATP + D-myo-inositol 1,3,4,5,6-pentakisphosphate ⟶ ADP + a diphospho-1D-myo-inositol tetrakisphosphate - superpathway of lipid-dependent phytate biosynthesis:
ATP + D-myo-inositol (1,3,4,5)-tetrakisphosphate ⟶ ADP + D-myo-inositol 1,3,4,5,6-pentakisphosphate + H+ - pyridoxamine anabolism:
pyridoxamine + pyruvate ⟶ ala + pyridoxal - pyridoxamine anabolism:
pyridoxamine + pyruvate ⟶ ala + pyridoxal - superpathway of N-acetylglucosamine, N-acetylmannosamine and N-acetylneuraminate degradation:
N-acetyl-D-glucosamine-6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate - N-acetylneuraminate and N-acetylmannosamine degradation:
N-acetyl-D-mannosamine + ATP ⟶ N-acetyl-D-mannosamine-6-phosphate + ADP + H+ - superpathway of N-acetylglucosamine, N-acetylmannosamine and N-acetylneuraminate degradation:
D-glucosamine 6-phosphate + H2O ⟶ D-fructose-6-phosphate + H+ + ammonia - N-acetylneuraminate and N-acetylmannosamine degradation:
N-acetyl-D-mannosamine + ATP ⟶ N-acetyl-D-mannosamine-6-phosphate + ADP + H+ - superpathway of N-acetylglucosamine, N-acetylmannosamine and N-acetylneuraminate degradation:
D-glucosamine 6-phosphate + H2O ⟶ D-fructose-6-phosphate + H+ + ammonia - CMP-N-acetylneuraminate biosynthesis I (eukaryotes):
N-acetyl-D-mannosamine + ATP ⟶ N-acetyl-D-mannosamine-6-phosphate + ADP + H+ - N-acetylneuraminate and N-acetylmannosamine degradation:
N-acetyl-D-mannosamine + ATP ⟶ N-acetyl-D-mannosamine-6-phosphate + ADP + H+ - coenzyme A biosynthesis:
H+ + R-4'-phosphopantothenoyl-L-cysteine ⟶ 4'-phosphopantetheine + CO2 - coenzyme A biosynthesis:
H+ + R-4'-phosphopantothenoyl-L-cysteine ⟶ 4'-phosphopantetheine + CO2 - pyrimidine ribonucleotides interconversion:
ATP + UDP ⟶ ADP + H+ + UTP - pyrimidine ribonucleotides interconversion:
ATP + CDP ⟶ ADP + CTP + H+ - GDP-mannose metabolism:
ATP + D-mannose ⟶ ADP + D-mannose 6-phosphate + H+ - mannitol degradation II:
ATP + D-mannose ⟶ ADP + D-mannose 6-phosphate + H+ - mannitol degradation II:
ATP + D-mannose ⟶ ADP + D-mannose 6-phosphate + H+ - pyrimidine deoxyribonucleotide phosphorylation:
ATP + dTDP ⟶ ADP + dTTP - pyrimidine deoxyribonucleotides de novo biosynthesis III:
ATP + dTDP ⟶ ADP + dTTP - pyrimidine deoxyribonucleotides de novo biosynthesis II:
ATP + dTDP ⟶ ADP + dTTP - pyrimidine deoxyribonucleotides de novo biosynthesis I:
ATP + dTDP ⟶ ADP + dTTP - Bifidobacterium shunt:
β-D-glucose + ATP ⟶ β-D-glucose-6-phosphate + ADP + H+ - glucose and glucose-1-phosphate degradation:
β-D-glucose + UQ ⟶ D-glucono-1,5-lactone + UQH2 - GDP-glucose biosynthesis:
β-D-glucose + ATP ⟶ β-D-glucose-6-phosphate + ADP + H+ - glycolysis III:
β-D-glucose + ATP ⟶ β-D-glucose-6-phosphate + ADP + H+ - glucose and glucose-1-phosphate degradation:
β-D-glucose + ATP ⟶ β-D-glucose-6-phosphate + ADP + H+ - trehalose degradation II (trehalase):
β-D-glucose + ATP ⟶ β-D-glucose-6-phosphate + ADP + H+ - glycolysis V (Pyrococcus):
β-D-glucose + ADP ⟶ β-D-glucose-6-phosphate + AMP + H+ - glucose and glucose-1-phosphate degradation:
α-D-glucose 1-phosphate + H2O ⟶ D-glucose + phosphate - GDP-glucose biosynthesis:
β-D-glucose + ATP ⟶ β-D-glucose-6-phosphate + ADP + H+ - glycolysis III:
β-D-glucose + ATP ⟶ β-D-glucose-6-phosphate + ADP + H+ - trehalose degradation V:
β-D-glucose + ATP ⟶ β-D-glucose-6-phosphate + ADP + H+ - trehalose degradation II (trehalase):
β-D-glucose + ATP ⟶ β-D-glucose-6-phosphate + ADP + H+ - glycogen degradation I:
maltose + maltotriose ⟶ β-D-glucose + maltotetraose - glucose and glucose-1-phosphate degradation:
α-D-glucose 1-phosphate + H2O ⟶ D-glucose + phosphate - GDP-glucose biosynthesis:
β-D-glucose + ATP ⟶ β-D-glucose-6-phosphate + ADP + H+ - glycolysis III:
β-D-glucose + ATP ⟶ β-D-glucose-6-phosphate + ADP + H+ - glycogen degradation I:
maltose + maltotriose ⟶ β-D-glucose + maltotetraose - homolactic fermentation:
β-D-glucose + ATP ⟶ β-D-glucose-6-phosphate + ADP + H+ - glycolysis III (glucokinase):
β-D-glucose + ATP ⟶ β-D-glucose-6-phosphate + ADP + H+ - glycogen degradation I:
β-D-glucose + ATP ⟶ β-D-glucose-6-phosphate + ADP + H+ - glucose and glucose-1-phosphate degradation:
β-D-glucose + UQ ⟶ D-glucono-1,5-lactone + UQH2 - proline biosynthesis II:
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H - proline biosynthesis II:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + NAD(P)H + ammonia - sphingosine and sphingosine-1-phosphate metabolism:
ATP + sphingosine ⟶ ADP + H+ + sphingosine-1-phosphate - pyrimidine deoxyribonucleotides de novo biosynthesis:
H2O + dCTP ⟶ ammonia + dUTP - starch biosynthesis:
ADP-D-glucose + a 1,4-α-D-glucan ⟶ ADP + a 1,4-α-D-glucan - NAD phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - purine nucleosides salvage II (plant):
AMP + diphosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + adenine - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle I:
ATP + Glu + ammonium ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis III:
oxaloacetate + phosphate ⟶ hydrogencarbonate + phosphoenolpyruvate - L-glutamine biosynthesis I:
ATP + Glu + ammonium ⟶ ADP + H+ + gln + phosphate - L-citrulline degradation:
ATP + CO2 + ammonium ⟶ ADP + H+ + carbamoyl phosphate - glutamate-glutamine shuttle:
ATP + Glu + ammonium ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle II:
ATP + Glu + ammonium ⟶ ADP + H+ + gln + phosphate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - succinic fermentation pathway:
(S)-malate ⟶ H2O + fumarate - respiration (anaerobic):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - polyphosphate metabolism:
ATP + long chain polyphosphate ⟶ ADP + long chain polyphosphate - galactose degradation III:
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP + H+ - galactose degradation I:
β-D-galactose ⟶ α-D-galactose - superpathway of glyoxylate cycle:
ATP + a fatty acid + coenzyme A ⟶ AMP + H+ + a 2,3,4-saturated fatty acyl CoA + diphosphate - respiration (anaerobic):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - colanic acid building blocks biosynthesis:
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP + H+ - choline biosynthesis I:
H2O + phosphoryl-choline ⟶ choline + phosphate - phosphatidylethanolamine biosynthesis II:
ATP + ethanolamine ⟶ ADP + H+ + phosphoryl-ethanolamine - folate transformations II (plants):
NAD+ + gly + tetrahydrofolate ⟶ 5,10-methylenetetrahydrofolate + CO2 + H+ + NADH + ammonia - glycolysis I:
ATP + D-fructose-6-phosphate ⟶ ADP + H+ + fructose-1,6-bisphosphate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - nitrate reduction II (assimilatory):
ATP + ammonia + glt ⟶ ADP + gln + phosphate - pyruvate fermentation to acetate III:
an oxidized ferredoxin [iron-sulfur] cluster + coenzyme A + pyruvate ⟶ CO2 + a reduced ferredoxin [iron-sulfur] cluster + acetyl-CoA - superpathway of citrulline metabolism:
ATP + CO2 + H2O + ammonia ⟶ ADP + H+ + carbamoyl-phosphate + phosphate - pyrimidine ribonucleotides interconversion:
ATP + H2O + UTP + gln ⟶ ADP + CTP + H+ + glt + phosphate - tetrahydrofolate biosynthesis II:
ADP + a 10-formyltetrahydrofolate + phosphate ⟶ ATP + a tetrahydrofolate + formate - glycolysis II:
ATP + D-fructose-6-phosphate ⟶ ADP + H+ + fructose-1,6-bisphosphate - glycine degradation I:
a [glycine-cleavage complex H protein] N6-aminomethyldihydrolipoyl-L-lysine + tetrahydrofolate ⟶ 5,10-methylenetetrahydrofolate + a [glycine-cleavage complex H protein] N6-dihydrolipoyl-L-lysine + ammonia - D-gluconate degradation:
ATP + D-gluconate ⟶ 6-phospho-D-gluconate + ADP + H+ - gluconeogenesis I:
(S)-malate + NAD+ ⟶ CO2 + NADH + pyruvate - folate transformations I:
NAD+ + gly + tetrahydrofolate ⟶ 5,10-methylenetetrahydrofolate + CO2 + H+ + NADH + ammonia - salvage pathways of pyrimidine ribonucleotides:
H2O + cytidine ⟶ ammonia + uridine - purine nucleotides de novo biosynthesis II:
5'-phosphoribosyl-4-(N-succinocarboxamide)-5-aminoimidazole ⟶ aminoimidazole carboxamide ribonucleotide + fumarate - formaldehyde oxidation V (tetrahydrofolate pathway):
ATP + formate + tetrahydrofolate ⟶ 10-formyl-tetrahydrofolate + ADP + phosphate - phosphatidylcholine biosynthesis I:
ATP + choline ⟶ ADP + H+ + phosphoryl-choline - ornithine biosynthesis:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - formaldehyde assimilation II (RuMP Cycle):
ATP + D-fructose-6-phosphate ⟶ ADP + H+ + fructose-1,6-bisphosphate - sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine + CO2 + coenzyme A - urea cycle:
ATP + CO2 + H2O + ammonia ⟶ ADP + H+ + carbamoyl-phosphate + phosphate - ethanol fermentation to acetate:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - respiration (anaerobic):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - choline biosynthesis I:
H2O + phosphoryl-choline ⟶ choline + phosphate - superpathway of ornithine degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ γ-glutamyl-γ-aminobutyraldehyde + ammonium + hydrogen peroxide - coenzyme A biosynthesis:
H+ + R-4'-phosphopantothenoyl-L-cysteine ⟶ 4'-phosphopantetheine + CO2 - lysine fermentation to acetate and butyrate:
L-3-aminobutyryl-CoA ⟶ H+ + ammonia + crotonyl-CoA - citrulline biosynthesis:
H2O + gln ⟶ H+ + ammonia + glt - acetate formation from acetyl-CoA II:
ATP + acetate + coenzyme A ⟶ ADP + acetyl-CoA + phosphate - superpathway of geranylgeranyldiphosphate biosynthesis II (via MEP):
D-glyceraldehyde-3-phosphate + H+ + pyruvate ⟶ 1-deoxy-D-xylulose 5-phosphate + CO2 - pyridoxamine anabolism:
pyridoxamine + pyruvate ⟶ ala + pyridoxal - mevalonate pathway I:
ATP + mevalonate-diphosphate ⟶ ADP + CO2 + isopentenyl diphosphate + phosphate - superpathway of acetate utilization and formation:
ATP + acetate ⟶ ADP + acetylphosphate - γ-glutamyl cycle:
5-oxoproline + ATP + H2O ⟶ ADP + H+ + glt + phosphate - colanic acid building blocks biosynthesis:
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP + H+ - glutathione biosynthesis:
ATP + L-γ-glutamylcysteine + gly ⟶ ADP + H+ + glutathione + phosphate - proline biosynthesis I:
ATP + glt ⟶ ADP + L-glutamate-5-phosphate - acetate formation from acetyl-CoA I:
ATP + acetate ⟶ ADP + acetylphosphate - reductive acetyl coenzyme A pathway:
H2O + an oxidized ferredoxin [iron-sulfur] cluster + carbon monoxide ⟶ CO2 + H+ + a reduced ferredoxin [iron-sulfur] cluster - chorismate biosynthesis I:
ATP + shikimate ⟶ ADP + H+ + shikimate-3-phosphate - folate polyglutamylation:
ATP + a 10-formyltetrahydrofolate + glt ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - formaldehyde assimilation I (serine pathway):
H+ + oxaloacetate + phosphate ⟶ CO2 + H2O + phosphoenolpyruvate - superpathway of choline biosynthesis:
H2O + a phosphatidylcholine ⟶ a 1,2-diacyl-sn-glycerol 3-phosphate + choline - 5-aminoimidazole ribonucleotide biosynthesis I:
5'-phosphoribosyl-N-formylglycineamide + ATP + H2O + gln ⟶ 5-phosphoribosyl-N-formylglycineamidine + ADP + H+ + glt + phosphate - pyruvate fermentation to acetate and alanine:
2-oxoglutarate + ala ⟶ glt + pyruvate - glycolysis IV (plant cytosol):
ATP + D-fructose-6-phosphate ⟶ ADP + H+ + fructose-1,6-bisphosphate - 5-aminoimidazole ribonucleotide biosynthesis II:
5'-phosphoribosyl-N-formylglycineamide + ATP + H2O + gln ⟶ 5-phosphoribosyl-N-formylglycineamidine + ADP + H+ + glt + phosphate - superpathway of phenylalanine, tyrosine, and tryptophan biosynthesis:
glt + phenylpyruvate ⟶ 2-oxoglutarate + phe - putrescine degradation II:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ γ-glutamyl-γ-aminobutyraldehyde + ammonium + hydrogen peroxide - flavin biosynthesis I (bacteria and plants):
2,5-diamino-6-(5-phospho-D-ribosylamino)pyrimidin-4(3H)-one + H2O ⟶ 5-amino-6-(5-phospho-D-ribosylamino)uracil + ammonia - superpathway of glycolysis and Entner-Doudoroff:
ATP + D-fructose-6-phosphate ⟶ ADP + H+ + fructose-1,6-bisphosphate - phosphatidylethanolamine biosynthesis II:
ATP + ethanolamine ⟶ ADP + H+ + phosphoryl-ethanolamine - NAD salvage pathway III:
ATP + nicotinamide riboside ⟶ ADP + H+ + nicotinamide mononucleotide - inosine-5'-phosphate biosynthesis II:
5'-phosphoribosyl-4-(N-succinocarboxamide)-5-aminoimidazole ⟶ aminoimidazole carboxamide ribonucleotide + fumarate - superpathway of tetrahydrofolate biosynthesis:
7,8-dihydropteroate + ATP + glt ⟶ 7,8-dihydrofolate monoglutamate + ADP + H+ + phosphate - superpathway of chorismate:
glt + phenylpyruvate ⟶ 2-oxoglutarate + phe - guanine and guanosine salvage III:
ATP + guanosine ⟶ ADP + GMP + H+ - PRPP biosynthesis II:
ATP + ribose-1,5-bisphosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + ADP - NAD salvage pathway II:
ATP + nicotinamide riboside ⟶ ADP + H+ + nicotinamide mononucleotide - methylerythritol phosphate pathway:
D-glyceraldehyde-3-phosphate + H+ + pyruvate ⟶ 1-deoxy-D-xylulose 5-phosphate + CO2 - glutamine biosynthesis I:
ATP + ammonia + glt ⟶ ADP + gln + phosphate - superpathway of glyoxylate cycle:
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - ammonia assimilation cycle II:
ATP + ammonia + glt ⟶ ADP + gln + phosphate - tetrahydrofolate biosynthesis:
7,8-dihydropteroate + ATP + glt ⟶ 7,8-dihydrofolate monoglutamate + ADP + H+ + phosphate - superpathway of tetrahydrofolate biosynthesis and salvage:
7,8-dihydropteroate + ATP + glt ⟶ 7,8-dihydrofolate monoglutamate + ADP + H+ + phosphate - γ-glutamyl cycle:
ATP + cys + glt ⟶ ADP + H+ + L-γ-glutamylcysteine + phosphate - phosphatidylethanolamine biosynthesis II:
ATP + ethanolamine ⟶ ADP + H+ + phosphoryl-ethanolamine - NAD phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - pyrimidine ribonucleotides interconversion:
ATP + CDP ⟶ ADP + CTP - creatine biosynthesis:
creatine-phosphate ⟶ H2O + creatinine + phosphate - flavin biosynthesis IV (mammalian):
ATP + riboflavin ⟶ ADP + FMN + H+ - superpathway of citrulline metabolism:
H2O + gln ⟶ H+ + ammonia + glt - phosphatidylcholine biosynthesis I:
ATP + choline ⟶ ADP + H+ + phosphoryl-choline - NAD salvage pathway III:
ATP + nicotinamide riboside ⟶ ADP + H+ + nicotinamide mononucleotide - sphingosine and sphingosine-1-phosphate metabolism:
ATP + sphingosine ⟶ ADP + H+ + sphingosine-1-phosphate - citrulline biosynthesis:
H2O + gln ⟶ H+ + ammonia + glt - UDP-galactose biosynthesis (salvage pathway from galactose using UDP-glucose):
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP + H+ - urea cycle:
ATP + CO2 + H2O + ammonia ⟶ ADP + H+ + carbamoyl-phosphate + phosphate - superpathway of 5-aminoimidazole ribonucleotide biosynthesis:
5-phosphoribosyl-N-formylglycineamidine + ATP ⟶ 5-aminoimidazole ribonucleotide + ADP + H+ + phosphate - 3-phosphoinositide biosynthesis:
myo-inositol + a CDP-diacylglycerol ⟶ CMP + a 1-phosphatidyl-1D-myo-inositol - citrulline degradation:
ATP + CO2 + ammonia ⟶ ADP + H+ + carbamoyl-phosphate - coenzyme A biosynthesis:
ATP + dephospho-CoA ⟶ ADP + H+ + coenzyme A - inosine-5'-phosphate biosynthesis II:
5'-phosphoribosyl-4-(N-succinocarboxamide)-5-aminoimidazole ⟶ aminoimidazole carboxamide ribonucleotide + fumarate - superpathway of acetyl-CoA biosynthesis:
ADP + acetyl-CoA + oxaloacetate + phosphate ⟶ ATP + citrate + coenzyme A - xylitol degradation:
ATP + D-xylulose ⟶ ADP + D-xylulose-5-phosphate + H+ - glycolysis I:
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate - Leloir pathway:
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP + H+ - 5-aminoimidazole ribonucleotide biosynthesis II:
5-phosphoribosyl-N-formylglycineamidine + ATP ⟶ 5-aminoimidazole ribonucleotide + ADP + H+ + phosphate - creatine-phosphate energy transfer:
ATP + creatine ⟶ ADP + H+ + creatine-phosphate - proline biosynthesis II:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + NAD(P)H + ammonia - sulfate activation for sulfonation:
ATP + adenosine 5'-phosphosulfate ⟶ ADP + H+ + phosphoadenosine-5'-phosphosulfate - salvage pathways of pyrimidine ribonucleotides:
H2O + cytidine ⟶ ammonia + uridine - L-glutamine biosynthesis II (tRNA-dependent):
ATP + gln ⟶ ADP + glt + phosphate - riboflavin, FMN and FAD transformations:
ATP + riboflavin ⟶ ADP + FMN + H+ - 1D-myo-inositol hexakisphosphate biosynthesis II (mammalian):
ATP + D-myo-inositol (1,3,4,5,6)-pentakisphosphate ⟶ 1D-myo-inositol 1,2,3,4,5,6-hexakisphosphate + ADP + H+ - superpathway of D-myo-inositol (1,4,5)-trisphosphate metabolism:
1D-myo-inositol (4)-monophosphate + H2O ⟶ myo-inositol + phosphate - selenocysteine biosynthesis II (archaea and eukaryotes):
ATP + H2O + hydrogen selenide ⟶ AMP + phosphate + selenophosphate - acetyl-CoA biosynthesis (from citrate):
ADP + acetyl-CoA + oxaloacetate + phosphate ⟶ ATP + citrate + coenzyme A - D-myo-inositol-5-phosphate metabolism:
ATP + a 1-phosphatidyl-1D-myo-inositol 5-phosphate ⟶ ADP + a 1-phosphatidyl-1D-myo-inositol 4,5-bisphosphate - D-myo-inositol (1,4,5)-trisphosphate biosynthesis:
myo-inositol + a CDP-diacylglycerol ⟶ CMP + a 1-phosphatidyl-1D-myo-inositol - glutamine biosynthesis II:
ATP + ammonia + glt ⟶ ADP + gln + phosphate - glutamate degradation VII:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - superpathway of cholesterol biosynthesis:
ATP + mevalonate-5-phosphate ⟶ ADP + mevalonate-diphosphate - galactose degradation I (Leloir pathway):
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP + H+ - histamine degradation:
H2O + O2 + histamine ⟶ H+ + ammonia + hydrogen peroxide + imidazole acetaldehyde - PIP metabolism:
myo-inositol + a CDP-diacylglycerol ⟶ CMP + a 1-phosphatidyl-1D-myo-inositol - folate polyglutamylation:
ATP + a tetrahydrofolate + glt ⟶ ADP + a tetrahydrofolate + phosphate - D-myo-inositol (1,3,4)-trisphosphate biosynthesis:
ATP + D-myo-inositol (1,4,5)-trisphosphate ⟶ ADP + D-myo-inositol (1,3,4,5)-tetrakisphosphate + H+ - D-myo-inositol (3,4,5,6)-tetrakisphosphate biosynthesis:
ATP + D-myo-inositol (1,3,4)-trisphosphate ⟶ ADP + D-myo-inositol (1,3,4,6)-tetrakisphosphate + H+ - mevalonate pathway I:
ATP + mevalonate-5-phosphate ⟶ ADP + mevalonate-diphosphate - colanic acid building blocks biosynthesis:
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP + H+ - sulfur metabolism:
ATP + adenosine 5'-phosphosulfate ⟶ ADP + H+ + phosphoadenosine-5'-phosphosulfate - glutathione biosynthesis:
ATP + cys + glt ⟶ ADP + H+ + L-γ-glutamylcysteine + phosphate - acetate formation from acetyl-CoA II:
ATP + acetate + coenzyme A ⟶ ADP + acetyl-CoA + phosphate - folate transformations I:
NAD+ + gly + tetrahydrofolate ⟶ 5,10-methylenetetrahydropteroyl mono-L-glutamate + CO2 + H+ + NADH + ammonia - folate transformations II (plants):
NAD+ + gly + tetrahydrofolate ⟶ 5,10-methylenetetrahydropteroyl mono-L-glutamate + CO2 + H+ + NADH + ammonia - arginine biosynthesis IV:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + NAD(P)H + ammonia - gluconeogenesis I:
ATP + oxaloacetate ⟶ ADP + CO2 + phosphoenolpyruvate - NAD salvage pathway II:
ATP + nicotinamide riboside ⟶ ADP + H+ + nicotinamide mononucleotide - copper transport II:
ATP + Cu2+ + H2O ⟶ ADP + Cu2+ + phosphate - 5-aminoimidazole ribonucleotide biosynthesis I:
5-phosphoribosyl-N-formylglycineamidine + ATP ⟶ 5-aminoimidazole ribonucleotide + ADP + H+ + phosphate - superpathway of geranylgeranyldiphosphate biosynthesis II (via MEP):
4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol + ATP ⟶ 2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol + ADP + H+ - 5-aminoimidazole ribonucleotide biosynthesis I:
5-phosphoribosyl-N-formylglycineamidine + ATP ⟶ 5-aminoimidazole ribonucleotide + ADP + H+ + phosphate - phosphatidylethanolamine biosynthesis II:
ATP + ethanolamine ⟶ ADP + H+ + phosphoryl-ethanolamine - UDP-galactose biosynthesis (salvage pathway from galactose using UDP-glucose):
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP + H+ - glycolysis I:
3-phospho-D-glycerate + ATP ⟶ 1,3-diphosphateglycerate + ADP + H+ - galactose degradation III:
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP + H+ - superpathway of cholesterol biosynthesis:
ATP + mevalonate-diphosphate ⟶ ADP + CO2 + H+ + isopentenyl diphosphate + phosphate - glutamine biosynthesis I:
ATP + ammonia + glt ⟶ ADP + H+ + gln + phosphate - pyruvate fermentation to acetate III:
ATP + acetate + coenzyme A ⟶ ADP + H+ + acetyl-CoA + phosphate - folate transformations:
H+ + NAD+ + gly + tetrahydrofolate ⟶ 5,10-methylenetetrahydrofolate + CO2 + NADH + ammonia - inosine-5'-phosphate biosynthesis II:
5'-phosphoribosyl-4-(N-succinocarboxamide)-5-aminoimidazole ⟶ aminoimidazole carboxamide ribonucleotide + fumarate - chorismate biosynthesis I:
ATP + shikimate ⟶ ADP + H+ + shikimate-3-phosphate - methylerythritol phosphate pathway:
4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol + ATP ⟶ 2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol + ADP + H+ - acetate formation from acetyl-CoA II:
ATP + acetate + coenzyme A ⟶ ADP + H+ + acetyl-CoA + phosphate - purine nucleotides de novo biosynthesis II:
5'-phosphoribosyl-4-(N-succinocarboxamide)-5-aminoimidazole ⟶ aminoimidazole carboxamide ribonucleotide + fumarate - glutathione biosynthesis:
ATP + cys + glt ⟶ ADP + H+ + L-γ-glutamylcysteine + phosphate - proline biosynthesis III:
2-oxoglutarate + L-ornithine ⟶ L-glutamate γ-semialdehyde + glt - superpathway of glutamate biosynthesis:
ATP + ammonia + glt ⟶ ADP + H+ + gln + phosphate - salvage pathways of pyrimidine ribonucleotides:
H2O + cytosine ⟶ ammonia + uracil - folate polyglutamylation I:
ATP + a 10-formyltetrahydrofolate + glt ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - mevalonate pathway I:
ATP + mevalonate-diphosphate ⟶ ADP + CO2 + H+ + isopentenyl diphosphate + phosphate - phosphatidylcholine biosynthesis I:
ATP + choline ⟶ ADP + H+ + phosphoryl-choline - salvage pathways of guanine, xanthine, and their nucleosides:
H2O + guanine ⟶ ammonia + xanthine - arginine biosynthesis IV:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + NAD(P)H + ammonia - colanic acid building blocks biosynthesis:
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP + H+ - NAD salvage pathway III:
ATP + nicotinamide riboside ⟶ ADP + H+ + nicotinamide mononucleotide - D-myo-inositol (1,3,4)-trisphosphate biosynthesis:
ATP + D-myo-inositol (1,4,5)-trisphosphate ⟶ ADP + D-myo-inositol (1,3,4,5)-tetrakisphosphate + H+ - purine nucleotides de novo biosynthesis II:
5'-phosphoribosyl-4-(N-succinocarboxamide)-5-aminoimidazole ⟶ aminoimidazole carboxamide ribonucleotide + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NADH ⟶ ADP + H+ + NADPH - sphingosine and sphingosine-1-phosphate metabolism:
ATP + sphingosine ⟶ ADP + H+ + sphingosine-1-phosphate - folate polyglutamylation I:
ATP + a 5,10-methylenetetrahydrofolate + glt ⟶ ADP + a 5,10-methylenetetrahydrofolate + phosphate - selenocysteine biosynthesis II (archaea and eukaryotes):
ATP + H2O + hydrogen selenide ⟶ AMP + H+ + phosphate + selenophosphate - glycolysis I:
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate - mevalonate pathway I:
ATP + mevalonate-5-phosphate ⟶ ADP + H+ + mevalonate-diphosphate - γ-glutamyl cycle:
ATP + L-γ-glutamylcysteine + gly ⟶ ADP + H+ + glutathione + phosphate - flavin biosynthesis III (fungi):
2,5-diamino-6-(5-phospho-D-ribitylamino)pyrimidin-4(3H)-one + H2O ⟶ 5-amino-6-(5-phospho-D-ribosylamino)uracil + ammonia - superpathway of sulfur amino acid biosynthesis (Saccharomyces cerevisiae):
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glt ⟶ ADP + a folylpolyglutamate(n) + phosphate - sphingolipid metabolism:
4-hydroxysphinganine + ATP ⟶ ADP + H+ + phytosphingosine-1-P - biotin biosynthesis II:
H+ + ala + pimeloyl-CoA ⟶ 7-keto-8-aminopelargonate + CO2 + coenzyme A - mixed acid fermentation:
citrate ⟶ cis-aconitate + H2O - NAD salvage pathway III:
ATP + nicotinamide riboside ⟶ ADP + H+ + nicotinamide mononucleotide - ribitol degradation:
ATP + D-ribulose ⟶ ADP + D-ribulose-5-phosphate + H+ - NAD salvage pathway II:
ATP + nicotinamide riboside ⟶ ADP + H+ + nicotinamide mononucleotide - phosphatidylethanolamine biosynthesis II:
ATP + ethanolamine ⟶ ADP + H+ + phosphoryl-ethanolamine - biotin biosynthesis I:
H+ + ala + pimeloyl-CoA ⟶ 7-keto-8-aminopelargonate + CO2 + coenzyme A - superpathway of geranylgeranyldiphosphate biosynthesis I (via mevalonate):
ATP + mevalonate-5-phosphate ⟶ ADP + H+ + mevalonate-diphosphate - formaldehyde oxidation V (tetrahydrofolate pathway):
ATP + H+ + formate + tetrahydrofolate ⟶ 10-formyl-tetrahydrofolate + ADP + phosphate - UDP-galactose biosynthesis (salvage pathway from galactose using UDP-glucose):
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP + H+ - urea cycle:
ATP + CO2 + H2O + ammonia ⟶ ADP + H+ + carbamoyl-phosphate + phosphate - superpathway of ergosterol biosynthesis:
ATP + mevalonate-5-phosphate ⟶ ADP + H+ + mevalonate-diphosphate - phosphatidylcholine biosynthesis I:
ATP + choline ⟶ ADP + H+ + phosphoryl-choline - homoserine biosynthesis:
ATP + asp ⟶ ADP + H+ + L-aspartyl-4-phosphate - respiration (anaerobic):
citrate ⟶ cis-aconitate + H2O - glutamine biosynthesis I:
ATP + ammonia + glt ⟶ ADP + H+ + gln + phosphate - 3-phosphoinositide biosynthesis:
myo-inositol + a CDP-diacylglycerol ⟶ CMP + a 1-phosphatidyl-1D-myo-inositol - proline biosynthesis I:
ATP + glt ⟶ ADP + H+ + L-glutamate-5-phosphate - sulfate reduction I (assimilatory):
ATP + adenosine 5'-phosphosulfate ⟶ ADP + H+ + phosphoadenosine-5'-phosphosulfate - citrulline biosynthesis:
H2O + gln ⟶ H+ + ammonia + glt - nitrate reduction V (assimilatory):
ATP + ammonia + glt ⟶ ADP + H+ + gln + phosphate - sulfate activation for sulfonation:
ATP + adenosine 5'-phosphosulfate ⟶ ADP + H+ + phosphoadenosine-5'-phosphosulfate - D-arabinose degradation II:
ATP + D-ribulose ⟶ ADP + D-ribulose-5-phosphate + H+ - citrulline degradation:
ATP + CO2 + ammonia ⟶ ADP + H+ + carbamoyl-phosphate - glutathione biosynthesis:
ATP + L-γ-glutamylcysteine + gly ⟶ ADP + H+ + glutathione + phosphate - xylitol degradation:
ATP + D-xylulose ⟶ ADP + D-xylulose-5-phosphate + H+ - ornithine biosynthesis:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - coenzyme A biosynthesis:
(R)-pantothenate + ATP ⟶ ADP + D-4'-phosphopantothenate + H+ - glycolysis II:
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate - chorismate biosynthesis I:
ATP + shikimate ⟶ ADP + H+ + shikimate-3-phosphate - salvage pathways of guanine, xanthine, and their nucleosides:
H2O + guanine ⟶ ammonia + xanthine - salvage pathways of pyrimidine ribonucleotides:
H2O + cytidine ⟶ ammonia + uridine - gluconeogenesis I:
3-phospho-D-glycerate + ATP ⟶ 1,3-diphosphateglycerate + ADP + H+ - inosine-5'-phosphate biosynthesis II:
5'-phosphoribosyl-4-(N-succinocarboxamide)-5-aminoimidazole ⟶ aminoimidazole carboxamide ribonucleotide + fumarate - chorismate biosynthesis from 3-dehydroquinate:
ATP + shikimate ⟶ ADP + H+ + shikimate-3-phosphate - purine nucleotides degradation III (anaerobic):
4-aminoimidazole + H2O ⟶ 4-imidazolone + H+ + ammonia - purine nucleotides degradation IV (anaerobic):
4-aminoimidazole + H2O ⟶ 4-imidazolone + H+ + ammonia - gluconeogenesis:
3-phospho-D-glycerate + ATP ⟶ 1,3-diphosphateglycerate + ADP + H+ - superpathway of D-myo-inositol (1,4,5)-trisphosphate metabolism:
1D-myo-inositol (4)-monophosphate + H2O ⟶ myo-inositol + phosphate - 5-aminoimidazole ribonucleotide biosynthesis I:
5-phosphoribosyl-N-formylglycineamidine + ATP ⟶ 5-aminoimidazole ribonucleotide + ADP + H+ + phosphate - folate transformations:
H+ + NAD+ + gly + tetrahydrofolate ⟶ 5,10-methylenetetrahydrofolate + CO2 + NADH + ammonia - chorismate biosynthesis:
NADP+ + shikimate ⟶ 3-dehydro-shikimate + NADPH - superpathway of phenylalanine, tyrosine and tryptophan biosynthesis:
L-serine + indole ⟶ H2O + L-tryptophan - citrulline biosynthesis:
α-ketoglutarate + L-ornithine ⟶ L-glutamate + L-glutamate γ-semialdehyde - mannitol degradation:
ATP + D-mannose ⟶ ADP + mannose-6-phosphate - salvage pathways of pyrimidine ribonucleotides:
H2O + cytidine ⟶ ammonia + uridine - thiamin (vitamin B1) biosynthesis:
ATP + thiamine ⟶ AMP + thiamin diphosphate - riboflavin and FMN and FAD biosynthesis:
2,5-diamino-6-(ribosylamino)-4-(3H)-pyrimidinone 5'-phosphate + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - mannose degradation:
ATP + D-mannose ⟶ ADP + mannose-6-phosphate - proline biosynthesis:
H2O + L-glutamate + NAD(P)+ ⟶ α-ketoglutarate + NAD(P)H + ammonia - salvage pathways of guanine, xanthine, and their nucleosides:
H2O + guanine ⟶ ammonia + xanthine - N-acetylglucosamine degradation:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate - threonine degradation:
2-oxobutanoate + ammonia + succinate ⟶ H2O + O-succinyl-L-homoserine - threonine biosynthesis:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - D-arabinose degradation:
D-arabinose + NADPH ⟶ D-arabitol + NADP+ - ribitol degradation:
ATP + D-ribulose ⟶ ADP + D-ribulose-5-phosphate - salvage pathways of purine nucleosides:
AMP + pyrophosphate ⟶ 5-phosphoribosyl 1-pyrophosphate + adenine - pyridoxal 5'-phosphate (vitamin B6) biosynthesis:
H2O + O2 + pyridoxamine 5'-phosphate ⟶ H2O2 + ammonia + pyridoxal 5'-phosphate - salvage pathways of adenine, hypoxanthine, and their nucleosides:
AMP + H2O ⟶ D-ribose 5-phosphate + adenine - phosphatidylcholine biosynthesis (Kennedy pathway):
ATP + choline ⟶ ADP + phosphoryl-choline - glycerol degradation:
ATP + glycerol ⟶ ADP + glycerol-3-phosphate - N-acetylglucosamine , N-acetylmannosamine and N-acetylneuraminic acid dissimilation:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate - galactose degradation:
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP - UDP-α-D-glucuronate biosynthesis (from myo-inositol):
myo-inositol + O2 ⟶ D-glucopyranuronate + H+ + H2O - guanine and guanosine salvage III:
ATP + guanosine ⟶ ADP + GMP + H+ - purine nucleosides salvage II (plant):
AMP + diphosphate ⟶ PRPP + adenine - D-galactose degradation I (Leloir pathway):
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate - stachyose degradation:
H2O + raffinose ⟶ α-D-galactose + sucrose - D-galactose degradation III:
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP + H+ - galactose degradation I (Leloir pathway):
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP + H+ - stachyose degradation:
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP + H+ - galactose degradation I (Leloir pathway):
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP + H+ - colanic acid building blocks biosynthesis:
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP + H+ - galactose degradation III:
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP + H+
WikiPathways(4)
- Purine metabolism:
P1,P4-Bis(5'-xanthosyl) tetraphosphate ⟶ XTP - Glycerophospholipid biosynthetic pathway:
Serine ⟶ Ethanolamine - Aerobic glycolysis:
PYR ⟶ LAC - 16p11.2 distal deletion syndrome:
ATP ⟶ ADP
Plant Reactome(4764)
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
ATP + PanK ⟶ ADP + PPanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
ATP + PanK ⟶ ADP + PPanK - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
ATP + PanK ⟶ ADP + PPanK - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Cofactor biosyntheses:
9-mercaptodethiobiotin ⟶ Btn - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
ATP + PanK ⟶ ADP + PPanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
ATP + PanK ⟶ ADP + PPanK - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
ATP + PanK ⟶ ADP + PPanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - Pantothenate and coenzyme A biosynthesis III:
ATP + PanK ⟶ ADP + PPanK - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
ATP + PanK ⟶ ADP + PPanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
L-Phe ⟶ ammonia + trans-cinnamate - Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P - Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P - Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P - Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P - Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P - Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P - Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P - Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P - Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P - Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P - Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P - Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P - Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P - Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi - Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P - Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
1,3BPG + ADP ⟶ 3PG + ATP - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - glycolysis IV:
1,3BPG + ADP ⟶ 3PG + ATP - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
1,3BPG + ADP ⟶ 3PG + ATP - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
ATP + beta-D-glucose ⟶ ADP + H+ + beta-D-glucose-6-phosphate - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Carbohydrate metabolism:
ATP + Glycerol ⟶ ADP + G3P - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - glycolysis IV:
G6P ⟶ Fru(6)P - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - Carbohydrate metabolism:
ATP + beta-D-glucose ⟶ ADP + H+ + beta-D-glucose-6-phosphate - GDP-mannose metabolism:
ATP + Man ⟶ ADP + Man6P - Mannose catabolism:
ATP + Man ⟶ ADP + Man6P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
ATP + Man ⟶ ADP + Man6P - Mannose catabolism:
ATP + Man ⟶ ADP + Man6P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
ATP + Man ⟶ ADP + Man6P - Mannose catabolism:
ATP + Man ⟶ ADP + Man6P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - GDP-mannose metabolism:
Fru(6)P ⟶ Man6P - Mannose catabolism:
Man6P ⟶ Fru(6)P - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Ala ⟶ ADP + D-alanyl-D-alanine + Pi - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Ala ⟶ ADP + D-alanyl-D-alanine + Pi - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Ala ⟶ ADP + D-alanyl-D-alanine + Pi - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Ala ⟶ ADP + D-alanyl-D-alanine + Pi - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Ala ⟶ ADP + D-alanyl-D-alanine + Pi - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Ala ⟶ ADP + D-alanyl-D-alanine + Pi - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Ala ⟶ ADP + D-alanyl-D-alanine + Pi - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Peptidoglycan biosynthesis I:
ATP + D-Glu + UDP-N-acetylmuramoyl-L-alanine ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
ISCIT + NAD ⟶ 2OG + H+ + NADH + carbon dioxide - TCA cycle (plant):
ISCIT + NAD ⟶ 2OG + H+ + NADH + carbon dioxide - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
CIT ⟶ ISCIT - TCA cycle (plant):
CIT ⟶ ISCIT - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
CIT ⟶ ISCIT - TCA cycle (plant):
CIT ⟶ ISCIT - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Glutamate synthase cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
ISCIT + NAD ⟶ 2OG + H+ + NADH + carbon dioxide - TCA cycle (plant):
ISCIT + NAD ⟶ 2OG + H+ + NADH + carbon dioxide - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Glutamate synthase cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
CIT ⟶ ISCIT - TCA cycle (plant):
CIT ⟶ ISCIT - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Methionine biosynthesis II:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia - Threonine biosynthesis from homoserine:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
ATP + beta-D-glucose ⟶ ADP + H+ + beta-D-glucose-6-phosphate - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
ATP + beta-D-glucose ⟶ ADP + H+ + beta-D-glucose-6-phosphate - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
ATP + beta-D-glucose ⟶ ADP + H+ + beta-D-glucose-6-phosphate - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
ATP + beta-D-glucose ⟶ ADP + H+ + beta-D-glucose-6-phosphate - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Trehalose degradation II:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis II (acetyl cycle):
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis II (acetyl cycle):
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
N-acetylglutamyl-phosphate + TPNH ⟶ 2-acetamido-5-oxopentanoic acid + Pi + TPN - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
N-acetylglutamyl-phosphate + TPNH ⟶ 2-acetamido-5-oxopentanoic acid + Pi + TPN - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
N-acetylglutamyl-phosphate + TPNH ⟶ 2-acetamido-5-oxopentanoic acid + Pi + TPN - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis II (acetyl cycle):
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
ATP + NAcGlu ⟶ ADP + N-acetylglutamyl-phosphate - Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Arginine biosynthesis I:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis II (acetyl cycle):
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
N-acetylglutamyl-phosphate + TPNH ⟶ 2-acetamido-5-oxopentanoic acid + Pi + TPN - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
N-acetylglutamyl-phosphate + TPNH ⟶ 2-acetamido-5-oxopentanoic acid + Pi + TPN - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis II (acetyl cycle):
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis II (acetyl cycle):
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Thiamin biosynthesis:
ATP + hydroxymethylpyrimidine phosphate ⟶ 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Calvin cycle:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
ATP + RIB ⟶ ADP + FMN - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
GTP + H2O ⟶ 2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + HCOOH + PPi - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
GTP + H2O ⟶ 2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + HCOOH + PPi - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
ATP + RIB ⟶ ADP + FMN - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
5-amino-6-(5'-phosphoribosylamino)uracil + H+ + TPNH ⟶ 5-amino-6-(5'-phosphoribitylamino)uracil + TPN - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia - Xylose catabolism:
D-xylose ⟶ D-xylulose - Xylose catabolism:
D-xylose ⟶ D-xylulose - Xylose catabolism:
D-xylose ⟶ D-xylulose - Xylose catabolism:
D-xylose ⟶ D-xylulose - Xylose catabolism:
D-xylose ⟶ D-xylulose - Xylose catabolism:
D-xylose ⟶ D-xylulose - Xylose catabolism:
D-xylose ⟶ D-xylulose - Xylose catabolism:
D-xylose ⟶ D-xylulose - Xylose catabolism:
D-xylose ⟶ D-xylulose - Xylose catabolism:
D-xylose ⟶ D-xylulose - Xylose catabolism:
D-xylose ⟶ D-xylulose - Xylose catabolism:
D-xylose ⟶ D-xylulose - Xylose catabolism:
D-xylose ⟶ D-xylulose - Xylose catabolism:
D-xylose ⟶ D-xylulose - Xylose catabolism:
D-xylose ⟶ D-xylulose - Xylose catabolism:
D-xylose ⟶ D-xylulose - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
D-xylose ⟶ D-xylulose - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
D-xylose ⟶ D-xylulose - Xylose catabolism:
D-xylose ⟶ D-xylulose - Xylose catabolism:
D-xylose ⟶ D-xylulose - Xylose catabolism:
D-xylose ⟶ D-xylulose - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
D-xylose ⟶ D-xylulose - Xylose catabolism:
D-xylose ⟶ D-xylulose - Xylose catabolism:
D-xylose ⟶ D-xylulose - Xylose catabolism:
D-xylose ⟶ D-xylulose - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Xylose catabolism:
ATP + D-xylulose ⟶ ADP + D-xylulose 5-phosphate + H+ - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
ATP + L-Asp ⟶ 4-Phospho-L-aspartate + ADP - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
ATP + L-Asp ⟶ 4-Phospho-L-aspartate + ADP - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
ATP + L-Asp ⟶ 4-Phospho-L-aspartate + ADP - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
ATP + L-Asp ⟶ 4-Phospho-L-aspartate + ADP - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
ATP + L-Asp ⟶ 4-Phospho-L-aspartate + ADP - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
ATP + L-Asp ⟶ 4-Phospho-L-aspartate + ADP - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
ATP + L-Asp ⟶ 4-Phospho-L-aspartate + ADP - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
ATP + L-Asp ⟶ 4-Phospho-L-aspartate + ADP - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
ATP + L-Asp ⟶ 4-Phospho-L-aspartate + ADP - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
ATP + L-Asp ⟶ 4-Phospho-L-aspartate + ADP - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
ATP + L-Asp ⟶ ADP + L-aspartyl-4-phosphate - Lysine biosynthesis I:
ATP + L-Asp ⟶ ADP + L-aspartyl-4-phosphate - Lysine biosynthesis II:
ATP + L-Asp ⟶ ADP + L-aspartyl-4-phosphate - Lysine biosynthesis VI:
ATP + L-Asp ⟶ 4-Phospho-L-aspartate + ADP - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
4-Phospho-L-aspartate + H+ + TPNH ⟶ L-aspartic 4-semialdehyde + Pi + TPN - Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis I:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis II:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN - Lysine biosynthesis VI:
ATP + L-Asp ⟶ 4-Phospho-L-aspartate + ADP - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
4-CDP-2-C-methyl-D-erythritol + ATP ⟶ 4-CDP-2-C-methyl-D-erythritol 2-phosphate + ADP - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
4-CDP-2-C-methyl-D-erythritol + ATP ⟶ 4-CDP-2-C-methyl-D-erythritol 2-phosphate + ADP - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - DXP pathway:
1-deoxy-D-xylulose 5-phosphate + TPNH ⟶ 2-C-methyl-D-erythritol-4-phosphate + TPN - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
ADP + Pi + an N10-formyl-tetrahydrofolate ⟶ ATP + HCOOH + a tetrahydrofolate polyglutamate - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
ATP + PXA ⟶ ADP + PXAP - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
ATP + PXA ⟶ ADP + PXAP - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Pyridoxal 5'-phosphate salvage pathway:
H2O + Oxygen + PXAP ⟶ H2O2 + PXLP + ammonia - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
ATP + Gal ⟶ ADP + Gal1P - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
ATP + Gal ⟶ ADP + Gal1P - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
ATP + SKM ⟶ ADP + SKMP - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
ATP + SKM ⟶ ADP + SKMP - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - shikimate pathway:
3-dehydro-shikimate + TPNH ⟶ SKM + TPN - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
(R)-mevalonate + ATP ⟶ ADP + MVA5P - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
(R)-mevalonate + ATP ⟶ ADP + MVA5P - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
(R)-mevalonate + ATP ⟶ ADP + MVA5P - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
(R)-mevalonate + ATP ⟶ ADP + MVA5P - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
(R)-mevalonate + ATP ⟶ ADP + MVA5P - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
(R)-mevalonate + ATP ⟶ ADP + MVA5P - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - Secondary metabolism:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - MVA pathway:
(R)-mevalonate + ATP ⟶ ADP + MVA5P - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
(R)-mevalonate + ATP ⟶ ADP + MVA5P - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - Secondary metabolism:
DMAPP + genistein ⟶ PPi + lupiwighteone - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5-methylthioribose + ATP ⟶ 5-methylthioribose-1-phosphate + ADP - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5-methylthioribose + ATP ⟶ 5-methylthioribose-1-phosphate + ADP - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
(1,4-alpha-glycosyl)n + ADP-D-glucose ⟶ (1,4-alpha-glycosyl)n + ADP - Growth and developmental processes:
PIN/IAA ⟶ IAA - Reproductive structure development:
PIN/IAA ⟶ IAA - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
PIN/IAA ⟶ IAA - Reproductive structure development:
PIN/IAA ⟶ IAA - Starch biosynthesis:
(1,4-alpha-glycosyl)n + ADP-D-glucose ⟶ (1,4-alpha-glycosyl)n + ADP - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
PIN/IAA ⟶ IAA - Reproductive structure development:
PIN/IAA ⟶ IAA - Starch biosynthesis:
(1,4-alpha-glycosyl)n + ADP-D-glucose ⟶ (1,4-alpha-glycosyl)n + ADP - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
PIN/IAA ⟶ IAA - Reproductive structure development:
PIN/IAA ⟶ IAA - Starch biosynthesis:
(1,4-alpha-glycosyl)n + ADP-D-glucose ⟶ (1,4-alpha-glycosyl)n + ADP - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
PIN/IAA ⟶ IAA - Regulatory network of nutrient accumulation:
(1,4-alpha-glycosyl)n + ADP-D-glucose ⟶ (1,4-alpha-glycosyl)n + ADP - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
PIN/IAA ⟶ IAA - Regulatory network of nutrient accumulation:
(1,4-alpha-glycosyl)n + ADP-D-glucose ⟶ (1,4-alpha-glycosyl)n + ADP - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
PIN/IAA ⟶ IAA - Regulatory network of nutrient accumulation:
(1,4-alpha-glycosyl)n + ADP-D-glucose ⟶ (1,4-alpha-glycosyl)n + ADP - Starch biosynthesis:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Growth and developmental processes:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Reproductive structure development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
PIN/IAA ⟶ IAA - Regulatory network of nutrient accumulation:
(1,4-alpha-glycosyl)n + ADP-D-glucose ⟶ (1,4-alpha-glycosyl)n + ADP - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Seed development:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - Regulatory network of nutrient accumulation:
Fru(6)P ⟶ beta-D-glucose-6-phosphate - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - glycolysis I:
GA3P + Pi + TPN ⟶ 1,3-Bisphospho-D-glycerate + H+ + TPNH - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
H2O + N-Carbamoylputrescine ⟶ Putrescine + ammonia + carbon dioxide - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
glyoxylate ⟶ 2-hydroxy-3-oxopropanoic acid + carbon dioxide - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
glyoxylate ⟶ 2-hydroxy-3-oxopropanoic acid + carbon dioxide - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
glyoxylate ⟶ 2-hydroxy-3-oxopropanoic acid + carbon dioxide - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
glyoxylate ⟶ 2-hydroxy-3-oxopropanoic acid + carbon dioxide - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
H2O + N-Carbamoylputrescine ⟶ Putrescine + ammonia + carbon dioxide - Allantoin assimilation:
ATP + D-glycerate ⟶ 3PG + ADP - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
ATP + D-glycerate ⟶ 3PG + ADP - Allantoin assimilation:
ATP + D-glycerate ⟶ 3PG + ADP - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
glyoxylate ⟶ 2-hydroxy-3-oxopropanoic acid + carbon dioxide - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Allantoin assimilation:
ATP + D-glycerate ⟶ 3PG + ADP - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
glyoxylate ⟶ 2-hydroxy-3-oxopropanoic acid + carbon dioxide - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Allantoin assimilation:
H2O + allantoin ⟶ H+ + allantoate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - Pyridoxamine anabolism:
ATP + PXL ⟶ ADP + PXLP - UDP-L-arabinose biosynthesis (salvage pathway):
ATP + L-arabinose ⟶ ADP + beta-L-arabinose 1-phosphate - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + Vradi0215s00270 ⟶ ADP + Vradi0215s00270 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
ATP + GlcA ⟶ ADP + D-glucuronate 1-phosphate - Fatty acid and lipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
AET7Gv20749500 + ATP ⟶ ADP + AET7Gv20749500 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + TanjilG_21567 ⟶ ADP + TanjilG_21567 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + VIT_15s0048g02410 ⟶ ADP + VIT_15s0048g02410 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
ATP + GlcA ⟶ ADP + D-glucuronate 1-phosphate - Folate polyglutamylation I:
ATP + L-Glu + a tetrahydrofolate polyglutamate ⟶ ADP + Pi + a tetrahydrofolate polyglutamate - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + ORUFI08G03840 ⟶ ADP + ORUFI08G03840 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + GSMUA_Achr1G06360_001 ⟶ ADP + GSMUA_Achr1G06360_001 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + BVRB_1g001980 ⟶ ADP + BVRB_1g001980 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + Homologues of CCA1 ⟶ ADP + Homologues of CCA1 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + TCM_005021 ⟶ ADP + TCM_005021 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + BGIOSGA028019 ⟶ ADP + BGIOSGA028019 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + HORVU7Hr1G070870 ⟶ ADP + HORVU7Hr1G070870 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + Homologues of CCA1 ⟶ ADP + Homologues of CCA1 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + Homologues of CCA1 ⟶ ADP + Homologues of CCA1 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + Homologues of CCA1 ⟶ ADP + Homologues of CCA1 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + OGLUM08G03510 ⟶ ADP + OGLUM08G03510 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + Homologues of CCA1 ⟶ ADP + Homologues of CCA1 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + Homologues of CCA1 ⟶ ADP + Homologues of CCA1 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + Homologues of CCA1 ⟶ ADP + Homologues of CCA1 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + Homologues of CCA1 ⟶ ADP + Homologues of CCA1 - Circadian rhythm:
ATP + OPUNC08G03280 ⟶ ADP + OPUNC08G03280 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
ATP + GlcA ⟶ ADP + D-glucuronate 1-phosphate - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + LPERR08G03480 ⟶ ADP + LPERR08G03480 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + SETIT_013398mg ⟶ ADP + SETIT_013398mg - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + LR48_Vigan11g025500 ⟶ ADP + LR48_Vigan11g025500 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + Csa_6G095910 ⟶ ADP + Csa_6G095910 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + PRUPE_2G200400 ⟶ ADP + PRUPE_2G200400 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Circadian rhythm:
ATP + KN538681.1_FG110 ⟶ ADP + KN538681.1_FG110 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + CCACVL1_01635 ⟶ ADP + CCACVL1_01635 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Choline biosynthesis I:
ATP + ETA ⟶ ADP + PETA - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + Homologues of CCA1 ⟶ ADP + Homologues of CCA1 - Circadian rhythm:
ATP + Homologues of CCA1 ⟶ ADP + Homologues of CCA1 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + ORGLA08G0028700 ⟶ ADP + ORGLA08G0028700 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + L-Glu + a tetrahydrofolate polyglutamate ⟶ ADP + Pi + a tetrahydrofolate polyglutamate - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
ATP + GlcA ⟶ ADP + D-glucuronate 1-phosphate - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
ATP + GlcA ⟶ ADP + D-glucuronate 1-phosphate - Folate polyglutamylation I:
ATP + L-Glu + a tetrahydrofolate polyglutamate ⟶ ADP + Pi + a tetrahydrofolate polyglutamate - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
ATP + GlcA ⟶ ADP + D-glucuronate 1-phosphate - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + Solyc10g005080.3 ⟶ ADP + Solyc10g005080.3 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + OMERI08G03470 ⟶ ADP + OMERI08G03470 - Circadian rhythm:
ATP + TRIUR3_13395 ⟶ ADP + TRIUR3_13395 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + Homologues of CCA1 ⟶ ADP + Homologues of CCA1 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + BRADI_3g16515v3 ⟶ ADP + BRADI_3g16515v3 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + ONIVA08G03410 ⟶ ADP + ONIVA08G03410 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + MTR_7g118330 ⟶ ADP + MTR_7g118330 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
ATP + GlcA ⟶ ADP + D-glucuronate 1-phosphate - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + Homologues of CCA1 ⟶ ADP + Homologues of CCA1 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + Tp57577_TGAC_v2_gene4678 ⟶ ADP + Tp57577_TGAC_v2_gene4678 - Circadian rhythm:
AMTR_s00001p00272270 + ATP ⟶ ADP + AMTR_s00001p00272270 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + L-Glu + a tetrahydrofolate polyglutamate ⟶ ADP + Pi + a tetrahydrofolate polyglutamate - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + OBART08G03430 ⟶ ADP + OBART08G03430 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + Homologues of CCA1 ⟶ ADP + Homologues of CCA1 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + L-Cys + L-Glu ⟶ ADP + Pi + gGluCys - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + OB08G13700 ⟶ ADP + OB08G13700 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + SORBI_3007G047400 ⟶ ADP + SORBI_3007G047400 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + Homologues of CCA1 ⟶ ADP + Homologues of CCA1 - Circadian rhythm:
ATP + PAHAL_6G039600 ⟶ ADP + PAHAL_6G039600 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + GQ55_6G040200 ⟶ ADP + GQ55_6G040200 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen - Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen - Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + Homologues of CCA1 ⟶ ADP + Homologues of CCA1 - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - UDP-D-GlcA biosynthesis:
Ins + Oxygen ⟶ GlcA + H2O - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Circadian rhythm:
ATP + Homologues of CCA1 ⟶ ADP + Homologues of CCA1
INOH(46)
- Arginine and Proline metabolism ( Arginine and Proline metabolism ):
ATP + Creatine ⟶ ADP + N-Phospho-creatine - ATP + Creatine = ADP + N-Phospho-creatine ( Arginine and Proline metabolism ):
ATP + Creatine ⟶ ADP + N-Phospho-creatine - Alanine,Aspartic acid and Asparagine metabolism ( Alanine,Aspartic acid and Asparagine metabolism ):
H2O + N-Acetyl-L-aspartic acid ⟶ Acetic acid + L-Aspartic acid - ATP + Pyruvic acid + CO2 + H2O = ADP + Oxaloacetic acid + Orthophosphate ( Alanine,Aspartic acid and Asparagine metabolism ):
ATP + CO2 + H2O + Pyruvic acid ⟶ ADP + Orthophosphate + Oxaloacetic acid - Citrate cycle ( Citrate cycle ):
H2O + cis-Aconitic acid ⟶ Isocitric acid - ATP + Pyruvic acid + CO2 + H2O = ADP + Oxaloacetic acid + Orthophosphate ( Glycolysis and Gluconeogenesis ):
ADP + Orthophosphate + Oxaloacetic acid ⟶ ATP + CO2 + H2O + Pyruvic acid - Glycolysis and Gluconeogenesis ( Glycolysis and Gluconeogenesis ):
D-Glucose 6-phosphate + H2O ⟶ D-Glucose + Orthophosphate - Purine nucleotides and Nucleosides metabolism ( Purine nucleotides and Nucleosides metabolism ):
H2O + XTP ⟶ Pyrophosphate + XMP - Glutamic acid and Glutamine metabolism ( Glutamic acid and Glutamine metabolism ):
ATP + L-Glutamine + tRNA(Gln) ⟶ AMP + L-Glutaminyl-tRNA(Gln) + Pyrophosphate - ATP + dGMP = ADP + dGDP ( Purine nucleotides and Nucleosides metabolism ):
ATP + dGMP ⟶ ADP + dGDP - Pyrimidine Nucleotides and Nucleosides metabolism ( Pyrimidine Nucleotides and Nucleosides metabolism ):
Deoxy-cytidine + H2O ⟶ Deoxy-uridine + NH3 - ATP + dTDP = ADP + dTTP ( Pyrimidine Nucleotides and Nucleosides metabolism ):
ADP + dTTP ⟶ ATP + dTDP - ATP + dCDP = ADP + dCTP ( Pyrimidine Nucleotides and Nucleosides metabolism ):
ATP + dCDP ⟶ ADP + dCTP - ATP + dCMP = ADP + dCDP ( Pyrimidine Nucleotides and Nucleosides metabolism ):
ADP + dCDP ⟶ ATP + dCMP - ATP + D-Glycerate 3-phosphate = ADP + 1,3-Bisphospho-D-glyceric acid ( Glycolysis and Gluconeogenesis ):
1,3-Bisphospho-D-glyceric acid + ADP ⟶ ATP + D-Glycerate 3-phosphate - ATP + UMP = ADP + UDP ( Pyrimidine Nucleotides and Nucleosides metabolism ):
ATP + UMP ⟶ ADP + UDP - Pentose phosphate cycle ( Pentose phosphate cycle ):
ATP + D-Ribose 5-phosphate ⟶ AMP + D-5-Phospho-ribosyl 1-diphosphate - Aminosugars metabolism ( Aminosugars metabolism ):
D-Fructose 6-phosphate + NH3 ⟶ D-Glucosamine 6-phosphate + H2O - Fructose and Mannose metabolism ( Fructose and Mannose metabolism ):
D-Sorbitol + NADP+ ⟶ D-Glucose + NADPH - ATP + dUMP = ADP + dUDP ( Pyrimidine Nucleotides and Nucleosides metabolism ):
ADP + dUDP ⟶ ATP + dUMP - ATP + GMP = ADP + GDP ( Purine nucleotides and Nucleosides metabolism ):
ADP + GDP ⟶ ATP + GMP - Propanoate metabolism ( Propanoate metabolism ):
ATP + CoA + Propanoic acid ⟶ AMP + Propanoyl-CoA + Pyrophosphate - CoA + ATP + Succinic acid = Succinyl-CoA + ADP + Orthophosphate ( Citrate cycle ):
ATP + CoA + Succinic acid ⟶ ADP + Orthophosphate + Succinyl-CoA - Tryptophan degradation ( Tryptophan degradation ):
L-Tryptophan + O2 ⟶ N-Formyl-L-kynurenine - ATP + CoA + Citric acid = ADP + Acetyl-CoA + Oxaloacetic acid + Orthophosphate ( Lysine degradation ):
ADP + Acetyl-CoA + Orthophosphate + Oxaloacetic acid ⟶ ATP + Citric acid + CoA - Pyruvate metabolism ( Pyruvate metabolism ):
ATP + Acetic acid + CoA ⟶ AMP + Acetyl-CoA + Pyrophosphate - ATP + IDP = ADP + ITP ( Purine nucleotides and Nucleosides metabolism ):
ADP + ITP ⟶ ATP + IDP - ATP + dUDP = ADP + dUTP ( Pyrimidine Nucleotides and Nucleosides metabolism ):
ADP + dUTP ⟶ ATP + dUDP - Folate metabolism ( Folate metabolism ):
6-Pyruvoyl-5,6,7,8-tetrahydro-pterin + NADPH ⟶ 5,6,7,8-Tetrahydro-biopterin + NADP+ - ATP + dAMP = ADP + dADP ( Purine nucleotides and Nucleosides metabolism ):
ADP + dADP ⟶ ATP + dAMP - ATP + dADP = ADP + dATP ( Purine nucleotides and Nucleosides metabolism ):
ATP + dADP ⟶ ADP + dATP - ATP + dTMP = ADP + dTDP ( Pyrimidine Nucleotides and Nucleosides metabolism ):
ATP + dTMP ⟶ ADP + dTDP - ATP + GDP = ADP + GTP ( Purine nucleotides and Nucleosides metabolism ):
ATP + GDP ⟶ ADP + GTP - Vitamin B6 metabolism ( Vitamin B6 metabolism ):
H2O + O2 + Pyridoxal ⟶ 4-Pyridoxic acid + H2O2 - ATP + L-Glutamic acid + NH3 = ADP + L-Glutamine + Orthophosphate ( Glutamic acid and Glutamine metabolism ):
ATP + L-Glutamic acid + NH3 ⟶ ADP + L-Glutamine + Orthophosphate - Inositol phosphate metabolism ( Inositol phosphate metabolism ):
O2 + myo-Inositol ⟶ D-Glucuronic acid + H2O - ATP + CDP = ADP + CTP ( Pyrimidine Nucleotides and Nucleosides metabolism ):
ATP + CDP ⟶ ADP + CTP - ATP + CMP = ADP + CDP ( Pyrimidine Nucleotides and Nucleosides metabolism ):
ADP + CDP ⟶ ATP + CMP - Steroids metabolism ( Steroids metabolism ):
7-Dehydro-cholesterol + NADP+ ⟶ Cholesterol + NADPH - ATP + dIDP = ADP + dITP ( Purine nucleotides and Nucleosides metabolism ):
ATP + dIDP ⟶ ADP + dITP - Valine,Leucine and Isoleucine degradation ( Valine,Leucine and Isoleucine degradation ):
2-Methyl-3-acetoacetyl-CoA + CoA ⟶ Acetyl-CoA + Propanoyl-CoA - UTP + AMP = UDP + ADP ( Pyrimidine Nucleotides and Nucleosides metabolism ):
ADP + UDP ⟶ AMP + UTP - ATP + UDP = ADP + UTP ( Pyrimidine Nucleotides and Nucleosides metabolism ):
ADP + UTP ⟶ ATP + UDP - Galactose metabolism ( Galactose metabolism ):
D-Glucose + UDP-D-galactose ⟶ Lactose + UDP - Nicotinate and Nicotinamide metabolism ( Nicotinate and Nicotinamide metabolism ):
ATP + Deamido-NAD+ + H2O + L-Glutamine ⟶ AMP + L-Glutamic acid + NAD+ + Pyrophosphate - ATP + AMP = 2 ADP ( Purine nucleotides and Nucleosides metabolism ):
AMP + ATP ⟶ ADP
PlantCyc(6)
- superpathway of cytosolic glycolysis (plants), pyruvate dehydrogenase and TCA cycle:
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate - lipid IVA biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + H+ + lipid IVA - biotin-carboxyl carrier protein assembly:
ATP + a [biotin carboxyl-carrier-protein dimer]-N6-biotinyl-L-lysine + hydrogencarbonate ⟶ ADP + H+ + a [carboxyl-carrier protein dimer]-N6-carboxybiotinyl-L-lysine + phosphate - L-leucine degradation I:
3-methylcrotonyl-CoA + ATP + hydrogencarbonate ⟶ 3-methylglutaconyl-CoA + ADP + H+ + phosphate - superpathway of lipid-dependent phytate biosynthesis:
ATP + D-myo-inositol 1,3,4,5,6-pentakisphosphate ⟶ ADP + H+ + Ins(1,2,3,4,5,6)P6 - pyrimidine deoxyribonucleotides de novo biosynthesis III:
ATP + dTDP ⟶ ADP + dTTP
COVID-19 Disease Map(3)
- @COVID-19 Disease
Map["name"]:
Adenosine + Pi ⟶ Adenine + _alpha_-D-Ribose 1-phosphate - @COVID-19 Disease
Map["name"]:
cytidine ⟶ uridine - @COVID-19 Disease
Map["name"]:
H_sub_2_endsub_O_sub_2_endsub_ + glutathione ⟶ H_sub_2_endsub_O + glutathione disulfide
PathBank(7752)
- Purine Metabolism:
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate - Adenosine Deaminase Deficiency:
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate - Adenylosuccinate Lyase Deficiency:
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate - Gout or Kelley-Seegmiller Syndrome:
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate - Lesch-Nyhan Syndrome (LNS):
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate - Molybdenum Cofactor Deficiency:
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate - Xanthine Dehydrogenase Deficiency (Xanthinuria):
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate - Purine Nucleoside Phosphorylase Deficiency:
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate - AICA-Ribosiduria:
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate - Azathioprine Action Pathway:
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate - Mercaptopurine Action Pathway:
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate - Thioguanine Action Pathway:
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate - Xanthinuria Type I:
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate - Xanthinuria Type II:
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate - Adenine Phosphoribosyltransferase Deficiency (APRT):
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate - Mitochondrial DNA Depletion Syndrome-3:
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate - Myoadenylate Deaminase Deficiency:
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate - Purine Nucleotides De Novo Biosynthesis:
N(6)-(1,2-dicarboxyethyl)AMP ⟶ Adenosine monophosphate + Fumaric acid - Purine Nucleotides De Novo Biosynthesis 2:
N(6)-(1,2-dicarboxyethyl)AMP ⟶ Adenosine monophosphate + Fumaric acid - Purine Nucleotides De Novo Biosynthesis:
N(6)-(1,2-dicarboxyethyl)AMP ⟶ Adenosine monophosphate + Fumaric acid - Purine Metabolism:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate - Adenosine Deaminase Deficiency:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate - Adenylosuccinate Lyase Deficiency:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate - AICA-Ribosiduria:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate - Gout or Kelley-Seegmiller Syndrome:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate - Xanthine Dehydrogenase Deficiency (Xanthinuria):
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate - Lesch-Nyhan Syndrome (LNS):
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate - Molybdenum Cofactor Deficiency:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate - Purine Nucleoside Phosphorylase Deficiency:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate - Xanthinuria Type I:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate - Xanthinuria Type II:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate - Adenine Phosphoribosyltransferase Deficiency (APRT):
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate - Mitochondrial DNA Depletion Syndrome:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate - Myoadenylate Deaminase Deficiency:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate - Purine Metabolism:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate - Purine Metabolism:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate - Adenosine Deaminase Deficiency:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate - Adenylosuccinate Lyase Deficiency:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate - AICA-Ribosiduria:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate - Gout or Kelley-Seegmiller Syndrome:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate - Xanthine Dehydrogenase Deficiency (Xanthinuria):
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate - Lesch-Nyhan Syndrome (LNS):
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate - Molybdenum Cofactor Deficiency:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate - Purine Nucleoside Phosphorylase Deficiency:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate - Xanthinuria Type I:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate - Xanthinuria Type II:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate - Adenine Phosphoribosyltransferase Deficiency (APRT):
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate - Mitochondrial DNA Depletion Syndrome:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate - Myoadenylate Deaminase Deficiency:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate - Purine Nucleotides De Novo Biosynthesis:
N(6)-(1,2-dicarboxyethyl)AMP ⟶ Adenosine monophosphate + Fumaric acid - Purine Nucleotides De Novo Biosynthesis 2:
N(6)-(1,2-dicarboxyethyl)AMP ⟶ Adenosine monophosphate + Fumaric acid - Glycolysis:
Adenosine triphosphate + D-Glucose ⟶ Adenosine diphosphate + Glucose 6-phosphate - Gluconeogenesis:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate - Glycogen Storage Disease Type 1A (GSD1A) or Von Gierke Disease:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate - Glycogenosis, Type VII. Tarui Disease:
Adenosine triphosphate + D-Glucose ⟶ Adenosine diphosphate + Glucose 6-phosphate - Phosphoenolpyruvate Carboxykinase Deficiency 1 (PEPCK1):
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate - Fructose-1,6-diphosphatase Deficiency:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate - Triosephosphate Isomerase Deficiency:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate - Fanconi-Bickel Syndrome:
Adenosine triphosphate + D-Glucose ⟶ Adenosine diphosphate + Glucose 6-phosphate - Glycogenosis, Type IB:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate - Glycogenosis, Type IC:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate - Glycogenosis, Type IA. Von Gierke Disease:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate - Warburg Effect:
L-Glutamic acid + NAD + Water ⟶ Ammonia + NADH + Oxoglutaric acid - Glycolysis and Pyruvate Dehydrogenase:
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water - Gluconeogenesis from L-Malic Acid:
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water - Glycolysis:
Adenosine triphosphate + D-Glucose ⟶ Adenosine diphosphate + Glucose 6-phosphate - Fructose Metabolism:
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water - Glycerol Metabolism:
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water - Glycerol Metabolism II:
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water - Glycerol Metabolism III (sn-Glycero-3-Phosphoethanolamine):
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water - Glycerol Metabolism IV (Glycerophosphoglycerol):
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water - Glycerol Metabolism V (Glycerophosphoserine):
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water - Glycolysis I:
Adenosine triphosphate + D-Glucose ⟶ Adenosine diphosphate + Glucose 6-phosphate - Gluconeogenesis from L-Malic Acid:
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water - Photosynthesis:
Fructose 1,6-bisphosphate + Water ⟶ Fructose 6-phosphate + Phosphate - Calvin-Benson Cycle:
Fructose 1,6-bisphosphate + Water ⟶ Fructose 6-phosphate + Phosphate - Glycolysis:
Adenosine triphosphate + D-Glucose ⟶ Adenosine diphosphate + Glucose 6-phosphate - Gluconeogenesis:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate - Glycogen Storage Disease Type 1A (GSD1A) or Von Gierke Disease:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate - Glycogenosis, Type VII. Tarui Disease:
Adenosine triphosphate + D-Glucose ⟶ Adenosine diphosphate + Glucose 6-phosphate - Phosphoenolpyruvate Carboxykinase Deficiency 1 (PEPCK1):
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate - Fructose-1,6-diphosphatase Deficiency:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate - Triosephosphate Isomerase Deficiency:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate - Fanconi-Bickel Syndrome:
Adenosine triphosphate + D-Glucose ⟶ Adenosine diphosphate + Glucose 6-phosphate - Glycogenosis, Type IB:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate - Glycogenosis, Type IC:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate - Glycogenosis, Type IA. Von Gierke Disease:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate - Warburg Effect:
L-Glutamic acid + NAD + Water ⟶ Ammonia + NADH + Oxoglutaric acid - Glycolysis:
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate - Gluconeogenesis:
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate - Warburg Effect:
L-Glutamine + Water ⟶ Ammonia + L-Glutamic acid - Glycolysis:
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate - Gluconeogenesis:
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate - Warburg Effect:
L-Glutamine + Water ⟶ Ammonia + L-Glutamic acid - Glycolysis:
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate - Warburg Effect:
L-Glutamine + Water ⟶ Ammonia + L-Glutamic acid - Glycolysis:
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate - Warburg Effect:
L-Glutamine + Water ⟶ Ammonia + L-Glutamic acid - Glycogen Storage Disease Type 1A (GSD1A) or Von Gierke Disease:
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate - Glycogenosis, Type VII. Tarui Disease:
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate - Phosphoenolpyruvate Carboxykinase Deficiency 1 (PEPCK1):
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate - Fructose-1,6-diphosphatase Deficiency:
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate - Triosephosphate Isomerase Deficiency:
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate - Fanconi-Bickel Syndrome:
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate - Glycogenosis, Type IB:
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate - Glycogenosis, Type IC:
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate - Glycogenosis, Type IA. Von Gierke Disease:
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate - Fructose Metabolism:
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water - Glycerol Metabolism:
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water - Glycerol Metabolism II:
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water - Glycerol Metabolism III (sn-Glycero-3-Phosphoethanolamine):
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water - Glycerol Metabolism IV (Glycerophosphoglycerol):
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water - Glycerol Metabolism V (Glycerophosphoserine):
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water - Alanine Metabolism:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate - Citric Acid Cycle:
Citric acid ⟶ Water + cis-Aconitic acid - Pyruvate Metabolism:
Acetic acid + Coenzyme A ⟶ Acetyl-CoA + Water - Primary Hyperoxaluria Type I:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate - Pyruvate Carboxylase Deficiency:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate - Lactic Acidemia:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate - Leigh Syndrome:
Acetic acid + Coenzyme A ⟶ Acetyl-CoA + Water - Pyruvate Decarboxylase E1 Component Deficiency (PDHE1 Deficiency):
Acetic acid + Coenzyme A ⟶ Acetyl-CoA + Water - Pyruvate Dehydrogenase Complex Deficiency:
Acetic acid + Coenzyme A ⟶ Acetyl-CoA + Water - Transfer of Acetyl Groups into Mitochondria:
D-Glucose ⟶ Pyruvic acid - Congenital Lactic Acidosis:
Citric acid ⟶ Water + cis-Aconitic acid - Fumarase Deficiency:
Citric acid ⟶ Water + cis-Aconitic acid - Mitochondrial Complex II Deficiency:
Citric acid ⟶ Water + cis-Aconitic acid - 2-Ketoglutarate Dehydrogenase Complex Deficiency:
Citric acid ⟶ Water + cis-Aconitic acid - Pyruvate Dehydrogenase Deficiency (E3):
Citric acid ⟶ Water + cis-Aconitic acid - Pyruvate Dehydrogenase Deficiency (E2):
Citric acid ⟶ Water + cis-Aconitic acid - Primary Hyperoxaluria II, PH2:
Acetic acid + Coenzyme A ⟶ Acetyl-CoA + Water - Pyruvate Kinase Deficiency:
Acetic acid + Coenzyme A ⟶ Acetyl-CoA + Water - D-Glucarate and D-Galactarate Degradation:
Adenosine triphosphate + Pyruvic acid + Water ⟶ Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid - The Oncogenic Action of 2-Hydroxyglutarate:
L-Glutamine + Water ⟶ Ammonia + L-Glutamic acid - The Oncogenic Action of Succinate:
Citric acid ⟶ Water + cis-Aconitic acid - The Oncogenic Action of Fumarate:
Citric acid ⟶ Water + cis-Aconitic acid - Glutaminolysis and Cancer:
L-Glutamine ⟶ Ammonia + L-Glutamic acid - TCA Cycle:
Citric acid ⟶ Water + cis-Aconitic acid - Pyruvate Metabolism:
2-Isopropylmalic acid + Coenzyme A ⟶ -Ketoisovaleric acid + Acetyl-CoA + Water - Ethanol Fermentation:
Adenosine triphosphate + D-Glucose ⟶ Adenosine diphosphate + Glucose 6-phosphate - The Oncogenic Action of L-2-Hydroxyglutarate in Hydroxyglutaric aciduria:
L-Glutamine + Water ⟶ Ammonia + L-Glutamic acid - The Oncogenic Action of D-2-Hydroxyglutarate in Hydroxyglutaric aciduria:
L-Glutamine + Water ⟶ Ammonia + L-Glutamic acid - Citric Acid Cycle:
Citric acid ⟶ Water + cis-Aconitic acid - Alanine Metabolism:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate - Pyruvate Metabolism:
Acetaldehyde + NAD + Water ⟶ Acetic acid + Hydrogen Ion + NADH - Transfer of Acetyl Groups into Mitochondria:
D-Glucose ⟶ Pyruvic acid - Lactic Acidemia:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate - Leigh Syndrome:
Acetaldehyde + NAD + Water ⟶ Acetic acid + Hydrogen Ion + NADH - Pyruvate Dehydrogenase Complex Deficiency:
Acetaldehyde + NAD + Water ⟶ Acetic acid + Hydrogen Ion + NADH - Pyruvate Decarboxylase E1 Component Deficiency (PDHE1 Deficiency):
Acetaldehyde + NAD + Water ⟶ Acetic acid + Hydrogen Ion + NADH - Pyruvate Carboxylase Deficiency:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate - Primary Hyperoxaluria Type I:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate - Congenital Lactic Acidosis:
Citric acid ⟶ Water + cis-Aconitic acid - Fumarase Deficiency:
Citric acid ⟶ Water + cis-Aconitic acid - Mitochondrial Complex II Deficiency:
Citric acid ⟶ Water + cis-Aconitic acid - 2-Ketoglutarate Dehydrogenase Complex Deficiency:
Citric acid ⟶ Water + cis-Aconitic acid - Pyruvate Dehydrogenase Deficiency (E3):
Citric acid ⟶ Water + cis-Aconitic acid - Pyruvate Dehydrogenase Deficiency (E2):
Citric acid ⟶ Water + cis-Aconitic acid - Primary Hyperoxaluria II, PH2:
Acetaldehyde + NAD + Water ⟶ Acetic acid + Hydrogen Ion + NADH - Pyruvate Kinase Deficiency:
Acetaldehyde + NAD + Water ⟶ Acetic acid + Hydrogen Ion + NADH - Citric Acid Cycle:
Citric acid ⟶ Water + cis-Aconitic acid - Alanine Metabolism:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate - Pyruvate Metabolism:
Acetaldehyde + NAD + Water ⟶ Acetic acid + Hydrogen Ion + NADH - Transfer of Acetyl Groups into Mitochondria:
L-Malic acid + NAD ⟶ Hydrogen Ion + NADH + Oxalacetic acid - Citric Acid Cycle:
Citric acid ⟶ Water + cis-Aconitic acid - Alanine Metabolism:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate - Pyruvate Metabolism:
Acetaldehyde + NAD + Water ⟶ Acetic acid + Hydrogen Ion + NADH - Transfer of Acetyl Groups into Mitochondria:
L-Malic acid + NAD ⟶ Hydrogen Ion + NADH + Oxalacetic acid - Citric Acid Cycle:
Citric acid ⟶ Water + cis-Aconitic acid - Alanine Metabolism:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate - Pyruvate Metabolism:
Acetic acid + Coenzyme A ⟶ Acetyl-CoA + Water - Transfer of Acetyl Groups into Mitochondria:
L-Malic acid + NAD ⟶ Hydrogen Ion + NADH + Oxalacetic acid - Citric Acid Cycle:
Citric acid ⟶ Water + cis-Aconitic acid - Alanine Metabolism:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate - Pyruvate Metabolism:
Acetic acid + Coenzyme A ⟶ Acetyl-CoA + Water - Transfer of Acetyl Groups into Mitochondria:
L-Malic acid + NAD ⟶ Hydrogen Ion + NADH + Oxalacetic acid - The Oncogenic Action of 2-Hydroxyglutarate:
L-Glutamine + Water ⟶ Ammonia + L-Glutamic acid - Glutaminolysis and Cancer:
L-Glutamine ⟶ Ammonia + L-Glutamic acid - The Oncogenic Action of 2-Hydroxyglutarate:
L-Glutamine + Water ⟶ Ammonia + L-Glutamic acid - Glutaminolysis and Cancer:
L-Glutamine ⟶ Ammonia + L-Glutamic acid - Lactic Acidemia:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate - Leigh Syndrome:
Acetaldehyde + NAD + Water ⟶ Acetic acid + Hydrogen Ion + NADH - Pyruvate Dehydrogenase Complex Deficiency:
Acetaldehyde + NAD + Water ⟶ Acetic acid + Hydrogen Ion + NADH - Pyruvate Decarboxylase E1 Component Deficiency (PDHE1 Deficiency):
Acetaldehyde + NAD + Water ⟶ Acetic acid + Hydrogen Ion + NADH - Pyruvate Carboxylase Deficiency:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate - Primary Hyperoxaluria Type I:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate - Congenital Lactic Acidosis:
Citric acid ⟶ Water + cis-Aconitic acid - Fumarase Deficiency:
Citric acid ⟶ Water + cis-Aconitic acid - Mitochondrial Complex II Deficiency:
Citric acid ⟶ Water + cis-Aconitic acid - 2-Ketoglutarate Dehydrogenase Complex Deficiency:
Citric acid ⟶ Water + cis-Aconitic acid - Pyruvate Dehydrogenase Deficiency (E3):
Citric acid ⟶ Water + cis-Aconitic acid - Pyruvate Dehydrogenase Deficiency (E2):
Citric acid ⟶ Water + cis-Aconitic acid - Primary Hyperoxaluria II, PH2:
Acetaldehyde + NAD + Water ⟶ Acetic acid + Hydrogen Ion + NADH - Pyruvate Kinase Deficiency:
Acetaldehyde + NAD + Water ⟶ Acetic acid + Hydrogen Ion + NADH - Citrate Cycle:
Isocitric acid ⟶ Water + cis-Aconitic acid - D-Glucarate and D-Galactarate Degradation:
Adenosine triphosphate + Pyruvic acid + Water ⟶ Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid - Oxidation of Branched-Chain Fatty Acids:
L-Carnitine + Propionyl-CoA ⟶ Coenzyme A + Propionylcarnitine - Oxidation of Branched-Chain Fatty Acids:
L-Carnitine + Propionyl-CoA ⟶ Coenzyme A + Propionylcarnitine - Oxidation of Branched-Chain Fatty Acids:
L-Carnitine + Propionyl-CoA ⟶ Coenzyme A + Propionylcarnitine - Oxidation of Branched-Chain Fatty Acids:
L-Carnitine + Propionyl-CoA ⟶ Coenzyme A + Propionylcarnitine - Oxidation of Branched-Chain Fatty Acids:
L-Carnitine + Propionyl-CoA ⟶ Coenzyme A + Propionylcarnitine - Oxidation of Branched-Chain Fatty Acids:
L-Carnitine + Propionyl-CoA ⟶ Coenzyme A + Propionylcarnitine - Mercaptopurine Metabolism Pathway:
Adenosine triphosphate + L-Glutamine + Thioxanthine monophosphate + Water ⟶ 6-Thioguanosine monophosphate + Adenosine monophosphate + Pyrophosphate - Lysolipid Incorporation into ER PC(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
Glycerophosphocholine + Water ⟶ Choline + Glycerol 3-phosphate + Hydrogen Ion - Lysolipid incorporation into Mitochondria PC(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + LysoPC(20:4(5Z,8Z,11Z,14Z)) + Water ⟶ Adenosine diphosphate + LysoPC(20:4(5Z,8Z,11Z,14Z)) + Phosphate - Pantothenate and CoA Biosynthesis:
Dephospho-CoA + Water ⟶ Adenosine monophosphate + Pantetheine 4'-phosphate - Pantothenate and CoA Biosynthesis:
-Ketoisovaleric acid + 5,10-Methylene-THF + Water ⟶ 2-dehydropantoate + Tetrahydrofolic acid - beta-Alanine Metabolism:
(R)-pantoate + -Alanine + Adenosine triphosphate ⟶ Adenosine monophosphate + Hydrogen Ion + Pantothenic acid + Pyrophosphate - beta-Alanine Metabolism:
(R)-pantoate + -Alanine + Adenosine triphosphate ⟶ Adenosine monophosphate + Hydrogen Ion + Pantothenic acid + Pyrophosphate - Pantothenate and CoA Biosynthesis:
-Ketoisovaleric acid + 5,10-Methylene-THF + Water ⟶ 2-dehydropantoate + Tetrahydrofolic acid - Pantothenate and CoA Biosynthesis:
Dephospho-CoA + Water ⟶ Adenosine monophosphate + Pantetheine 4'-phosphate - Pantothenate and CoA Biosynthesis:
Dephospho-CoA + Water ⟶ Adenosine monophosphate + Pantetheine 4'-phosphate - Pantothenate and CoA Biosynthesis:
Dephospho-CoA + Water ⟶ Adenosine monophosphate + Pantetheine 4'-phosphate - Pantothenate and CoA Biosynthesis:
Dephospho-CoA + Water ⟶ Adenosine monophosphate + Pantetheine 4'-phosphate - Pantothenate and CoA Biosynthesis:
Dephospho-CoA + Water ⟶ Adenosine monophosphate + Pantetheine 4'-phosphate - Pantothenate and CoA Biosynthesis:
-Ketoisovaleric acid + 5,10-Methylene-THF + Water ⟶ 2-dehydropantoate + Tetrahydrofolic acid - Inositol Metabolism:
Oxygen + myo-Inositol ⟶ D-Glucuronic acid + Water - Inositol Phosphate Metabolism:
1D-myo-Inositol 3-phosphate + Water ⟶ Phosphate + myo-Inositol - Inositol Metabolism:
Oxygen + myo-Inositol ⟶ D-Glucuronic acid + Water - Inositol Phosphate Metabolism:
Myo-inositol 1-phosphate + Water ⟶ Phosphate + myo-Inositol - Inositol Metabolism:
Oxygen + myo-Inositol ⟶ D-Glucuronic acid + Water - Inositol Phosphate Metabolism:
Myo-inositol 1-phosphate + Water ⟶ Phosphate + myo-Inositol - Inositol Metabolism:
Oxygen + myo-Inositol ⟶ D-Glucuronic acid + Water - Inositol Phosphate Metabolism:
Myo-inositol 1-phosphate + Water ⟶ Phosphate + myo-Inositol - Inositol Metabolism:
Oxygen + myo-Inositol ⟶ D-Glucuronic acid + Water - Inositol Phosphate Metabolism:
Myo-inositol 1-phosphate + Water ⟶ Phosphate + myo-Inositol - Inositol Metabolism:
Oxygen + myo-Inositol ⟶ D-Glucuronic acid + Water - Inositol Phosphate Metabolism:
Myo-inositol 1-phosphate + Water ⟶ Phosphate + myo-Inositol - D-Allulose Degradation:
Adenosine triphosphate + D-allopyranose + Water ⟶ Adenosine diphosphate + D-allopyranose + Hydrogen Ion + Phosphate - Acetaminophen Metabolism Pathway:
Acetaminophen + Phosphoadenosine phosphosulfate ⟶ Adenosine 3',5'-diphosphate + Paracetamol sulfate - Sedoheptulose Bisphosphate Bypass:
Adenosine triphosphate + D-Sedoheptulose 7-phosphate ⟶ Adenosine diphosphate + Hydrogen Ion + Sedoheptulose 1,7-bisphosphate - Pyrimidine Metabolism:
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine - Urea Cycle:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate - Arginine and Proline Metabolism:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Glutamate Metabolism:
Adenosine triphosphate + L-Glutamine + Nicotinic acid adenine dinucleotide + Water ⟶ Adenosine monophosphate + L-Glutamic acid + NAD + Pyrophosphate - Ammonia Recycling:
Adenosine triphosphate + L-Aspartic acid + L-Glutamine + Water ⟶ Adenosine monophosphate + L-Asparagine + L-Glutamic acid + Pyrophosphate - 4-Hydroxybutyric Aciduria/Succinic Semialdehyde Dehydrogenase Deficiency:
Adenosine triphosphate + L-Glutamine + Nicotinic acid adenine dinucleotide + Water ⟶ Adenosine monophosphate + L-Glutamic acid + NAD + Pyrophosphate - Homocarnosinosis:
Adenosine triphosphate + L-Glutamine + Nicotinic acid adenine dinucleotide + Water ⟶ Adenosine monophosphate + L-Glutamic acid + NAD + Pyrophosphate - Hyperinsulinism-Hyperammonemia Syndrome:
Adenosine triphosphate + L-Glutamine + Nicotinic acid adenine dinucleotide + Water ⟶ Adenosine monophosphate + L-Glutamic acid + NAD + Pyrophosphate - Prolidase Deficiency (PD):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Arginine: Glycine Amidinotransferase Deficiency (AGAT Deficiency):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Hyperprolinemia Type II:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Hyperprolinemia Type I:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Prolinemia Type II:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Guanidinoacetate Methyltransferase Deficiency (GAMT Deficiency):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Ornithine Aminotransferase Deficiency (OAT Deficiency):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Argininemia:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate - Argininosuccinic Aciduria:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate - Citrullinemia Type I:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate - Ornithine Transcarbamylase Deficiency (OTC Deficiency):
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate - beta-Ureidopropionase Deficiency:
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine - UMP Synthase Deficiency (Orotic Aciduria):
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine - Dihydropyrimidinase Deficiency:
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine - MNGIE (Mitochondrial Neurogastrointestinal Encephalopathy):
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine - Carbamoyl Phosphate Synthetase Deficiency:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate - 2-Hydroxyglutric Aciduria (D and L Form):
Adenosine triphosphate + L-Glutamine + Nicotinic acid adenine dinucleotide + Water ⟶ Adenosine monophosphate + L-Glutamic acid + NAD + Pyrophosphate - Creatine Deficiency, Guanidinoacetate Methyltransferase Deficiency:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Hyperornithinemia with Gyrate Atrophy (HOGA):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Hyperornithinemia-Hyperammonemia-Homocitrullinuria [HHH-syndrome]:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - L-Arginine:Glycine Amidinotransferase Deficiency:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Succinic Semialdehyde Dehydrogenase Deficiency:
Adenosine triphosphate + L-Glutamine + Nicotinic acid adenine dinucleotide + Water ⟶ Adenosine monophosphate + L-Glutamic acid + NAD + Pyrophosphate - Arginine Metabolism:
N-Acetylornithine + Water ⟶ Acetic acid + Ornithine - Pyrimidine Metabolism:
Hydrogen Ion + N-carbamoyl-L-aspartate ⟶ 4,5-Dihydroorotic acid + Water - Allantoin Degradation (Anaerobic):
(S)-Ureidoglycolic acid + NADP ⟶ Hydrogen Ion + NADPH + Oxalureate - Pyrimidine Metabolism:
Hydrogen Ion + N-carbamoyl-L-aspartate ⟶ 4,5-Dihydroorotic acid + Water - Arginine Metabolism:
N-Acetylornithine + Water ⟶ Acetic acid + Ornithine - Proline Metabolism:
N-Acetylornithine + Water ⟶ Acetic acid + Ornithine - Arginine and Proline Metabolism:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Ammonia Recycling:
Adenosine triphosphate + L-Aspartic acid + L-Glutamine + Water ⟶ Adenosine monophosphate + L-Asparagine + L-Glutamic acid + Pyrophosphate - Glutamate Metabolism:
Adenosine triphosphate + L-Glutamine ⟶ Adenosine monophosphate + Pyrophosphate - Arginine and Proline Metabolism:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Pyrimidine Metabolism:
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine - Urea Cycle:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate - 2-Hydroxyglutric Aciduria (D and L Form):
Adenosine triphosphate + L-Glutamine + Water + Xanthylic acid ⟶ Adenosine monophosphate + Guanosine monophosphate + L-Glutamic acid + Pyrophosphate - 4-Hydroxybutyric Aciduria/Succinic Semialdehyde Dehydrogenase Deficiency:
Adenosine triphosphate + L-Glutamine + Water + Xanthylic acid ⟶ Adenosine monophosphate + Guanosine monophosphate + L-Glutamic acid + Pyrophosphate - Arginine: Glycine Amidinotransferase Deficiency (AGAT Deficiency):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Argininemia:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate - Argininosuccinic Aciduria:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate - beta-Ureidopropionase Deficiency:
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine - Carbamoyl Phosphate Synthetase Deficiency:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate - Citrullinemia Type I:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate - Dihydropyrimidinase Deficiency:
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine - Guanidinoacetate Methyltransferase Deficiency (GAMT Deficiency):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Homocarnosinosis:
Adenosine triphosphate + L-Glutamine + Water + Xanthylic acid ⟶ Adenosine monophosphate + Guanosine monophosphate + L-Glutamic acid + Pyrophosphate - Hyperinsulinism-Hyperammonemia Syndrome:
Adenosine triphosphate + L-Glutamine + Water + Xanthylic acid ⟶ Adenosine monophosphate + Guanosine monophosphate + L-Glutamic acid + Pyrophosphate - Hyperprolinemia Type I:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Hyperprolinemia Type II:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - UMP Synthase Deficiency (Orotic Aciduria):
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine - MNGIE (Mitochondrial Neurogastrointestinal Encephalopathy):
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine - Ornithine Aminotransferase Deficiency (OAT Deficiency):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Prolinemia Type II:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Prolidase Deficiency (PD):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Ornithine Transcarbamylase Deficiency (OTC Deficiency):
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate - Creatine Deficiency, Guanidinoacetate Methyltransferase Deficiency:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Hyperornithinemia with Gyrate Atrophy (HOGA):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Hyperornithinemia-Hyperammonemia-Homocitrullinuria [HHH-syndrome]:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - L-Arginine:Glycine Amidinotransferase Deficiency:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Succinic Semialdehyde Dehydrogenase Deficiency:
Adenosine triphosphate + L-Glutamine + Water + Xanthylic acid ⟶ Adenosine monophosphate + Guanosine monophosphate + L-Glutamic acid + Pyrophosphate - Glutamate Metabolism:
Adenosine triphosphate + L-Glutamine + Water + Xanthylic acid ⟶ Adenosine monophosphate + Guanosine monophosphate + L-Glutamic acid + Pyrophosphate - Ammonia Recycling:
Adenosine triphosphate + L-Aspartic acid + L-Glutamine + Water ⟶ Adenosine monophosphate + L-Asparagine + L-Glutamic acid + Pyrophosphate - Arginine and Proline Metabolism:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Urea Cycle:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate - Pyrimidine Metabolism:
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine - Glutamate Metabolism:
Adenosine triphosphate + L-Glutamine + Water + Xanthylic acid ⟶ Adenosine monophosphate + Guanosine monophosphate + L-Glutamic acid + Pyrophosphate - Ammonia Recycling:
Adenosine triphosphate + L-Aspartic acid + L-Glutamine + Water ⟶ Adenosine monophosphate + L-Asparagine + L-Glutamic acid + Pyrophosphate - Arginine and Proline Metabolism:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Urea Cycle:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate - Pyrimidine Metabolism:
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine - Glutamate Metabolism:
Adenosine triphosphate + L-Glutamine + Water + Xanthylic acid ⟶ Adenosine monophosphate + Guanosine monophosphate + L-Glutamic acid + Pyrophosphate - Ammonia Recycling:
Adenosine triphosphate + L-Aspartic acid + L-Glutamine + Water ⟶ Adenosine monophosphate + L-Asparagine + L-Glutamic acid + Pyrophosphate - Pyrimidine Metabolism:
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine - Glutamate Metabolism:
Adenosine triphosphate + L-Glutamine + Water + Xanthylic acid ⟶ Adenosine monophosphate + Guanosine monophosphate + L-Glutamic acid + Pyrophosphate - Ammonia Recycling:
Adenosine triphosphate + L-Aspartic acid + L-Glutamine + Water ⟶ Adenosine monophosphate + L-Asparagine + L-Glutamic acid + Pyrophosphate - Pyrimidine Metabolism:
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine - 2-Hydroxyglutric Aciduria (D and L Form):
Adenosine triphosphate + L-Glutamine ⟶ Adenosine monophosphate + Pyrophosphate - 4-Hydroxybutyric Aciduria/Succinic Semialdehyde Dehydrogenase Deficiency:
Adenosine triphosphate + L-Glutamine ⟶ Adenosine monophosphate + Pyrophosphate - Arginine: Glycine Amidinotransferase Deficiency (AGAT Deficiency):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Argininemia:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate - Argininosuccinic Aciduria:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate - beta-Ureidopropionase Deficiency:
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine - Carbamoyl Phosphate Synthetase Deficiency:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate - Citrullinemia Type I:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate - Dihydropyrimidinase Deficiency:
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine - Guanidinoacetate Methyltransferase Deficiency (GAMT Deficiency):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Homocarnosinosis:
Adenosine triphosphate + L-Glutamine ⟶ Adenosine monophosphate + Pyrophosphate - Hyperinsulinism-Hyperammonemia Syndrome:
Adenosine triphosphate + L-Glutamine ⟶ Adenosine monophosphate + Pyrophosphate - Hyperprolinemia Type I:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Hyperprolinemia Type II:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - UMP Synthase Deficiency (Orotic Aciduria):
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine - MNGIE (Mitochondrial Neurogastrointestinal Encephalopathy):
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine - Ornithine Aminotransferase Deficiency (OAT Deficiency):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Prolinemia Type II:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Prolidase Deficiency (PD):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Ornithine Transcarbamylase Deficiency (OTC Deficiency):
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate - Creatine Deficiency, Guanidinoacetate Methyltransferase Deficiency:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Hyperornithinemia with Gyrate Atrophy (HOGA):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Hyperornithinemia-Hyperammonemia-Homocitrullinuria [HHH-syndrome]:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - L-Arginine:Glycine Amidinotransferase Deficiency:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine - Succinic Semialdehyde Dehydrogenase Deficiency:
Adenosine triphosphate + L-Glutamine ⟶ Adenosine monophosphate + Pyrophosphate - Arginine Metabolism:
N-Acetylornithine + Water ⟶ Acetic acid + Ornithine - Pyrimidine Metabolism:
Hydrogen Ion + N-carbamoyl-L-aspartate ⟶ 4,5-Dihydroorotic acid + Water - Allantoin Degradation (Anaerobic):
Adenosine diphosphate + Carbamoyl phosphate + Hydrogen Ion ⟶ Adenosine triphosphate + Ammonium + Carbon dioxide - Sphingolipid Metabolism:
Glucosylceramide (d18:1/18:0) + Water ⟶ Ceramide (d18:1/18:0) + D-Glucose - Gaucher Disease:
Glucosylceramide (d18:1/18:0) + Water ⟶ Ceramide (d18:1/18:0) + D-Glucose - Globoid Cell Leukodystrophy:
Glucosylceramide (d18:1/18:0) + Water ⟶ Ceramide (d18:1/18:0) + D-Glucose - Metachromatic Leukodystrophy (MLD):
Glucosylceramide (d18:1/18:0) + Water ⟶ Ceramide (d18:1/18:0) + D-Glucose - Fabry Disease:
Glucosylceramide (d18:1/18:0) + Water ⟶ Ceramide (d18:1/18:0) + D-Glucose - Krabbe Disease:
Glucosylceramide (d18:1/18:0) + Water ⟶ Ceramide (d18:1/18:0) + D-Glucose - Sphingolipid Metabolism:
Galactosylceramide (d18:1/16:0) + Phosphoadenosine phosphosulfate ⟶ 3-O-Sulfogalactosylceramide (d18:1/24:0) + Adenosine 3',5'-diphosphate - Gaucher Disease:
Galactosylceramide (d18:1/16:0) + Phosphoadenosine phosphosulfate ⟶ 3-O-Sulfogalactosylceramide (d18:1/24:0) + Adenosine 3',5'-diphosphate - Globoid Cell Leukodystrophy:
Galactosylceramide (d18:1/16:0) + Phosphoadenosine phosphosulfate ⟶ 3-O-Sulfogalactosylceramide (d18:1/24:0) + Adenosine 3',5'-diphosphate - Metachromatic Leukodystrophy (MLD):
Galactosylceramide (d18:1/16:0) + Phosphoadenosine phosphosulfate ⟶ 3-O-Sulfogalactosylceramide (d18:1/24:0) + Adenosine 3',5'-diphosphate - Fabry Disease:
Galactosylceramide (d18:1/16:0) + Phosphoadenosine phosphosulfate ⟶ 3-O-Sulfogalactosylceramide (d18:1/24:0) + Adenosine 3',5'-diphosphate - Krabbe Disease:
Galactosylceramide (d18:1/16:0) + Phosphoadenosine phosphosulfate ⟶ 3-O-Sulfogalactosylceramide (d18:1/24:0) + Adenosine 3',5'-diphosphate - Sphingolipid Metabolism:
Galactosylceramide (d18:1/16:0) + Phosphoadenosine phosphosulfate ⟶ 3-O-Sulfogalactosylceramide (d18:1/24:0) + Adenosine 3',5'-diphosphate - Sphingolipid Metabolism:
Galactosylceramide (d18:1/16:0) + Phosphoadenosine phosphosulfate ⟶ 3-O-Sulfogalactosylceramide (d18:1/24:0) + Adenosine 3',5'-diphosphate - Sphingolipid Metabolism:
Galactosylceramide (d18:1/16:0) + Phosphoadenosine phosphosulfate ⟶ 3-O-Sulfogalactosylceramide (d18:1/24:0) + Adenosine 3',5'-diphosphate - Sphingolipid Metabolism:
Galactosylceramide (d18:1/16:0) + Phosphoadenosine phosphosulfate ⟶ 3-O-Sulfogalactosylceramide (d18:1/24:0) + Adenosine 3',5'-diphosphate - Gaucher Disease:
Galactosylceramide (d18:1/16:0) + Phosphoadenosine phosphosulfate ⟶ 3-O-Sulfogalactosylceramide (d18:1/24:0) + Adenosine 3',5'-diphosphate - Globoid Cell Leukodystrophy:
Galactosylceramide (d18:1/16:0) + Phosphoadenosine phosphosulfate ⟶ 3-O-Sulfogalactosylceramide (d18:1/24:0) + Adenosine 3',5'-diphosphate - Metachromatic Leukodystrophy (MLD):
Galactosylceramide (d18:1/16:0) + Phosphoadenosine phosphosulfate ⟶ 3-O-Sulfogalactosylceramide (d18:1/24:0) + Adenosine 3',5'-diphosphate - Fabry Disease:
Galactosylceramide (d18:1/16:0) + Phosphoadenosine phosphosulfate ⟶ 3-O-Sulfogalactosylceramide (d18:1/24:0) + Adenosine 3',5'-diphosphate - Krabbe Disease:
Galactosylceramide (d18:1/16:0) + Phosphoadenosine phosphosulfate ⟶ 3-O-Sulfogalactosylceramide (d18:1/24:0) + Adenosine 3',5'-diphosphate - Adenine and Adenosine Salvage II:
Adenine + Ribose 1-phosphate ⟶ Adenosine + Phosphate - Pyrimidine Deoxyribonucleosides Salvage:
Deoxycytidine + Hydrogen Ion + Water ⟶ Ammonium + Deoxyuridine - Lactose Synthesis:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate - Congenital Disorder of Glycosylation CDG-IId:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate - GLUT-1 Deficiency Syndrome:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate - Lactose Synthesis:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate - Congenital Disorder of Glycosylation CDG-IId:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate - GLUT-1 Deficiency Syndrome:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate - Lactose Synthesis:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate - Lactose Synthesis:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate - Lactose Synthesis:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate - Lactose Synthesis:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate - Congenital Disorder of Glycosylation CDG-IId:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate - GLUT-1 Deficiency Syndrome:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate - Amino Sugar Metabolism:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate - Sialuria or French Type Sialuria:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate - Salla Disease/Infantile Sialic Acid Storage Disease:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate - Tay-Sachs Disease:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate - G(M2)-Gangliosidosis: Variant B, Tay-Sachs Disease:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate - Amino Sugar and Nucleotide Sugar Metabolism I:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate - Amino Sugar and Nucleotide Sugar Metabolism II:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate - Amino Sugar and Nucleotide Sugar Metabolism III:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate - Amino Sugar Metabolism:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate - Sialuria or French Type Sialuria:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate - Salla Disease/Infantile Sialic Acid Storage Disease:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate - Tay-Sachs Disease:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate - G(M2)-Gangliosidosis: Variant B, Tay-Sachs Disease:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate - Amino Sugar Metabolism:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate - Amino Sugar Metabolism:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate - Amino Sugar Metabolism:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate - Sialuria or French Type Sialuria:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate - Salla Disease/Infantile Sialic Acid Storage Disease:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate - Tay-Sachs Disease:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate - G(M2)-Gangliosidosis: Variant B, Tay-Sachs Disease:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate - Amino Sugar and Nucleotide Sugar Metabolism I:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate - Amino Sugar and Nucleotide Sugar Metabolism III:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate - Glycerol Metabolism:
Dihydroxyacetone + Hydrogen Ion + NADPH ⟶ Glycerol + NADP - Ascorbate Metabolism:
Ascorbic acid + Hydrogen Ion + Hydrogen peroxide ⟶ Ascorbic acid + Dehydroascorbic acid + Water - L-Arabinose Degradation I:
L-Arabinose ⟶ L-Ribulose - Docetaxel Action Pathway:
Adenosine triphosphate + Docetaxel + Water ⟶ Adenosine diphosphate + Docetaxel + Phosphate - Salvage Pathways of Pyrimidine Deoxyribonucleotides:
Deoxycytidine + Hydrogen Ion + Water ⟶ Ammonium + Deoxyuridine - Vinblastine Action Pathway:
Adenosine triphosphate + Vinblastine + Water ⟶ Adenosine diphosphate + Phosphate + Vinblastine - Acetate Metabolism:
Acetylphosphate + Adenosine diphosphate ⟶ Acetic acid + Adenosine triphosphate - Acetate Metabolism:
Acetylphosphate + Adenosine diphosphate ⟶ Acetic acid + Adenosine triphosphate - Lysine Metabolism:
Hydrogen Ion + meso-diaminopimelate ⟶ Carbon dioxide + L-Lysine - Fructose and Mannose Degradation:
D-Fructose 2,6-bisphosphate + Water ⟶ Fructose 6-phosphate + Phosphate - Fructosuria:
D-Fructose 2,6-bisphosphate + Water ⟶ Fructose 6-phosphate + Phosphate - Fructose Intolerance, Hereditary:
D-Fructose 2,6-bisphosphate + Water ⟶ Fructose 6-phosphate + Phosphate - Mannose Metabolism:
Adenosine triphosphate + D-Mannose ⟶ Adenosine diphosphate + Hydrogen Ion + Mannose 6-phosphate - Amino Sugar and Nucleotide Sugar Metabolism:
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate - Mannose Metabolism:
ADP-Mannose + Water ⟶ Adenosine monophosphate + D-Mannose 1-phosphate - Fructose and Mannose Degradation:
Fructose 1,6-bisphosphate + Water ⟶ Fructose 6-phosphate + Phosphate - Fructose Intolerance, Hereditary:
Fructose 1,6-bisphosphate + Water ⟶ Fructose 6-phosphate + Phosphate - Fructosuria:
Adenosine triphosphate + D-Fructose ⟶ Adenosine diphosphate + Fructose 6-phosphate - Fructose Intolerance, Hereditary:
Adenosine triphosphate + D-Fructose ⟶ Adenosine diphosphate + Fructose 6-phosphate - Fructose and Mannose Degradation:
Adenosine triphosphate + D-Fructose ⟶ Adenosine diphosphate + Fructose 6-phosphate - Fructose and Mannose Degradation:
Adenosine triphosphate + D-Fructose ⟶ Adenosine diphosphate + Fructose 6-phosphate - Fructosuria:
Fructose 1,6-bisphosphate + Water ⟶ Fructose 6-phosphate + Phosphate - D-Alanine Metabolism:
L-Alanine ⟶ D-Alanine - L-Alanine Metabolism:
L-Valine + Pyruvic acid ⟶ -Ketoisovaleric acid + L-Alanine - Peptidoglycan Biosynthesis I:
Adenosine triphosphate + L-Alanine + UDP-N-acetyl- -D-muramate ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate + UDP-N-acetylmuramoyl-L-alanine - Peptidoglycan Biosynthesis II:
Adenosine triphosphate + L-Alanine + UDP-N-acetyl- -D-muramate ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate + UDP-N-Acetylmuramyl-L-Ala - D-Alanine Metabolism:
L-Alanine ⟶ D-Alanine - L-Alanine Metabolism:
L-Valine + Pyruvic acid ⟶ -Ketoisovaleric acid + L-Alanine - Peptidoglycan Biosynthesis I:
Adenosine triphosphate + L-Alanine + UDP-N-acetyl- -D-muramate ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate + UDP-N-acetylmuramoyl-L-alanine - Peptidoglycan Biosynthesis II:
Adenosine triphosphate + L-Alanine + UDP-N-acetyl- -D-muramate ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate + UDP-N-Acetylmuramyl-L-Ala - Fucose and Rhamnose Degradation:
-L-fucopyranose ⟶ L-fuculose - Vincristine Action Pathway:
Adenosine triphosphate + Vincristine + Water ⟶ Adenosine diphosphate + Phosphate + Vincristine - Fructoselysine and Psicoselysine Degradation:
Fructoselysine-6-phosphate + Water ⟶ -D-Glucose 6-phosphate + L-Lysine - Gemcitabine Action Pathway:
Gemcitabine Monophosphate + Water ⟶ Ammonia + Difluorodeoxyuridine monophosphate - Gemcitabine Metabolism Pathway:
Gemcitabine Monophosphate + Water ⟶ Ammonia + Difluorodeoxyuridine monophosphate - D-Glutamine and D-Glutamate Metabolism:
L-Glutamine + Water ⟶ Ammonia + L-Glutamic acid - D-Glutamine and D-Glutamate Metabolism:
L-Glutamine + Water ⟶ Ammonia + L-Glutamic acid - Fructose Metabolism:
Adenosine triphosphate + D-Fructose ⟶ -D-Fructose 6-phosphate + Adenosine diphosphate - Lipopolysaccharide Biosynthesis:
UDP-3-O-[(3R)-3-hydroxymyristoyl]-N-acetyl- -D-glucosamine + Water ⟶ Acetic acid + UDP-3-O-(3-hydroxymyristoyl)- -D-glucosamine - Lipopolysaccharide Biosynthesis II:
UDP-3-O-[(3R)-3-hydroxymyristoyl]-N-acetyl- -D-glucosamine + Water ⟶ Acetic acid + UDP-3-O-(3-hydroxymyristoyl)- -D-glucosamine - Lipopolysaccharide Biosynthesis III:
UDP-3-O-[(3R)-3-hydroxymyristoyl]-N-acetyl- -D-glucosamine + Water ⟶ Acetic acid + UDP-3-O-(3-hydroxymyristoyl)- -D-glucosamine - Lipopolysaccharide Biosynthesis:
UDP-3-O-[(3R)-3-hydroxymyristoyl]-N-acetyl- -D-glucosamine + Water ⟶ Acetic acid + UDP-3-O-(3-hydroxymyristoyl)- -D-glucosamine - Lipopolysaccharide Biosynthesis II:
UDP-3-O-[(3R)-3-hydroxymyristoyl]-N-acetyl- -D-glucosamine + Water ⟶ Acetic acid + UDP-3-O-(3-hydroxymyristoyl)- -D-glucosamine - Lipopolysaccharide Biosynthesis III:
UDP-3-O-[(3R)-3-hydroxymyristoyl]-N-acetyl- -D-glucosamine + Water ⟶ Acetic acid + UDP-3-O-(3-hydroxymyristoyl)- -D-glucosamine - TCA Cycle:
Citric acid ⟶ Water + cis-Aconitic acid - TCA cycle (ubiquinol-2):
Citric acid ⟶ Water + cis-Aconitic acid - TCA cycle (ubiquinol-3):
Citric acid ⟶ Water + cis-Aconitic acid - TCA cycle (ubiquinol-4):
Citric acid ⟶ Water + cis-Aconitic acid - TCA cycle (ubiquinol-5):
Citric acid ⟶ Water + cis-Aconitic acid - TCA cycle (ubiquinol-6):
Citric acid ⟶ Water + cis-Aconitic acid - TCA cycle (ubiquinol-7):
Citric acid ⟶ Water + cis-Aconitic acid - TCA cycle (ubiquinol-8):
Citric acid ⟶ Water + cis-Aconitic acid - TCA cycle (ubiquinol-9):
Citric acid ⟶ Water + cis-Aconitic acid - TCA cycle (ubiquinol-10):
Citric acid ⟶ Water + cis-Aconitic acid - TCA cycle (ubiquinol-0):
Citric acid ⟶ Water + cis-Aconitic acid - TCA Cycle:
Water + cis-Aconitic acid ⟶ D-threo-Isocitric acid - TCA Cycle (Ubiquinol-2):
Water + cis-Aconitic acid ⟶ D-threo-Isocitric acid - TCA Cycle (Ubiquinol-3):
Water + cis-Aconitic acid ⟶ D-threo-Isocitric acid - TCA Cycle (Ubiquinol-4):
Water + cis-Aconitic acid ⟶ D-threo-Isocitric acid - TCA Cycle (Ubiquinol-5):
Water + cis-Aconitic acid ⟶ D-threo-Isocitric acid - TCA Cycle (Ubiquinol-6):
Water + cis-Aconitic acid ⟶ D-threo-Isocitric acid - TCA Cycle (Ubiquinol-7):
Water + cis-Aconitic acid ⟶ D-threo-Isocitric acid - TCA Cycle (Ubiquinol-8):
Water + cis-Aconitic acid ⟶ D-threo-Isocitric acid - TCA Cycle (Ubiquinol-9):
Water + cis-Aconitic acid ⟶ D-threo-Isocitric acid - TCA Cycle (Ubiquinol-10):
Water + cis-Aconitic acid ⟶ D-threo-Isocitric acid - TCA Cycle (Ubiquinol-0):
Water + cis-Aconitic acid ⟶ D-threo-Isocitric acid - Methotrexate Action Pathway:
5-Formiminotetrahydrofolic acid ⟶ 5,10-Methenyltetrahydrofolic acid + Ammonia - Purine Degradation:
Adenosine triphosphate + Pseudouridine ⟶ Adenosine diphosphate + Hydrogen Ion + Pseudouridine 5'-phosphate - Lysolipid Incorporation into ER PC(16:1(9Z)/16:1(9Z)):
Glycerophosphocholine + Water ⟶ Choline + Glycerol 3-phosphate + Hydrogen Ion - Lysolipid incorporation into Mitochondria PC(16:1(9Z)/16:1(9Z)):
Adenosine triphosphate + LysoPC(16:1(9Z)/0:0) + Water ⟶ Adenosine diphosphate + LysoPC(16:1(9Z)/0:0) + Phosphate - tRNA Charging:
Adenosine triphosphate + Hydrogen Ion + L-Arginine ⟶ Adenosine monophosphate + Pyrophosphate - tRNA Charging:
Adenosine triphosphate + Hydrogen Ion + L-Arginine ⟶ Adenosine monophosphate + Pyrophosphate - Thiamine Metabolism:
Adenosine triphosphate + Thiamine ⟶ Adenosine monophosphate + Thiamine pyrophosphate - Thiamin Diphosphate Biosynthesis:
L-Glutamine + Phosphoribosyl pyrophosphate + Water ⟶ 5-Phosphoribosylamine + L-Glutamic acid + Pyrophosphate - Thiamine Metabolism:
Adenosine triphosphate + Thiamine ⟶ Adenosine monophosphate + Thiamine pyrophosphate - Thiamine Metabolism:
Adenosine triphosphate + Thiamine ⟶ Adenosine monophosphate + Thiamine pyrophosphate - Thiamine Metabolism:
Adenosine triphosphate + Thiamine ⟶ Adenosine monophosphate + Thiamine pyrophosphate - Thiamin Diphosphate Biosynthesis:
L-Glutamine + Phosphoribosyl pyrophosphate + Water ⟶ 5-Phosphoribosylamine + L-Glutamic acid + Pyrophosphate - Lactose Degradation:
-Lactose + Water ⟶ D-Galactose + D-Glucose - Trehalose Degradation:
Trehalose + Water ⟶ -D-Glucose - Lactose Intolerance:
-Lactose + Water ⟶ D-Galactose + D-Glucose - Esomeprazole Action Pathway:
Adenosine triphosphate + Hydrogen Ion + Potassium + Water ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate + Potassium - Omeprazole Action Pathway:
Hydrogen + Omeprazole ⟶ Active Metabolite of Omeprazole - Lansoprazole Action Pathway:
Adenosine triphosphate + Hydrogen Ion + Potassium + Water ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate + Potassium - Pantoprazole Action Pathway:
Hydrogen + Pantoprazole ⟶ Active Metabolite of Pantoprazole - Rabeprazole Action Pathway:
Adenosine triphosphate + Hydrogen Ion + Potassium + Water ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate + Potassium - Ranitidine Action Pathway:
Adenosine triphosphate + Hydrogen Ion + Potassium + Water ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate + Potassium - Famotidine Action Pathway:
Adenosine triphosphate + Hydrogen Ion + Potassium + Water ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate + Potassium - Cimetidine Action Pathway:
Adenosine triphosphate + Hydrogen Ion + Potassium + Water ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate + Potassium - Nizatidine Action Pathway:
Adenosine triphosphate + Hydrogen Ion + Potassium + Water ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate + Potassium - Pirenzepine Action Pathway:
Adenosine triphosphate + Hydrogen Ion + Potassium + Water ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate + Potassium - Benzocaine Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Bupivacaine Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Chloroprocaine Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Cocaine Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Dibucaine Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Levobupivacaine Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Lidocaine (Local Anaesthetic) Action Pathway:
Lidocaine ⟶ 2,6-Dimethylaniline - Mepivacaine Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Oxybuprocaine Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Prilocaine Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Procaine Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Proparacaine Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Ropivacaine Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Codeine Action Pathway:
Codeine + NADH + Oxygen ⟶ Formaldehyde + Morphine + NAD + Water - Morphine Action Pathway:
Morphine ⟶ Normorphine - Methadone Action Pathway:
Methadone ⟶ 2-ethyl-1,5-dimethyl-3,3-diphenylpyrrolinium (EDDP) - Oxycodone Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Hydromorphone Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Hydrocodone Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Oxymorphone Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Alfentanil Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Carfentanil Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Fentanyl Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Remifentanil Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Sufentanil Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Imipramine Action Pathway:
Imipramine + NADH + Oxygen ⟶ Desipramine + Formaldehyde + NAD + Water - Desipramine Action Pathway:
Desipramine + Hydrogen Ion + NADPH + Oxygen ⟶ 2-hydroxydesipramine + NADP + Water - Citalopram Action Pathway:
Didemethylcitalopram + Oxygen + Water ⟶ Ammonia + Citalopram aldehyde + Hydrogen peroxide - Escitalopram Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Fluoxetine Action Pathway:
Fluoxetine + NADH + Oxygen ⟶ Formaldehyde + NAD + Norfluoxetine + Water - Nicotine Action Pathway:
Nicotine ⟶ Nornicotine - Gastric Acid Production:
Adenosine triphosphate + Hydrogen Ion + Potassium + Water ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate + Potassium - Tramadol Action Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Propoxyphene Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Levorphanol Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Anileridine Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Diphenoxylate Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Dezocine Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Levomethadyl Acetate Action Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Methadyl Acetate Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - 3-Methylthiofentanyl Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Dimethylthiambutene Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Ethylmorphine Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Levallorphan Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Buprenorphine Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Alvimopan Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Pentazocine Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Naltrexone Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Naloxone Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Dihydromorphine Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Ketobemidone Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Nalbuphine Action Pathway:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Roxatidine Acetate Action Pathway:
Adenosine triphosphate + Hydrogen Ion + Potassium + Water ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate + Potassium - Metiamide Action Pathway:
Adenosine triphosphate + Hydrogen Ion + Potassium + Water ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate + Potassium - Betazole Action Pathway:
Adenosine triphosphate + Hydrogen Ion + Potassium + Water ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate + Potassium - Lafutidine H2-Antihistamine Action:
Adenosine triphosphate + Hydrogen Ion + Potassium + Water ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate + Potassium - Lactose Degradation:
-Lactose + Water ⟶ D-Galactose + D-Glucose - Trehalose Degradation:
Trehalose + Water ⟶ -D-Glucose - Lactose Intolerance:
-Lactose + Water ⟶ D-Galactose + D-Glucose - Neuron Function:
Adenosine triphosphate + Potassium + Sodium + Water ⟶ Adenosine diphosphate + Phosphate + Potassium + Sodium - Lactose Degradation:
-Lactose + Water ⟶ D-Galactose + D-Glucose - Trehalose Degradation:
Trehalose + Water ⟶ -D-Glucose - Lactose Degradation:
-Lactose + Water ⟶ D-Galactose + D-Glucose - Trehalose Degradation:
Trehalose + Water ⟶ -D-Glucose - Gastric Acid Production:
Adenosine triphosphate + Hydrogen Ion + Potassium + Water ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate + Potassium - Gastric Acid Production:
Adenosine triphosphate + Hydrogen Ion + Potassium + Water ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate + Potassium - Gastric Acid Production:
Adenosine triphosphate + Hydrogen Ion + Potassium + Water ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate + Potassium - Lactose Intolerance:
-Lactose + Water ⟶ D-Galactose + D-Glucose - Propanoate Metabolism:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA - Malonic Aciduria:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA - Methylmalonic Aciduria Due to Cobalamin-Related Disorders:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA - Malonyl-CoA Decarboxylase Deficiency:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA - Palmitate Biosynthesis:
Hydrogen Ion + NADPH + acetoacetyl-[acp] ⟶ (R)-3-hydroxybutanoyl-[acp] + NADP - Fatty Acid Elongation (Saturated):
3-oxoacyl-[acp] + Hydrogen Ion + NADPH ⟶ (3R)-3-hydroxyacyl-[acyl-carrier protein] + NADP - Fatty Acid Biosynthesis:
3-oxoacyl-[acp] + Hydrogen Ion + NADPH ⟶ (3R)-3-hydroxyacyl-[acyl-carrier protein] + NADP - Palmitate Biosynthesis 2:
Hydrogen Ion + NADPH + acetoacetyl-[acp] ⟶ (R)-3-hydroxybutanoyl-[acp] + NADP - Biotin-Carboxyl Carrier Protein Assembly:
Adenosine triphosphate + Biotin + Biotin-Carboxyl Carrying Protein ⟶ Adenosine monophosphate + Biotinylated [BCCP monomer] + Hydrogen Ion + Pyrophosphate - Propanoate Metabolism:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA - Malonic Aciduria:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA - Methylmalonic Aciduria Due to Cobalamin-Related Disorders:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA - Malonyl-CoA Decarboxylase Deficiency:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA - Propanoate Metabolism:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA - Propanoate Metabolism:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA - Propanoate Metabolism:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA - Propanoate Metabolism:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA - Malonic Aciduria:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA - Methylmalonic Aciduria Due to Cobalamin-Related Disorders:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA - Malonyl-CoA Decarboxylase Deficiency:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA - Palmitate Biosynthesis:
Acetyl-CoA + Adenosine triphosphate + Hydrogen carbonate ⟶ Adenosine diphosphate + Hydrogen Ion + Malonyl-CoA + Phosphate - Fatty Acid Elongation (Saturated):
Acetyl-CoA + Adenosine triphosphate + Hydrogen carbonate ⟶ Adenosine diphosphate + Hydrogen Ion + Malonyl-CoA + Phosphate - Fatty Acid Biosynthesis:
Acetyl-CoA + Adenosine triphosphate + Hydrogen carbonate ⟶ Adenosine diphosphate + Hydrogen Ion + Malonyl-CoA + Phosphate - Palmitate Biosynthesis 2:
Acetyl-CoA + Adenosine triphosphate + Hydrogen carbonate ⟶ Adenosine diphosphate + Hydrogen Ion + Malonyl-CoA + Phosphate - Biotin-Carboxyl Carrier Protein Assembly:
Adenosine triphosphate + Biotin + Biotin-Carboxyl Carrying Protein ⟶ Adenosine monophosphate + Biotinylated [BCCP monomer] + Hydrogen Ion + Pyrophosphate - Paclitaxel Action Pathway:
Adenosine triphosphate + Paclitaxel + Water ⟶ Adenosine diphosphate + Paclitaxel + Phosphorus - Folate Biosynthesis:
7,8-Dihydroneopterin ⟶ 6-hydroxymethyl-7,8-dihydropterin + Glycolaldehyde - Tetrahydrofolate Biosynthesis:
7,8-Dihydroneopterin ⟶ 6-hydroxymethyl-7,8-dihydropterin + Glycolaldehyde - Folate Biosynthesis:
Adenosine triphosphate + HMDHP ⟶ Adenosine monophosphate + HMDHP pyrophosphate + Hydrogen Ion - Folate Biosynthesis:
7,8-Dihydroneopterin ⟶ 6-hydroxymethyl-7,8-dihydropterin + Glycolaldehyde - Threonine Biosynthesis:
L-Glutamic acid + Oxalacetic acid ⟶ L-Aspartic acid + Oxoglutaric acid - Secondary Metabolites: Threonine Biosynthesis from Aspartate:
O-Phosphohomoserine + Water ⟶ L-Threonine + Phosphate - Threonine Metabolism:
L-Threonine ⟶ Acetaldehyde + Glycine - Methionine Metabolism:
2-iminobutanoate + Hydrogen Ion + Water ⟶ 2-Ketobutyric acid + Ammonium - Threonine Metabolism:
2-iminobutanoate + Hydrogen Ion + Water ⟶ 2-Ketobutyric acid + Ammonium - Threonine Biosynthesis:
L-Glutamic acid + Oxalacetic acid ⟶ L-Aspartic acid + Oxoglutaric acid - Secondary Metabolites: Threonine Biosynthesis from Aspartate:
O-Phosphohomoserine + Water ⟶ L-Threonine + Phosphate - Glutathione Metabolism:
Cysteinylglycine + Water ⟶ Glycine + L-Cysteine - Glutathione Synthetase Deficiency:
Cysteinylglycine + Water ⟶ Glycine + L-Cysteine - 5-Oxoprolinuria:
Cysteinylglycine + Water ⟶ Glycine + L-Cysteine - gamma-Glutamyltransferase Deficiency:
Cysteinylglycine + Water ⟶ Glycine + L-Cysteine - 5-Oxoprolinase Deficiency:
Cysteinylglycine + Water ⟶ Glycine + L-Cysteine - gamma-Glutamyltranspeptidase Deficiency:
Cysteinylglycine + Water ⟶ Glycine + L-Cysteine - Glutathione Metabolism:
-Glutamylcysteine + Adenosine triphosphate + Glycine ⟶ Adenosine diphosphate + Glutathione + Hydrogen Ion + Phosphate - Glutathione Metabolism II:
1-Nitronaphthalene-5,6-oxide + Glutathione ⟶ 1-Nitro-5-glutathionyl-6-hydroxy-5,6-dihydronaphthalene - Glutathione Metabolism III:
-Glutamylcysteine + Adenosine triphosphate + Glycine ⟶ Adenosine diphosphate + Glutathione + Hydrogen Ion + Phosphate - Glutathione Metabolism:
Glutathione + L-Cysteine ⟶ -Glutamylcysteine + Cysteinylglycine - Glutathione Metabolism:
Glutathione + L-amino acid ⟶ (5-L-Glutamyl)-L-amino acid + Cysteinylglycine - 5-Oxoprolinuria:
Glutathione + L-amino acid ⟶ (5-L-Glutamyl)-L-amino acid + Cysteinylglycine - gamma-Glutamyltransferase Deficiency:
Glutathione + L-amino acid ⟶ (5-L-Glutamyl)-L-amino acid + Cysteinylglycine - Glutathione Synthetase Deficiency:
Glutathione + L-amino acid ⟶ (5-L-Glutamyl)-L-amino acid + Cysteinylglycine - 5-Oxoprolinase Deficiency:
Glutathione + L-amino acid ⟶ (5-L-Glutamyl)-L-amino acid + Cysteinylglycine - gamma-Glutamyltranspeptidase Deficiency:
Glutathione + L-amino acid ⟶ (5-L-Glutamyl)-L-amino acid + Cysteinylglycine - Glutathione Metabolism:
Glutathione + L-amino acid ⟶ (5-L-Glutamyl)-L-amino acid + Cysteinylglycine - Glutathione Metabolism:
Glutathione + L-amino acid ⟶ (5-L-Glutamyl)-L-amino acid + Cysteinylglycine - Glutathione Metabolism:
Glutathione + L-amino acid ⟶ (5-L-Glutamyl)-L-amino acid + Cysteinylglycine - Glutathione Metabolism:
Glutathione + L-amino acid ⟶ (5-L-Glutamyl)-L-amino acid + Cysteinylglycine - 5-Oxoprolinuria:
Glutathione + L-amino acid ⟶ (5-L-Glutamyl)-L-amino acid + Cysteinylglycine - gamma-Glutamyltransferase Deficiency:
Glutathione + L-amino acid ⟶ (5-L-Glutamyl)-L-amino acid + Cysteinylglycine - Glutathione Synthetase Deficiency:
Glutathione + L-amino acid ⟶ (5-L-Glutamyl)-L-amino acid + Cysteinylglycine - 5-Oxoprolinase Deficiency:
Glutathione + L-amino acid ⟶ (5-L-Glutamyl)-L-amino acid + Cysteinylglycine - gamma-Glutamyltranspeptidase Deficiency:
Glutathione + L-amino acid ⟶ (5-L-Glutamyl)-L-amino acid + Cysteinylglycine - Glutathione Metabolism:
Hydrogen Ion + NADPH + Oxidized glutathione ⟶ Glutathione + NADP - Glutathione Metabolism II:
1-Nitronaphthalene-5,6-oxide + Glutathione ⟶ 1-Nitro-5-glutathionyl-6-hydroxy-5,6-dihydronaphthalene - Glutathione Metabolism III:
Hydrogen Ion + NADPH + Oxidized glutathione ⟶ Glutathione + NADP - Galactose Metabolism:
-D-Glucose + Phosphocarrier protein HPr ⟶ -D-Glucose 6-phosphate + Phosphocarrier protein HPr - Starch and Sucrose Metabolism:
D-Glucose + [PTS enzyme I]-N -phospho-L-histidine ⟶ -D-glucose 1-phosphate + [PTS enzyme I]-L-histidine - Secondary Metabolites: Trehalose Biosynthesis and Metabolism:
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate + Hydrogen ion - Starch and Sucrose Metabolism:
-D-Glucose + Unknown ⟶ -D-Glucose 6-phosphate + Unknown - Secondary Metabolites: Trehalose Biosynthesis and Metabolism:
, -trehalose + Water ⟶ -D-Glucose - Nevirapine Metabolism Pathway:
12-Hydroxynevirapine + Oxygen + Water ⟶ 4-Carboxynevirapine + Hydrogen peroxide - Adenosylcobalamin Salvage from Cobinamide:
Adenosine triphosphate + Cobinamide + Water ⟶ Adenosine diphosphate + Cobinamide + Hydrogen Ion + Phosphate - Adenosylcobalamin Salvage from Cobinamide:
Adenosine triphosphate + Cyanocobalamin + Water ⟶ Adenosine diphosphate + Cyanocobalamin + Hydrogen Ion + Phosphate - Ornithine Metabolism:
N-Acetylornithine + Water ⟶ Acetic acid + Ornithine - Ornithine Metabolism:
N-Acetylornithine + Water ⟶ Acetic acid + Ornithine - NAD Salvage:
Adenosine triphosphate + L-Glutamine + Nicotinic acid adenine dinucleotide + Water ⟶ Adenosine monophosphate + Hydrogen Ion + L-Glutamic acid + NAD + Pyrophosphate - NAD Metabolism:
N'-Formylkynurenine + Water ⟶ Formic acid + Hydrogen Ion + L-Kynurenine - Nicotinate and Nicotinamide Metabolism:
Adenosine triphosphate + L-Glutamine + Nicotinic acid adenine dinucleotide + Water ⟶ Adenosine monophosphate + L-Glutamic acid + NAD + Pyrophosphate - NAD Salvage:
Adenosine triphosphate + L-Glutamine + Nicotinic acid adenine dinucleotide + Water ⟶ Adenosine monophosphate + Hydrogen Ion + L-Glutamic acid + NAD + Pyrophosphate - Valine, Leucine, and Isoleucine Degradation:
-Ketoisovaleric acid + Thiamine pyrophosphate ⟶ 2-Methyl-1-hydroxypropyl-ThPP + Carbon dioxide - Threonine and 2-Oxobutanoate Degradation:
L-Threonine ⟶ 2-Ketobutyric acid + Ammonia - beta-Ketothiolase Deficiency:
-Ketoisovaleric acid + Thiamine pyrophosphate ⟶ 2-Methyl-1-hydroxypropyl-ThPP + Carbon dioxide - 2-Methyl-3-hydroxybutyryl-CoA Dehydrogenase Deficiency:
-Ketoisovaleric acid + Thiamine pyrophosphate ⟶ 2-Methyl-1-hydroxypropyl-ThPP + Carbon dioxide - Propionic Acidemia:
-Ketoisovaleric acid + Thiamine pyrophosphate ⟶ 2-Methyl-1-hydroxypropyl-ThPP + Carbon dioxide - 3-Hydroxy-3-methylglutaryl-CoA Lyase Deficiency:
-Ketoisovaleric acid + Thiamine pyrophosphate ⟶ 2-Methyl-1-hydroxypropyl-ThPP + Carbon dioxide - Maple Syrup Urine Disease:
-Ketoisovaleric acid + Thiamine pyrophosphate ⟶ 2-Methyl-1-hydroxypropyl-ThPP + Carbon dioxide - 3-Methylcrotonyl-CoA Carboxylase Deficiency Type I:
-Ketoisovaleric acid + Thiamine pyrophosphate ⟶ 2-Methyl-1-hydroxypropyl-ThPP + Carbon dioxide - 3-Methylglutaconic Aciduria Type I:
-Ketoisovaleric acid + Thiamine pyrophosphate ⟶ 2-Methyl-1-hydroxypropyl-ThPP + Carbon dioxide - 3-Methylglutaconic Aciduria Type III:
-Ketoisovaleric acid + Thiamine pyrophosphate ⟶ 2-Methyl-1-hydroxypropyl-ThPP + Carbon dioxide - Methylmalonate Semialdehyde Dehydrogenase Deficiency:
-Ketoisovaleric acid + Thiamine pyrophosphate ⟶ 2-Methyl-1-hydroxypropyl-ThPP + Carbon dioxide - Methylmalonic Aciduria:
-Ketoisovaleric acid + Thiamine pyrophosphate ⟶ 2-Methyl-1-hydroxypropyl-ThPP + Carbon dioxide - Isovaleric Aciduria:
-Ketoisovaleric acid + Thiamine pyrophosphate ⟶ 2-Methyl-1-hydroxypropyl-ThPP + Carbon dioxide - 3-Methylglutaconic Aciduria Type IV:
-Ketoisovaleric acid + Thiamine pyrophosphate ⟶ 2-Methyl-1-hydroxypropyl-ThPP + Carbon dioxide - 3-Hydroxyisobutyric Acid Dehydrogenase Deficiency:
-Ketoisovaleric acid + Thiamine pyrophosphate ⟶ 2-Methyl-1-hydroxypropyl-ThPP + Carbon dioxide - 3-Hydroxyisobutyric Aciduria:
-Ketoisovaleric acid + Thiamine pyrophosphate ⟶ 2-Methyl-1-hydroxypropyl-ThPP + Carbon dioxide - Isobutyryl-CoA Dehydrogenase Deficiency:
-Ketoisovaleric acid + Thiamine pyrophosphate ⟶ 2-Methyl-1-hydroxypropyl-ThPP + Carbon dioxide - Isovaleric Acidemia:
-Ketoisovaleric acid + Thiamine pyrophosphate ⟶ 2-Methyl-1-hydroxypropyl-ThPP + Carbon dioxide - Propanoyl-CoA Degradation:
Adenosine triphosphate + Hydrogen carbonate + Propionyl-CoA ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate + S-Methylmalonyl-CoA - Leucine Degradation:
3-Hydroxy-3-methylglutaryl-CoA ⟶ Acetoacetic acid + Acetyl-CoA - Threonine and 2-Oxobutanoate Degradation:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA - Valine, Leucine, and Isoleucine Degradation:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - 2-Methyl-3-hydroxybutryl-CoA Dehydrogenase Deficiency:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - 3-Hydroxy-3-methylglutaryl-CoA Lyase Deficiency:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - 3-Methylcrotonyl-CoA Carboxylase Deficiency Type I:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - 3-Methylglutaconic Aciduria Type I:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - 3-Methylglutaconic Aciduria Type III:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - 3-Methylglutaconic Aciduria Type IV:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - beta-Ketothiolase Deficiency:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - Isovaleric Aciduria:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - Maple Syrup Urine Disease:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - Methylmalonate Semialdehyde Dehydrogenase Deficiency:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - Methylmalonic Aciduria:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - Propionic Acidemia:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - 3-Hydroxyisobutyric Acid Dehydrogenase Deficiency:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - 3-Hydroxyisobutyric Aciduria:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - Isobutyryl-CoA Dehydrogenase Deficiency:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - Isovaleric Acidemia:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - Valine, Leucine, and Isoleucine Degradation:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - Threonine and 2-Oxobutanoate Degradation:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA - Valine, Leucine, and Isoleucine Degradation:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - Threonine and 2-Oxobutanoate Degradation:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA - Threonine and 2-Oxobutanoate Degradation:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA - Threonine and 2-Oxobutanoate Degradation:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA - 2-Methyl-3-hydroxybutryl-CoA Dehydrogenase Deficiency:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - 3-Hydroxy-3-methylglutaryl-CoA Lyase Deficiency:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - 3-Methylcrotonyl-CoA Carboxylase Deficiency Type I:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - 3-Methylglutaconic Aciduria Type I:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - 3-Methylglutaconic Aciduria Type III:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - 3-Methylglutaconic Aciduria Type IV:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - beta-Ketothiolase Deficiency:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - Isovaleric Aciduria:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - Maple Syrup Urine Disease:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - Methylmalonate Semialdehyde Dehydrogenase Deficiency:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - Methylmalonic Aciduria:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - Propionic Acidemia:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - 3-Hydroxyisobutyric Acid Dehydrogenase Deficiency:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - 3-Hydroxyisobutyric Aciduria:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - Isobutyryl-CoA Dehydrogenase Deficiency:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - Isovaleric Acidemia:
L-Valine + Oxoglutaric acid ⟶ -Ketoisovaleric acid + L-Glutamic acid - Riboflavin Metabolism:
FAD + Water ⟶ Adenosine monophosphate + Flavin Mononucleotide - Flavin Biosynthesis:
5-Amino-6-(5'-phosphoribosylamino)uracil + Hydrogen Ion + NADPH ⟶ 5-Amino-6-(5'-phosphoribitylamino)uracil + NADP - Riboflavin Metabolism:
Adenosine triphosphate + Riboflavin ⟶ Adenosine diphosphate + Flavin Mononucleotide - Riboflavin Metabolism:
FAD + Water ⟶ Adenosine monophosphate + Flavin Mononucleotide - Riboflavin Metabolism:
FAD + Water ⟶ Adenosine monophosphate + Flavin Mononucleotide - Riboflavin Metabolism:
FAD + Water ⟶ Adenosine monophosphate + Flavin Mononucleotide - Riboflavin Metabolism:
FAD + Water ⟶ Adenosine monophosphate + Flavin Mononucleotide - Riboflavin Metabolism:
FAD + Water ⟶ Adenosine monophosphate + Flavin Mononucleotide - Flavin Biosynthesis:
Adenosine triphosphate + Riboflavin ⟶ Adenosine diphosphate + Flavin Mononucleotide + Hydrogen Ion - Isoleucine Biosynthesis:
2-iminobutanoate + Hydrogen Ion + Water ⟶ 2-Ketobutyric acid + Ammonium - Isoleucine Biosynthesis:
2-Ketobutyric acid + Hydrogen Ion + Pyruvic acid ⟶ (S)-2-Aceto-2-hydroxybutanoic acid + Carbon dioxide - Nitrogen Metabolism:
Ammonia + Hydrogen + NADPH + Oxoglutaric acid ⟶ L-Glutamic acid + NADP + Water - Nitrogen Metabolism:
Carbamic acid + Hydrogen Ion ⟶ Ammonia + Carbon dioxide - Putrescine Degradation II:
-glutamyl-L-putrescine + Hydrogen Ion + Oxygen ⟶ -Glutamyl- -butyraldehyde + Ammonium + Hydrogen peroxide - Putrescine Degradation II:
-glutamyl-L-putrescine + Hydrogen Ion + Oxygen ⟶ -Glutamyl- -butyraldehyde + Ammonium + Hydrogen peroxide - Ketogluconate Metabolism:
5-Keto-D-gluconate + Hydrogen Ion + NADPH ⟶ Gluconic acid + NADP - Ketogluconate Metabolism:
2-Keto-L-gluconate + Hydrogen Ion + NADPH ⟶ Gluconic acid + NADP - Pentose Phosphate Pathway:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate - Glucose-6-phosphate Dehydrogenase Deficiency:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate - Ribose-5-phosphate Isomerase Deficiency:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate - Transaldolase Deficiency:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate - Pentose Phosphate Pathway:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate - Glucose-6-phosphate Dehydrogenase Deficiency:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate - Ribose-5-phosphate Isomerase Deficiency:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate - Transaldolase Deficiency:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate - Pentose Phosphate Pathway:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate - Pentose Phosphate Pathway:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate - Pentose Phosphate Pathway:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate - Pentose Phosphate Pathway:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate - Glucose-6-phosphate Dehydrogenase Deficiency:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate - Ribose-5-phosphate Isomerase Deficiency:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate - Transaldolase Deficiency:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate - Xylose Degradation I:
Adenosine triphosphate + D-Xylulose ⟶ Adenosine diphosphate + Hydrogen Ion + Xylulose 5-phosphate - Xylitol Degradation:
D-Xylose + NADP ⟶ D-Xylitol + Hydrogen Ion + NADPH - Xylose Degradation I:
Adenosine triphosphate + D-Xylulose ⟶ Adenosine diphosphate + Hydrogen Ion + Xylulose 5-phosphate - Tenofovir Metabolism Pathway:
Adenosine triphosphate + Tenofovir Monophosphate ⟶ Adenosine diphosphate + Tenofovir Diphosphate - Lysolipid Incorporation into ER PC(18:1(9Z)/18:1(9Z)):
Glycerophosphocholine + Water ⟶ Choline + Glycerol 3-phosphate + Hydrogen Ion - Lysolipid incorporation into Mitochondria PC(18:1(9Z)/18:1(9Z)):
Adenosine triphosphate + LysoPC(18:1(9Z)) + Water ⟶ Adenosine diphosphate + LysoPC(18:1(9Z)) + Phosphate - Glycine and Serine Metabolism:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine - Glycerolipid Metabolism:
Glyceraldehyde + NADP ⟶ Glycerol + NADPH - Dimethylglycine Dehydrogenase Deficiency:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine - Dihydropyrimidine Dehydrogenase Deficiency (DHPD):
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine - Sarcosinemia:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine - Glycerol Kinase Deficiency:
Glyceraldehyde + NADP ⟶ Glycerol + NADPH - Non-Ketotic Hyperglycinemia:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine - Dimethylglycine Dehydrogenase Deficiency:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine - Hyperglycinemia, Non-Ketotic:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine - D-Glyceric Acidura:
Glyceraldehyde + NADP ⟶ Glycerol + NADPH - Familial Lipoprotein Lipase Deficiency:
Glyceraldehyde + NADP ⟶ Glycerol + NADPH - 3-Phosphoglycerate Dehydrogenase Deficiency:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine - Glycolate and Glyoxylate Degradation:
Allantoin ⟶ (S)-(+)-allantoin - Glycolate and Glyoxylate Degradation II:
Water + cis-Aconitic acid ⟶ Isocitric acid - Glycerolipid Metabolism:
DG(16:0/16:0/0:0) + Palmityl-CoA ⟶ Coenzyme A + TG(16:0/16:0/16:0)[iso] - Glycine and Serine Metabolism:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine - 3-Phosphoglycerate Dehydrogenase Deficiency:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine - Dihydropyrimidine Dehydrogenase Deficiency (DHPD):
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine - Dimethylglycine Dehydrogenase Deficiency:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine - Glycerol Kinase Deficiency:
DG(16:0/16:0/0:0) + Palmityl-CoA ⟶ Coenzyme A + TG(16:0/16:0/16:0)[iso] - Sarcosinemia:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine - Non-Ketotic Hyperglycinemia:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine - Hyperglycinemia, Non-Ketotic:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine - D-Glyceric Acidura:
DG(16:0/16:0/0:0) + Palmityl-CoA ⟶ Coenzyme A + TG(16:0/16:0/16:0)[iso] - Familial Lipoprotein Lipase Deficiency:
DG(16:0/16:0/0:0) + Palmityl-CoA ⟶ Coenzyme A + TG(16:0/16:0/16:0)[iso] - 3-Phosphoglycerate Dehydrogenase Deficiency:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine - Glycerolipid Metabolism:
DG(16:0/16:0/0:0) + Palmityl-CoA ⟶ Coenzyme A + TG(16:0/16:0/16:0)[iso] - Glycine and Serine Metabolism:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine - Glycerolipid Metabolism:
DG(16:0/16:0/0:0) + Palmityl-CoA ⟶ Coenzyme A + TG(16:0/16:0/16:0)[iso] - Glycine and Serine Metabolism:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine - Glycine and Serine Metabolism:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine - Glycine and Serine Metabolism:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine - Dihydropyrimidine Dehydrogenase Deficiency (DHPD):
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine - Dimethylglycine Dehydrogenase Deficiency:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine - Glycerol Kinase Deficiency:
DG(16:0/16:0/0:0) + Palmityl-CoA ⟶ Coenzyme A + TG(16:0/16:0/16:0)[iso] - Sarcosinemia:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine - Non-Ketotic Hyperglycinemia:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine - Hyperglycinemia, Non-Ketotic:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine - D-Glyceric Acidura:
DG(16:0/16:0/0:0) + Palmityl-CoA ⟶ Coenzyme A + TG(16:0/16:0/16:0)[iso] - Familial Lipoprotein Lipase Deficiency:
DG(16:0/16:0/0:0) + Palmityl-CoA ⟶ Coenzyme A + TG(16:0/16:0/16:0)[iso] - Glycolate and Glyoxylate Degradation:
Allantoin ⟶ (S)-(+)-allantoin - Glycolate and Glyoxylate Degradation II:
Water + cis-Aconitic acid ⟶ Isocitric acid - Galactose Metabolism:
D-Galactose + D-Mannose ⟶ Epimelibiose - Nucleotide Sugars Metabolism:
Adenosine triphosphate + D-Galactose ⟶ Adenosine diphosphate + Galactose 1-phosphate - Starch and Sucrose Metabolism:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid - Galactosemia:
D-Galactose + D-Mannose ⟶ Epimelibiose - Galactosemia II (GALK):
Adenosine triphosphate + D-Galactose ⟶ Adenosine diphosphate + Galactose 1-phosphate - Galactosemia III:
Adenosine triphosphate + D-Galactose ⟶ Adenosine diphosphate + Galactose 1-phosphate - Glycogen Synthetase Deficiency:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid - Glycogenosis, Type III. Cori Disease, Debrancher Glycogenosis:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid - Glycogenosis, Type IV. Amylopectinosis, Anderson Disease:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid - Glycogenosis, Type VI. Hers Disease:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid - Mucopolysaccharidosis VII. Sly Syndrome:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid - Sucrase-Isomaltase Deficiency:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid - Trehalose Degradation I (Low Osmolarity):
-D-Glucopyranuronic acid + Adenosine triphosphate ⟶ Adenosine diphosphate + Glucose 6-phosphate + Hydrogen Ion - Fructose Metabolism:
-D-fructofuranose + Adenosine triphosphate ⟶ -D-Fructose 6-phosphate + Adenosine triphosphate + Hydrogen Ion - Starch and Sucrose Metabolism:
Adenosine triphosphate + D-Glucose ⟶ Adenosine diphosphate + Glucose 6-phosphate - Galactose Metabolism:
D-Galactose + D-Mannose ⟶ Epimelibiose - Nucleotide Sugars Metabolism:
Adenosine triphosphate + D-Galactose ⟶ Adenosine diphosphate + Galactose 1-phosphate - Starch and Sucrose Metabolism:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid - Galactosemia:
D-Galactose + D-Mannose ⟶ Epimelibiose - Galactosemia II (GALK):
Adenosine triphosphate + D-Galactose ⟶ Adenosine diphosphate + Galactose 1-phosphate - Galactosemia III:
Adenosine triphosphate + D-Galactose ⟶ Adenosine diphosphate + Galactose 1-phosphate - Glycogen Synthetase Deficiency:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid - Glycogenosis, Type III. Cori Disease, Debrancher Glycogenosis:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid - Glycogenosis, Type IV. Amylopectinosis, Anderson Disease:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid - Glycogenosis, Type VI. Hers Disease:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid - Mucopolysaccharidosis VII. Sly Syndrome:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid - Sucrase-Isomaltase Deficiency:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid - Nucleotide Sugars Metabolism:
Adenosine triphosphate + D-Galactose ⟶ Adenosine diphosphate + Galactose 1-phosphate - Galactose Metabolism:
D-Galactose + D-Mannose ⟶ Epimelibiose - Starch and Sucrose Metabolism:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid - Nucleotide Sugars Metabolism:
Adenosine triphosphate + D-Galactose ⟶ Adenosine diphosphate + Galactose 1-phosphate - Galactose Metabolism:
D-Galactose + D-Mannose ⟶ Epimelibiose - Starch and Sucrose Metabolism:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid - Nucleotide Sugars Metabolism:
Adenosine triphosphate + D-Galactose ⟶ Adenosine diphosphate + Galactose 1-phosphate - Nucleotide Sugars Metabolism:
Adenosine triphosphate + D-Galactose ⟶ Adenosine diphosphate + Galactose 1-phosphate - Chitin Biosynthesis:
Fructose 6-phosphate + L-Glutamine ⟶ Glucosamine 6-phosphate + L-Glutamic acid - Galactosemia:
D-Galactose + D-Mannose ⟶ Epimelibiose - Galactosemia II (GALK):
Adenosine triphosphate + D-Galactose ⟶ Adenosine diphosphate + Galactose 1-phosphate - Galactosemia III:
Adenosine triphosphate + D-Galactose ⟶ Adenosine diphosphate + Galactose 1-phosphate - Glycogen Synthetase Deficiency:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid - Glycogenosis, Type III. Cori Disease, Debrancher Glycogenosis:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid - Glycogenosis, Type IV. Amylopectinosis, Anderson Disease:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid - Glycogenosis, Type VI. Hers Disease:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid - Mucopolysaccharidosis VII. Sly Syndrome:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid - Sucrase-Isomaltase Deficiency:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid - Trehalose Degradation I (Low Osmolarity):
-D-Glucopyranuronic acid + Adenosine triphosphate ⟶ Adenosine diphosphate + Glucose 6-phosphate + Hydrogen Ion - L-Glutamate Metabolism:
L-Glutamine + Water ⟶ Ammonia + L-Glutamic acid - PreQ0 Metabolism:
S-Adenosylmethionine ⟶ Adenine + Hydrogen Ion + L-Methionine + epoxyqueuosine - Glutamine Metabolism:
Adenosine triphosphate + Phosphate + Pyruvic acid ⟶ Adenosine monophosphate + Hydrogen Ion + Phosphoenolpyruvic acid + Pyrophosphate - L-Glutamate Metabolism:
L-Glutamine + Water ⟶ Ammonia + L-Glutamic acid - PreQ0 Metabolism:
S-Adenosylmethionine ⟶ Adenine + Hydrogen Ion + L-Methionine + epoxyqueuosine - Selenoamino Acid Metabolism:
Selenocystathionine + Water ⟶ 2-Ketobutyric acid + Ammonia + Selenocysteine - Selenoamino Acid Metabolism:
Selenocystathionine + Water ⟶ 2-Ketobutyric acid + Ammonia + Selenocysteine - Selenoamino Acid Metabolism:
Selenocystathionine + Water ⟶ 2-Ketobutyric acid + Ammonia + Selenocysteine - Selenoamino Acid Metabolism:
Selenocystathionine + Water ⟶ 2-Ketobutyric acid + Ammonia + Selenocysteine - Selenoamino Acid Metabolism:
Selenocystathionine + Water ⟶ 2-Ketobutyric acid + Ammonia + Selenocysteine - Selenoamino Acid Metabolism:
Selenocystathionine + Water ⟶ 2-Ketobutyric acid + Ammonia + Selenocysteine - Beta Oxidation of Very Long Chain Fatty Acids:
Acetyl-CoA + L-Carnitine ⟶ Coenzyme A + L-Acetylcarnitine - Adrenoleukodystrophy, X-Linked:
Acetyl-CoA + L-Carnitine ⟶ Coenzyme A + L-Acetylcarnitine - Carnitine-Acylcarnitine Translocase Deficiency:
Acetyl-CoA + L-Carnitine ⟶ Coenzyme A + L-Acetylcarnitine - Beta Oxidation of Very Long Chain Fatty Acids:
Acetyl-CoA + L-Carnitine ⟶ Coenzyme A + L-Acetylcarnitine - Adrenoleukodystrophy, X-Linked:
Acetyl-CoA + L-Carnitine ⟶ Coenzyme A + L-Acetylcarnitine - Carnitine-Acylcarnitine Translocase Deficiency:
Acetyl-CoA + L-Carnitine ⟶ Coenzyme A + L-Acetylcarnitine - Beta Oxidation of Very Long Chain Fatty Acids:
Acetyl-CoA + L-Carnitine ⟶ Coenzyme A + L-Acetylcarnitine - Beta Oxidation of Very Long Chain Fatty Acids:
Acetyl-CoA + L-Carnitine ⟶ Coenzyme A + L-Acetylcarnitine - Beta Oxidation of Very Long Chain Fatty Acids:
Acetyl-CoA + L-Carnitine ⟶ Coenzyme A + L-Acetylcarnitine - Beta Oxidation of Very Long Chain Fatty Acids:
Acetyl-CoA + L-Carnitine ⟶ Coenzyme A + L-Acetylcarnitine - Adrenoleukodystrophy, X-Linked:
Acetyl-CoA + L-Carnitine ⟶ Coenzyme A + L-Acetylcarnitine - Carnitine-Acylcarnitine Translocase Deficiency:
Acetyl-CoA + L-Carnitine ⟶ Coenzyme A + L-Acetylcarnitine - Sphingolipid Metabolism:
L-Serine + Palmityl-CoA ⟶ 3-Dehydrosphinganine + Carbon dioxide - 2-O-alpha-Mannosyl-D-glycerate Degradation:
Adenosine triphosphate + Glyceric acid ⟶ 2-Phospho-D-glyceric acid + Adenosine diphosphate + Hydrogen Ion - Vitamin B1/Thiamine Metabolism:
Adenosine triphosphate + Thiamine ⟶ Adenosine monophosphate + Hydrogen Ion + Thiamine pyrophosphate - Hexuronide and Hexuronate Degradation:
Bilirubin diglucuronide + Water ⟶ Benzyl alcohol + D-glucopyranuronate - Guanine and Guanosine Salvage:
Adenosine triphosphate + Guanosine ⟶ Adenosine diphosphate + Guanosine monophosphate + Hydrogen Ion - Serine Biosynthesis and Metabolism:
DL-O-Phosphoserine + Water ⟶ L-Serine + Phosphate - Vinorelbine Action Pathway:
Adenosine triphosphate + Vinorelbine + Water ⟶ Adenosine diphosphate + Phosphate + Vinorelbine - Folate Metabolism:
5-Formiminotetrahydrofolic acid ⟶ 5,10-Methenyltetrahydrofolic acid + Ammonia - Methylenetetrahydrofolate Reductase Deficiency (MTHFRD):
5-Formiminotetrahydrofolic acid ⟶ 5,10-Methenyltetrahydrofolic acid + Ammonia - Folate Malabsorption, Hereditary:
5-Formiminotetrahydrofolic acid ⟶ 5,10-Methenyltetrahydrofolic acid + Ammonia - Folate Metabolism:
5-Formiminotetrahydrofolic acid ⟶ 5,10-Methenyltetrahydrofolic acid + Ammonia - Glycine Metabolism:
DL-O-Phosphoserine + Water ⟶ L-Serine + Phosphate - Serine Metabolism:
DL-O-Phosphoserine + Water ⟶ L-Serine + Phosphate - Glycine Metabolism:
L-Serine + Tetrahydrofolic acid ⟶ 5,10-Methylene-THF + Glycine + Water - Serine Metabolism:
L-Serine + Tetrahydrofolic acid ⟶ 5,10-Methylene-THF + Glycine + Water - Folate Malabsorption, Hereditary:
5-Formiminotetrahydrofolic acid ⟶ 5,10-Methenyltetrahydrofolic acid + Ammonia - Methylenetetrahydrofolate Reductase Deficiency (MTHFRD):
5-Formiminotetrahydrofolic acid ⟶ 5,10-Methenyltetrahydrofolic acid + Ammonia - Folate Malabsorption, Hereditary:
5-Formiminotetrahydrofolic acid ⟶ 5,10-Methenyltetrahydrofolic acid + Ammonia - Folate Metabolism:
5-Formiminotetrahydrofolic acid ⟶ 5,10-Methenyltetrahydrofolic acid + Ammonia - Folate Metabolism:
5-Formiminotetrahydrofolic acid ⟶ 5,10-Methenyltetrahydrofolic acid + Ammonia - Folate Metabolism:
5-Formiminotetrahydrofolic acid ⟶ 5,10-Methenyltetrahydrofolic acid + Ammonia - Folate Metabolism:
5-Formiminotetrahydrofolic acid ⟶ 5,10-Methenyltetrahydrofolic acid + Ammonia - Methylenetetrahydrofolate Reductase Deficiency (MTHFRD):
5-Formiminotetrahydrofolic acid ⟶ 5,10-Methenyltetrahydrofolic acid + Ammonia - Inner Membrane Transport:
Adenosine triphosphate + Water + Zinc ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate + Zinc - Inner Membrane Transport:
Adenosine triphosphate + Water + Zinc ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate + Zinc - N-Acetylneuraminate, N-Acetylmannosamine, and N-Acetylglucosamine Degradation:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate - Vitamin B6:
2-Oxo-3-hydroxy-4-phosphobutanoic acid + L-Glutamic acid ⟶ O-Phospho-4-hydroxy-L-threonine + Oxoglutaric acid - Vitamin B6 Metabolism:
Oxygen + Pyridoxamine 5'-phosphate + Water ⟶ Ammonia + Hydrogen peroxide + Pyridoxal 5'-phosphate - Histidine Metabolism:
-Alanine + Adenosine triphosphate + L-Histidine ⟶ Adenosine diphosphate + Carnosine + Phosphate - Histidinemia:
-Alanine + Adenosine triphosphate + L-Histidine ⟶ Adenosine diphosphate + Carnosine + Phosphate - Histidine Metabolism:
Carnosine + Water ⟶ -Alanine + L-Histidine - Histidinemia:
Carnosine + Water ⟶ -Alanine + L-Histidine - Histidine Metabolism:
Carnosine + Water ⟶ -Alanine + L-Histidine - Histidine Metabolism:
Carnosine + Water ⟶ -Alanine + L-Histidine - Histidinemia:
Carnosine + Water ⟶ -Alanine + L-Histidine - Sulfate/Sulfite Metabolism:
Estrone + Phosphoadenosine phosphosulfate ⟶ Adenosine 3',5'-diphosphate + Estrone sulfate - Sulfite Oxidase Deficiency:
Estrone + Phosphoadenosine phosphosulfate ⟶ Adenosine 3',5'-diphosphate + Estrone sulfate - Cysteine Biosynthesis:
Hydrogen sulfide + O-Acetylserine ⟶ Acetic acid + Hydrogen Ion + L-Cysteine - Sulfur Metabolism:
Hydrogen sulfide + O-Acetylserine ⟶ Acetic acid + Hydrogen Ion + L-Cysteine - Sulfur Metabolism (Butanesulfonate):
Hydrogen sulfide + O-Acetylserine ⟶ Acetic acid + Hydrogen Ion + L-Cysteine - Sulfur Metabolism (Propanesulfonate):
Hydrogen sulfide + O-Acetylserine ⟶ Acetic acid + Hydrogen Ion + L-Cysteine - Sulfur Metabolism (Ethanesulfonate):
Hydrogen sulfide + O-Acetylserine ⟶ Acetic acid + Hydrogen Ion + L-Cysteine - Sulfur Metabolism (Isethionate):
Hydrogen sulfide + O-Acetylserine ⟶ Acetic acid + Hydrogen Ion + L-Cysteine - Sulfur Metabolism (Methanesulfonate):
Hydrogen sulfide + O-Acetylserine ⟶ Acetic acid + Hydrogen Ion + L-Cysteine - Sulfur Metabolism:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + Ammonium + L-Cysteine - Sulfate/Sulfite Metabolism:
Estrone + Phosphoadenosine phosphosulfate ⟶ Adenosine 3',5'-diphosphate + Estrone sulfate - Sulfite Oxidase Deficiency:
Estrone + Phosphoadenosine phosphosulfate ⟶ Adenosine 3',5'-diphosphate + Estrone sulfate - Sulfate/Sulfite Metabolism:
Estrone + Phosphoadenosine phosphosulfate ⟶ Adenosine 3',5'-diphosphate + Estrone sulfate - Sulfate/Sulfite Metabolism:
Estrone + Phosphoadenosine phosphosulfate ⟶ Adenosine 3',5'-diphosphate + Estrone sulfate - Sulfate/Sulfite Metabolism:
Estrone + Phosphoadenosine phosphosulfate ⟶ Adenosine 3',5'-diphosphate + Estrone sulfate - Sulfate/Sulfite Metabolism:
Estrone + Phosphoadenosine phosphosulfate ⟶ Adenosine 3',5'-diphosphate + Estrone sulfate - Sulfite Oxidase Deficiency:
Estrone + Phosphoadenosine phosphosulfate ⟶ Adenosine 3',5'-diphosphate + Estrone sulfate - Cysteine Biosynthesis:
Hydrogen sulfide + O-Acetylserine ⟶ Acetic acid + Hydrogen Ion + L-Cysteine - Sulfur Metabolism:
Hydrogen sulfide + O-Acetylserine ⟶ Acetic acid + Hydrogen Ion + L-Cysteine - Sulfur Metabolism (Butanesulfonate):
Hydrogen sulfide + O-Acetylserine ⟶ Acetic acid + Hydrogen Ion + L-Cysteine - Sulfur Metabolism (Propanesulfonate):
Hydrogen sulfide + O-Acetylserine ⟶ Acetic acid + Hydrogen Ion + L-Cysteine - Sulfur Metabolism (Ethanesulfonate):
Hydrogen sulfide + O-Acetylserine ⟶ Acetic acid + Hydrogen Ion + L-Cysteine - Sulfur Metabolism (Isethionate):
Hydrogen sulfide + O-Acetylserine ⟶ Acetic acid + Hydrogen Ion + L-Cysteine - Sulfur Metabolism (Methanesulfonate):
Hydrogen sulfide + O-Acetylserine ⟶ Acetic acid + Hydrogen Ion + L-Cysteine - Phytanic Acid Peroxisomal Oxidation:
Oxoglutaric acid + Oxygen + Phytanoyl-CoA ⟶ 2-Hydroxyphytanoyl-CoA + Carbon dioxide + Succinic acid - Refsum Disease:
Oxoglutaric acid + Oxygen + Phytanoyl-CoA ⟶ 2-Hydroxyphytanoyl-CoA + Carbon dioxide + Succinic acid - Phytanic Acid Peroxisomal Oxidation:
Oxoglutaric acid + Oxygen + Phytanoyl-CoA ⟶ 2-Hydroxyphytanoyl-CoA + Carbon dioxide + Succinic acid - Refsum Disease:
Oxoglutaric acid + Oxygen + Phytanoyl-CoA ⟶ 2-Hydroxyphytanoyl-CoA + Carbon dioxide + Succinic acid - Phytanic Acid Peroxisomal Oxidation:
Adenosine triphosphate + Coenzyme A + Phytanic acid ⟶ Adenosine diphosphate + Phytanoyl-CoA + Pyrophosphate - Phytanic Acid Peroxisomal Oxidation:
Adenosine triphosphate + Coenzyme A + Phytanic acid ⟶ Adenosine diphosphate + Phytanoyl-CoA + Pyrophosphate - Phytanic Acid Peroxisomal Oxidation:
Adenosine triphosphate + Coenzyme A + Phytanic acid ⟶ Adenosine diphosphate + Phytanoyl-CoA + Pyrophosphate - Phytanic Acid Peroxisomal Oxidation:
Adenosine triphosphate + Coenzyme A + Phytanic acid ⟶ Adenosine diphosphate + Phytanoyl-CoA + Pyrophosphate - Refsum Disease:
Adenosine triphosphate + Coenzyme A + Phytanic acid ⟶ Adenosine diphosphate + Phytanoyl-CoA + Pyrophosphate - Irinotecan Action Pathway:
Adenosine triphosphate + Irinotecan + Water ⟶ Adenosine diphosphate + Irinotecan + Phosphate - Irinotecan Metabolism Pathway:
Adenosine triphosphate + Irinotecan + Water ⟶ Adenosine diphosphate + Irinotecan + Phosphate - Chorismate Biosynthesis:
3-dehydroshikimate + Hydrogen Ion + NADPH ⟶ NADP + Shikimic acid - Shikimate Pathway (Chorismate Biosynthesis):
Adenosine triphosphate + Shikimic acid ⟶ Adenosine diphosphate + Hydrogen Ion + shikimate 3-phosphate - Chorismate Biosynthesis:
Adenosine triphosphate + Shikimic acid ⟶ Adenosine diphosphate + Hydrogen Ion + shikimate 3-phosphate - Proline Metabolism:
Adenosine triphosphate + L-Glutamic acid + Water ⟶ Adenosine diphosphate + Hydrogen Ion + L-Glutamic acid + Phosphate - Porphyrin Metabolism:
Adenosine triphosphate + Hydrogen Ion + L-Glutamic acid ⟶ Adenosine monophosphate + Pyrophosphate - Proline Metabolism:
Adenosine triphosphate + L-Glutamic acid + Water ⟶ Adenosine diphosphate + Hydrogen Ion + L-Glutamic acid + Phosphate - Proline Metabolism:
Adenosine triphosphate + L-Glutamic acid + Water ⟶ Adenosine diphosphate + Hydrogen Ion + L-Glutamic acid + Phosphate - Porphyrin Metabolism:
Adenosine triphosphate + Hydrogen Ion + L-Glutamic acid ⟶ Adenosine monophosphate + Pyrophosphate - Cysteine Metabolism:
Adenosine triphosphate + L-Cysteine ⟶ Adenosine monophosphate + Pyrophosphate - beta-Mercaptolactate-Cysteine Disulfiduria:
Adenosine triphosphate + L-Cysteine ⟶ Adenosine monophosphate + Pyrophosphate - Cystinosis, Ocular Nonnephropathic:
Adenosine triphosphate + L-Cysteine ⟶ Adenosine monophosphate + Pyrophosphate - Nitrogen Metabolism:
Adenosine triphosphate + Ammonia + L-Glutamic acid ⟶ Adenosine diphosphate + L-Glutamine + Phosphate - Folate Polyglutamylation:
L-Serine + a tetrahydrofolate ⟶ 5,10-methylene-tetrahydrofolate + Glycine + Water - Cysteine Metabolism:
Adenosine triphosphate + L-Cysteine ⟶ Adenosine monophosphate + Pyrophosphate - Cystinosis, Ocular Nonnephropathic:
Adenosine triphosphate + L-Cysteine ⟶ Adenosine monophosphate + Pyrophosphate - beta-Mercaptolactate-Cysteine Disulfiduria:
Adenosine triphosphate + L-Cysteine ⟶ Adenosine monophosphate + Pyrophosphate - Cystinosis, Ocular Nonnephropathic:
Adenosine triphosphate + L-Cysteine ⟶ Adenosine monophosphate + Pyrophosphate - Cysteine Metabolism:
Adenosine triphosphate + L-Cysteine ⟶ Adenosine monophosphate + Pyrophosphate - Cysteine Metabolism:
Adenosine triphosphate + L-Cysteine ⟶ Adenosine monophosphate + Pyrophosphate - beta-Mercaptolactate-Cysteine Disulfiduria:
Adenosine triphosphate + L-Cysteine ⟶ Adenosine monophosphate + Pyrophosphate - Lamivudine Metabolism Pathway:
Lamivudine + Oxygen + Water ⟶ Hydrogen peroxide + Lamivudine sulfoxide - Triacylglycerol Degradation:
1-monoglyceride + Water ⟶ Fatty Acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/16:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/16:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/16:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/16:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/16:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/16:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/16:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/16:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/16:0/20:1(11Z)):
TG(16:0/16:0/20:1(11Z))[iso3] + Water ⟶ 11Z-Eicosenoic acid + DG(16:0/16:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/16:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/16:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/16:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:0/20:1(11Z)):
TG(16:0/18:0/20:1(11Z))[iso6] + Water ⟶ 11Z-Eicosenoic acid + DG(16:0/18:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:1(9Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:1(9Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:1(9Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:1(9Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:1(9Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:1(9Z)/20:1(11Z)):
TG(16:0/18:1(9Z)/20:1(11Z))[iso6] + Water ⟶ 11Z-Eicosenoic acid + DG(16:0/18:1(9Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:1(9Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:1(9Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:1(11Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:1(11Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:1(11Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:1(11Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:1(11Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:1(11Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:1(11Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:1(11Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:1(11Z)/20:1(11Z)):
TG(16:0/18:1(11Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(16:0/18:1(11Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:1(11Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:1(11Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:1(11Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:2(9Z,12Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:2(9Z,12Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:2(9Z,12Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:2(9Z,12Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:2(9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:2(9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:2(9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:2(9Z,12Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:2(9Z,12Z)/20:1(11Z)):
TG(16:0/18:2(9Z,12Z)/20:1(11Z))[iso6] + Water ⟶ 11Z-Eicosenoic acid + DG(16:0/18:2(9Z,12Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:2(9Z,12Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:2(9Z,12Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:2(9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:3(6Z,9Z,12Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:3(6Z,9Z,12Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:3(6Z,9Z,12Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:3(6Z,9Z,12Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:3(6Z,9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:3(6Z,9Z,12Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:3(6Z,9Z,12Z)/20:1(11Z)):
TG(16:0/18:3(6Z,9Z,12Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(16:0/18:3(6Z,9Z,12Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:3(6Z,9Z,12Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:3(6Z,9Z,12Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:3(6Z,9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:3(9Z,12Z,15Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:3(9Z,12Z,15Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:3(9Z,12Z,15Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:3(9Z,12Z,15Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:3(9Z,12Z,15Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:3(9Z,12Z,15Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:3(9Z,12Z,15Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:3(9Z,12Z,15Z)/20:1(11Z)):
TG(16:0/18:3(9Z,12Z,15Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(16:0/18:3(9Z,12Z,15Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:3(9Z,12Z,15Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:3(9Z,12Z,15Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/18:3(9Z,12Z,15Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:0/20:1(11Z)):
TG(16:0/20:0/20:1(11Z))[iso6] + Water ⟶ 11Z-Eicosenoic acid + DG(16:0/20:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:1(11Z)/16:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:1(11Z)/18:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:1(11Z)/18:1(9Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:1(11Z)/18:1(11Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:1(11Z)/18:2(9Z,12Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:1(11Z)/18:3(6Z,9Z,12Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:1(11Z)/18:3(9Z,12Z,15Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:1(11Z)/20:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:1(11Z)/20:1(11Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:1(11Z)/20:1(13Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:1(11Z)/22:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:1(11Z)/22:1(13Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:1(13Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:1(13Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:1(13Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:1(13Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:1(13Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:1(13Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:1(13Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:1(13Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:1(13Z)/20:1(11Z)):
TG(16:0/20:1(13Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(16:0/20:1(13Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:1(13Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:1(13Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/20:1(13Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/22:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/22:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/22:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/22:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/22:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/22:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/22:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/22:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/22:0/20:1(11Z)):
TG(16:0/22:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(16:0/22:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/22:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/22:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/22:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/22:1(13Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/22:1(13Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/22:1(13Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/22:1(13Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/22:1(13Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/22:1(13Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/22:1(13Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/22:1(13Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/22:1(13Z)/20:1(11Z)):
TG(16:0/22:1(13Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(16:0/22:1(13Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/22:1(13Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/22:1(13Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(16:0/22:1(13Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/16:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/16:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/16:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/16:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/16:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/16:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/16:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/16:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/16:0/20:1(11Z)):
TG(18:0/16:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:0/16:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/16:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/16:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/16:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:0/20:1(11Z)):
TG(18:0/18:0/20:1(11Z))[iso3] + Water ⟶ 11Z-Eicosenoic acid + DG(18:0/18:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:1(9Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:1(9Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:1(9Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:1(9Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:1(9Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:1(9Z)/20:1(11Z)):
TG(18:0/18:1(9Z)/20:1(11Z))[iso6] + Water ⟶ 11Z-Eicosenoic acid + DG(18:0/18:1(9Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:1(9Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:1(9Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:1(11Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:1(11Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:1(11Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:1(11Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:1(11Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:1(11Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:1(11Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:1(11Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:1(11Z)/20:1(11Z)):
TG(18:0/18:1(11Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:0/18:1(11Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:1(11Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:1(11Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:1(11Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:2(9Z,12Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:2(9Z,12Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:2(9Z,12Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:2(9Z,12Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:2(9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:2(9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:2(9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:2(9Z,12Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:2(9Z,12Z)/20:1(11Z)):
TG(18:0/18:2(9Z,12Z)/20:1(11Z))[iso6] + Water ⟶ 11Z-Eicosenoic acid + DG(18:0/18:2(9Z,12Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:2(9Z,12Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:2(9Z,12Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:2(9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:3(6Z,9Z,12Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:3(6Z,9Z,12Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:3(6Z,9Z,12Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:3(6Z,9Z,12Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:3(6Z,9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:3(6Z,9Z,12Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:3(6Z,9Z,12Z)/20:1(11Z)):
TG(18:0/18:3(6Z,9Z,12Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:0/18:3(6Z,9Z,12Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:3(6Z,9Z,12Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:3(6Z,9Z,12Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:3(6Z,9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:3(9Z,12Z,15Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:3(9Z,12Z,15Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:3(9Z,12Z,15Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:3(9Z,12Z,15Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:3(9Z,12Z,15Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:3(9Z,12Z,15Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:3(9Z,12Z,15Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:3(9Z,12Z,15Z)/20:1(11Z)):
TG(18:0/18:3(9Z,12Z,15Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:0/18:3(9Z,12Z,15Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:3(9Z,12Z,15Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:3(9Z,12Z,15Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/18:3(9Z,12Z,15Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:0/20:1(11Z)):
TG(18:0/20:0/20:1(11Z))[iso6] + Water ⟶ 11Z-Eicosenoic acid + DG(18:0/20:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:1(11Z)/16:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:1(11Z)/18:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:1(11Z)/18:1(9Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:1(11Z)/18:1(11Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:1(11Z)/18:2(9Z,12Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:1(11Z)/18:3(6Z,9Z,12Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:1(11Z)/18:3(9Z,12Z,15Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:1(11Z)/20:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:1(11Z)/20:1(11Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:1(11Z)/20:1(13Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:1(11Z)/22:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:1(11Z)/22:1(13Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:1(13Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:1(13Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:1(13Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:1(13Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:1(13Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:1(13Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:1(13Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:1(13Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:1(13Z)/20:1(11Z)):
TG(18:0/20:1(13Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:0/20:1(13Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:1(13Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:1(13Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/20:1(13Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/22:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/22:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/22:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/22:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/22:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/22:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/22:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/22:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/22:0/20:1(11Z)):
TG(18:0/22:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:0/22:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/22:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/22:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/22:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/22:1(13Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/22:1(13Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/22:1(13Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/22:1(13Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/22:1(13Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/22:1(13Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/22:1(13Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/22:1(13Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/22:1(13Z)/20:1(11Z)):
TG(18:0/22:1(13Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:0/22:1(13Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/22:1(13Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/22:1(13Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:0/22:1(13Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/16:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/16:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/16:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/16:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/16:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/16:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/16:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/16:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/16:0/20:1(11Z)):
TG(18:1(9Z)/16:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:1(9Z)/16:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/16:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/16:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/16:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:0/20:1(11Z)):
TG(18:1(9Z)/18:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:1(9Z)/18:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:1(9Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:1(9Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:1(9Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:1(9Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:1(9Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:1(9Z)/20:1(11Z)):
TG(18:1(9Z)/18:1(9Z)/20:1(11Z))[iso3] + Water ⟶ 11Z-Eicosenoic acid + DG(18:1(9Z)/18:1(9Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:1(9Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:1(9Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:1(11Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:1(11Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:1(11Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:1(11Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:1(11Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:1(11Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:1(11Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:1(11Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:1(11Z)/20:1(11Z)):
TG(18:1(9Z)/18:1(11Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:1(9Z)/18:1(11Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:1(11Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:1(11Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:1(11Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:2(9Z,12Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:2(9Z,12Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:2(9Z,12Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:2(9Z,12Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:2(9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:2(9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:2(9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:2(9Z,12Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:2(9Z,12Z)/20:1(11Z)):
TG(18:1(9Z)/18:2(9Z,12Z)/20:1(11Z))[iso6] + Water ⟶ 11Z-Eicosenoic acid + DG(18:1(9Z)/18:2(9Z,12Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:2(9Z,12Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:2(9Z,12Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:2(9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:3(6Z,9Z,12Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:3(6Z,9Z,12Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:3(6Z,9Z,12Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:3(6Z,9Z,12Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:3(6Z,9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:3(6Z,9Z,12Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:3(6Z,9Z,12Z)/20:1(11Z)):
TG(18:1(9Z)/18:3(6Z,9Z,12Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:1(9Z)/18:3(6Z,9Z,12Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:3(6Z,9Z,12Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:3(6Z,9Z,12Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:3(6Z,9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:3(9Z,12Z,15Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:3(9Z,12Z,15Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:3(9Z,12Z,15Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:3(9Z,12Z,15Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:3(9Z,12Z,15Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:3(9Z,12Z,15Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:3(9Z,12Z,15Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:3(9Z,12Z,15Z)/20:1(11Z)):
TG(18:1(9Z)/18:3(9Z,12Z,15Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:1(9Z)/18:3(9Z,12Z,15Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:3(9Z,12Z,15Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:3(9Z,12Z,15Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/18:3(9Z,12Z,15Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:0/20:1(11Z)):
TG(18:1(9Z)/20:0/20:1(11Z))[iso6] + Water ⟶ 11Z-Eicosenoic acid + DG(18:1(9Z)/20:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:1(11Z)/16:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:1(11Z)/18:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:1(11Z)/18:1(9Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:1(11Z)/18:1(11Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:1(11Z)/18:2(9Z,12Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:1(11Z)/18:3(6Z,9Z,12Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:1(11Z)/18:3(9Z,12Z,15Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:1(11Z)/20:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:1(11Z)/20:1(11Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:1(11Z)/20:1(13Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:1(11Z)/22:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:1(11Z)/22:1(13Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:1(13Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:1(13Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:1(13Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:1(13Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:1(13Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:1(13Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:1(13Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:1(13Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:1(13Z)/20:1(11Z)):
TG(18:1(9Z)/20:1(13Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:1(9Z)/20:1(13Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:1(13Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:1(13Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/20:1(13Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/22:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/22:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/22:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/22:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/22:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/22:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/22:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/22:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/22:0/20:1(11Z)):
TG(18:1(9Z)/22:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:1(9Z)/22:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/22:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/22:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/22:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/22:1(13Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/22:1(13Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/22:1(13Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/22:1(13Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/22:1(13Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/22:1(13Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/22:1(13Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/22:1(13Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/22:1(13Z)/20:1(11Z)):
TG(18:1(9Z)/22:1(13Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:1(9Z)/22:1(13Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/22:1(13Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/22:1(13Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(9Z)/22:1(13Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/16:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/16:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/16:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/16:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/16:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/16:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/16:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/16:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/16:0/20:1(11Z)):
TG(18:1(11Z)/16:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:1(11Z)/16:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/16:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/16:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/16:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:0/20:1(11Z)):
TG(18:1(11Z)/18:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:1(11Z)/18:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:1(9Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:1(9Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:1(9Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:1(9Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:1(9Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:1(9Z)/20:1(11Z)):
TG(18:1(11Z)/18:1(9Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:1(11Z)/18:1(9Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:1(9Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:1(9Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:1(11Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:1(11Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:1(11Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:1(11Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:1(11Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:1(11Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:1(11Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:1(11Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:1(11Z)/20:1(11Z)):
TG(18:1(11Z)/18:1(11Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:1(11Z)/18:1(11Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:1(11Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:1(11Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:1(11Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:2(9Z,12Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:2(9Z,12Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:2(9Z,12Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:2(9Z,12Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:2(9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:2(9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:2(9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:2(9Z,12Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:2(9Z,12Z)/20:1(11Z)):
TG(18:1(11Z)/18:2(9Z,12Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:1(11Z)/18:2(9Z,12Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:2(9Z,12Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:2(9Z,12Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:2(9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:3(6Z,9Z,12Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:3(6Z,9Z,12Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:3(6Z,9Z,12Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:3(6Z,9Z,12Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:3(6Z,9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:3(6Z,9Z,12Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:3(6Z,9Z,12Z)/20:1(11Z)):
TG(18:1(11Z)/18:3(6Z,9Z,12Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:1(11Z)/18:3(6Z,9Z,12Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:3(6Z,9Z,12Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:3(6Z,9Z,12Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:3(6Z,9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:3(9Z,12Z,15Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:3(9Z,12Z,15Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:3(9Z,12Z,15Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:3(9Z,12Z,15Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:3(9Z,12Z,15Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:3(9Z,12Z,15Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:3(9Z,12Z,15Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:3(9Z,12Z,15Z)/20:1(11Z)):
TG(18:1(11Z)/18:3(9Z,12Z,15Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:1(11Z)/18:3(9Z,12Z,15Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:3(9Z,12Z,15Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:3(9Z,12Z,15Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/18:3(9Z,12Z,15Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:0/20:1(11Z)):
TG(18:1(11Z)/20:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:1(11Z)/20:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:1(11Z)/16:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:1(11Z)/18:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:1(11Z)/18:1(9Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:1(11Z)/18:1(11Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:1(11Z)/18:2(9Z,12Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:1(11Z)/18:3(6Z,9Z,12Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:1(11Z)/18:3(9Z,12Z,15Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:1(11Z)/20:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:1(11Z)/20:1(11Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:1(11Z)/20:1(13Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:1(11Z)/22:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:1(11Z)/22:1(13Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:1(13Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:1(13Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:1(13Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:1(13Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:1(13Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:1(13Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:1(13Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:1(13Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:1(13Z)/20:1(11Z)):
TG(18:1(11Z)/20:1(13Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:1(11Z)/20:1(13Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:1(13Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:1(13Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/20:1(13Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/22:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/22:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/22:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/22:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/22:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/22:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/22:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/22:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/22:0/20:1(11Z)):
TG(18:1(11Z)/22:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:1(11Z)/22:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/22:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/22:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/22:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/22:1(13Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/22:1(13Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/22:1(13Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/22:1(13Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/22:1(13Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/22:1(13Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/22:1(13Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/22:1(13Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/22:1(13Z)/20:1(11Z)):
TG(18:1(11Z)/22:1(13Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:1(11Z)/22:1(13Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/22:1(13Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/22:1(13Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:1(11Z)/22:1(13Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/16:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/16:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/16:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/16:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/16:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/16:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/16:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/16:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/16:0/20:1(11Z)):
TG(18:2(9Z,12Z)/16:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:2(9Z,12Z)/16:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/16:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/16:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/16:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:0/20:1(11Z)):
TG(18:2(9Z,12Z)/18:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:2(9Z,12Z)/18:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:1(9Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:1(9Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:1(9Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:1(9Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:1(9Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:1(9Z)/20:1(11Z)):
TG(18:2(9Z,12Z)/18:1(9Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:2(9Z,12Z)/18:1(9Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:1(9Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:1(9Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:1(11Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:1(11Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:1(11Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:1(11Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:1(11Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:1(11Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:1(11Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:1(11Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:1(11Z)/20:1(11Z)):
TG(18:2(9Z,12Z)/18:1(11Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:2(9Z,12Z)/18:1(11Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:1(11Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:1(11Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:1(11Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:2(9Z,12Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:2(9Z,12Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:2(9Z,12Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:2(9Z,12Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:2(9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:2(9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:2(9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:2(9Z,12Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:2(9Z,12Z)/20:1(11Z)):
TG(18:2(9Z,12Z)/18:2(9Z,12Z)/20:1(11Z))[iso3] + Water ⟶ 11Z-Eicosenoic acid + DG(18:2(9Z,12Z)/18:2(9Z,12Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:2(9Z,12Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:2(9Z,12Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:2(9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)/20:1(11Z)):
TG(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)/20:1(11Z)):
TG(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:0/20:1(11Z)):
TG(18:2(9Z,12Z)/20:0/20:1(11Z))[iso6] + Water ⟶ 11Z-Eicosenoic acid + DG(18:2(9Z,12Z)/20:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:1(11Z)/16:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:1(11Z)/18:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:1(11Z)/18:1(9Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:1(11Z)/18:1(11Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:1(11Z)/18:2(9Z,12Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:1(11Z)/18:3(6Z,9Z,12Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:1(11Z)/18:3(9Z,12Z,15Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:1(11Z)/20:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:1(11Z)/20:1(11Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:1(11Z)/20:1(13Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:1(11Z)/22:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:1(11Z)/22:1(13Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:1(13Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:1(13Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:1(13Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:1(13Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:1(13Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:1(13Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:1(13Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:1(13Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:1(13Z)/20:1(11Z)):
TG(18:2(9Z,12Z)/20:1(13Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:2(9Z,12Z)/20:1(13Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:1(13Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:1(13Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/20:1(13Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/22:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/22:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/22:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/22:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/22:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/22:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/22:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/22:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/22:0/20:1(11Z)):
TG(18:2(9Z,12Z)/22:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:2(9Z,12Z)/22:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/22:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/22:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/22:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/22:1(13Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/22:1(13Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/22:1(13Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/22:1(13Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/22:1(13Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/22:1(13Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/22:1(13Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/22:1(13Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/22:1(13Z)/20:1(11Z)):
TG(18:2(9Z,12Z)/22:1(13Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:2(9Z,12Z)/22:1(13Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/22:1(13Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/22:1(13Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:2(9Z,12Z)/22:1(13Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/16:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/16:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/16:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/16:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/16:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/16:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/16:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/16:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/16:0/20:1(11Z)):
TG(18:3(6Z,9Z,12Z)/16:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:3(6Z,9Z,12Z)/16:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/16:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/16:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/16:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:0/20:1(11Z)):
TG(18:3(6Z,9Z,12Z)/18:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:3(6Z,9Z,12Z)/18:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:1(9Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:1(9Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:1(9Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:1(9Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:1(9Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:1(9Z)/20:1(11Z)):
TG(18:3(6Z,9Z,12Z)/18:1(9Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:3(6Z,9Z,12Z)/18:1(9Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:1(9Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:1(9Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:1(11Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:1(11Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:1(11Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:1(11Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:1(11Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:1(11Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:1(11Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:1(11Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:1(11Z)/20:1(11Z)):
TG(18:3(6Z,9Z,12Z)/18:1(11Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:3(6Z,9Z,12Z)/18:1(11Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:1(11Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:1(11Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:1(11Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:2(9Z,12Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:2(9Z,12Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:2(9Z,12Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:2(9Z,12Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:2(9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:2(9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:2(9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:2(9Z,12Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:2(9Z,12Z)/20:1(11Z)):
TG(18:3(6Z,9Z,12Z)/18:2(9Z,12Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:3(6Z,9Z,12Z)/18:2(9Z,12Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:2(9Z,12Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:2(9Z,12Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:2(9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)/20:1(11Z)):
TG(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)/20:1(11Z)):
TG(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:0/20:1(11Z)):
TG(18:3(6Z,9Z,12Z)/20:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:3(6Z,9Z,12Z)/20:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:1(11Z)/16:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:1(11Z)/18:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:1(11Z)/18:1(9Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:1(11Z)/18:1(11Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:1(11Z)/18:2(9Z,12Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:1(11Z)/18:3(6Z,9Z,12Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:1(11Z)/18:3(9Z,12Z,15Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:1(11Z)/20:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:1(11Z)/20:1(11Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:1(11Z)/20:1(13Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:1(11Z)/22:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:1(11Z)/22:1(13Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:1(13Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:1(13Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:1(13Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:1(13Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:1(13Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:1(13Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:1(13Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:1(13Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:1(13Z)/20:1(11Z)):
TG(18:3(6Z,9Z,12Z)/20:1(13Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:3(6Z,9Z,12Z)/20:1(13Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:1(13Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:1(13Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/20:1(13Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/22:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/22:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/22:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/22:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/22:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/22:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/22:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/22:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/22:0/20:1(11Z)):
TG(18:3(6Z,9Z,12Z)/22:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:3(6Z,9Z,12Z)/22:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/22:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/22:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/22:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/22:1(13Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/22:1(13Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/22:1(13Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/22:1(13Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/22:1(13Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/22:1(13Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/22:1(13Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/22:1(13Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/22:1(13Z)/20:1(11Z)):
TG(18:3(6Z,9Z,12Z)/22:1(13Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:3(6Z,9Z,12Z)/22:1(13Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/22:1(13Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/22:1(13Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(6Z,9Z,12Z)/22:1(13Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/16:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/16:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/16:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/16:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/16:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/16:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/16:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/16:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/16:0/20:1(11Z)):
TG(18:3(9Z,12Z,15Z)/16:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:3(9Z,12Z,15Z)/16:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/16:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/16:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/16:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:0/20:1(11Z)):
TG(18:3(9Z,12Z,15Z)/18:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:3(9Z,12Z,15Z)/18:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:1(9Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:1(9Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:1(9Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:1(9Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:1(9Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:1(9Z)/20:1(11Z)):
TG(18:3(9Z,12Z,15Z)/18:1(9Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:3(9Z,12Z,15Z)/18:1(9Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:1(9Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:1(9Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:1(11Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:1(11Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:1(11Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:1(11Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:1(11Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:1(11Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:1(11Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:1(11Z)/20:1(11Z)):
TG(18:3(9Z,12Z,15Z)/18:1(11Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:3(9Z,12Z,15Z)/18:1(11Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:1(11Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:1(11Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:1(11Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:2(9Z,12Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:2(9Z,12Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:2(9Z,12Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:2(9Z,12Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:2(9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:2(9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:2(9Z,12Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:2(9Z,12Z)/20:1(11Z)):
TG(18:3(9Z,12Z,15Z)/18:2(9Z,12Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:3(9Z,12Z,15Z)/18:2(9Z,12Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:2(9Z,12Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:2(9Z,12Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:2(9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:3(6Z,9Z,12Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:3(6Z,9Z,12Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:3(6Z,9Z,12Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:3(6Z,9Z,12Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:3(6Z,9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:3(6Z,9Z,12Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:3(6Z,9Z,12Z)/20:1(11Z)):
TG(18:3(9Z,12Z,15Z)/18:3(6Z,9Z,12Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:3(9Z,12Z,15Z)/18:3(6Z,9Z,12Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:3(6Z,9Z,12Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:3(6Z,9Z,12Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:3(6Z,9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)/20:1(11Z)):
TG(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:0/20:1(11Z)):
TG(18:3(9Z,12Z,15Z)/20:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:3(9Z,12Z,15Z)/20:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:1(11Z)/16:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:1(11Z)/18:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:1(11Z)/18:1(9Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:1(11Z)/18:1(11Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:1(11Z)/18:2(9Z,12Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:1(11Z)/18:3(6Z,9Z,12Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:1(11Z)/18:3(9Z,12Z,15Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:1(11Z)/20:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:1(11Z)/20:1(11Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:1(11Z)/20:1(13Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:1(11Z)/22:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:1(11Z)/22:1(13Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:1(13Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:1(13Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:1(13Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:1(13Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:1(13Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:1(13Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:1(13Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:1(13Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:1(13Z)/20:1(11Z)):
TG(18:3(9Z,12Z,15Z)/20:1(13Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:3(9Z,12Z,15Z)/20:1(13Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:1(13Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:1(13Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/20:1(13Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/22:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/22:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/22:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/22:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/22:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/22:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/22:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/22:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/22:0/20:1(11Z)):
TG(18:3(9Z,12Z,15Z)/22:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:3(9Z,12Z,15Z)/22:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/22:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/22:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/22:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/22:1(13Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/22:1(13Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/22:1(13Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/22:1(13Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/22:1(13Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/22:1(13Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/22:1(13Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/22:1(13Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/22:1(13Z)/20:1(11Z)):
TG(18:3(9Z,12Z,15Z)/22:1(13Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(18:3(9Z,12Z,15Z)/22:1(13Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/22:1(13Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/22:1(13Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/22:1(13Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/16:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/16:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/16:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/16:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/16:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/16:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/16:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/16:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/16:0/20:1(11Z)):
TG(20:0/16:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(20:0/16:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/16:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/16:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/16:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:0/20:1(11Z)):
TG(20:0/18:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(20:0/18:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:1(9Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:1(9Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:1(9Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:1(9Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:1(9Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:1(9Z)/20:1(11Z)):
TG(20:0/18:1(9Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(20:0/18:1(9Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:1(9Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:1(9Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:1(11Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:1(11Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:1(11Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:1(11Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:1(11Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:1(11Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:1(11Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:1(11Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:1(11Z)/20:1(11Z)):
TG(20:0/18:1(11Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(20:0/18:1(11Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:1(11Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:1(11Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:1(11Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:2(9Z,12Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:2(9Z,12Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:2(9Z,12Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:2(9Z,12Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:2(9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:2(9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:2(9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:2(9Z,12Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:2(9Z,12Z)/20:1(11Z)):
TG(20:0/18:2(9Z,12Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(20:0/18:2(9Z,12Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:2(9Z,12Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:2(9Z,12Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:2(9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:3(6Z,9Z,12Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:3(6Z,9Z,12Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:3(6Z,9Z,12Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:3(6Z,9Z,12Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:3(6Z,9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:3(6Z,9Z,12Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:3(6Z,9Z,12Z)/20:1(11Z)):
TG(20:0/18:3(6Z,9Z,12Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(20:0/18:3(6Z,9Z,12Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:3(6Z,9Z,12Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:3(6Z,9Z,12Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:3(6Z,9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:3(9Z,12Z,15Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:3(9Z,12Z,15Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:3(9Z,12Z,15Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:3(9Z,12Z,15Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:3(9Z,12Z,15Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:3(9Z,12Z,15Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:3(9Z,12Z,15Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:3(9Z,12Z,15Z)/20:1(11Z)):
TG(20:0/18:3(9Z,12Z,15Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(20:0/18:3(9Z,12Z,15Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:3(9Z,12Z,15Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:3(9Z,12Z,15Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/18:3(9Z,12Z,15Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:0/20:1(11Z)):
TG(20:0/20:0/20:1(11Z))[iso3] + Water ⟶ 11Z-Eicosenoic acid + DG(20:0/20:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:1(11Z)/16:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:1(11Z)/18:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:1(11Z)/18:1(9Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:1(11Z)/18:1(11Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:1(11Z)/18:2(9Z,12Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:1(11Z)/18:3(6Z,9Z,12Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:1(11Z)/18:3(9Z,12Z,15Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:1(11Z)/20:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:1(11Z)/20:1(11Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:1(11Z)/20:1(13Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:1(11Z)/22:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:1(11Z)/22:1(13Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:1(13Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:1(13Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:1(13Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:1(13Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:1(13Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:1(13Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:1(13Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:1(13Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:1(13Z)/20:1(11Z)):
TG(20:0/20:1(13Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(20:0/20:1(13Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:1(13Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:1(13Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/20:1(13Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/22:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/22:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/22:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/22:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/22:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/22:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/22:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/22:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/22:0/20:1(11Z)):
TG(20:0/22:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(20:0/22:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/22:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/22:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/22:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/22:1(13Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/22:1(13Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/22:1(13Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/22:1(13Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/22:1(13Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/22:1(13Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/22:1(13Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/22:1(13Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/22:1(13Z)/20:1(11Z)):
TG(20:0/22:1(13Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(20:0/22:1(13Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/22:1(13Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/22:1(13Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:0/22:1(13Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(11Z)/16:0/16:0):
DG(20:1(11Z)/16:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/16:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/16:0/18:0):
DG(20:1(11Z)/16:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/16:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/16:0/18:1(9Z)):
DG(20:1(11Z)/16:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/16:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/16:0/18:1(11Z)):
DG(20:1(11Z)/16:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/16:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/16:0/18:2(9Z,12Z)):
DG(20:1(11Z)/16:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/16:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/16:0/18:3(6Z,9Z,12Z)):
DG(20:1(11Z)/16:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/16:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/16:0/18:3(9Z,12Z,15Z)):
DG(20:1(11Z)/16:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/16:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/16:0/20:0):
DG(20:1(11Z)/16:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/16:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/16:0/20:1(11Z)):
DG(20:1(11Z)/16:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/16:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/16:0/20:1(13Z)):
DG(20:1(11Z)/16:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/16:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/16:0/22:0):
DG(20:1(11Z)/16:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/16:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/16:0/22:1(13Z)):
DG(20:1(11Z)/16:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/16:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:0/16:0):
DG(20:1(11Z)/18:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:0/18:0):
DG(20:1(11Z)/18:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:0/18:1(9Z)):
DG(20:1(11Z)/18:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:0/18:1(11Z)):
DG(20:1(11Z)/18:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:0/18:2(9Z,12Z)):
DG(20:1(11Z)/18:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:0/18:3(6Z,9Z,12Z)):
DG(20:1(11Z)/18:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:0/18:3(9Z,12Z,15Z)):
DG(20:1(11Z)/18:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:0/20:0):
DG(20:1(11Z)/18:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:0/20:1(11Z)):
DG(20:1(11Z)/18:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:0/20:1(13Z)):
DG(20:1(11Z)/18:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:0/22:0):
DG(20:1(11Z)/18:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:0/22:1(13Z)):
DG(20:1(11Z)/18:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:1(9Z)/16:0):
DG(20:1(11Z)/18:1(9Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:1(9Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:1(9Z)/18:0):
DG(20:1(11Z)/18:1(9Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:1(9Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:1(9Z)/18:1(9Z)):
DG(20:1(11Z)/18:1(9Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:1(9Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:1(9Z)/18:1(11Z)):
DG(20:1(11Z)/18:1(9Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:1(9Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:1(9Z)/18:2(9Z,12Z)):
DG(20:1(11Z)/18:1(9Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:1(9Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:1(9Z)/18:3(6Z,9Z,12Z)):
DG(20:1(11Z)/18:1(9Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:1(9Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:1(9Z)/18:3(9Z,12Z,15Z)):
DG(20:1(11Z)/18:1(9Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:1(9Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:1(9Z)/20:0):
DG(20:1(11Z)/18:1(9Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:1(9Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:1(9Z)/20:1(11Z)):
TG(20:1(11Z)/18:1(9Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(20:1(11Z)/18:1(9Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(11Z)/18:1(9Z)/20:1(13Z)):
DG(20:1(11Z)/18:1(9Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:1(9Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:1(9Z)/22:0):
DG(20:1(11Z)/18:1(9Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:1(9Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:1(9Z)/22:1(13Z)):
DG(20:1(11Z)/18:1(9Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:1(9Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:1(11Z)/16:0):
DG(20:1(11Z)/18:1(11Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:1(11Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:1(11Z)/18:0):
DG(20:1(11Z)/18:1(11Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:1(11Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:1(11Z)/18:1(9Z)):
DG(20:1(11Z)/18:1(11Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:1(11Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:1(11Z)/18:1(11Z)):
DG(20:1(11Z)/18:1(11Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:1(11Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:1(11Z)/18:2(9Z,12Z)):
DG(20:1(11Z)/18:1(11Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:1(11Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:1(11Z)/18:3(6Z,9Z,12Z)):
DG(20:1(11Z)/18:1(11Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:1(11Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:1(11Z)/18:3(9Z,12Z,15Z)):
DG(20:1(11Z)/18:1(11Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:1(11Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:1(11Z)/20:0):
DG(20:1(11Z)/18:1(11Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:1(11Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:1(11Z)/20:1(11Z)):
TG(20:1(11Z)/18:1(11Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(20:1(11Z)/18:1(11Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(11Z)/18:1(11Z)/20:1(13Z)):
DG(20:1(11Z)/18:1(11Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:1(11Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:1(11Z)/22:0):
DG(20:1(11Z)/18:1(11Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:1(11Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:1(11Z)/22:1(13Z)):
DG(20:1(11Z)/18:1(11Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:1(11Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:2(9Z,12Z)/16:0):
DG(20:1(11Z)/18:2(9Z,12Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:2(9Z,12Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:2(9Z,12Z)/18:0):
DG(20:1(11Z)/18:2(9Z,12Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:2(9Z,12Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:2(9Z,12Z)/18:1(9Z)):
DG(20:1(11Z)/18:2(9Z,12Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:2(9Z,12Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:2(9Z,12Z)/18:1(11Z)):
DG(20:1(11Z)/18:2(9Z,12Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:2(9Z,12Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:2(9Z,12Z)/18:2(9Z,12Z)):
DG(20:1(11Z)/18:2(9Z,12Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:2(9Z,12Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:2(9Z,12Z)/18:3(6Z,9Z,12Z)):
DG(20:1(11Z)/18:2(9Z,12Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:2(9Z,12Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:2(9Z,12Z)/18:3(9Z,12Z,15Z)):
DG(20:1(11Z)/18:2(9Z,12Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:2(9Z,12Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:2(9Z,12Z)/20:0):
DG(20:1(11Z)/18:2(9Z,12Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:2(9Z,12Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:2(9Z,12Z)/20:1(11Z)):
DG(20:1(11Z)/18:2(9Z,12Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:2(9Z,12Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:2(9Z,12Z)/20:1(13Z)):
DG(20:1(11Z)/18:2(9Z,12Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:2(9Z,12Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:2(9Z,12Z)/22:0):
DG(20:1(11Z)/18:2(9Z,12Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:2(9Z,12Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:2(9Z,12Z)/22:1(13Z)):
DG(20:1(11Z)/18:2(9Z,12Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:2(9Z,12Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:3(6Z,9Z,12Z)/16:0):
DG(20:1(11Z)/18:3(6Z,9Z,12Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:3(6Z,9Z,12Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:3(6Z,9Z,12Z)/18:0):
DG(20:1(11Z)/18:3(6Z,9Z,12Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:3(6Z,9Z,12Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:3(6Z,9Z,12Z)/18:1(9Z)):
DG(20:1(11Z)/18:3(6Z,9Z,12Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:3(6Z,9Z,12Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:3(6Z,9Z,12Z)/18:1(11Z)):
DG(20:1(11Z)/18:3(6Z,9Z,12Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:3(6Z,9Z,12Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:3(6Z,9Z,12Z)/18:2(9Z,12Z)):
DG(20:1(11Z)/18:3(6Z,9Z,12Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:3(6Z,9Z,12Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)):
DG(20:1(11Z)/18:3(6Z,9Z,12Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:3(6Z,9Z,12Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)):
DG(20:1(11Z)/18:3(6Z,9Z,12Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:3(6Z,9Z,12Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:3(6Z,9Z,12Z)/20:0):
DG(20:1(11Z)/18:3(6Z,9Z,12Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:3(6Z,9Z,12Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:3(6Z,9Z,12Z)/20:1(11Z)):
DG(20:1(11Z)/18:3(6Z,9Z,12Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:3(6Z,9Z,12Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:3(6Z,9Z,12Z)/20:1(13Z)):
DG(20:1(11Z)/18:3(6Z,9Z,12Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:3(6Z,9Z,12Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:3(6Z,9Z,12Z)/22:0):
DG(20:1(11Z)/18:3(6Z,9Z,12Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:3(6Z,9Z,12Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:3(6Z,9Z,12Z)/22:1(13Z)):
DG(20:1(11Z)/18:3(6Z,9Z,12Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:3(6Z,9Z,12Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:3(9Z,12Z,15Z)/16:0):
DG(20:1(11Z)/18:3(9Z,12Z,15Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:3(9Z,12Z,15Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:3(9Z,12Z,15Z)/18:0):
DG(20:1(11Z)/18:3(9Z,12Z,15Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:3(9Z,12Z,15Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:3(9Z,12Z,15Z)/18:1(9Z)):
DG(20:1(11Z)/18:3(9Z,12Z,15Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:3(9Z,12Z,15Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:3(9Z,12Z,15Z)/18:1(11Z)):
DG(20:1(11Z)/18:3(9Z,12Z,15Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:3(9Z,12Z,15Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:3(9Z,12Z,15Z)/18:2(9Z,12Z)):
DG(20:1(11Z)/18:3(9Z,12Z,15Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:3(9Z,12Z,15Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:3(9Z,12Z,15Z)/18:3(6Z,9Z,12Z)):
DG(20:1(11Z)/18:3(9Z,12Z,15Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:3(9Z,12Z,15Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)):
DG(20:1(11Z)/18:3(9Z,12Z,15Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:3(9Z,12Z,15Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:3(9Z,12Z,15Z)/20:0):
DG(20:1(11Z)/18:3(9Z,12Z,15Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:3(9Z,12Z,15Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:3(9Z,12Z,15Z)/20:1(11Z)):
DG(20:1(11Z)/18:3(9Z,12Z,15Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:3(9Z,12Z,15Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:3(9Z,12Z,15Z)/20:1(13Z)):
DG(20:1(11Z)/18:3(9Z,12Z,15Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:3(9Z,12Z,15Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:3(9Z,12Z,15Z)/22:0):
DG(20:1(11Z)/18:3(9Z,12Z,15Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:3(9Z,12Z,15Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/18:3(9Z,12Z,15Z)/22:1(13Z)):
DG(20:1(11Z)/18:3(9Z,12Z,15Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/18:3(9Z,12Z,15Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/20:0/16:0):
DG(20:1(11Z)/20:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/20:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/20:0/18:0):
DG(20:1(11Z)/20:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/20:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/20:0/18:1(9Z)):
DG(20:1(11Z)/20:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/20:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/20:0/18:1(11Z)):
DG(20:1(11Z)/20:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/20:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/20:0/18:2(9Z,12Z)):
DG(20:1(11Z)/20:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/20:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/20:0/18:3(6Z,9Z,12Z)):
DG(20:1(11Z)/20:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/20:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/20:0/18:3(9Z,12Z,15Z)):
DG(20:1(11Z)/20:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/20:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/20:0/20:0):
DG(20:1(11Z)/20:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/20:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/20:0/20:1(11Z)):
DG(20:1(11Z)/20:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/20:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/20:0/20:1(13Z)):
DG(20:1(11Z)/20:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/20:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/20:0/22:0):
DG(20:1(11Z)/20:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/20:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/20:0/22:1(13Z)):
DG(20:1(11Z)/20:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/20:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/20:1(11Z)/16:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(11Z)/20:1(11Z)/18:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(11Z)/20:1(11Z)/18:1(9Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(11Z)/20:1(11Z)/18:1(11Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(11Z)/20:1(11Z)/18:2(9Z,12Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(11Z)/20:1(11Z)/18:3(6Z,9Z,12Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(11Z)/20:1(11Z)/18:3(9Z,12Z,15Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(11Z)/20:1(11Z)/20:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(11Z)/20:1(11Z)/20:1(11Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(11Z)/20:1(11Z)/20:1(13Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(11Z)/20:1(11Z)/22:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(11Z)/20:1(11Z)/22:1(13Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(11Z)/20:1(13Z)/16:0):
DG(20:1(11Z)/20:1(13Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/20:1(13Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/20:1(13Z)/18:0):
DG(20:1(11Z)/20:1(13Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/20:1(13Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/20:1(13Z)/18:1(9Z)):
DG(20:1(11Z)/20:1(13Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/20:1(13Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/20:1(13Z)/18:1(11Z)):
DG(20:1(11Z)/20:1(13Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/20:1(13Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/20:1(13Z)/18:2(9Z,12Z)):
DG(20:1(11Z)/20:1(13Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/20:1(13Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/20:1(13Z)/18:3(6Z,9Z,12Z)):
DG(20:1(11Z)/20:1(13Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/20:1(13Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/20:1(13Z)/18:3(9Z,12Z,15Z)):
DG(20:1(11Z)/20:1(13Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/20:1(13Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/20:1(13Z)/20:0):
DG(20:1(11Z)/20:1(13Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/20:1(13Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/20:1(13Z)/20:1(11Z)):
DG(20:1(11Z)/20:1(13Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/20:1(13Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/20:1(13Z)/20:1(13Z)):
DG(20:1(11Z)/20:1(13Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/20:1(13Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/20:1(13Z)/22:0):
DG(20:1(11Z)/20:1(13Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/20:1(13Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/20:1(13Z)/22:1(13Z)):
DG(20:1(11Z)/20:1(13Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/20:1(13Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/22:0/16:0):
DG(20:1(11Z)/22:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/22:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/22:0/18:0):
DG(20:1(11Z)/22:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/22:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/22:0/18:1(9Z)):
DG(20:1(11Z)/22:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/22:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/22:0/18:1(11Z)):
DG(20:1(11Z)/22:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/22:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/22:0/18:2(9Z,12Z)):
DG(20:1(11Z)/22:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/22:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/22:0/18:3(6Z,9Z,12Z)):
DG(20:1(11Z)/22:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/22:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/22:0/18:3(9Z,12Z,15Z)):
DG(20:1(11Z)/22:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/22:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/22:0/20:0):
DG(20:1(11Z)/22:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/22:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/22:0/20:1(11Z)):
DG(20:1(11Z)/22:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/22:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/22:0/20:1(13Z)):
DG(20:1(11Z)/22:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/22:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/22:0/22:0):
DG(20:1(11Z)/22:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/22:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/22:0/22:1(13Z)):
DG(20:1(11Z)/22:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/22:0/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/22:1(13Z)/16:0):
DG(20:1(11Z)/22:1(13Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/22:1(13Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/22:1(13Z)/18:0):
DG(20:1(11Z)/22:1(13Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/22:1(13Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/22:1(13Z)/18:1(9Z)):
DG(20:1(11Z)/22:1(13Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/22:1(13Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/22:1(13Z)/18:1(11Z)):
DG(20:1(11Z)/22:1(13Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/22:1(13Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/22:1(13Z)/18:2(9Z,12Z)):
DG(20:1(11Z)/22:1(13Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/22:1(13Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/22:1(13Z)/18:3(6Z,9Z,12Z)):
DG(20:1(11Z)/22:1(13Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/22:1(13Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/22:1(13Z)/18:3(9Z,12Z,15Z)):
DG(20:1(11Z)/22:1(13Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/22:1(13Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/22:1(13Z)/20:0):
DG(20:1(11Z)/22:1(13Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/22:1(13Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/22:1(13Z)/20:1(11Z)):
DG(20:1(11Z)/22:1(13Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/22:1(13Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/22:1(13Z)/20:1(13Z)):
DG(20:1(11Z)/22:1(13Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/22:1(13Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/22:1(13Z)/22:0):
DG(20:1(11Z)/22:1(13Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/22:1(13Z)/0:0) - Triacylglycerol Degradation TG(20:1(11Z)/22:1(13Z)/22:1(13Z)):
DG(20:1(11Z)/22:1(13Z)/0:0) + Water ⟶ 11Z-Eicosenoic acid + Hydrogen Ion + MG(0:0/22:1(13Z)/0:0) - Triacylglycerol Degradation TG(20:1(13Z)/16:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/16:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/16:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/16:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/16:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/16:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/16:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/16:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/16:0/20:1(11Z)):
TG(20:1(13Z)/16:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(20:1(13Z)/16:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/16:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/16:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/16:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:0/20:1(11Z)):
TG(20:1(13Z)/18:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(20:1(13Z)/18:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:1(9Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:1(9Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:1(9Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:1(9Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:1(9Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:1(9Z)/20:1(11Z)):
TG(20:1(13Z)/18:1(9Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(20:1(13Z)/18:1(9Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:1(9Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:1(9Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:1(11Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:1(11Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:1(11Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:1(11Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:1(11Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:1(11Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:1(11Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:1(11Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:1(11Z)/20:1(11Z)):
TG(20:1(13Z)/18:1(11Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(20:1(13Z)/18:1(11Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:1(11Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:1(11Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:1(11Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:2(9Z,12Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:2(9Z,12Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:2(9Z,12Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:2(9Z,12Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:2(9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:2(9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:2(9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:2(9Z,12Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:2(9Z,12Z)/20:1(11Z)):
TG(20:1(13Z)/18:2(9Z,12Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(20:1(13Z)/18:2(9Z,12Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:2(9Z,12Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:2(9Z,12Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:2(9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:3(6Z,9Z,12Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:3(6Z,9Z,12Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:3(6Z,9Z,12Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:3(6Z,9Z,12Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:3(6Z,9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:3(6Z,9Z,12Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:3(6Z,9Z,12Z)/20:1(11Z)):
TG(20:1(13Z)/18:3(6Z,9Z,12Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(20:1(13Z)/18:3(6Z,9Z,12Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:3(6Z,9Z,12Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:3(6Z,9Z,12Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:3(6Z,9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:3(9Z,12Z,15Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:3(9Z,12Z,15Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:3(9Z,12Z,15Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:3(9Z,12Z,15Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:3(9Z,12Z,15Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:3(9Z,12Z,15Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:3(9Z,12Z,15Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:3(9Z,12Z,15Z)/20:1(11Z)):
TG(20:1(13Z)/18:3(9Z,12Z,15Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(20:1(13Z)/18:3(9Z,12Z,15Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:3(9Z,12Z,15Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:3(9Z,12Z,15Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/18:3(9Z,12Z,15Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:0/20:1(11Z)):
TG(20:1(13Z)/20:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(20:1(13Z)/20:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:1(11Z)/16:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:1(11Z)/18:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:1(11Z)/18:1(9Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:1(11Z)/18:1(11Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:1(11Z)/18:2(9Z,12Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:1(11Z)/18:3(6Z,9Z,12Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:1(11Z)/18:3(9Z,12Z,15Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:1(11Z)/20:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:1(11Z)/20:1(11Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:1(11Z)/20:1(13Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:1(11Z)/22:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:1(11Z)/22:1(13Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:1(13Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:1(13Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:1(13Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:1(13Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:1(13Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:1(13Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:1(13Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:1(13Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:1(13Z)/20:1(11Z)):
TG(20:1(13Z)/20:1(13Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(20:1(13Z)/20:1(13Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:1(13Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:1(13Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/20:1(13Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/22:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/22:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/22:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/22:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/22:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/22:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/22:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/22:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/22:0/20:1(11Z)):
TG(20:1(13Z)/22:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(20:1(13Z)/22:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/22:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/22:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/22:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/22:1(13Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/22:1(13Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/22:1(13Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/22:1(13Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/22:1(13Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/22:1(13Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/22:1(13Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/22:1(13Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/22:1(13Z)/20:1(11Z)):
TG(20:1(13Z)/22:1(13Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(20:1(13Z)/22:1(13Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/22:1(13Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/22:1(13Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(20:1(13Z)/22:1(13Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/16:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/16:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/16:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/16:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/16:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/16:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/16:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/16:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/16:0/20:1(11Z)):
TG(22:0/16:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(22:0/16:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/16:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/16:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/16:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:0/20:1(11Z)):
TG(22:0/18:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(22:0/18:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:1(9Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:1(9Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:1(9Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:1(9Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:1(9Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:1(9Z)/20:1(11Z)):
TG(22:0/18:1(9Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(22:0/18:1(9Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:1(9Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:1(9Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:1(11Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:1(11Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:1(11Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:1(11Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:1(11Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:1(11Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:1(11Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:1(11Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:1(11Z)/20:1(11Z)):
TG(22:0/18:1(11Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(22:0/18:1(11Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:1(11Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:1(11Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:1(11Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:2(9Z,12Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:2(9Z,12Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:2(9Z,12Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:2(9Z,12Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:2(9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:2(9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:2(9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:2(9Z,12Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:2(9Z,12Z)/20:1(11Z)):
TG(22:0/18:2(9Z,12Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(22:0/18:2(9Z,12Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:2(9Z,12Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:2(9Z,12Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:2(9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:3(6Z,9Z,12Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:3(6Z,9Z,12Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:3(6Z,9Z,12Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:3(6Z,9Z,12Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:3(6Z,9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:3(6Z,9Z,12Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:3(6Z,9Z,12Z)/20:1(11Z)):
TG(22:0/18:3(6Z,9Z,12Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(22:0/18:3(6Z,9Z,12Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:3(6Z,9Z,12Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:3(6Z,9Z,12Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:3(6Z,9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:3(9Z,12Z,15Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:3(9Z,12Z,15Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:3(9Z,12Z,15Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:3(9Z,12Z,15Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:3(9Z,12Z,15Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:3(9Z,12Z,15Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:3(9Z,12Z,15Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:3(9Z,12Z,15Z)/20:1(11Z)):
TG(22:0/18:3(9Z,12Z,15Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(22:0/18:3(9Z,12Z,15Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:3(9Z,12Z,15Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:3(9Z,12Z,15Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/18:3(9Z,12Z,15Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:0/20:1(11Z)):
TG(22:0/20:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(22:0/20:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:1(11Z)/16:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:1(11Z)/18:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:1(11Z)/18:1(9Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:1(11Z)/18:1(11Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:1(11Z)/18:2(9Z,12Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:1(11Z)/18:3(6Z,9Z,12Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:1(11Z)/18:3(9Z,12Z,15Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:1(11Z)/20:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:1(11Z)/20:1(11Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:1(11Z)/20:1(13Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:1(11Z)/22:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:1(11Z)/22:1(13Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:1(13Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:1(13Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:1(13Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:1(13Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:1(13Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:1(13Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:1(13Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:1(13Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:1(13Z)/20:1(11Z)):
TG(22:0/20:1(13Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(22:0/20:1(13Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:1(13Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:1(13Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/20:1(13Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/22:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/22:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/22:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/22:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/22:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/22:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/22:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/22:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/22:0/20:1(11Z)):
TG(22:0/22:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(22:0/22:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/22:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/22:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/22:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/22:1(13Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/22:1(13Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/22:1(13Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/22:1(13Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/22:1(13Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/22:1(13Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/22:1(13Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/22:1(13Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/22:1(13Z)/20:1(11Z)):
TG(22:0/22:1(13Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(22:0/22:1(13Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/22:1(13Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/22:1(13Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:0/22:1(13Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/16:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/16:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/16:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/16:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/16:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/16:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/16:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/16:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/16:0/20:1(11Z)):
TG(22:1(13Z)/16:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(22:1(13Z)/16:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/16:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/16:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/16:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:0/20:1(11Z)):
TG(22:1(13Z)/18:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(22:1(13Z)/18:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:1(9Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:1(9Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:1(9Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:1(9Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:1(9Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:1(9Z)/20:1(11Z)):
TG(22:1(13Z)/18:1(9Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(22:1(13Z)/18:1(9Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:1(9Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:1(11Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:1(11Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:1(11Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:1(11Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:1(11Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:1(11Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:1(11Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:1(11Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:1(11Z)/20:1(11Z)):
TG(22:1(13Z)/18:1(11Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(22:1(13Z)/18:1(11Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:1(11Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:1(11Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:1(11Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:2(9Z,12Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:2(9Z,12Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:2(9Z,12Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:2(9Z,12Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:2(9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:2(9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:2(9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:2(9Z,12Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:2(9Z,12Z)/20:1(11Z)):
TG(22:1(13Z)/18:2(9Z,12Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(22:1(13Z)/18:2(9Z,12Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:2(9Z,12Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:2(9Z,12Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:2(9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:3(6Z,9Z,12Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:3(6Z,9Z,12Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:3(6Z,9Z,12Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:3(6Z,9Z,12Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:3(6Z,9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:3(6Z,9Z,12Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:3(6Z,9Z,12Z)/20:1(11Z)):
TG(22:1(13Z)/18:3(6Z,9Z,12Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(22:1(13Z)/18:3(6Z,9Z,12Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:3(6Z,9Z,12Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:3(6Z,9Z,12Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:3(6Z,9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:3(9Z,12Z,15Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:3(9Z,12Z,15Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:3(9Z,12Z,15Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:3(9Z,12Z,15Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:3(9Z,12Z,15Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:3(9Z,12Z,15Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:3(9Z,12Z,15Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:3(9Z,12Z,15Z)/20:1(11Z)):
TG(22:1(13Z)/18:3(9Z,12Z,15Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(22:1(13Z)/18:3(9Z,12Z,15Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:3(9Z,12Z,15Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:3(9Z,12Z,15Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:3(9Z,12Z,15Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:0/20:1(11Z)):
TG(22:1(13Z)/20:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(22:1(13Z)/20:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:1(11Z)/16:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:1(11Z)/18:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:1(11Z)/18:1(9Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:1(11Z)/18:1(11Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:1(11Z)/18:2(9Z,12Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:1(11Z)/18:3(6Z,9Z,12Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:1(11Z)/18:3(9Z,12Z,15Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:1(11Z)/20:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:1(11Z)/20:1(11Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:1(11Z)/20:1(13Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:1(11Z)/22:0):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:1(11Z)/22:1(13Z)):
MG(20:1(11Z)/0:0/0:0) + Water ⟶ 11Z-Eicosenoic acid + Glycerol + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:1(13Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:1(13Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:1(13Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:1(13Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:1(13Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:1(13Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:1(13Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:1(13Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:1(13Z)/20:1(11Z)):
TG(22:1(13Z)/20:1(13Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(22:1(13Z)/20:1(13Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:1(13Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:1(13Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/20:1(13Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/22:0/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/22:0/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/22:0/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/22:0/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/22:0/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/22:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/22:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/22:0/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/22:0/20:1(11Z)):
TG(22:1(13Z)/22:0/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(22:1(13Z)/22:0/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/22:0/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/22:0/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/22:0/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/22:1(13Z)/16:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/22:1(13Z)/18:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/22:1(13Z)/18:1(9Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/22:1(13Z)/18:1(11Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/22:1(13Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/22:1(13Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/22:1(13Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/22:1(13Z)/20:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/22:1(13Z)/20:1(11Z)):
TG(22:1(13Z)/22:1(13Z)/20:1(11Z)) + Water ⟶ 11Z-Eicosenoic acid + DG(22:1(13Z)/22:1(13Z)/0:0) + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/22:1(13Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/22:1(13Z)/22:0):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/22:1(13Z)/22:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(22:1(13Z)/18:1(9Z)/20:1(13Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:1(11Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Triacylglycerol Degradation TG(18:3(9Z,12Z,15Z)/18:2(9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Glycerol ⟶ Adenosine diphosphate + Glycerol 3-phosphate + Hydrogen Ion - Inositol Phosphate Metabolism:
Myo-inositol 1-phosphate + Water ⟶ Phosphate + myo-Inositol - Inositol Metabolism:
Myo-inositol 1-phosphate + Water ⟶ Phosphate + myo-Inositol - Phosphatidylinositol Phosphate Metabolism:
CDP-DG(16:0/18:1(9Z)) + myo-Inositol ⟶ Cytidine monophosphate + PI(16:0/18:1(9Z)) - Joubert Syndrome:
CDP-DG(16:0/18:1(9Z)) + myo-Inositol ⟶ Cytidine monophosphate + PI(16:0/18:1(9Z)) - Phosphatidylinositol Phosphate Metabolism:
CDP-DG(16:0/18:1(9Z)) + myo-Inositol ⟶ Cytidine monophosphate + PI(16:0/18:1(9Z)) - Joubert Syndrome:
CDP-DG(16:0/18:1(9Z)) + myo-Inositol ⟶ Cytidine monophosphate + PI(16:0/18:1(9Z)) - Phosphatidylinositol Phosphate Metabolism:
CDP-DG(16:0/18:1(9Z)) + myo-Inositol ⟶ Cytidine monophosphate + PI(16:0/18:1(9Z)) - Phosphatidylinositol Phosphate Metabolism:
CDP-DG(16:0/18:1(9Z)) + myo-Inositol ⟶ Cytidine monophosphate + PI(16:0/18:1(9Z)) - Phosphatidylinositol Phosphate Metabolism:
CDP-DG(16:0/18:1(9Z)) + myo-Inositol ⟶ Cytidine monophosphate + PI(16:0/18:1(9Z)) - Phosphatidylinositol Phosphate Metabolism:
CDP-DG(16:0/18:1(9Z)) + myo-Inositol ⟶ Cytidine monophosphate + PI(16:0/18:1(9Z)) - Joubert Syndrome:
CDP-DG(16:0/18:1(9Z)) + myo-Inositol ⟶ Cytidine monophosphate + PI(16:0/18:1(9Z)) - Nicotinate and Nicotinamide Metabolism:
NAD + Water ⟶ Adenosine monophosphate + Nicotinamide ribotide - Nicotinate and Nicotinamide Metabolism:
Adenosine triphosphate + L-Glutamine + Nicotinic acid adenine dinucleotide + Water ⟶ Adenosine monophosphate + L-Glutamic acid + NAD + Pyrophosphate - Nicotinate and Nicotinamide Metabolism:
Adenosine triphosphate + L-Glutamine + Nicotinic acid adenine dinucleotide + Water ⟶ Adenosine monophosphate + L-Glutamic acid + NAD + Pyrophosphate - Nicotinate and Nicotinamide Metabolism:
Adenosine triphosphate + L-Glutamine + Nicotinic acid adenine dinucleotide + Water ⟶ Adenosine monophosphate + L-Glutamic acid + NAD + Pyrophosphate - Nicotinate and Nicotinamide Metabolism:
Adenosine triphosphate + L-Glutamine + Nicotinic acid adenine dinucleotide + Water ⟶ Adenosine monophosphate + L-Glutamic acid + NAD + Pyrophosphate - Mycophenolic Acid Metabolism Pathway:
Adenosine triphosphate + Mycophenolic acid + Water ⟶ Adenosine diphosphate + Mycophenolic acid + Phosphate - Steroid Biosynthesis:
Lathosterol + NADPH + Oxygen ⟶ 7-Dehydrocholesterol + NADP + Water - Smith-Lemli-Opitz Syndrome (SLOS):
Lathosterol + NADPH + Oxygen ⟶ 7-Dehydrocholesterol + NADP + Water - CHILD Syndrome:
Lathosterol + NADPH + Oxygen ⟶ 7-Dehydrocholesterol + NADP + Water - Desmosterolosis:
Lathosterol + NADPH + Oxygen ⟶ 7-Dehydrocholesterol + NADP + Water - Chondrodysplasia Punctata II, X-Linked Dominant (CDPX2):
Lathosterol + NADPH + Oxygen ⟶ 7-Dehydrocholesterol + NADP + Water - Lysosomal Acid Lipase Deficiency (Wolman Disease):
Lathosterol + NADPH + Oxygen ⟶ 7-Dehydrocholesterol + NADP + Water - Ibandronate Action Pathway:
Lathosterol + NADPH + Oxygen ⟶ 7-Dehydrocholesterol + NADP + Water - Simvastatin Action Pathway:
Lathosterol + NADPH + Oxygen ⟶ 7-Dehydrocholesterol + NADP + Water - Pravastatin Action Pathway:
Lathosterol + NADPH + Oxygen ⟶ 7-Dehydrocholesterol + NADP + Water - Rosuvastatin Action Pathway:
Lathosterol + NADPH + Oxygen ⟶ 7-Dehydrocholesterol + NADP + Water - Alendronate Action Pathway:
Lathosterol + NADPH + Oxygen ⟶ 7-Dehydrocholesterol + NADP + Water - Hypercholesterolemia:
Lathosterol + NADPH + Oxygen ⟶ 7-Dehydrocholesterol + NADP + Water - Lovastatin Action Pathway:
Lathosterol + NADPH + Oxygen ⟶ 7-Dehydrocholesterol + NADP + Water - Zoledronate Action Pathway:
Lathosterol + NADPH + Oxygen ⟶ 7-Dehydrocholesterol + NADP + Water - Cerivastatin Action Pathway:
Lathosterol + NADPH + Oxygen ⟶ 7-Dehydrocholesterol + NADP + Water - Risedronate Action Pathway:
Lathosterol + NADPH + Oxygen ⟶ 7-Dehydrocholesterol + NADP + Water - Pamidronate Action Pathway:
Lathosterol + NADPH + Oxygen ⟶ 7-Dehydrocholesterol + NADP + Water - Fluvastatin Action Pathway:
Lathosterol + NADPH + Oxygen ⟶ 7-Dehydrocholesterol + NADP + Water - Atorvastatin Action Pathway:
Lathosterol + NADPH + Oxygen ⟶ 7-Dehydrocholesterol + NADP + Water - Cholesteryl Ester Storage Disease:
Lathosterol + NADPH + Oxygen ⟶ 7-Dehydrocholesterol + NADP + Water - Hyper-IgD Syndrome:
Lathosterol + NADPH + Oxygen ⟶ 7-Dehydrocholesterol + NADP + Water - Mevalonic Aciduria:
Lathosterol + NADPH + Oxygen ⟶ 7-Dehydrocholesterol + NADP + Water - Wolman Disease:
Lathosterol + NADPH + Oxygen ⟶ 7-Dehydrocholesterol + NADP + Water - Steroid Biosynthesis:
Farnesyl pyrophosphate + NADPH ⟶ NADP + Pyrophosphate + Squalene - Terpenoid Backbone Biosynthesis:
3-Hydroxy-3-methylglutaryl-CoA + NADPH ⟶ Coenzyme A + Mevalonic acid + NADP - Cholesterol biosynthesis and metabolism CE(14:0):
Desmosterol ⟶ Cholesterol - Cholesterol biosynthesis and metabolism CE(10:0):
Desmosterol ⟶ Cholesterol - Cholesterol Biosynthesis and Metabolism CE(12:0):
Cholesterol + Lauroyl-CoA ⟶ CE(12:0) + Coenzyme A - Cholesterol Biosynthesis and Metabolism CE(16:0):
Cholesterol + Palmityl-CoA ⟶ CE(16:0) + Coenzyme A - Cholesterol biosynthesis and metabolism CE(18:0):
Desmosterol ⟶ Cholesterol - Steroid Biosynthesis:
7-Dehydrocholesterol + NADPH ⟶ Cholesterol + NADP - CHILD Syndrome:
7-Dehydrocholesterol + NADPH ⟶ Cholesterol + NADP - Chondrodysplasia Punctata II, X-Linked Dominant (CDPX2):
7-Dehydrocholesterol + NADPH ⟶ Cholesterol + NADP - Desmosterolosis:
7-Dehydrocholesterol + NADPH ⟶ Cholesterol + NADP - Lysosomal Acid Lipase Deficiency (Wolman Disease):
7-Dehydrocholesterol + NADPH ⟶ Cholesterol + NADP - Smith-Lemli-Opitz Syndrome (SLOS):
7-Dehydrocholesterol + NADPH ⟶ Cholesterol + NADP - Hypercholesterolemia:
7-Dehydrocholesterol + NADPH ⟶ Cholesterol + NADP - Cholesteryl Ester Storage Disease:
7-Dehydrocholesterol + NADPH ⟶ Cholesterol + NADP - Hyper-IgD Syndrome:
7-Dehydrocholesterol + NADPH ⟶ Cholesterol + NADP - Mevalonic Aciduria:
7-Dehydrocholesterol + NADPH ⟶ Cholesterol + NADP - Wolman Disease:
7-Dehydrocholesterol + NADPH ⟶ Cholesterol + NADP - Cholesterol Biosynthesis and Metabolism:
Cholesterol + long-chain fatty acyl-CoA ⟶ Cholesteryl ester + Coenzyme A - Steroid Biosynthesis:
7-Dehydrocholesterol + NADPH ⟶ Cholesterol + NADP - Steroid Biosynthesis:
7-Dehydrocholesterol + NADPH ⟶ Cholesterol + NADP - CHILD Syndrome:
7-Dehydrocholesterol + NADPH ⟶ Cholesterol + NADP - Chondrodysplasia Punctata II, X-Linked Dominant (CDPX2):
7-Dehydrocholesterol + NADPH ⟶ Cholesterol + NADP - Desmosterolosis:
7-Dehydrocholesterol + NADPH ⟶ Cholesterol + NADP - Lysosomal Acid Lipase Deficiency (Wolman Disease):
7-Dehydrocholesterol + NADPH ⟶ Cholesterol + NADP - Smith-Lemli-Opitz Syndrome (SLOS):
7-Dehydrocholesterol + NADPH ⟶ Cholesterol + NADP - Hypercholesterolemia:
7-Dehydrocholesterol + NADPH ⟶ Cholesterol + NADP - Cholesteryl Ester Storage Disease:
7-Dehydrocholesterol + NADPH ⟶ Cholesterol + NADP - Hyper-IgD Syndrome:
7-Dehydrocholesterol + NADPH ⟶ Cholesterol + NADP - Mevalonic Aciduria:
7-Dehydrocholesterol + NADPH ⟶ Cholesterol + NADP - Wolman Disease:
7-Dehydrocholesterol + NADPH ⟶ Cholesterol + NADP - Mevalonate Pathway:
(S)-2,3-Epoxysqualene ⟶ Lanosterol - Mevalonate Pathway:
3-Hydroxy-3-methylglutaryl-CoA + Hydrogen Ion + NADPH ⟶ (R)-mevalonate + Coenzyme A + NADP - Quorum Sensing:
S-Adenosylhomocysteine + Water ⟶ Adenine + S-ribosyl-L-homocysteine - Vindesine Action Pathway:
Adenosine triphosphate + Vindesine + Water ⟶ Adenosine diphosphate + Phosphate + Vindesine - Thiosulfate Disproportionation III:
Adenosine triphosphate + Thiosulfate + Water ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate + Thiosulfate - Thiosulfate Disproportionation III:
Adenosine triphosphate + Thiosulfate + Water ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate + Thiosulfate - Taurine Metabolism:
Oxoglutaric acid + Oxygen + Taurine ⟶ Aminoacetaldehyde + Carbon dioxide + Succinic acid + Sulfite - Taurine Metabolism I:
Oxoglutaric acid + Oxygen + Taurine ⟶ Aminoacetaldehyde + Carbon dioxide + Succinic acid + Sulfite - Taurine Metabolism:
Adenosine triphosphate + Taurine + Water ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate + Taurine - Taurine Metabolism I:
Adenosine triphosphate + Taurine + Water ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate + Taurine - S-Adenosyl-L-Methionine Biosynthesis:
5'-S-methyl-5'-thioadenosine + Water ⟶ 5-Methylthioribose + Adenine - S-Adenosyl-L-Methionine Biosynthesis:
5'-S-methyl-5'-thioadenosine + Water ⟶ 5-Methylthioribose + Adenine - Adefovir Dipivoxil Metabolism Pathway:
Adefovir + Adenosine triphosphate ⟶ Adefovir Monophosphate + Adenosine diphosphate - Phytate Biosynthesis:
Adenosine triphosphate + Inositol 1,3,4-trisphosphate ⟶ 1D-Myo-inositol 1,3,4,6-tetrakisphosphate + Adenosine diphosphate + Hydrogen Ion - Lysolipid incorporation into Mitochondria PC(16:0/16:0):
Adenosine triphosphate + LysoPC(16:0) + Water ⟶ Adenosine diphosphate + LysoPC(16:0) + Phosphate - Lysolipid Incorporation into ER PC(16:0/16:0):
Adenosine triphosphate + LysoPC(16:0) + Water ⟶ Adenosine diphosphate + LysoPC(16:0) + Phosphate - PRPP Biosynthesis:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Hydrogen Ion + Phosphoribosyl pyrophosphate - Choline Metabolism:
PC(16:0/16:0) + Water ⟶ Choline + Hydrogen Ion + PA(16:0/16:0) - Lysolipid Incorporation into ER:
Glycerophosphocholine + Water ⟶ Choline + Glycerol 3-phosphate + Hydrogen Ion - Lysolipid Incorporation into ER PC(10:0/10:0):
Glycerophosphocholine + Water ⟶ Choline + Glycerol 3-phosphate + Hydrogen Ion - Lysolipid Incorporation into ER PC(14:0/14:0):
Glycerophosphocholine + Water ⟶ Choline + Glycerol 3-phosphate + Hydrogen Ion - Lysolipid Incorporation into ER PC(16:1(11Z)/16:1(11Z)):
Glycerophosphocholine + Water ⟶ Choline + Glycerol 3-phosphate + Hydrogen Ion - Lysolipid Incorporation into ER PC(18:0/18:0):
Glycerophosphocholine + Water ⟶ Choline + Glycerol 3-phosphate + Hydrogen Ion - Lysolipid Incorporation into ER PC(18:2(9Z,11Z)/18:2(9Z,11Z)):
Glycerophosphocholine + Water ⟶ Choline + Glycerol 3-phosphate + Hydrogen Ion - Phosphatidylcholine Biosynthesis:
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis:
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine biosynthesis PC(14:0/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11D3/11D3):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11D3/11D5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11D3/13D5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11D3/9D3):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11D3/9D5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11D3/11M3):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11D3/11M5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11D3/13M5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11D3/9M5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11D5/11D3):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11D5/11D5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11D5/13D5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11D5/9D3):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11D5/9D5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11D5/11M3):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11D5/11M5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11D5/13M5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11D5/9M5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(13D5/11D3):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(13D5/11D5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(13D5/13D5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(13D5/9D3):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(13D5/9D5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(13D5/11M3):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(13D5/11M5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(13D5/13M5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(13D5/9M5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(9D3/11D3):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(9D3/11D5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(9D3/13D5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(9D3/9D3):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(9D3/9D5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(9D3/11M3):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(9D3/11M5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(9D3/13M5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(9D3/9M5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(9D5/11D3):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(9D5/11D5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(9D5/13D5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(9D5/9D3):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(9D5/9D5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(9D5/11M3):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(9D5/11M5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(9D5/13M5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(9D5/9M5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11M3/11D3):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11M3/11D5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11M3/13D5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11M3/9D3):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11M3/9D5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11M3/11M3):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11M3/11M5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11M3/13M5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11M3/9M5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11M5/11D3):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11M5/11D5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11M5/13D5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11M5/9D3):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11M5/9D5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11M5/11M3):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11M5/11M5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11M5/13M5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(11M5/9M5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(13M5/11D3):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(13M5/11D5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(13M5/13D5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(13M5/9D3):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(13M5/9D5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(13M5/11M3):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(13M5/11M5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(13M5/13M5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(13M5/9M5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(9M5/11D3):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(9M5/11D5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(9M5/13D5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(9M5/9D3):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(9M5/9D5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(9M5/11M3):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(9M5/11M5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(9M5/13M5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(9M5/9M5):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis:
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/16:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(16:0/18:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(16:0/18:1(9Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(16:0/18:1(11Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(16:0/18:2(9Z,12Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(16:0/18:3(6Z,9Z,12Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(16:0/18:3(9Z,12Z,15Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(16:0/20:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(16:0/20:1(11Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(16:0/20:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(16:0/22:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(16:0/22:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:0/18:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:0/18:1(9Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:0/18:1(11Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:0/18:2(9Z,12Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:0/18:3(6Z,9Z,12Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:0/18:3(9Z,12Z,15Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:0/20:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:0/20:1(11Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:0/20:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:0/22:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:0/22:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:1(9Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:1(11Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:2(9Z,12Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:3(6Z,9Z,12Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:3(9Z,12Z,15Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:1(11Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:1(11Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:2(9Z,12Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:3(6Z,9Z,12Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:3(9Z,12Z,15Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:1(11Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:2(9Z,12Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:1(11Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:1(11Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:1(11Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(20:0/20:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(20:0/20:1(11Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(20:0/20:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(20:0/22:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(20:0/22:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:1(11Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(20:1(13Z)/20:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(20:1(13Z)/22:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(20:1(13Z)/22:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(22:0/22:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(22:0/22:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylcholine Biosynthesis PC(14:0/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/18:0):
CDP-Ethanolamine + DG(18:0/18:0/0:0) ⟶ Cytidine monophosphate + PE(18:0/18:0) - Phosphatidylcholine Biosynthesis PC(18:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis:
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/18:0):
CDP-Ethanolamine + DG(18:0/18:0/0:0) ⟶ Cytidine monophosphate + PE(18:0/18:0) - Phosphatidylcholine Biosynthesis PC(18:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis:
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(14:1(9Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(15:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(16:1(9Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/18:0):
CDP-Ethanolamine + DG(18:0/18:0/0:0) ⟶ Cytidine monophosphate + PE(18:0/18:0) - Phosphatidylcholine Biosynthesis PC(18:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(11Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:1(9Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:1(11Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:1(13Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine Biosynthesis PC(24:1(15Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine - Phosphatidylcholine/Phosphatidylethanolamine Biosynthesis:
L-Serine + Phosphatidylcholine ⟶ Choline + an L-1-phosphatidylserine - Array:
L-Serine + PC(14:0/14:0) ⟶ Choline + PS(14:0/14:0) - Array:
L-Serine + PC(14:0/i-15:0) ⟶ Choline + PS(14:0/i-15:0) - Array:
L-Serine + PC(14:0/16:0) ⟶ Choline + PS(14:0/16:0) - Array:
L-Serine + PC(14:0/16:1(9Z)) ⟶ Choline + PS(14:0/16:1(9Z)) - Array:
L-Serine + PC(14:0/i-17:0) ⟶ Choline + PS(14:0/i-17:0) - Array:
L-Serine + PC(14:0/18:0) ⟶ Choline + PS(14:0/18:0) - Array:
L-Serine + PC(14:0/18:1(9Z)) ⟶ Choline + PS(14:0/18:1(9Z)) - Array:
L-Serine + PC(14:0/18:1(11Z)) ⟶ Choline + PS(14:0/18:1(11Z)) - Array:
L-Serine + PC(14:0/18:2(9Z,12Z)) ⟶ Choline + PS(14:0/18:2(9Z,12Z)) - Array:
L-Serine + PC(14:0/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(14:0/18:3(6Z,9Z,12Z)) - Array:
L-Serine + PC(14:0/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(14:0/18:3(9Z,12Z,15Z)) - Array:
L-Serine + PC(14:0/20:0) ⟶ Choline + PS(14:0/20:0) - Array:
L-Serine + PC(14:0/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(14:0/20:3(5Z,8Z,11Z)) - Array:
L-Serine + PC(14:0/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(14:0/20:3(8Z,11Z,14Z)) - Array:
L-Serine + PC(14:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(14:0/20:4(5Z,8Z,11Z,14Z)) - Array:
L-Serine + PC(14:0/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(14:0/20:4(8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(14:0/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(14:0/20:5(5Z,8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(i-15:0/i-15:0) ⟶ Choline + PS(i-15:0/i-15:0) - Array:
L-Serine + PC(i-15:0/16:0) ⟶ Choline + PS(i-15:0/16:0) - Array:
L-Serine + PC(i-15:0/16:1(9Z)) ⟶ Choline + PS(i-15:0/16:1(9Z)) - Array:
L-Serine + PC(i-15:0/i-17:0) ⟶ Choline + PS(i-15:0/i-17:0) - Array:
L-Serine + PC(i-15:0/18:0) ⟶ Choline + PS(i-15:0/18:0) - Array:
L-Serine + PC(i-15:0/18:1(9Z)) ⟶ Choline + PS(i-15:0/18:1(9Z)) - Array:
L-Serine + PC(i-15:0/18:1(11Z)) ⟶ Choline + PS(i-15:0/18:1(11Z)) - Array:
L-Serine + PC(i-15:0/18:2(9Z,12Z)) ⟶ Choline + PS(i-15:0/18:2(9Z,12Z)) - Array:
L-Serine + PC(i-15:0/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(i-15:0/18:3(6Z,9Z,12Z)) - Array:
L-Serine + PC(i-15:0/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(i-15:0/18:3(9Z,12Z,15Z)) - Array:
L-Serine + PC(i-15:0/20:0) ⟶ Choline + PS(i-15:0/20:0) - Array:
L-Serine + PC(i-15:0/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(i-15:0/20:3(5Z,8Z,11Z)) - Array:
L-Serine + PC(i-15:0/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(i-15:0/20:3(8Z,11Z,14Z)) - Array:
L-Serine + PC(i-15:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(i-15:0/20:4(5Z,8Z,11Z,14Z)) - Array:
L-Serine + PC(i-15:0/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(i-15:0/20:4(8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(i-15:0/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(i-15:0/20:5(5Z,8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(16:0/16:0) ⟶ Choline + PS(16:0/16:0) - Array:
L-Serine + PC(16:0/16:1(9Z)) ⟶ Choline + PS(16:0/16:1(9Z)) - Array:
L-Serine + PC(16:0/i-17:0) ⟶ Choline + PS(16:0/i-17:0) - Array:
L-Serine + PC(16:0/18:0) ⟶ Choline + PS(16:0/18:0) - Array:
L-Serine + PC(16:0/18:1(9Z)) ⟶ Choline + PS(16:0/18:1(9Z)) - Array:
L-Serine + PC(16:0/18:1(11Z)) ⟶ Choline + PS(16:0/18:1(11Z)) - Array:
L-Serine + PC(16:0/18:2(9Z,12Z)) ⟶ Choline + PS(16:0/18:2(9Z,12Z)) - Array:
L-Serine + PC(16:0/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(16:0/18:3(6Z,9Z,12Z)) - Array:
L-Serine + PC(16:0/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(16:0/18:3(9Z,12Z,15Z)) - Array:
L-Serine + PC(16:0/20:0) ⟶ Choline + PS(16:0/20:0) - Array:
L-Serine + PC(16:0/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(16:0/20:3(5Z,8Z,11Z)) - Array:
L-Serine + PC(16:0/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(16:0/20:3(8Z,11Z,14Z)) - Array:
L-Serine + PC(16:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(16:0/20:4(5Z,8Z,11Z,14Z)) - Array:
L-Serine + PC(16:0/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(16:0/20:4(8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(16:0/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(16:0/20:5(5Z,8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(16:1(9Z)/16:1(9Z)) ⟶ Choline + PS(16:1(9Z)/16:1(9Z)) - Array:
L-Serine + PC(16:1(9Z)/i-17:0) ⟶ Choline + PS(16:1(9Z)/i-17:0) - Array:
L-Serine + PC(16:1(9Z)/18:0) ⟶ Choline + PS(16:1(9Z)/18:0) - Array:
L-Serine + PC(16:1(9Z)/18:1(9Z)) ⟶ Choline + PS(16:1(9Z)/18:1(9Z)) - Array:
L-Serine + PC(16:1(9Z)/18:1(11Z)) ⟶ Choline + PS(16:1(9Z)/18:1(11Z)) - Array:
L-Serine + PC(16:1(9Z)/18:2(9Z,12Z)) ⟶ Choline + PS(16:1(9Z)/18:2(9Z,12Z)) - Array:
L-Serine + PC(16:1(9Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(16:1(9Z)/18:3(6Z,9Z,12Z)) - Array:
L-Serine + PC(16:1(9Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(16:1(9Z)/18:3(9Z,12Z,15Z)) - Array:
L-Serine + PC(16:1(9Z)/20:0) ⟶ Choline + PS(16:1(9Z)/20:0) - Array:
L-Serine + PC(16:1(9Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(16:1(9Z)/20:3(5Z,8Z,11Z)) - Array:
L-Serine + PC(16:1(9Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(16:1(9Z)/20:3(8Z,11Z,14Z)) - Array:
L-Serine + PC(16:1(9Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(16:1(9Z)/20:4(5Z,8Z,11Z,14Z)) - Array:
L-Serine + PC(16:1(9Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(16:1(9Z)/20:4(8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(16:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(16:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(i-17:0/i-17:0) ⟶ Choline + PS(i-17:0/i-17:0) - Array:
L-Serine + PC(i-17:0/18:0) ⟶ Choline + PS(i-17:0/18:0) - Array:
L-Serine + PC(i-17:0/18:1(9Z)) ⟶ Choline + PS(i-17:0/18:1(9Z)) - Array:
L-Serine + PC(i-17:0/18:1(11Z)) ⟶ Choline + PS(i-17:0/18:1(11Z)) - Array:
L-Serine + PC(i-17:0/18:2(9Z,12Z)) ⟶ Choline + PS(i-17:0/18:2(9Z,12Z)) - Array:
L-Serine + PC(i-17:0/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(i-17:0/18:3(6Z,9Z,12Z)) - Array:
L-Serine + PC(i-17:0/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(i-17:0/18:3(9Z,12Z,15Z)) - Array:
L-Serine + PC(i-17:0/20:0) ⟶ Choline + PS(i-17:0/20:0) - Array:
L-Serine + PC(i-17:0/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(i-17:0/20:3(5Z,8Z,11Z)) - Array:
L-Serine + PC(i-17:0/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(i-17:0/20:3(8Z,11Z,14Z)) - Array:
L-Serine + PC(i-17:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(i-17:0/20:4(5Z,8Z,11Z,14Z)) - Array:
L-Serine + PC(i-17:0/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(i-17:0/20:4(8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(i-17:0/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(i-17:0/20:5(5Z,8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(18:0/18:0) ⟶ Choline + PS(18:0/18:0) - Array:
L-Serine + PC(18:0/18:1(9Z)) ⟶ Choline + PS(18:0/18:1(9Z)) - Array:
L-Serine + PC(18:0/18:1(11Z)) ⟶ Choline + PS(18:0/18:1(11Z)) - Array:
L-Serine + PC(18:0/18:2(9Z,12Z)) ⟶ Choline + PS(18:0/18:2(9Z,12Z)) - Array:
L-Serine + PC(18:0/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(18:0/18:3(6Z,9Z,12Z)) - Array:
L-Serine + PC(18:0/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:0/18:3(9Z,12Z,15Z)) - Array:
L-Serine + PC(18:0/20:0) ⟶ Choline + PS(18:0/20:0) - Array:
L-Serine + PC(18:0/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:0/20:3(5Z,8Z,11Z)) - Array:
L-Serine + PC(18:0/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:0/20:3(8Z,11Z,14Z)) - Array:
L-Serine + PC(18:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:0/20:4(5Z,8Z,11Z,14Z)) - Array:
L-Serine + PC(18:0/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:0/20:4(8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(18:0/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:0/20:5(5Z,8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(18:1(9Z)/18:1(9Z)) ⟶ Choline + PS(18:1(9Z)/18:1(9Z)) - Array:
L-Serine + PC(18:1(9Z)/18:1(11Z)) ⟶ Choline + PS(18:1(9Z)/18:1(11Z)) - Array:
L-Serine + PC(18:1(9Z)/18:2(9Z,12Z)) ⟶ Choline + PS(18:1(9Z)/18:2(9Z,12Z)) - Array:
L-Serine + PC(18:1(9Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(18:1(9Z)/18:3(6Z,9Z,12Z)) - Array:
L-Serine + PC(18:1(9Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:1(9Z)/18:3(9Z,12Z,15Z)) - Array:
L-Serine + PC(18:1(9Z)/20:0) ⟶ Choline + PS(18:1(9Z)/20:0) - Array:
L-Serine + PC(18:1(9Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:1(9Z)/20:3(5Z,8Z,11Z)) - Array:
L-Serine + PC(18:1(9Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:1(9Z)/20:3(8Z,11Z,14Z)) - Array:
L-Serine + PC(18:1(9Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:1(9Z)/20:4(5Z,8Z,11Z,14Z)) - Array:
L-Serine + PC(18:1(9Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:1(9Z)/20:4(8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(18:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(18:1(11Z)/18:1(11Z)) ⟶ Choline + PS(18:1(11Z)/18:1(11Z)) - Array:
L-Serine + PC(18:1(11Z)/18:2(9Z,12Z)) ⟶ Choline + PS(18:1(11Z)/18:2(9Z,12Z)) - Array:
L-Serine + PC(18:1(11Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(18:1(11Z)/18:3(6Z,9Z,12Z)) - Array:
L-Serine + PC(18:1(11Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:1(11Z)/18:3(9Z,12Z,15Z)) - Array:
L-Serine + PC(18:1(11Z)/20:0) ⟶ Choline + PS(18:1(11Z)/20:0) - Array:
L-Serine + PC(18:1(11Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:1(11Z)/20:3(5Z,8Z,11Z)) - Array:
L-Serine + PC(18:1(11Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:1(11Z)/20:3(8Z,11Z,14Z)) - Array:
L-Serine + PC(18:1(11Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:1(11Z)/20:4(5Z,8Z,11Z,14Z)) - Array:
L-Serine + PC(18:1(11Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:1(11Z)/20:4(8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(18:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(18:2(9Z,12Z)/18:2(9Z,12Z)) ⟶ Choline + PS(18:2(9Z,12Z)/18:2(9Z,12Z)) - Array:
L-Serine + PC(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)) - Array:
L-Serine + PC(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)) - Array:
L-Serine + PC(18:2(9Z,12Z)/20:0) ⟶ Choline + PS(18:2(9Z,12Z)/20:0) - Array:
L-Serine + PC(18:2(9Z,12Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:3(5Z,8Z,11Z)) - Array:
L-Serine + PC(18:2(9Z,12Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:3(8Z,11Z,14Z)) - Array:
L-Serine + PC(18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) - Array:
L-Serine + PC(18:2(9Z,12Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:4(8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(18:2(9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)) - Array:
L-Serine + PC(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)) - Array:
L-Serine + PC(18:3(6Z,9Z,12Z)/20:0) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:0) - Array:
L-Serine + PC(18:3(6Z,9Z,12Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:3(5Z,8Z,11Z)) - Array:
L-Serine + PC(18:3(6Z,9Z,12Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:3(8Z,11Z,14Z)) - Array:
L-Serine + PC(18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) - Array:
L-Serine + PC(18:3(6Z,9Z,12Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:4(8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(18:3(6Z,9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)) - Array:
L-Serine + PC(18:3(9Z,12Z,15Z)/20:0) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:0) - Array:
L-Serine + PC(18:3(9Z,12Z,15Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:3(5Z,8Z,11Z)) - Array:
L-Serine + PC(18:3(9Z,12Z,15Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:3(8Z,11Z,14Z)) - Array:
L-Serine + PC(18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) - Array:
L-Serine + PC(18:3(9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(18:3(9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(20:0/20:0) ⟶ Choline + PS(20:0/20:0) - Array:
L-Serine + PC(20:0/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(20:0/20:3(5Z,8Z,11Z)) - Array:
L-Serine + PC(20:0/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(20:0/20:3(8Z,11Z,14Z)) - Array:
L-Serine + PC(20:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:0/20:4(5Z,8Z,11Z,14Z)) - Array:
L-Serine + PC(20:0/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:0/20:4(8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(20:0/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:0/20:5(5Z,8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(20:3(5Z,8Z,11Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/20:3(5Z,8Z,11Z)) - Array:
L-Serine + PC(20:3(5Z,8Z,11Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/20:3(8Z,11Z,14Z)) - Array:
L-Serine + PC(20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)) - Array:
L-Serine + PC(20:3(5Z,8Z,11Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/20:4(8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(20:3(5Z,8Z,11Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(20:3(8Z,11Z,14Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/20:3(8Z,11Z,14Z)) - Array:
L-Serine + PC(20:3(8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) - Array:
L-Serine + PC(20:3(8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(20:3(8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) - Array:
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/20:4(8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Array:
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylcholine/Phosphatidylethanolamine Biosynthesis:
L-Serine + Phosphatidylcholine ⟶ Choline + an L-1-phosphatidylserine - Array:
L-Serine + PC(14:0/14:0) ⟶ Choline + PS(14:0/14:0) - Array:
L-Serine + PC(14:0/14:1(9Z)) ⟶ Choline + PS(14:0/14:1(9Z)) - Array:
L-Serine + PC(14:0/15:0) ⟶ Choline + PS(14:0/15:0) - Array:
L-Serine + PC(14:0/16:0) ⟶ Choline + PS(14:0/16:0) - Array:
L-Serine + PC(14:0/18:0) ⟶ Choline + PS(14:0/18:0) - Array:
L-Serine + PC(14:0/18:1(9Z)) ⟶ Choline + PS(14:0/18:1(9Z)) - Array:
L-Serine + PC(14:0/18:1(11Z)) ⟶ Choline + PS(14:0/18:1(11Z)) - Array:
L-Serine + PC(14:0/18:2(9Z,12Z)) ⟶ Choline + PS(14:0/18:2(9Z,12Z)) - Array:
L-Serine + PC(14:0/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(14:0/18:3(9Z,12Z,15Z)) - Array:
L-Serine + PC(14:0/20:1(11Z)) ⟶ Choline + PS(14:0/20:1(11Z)) - Array:
L-Serine + PC(14:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(14:0/20:4(5Z,8Z,11Z,14Z)) - Array:
L-Serine + PC(14:0/22:0) ⟶ Choline + PS(14:0/22:0) - Array:
L-Serine + PC(14:1(9Z)/14:1(9Z)) ⟶ Choline + PS(14:1(9Z)/14:1(9Z)) - Array:
L-Serine + PC(14:1(9Z)/15:0) ⟶ Choline + PS(14:1(9Z)/15:0) - Array:
L-Serine + PC(14:1(9Z)/16:0) ⟶ Choline + PS(14:1(9Z)/16:0) - Array:
L-Serine + PC(14:1(9Z)/18:0) ⟶ Choline + PS(14:1(9Z)/18:0) - Array:
L-Serine + PC(14:1(9Z)/18:1(9Z)) ⟶ Choline + PS(14:1(9Z)/18:1(9Z)) - Array:
L-Serine + PC(14:1(9Z)/18:1(11Z)) ⟶ Choline + PS(14:1(9Z)/18:1(11Z)) - Array:
L-Serine + PC(14:1(9Z)/18:2(9Z,12Z)) ⟶ Choline + PS(14:1(9Z)/18:2(9Z,12Z)) - Array:
L-Serine + PC(14:1(9Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(14:1(9Z)/18:3(9Z,12Z,15Z)) - Array:
L-Serine + PC(14:1(9Z)/20:1(11Z)) ⟶ Choline + PS(14:1(9Z)/20:1(11Z)) - Array:
L-Serine + PC(14:1(9Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(14:1(9Z)/20:4(5Z,8Z,11Z,14Z)) - Array:
L-Serine + PC(14:1(9Z)/22:0) ⟶ Choline + PS(14:1(9Z)/22:0) - Array:
L-Serine + PC(15:0/15:0) ⟶ Choline + PS(15:0/15:0) - Array:
L-Serine + PC(15:0/16:0) ⟶ Choline + PS(15:0/16:0) - Array:
L-Serine + PC(15:0/18:0) ⟶ Choline + PS(15:0/18:0) - Array:
L-Serine + PC(15:0/18:1(9Z)) ⟶ Choline + PS(15:0/18:1(9Z)) - Array:
L-Serine + PC(15:0/18:1(11Z)) ⟶ Choline + PS(15:0/18:1(11Z)) - Array:
L-Serine + PC(15:0/18:2(9Z,12Z)) ⟶ Choline + PS(15:0/18:2(9Z,12Z)) - Array:
L-Serine + PC(15:0/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(15:0/18:3(9Z,12Z,15Z)) - Array:
L-Serine + PC(15:0/20:1(11Z)) ⟶ Choline + PS(15:0/20:1(11Z)) - Array:
L-Serine + PC(15:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(15:0/20:4(5Z,8Z,11Z,14Z)) - Array:
L-Serine + PC(15:0/22:0) ⟶ Choline + PS(15:0/22:0) - Array:
L-Serine + PC(16:0/16:0) ⟶ Choline + PS(16:0/16:0) - Array:
L-Serine + PC(16:0/18:0) ⟶ Choline + PS(16:0/18:0) - Array:
L-Serine + PC(16:0/18:1(9Z)) ⟶ Choline + PS(16:0/18:1(9Z)) - Array:
L-Serine + PC(16:0/18:1(11Z)) ⟶ Choline + PS(16:0/18:1(11Z)) - Array:
L-Serine + PC(16:0/18:2(9Z,12Z)) ⟶ Choline + PS(16:0/18:2(9Z,12Z)) - Array:
L-Serine + PC(16:0/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(16:0/18:3(9Z,12Z,15Z)) - Array:
L-Serine + PC(16:0/20:1(11Z)) ⟶ Choline + PS(16:0/20:1(11Z)) - Array:
L-Serine + PC(16:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(16:0/20:4(5Z,8Z,11Z,14Z)) - Array:
L-Serine + PC(16:0/22:0) ⟶ Choline + PS(16:0/22:0) - Array:
L-Serine + PC(18:0/18:0) ⟶ Choline + PS(18:0/18:0) - Array:
L-Serine + PC(18:0/18:1(9Z)) ⟶ Choline + PS(18:0/18:1(9Z)) - Array:
L-Serine + PC(18:0/18:1(11Z)) ⟶ Choline + PS(18:0/18:1(11Z)) - Array:
L-Serine + PC(18:0/18:2(9Z,12Z)) ⟶ Choline + PS(18:0/18:2(9Z,12Z)) - Array:
L-Serine + PC(18:0/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:0/18:3(9Z,12Z,15Z)) - Array:
L-Serine + PC(18:0/20:1(11Z)) ⟶ Choline + PS(18:0/20:1(11Z)) - Array:
L-Serine + PC(18:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:0/20:4(5Z,8Z,11Z,14Z)) - Array:
L-Serine + PC(18:0/22:0) ⟶ Choline + PS(18:0/22:0) - Array:
L-Serine + PC(18:1(9Z)/18:1(9Z)) ⟶ Choline + PS(18:1(9Z)/18:1(9Z)) - Array:
L-Serine + PC(18:1(9Z)/18:1(11Z)) ⟶ Choline + PS(18:1(9Z)/18:1(11Z)) - Array:
L-Serine + PC(18:1(9Z)/18:2(9Z,12Z)) ⟶ Choline + PS(18:1(9Z)/18:2(9Z,12Z)) - Array:
L-Serine + PC(18:1(9Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:1(9Z)/18:3(9Z,12Z,15Z)) - Array:
L-Serine + PC(18:1(9Z)/20:1(11Z)) ⟶ Choline + PS(18:1(9Z)/20:1(11Z)) - Array:
L-Serine + PC(18:1(9Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:1(9Z)/20:4(5Z,8Z,11Z,14Z)) - Array:
L-Serine + PC(18:1(9Z)/22:0) ⟶ Choline + PS(18:1(9Z)/22:0) - Array:
L-Serine + PC(18:1(11Z)/18:1(11Z)) ⟶ Choline + PS(18:1(11Z)/18:1(11Z)) - Array:
L-Serine + PC(18:1(11Z)/18:2(9Z,12Z)) ⟶ Choline + PS(18:1(11Z)/18:2(9Z,12Z)) - Array:
L-Serine + PC(18:1(11Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:1(11Z)/18:3(9Z,12Z,15Z)) - Array:
L-Serine + PC(18:1(11Z)/20:1(11Z)) ⟶ Choline + PS(18:1(11Z)/20:1(11Z)) - Array:
L-Serine + PC(18:1(11Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:1(11Z)/20:4(5Z,8Z,11Z,14Z)) - Array:
L-Serine + PC(18:1(11Z)/22:0) ⟶ Choline + PS(18:1(11Z)/22:0) - Array:
L-Serine + PC(18:2(9Z,12Z)/18:2(9Z,12Z)) ⟶ Choline + PS(18:2(9Z,12Z)/18:2(9Z,12Z)) - Array:
L-Serine + PC(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)) - Array:
L-Serine + PC(18:2(9Z,12Z)/20:1(11Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:1(11Z)) - Array:
L-Serine + PC(18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) - Array:
L-Serine + PC(18:2(9Z,12Z)/22:0) ⟶ Choline + PS(18:2(9Z,12Z)/22:0) - Array:
L-Serine + PC(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)) - Array:
L-Serine + PC(18:3(9Z,12Z,15Z)/20:1(11Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:1(11Z)) - Array:
L-Serine + PC(18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) - Array:
L-Serine + PC(18:3(9Z,12Z,15Z)/22:0) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/22:0) - Array:
L-Serine + PC(20:1(11Z)/20:1(11Z)) ⟶ Choline + PS(20:1(11Z)/20:1(11Z)) - Array:
L-Serine + PC(20:1(11Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:1(11Z)/20:4(5Z,8Z,11Z,14Z)) - Array:
L-Serine + PC(20:1(11Z)/22:0) ⟶ Choline + PS(20:1(11Z)/22:0) - Array:
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) - Array:
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/22:0) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/22:0) - Array:
L-Serine + PC(22:0/22:0) ⟶ Choline + PS(22:0/22:0) - Ribose Degradation:
-D-Ribopyranose + Adenosine triphosphate + Water ⟶ -D-Ribopyranose + Adenosine diphosphate + Hydrogen Ion + Phosphate - Ribose Degradation:
-D-Ribopyranose + Adenosine triphosphate + Water ⟶ -D-Ribopyranose + Adenosine diphosphate + Hydrogen Ion + Phosphate - Lysine Biosynthesis:
Hydrogen Ion + meso-diaminopimelate ⟶ Carbon dioxide + L-Lysine - Cysteine Metabolism:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + Ammonium + L-Cysteine - Methionine Metabolism and Salvage:
2-Oxo-4-methylthiobutanoic acid + L-Phenylalanine ⟶ 2-Ketobutyric acid + L-Methionine - Monobactam Biosynthesis:
Adenosine triphosphate + Sulfate ⟶ Adenosine phosphosulfate + Pyrophosphate - Lysine Biosynthesis:
Hydrogen Ion + meso-diaminopimelate ⟶ Carbon dioxide + L-Lysine - Bile Acid Biosynthesis:
Choloyl-CoA + Taurine ⟶ Coenzyme A + Taurocholic acid - Congenital Bile Acid Synthesis Defect Type II:
Choloyl-CoA + Taurine ⟶ Coenzyme A + Taurocholic acid - Congenital Bile Acid Synthesis Defect Type III:
Choloyl-CoA + Taurine ⟶ Coenzyme A + Taurocholic acid - Familial Hypercholanemia (FHCA):
Choloyl-CoA + Taurine ⟶ Coenzyme A + Taurocholic acid - Zellweger Syndrome:
Choloyl-CoA + Taurine ⟶ Coenzyme A + Taurocholic acid - Cerebrotendinous Xanthomatosis (CTX):
Choloyl-CoA + Taurine ⟶ Coenzyme A + Taurocholic acid - 27-Hydroxylase Deficiency:
Choloyl-CoA + Taurine ⟶ Coenzyme A + Taurocholic acid - Bile Acid Biosynthesis:
Choloyl-CoA + Taurine ⟶ Coenzyme A + Taurocholic acid - 27-Hydroxylase Deficiency:
Choloyl-CoA + Taurine ⟶ Coenzyme A + Taurocholic acid - Cerebrotendinous Xanthomatosis (CTX):
Choloyl-CoA + Taurine ⟶ Coenzyme A + Taurocholic acid - Congenital Bile Acid Synthesis Defect Type II:
Choloyl-CoA + Taurine ⟶ Coenzyme A + Taurocholic acid - Congenital Bile Acid Synthesis Defect Type III:
Choloyl-CoA + Taurine ⟶ Coenzyme A + Taurocholic acid - Familial Hypercholanemia (FHCA):
Choloyl-CoA + Taurine ⟶ Coenzyme A + Taurocholic acid - Zellweger Syndrome:
Choloyl-CoA + Taurine ⟶ Coenzyme A + Taurocholic acid - 27-Hydroxylase Deficiency:
Choloyl-CoA + Taurine ⟶ Coenzyme A + Taurocholic acid - Bile Acid Biosynthesis:
Choloyl-CoA + Taurine ⟶ Coenzyme A + Taurocholic acid - Bile Acid Biosynthesis:
Choloyl-CoA + Taurine ⟶ Coenzyme A + Taurocholic acid - Cerebrotendinous Xanthomatosis (CTX):
Choloyl-CoA + Taurine ⟶ Coenzyme A + Taurocholic acid - Congenital Bile Acid Synthesis Defect Type II:
Choloyl-CoA + Taurine ⟶ Coenzyme A + Taurocholic acid - Congenital Bile Acid Synthesis Defect Type III:
Choloyl-CoA + Taurine ⟶ Coenzyme A + Taurocholic acid - Familial Hypercholanemia (FHCA):
Choloyl-CoA + Taurine ⟶ Coenzyme A + Taurocholic acid - Zellweger Syndrome:
Choloyl-CoA + Taurine ⟶ Coenzyme A + Taurocholic acid - Clopidogrel Action Pathway:
Clopidogrel + Oxygen + Water ⟶ 2-Oxoclopidogrel + Hydrogen peroxide - Clopidogrel Metabolism Pathway:
Clopidogrel + Oxygen + Water ⟶ 2-Oxoclopidogrel + Hydrogen peroxide - Hydrogen Sulfide Biosynthesis I:
L-Cysteine + Oxoglutaric acid ⟶ 3-Mercaptopyruvic acid + L-Glutamic acid - Hydrogen Sulfide Biosynthesis I:
Adenosine triphosphate + L-Cysteine + Water ⟶ Adenosine diphosphate + Hydrogen Ion + L-Cysteine + Phosphate - ADP-L-glycero-beta-D-manno-heptose Biosynthesis:
Adenosine triphosphate + D-glycero-D-manno-heptose 7-phosphate ⟶ Adenosine diphosphate + D-glycero- -D-manno-heptose 1,7-bisphosphate + Hydrogen Ion - Erlotinib Action Pathway:
Adenosine triphosphate + Erlotinib + Water ⟶ Adenosine diphosphate + Erlotinib + Phosphate - Lysolipid incorporation into Mitochondria PC(18:0/18:0):
Adenosine triphosphate + LysoPC(18:0) + Water ⟶ Adenosine diphosphate + LysoPC(18:0) + Phosphate - Lysolipid Incorporation into Mitochondria:
Adenosine triphosphate + LysoPC(14:0/0:0) + Water ⟶ Adenosine diphosphate + LysoPC(14:0/0:0) + Phosphate - Lysolipid incorporation into Mitochondria PC(14:0/14:0):
Adenosine triphosphate + LysoPC(14:0/0:0) + Water ⟶ Adenosine diphosphate + LysoPC(14:0/0:0) + Phosphate - Lysolipid incorporation into Mitochondria PC(16:1(11Z)/16:1(11Z)):
Adenosine triphosphate + LysoPC(14:0/0:0) + Water ⟶ Adenosine diphosphate + LysoPC(14:0/0:0) + Phosphate - Lysolipid incorporation into Mitochondria PC(18:2(9Z,11Z)/18:2(9Z,11Z)):
Adenosine triphosphate + LysoPC(14:0/0:0) + Water ⟶ Adenosine diphosphate + LysoPC(14:0/0:0) + Phosphate - Etoposide Action Pathway:
Adenosine triphosphate + Etoposide + Water ⟶ Adenosine diphosphate + Etoposide + Phosphate - Etoposide Metabolism Pathway:
Adenosine triphosphate + Etoposide + Water ⟶ Adenosine diphosphate + Etoposide + Phosphate - Propanoate Metabolism:
2-iminobutanoate + Hydrogen Ion + Water ⟶ 2-Ketobutyric acid + Ammonium - Propanoate Metabolism:
2-Ketobutyric acid + Coenzyme A ⟶ Formic acid + Propionyl-CoA - NAD Phosphorylation and Dephosphorylation:
Hydrogen Ion + NADH + NADP ⟶ Hydrogen Ion + NAD + NADPH - NAD Phosphorylation and Dephosphorylation:
Adenosine triphosphate + NAD ⟶ Adenosine diphosphate + Hydrogen Ion + NADP - Mitochondrial Electron Transport Chain:
Adenosine diphosphate + Hydrogen Ion ⟶ Adenosine triphosphate + Hydrogen Ion - Acebutolol Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Alprenolol Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Atenolol Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Betaxolol Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Bisoprolol Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Esmolol Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Metoprolol Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Nadolol Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Oxprenolol Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Penbutolol Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Pindolol Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Propranolol Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Quinidine Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Procainamide (Antiarrhythmic) Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Disopyramide Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Fosphenytoin (Antiarrhythmic) Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Phenytoin (Antiarrhythmic) Action Pathway:
Hydrogen Ion + NADPH + Oxygen + Phenytoin ⟶ NADP + Phenytoin arene-oxide + Water - Lidocaine (Antiarrhythmic) Action Pathway:
Lidocaine ⟶ 2,6-Dimethylaniline - Mexiletine Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Tocainide Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Flecainide Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Ibutilide Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Diltiazem Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Nebivolol Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Carvedilol Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Labetalol Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Verapamil Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Amlodipine Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Felodipine Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Isradipine Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Nifedipine Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Nimodipine Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Nisoldipine Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Nitrendipine Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Adefovir Dipivoxil Action Pathway:
Adenosine triphosphate + Water ⟶ Adenosine diphosphate + Phosphate - Tenofovir Action Pathway:
Adenosine triphosphate + Water ⟶ Adenosine diphosphate + Phosphate - Striated Muscle Contraction:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Tramadol Metabolism Pathway:
NADH + Oxygen + Tramadol ⟶ Formaldehyde + N-Desmethyltramadol + NAD + Water - Doxorubicin Metabolism Pathway:
Adenosine triphosphate + Doxorubicin + Water ⟶ Adenosine diphosphate + Doxorubicin + Phosphate - Bopindolol Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Carteolol Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Timolol Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Sotalol Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Epinephrine Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Dobutamine Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Isoprenaline Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Arbutamine Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Amiodarone Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Levobunolol Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Metipranolol Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Bevantolol Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Practolol Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Bupranolol Action Pathway:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Biosynthesis of Siderophore Group Nonribosomal Peptides:
2,3-Dihydroxybenzoic acid + Adenosine triphosphate + L-Serine ⟶ Adenosine monophosphate + Hydrogen Ion + Pyrophosphate + enterobactin - Biotin Metabolism:
Dethiobiotin + Hydrogen Ion + S-Adenosylmethionine + a sulfurated [sulfur carrier] ⟶ 5'-Deoxyadenosine + Biotin + L-Methionine - tRNA Charging 2:
Adenosine triphosphate + Hydrogen Ion + L-Arginine ⟶ Adenosine monophosphate + Pyrophosphate - Galactitol and Galactonate Degradation:
Galactitol + Phosphocarrier protein HPr ⟶ Galactose 1-phosphate + Phosphocarrier protein HPr - Galactose Degradation/Leloir Pathway:
-D-Glucose + Phosphocarrier protein HPr ⟶ -D-Glucose 6-phosphate + Phosphocarrier protein HPr - Secondary Metabolites: Methylerythritol Phosphate and Polyisoprenoid Biosynthesis:
1-Deoxy-D-xylulose 5-phosphate + Hydrogen Ion + NADPH ⟶ 2-C-methyl-D-erythritol 4-phosphate + NADP - Secondary Metabolites: Isoprenoid Biosynthesis (Nonmevalonate Pathway):
1-Deoxy-D-xylulose 5-phosphate + Hydrogen Ion + NADPH ⟶ 2-C-methyl-D-erythritol 4-phosphate + NADP - Spermidine Biosynthesis I:
Adenosine triphosphate + Water ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate - 1,6-Anhydro-N-acetylmuramic Acid Recycling:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + D-glucosamine 6-phosphate - L-Lyxose Degradation:
Adenosine triphosphate + L-xylulose ⟶ Adenosine diphosphate + Hydrogen Ion + L-xylulose -5-phosphate - BaeSR Two-Component Signal Transduction System:
Adenosine triphosphate + Signal transduction histidine-protein kinase BaeS ⟶ Adenosine diphosphate + BaeS-Phis250 - Leloir Pathway:
-D-Galactose ⟶ D-Galactose - Glycerophospholipid Metabolism:
Adenosine triphosphate + Ethanolamine ⟶ Adenosine diphosphate + Hydrogen Ion + O-Phosphoethanolamine - Lysolipid incorporation into Mitochondria PC(10:0/10:0):
Adenosine triphosphate + LysoPC(10:0) + Water ⟶ Adenosine diphosphate + LysoPC(10:0) + Phosphate - Choline Biosynthesis I:
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Choline Biosynthesis II:
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - D-myo-Inositol (1,4,5)-Trisphosphate Biosynthesis:
a CDP-diacylglycerol + myo-Inositol ⟶ Cytidine monophosphate + Hydrogen Ion + L-1-phosphatidyl-inositol - Glycine Betaine Biosynthesis I:
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Glycine Betaine Biosynthesis II:
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - D-Galactose Degradation (Leloir pathway):
Beta-D-Galactose ⟶ D-Galactose - Oxidative Phosphorylation:
Adenosine diphosphate + Phosphate ⟶ Adenosine triphosphate - Photosynthesis (Light-Dependent Reactions):
Adenosine diphosphate + Phosphate ⟶ Adenosine triphosphate - Phosphatidylethanolamine Biosynthesis:
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylethanolamine Biosynthesis PE(14:0/14:0):
L-Serine + PC(14:0/14:0) ⟶ Choline + PS(14:0/14:0) - Phosphatidylethanolamine Biosynthesis PE(14:0/14:1(9Z)):
L-Serine + PC(14:0/14:1(9Z)) ⟶ Choline + PS(14:0/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/15:0):
L-Serine + PC(14:0/15:0) ⟶ Choline + PS(14:0/15:0) - Phosphatidylethanolamine Biosynthesis PE(14:0/16:0):
L-Serine + PC(14:0/16:0) ⟶ Choline + PS(14:0/16:0) - Phosphatidylethanolamine Biosynthesis PE(14:0/16:1(9Z)):
L-Serine + PC(14:0/16:1(9Z)) ⟶ Choline + PS(14:0/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/18:0):
L-Serine + PC(14:0/18:0) ⟶ Choline + PS(14:0/18:0) - Phosphatidylethanolamine Biosynthesis PE(14:0/18:1(11Z)):
L-Serine + PC(14:0/18:1(11Z)) ⟶ Choline + PS(14:0/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/18:1(9Z)):
L-Serine + PC(14:0/18:1(9Z)) ⟶ Choline + PS(14:0/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/18:2(9Z,12Z)):
L-Serine + PC(14:0/18:2(9Z,12Z)) ⟶ Choline + PS(14:0/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/18:3(6Z,9Z,12Z)):
L-Serine + PC(14:0/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(14:0/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/18:3(9Z,12Z,15Z)):
L-Serine + PC(14:0/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(14:0/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(14:0/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(14:0/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:0):
L-Serine + PC(14:0/20:0) ⟶ Choline + PS(14:0/20:0) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:1(11Z)):
L-Serine + PC(14:0/20:1(11Z)) ⟶ Choline + PS(14:0/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:2(11Z,14Z)):
L-Serine + PC(14:0/20:2(11Z,14Z)) ⟶ Choline + PS(14:0/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:3(5Z,8Z,11Z)):
L-Serine + PC(14:0/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(14:0/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:3(8Z,11Z,14Z)):
L-Serine + PC(14:0/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(14:0/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(14:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(14:0/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(14:0/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(14:0/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(14:0/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(14:0/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/22:0):
L-Serine + PC(14:0/22:0) ⟶ Choline + PS(14:0/22:0) - Phosphatidylethanolamine Biosynthesis PE(14:0/22:1(13Z)):
L-Serine + PC(14:0/22:1(13Z)) ⟶ Choline + PS(14:0/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/22:2(13Z,16Z)):
L-Serine + PC(14:0/22:2(13Z,16Z)) ⟶ Choline + PS(14:0/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(14:0/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(14:0/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(14:0/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(14:0/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(14:0/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(14:0/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(14:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(14:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/24:0):
L-Serine + PC(14:0/24:0) ⟶ Choline + PS(14:0/24:0) - Phosphatidylethanolamine Biosynthesis PE(14:0/24:1(15Z)):
L-Serine + PC(14:0/24:1(15Z)) ⟶ Choline + PS(14:0/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/14:0):
L-Serine + PC(14:1(9Z)/14:0) ⟶ Choline + PS(14:1(9Z)/14:0) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/14:1(9Z)):
L-Serine + PC(14:1(9Z)/14:1(9Z)) ⟶ Choline + PS(14:1(9Z)/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/15:0):
L-Serine + PC(14:1(9Z)/15:0) ⟶ Choline + PS(14:1(9Z)/15:0) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/16:0):
L-Serine + PC(14:1(9Z)/16:0) ⟶ Choline + PS(14:1(9Z)/16:0) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/16:1(9Z)):
L-Serine + PC(14:1(9Z)/16:1(9Z)) ⟶ Choline + PS(14:1(9Z)/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/18:0):
L-Serine + PC(14:1(9Z)/18:0) ⟶ Choline + PS(14:1(9Z)/18:0) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/18:1(11Z)):
L-Serine + PC(14:1(9Z)/18:1(11Z)) ⟶ Choline + PS(14:1(9Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/18:1(9Z)):
L-Serine + PC(14:1(9Z)/18:1(9Z)) ⟶ Choline + PS(14:1(9Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/18:2(9Z,12Z)):
L-Serine + PC(14:1(9Z)/18:2(9Z,12Z)) ⟶ Choline + PS(14:1(9Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(14:1(9Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(14:1(9Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(14:1(9Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(14:1(9Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:0):
L-Serine + PC(14:1(9Z)/20:0) ⟶ Choline + PS(14:1(9Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:1(11Z)):
L-Serine + PC(14:1(9Z)/20:1(11Z)) ⟶ Choline + PS(14:1(9Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:2(11Z,14Z)):
L-Serine + PC(14:1(9Z)/20:2(11Z,14Z)) ⟶ Choline + PS(14:1(9Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(14:1(9Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(14:1(9Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(14:1(9Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(14:1(9Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(14:1(9Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(14:1(9Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(14:1(9Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(14:1(9Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(14:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(14:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/22:0):
L-Serine + PC(14:1(9Z)/22:0) ⟶ Choline + PS(14:1(9Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/22:1(13Z)):
L-Serine + PC(14:1(9Z)/22:1(13Z)) ⟶ Choline + PS(14:1(9Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/22:2(13Z,16Z)):
L-Serine + PC(14:1(9Z)/22:2(13Z,16Z)) ⟶ Choline + PS(14:1(9Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(14:1(9Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(14:1(9Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(14:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(14:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(14:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(14:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(14:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(14:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/24:0):
L-Serine + PC(14:1(9Z)/24:0) ⟶ Choline + PS(14:1(9Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/24:1(15Z)):
L-Serine + PC(14:1(9Z)/24:1(15Z)) ⟶ Choline + PS(14:1(9Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/14:0):
L-Serine + PC(15:0/14:0) ⟶ Choline + PS(15:0/14:0) - Phosphatidylethanolamine Biosynthesis PE(15:0/14:1(9Z)):
L-Serine + PC(15:0/14:1(9Z)) ⟶ Choline + PS(15:0/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/15:0):
L-Serine + PC(15:0/15:0) ⟶ Choline + PS(15:0/15:0) - Phosphatidylethanolamine Biosynthesis PE(15:0/16:0):
L-Serine + PC(15:0/16:0) ⟶ Choline + PS(15:0/16:0) - Phosphatidylethanolamine Biosynthesis PE(15:0/16:1(9Z)):
L-Serine + PC(15:0/16:1(9Z)) ⟶ Choline + PS(15:0/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/18:0):
L-Serine + PC(15:0/18:0) ⟶ Choline + PS(15:0/18:0) - Phosphatidylethanolamine Biosynthesis PE(15:0/18:1(11Z)):
L-Serine + PC(15:0/18:1(11Z)) ⟶ Choline + PS(15:0/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/18:1(9Z)):
L-Serine + PC(15:0/18:1(9Z)) ⟶ Choline + PS(15:0/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/18:2(9Z,12Z)):
L-Serine + PC(15:0/18:2(9Z,12Z)) ⟶ Choline + PS(15:0/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/18:3(6Z,9Z,12Z)):
L-Serine + PC(15:0/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(15:0/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/18:3(9Z,12Z,15Z)):
L-Serine + PC(15:0/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(15:0/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(15:0/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(15:0/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:0):
L-Serine + PC(15:0/20:0) ⟶ Choline + PS(15:0/20:0) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:1(11Z)):
L-Serine + PC(15:0/20:1(11Z)) ⟶ Choline + PS(15:0/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:2(11Z,14Z)):
L-Serine + PC(15:0/20:2(11Z,14Z)) ⟶ Choline + PS(15:0/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:3(5Z,8Z,11Z)):
L-Serine + PC(15:0/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(15:0/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:3(8Z,11Z,14Z)):
L-Serine + PC(15:0/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(15:0/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(15:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(15:0/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(15:0/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(15:0/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(15:0/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(15:0/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/22:0):
L-Serine + PC(15:0/22:0) ⟶ Choline + PS(15:0/22:0) - Phosphatidylethanolamine Biosynthesis PE(15:0/22:1(13Z)):
L-Serine + PC(15:0/22:1(13Z)) ⟶ Choline + PS(15:0/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/22:2(13Z,16Z)):
L-Serine + PC(15:0/22:2(13Z,16Z)) ⟶ Choline + PS(15:0/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(15:0/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(15:0/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(15:0/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(15:0/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(15:0/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(15:0/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(15:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(15:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/24:0):
L-Serine + PC(15:0/24:0) ⟶ Choline + PS(15:0/24:0) - Phosphatidylethanolamine Biosynthesis PE(15:0/24:1(15Z)):
L-Serine + PC(15:0/24:1(15Z)) ⟶ Choline + PS(15:0/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/14:0):
L-Serine + PC(16:0/14:0) ⟶ Choline + PS(16:0/14:0) - Phosphatidylethanolamine Biosynthesis PE(16:0/14:1(9Z)):
L-Serine + PC(16:0/14:1(9Z)) ⟶ Choline + PS(16:0/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/15:0):
L-Serine + PC(16:0/15:0) ⟶ Choline + PS(16:0/15:0) - Phosphatidylethanolamine Biosynthesis PE(16:0/16:0):
L-Serine + PC(16:0/16:0) ⟶ Choline + PS(16:0/16:0) - Phosphatidylethanolamine Biosynthesis PE(16:0/16:1(9Z)):
L-Serine + PC(16:0/16:1(9Z)) ⟶ Choline + PS(16:0/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:0):
L-Serine + PC(16:0/18:0) ⟶ Choline + PS(16:0/18:0) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:1(11Z)):
L-Serine + PC(16:0/18:1(11Z)) ⟶ Choline + PS(16:0/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:1(9Z)):
L-Serine + PC(16:0/18:1(9Z)) ⟶ Choline + PS(16:0/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:2(9Z,12Z)):
L-Serine + PC(16:0/18:2(9Z,12Z)) ⟶ Choline + PS(16:0/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:3(6Z,9Z,12Z)):
L-Serine + PC(16:0/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(16:0/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:3(9Z,12Z,15Z)):
L-Serine + PC(16:0/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(16:0/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(16:0/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(16:0/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:0):
L-Serine + PC(16:0/20:0) ⟶ Choline + PS(16:0/20:0) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:1(11Z)):
L-Serine + PC(16:0/20:1(11Z)) ⟶ Choline + PS(16:0/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:2(11Z,14Z)):
L-Serine + PC(16:0/20:2(11Z,14Z)) ⟶ Choline + PS(16:0/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:3(5Z,8Z,11Z)):
L-Serine + PC(16:0/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(16:0/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:3(8Z,11Z,14Z)):
L-Serine + PC(16:0/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(16:0/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(16:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(16:0/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(16:0/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(16:0/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(16:0/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(16:0/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/22:0):
L-Serine + PC(16:0/22:0) ⟶ Choline + PS(16:0/22:0) - Phosphatidylethanolamine Biosynthesis PE(16:0/22:1(13Z)):
L-Serine + PC(16:0/22:1(13Z)) ⟶ Choline + PS(16:0/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/22:2(13Z,16Z)):
L-Serine + PC(16:0/22:2(13Z,16Z)) ⟶ Choline + PS(16:0/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(16:0/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(16:0/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(16:0/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(16:0/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(16:0/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(16:0/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(16:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(16:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/24:0):
L-Serine + PC(16:0/24:0) ⟶ Choline + PS(16:0/24:0) - Phosphatidylethanolamine Biosynthesis PE(16:0/24:1(15Z)):
L-Serine + PC(16:0/24:1(15Z)) ⟶ Choline + PS(16:0/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/14:0):
L-Serine + PC(16:1(9Z)/14:0) ⟶ Choline + PS(16:1(9Z)/14:0) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/14:1(9Z)):
L-Serine + PC(16:1(9Z)/14:1(9Z)) ⟶ Choline + PS(16:1(9Z)/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/15:0):
L-Serine + PC(16:1(9Z)/15:0) ⟶ Choline + PS(16:1(9Z)/15:0) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/16:0):
L-Serine + PC(16:1(9Z)/16:0) ⟶ Choline + PS(16:1(9Z)/16:0) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/16:1(9Z)):
L-Serine + PC(16:1(9Z)/16:1(9Z)) ⟶ Choline + PS(16:1(9Z)/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/18:1(11Z)):
L-Serine + PC(16:1(9Z)/18:1(11Z)) ⟶ Choline + PS(16:1(9Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/18:1(9Z)):
L-Serine + PC(16:1(9Z)/18:1(9Z)) ⟶ Choline + PS(16:1(9Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/18:2(9Z,12Z)):
L-Serine + PC(16:1(9Z)/18:2(9Z,12Z)) ⟶ Choline + PS(16:1(9Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(16:1(9Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(16:1(9Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(16:1(9Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(16:1(9Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(16:1(9Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(16:1(9Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:0):
L-Serine + PC(16:1(9Z)/20:0) ⟶ Choline + PS(16:1(9Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:1(11Z)):
L-Serine + PC(16:1(9Z)/20:1(11Z)) ⟶ Choline + PS(16:1(9Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:2(11Z,14Z)):
L-Serine + PC(16:1(9Z)/20:2(11Z,14Z)) ⟶ Choline + PS(16:1(9Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(16:1(9Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(16:1(9Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(16:1(9Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(16:1(9Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(16:1(9Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(16:1(9Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(16:1(9Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(16:1(9Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(16:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(16:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/22:0):
L-Serine + PC(16:1(9Z)/22:0) ⟶ Choline + PS(16:1(9Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/22:1(13Z)):
L-Serine + PC(16:1(9Z)/22:1(13Z)) ⟶ Choline + PS(16:1(9Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/22:2(13Z,16Z)):
L-Serine + PC(16:1(9Z)/22:2(13Z,16Z)) ⟶ Choline + PS(16:1(9Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(16:1(9Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(16:1(9Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(16:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(16:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(16:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(16:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(16:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(16:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/24:0):
L-Serine + PC(16:1(9Z)/24:0) ⟶ Choline + PS(16:1(9Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/24:1(15Z)):
L-Serine + PC(16:1(9Z)/24:1(15Z)) ⟶ Choline + PS(16:1(9Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/14:0):
L-Serine + PC(18:0/14:0) ⟶ Choline + PS(18:0/14:0) - Phosphatidylethanolamine Biosynthesis PE(18:0/14:1(9Z)):
L-Serine + PC(18:0/14:1(9Z)) ⟶ Choline + PS(18:0/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/15:0):
L-Serine + PC(18:0/15:0) ⟶ Choline + PS(18:0/15:0) - Phosphatidylethanolamine Biosynthesis PE(18:0/16:0):
L-Serine + PC(18:0/16:0) ⟶ Choline + PS(18:0/16:0) - Phosphatidylethanolamine Biosynthesis PE(18:0/16:1(9Z)):
L-Serine + PC(18:0/16:1(9Z)) ⟶ Choline + PS(18:0/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:0):
L-Serine + PC(18:0/18:0) ⟶ Choline + PS(18:0/18:0) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:1(11Z)):
L-Serine + PC(18:0/18:1(11Z)) ⟶ Choline + PS(18:0/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:1(9Z)):
L-Serine + PC(18:0/18:1(9Z)) ⟶ Choline + PS(18:0/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:2(9Z,12Z)):
L-Serine + PC(18:0/18:2(9Z,12Z)) ⟶ Choline + PS(18:0/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:3(6Z,9Z,12Z)):
L-Serine + PC(18:0/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(18:0/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:3(9Z,12Z,15Z)):
L-Serine + PC(18:0/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:0/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(18:0/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(18:0/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:0):
L-Serine + PC(18:0/20:0) ⟶ Choline + PS(18:0/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:1(11Z)):
L-Serine + PC(18:0/20:1(11Z)) ⟶ Choline + PS(18:0/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:2(11Z,14Z)):
L-Serine + PC(18:0/20:2(11Z,14Z)) ⟶ Choline + PS(18:0/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:3(5Z,8Z,11Z)):
L-Serine + PC(18:0/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:0/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:3(8Z,11Z,14Z)):
L-Serine + PC(18:0/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:0/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(18:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:0/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(18:0/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:0/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(18:0/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:0/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/22:0):
L-Serine + PC(18:0/22:0) ⟶ Choline + PS(18:0/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:0/22:1(13Z)):
L-Serine + PC(18:0/22:1(13Z)) ⟶ Choline + PS(18:0/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/22:2(13Z,16Z)):
L-Serine + PC(18:0/22:2(13Z,16Z)) ⟶ Choline + PS(18:0/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(18:0/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:0/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(18:0/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:0/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:0/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:0/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/24:0):
L-Serine + PC(18:0/24:0) ⟶ Choline + PS(18:0/24:0) - Phosphatidylethanolamine Biosynthesis PE(18:0/24:1(15Z)):
L-Serine + PC(18:0/24:1(15Z)) ⟶ Choline + PS(18:0/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/14:0):
L-Serine + PC(18:1(11Z)/14:0) ⟶ Choline + PS(18:1(11Z)/14:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/14:1(9Z)):
L-Serine + PC(18:1(11Z)/14:1(9Z)) ⟶ Choline + PS(18:1(11Z)/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/15:0):
L-Serine + PC(18:1(11Z)/15:0) ⟶ Choline + PS(18:1(11Z)/15:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/16:0):
L-Serine + PC(18:1(11Z)/16:0) ⟶ Choline + PS(18:1(11Z)/16:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/16:1(9Z)):
L-Serine + PC(18:1(11Z)/16:1(9Z)) ⟶ Choline + PS(18:1(11Z)/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/18:0):
L-Serine + PC(18:1(11Z)/18:0) ⟶ Choline + PS(18:1(11Z)/18:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/18:1(11Z)):
L-Serine + PC(18:1(11Z)/18:1(11Z)) ⟶ Choline + PS(18:1(11Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/18:1(9Z)):
L-Serine + PC(18:1(11Z)/18:1(9Z)) ⟶ Choline + PS(18:1(11Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/18:2(9Z,12Z)):
L-Serine + PC(18:1(11Z)/18:2(9Z,12Z)) ⟶ Choline + PS(18:1(11Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(18:1(11Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(18:1(11Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(18:1(11Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:1(11Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(18:1(11Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(18:1(11Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:0):
L-Serine + PC(18:1(11Z)/20:0) ⟶ Choline + PS(18:1(11Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:1(11Z)):
L-Serine + PC(18:1(11Z)/20:1(11Z)) ⟶ Choline + PS(18:1(11Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:2(11Z,14Z)):
L-Serine + PC(18:1(11Z)/20:2(11Z,14Z)) ⟶ Choline + PS(18:1(11Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(18:1(11Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:1(11Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(18:1(11Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:1(11Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(18:1(11Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:1(11Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(18:1(11Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:1(11Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(18:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/22:0):
L-Serine + PC(18:1(11Z)/22:0) ⟶ Choline + PS(18:1(11Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/22:1(13Z)):
L-Serine + PC(18:1(11Z)/22:1(13Z)) ⟶ Choline + PS(18:1(11Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/22:2(13Z,16Z)):
L-Serine + PC(18:1(11Z)/22:2(13Z,16Z)) ⟶ Choline + PS(18:1(11Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(18:1(11Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:1(11Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(18:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/24:0):
L-Serine + PC(18:1(11Z)/24:0) ⟶ Choline + PS(18:1(11Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/24:1(15Z)):
L-Serine + PC(18:1(11Z)/24:1(15Z)) ⟶ Choline + PS(18:1(11Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/14:0):
L-Serine + PC(18:1(9Z)/14:0) ⟶ Choline + PS(18:1(9Z)/14:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/14:1(9Z)):
L-Serine + PC(18:1(9Z)/14:1(9Z)) ⟶ Choline + PS(18:1(9Z)/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/15:0):
L-Serine + PC(18:1(9Z)/15:0) ⟶ Choline + PS(18:1(9Z)/15:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/16:0):
L-Serine + PC(18:1(9Z)/16:0) ⟶ Choline + PS(18:1(9Z)/16:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/16:1(9Z)):
L-Serine + PC(18:1(9Z)/16:1(9Z)) ⟶ Choline + PS(18:1(9Z)/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/18:0):
L-Serine + PC(18:1(9Z)/18:0) ⟶ Choline + PS(18:1(9Z)/18:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/18:1(11Z)):
L-Serine + PC(18:1(9Z)/18:1(11Z)) ⟶ Choline + PS(18:1(9Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/18:1(9Z)):
L-Serine + PC(18:1(9Z)/18:1(9Z)) ⟶ Choline + PS(18:1(9Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/18:2(9Z,12Z)):
L-Serine + PC(18:1(9Z)/18:2(9Z,12Z)) ⟶ Choline + PS(18:1(9Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(18:1(9Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(18:1(9Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(18:1(9Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:1(9Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(18:1(9Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(18:1(9Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:0):
L-Serine + PC(18:1(9Z)/20:0) ⟶ Choline + PS(18:1(9Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:1(11Z)):
L-Serine + PC(18:1(9Z)/20:1(11Z)) ⟶ Choline + PS(18:1(9Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:2(11Z,14Z)):
L-Serine + PC(18:1(9Z)/20:2(11Z,14Z)) ⟶ Choline + PS(18:1(9Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(18:1(9Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:1(9Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(18:1(9Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:1(9Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(18:1(9Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:1(9Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(18:1(9Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:1(9Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(18:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/22:0):
L-Serine + PC(18:1(9Z)/22:0) ⟶ Choline + PS(18:1(9Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/22:1(13Z)):
L-Serine + PC(18:1(9Z)/22:1(13Z)) ⟶ Choline + PS(18:1(9Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/22:2(13Z,16Z)):
L-Serine + PC(18:1(9Z)/22:2(13Z,16Z)) ⟶ Choline + PS(18:1(9Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(18:1(9Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:1(9Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(18:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/24:0):
L-Serine + PC(18:1(9Z)/24:0) ⟶ Choline + PS(18:1(9Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/24:1(15Z)):
L-Serine + PC(18:1(9Z)/24:1(15Z)) ⟶ Choline + PS(18:1(9Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/14:0):
L-Serine + PC(18:2(9Z,12Z)/14:0) ⟶ Choline + PS(18:2(9Z,12Z)/14:0) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/14:1(9Z)):
L-Serine + PC(18:2(9Z,12Z)/14:1(9Z)) ⟶ Choline + PS(18:2(9Z,12Z)/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/15:0):
L-Serine + PC(18:2(9Z,12Z)/15:0) ⟶ Choline + PS(18:2(9Z,12Z)/15:0) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/16:0):
L-Serine + PC(18:2(9Z,12Z)/16:0) ⟶ Choline + PS(18:2(9Z,12Z)/16:0) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/16:1(9Z)):
L-Serine + PC(18:2(9Z,12Z)/16:1(9Z)) ⟶ Choline + PS(18:2(9Z,12Z)/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/18:0):
L-Serine + PC(18:2(9Z,12Z)/18:0) ⟶ Choline + PS(18:2(9Z,12Z)/18:0) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/18:1(11Z)):
L-Serine + PC(18:2(9Z,12Z)/18:1(11Z)) ⟶ Choline + PS(18:2(9Z,12Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/18:1(9Z)):
L-Serine + PC(18:2(9Z,12Z)/18:1(9Z)) ⟶ Choline + PS(18:2(9Z,12Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/18:2(9Z,12Z)):
L-Serine + PC(18:2(9Z,12Z)/18:2(9Z,12Z)) ⟶ Choline + PS(18:2(9Z,12Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(18:2(9Z,12Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(18:2(9Z,12Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:0):
L-Serine + PC(18:2(9Z,12Z)/20:0) ⟶ Choline + PS(18:2(9Z,12Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:1(11Z)):
L-Serine + PC(18:2(9Z,12Z)/20:1(11Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:2(11Z,14Z)):
L-Serine + PC(18:2(9Z,12Z)/20:2(11Z,14Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(18:2(9Z,12Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(18:2(9Z,12Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(18:2(9Z,12Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(18:2(9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/22:0):
L-Serine + PC(18:2(9Z,12Z)/22:0) ⟶ Choline + PS(18:2(9Z,12Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/22:1(13Z)):
L-Serine + PC(18:2(9Z,12Z)/22:1(13Z)) ⟶ Choline + PS(18:2(9Z,12Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/22:2(13Z,16Z)):
L-Serine + PC(18:2(9Z,12Z)/22:2(13Z,16Z)) ⟶ Choline + PS(18:2(9Z,12Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(18:2(9Z,12Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:2(9Z,12Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(18:2(9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:2(9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:2(9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:2(9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/24:0):
L-Serine + PC(18:2(9Z,12Z)/24:0) ⟶ Choline + PS(18:2(9Z,12Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/24:1(15Z)):
L-Serine + PC(18:2(9Z,12Z)/24:1(15Z)) ⟶ Choline + PS(18:2(9Z,12Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/14:0):
L-Serine + PC(18:3(6Z,9Z,12Z)/14:0) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/14:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/14:1(9Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/14:1(9Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/15:0):
L-Serine + PC(18:3(6Z,9Z,12Z)/15:0) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/15:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/16:0):
L-Serine + PC(18:3(6Z,9Z,12Z)/16:0) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/16:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/16:1(9Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/16:1(9Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/18:0):
L-Serine + PC(18:3(6Z,9Z,12Z)/18:0) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/18:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/18:1(11Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/18:1(11Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/18:1(9Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/18:1(9Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/18:2(9Z,12Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/18:2(9Z,12Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:0):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:0) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:1(11Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:1(11Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:2(11Z,14Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:2(11Z,14Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/22:0):
L-Serine + PC(18:3(6Z,9Z,12Z)/22:0) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/22:1(13Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/22:1(13Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/22:2(13Z,16Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/22:2(13Z,16Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/24:0):
L-Serine + PC(18:3(6Z,9Z,12Z)/24:0) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/24:1(15Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/24:1(15Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/14:0):
L-Serine + PC(18:3(9Z,12Z,15Z)/14:0) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/14:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/14:1(9Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/14:1(9Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/15:0):
L-Serine + PC(18:3(9Z,12Z,15Z)/15:0) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/15:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/16:0):
L-Serine + PC(18:3(9Z,12Z,15Z)/16:0) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/16:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/16:1(9Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/16:1(9Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/18:0):
L-Serine + PC(18:3(9Z,12Z,15Z)/18:0) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/18:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/18:1(11Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/18:1(11Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/18:1(9Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/18:1(9Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/18:2(9Z,12Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/18:2(9Z,12Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:0):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:0) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:1(11Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:1(11Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:2(11Z,14Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:2(11Z,14Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/22:0):
L-Serine + PC(18:3(9Z,12Z,15Z)/22:0) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/22:1(13Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/22:1(13Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/22:2(13Z,16Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/22:2(13Z,16Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/24:0):
L-Serine + PC(18:3(9Z,12Z,15Z)/24:0) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/24:1(15Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/24:1(15Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/14:0):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/14:0) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/14:0) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/14:1(9Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/14:1(9Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/15:0):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/15:0) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/15:0) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/16:0):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/16:0) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/16:0) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/16:1(9Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/16:1(9Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/18:0):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/18:0) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/18:0) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/18:1(11Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/18:1(11Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/18:1(9Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/18:1(9Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/18:2(9Z,12Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/18:2(9Z,12Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:0):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:0) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:1(11Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:1(11Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:2(11Z,14Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:2(11Z,14Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/22:0):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/22:0) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/22:1(13Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/22:1(13Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/22:2(13Z,16Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/22:2(13Z,16Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/24:0):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/24:0) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/24:1(15Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/24:1(15Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/14:0):
L-Serine + PC(20:0/14:0) ⟶ Choline + PS(20:0/14:0) - Phosphatidylethanolamine Biosynthesis PE(20:0/14:1(9Z)):
L-Serine + PC(20:0/14:1(9Z)) ⟶ Choline + PS(20:0/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/15:0):
L-Serine + PC(20:0/15:0) ⟶ Choline + PS(20:0/15:0) - Phosphatidylethanolamine Biosynthesis PE(20:0/16:0):
L-Serine + PC(20:0/16:0) ⟶ Choline + PS(20:0/16:0) - Phosphatidylethanolamine Biosynthesis PE(20:0/16:1(9Z)):
L-Serine + PC(20:0/16:1(9Z)) ⟶ Choline + PS(20:0/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/18:0):
L-Serine + PC(20:0/18:0) ⟶ Choline + PS(20:0/18:0) - Phosphatidylethanolamine Biosynthesis PE(20:0/18:1(11Z)):
L-Serine + PC(20:0/18:1(11Z)) ⟶ Choline + PS(20:0/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/18:1(9Z)):
L-Serine + PC(20:0/18:1(9Z)) ⟶ Choline + PS(20:0/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/18:2(9Z,12Z)):
L-Serine + PC(20:0/18:2(9Z,12Z)) ⟶ Choline + PS(20:0/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/18:3(6Z,9Z,12Z)):
L-Serine + PC(20:0/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(20:0/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/18:3(9Z,12Z,15Z)):
L-Serine + PC(20:0/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(20:0/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(20:0/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(20:0/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:0):
L-Serine + PC(20:0/20:0) ⟶ Choline + PS(20:0/20:0) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:1(11Z)):
L-Serine + PC(20:0/20:1(11Z)) ⟶ Choline + PS(20:0/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:2(11Z,14Z)):
L-Serine + PC(20:0/20:2(11Z,14Z)) ⟶ Choline + PS(20:0/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:3(5Z,8Z,11Z)):
L-Serine + PC(20:0/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(20:0/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:3(8Z,11Z,14Z)):
L-Serine + PC(20:0/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(20:0/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(20:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:0/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(20:0/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:0/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:0/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:0/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/22:0):
L-Serine + PC(20:0/22:0) ⟶ Choline + PS(20:0/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:0/22:1(13Z)):
L-Serine + PC(20:0/22:1(13Z)) ⟶ Choline + PS(20:0/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/22:2(13Z,16Z)):
L-Serine + PC(20:0/22:2(13Z,16Z)) ⟶ Choline + PS(20:0/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:0/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:0/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:0/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:0/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:0/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:0/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/24:0):
L-Serine + PC(20:0/24:0) ⟶ Choline + PS(20:0/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:0/24:1(15Z)):
L-Serine + PC(20:0/24:1(15Z)) ⟶ Choline + PS(20:0/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/14:0):
L-Serine + PC(20:1(11Z)/14:0) ⟶ Choline + PS(20:1(11Z)/14:0) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/14:1(9Z)):
L-Serine + PC(20:1(11Z)/14:1(9Z)) ⟶ Choline + PS(20:1(11Z)/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/15:0):
L-Serine + PC(20:1(11Z)/15:0) ⟶ Choline + PS(20:1(11Z)/15:0) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/16:0):
L-Serine + PC(20:1(11Z)/16:0) ⟶ Choline + PS(20:1(11Z)/16:0) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/16:1(9Z)):
L-Serine + PC(20:1(11Z)/16:1(9Z)) ⟶ Choline + PS(20:1(11Z)/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/18:0):
L-Serine + PC(20:1(11Z)/18:0) ⟶ Choline + PS(20:1(11Z)/18:0) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/18:1(11Z)):
L-Serine + PC(20:1(11Z)/18:1(11Z)) ⟶ Choline + PS(20:1(11Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/18:1(9Z)):
L-Serine + PC(20:1(11Z)/18:1(9Z)) ⟶ Choline + PS(20:1(11Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/18:2(9Z,12Z)):
L-Serine + PC(20:1(11Z)/18:2(9Z,12Z)) ⟶ Choline + PS(20:1(11Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(20:1(11Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(20:1(11Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(20:1(11Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(20:1(11Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(20:1(11Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(20:1(11Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/20:0):
L-Serine + PC(20:1(11Z)/20:0) ⟶ Choline + PS(20:1(11Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/20:1(11Z)):
L-Serine + PC(20:1(11Z)/20:1(11Z)) ⟶ Choline + PS(20:1(11Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/20:2(11Z,14Z)):
L-Serine + PC(20:1(11Z)/20:2(11Z,14Z)) ⟶ Choline + PS(20:1(11Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(20:1(11Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(20:1(11Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(20:1(11Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(20:1(11Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(20:1(11Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:1(11Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(20:1(11Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:1(11Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/22:0):
L-Serine + PC(20:1(11Z)/22:0) ⟶ Choline + PS(20:1(11Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/22:1(13Z)):
L-Serine + PC(20:1(11Z)/22:1(13Z)) ⟶ Choline + PS(20:1(11Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/22:2(13Z,16Z)):
L-Serine + PC(20:1(11Z)/22:2(13Z,16Z)) ⟶ Choline + PS(20:1(11Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:1(11Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:1(11Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/24:0):
L-Serine + PC(20:1(11Z)/24:0) ⟶ Choline + PS(20:1(11Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/24:1(15Z)):
L-Serine + PC(20:1(11Z)/24:1(15Z)) ⟶ Choline + PS(20:1(11Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/14:0):
L-Serine + PC(20:2(11Z,14Z)/14:0) ⟶ Choline + PS(20:2(11Z,14Z)/14:0) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/14:1(9Z)):
L-Serine + PC(20:2(11Z,14Z)/14:1(9Z)) ⟶ Choline + PS(20:2(11Z,14Z)/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/15:0):
L-Serine + PC(20:2(11Z,14Z)/15:0) ⟶ Choline + PS(20:2(11Z,14Z)/15:0) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/16:0):
L-Serine + PC(20:2(11Z,14Z)/16:0) ⟶ Choline + PS(20:2(11Z,14Z)/16:0) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/16:1(9Z)):
L-Serine + PC(20:2(11Z,14Z)/16:1(9Z)) ⟶ Choline + PS(20:2(11Z,14Z)/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/18:0):
L-Serine + PC(20:2(11Z,14Z)/18:0) ⟶ Choline + PS(20:2(11Z,14Z)/18:0) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/18:1(11Z)):
L-Serine + PC(20:2(11Z,14Z)/18:1(11Z)) ⟶ Choline + PS(20:2(11Z,14Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/18:1(9Z)):
L-Serine + PC(20:2(11Z,14Z)/18:1(9Z)) ⟶ Choline + PS(20:2(11Z,14Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/18:2(9Z,12Z)):
L-Serine + PC(20:2(11Z,14Z)/18:2(9Z,12Z)) ⟶ Choline + PS(20:2(11Z,14Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(20:2(11Z,14Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(20:2(11Z,14Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(20:2(11Z,14Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(20:2(11Z,14Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(20:2(11Z,14Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(20:2(11Z,14Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/20:0):
L-Serine + PC(20:2(11Z,14Z)/20:0) ⟶ Choline + PS(20:2(11Z,14Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/20:1(11Z)):
L-Serine + PC(20:2(11Z,14Z)/20:1(11Z)) ⟶ Choline + PS(20:2(11Z,14Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/20:2(11Z,14Z)):
L-Serine + PC(20:2(11Z,14Z)/20:2(11Z,14Z)) ⟶ Choline + PS(20:2(11Z,14Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(20:2(11Z,14Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(20:2(11Z,14Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(20:2(11Z,14Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(20:2(11Z,14Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(20:2(11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:2(11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(20:2(11Z,14Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:2(11Z,14Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:2(11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:2(11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/22:0):
L-Serine + PC(20:2(11Z,14Z)/22:0) ⟶ Choline + PS(20:2(11Z,14Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/22:1(13Z)):
L-Serine + PC(20:2(11Z,14Z)/22:1(13Z)) ⟶ Choline + PS(20:2(11Z,14Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/22:2(13Z,16Z)):
L-Serine + PC(20:2(11Z,14Z)/22:2(13Z,16Z)) ⟶ Choline + PS(20:2(11Z,14Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:2(11Z,14Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:2(11Z,14Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:2(11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:2(11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:2(11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:2(11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:2(11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:2(11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/24:0):
L-Serine + PC(20:2(11Z,14Z)/24:0) ⟶ Choline + PS(20:2(11Z,14Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/24:1(15Z)):
L-Serine + PC(20:2(11Z,14Z)/24:1(15Z)) ⟶ Choline + PS(20:2(11Z,14Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/14:0):
L-Serine + PC(20:3(5Z,8Z,11Z)/14:0) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/14:0) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/14:1(9Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/14:1(9Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/15:0):
L-Serine + PC(20:3(5Z,8Z,11Z)/15:0) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/15:0) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/16:0):
L-Serine + PC(20:3(5Z,8Z,11Z)/16:0) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/16:0) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/16:1(9Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/16:1(9Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/18:0):
L-Serine + PC(20:3(5Z,8Z,11Z)/18:0) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/18:0) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/18:1(11Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/18:1(11Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/18:1(9Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/18:1(9Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/18:2(9Z,12Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/18:2(9Z,12Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/20:0):
L-Serine + PC(20:3(5Z,8Z,11Z)/20:0) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/20:1(11Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/20:1(11Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/20:2(11Z,14Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/20:2(11Z,14Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/22:0):
L-Serine + PC(20:3(5Z,8Z,11Z)/22:0) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/22:1(13Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/22:1(13Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/22:2(13Z,16Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/22:2(13Z,16Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/24:0):
L-Serine + PC(20:3(5Z,8Z,11Z)/24:0) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/24:1(15Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/24:1(15Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/14:0):
L-Serine + PC(20:3(8Z,11Z,14Z)/14:0) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/14:0) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/14:1(9Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/14:1(9Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/15:0):
L-Serine + PC(20:3(8Z,11Z,14Z)/15:0) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/15:0) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/16:0):
L-Serine + PC(20:3(8Z,11Z,14Z)/16:0) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/16:0) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/16:1(9Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/16:1(9Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/18:0):
L-Serine + PC(20:3(8Z,11Z,14Z)/18:0) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/18:0) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/18:1(11Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/18:1(11Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/18:1(9Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/18:1(9Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/18:2(9Z,12Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/18:2(9Z,12Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/20:0):
L-Serine + PC(20:3(8Z,11Z,14Z)/20:0) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/20:1(11Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/20:1(11Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/20:2(11Z,14Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/20:2(11Z,14Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/22:0):
L-Serine + PC(20:3(8Z,11Z,14Z)/22:0) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/22:1(13Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/22:1(13Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/22:2(13Z,16Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/22:2(13Z,16Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/24:0):
L-Serine + PC(20:3(8Z,11Z,14Z)/24:0) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/24:1(15Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/24:1(15Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/14:0):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/14:0) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/14:0) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/14:1(9Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/14:1(9Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/15:0):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/15:0) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/15:0) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/16:0):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/16:0) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/16:0) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/16:1(9Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/16:1(9Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/18:0):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/18:0) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/18:0) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/18:1(11Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/18:1(11Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/18:1(9Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/18:1(9Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/18:2(9Z,12Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/18:2(9Z,12Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/20:0):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/20:0) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/20:1(11Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/20:1(11Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/20:2(11Z,14Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/20:2(11Z,14Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/22:0):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/22:0) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/22:1(13Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/22:1(13Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/22:2(13Z,16Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/22:2(13Z,16Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/24:0):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/24:0) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/24:1(15Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/24:1(15Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/14:0):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/14:0) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/14:0) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/14:1(9Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/14:1(9Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/15:0):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/15:0) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/15:0) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/16:0):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/16:0) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/16:0) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/16:1(9Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/16:1(9Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/18:0):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/18:0) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/18:0) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/18:1(11Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/18:1(11Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/18:1(9Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/18:1(9Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/18:2(9Z,12Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/18:2(9Z,12Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/20:0):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/20:0) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/20:1(11Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/20:1(11Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/20:2(11Z,14Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/20:2(11Z,14Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/22:0):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/22:0) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/22:1(13Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/22:1(13Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/22:2(13Z,16Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/22:2(13Z,16Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/24:0):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/24:0) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/24:1(15Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/24:1(15Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/14:0):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/14:0) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/14:0) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/14:1(9Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/14:1(9Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/15:0):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/15:0) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/15:0) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/16:0):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/16:0) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/16:0) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/16:1(9Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/16:1(9Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/18:0):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/18:0) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/18:0) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/18:1(11Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/18:1(11Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/18:1(9Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/18:1(9Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/18:2(9Z,12Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/18:2(9Z,12Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/20:0):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:0) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/20:1(11Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:1(11Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/20:2(11Z,14Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:2(11Z,14Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:0):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:0) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:2(13Z,16Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:2(13Z,16Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/24:0):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/24:0) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/24:1(15Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/24:1(15Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/14:0):
L-Serine + PC(22:0/14:0) ⟶ Choline + PS(22:0/14:0) - Phosphatidylethanolamine Biosynthesis PE(22:0/14:1(9Z)):
L-Serine + PC(22:0/14:1(9Z)) ⟶ Choline + PS(22:0/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/15:0):
L-Serine + PC(22:0/15:0) ⟶ Choline + PS(22:0/15:0) - Phosphatidylethanolamine Biosynthesis PE(22:0/16:0):
L-Serine + PC(22:0/16:0) ⟶ Choline + PS(22:0/16:0) - Phosphatidylethanolamine Biosynthesis PE(22:0/16:1(9Z)):
L-Serine + PC(22:0/16:1(9Z)) ⟶ Choline + PS(22:0/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/18:0):
L-Serine + PC(22:0/18:0) ⟶ Choline + PS(22:0/18:0) - Phosphatidylethanolamine Biosynthesis PE(22:0/18:1(11Z)):
L-Serine + PC(22:0/18:1(11Z)) ⟶ Choline + PS(22:0/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/18:1(9Z)):
L-Serine + PC(22:0/18:1(9Z)) ⟶ Choline + PS(22:0/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/18:2(9Z,12Z)):
L-Serine + PC(22:0/18:2(9Z,12Z)) ⟶ Choline + PS(22:0/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/18:3(6Z,9Z,12Z)):
L-Serine + PC(22:0/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(22:0/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/18:3(9Z,12Z,15Z)):
L-Serine + PC(22:0/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(22:0/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(22:0/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(22:0/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/20:0):
L-Serine + PC(22:0/20:0) ⟶ Choline + PS(22:0/20:0) - Phosphatidylethanolamine Biosynthesis PE(22:0/20:1(11Z)):
L-Serine + PC(22:0/20:1(11Z)) ⟶ Choline + PS(22:0/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/20:2(11Z,14Z)):
L-Serine + PC(22:0/20:2(11Z,14Z)) ⟶ Choline + PS(22:0/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/20:3(5Z,8Z,11Z)):
L-Serine + PC(22:0/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(22:0/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/20:3(8Z,11Z,14Z)):
L-Serine + PC(22:0/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(22:0/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(22:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(22:0/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(22:0/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(22:0/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(22:0/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(22:0/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/22:0):
L-Serine + PC(22:0/22:0) ⟶ Choline + PS(22:0/22:0) - Phosphatidylethanolamine Biosynthesis PE(22:0/22:1(13Z)):
L-Serine + PC(22:0/22:1(13Z)) ⟶ Choline + PS(22:0/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/22:2(13Z,16Z)):
L-Serine + PC(22:0/22:2(13Z,16Z)) ⟶ Choline + PS(22:0/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(22:0/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:0/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(22:0/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:0/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:0/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:0/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/24:0):
L-Serine + PC(22:0/24:0) ⟶ Choline + PS(22:0/24:0) - Phosphatidylethanolamine Biosynthesis PE(22:0/24:1(15Z)):
L-Serine + PC(22:0/24:1(15Z)) ⟶ Choline + PS(22:0/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/14:0):
L-Serine + PC(22:1(13Z)/14:0) ⟶ Choline + PS(22:1(13Z)/14:0) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/14:1(9Z)):
L-Serine + PC(22:1(13Z)/14:1(9Z)) ⟶ Choline + PS(22:1(13Z)/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/15:0):
L-Serine + PC(22:1(13Z)/15:0) ⟶ Choline + PS(22:1(13Z)/15:0) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/16:0):
L-Serine + PC(22:1(13Z)/16:0) ⟶ Choline + PS(22:1(13Z)/16:0) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/16:1(9Z)):
L-Serine + PC(22:1(13Z)/16:1(9Z)) ⟶ Choline + PS(22:1(13Z)/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/18:0):
L-Serine + PC(22:1(13Z)/18:0) ⟶ Choline + PS(22:1(13Z)/18:0) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/18:1(11Z)):
L-Serine + PC(22:1(13Z)/18:1(11Z)) ⟶ Choline + PS(22:1(13Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/18:1(9Z)):
L-Serine + PC(22:1(13Z)/18:1(9Z)) ⟶ Choline + PS(22:1(13Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/18:2(9Z,12Z)):
L-Serine + PC(22:1(13Z)/18:2(9Z,12Z)) ⟶ Choline + PS(22:1(13Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(22:1(13Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(22:1(13Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(22:1(13Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(22:1(13Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(22:1(13Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(22:1(13Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/20:0):
L-Serine + PC(22:1(13Z)/20:0) ⟶ Choline + PS(22:1(13Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/20:1(11Z)):
L-Serine + PC(22:1(13Z)/20:1(11Z)) ⟶ Choline + PS(22:1(13Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/20:2(11Z,14Z)):
L-Serine + PC(22:1(13Z)/20:2(11Z,14Z)) ⟶ Choline + PS(22:1(13Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(22:1(13Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(22:1(13Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(22:1(13Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(22:1(13Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(22:1(13Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(22:1(13Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(22:1(13Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(22:1(13Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(22:1(13Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(22:1(13Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/22:0):
L-Serine + PC(22:1(13Z)/22:0) ⟶ Choline + PS(22:1(13Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/22:1(13Z)):
L-Serine + PC(22:1(13Z)/22:1(13Z)) ⟶ Choline + PS(22:1(13Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/22:2(13Z,16Z)):
L-Serine + PC(22:1(13Z)/22:2(13Z,16Z)) ⟶ Choline + PS(22:1(13Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(22:1(13Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:1(13Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(22:1(13Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:1(13Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:1(13Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:1(13Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/24:0):
L-Serine + PC(22:1(13Z)/24:0) ⟶ Choline + PS(22:1(13Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/24:1(15Z)):
L-Serine + PC(22:1(13Z)/24:1(15Z)) ⟶ Choline + PS(22:1(13Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/14:0):
L-Serine + PC(22:2(13Z,16Z)/14:0) ⟶ Choline + PS(22:2(13Z,16Z)/14:0) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/14:1(9Z)):
L-Serine + PC(22:2(13Z,16Z)/14:1(9Z)) ⟶ Choline + PS(22:2(13Z,16Z)/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/15:0):
L-Serine + PC(22:2(13Z,16Z)/15:0) ⟶ Choline + PS(22:2(13Z,16Z)/15:0) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/16:0):
L-Serine + PC(22:2(13Z,16Z)/16:0) ⟶ Choline + PS(22:2(13Z,16Z)/16:0) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/16:1(9Z)):
L-Serine + PC(22:2(13Z,16Z)/16:1(9Z)) ⟶ Choline + PS(22:2(13Z,16Z)/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/18:0):
L-Serine + PC(22:2(13Z,16Z)/18:0) ⟶ Choline + PS(22:2(13Z,16Z)/18:0) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/18:1(11Z)):
L-Serine + PC(22:2(13Z,16Z)/18:1(11Z)) ⟶ Choline + PS(22:2(13Z,16Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/18:1(9Z)):
L-Serine + PC(22:2(13Z,16Z)/18:1(9Z)) ⟶ Choline + PS(22:2(13Z,16Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/18:2(9Z,12Z)):
L-Serine + PC(22:2(13Z,16Z)/18:2(9Z,12Z)) ⟶ Choline + PS(22:2(13Z,16Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(22:2(13Z,16Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(22:2(13Z,16Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(22:2(13Z,16Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(22:2(13Z,16Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(22:2(13Z,16Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(22:2(13Z,16Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/20:0):
L-Serine + PC(22:2(13Z,16Z)/20:0) ⟶ Choline + PS(22:2(13Z,16Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/20:1(11Z)):
L-Serine + PC(22:2(13Z,16Z)/20:1(11Z)) ⟶ Choline + PS(22:2(13Z,16Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/20:2(11Z,14Z)):
L-Serine + PC(22:2(13Z,16Z)/20:2(11Z,14Z)) ⟶ Choline + PS(22:2(13Z,16Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(22:2(13Z,16Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(22:2(13Z,16Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(22:2(13Z,16Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(22:2(13Z,16Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(22:2(13Z,16Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(22:2(13Z,16Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(22:2(13Z,16Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(22:2(13Z,16Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(22:2(13Z,16Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(22:2(13Z,16Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/22:0):
L-Serine + PC(22:2(13Z,16Z)/22:0) ⟶ Choline + PS(22:2(13Z,16Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/22:1(13Z)):
L-Serine + PC(22:2(13Z,16Z)/22:1(13Z)) ⟶ Choline + PS(22:2(13Z,16Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/22:2(13Z,16Z)):
L-Serine + PC(22:2(13Z,16Z)/22:2(13Z,16Z)) ⟶ Choline + PS(22:2(13Z,16Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(22:2(13Z,16Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:2(13Z,16Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(22:2(13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:2(13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:2(13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:2(13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/24:0):
L-Serine + PC(22:2(13Z,16Z)/24:0) ⟶ Choline + PS(22:2(13Z,16Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/24:1(15Z)):
L-Serine + PC(22:2(13Z,16Z)/24:1(15Z)) ⟶ Choline + PS(22:2(13Z,16Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/14:0):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/14:0) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/14:0) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/14:1(9Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/14:1(9Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/15:0):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/15:0) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/15:0) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/16:0):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/16:0) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/16:0) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/16:1(9Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/16:1(9Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/18:0):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/18:0) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/18:0) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/18:1(11Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/18:1(11Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/18:1(9Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/18:1(9Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/18:2(9Z,12Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/18:2(9Z,12Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/20:0):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/20:0) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/20:1(11Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/20:1(11Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/20:2(11Z,14Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/20:2(11Z,14Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/22:0):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/22:0) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/22:1(13Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/22:1(13Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/22:2(13Z,16Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/22:2(13Z,16Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/24:0):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/24:0) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/24:1(15Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/24:1(15Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/14:0):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/14:0) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/14:0) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/14:1(9Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/14:1(9Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/15:0):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/15:0) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/15:0) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/16:0):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/16:0) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/16:0) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/16:1(9Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/16:1(9Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/18:0):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/18:0) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/18:0) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/18:1(11Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/18:1(11Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/18:1(9Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/18:1(9Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/18:2(9Z,12Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/18:2(9Z,12Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/20:0):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/20:0) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/20:1(11Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/20:1(11Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/20:2(11Z,14Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/20:2(11Z,14Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/22:0):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:0) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/22:1(13Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:1(13Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/22:2(13Z,16Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:2(13Z,16Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/24:0):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/24:0) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/24:1(15Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/24:1(15Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/14:0):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/14:0) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/14:0) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/14:1(9Z)):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/14:1(9Z)) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/15:0):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/15:0) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/15:0) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/16:0):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/16:0) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/16:0) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/16:1(9Z)):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/16:1(9Z)) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/18:0):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/18:0) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/18:0) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/18:1(11Z)):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/18:1(11Z)) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/18:1(9Z)):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/18:1(9Z)) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/18:2(9Z,12Z)):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/18:2(9Z,12Z)) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/20:0):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/20:0) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/20:1(11Z)):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/20:1(11Z)) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/20:2(11Z,14Z)):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/20:2(11Z,14Z)) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/22:0):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:0) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/22:1(13Z)):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:1(13Z)) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/22:2(13Z,16Z)):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:2(13Z,16Z)) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/24:0):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/24:0) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/24:1(15Z)):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/24:1(15Z)) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/14:0):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/14:0) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/14:0) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/14:1(9Z)):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/14:1(9Z)) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/15:0):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/15:0) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/15:0) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/16:0):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/16:0) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/16:0) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/16:1(9Z)):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/16:1(9Z)) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:0):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:0) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:0) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:1(11Z)):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:1(11Z)) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:1(9Z)):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:1(9Z)) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:2(9Z,12Z)):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:2(9Z,12Z)) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:0):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:0) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:1(11Z)):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:1(11Z)) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:2(11Z,14Z)):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:2(11Z,14Z)) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:0):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:0) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:1(13Z)):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:1(13Z)) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:2(13Z,16Z)):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:2(13Z,16Z)) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:0):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:0) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:1(15Z)):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:1(15Z)) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(24:0/14:0):
L-Serine + PC(24:0/14:0) ⟶ Choline + PS(24:0/14:0) - Phosphatidylethanolamine Biosynthesis PE(24:0/14:1(9Z)):
L-Serine + PC(24:0/14:1(9Z)) ⟶ Choline + PS(24:0/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(24:0/15:0):
L-Serine + PC(24:0/15:0) ⟶ Choline + PS(24:0/15:0) - Phosphatidylethanolamine Biosynthesis PE(24:0/16:0):
L-Serine + PC(24:0/16:0) ⟶ Choline + PS(24:0/16:0) - Phosphatidylethanolamine Biosynthesis PE(24:0/16:1(9Z)):
L-Serine + PC(24:0/16:1(9Z)) ⟶ Choline + PS(24:0/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(24:0/18:0):
L-Serine + PC(24:0/18:0) ⟶ Choline + PS(24:0/18:0) - Phosphatidylethanolamine Biosynthesis PE(24:0/18:1(11Z)):
L-Serine + PC(24:0/18:1(11Z)) ⟶ Choline + PS(24:0/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(24:0/18:1(9Z)):
L-Serine + PC(24:0/18:1(9Z)) ⟶ Choline + PS(24:0/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(24:0/18:2(9Z,12Z)):
L-Serine + PC(24:0/18:2(9Z,12Z)) ⟶ Choline + PS(24:0/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(24:0/18:3(6Z,9Z,12Z)):
L-Serine + PC(24:0/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(24:0/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(24:0/18:3(9Z,12Z,15Z)):
L-Serine + PC(24:0/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(24:0/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(24:0/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(24:0/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(24:0/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(24:0/20:0):
L-Serine + PC(24:0/20:0) ⟶ Choline + PS(24:0/20:0) - Phosphatidylethanolamine Biosynthesis PE(24:0/20:1(11Z)):
L-Serine + PC(24:0/20:1(11Z)) ⟶ Choline + PS(24:0/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(24:0/20:2(11Z,14Z)):
L-Serine + PC(24:0/20:2(11Z,14Z)) ⟶ Choline + PS(24:0/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(24:0/20:3(5Z,8Z,11Z)):
L-Serine + PC(24:0/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(24:0/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(24:0/20:3(8Z,11Z,14Z)):
L-Serine + PC(24:0/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(24:0/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(24:0/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(24:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(24:0/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(24:0/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(24:0/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(24:0/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(24:0/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(24:0/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(24:0/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(24:0/22:0):
L-Serine + PC(24:0/22:0) ⟶ Choline + PS(24:0/22:0) - Phosphatidylethanolamine Biosynthesis PE(24:0/22:1(13Z)):
L-Serine + PC(24:0/22:1(13Z)) ⟶ Choline + PS(24:0/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(24:0/22:2(13Z,16Z)):
L-Serine + PC(24:0/22:2(13Z,16Z)) ⟶ Choline + PS(24:0/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(24:0/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(24:0/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(24:0/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(24:0/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(24:0/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(24:0/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(24:0/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(24:0/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(24:0/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(24:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(24:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(24:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(24:0/24:0):
L-Serine + PC(24:0/24:0) ⟶ Choline + PS(24:0/24:0) - Phosphatidylethanolamine Biosynthesis PE(24:0/24:1(15Z)):
L-Serine + PC(24:0/24:1(15Z)) ⟶ Choline + PS(24:0/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/14:0):
L-Serine + PC(24:1(15Z)/14:0) ⟶ Choline + PS(24:1(15Z)/14:0) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/14:1(9Z)):
L-Serine + PC(24:1(15Z)/14:1(9Z)) ⟶ Choline + PS(24:1(15Z)/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/15:0):
L-Serine + PC(24:1(15Z)/15:0) ⟶ Choline + PS(24:1(15Z)/15:0) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/16:0):
L-Serine + PC(24:1(15Z)/16:0) ⟶ Choline + PS(24:1(15Z)/16:0) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/16:1(9Z)):
L-Serine + PC(24:1(15Z)/16:1(9Z)) ⟶ Choline + PS(24:1(15Z)/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/18:0):
L-Serine + PC(24:1(15Z)/18:0) ⟶ Choline + PS(24:1(15Z)/18:0) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/18:1(11Z)):
L-Serine + PC(24:1(15Z)/18:1(11Z)) ⟶ Choline + PS(24:1(15Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/18:1(9Z)):
L-Serine + PC(24:1(15Z)/18:1(9Z)) ⟶ Choline + PS(24:1(15Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/18:2(9Z,12Z)):
L-Serine + PC(24:1(15Z)/18:2(9Z,12Z)) ⟶ Choline + PS(24:1(15Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(24:1(15Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(24:1(15Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(24:1(15Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(24:1(15Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(24:1(15Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(24:1(15Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/20:0):
L-Serine + PC(24:1(15Z)/20:0) ⟶ Choline + PS(24:1(15Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/20:1(11Z)):
L-Serine + PC(24:1(15Z)/20:1(11Z)) ⟶ Choline + PS(24:1(15Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/20:2(11Z,14Z)):
L-Serine + PC(24:1(15Z)/20:2(11Z,14Z)) ⟶ Choline + PS(24:1(15Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(24:1(15Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(24:1(15Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(24:1(15Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(24:1(15Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(24:1(15Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(24:1(15Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(24:1(15Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(24:1(15Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(24:1(15Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(24:1(15Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/22:0):
L-Serine + PC(24:1(15Z)/22:0) ⟶ Choline + PS(24:1(15Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/22:1(13Z)):
L-Serine + PC(24:1(15Z)/22:1(13Z)) ⟶ Choline + PS(24:1(15Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/22:2(13Z,16Z)):
L-Serine + PC(24:1(15Z)/22:2(13Z,16Z)) ⟶ Choline + PS(24:1(15Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(24:1(15Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(24:1(15Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(24:1(15Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(24:1(15Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(24:1(15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(24:1(15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(24:1(15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(24:1(15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/24:0):
L-Serine + PC(24:1(15Z)/24:0) ⟶ Choline + PS(24:1(15Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/24:1(15Z)):
L-Serine + PC(24:1(15Z)/24:1(15Z)) ⟶ Choline + PS(24:1(15Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis:
L-Serine + Phosphatidylcholine ⟶ Choline + an L-1-phosphatidylserine - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/18:0):
L-Serine + PC(16:1(9Z)/18:0) ⟶ Choline + PS(16:1(9Z)/18:0) - Phosphatidylethanolamine Biosynthesis PE(11D3/11D3):
L-Serine + PC(11D3/11D3) ⟶ Choline + PS(11D3/11D3) - Phosphatidylethanolamine Biosynthesis PE(11D3/11D5):
L-Serine + PC(11D3/11D5) ⟶ Choline + PS(11D3/11D5) - Phosphatidylethanolamine Biosynthesis PE(11D3/13D5):
L-Serine + PC(11D3/13D5) ⟶ Choline + PS(11D3/13D5) - Phosphatidylethanolamine Biosynthesis PE(11D3/9D3):
L-Serine + PC(11D3/9D3) ⟶ Choline + PS(11D3/9D3) - Phosphatidylethanolamine Biosynthesis PE(11D3/9D5):
L-Serine + PC(11D3/9D5) ⟶ Choline + PS(11D3/9D5) - Phosphatidylethanolamine Biosynthesis PE(11D3/11M3):
L-Serine + PC(11D3/11M3) ⟶ Choline + PS(11D3/11M3) - Phosphatidylethanolamine Biosynthesis PE(11D3/11M5):
L-Serine + PC(11D3/11M5) ⟶ Choline + PS(11D3/11M5) - Phosphatidylethanolamine Biosynthesis PE(11D3/13M5):
L-Serine + PC(11D3/13M5) ⟶ Choline + PS(11D3/13M5) - Phosphatidylethanolamine Biosynthesis PE(11D3/9M5):
L-Serine + PC(11D3/9M5) ⟶ Choline + PS(11D3/9M5) - Phosphatidylethanolamine Biosynthesis PE(11D5/11D3):
L-Serine + PC(11D5/11D3) ⟶ Choline + PS(11D5/11D3) - Phosphatidylethanolamine Biosynthesis PE(11D5/11D5):
L-Serine + PC(11D5/11D5) ⟶ Choline + PS(11D5/11D5) - Phosphatidylethanolamine Biosynthesis PE(11D5/13D5):
L-Serine + PC(11D5/13D5) ⟶ Choline + PS(11D5/13D5) - Phosphatidylethanolamine Biosynthesis PE(11D5/9D3):
L-Serine + PC(11D5/9D3) ⟶ Choline + PS(11D5/9D3) - Phosphatidylethanolamine Biosynthesis PE(11D5/9D5):
L-Serine + PC(11D5/9D5) ⟶ Choline + PS(11D5/9D5) - Phosphatidylethanolamine Biosynthesis PE(11D5/11M3):
L-Serine + PC(11D5/11M3) ⟶ Choline + PS(11D5/11M3) - Phosphatidylethanolamine Biosynthesis PE(11D5/11M5):
L-Serine + PC(11D5/11M5) ⟶ Choline + PS(11D5/11M5) - Phosphatidylethanolamine Biosynthesis PE(11D5/13M5):
L-Serine + PC(11D5/13M5) ⟶ Choline + PS(11D5/13M5) - Phosphatidylethanolamine Biosynthesis PE(11D5/9M5):
L-Serine + PC(11D5/9M5) ⟶ Choline + PS(11D5/9M5) - Phosphatidylethanolamine Biosynthesis PE(13D5/11D3):
L-Serine + PC(13D5/11D3) ⟶ Choline + PS(13D5/11D3) - Phosphatidylethanolamine Biosynthesis PE(13D5/11D5):
L-Serine + PC(13D5/11D5) ⟶ Choline + PS(13D5/11D5) - Phosphatidylethanolamine Biosynthesis PE(13D5/13D5):
L-Serine + PC(13D5/13D5) ⟶ Choline + PS(13D5/13D5) - Phosphatidylethanolamine Biosynthesis PE(13D5/9D3):
L-Serine + PC(13D5/9D3) ⟶ Choline + PS(13D5/9D3) - Phosphatidylethanolamine Biosynthesis PE(13D5/9D5):
L-Serine + PC(13D5/9D5) ⟶ Choline + PS(13D5/9D5) - Phosphatidylethanolamine Biosynthesis PE(13D5/11M3):
L-Serine + PC(13D5/11M3) ⟶ Choline + PS(13D5/11M3) - Phosphatidylethanolamine Biosynthesis PE(13D5/11M5):
L-Serine + PC(13D5/11M5) ⟶ Choline + PS(13D5/11M5) - Phosphatidylethanolamine Biosynthesis PE(13D5/13M5):
L-Serine + PC(13D5/13M5) ⟶ Choline + PS(13D5/13M5) - Phosphatidylethanolamine Biosynthesis PE(13D5/9M5):
L-Serine + PC(13D5/9M5) ⟶ Choline + PS(13D5/9M5) - Phosphatidylethanolamine Biosynthesis PE(9D3/11D3):
L-Serine + PC(9D3/11D3) ⟶ Choline + PS(9D3/11D3) - Phosphatidylethanolamine Biosynthesis PE(9D3/11D5):
L-Serine + PC(9D3/11D5) ⟶ Choline + PS(9D3/11D5) - Phosphatidylethanolamine Biosynthesis PE(9D3/13D5):
L-Serine + PC(9D3/13D5) ⟶ Choline + PS(9D3/13D5) - Phosphatidylethanolamine Biosynthesis PE(9D3/9D3):
L-Serine + PC(9D3/9D3) ⟶ Choline + PS(9D3/9D3) - Phosphatidylethanolamine Biosynthesis PE(9D3/9D5):
L-Serine + PC(9D3/9D5) ⟶ Choline + PS(9D3/9D5) - Phosphatidylethanolamine Biosynthesis PE(9D3/11M3):
L-Serine + PC(9D3/11M3) ⟶ Choline + PS(9D3/11M3) - Phosphatidylethanolamine Biosynthesis PE(9D3/11M5):
L-Serine + PC(9D3/11M5) ⟶ Choline + PS(9D3/11M5) - Phosphatidylethanolamine Biosynthesis PE(9D3/13M5):
L-Serine + PC(9D3/13M5) ⟶ Choline + PS(9D3/13M5) - Phosphatidylethanolamine Biosynthesis PE(9D3/9M5):
L-Serine + PC(9D3/9M5) ⟶ Choline + PS(9D3/9M5) - Phosphatidylethanolamine Biosynthesis PE(9D5/11D3):
L-Serine + PC(9D5/11D3) ⟶ Choline + PS(9D5/11D3) - Phosphatidylethanolamine Biosynthesis PE(9D5/11D5):
L-Serine + PC(9D5/11D5) ⟶ Choline + PS(9D5/11D5) - Phosphatidylethanolamine Biosynthesis PE(9D5/13D5):
L-Serine + PC(9D5/13D5) ⟶ Choline + PS(9D5/13D5) - Phosphatidylethanolamine Biosynthesis PE(9D5/9D3):
L-Serine + PC(9D5/9D3) ⟶ Choline + PS(9D5/9D3) - Phosphatidylethanolamine Biosynthesis PE(9D5/9D5):
L-Serine + PC(9D5/9D5) ⟶ Choline + PS(9D5/9D5) - Phosphatidylethanolamine Biosynthesis PE(9D5/11M3):
L-Serine + PC(9D5/11M3) ⟶ Choline + PS(9D5/11M3) - Phosphatidylethanolamine Biosynthesis PE(9D5/11M5):
L-Serine + PC(9D5/11M5) ⟶ Choline + PS(9D5/11M5) - Phosphatidylethanolamine Biosynthesis PE(9D5/13M5):
L-Serine + PC(9D5/13M5) ⟶ Choline + PS(9D5/13M5) - Phosphatidylethanolamine Biosynthesis PE(9D5/9M5):
L-Serine + PC(9D5/9M5) ⟶ Choline + PS(9D5/9M5) - Phosphatidylethanolamine Biosynthesis PE(11M3/11D3):
L-Serine + PC(11M3/11D3) ⟶ Choline + PS(11M3/11D3) - Phosphatidylethanolamine Biosynthesis PE(11M3/11D5):
L-Serine + PC(11M3/11D5) ⟶ Choline + PS(11M3/11D5) - Phosphatidylethanolamine Biosynthesis PE(11M3/13D5):
L-Serine + PC(11M3/13D5) ⟶ Choline + PS(11M3/13D5) - Phosphatidylethanolamine Biosynthesis PE(11M3/9D3):
L-Serine + PC(11M3/9D3) ⟶ Choline + PS(11M3/9D3) - Phosphatidylethanolamine Biosynthesis PE(11M3/9D5):
L-Serine + PC(11M3/9D5) ⟶ Choline + PS(11M3/9D5) - Phosphatidylethanolamine Biosynthesis PE(11M3/11M3):
L-Serine + PC(11M3/11M3) ⟶ Choline + PS(11M3/11M3) - Phosphatidylethanolamine Biosynthesis PE(11M3/11M5):
L-Serine + PC(11M3/11M5) ⟶ Choline + PS(11M3/11M5) - Phosphatidylethanolamine Biosynthesis PE(11M3/13M5):
L-Serine + PC(11M3/13M5) ⟶ Choline + PS(11M3/13M5) - Phosphatidylethanolamine Biosynthesis PE(11M3/9M5):
L-Serine + PC(11M3/9M5) ⟶ Choline + PS(11M3/9M5) - Phosphatidylethanolamine Biosynthesis PE(11M5/11D3):
L-Serine + PC(11M5/11D3) ⟶ Choline + PS(11M5/11D3) - Phosphatidylethanolamine Biosynthesis PE(11M5/11D5):
L-Serine + PC(11M5/11D5) ⟶ Choline + PS(11M5/11D5) - Phosphatidylethanolamine Biosynthesis PE(11M5/13D5):
L-Serine + PC(11M5/13D5) ⟶ Choline + PS(11M5/13D5) - Phosphatidylethanolamine Biosynthesis PE(11M5/9D3):
L-Serine + PC(11M5/9D3) ⟶ Choline + PS(11M5/9D3) - Phosphatidylethanolamine Biosynthesis PE(11M5/9D5):
L-Serine + PC(11M5/9D5) ⟶ Choline + PS(11M5/9D5) - Phosphatidylethanolamine Biosynthesis PE(11M5/11M3):
L-Serine + PC(11M5/11M3) ⟶ Choline + PS(11M5/11M3) - Phosphatidylethanolamine Biosynthesis PE(11M5/11M5):
L-Serine + PC(11M5/11M5) ⟶ Choline + PS(11M5/11M5) - Phosphatidylethanolamine Biosynthesis PE(11M5/13M5):
L-Serine + PC(11M5/13M5) ⟶ Choline + PS(11M5/13M5) - Phosphatidylethanolamine Biosynthesis PE(11M5/9M5):
L-Serine + PC(11M5/9M5) ⟶ Choline + PS(11M5/9M5) - Phosphatidylethanolamine Biosynthesis PE(13M5/11D3):
L-Serine + PC(13M5/11D3) ⟶ Choline + PS(13M5/11D3) - Phosphatidylethanolamine Biosynthesis PE(13M5/11D5):
L-Serine + PC(13M5/11D5) ⟶ Choline + PS(13M5/11D5) - Phosphatidylethanolamine Biosynthesis PE(13M5/13D5):
L-Serine + PC(13M5/13D5) ⟶ Choline + PS(13M5/13D5) - Phosphatidylethanolamine Biosynthesis PE(13M5/9D3):
L-Serine + PC(13M5/9D3) ⟶ Choline + PS(13M5/9D3) - Phosphatidylethanolamine Biosynthesis PE(13M5/9D5):
L-Serine + PC(13M5/9D5) ⟶ Choline + PS(13M5/9D5) - Phosphatidylethanolamine Biosynthesis PE(13M5/11M3):
L-Serine + PC(13M5/11M3) ⟶ Choline + PS(13M5/11M3) - Phosphatidylethanolamine Biosynthesis PE(13M5/11M5):
L-Serine + PC(13M5/11M5) ⟶ Choline + PS(13M5/11M5) - Phosphatidylethanolamine Biosynthesis PE(13M5/13M5):
L-Serine + PC(13M5/13M5) ⟶ Choline + PS(13M5/13M5) - Phosphatidylethanolamine Biosynthesis PE(13M5/9M5):
L-Serine + PC(13M5/9M5) ⟶ Choline + PS(13M5/9M5) - Phosphatidylethanolamine Biosynthesis PE(9M5/11D3):
L-Serine + PC(9M5/11D3) ⟶ Choline + PS(9M5/11D3) - Phosphatidylethanolamine Biosynthesis PE(9M5/11D5):
L-Serine + PC(9M5/11D5) ⟶ Choline + PS(9M5/11D5) - Phosphatidylethanolamine Biosynthesis PE(9M5/13D5):
L-Serine + PC(9M5/13D5) ⟶ Choline + PS(9M5/13D5) - Phosphatidylethanolamine Biosynthesis PE(9M5/9D3):
L-Serine + PC(9M5/9D3) ⟶ Choline + PS(9M5/9D3) - Phosphatidylethanolamine Biosynthesis PE(9M5/9D5):
L-Serine + PC(9M5/9D5) ⟶ Choline + PS(9M5/9D5) - Phosphatidylethanolamine Biosynthesis PE(9M5/11M3):
L-Serine + PC(9M5/11M3) ⟶ Choline + PS(9M5/11M3) - Phosphatidylethanolamine Biosynthesis PE(9M5/11M5):
L-Serine + PC(9M5/11M5) ⟶ Choline + PS(9M5/11M5) - Phosphatidylethanolamine Biosynthesis PE(9M5/13M5):
L-Serine + PC(9M5/13M5) ⟶ Choline + PS(9M5/13M5) - Phosphatidylethanolamine Biosynthesis PE(9M5/9M5):
L-Serine + PC(9M5/9M5) ⟶ Choline + PS(9M5/9M5) - Phosphatidylethanolamine Biosynthesis:
L-Serine + Phosphatidylcholine ⟶ Choline + an L-1-phosphatidylserine - Ubiquitin Proteasome Pathway:
Ubiquitin-like modifier-activating enzyme 1 ⟶ Adenosine monophosphate - Phosphatidylethanolamine Biosynthesis PE(14:0/14:0):
L-Serine + PC(14:0/14:0) ⟶ Choline + PS(14:0/14:0) - Phosphatidylethanolamine Biosynthesis PE(14:0/14:1(9Z)):
L-Serine + PC(14:0/14:1(9Z)) ⟶ Choline + PS(14:0/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/15:0):
L-Serine + PC(14:0/15:0) ⟶ Choline + PS(14:0/15:0) - Phosphatidylethanolamine Biosynthesis PE(14:0/16:0):
L-Serine + PC(14:0/16:0) ⟶ Choline + PS(14:0/16:0) - Phosphatidylethanolamine Biosynthesis PE(14:0/16:1(9Z)):
L-Serine + PC(14:0/16:1(9Z)) ⟶ Choline + PS(14:0/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/18:0):
L-Serine + PC(14:0/18:0) ⟶ Choline + PS(14:0/18:0) - Phosphatidylethanolamine Biosynthesis PE(14:0/18:1(11Z)):
L-Serine + PC(14:0/18:1(11Z)) ⟶ Choline + PS(14:0/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/18:1(9Z)):
L-Serine + PC(14:0/18:1(9Z)) ⟶ Choline + PS(14:0/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/18:2(9Z,12Z)):
L-Serine + PC(14:0/18:2(9Z,12Z)) ⟶ Choline + PS(14:0/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/18:3(6Z,9Z,12Z)):
L-Serine + PC(14:0/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(14:0/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/18:3(9Z,12Z,15Z)):
L-Serine + PC(14:0/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(14:0/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(14:0/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(14:0/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:0):
L-Serine + PC(14:0/20:0) ⟶ Choline + PS(14:0/20:0) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:1(11Z)):
L-Serine + PC(14:0/20:1(11Z)) ⟶ Choline + PS(14:0/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:2(11Z,14Z)):
L-Serine + PC(14:0/20:2(11Z,14Z)) ⟶ Choline + PS(14:0/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:3(5Z,8Z,11Z)):
L-Serine + PC(14:0/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(14:0/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:3(8Z,11Z,14Z)):
L-Serine + PC(14:0/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(14:0/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(14:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(14:0/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(14:0/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(14:0/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(14:0/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(14:0/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/22:0):
L-Serine + PC(14:0/22:0) ⟶ Choline + PS(14:0/22:0) - Phosphatidylethanolamine Biosynthesis PE(14:0/22:1(13Z)):
L-Serine + PC(14:0/22:1(13Z)) ⟶ Choline + PS(14:0/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/22:2(13Z,16Z)):
L-Serine + PC(14:0/22:2(13Z,16Z)) ⟶ Choline + PS(14:0/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(14:0/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(14:0/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(14:0/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(14:0/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(14:0/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(14:0/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(14:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(14:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/24:0):
L-Serine + PC(14:0/24:0) ⟶ Choline + PS(14:0/24:0) - Phosphatidylethanolamine Biosynthesis PE(14:0/24:1(15Z)):
L-Serine + PC(14:0/24:1(15Z)) ⟶ Choline + PS(14:0/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/14:1(9Z)):
L-Serine + PC(14:1(9Z)/14:1(9Z)) ⟶ Choline + PS(14:1(9Z)/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/15:0):
L-Serine + PC(14:1(9Z)/15:0) ⟶ Choline + PS(14:1(9Z)/15:0) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/16:0):
L-Serine + PC(14:1(9Z)/16:0) ⟶ Choline + PS(14:1(9Z)/16:0) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/16:1(9Z)):
L-Serine + PC(14:1(9Z)/16:1(9Z)) ⟶ Choline + PS(14:1(9Z)/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/18:0):
L-Serine + PC(14:1(9Z)/18:0) ⟶ Choline + PS(14:1(9Z)/18:0) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/18:1(11Z)):
L-Serine + PC(14:1(9Z)/18:1(11Z)) ⟶ Choline + PS(14:1(9Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/18:1(9Z)):
L-Serine + PC(14:1(9Z)/18:1(9Z)) ⟶ Choline + PS(14:1(9Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/18:2(9Z,12Z)):
L-Serine + PC(14:1(9Z)/18:2(9Z,12Z)) ⟶ Choline + PS(14:1(9Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(14:1(9Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(14:1(9Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(14:1(9Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(14:1(9Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:0):
L-Serine + PC(14:1(9Z)/20:0) ⟶ Choline + PS(14:1(9Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:1(11Z)):
L-Serine + PC(14:1(9Z)/20:1(11Z)) ⟶ Choline + PS(14:1(9Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:2(11Z,14Z)):
L-Serine + PC(14:1(9Z)/20:2(11Z,14Z)) ⟶ Choline + PS(14:1(9Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(14:1(9Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(14:1(9Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(14:1(9Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(14:1(9Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(14:1(9Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(14:1(9Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(14:1(9Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(14:1(9Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(14:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(14:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/22:0):
L-Serine + PC(14:1(9Z)/22:0) ⟶ Choline + PS(14:1(9Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/22:1(13Z)):
L-Serine + PC(14:1(9Z)/22:1(13Z)) ⟶ Choline + PS(14:1(9Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/22:2(13Z,16Z)):
L-Serine + PC(14:1(9Z)/22:2(13Z,16Z)) ⟶ Choline + PS(14:1(9Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(14:1(9Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(14:1(9Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(14:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(14:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(14:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(14:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(14:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(14:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/24:0):
L-Serine + PC(14:1(9Z)/24:0) ⟶ Choline + PS(14:1(9Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/24:1(15Z)):
L-Serine + PC(14:1(9Z)/24:1(15Z)) ⟶ Choline + PS(14:1(9Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/15:0):
L-Serine + PC(15:0/15:0) ⟶ Choline + PS(15:0/15:0) - Phosphatidylethanolamine Biosynthesis PE(15:0/16:0):
L-Serine + PC(15:0/16:0) ⟶ Choline + PS(15:0/16:0) - Phosphatidylethanolamine Biosynthesis PE(15:0/16:1(9Z)):
L-Serine + PC(15:0/16:1(9Z)) ⟶ Choline + PS(15:0/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/18:0):
L-Serine + PC(15:0/18:0) ⟶ Choline + PS(15:0/18:0) - Phosphatidylethanolamine Biosynthesis PE(15:0/18:1(11Z)):
L-Serine + PC(15:0/18:1(11Z)) ⟶ Choline + PS(15:0/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/18:1(9Z)):
L-Serine + PC(15:0/18:1(9Z)) ⟶ Choline + PS(15:0/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/18:2(9Z,12Z)):
L-Serine + PC(15:0/18:2(9Z,12Z)) ⟶ Choline + PS(15:0/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/18:3(6Z,9Z,12Z)):
L-Serine + PC(15:0/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(15:0/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/18:3(9Z,12Z,15Z)):
L-Serine + PC(15:0/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(15:0/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(15:0/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(15:0/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:0):
L-Serine + PC(15:0/20:0) ⟶ Choline + PS(15:0/20:0) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:1(11Z)):
L-Serine + PC(15:0/20:1(11Z)) ⟶ Choline + PS(15:0/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:2(11Z,14Z)):
L-Serine + PC(15:0/20:2(11Z,14Z)) ⟶ Choline + PS(15:0/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:3(5Z,8Z,11Z)):
L-Serine + PC(15:0/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(15:0/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:3(8Z,11Z,14Z)):
L-Serine + PC(15:0/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(15:0/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(15:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(15:0/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(15:0/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(15:0/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(15:0/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(15:0/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/22:0):
L-Serine + PC(15:0/22:0) ⟶ Choline + PS(15:0/22:0) - Phosphatidylethanolamine Biosynthesis PE(15:0/22:1(13Z)):
L-Serine + PC(15:0/22:1(13Z)) ⟶ Choline + PS(15:0/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/22:2(13Z,16Z)):
L-Serine + PC(15:0/22:2(13Z,16Z)) ⟶ Choline + PS(15:0/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(15:0/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(15:0/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(15:0/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(15:0/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(15:0/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(15:0/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(15:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(15:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/24:0):
L-Serine + PC(15:0/24:0) ⟶ Choline + PS(15:0/24:0) - Phosphatidylethanolamine Biosynthesis PE(15:0/24:1(15Z)):
L-Serine + PC(15:0/24:1(15Z)) ⟶ Choline + PS(15:0/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/16:0):
L-Serine + PC(16:0/16:0) ⟶ Choline + PS(16:0/16:0) - Phosphatidylethanolamine Biosynthesis PE(16:0/16:1(9Z)):
L-Serine + PC(16:0/16:1(9Z)) ⟶ Choline + PS(16:0/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:0):
L-Serine + PC(16:0/18:0) ⟶ Choline + PS(16:0/18:0) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:1(11Z)):
L-Serine + PC(16:0/18:1(11Z)) ⟶ Choline + PS(16:0/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:1(9Z)):
L-Serine + PC(16:0/18:1(9Z)) ⟶ Choline + PS(16:0/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:2(9Z,12Z)):
L-Serine + PC(16:0/18:2(9Z,12Z)) ⟶ Choline + PS(16:0/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:3(6Z,9Z,12Z)):
L-Serine + PC(16:0/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(16:0/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:3(9Z,12Z,15Z)):
L-Serine + PC(16:0/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(16:0/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(16:0/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(16:0/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:0):
L-Serine + PC(16:0/20:0) ⟶ Choline + PS(16:0/20:0) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:1(11Z)):
L-Serine + PC(16:0/20:1(11Z)) ⟶ Choline + PS(16:0/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:2(11Z,14Z)):
L-Serine + PC(16:0/20:2(11Z,14Z)) ⟶ Choline + PS(16:0/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:3(5Z,8Z,11Z)):
L-Serine + PC(16:0/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(16:0/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:3(8Z,11Z,14Z)):
L-Serine + PC(16:0/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(16:0/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(16:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(16:0/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(16:0/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(16:0/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(16:0/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(16:0/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/22:0):
L-Serine + PC(16:0/22:0) ⟶ Choline + PS(16:0/22:0) - Phosphatidylethanolamine Biosynthesis PE(16:0/22:1(13Z)):
L-Serine + PC(16:0/22:1(13Z)) ⟶ Choline + PS(16:0/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/22:2(13Z,16Z)):
L-Serine + PC(16:0/22:2(13Z,16Z)) ⟶ Choline + PS(16:0/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(16:0/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(16:0/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(16:0/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(16:0/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(16:0/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(16:0/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(16:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(16:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/24:0):
L-Serine + PC(16:0/24:0) ⟶ Choline + PS(16:0/24:0) - Phosphatidylethanolamine Biosynthesis PE(16:0/24:1(15Z)):
L-Serine + PC(16:0/24:1(15Z)) ⟶ Choline + PS(16:0/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/16:1(9Z)):
L-Serine + PC(16:1(9Z)/16:1(9Z)) ⟶ Choline + PS(16:1(9Z)/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/18:0):
L-Serine + PC(16:1(9Z)/18:0) ⟶ Choline + PS(16:1(9Z)/18:0) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/18:1(11Z)):
L-Serine + PC(16:1(9Z)/18:1(11Z)) ⟶ Choline + PS(16:1(9Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/18:1(9Z)):
L-Serine + PC(16:1(9Z)/18:1(9Z)) ⟶ Choline + PS(16:1(9Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/18:2(9Z,12Z)):
L-Serine + PC(16:1(9Z)/18:2(9Z,12Z)) ⟶ Choline + PS(16:1(9Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(16:1(9Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(16:1(9Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(16:1(9Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(16:1(9Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(16:1(9Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(16:1(9Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:0):
L-Serine + PC(16:1(9Z)/20:0) ⟶ Choline + PS(16:1(9Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:1(11Z)):
L-Serine + PC(16:1(9Z)/20:1(11Z)) ⟶ Choline + PS(16:1(9Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:2(11Z,14Z)):
L-Serine + PC(16:1(9Z)/20:2(11Z,14Z)) ⟶ Choline + PS(16:1(9Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(16:1(9Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(16:1(9Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(16:1(9Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(16:1(9Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(16:1(9Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(16:1(9Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(16:1(9Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(16:1(9Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(16:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(16:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/22:0):
L-Serine + PC(16:1(9Z)/22:0) ⟶ Choline + PS(16:1(9Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/22:1(13Z)):
L-Serine + PC(16:1(9Z)/22:1(13Z)) ⟶ Choline + PS(16:1(9Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/22:2(13Z,16Z)):
L-Serine + PC(16:1(9Z)/22:2(13Z,16Z)) ⟶ Choline + PS(16:1(9Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(16:1(9Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(16:1(9Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(16:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(16:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(16:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(16:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(16:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(16:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/24:0):
L-Serine + PC(16:1(9Z)/24:0) ⟶ Choline + PS(16:1(9Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/24:1(15Z)):
L-Serine + PC(16:1(9Z)/24:1(15Z)) ⟶ Choline + PS(16:1(9Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:0):
L-Serine + PC(18:0/18:0) ⟶ Choline + PS(18:0/18:0) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:1(11Z)):
L-Serine + PC(18:0/18:1(11Z)) ⟶ Choline + PS(18:0/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:1(9Z)):
L-Serine + PC(18:0/18:1(9Z)) ⟶ Choline + PS(18:0/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:2(9Z,12Z)):
L-Serine + PC(18:0/18:2(9Z,12Z)) ⟶ Choline + PS(18:0/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:3(6Z,9Z,12Z)):
L-Serine + PC(18:0/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(18:0/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:3(9Z,12Z,15Z)):
L-Serine + PC(18:0/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:0/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(18:0/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(18:0/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:0):
L-Serine + PC(18:0/20:0) ⟶ Choline + PS(18:0/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:1(11Z)):
L-Serine + PC(18:0/20:1(11Z)) ⟶ Choline + PS(18:0/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:2(11Z,14Z)):
L-Serine + PC(18:0/20:2(11Z,14Z)) ⟶ Choline + PS(18:0/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:3(5Z,8Z,11Z)):
L-Serine + PC(18:0/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:0/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:3(8Z,11Z,14Z)):
L-Serine + PC(18:0/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:0/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(18:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:0/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(18:0/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:0/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(18:0/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:0/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/22:0):
L-Serine + PC(18:0/22:0) ⟶ Choline + PS(18:0/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:0/22:1(13Z)):
L-Serine + PC(18:0/22:1(13Z)) ⟶ Choline + PS(18:0/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/22:2(13Z,16Z)):
L-Serine + PC(18:0/22:2(13Z,16Z)) ⟶ Choline + PS(18:0/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(18:0/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:0/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(18:0/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:0/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:0/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:0/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/24:0):
L-Serine + PC(18:0/24:0) ⟶ Choline + PS(18:0/24:0) - Phosphatidylethanolamine Biosynthesis PE(18:0/24:1(15Z)):
L-Serine + PC(18:0/24:1(15Z)) ⟶ Choline + PS(18:0/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/18:1(11Z)):
L-Serine + PC(18:1(11Z)/18:1(11Z)) ⟶ Choline + PS(18:1(11Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/18:1(9Z)):
L-Serine + PC(18:1(11Z)/18:1(9Z)) ⟶ Choline + PS(18:1(11Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/18:2(9Z,12Z)):
L-Serine + PC(18:1(11Z)/18:2(9Z,12Z)) ⟶ Choline + PS(18:1(11Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(18:1(11Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(18:1(11Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(18:1(11Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:1(11Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(18:1(11Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(18:1(11Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:0):
L-Serine + PC(18:1(11Z)/20:0) ⟶ Choline + PS(18:1(11Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:1(11Z)):
L-Serine + PC(18:1(11Z)/20:1(11Z)) ⟶ Choline + PS(18:1(11Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:2(11Z,14Z)):
L-Serine + PC(18:1(11Z)/20:2(11Z,14Z)) ⟶ Choline + PS(18:1(11Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(18:1(11Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:1(11Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(18:1(11Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:1(11Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(18:1(11Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:1(11Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(18:1(11Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:1(11Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(18:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/22:0):
L-Serine + PC(18:1(11Z)/22:0) ⟶ Choline + PS(18:1(11Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/22:1(13Z)):
L-Serine + PC(18:1(11Z)/22:1(13Z)) ⟶ Choline + PS(18:1(11Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/22:2(13Z,16Z)):
L-Serine + PC(18:1(11Z)/22:2(13Z,16Z)) ⟶ Choline + PS(18:1(11Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(18:1(11Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:1(11Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(18:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/24:0):
L-Serine + PC(18:1(11Z)/24:0) ⟶ Choline + PS(18:1(11Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/24:1(15Z)):
L-Serine + PC(18:1(11Z)/24:1(15Z)) ⟶ Choline + PS(18:1(11Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/18:1(9Z)):
L-Serine + PC(18:1(9Z)/18:1(9Z)) ⟶ Choline + PS(18:1(9Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/18:2(9Z,12Z)):
L-Serine + PC(18:1(9Z)/18:2(9Z,12Z)) ⟶ Choline + PS(18:1(9Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(18:1(9Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(18:1(9Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(18:1(9Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:1(9Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(18:1(9Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(18:1(9Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:0):
L-Serine + PC(18:1(9Z)/20:0) ⟶ Choline + PS(18:1(9Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:1(11Z)):
L-Serine + PC(18:1(9Z)/20:1(11Z)) ⟶ Choline + PS(18:1(9Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:2(11Z,14Z)):
L-Serine + PC(18:1(9Z)/20:2(11Z,14Z)) ⟶ Choline + PS(18:1(9Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(18:1(9Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:1(9Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(18:1(9Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:1(9Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(18:1(9Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:1(9Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(18:1(9Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:1(9Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(18:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/22:0):
L-Serine + PC(18:1(9Z)/22:0) ⟶ Choline + PS(18:1(9Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/22:1(13Z)):
L-Serine + PC(18:1(9Z)/22:1(13Z)) ⟶ Choline + PS(18:1(9Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/22:2(13Z,16Z)):
L-Serine + PC(18:1(9Z)/22:2(13Z,16Z)) ⟶ Choline + PS(18:1(9Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(18:1(9Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:1(9Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(18:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/24:0):
L-Serine + PC(18:1(9Z)/24:0) ⟶ Choline + PS(18:1(9Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/24:1(15Z)):
L-Serine + PC(18:1(9Z)/24:1(15Z)) ⟶ Choline + PS(18:1(9Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/18:2(9Z,12Z)):
L-Serine + PC(18:2(9Z,12Z)/18:2(9Z,12Z)) ⟶ Choline + PS(18:2(9Z,12Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(18:2(9Z,12Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(18:2(9Z,12Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:0):
L-Serine + PC(18:2(9Z,12Z)/20:0) ⟶ Choline + PS(18:2(9Z,12Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:1(11Z)):
L-Serine + PC(18:2(9Z,12Z)/20:1(11Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:2(11Z,14Z)):
L-Serine + PC(18:2(9Z,12Z)/20:2(11Z,14Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(18:2(9Z,12Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(18:2(9Z,12Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(18:2(9Z,12Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(18:2(9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/22:0):
L-Serine + PC(18:2(9Z,12Z)/22:0) ⟶ Choline + PS(18:2(9Z,12Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/22:1(13Z)):
L-Serine + PC(18:2(9Z,12Z)/22:1(13Z)) ⟶ Choline + PS(18:2(9Z,12Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/22:2(13Z,16Z)):
L-Serine + PC(18:2(9Z,12Z)/22:2(13Z,16Z)) ⟶ Choline + PS(18:2(9Z,12Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(18:2(9Z,12Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:2(9Z,12Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(18:2(9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:2(9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:2(9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:2(9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/24:0):
L-Serine + PC(18:2(9Z,12Z)/24:0) ⟶ Choline + PS(18:2(9Z,12Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/24:1(15Z)):
L-Serine + PC(18:2(9Z,12Z)/24:1(15Z)) ⟶ Choline + PS(18:2(9Z,12Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:0):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:0) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:1(11Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:1(11Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:2(11Z,14Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:2(11Z,14Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/22:0):
L-Serine + PC(18:3(6Z,9Z,12Z)/22:0) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/22:1(13Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/22:1(13Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/22:2(13Z,16Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/22:2(13Z,16Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/24:0):
L-Serine + PC(18:3(6Z,9Z,12Z)/24:0) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/24:1(15Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/24:1(15Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:0):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:0) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:1(11Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:1(11Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:2(11Z,14Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:2(11Z,14Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/22:0):
L-Serine + PC(18:3(9Z,12Z,15Z)/22:0) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/22:1(13Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/22:1(13Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/22:2(13Z,16Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/22:2(13Z,16Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/24:0):
L-Serine + PC(18:3(9Z,12Z,15Z)/24:0) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/24:1(15Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/24:1(15Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:0):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:0) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:1(11Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:1(11Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:2(11Z,14Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:2(11Z,14Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/22:0):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/22:0) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/22:1(13Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/22:1(13Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/22:2(13Z,16Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/22:2(13Z,16Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/24:0):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/24:0) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/24:1(15Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/24:1(15Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:0):
L-Serine + PC(20:0/20:0) ⟶ Choline + PS(20:0/20:0) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:1(11Z)):
L-Serine + PC(20:0/20:1(11Z)) ⟶ Choline + PS(20:0/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:2(11Z,14Z)):
L-Serine + PC(20:0/20:2(11Z,14Z)) ⟶ Choline + PS(20:0/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:3(5Z,8Z,11Z)):
L-Serine + PC(20:0/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(20:0/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:3(8Z,11Z,14Z)):
L-Serine + PC(20:0/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(20:0/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(20:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:0/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(20:0/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:0/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:0/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:0/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/22:0):
L-Serine + PC(20:0/22:0) ⟶ Choline + PS(20:0/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:0/22:1(13Z)):
L-Serine + PC(20:0/22:1(13Z)) ⟶ Choline + PS(20:0/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/22:2(13Z,16Z)):
L-Serine + PC(20:0/22:2(13Z,16Z)) ⟶ Choline + PS(20:0/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:0/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:0/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:0/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:0/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:0/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:0/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/24:0):
L-Serine + PC(20:0/24:0) ⟶ Choline + PS(20:0/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:0/24:1(15Z)):
L-Serine + PC(20:0/24:1(15Z)) ⟶ Choline + PS(20:0/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/20:1(11Z)):
L-Serine + PC(20:1(11Z)/20:1(11Z)) ⟶ Choline + PS(20:1(11Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/20:2(11Z,14Z)):
L-Serine + PC(20:1(11Z)/20:2(11Z,14Z)) ⟶ Choline + PS(20:1(11Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(20:1(11Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(20:1(11Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(20:1(11Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(20:1(11Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(20:1(11Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:1(11Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(20:1(11Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:1(11Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/22:0):
L-Serine + PC(20:1(11Z)/22:0) ⟶ Choline + PS(20:1(11Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/22:1(13Z)):
L-Serine + PC(20:1(11Z)/22:1(13Z)) ⟶ Choline + PS(20:1(11Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/22:2(13Z,16Z)):
L-Serine + PC(20:1(11Z)/22:2(13Z,16Z)) ⟶ Choline + PS(20:1(11Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:1(11Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:1(11Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/24:0):
L-Serine + PC(20:1(11Z)/24:0) ⟶ Choline + PS(20:1(11Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/24:1(15Z)):
L-Serine + PC(20:1(11Z)/24:1(15Z)) ⟶ Choline + PS(20:1(11Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/20:2(11Z,14Z)):
L-Serine + PC(20:2(11Z,14Z)/20:2(11Z,14Z)) ⟶ Choline + PS(20:2(11Z,14Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(20:2(11Z,14Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(20:2(11Z,14Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(20:2(11Z,14Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(20:2(11Z,14Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(20:2(11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:2(11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(20:2(11Z,14Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:2(11Z,14Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:2(11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:2(11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/22:0):
L-Serine + PC(20:2(11Z,14Z)/22:0) ⟶ Choline + PS(20:2(11Z,14Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/22:1(13Z)):
L-Serine + PC(20:2(11Z,14Z)/22:1(13Z)) ⟶ Choline + PS(20:2(11Z,14Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/22:2(13Z,16Z)):
L-Serine + PC(20:2(11Z,14Z)/22:2(13Z,16Z)) ⟶ Choline + PS(20:2(11Z,14Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:2(11Z,14Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:2(11Z,14Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:2(11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:2(11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:2(11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:2(11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:2(11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:2(11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/24:0):
L-Serine + PC(20:2(11Z,14Z)/24:0) ⟶ Choline + PS(20:2(11Z,14Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/24:1(15Z)):
L-Serine + PC(20:2(11Z,14Z)/24:1(15Z)) ⟶ Choline + PS(20:2(11Z,14Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/22:0):
L-Serine + PC(20:3(5Z,8Z,11Z)/22:0) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/22:1(13Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/22:1(13Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/22:2(13Z,16Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/22:2(13Z,16Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/24:0):
L-Serine + PC(20:3(5Z,8Z,11Z)/24:0) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/24:1(15Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/24:1(15Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/22:0):
L-Serine + PC(20:3(8Z,11Z,14Z)/22:0) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/22:1(13Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/22:1(13Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/22:2(13Z,16Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/22:2(13Z,16Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/24:0):
L-Serine + PC(20:3(8Z,11Z,14Z)/24:0) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/24:1(15Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/24:1(15Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/22:0):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/22:0) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/22:1(13Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/22:1(13Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/22:2(13Z,16Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/22:2(13Z,16Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/24:0):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/24:0) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/24:1(15Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/24:1(15Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/22:0):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/22:0) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/22:1(13Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/22:1(13Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/22:2(13Z,16Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/22:2(13Z,16Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/24:0):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/24:0) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/24:1(15Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/24:1(15Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:0):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:0) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:2(13Z,16Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:2(13Z,16Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/24:0):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/24:0) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/24:1(15Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/24:1(15Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/22:0):
L-Serine + PC(22:0/22:0) ⟶ Choline + PS(22:0/22:0) - Phosphatidylethanolamine Biosynthesis PE(22:0/22:1(13Z)):
L-Serine + PC(22:0/22:1(13Z)) ⟶ Choline + PS(22:0/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/22:2(13Z,16Z)):
L-Serine + PC(22:0/22:2(13Z,16Z)) ⟶ Choline + PS(22:0/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(22:0/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:0/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(22:0/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:0/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:0/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:0/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/24:0):
L-Serine + PC(22:0/24:0) ⟶ Choline + PS(22:0/24:0) - Phosphatidylethanolamine Biosynthesis PE(22:0/24:1(15Z)):
L-Serine + PC(22:0/24:1(15Z)) ⟶ Choline + PS(22:0/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/22:1(13Z)):
L-Serine + PC(22:1(13Z)/22:1(13Z)) ⟶ Choline + PS(22:1(13Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/22:2(13Z,16Z)):
L-Serine + PC(22:1(13Z)/22:2(13Z,16Z)) ⟶ Choline + PS(22:1(13Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(22:1(13Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:1(13Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(22:1(13Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:1(13Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:1(13Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:1(13Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/24:0):
L-Serine + PC(22:1(13Z)/24:0) ⟶ Choline + PS(22:1(13Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/24:1(15Z)):
L-Serine + PC(22:1(13Z)/24:1(15Z)) ⟶ Choline + PS(22:1(13Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/22:2(13Z,16Z)):
L-Serine + PC(22:2(13Z,16Z)/22:2(13Z,16Z)) ⟶ Choline + PS(22:2(13Z,16Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(22:2(13Z,16Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:2(13Z,16Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(22:2(13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:2(13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:2(13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:2(13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/24:0):
L-Serine + PC(22:2(13Z,16Z)/24:0) ⟶ Choline + PS(22:2(13Z,16Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/24:1(15Z)):
L-Serine + PC(22:2(13Z,16Z)/24:1(15Z)) ⟶ Choline + PS(22:2(13Z,16Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/24:0):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/24:0) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/24:1(15Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/24:1(15Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/24:0):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/24:0) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/24:1(15Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/24:1(15Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/24:0):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/24:0) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/24:1(15Z)):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/24:1(15Z)) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:0):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:0) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:1(15Z)):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:1(15Z)) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(24:0/24:0):
L-Serine + PC(24:0/24:0) ⟶ Choline + PS(24:0/24:0) - Phosphatidylethanolamine Biosynthesis PE(24:0/24:1(15Z)):
L-Serine + PC(24:0/24:1(15Z)) ⟶ Choline + PS(24:0/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/24:1(15Z)):
L-Serine + PC(24:1(15Z)/24:1(15Z)) ⟶ Choline + PS(24:1(15Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/16:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine - Phosphatidylethanolamine Biosynthesis PE(16:0/18:0):
CDP-DG(16:0/18:0) + L-Serine ⟶ Cytidine monophosphate + PS(16:0/18:0) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:1(9Z)):
CDP-DG(16:0/18:1(9Z)) + L-Serine ⟶ Cytidine monophosphate + PS(16:0/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:1(11Z)):
CDP-DG(16:0/18:1(11Z)) + L-Serine ⟶ Cytidine monophosphate + PS(16:0/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:2(9Z,12Z)):
CDP-DG(16:0/18:2(9Z,12Z)) + L-Serine ⟶ Cytidine monophosphate + PS(16:0/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:3(6Z,9Z,12Z)):
CDP-DG(16:0/18:3(6Z,9Z,12Z)) + L-Serine ⟶ Cytidine monophosphate + PS(16:0/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:3(9Z,12Z,15Z)):
CDP-DG(16:0/18:3(9Z,12Z,15Z)) + L-Serine ⟶ Cytidine monophosphate + PS(16:0/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:0):
CDP-DG(16:0/20:0) + L-Serine ⟶ Cytidine monophosphate + PS(16:0/20:0) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:1(11Z)):
CDP-DG(16:0/20:1(11Z)) + L-Serine ⟶ Cytidine monophosphate + PS(16:0/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:1(13Z)):
CDP-DG(16:0/20:1(13Z)) + L-Serine ⟶ Cytidine monophosphate + PS(16:0/20:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/22:0):
CDP-DG(16:0/22:0) + L-Serine ⟶ Cytidine monophosphate + PS(16:0/22:0) - Phosphatidylethanolamine Biosynthesis PE(16:0/22:1(13Z)):
CDP-DG(16:0/22:1(13Z)) + L-Serine ⟶ Cytidine monophosphate + PS(16:0/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:0):
CDP-DG(18:0/18:0) + L-Serine ⟶ Cytidine monophosphate + PS(18:0/18:0) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:1(9Z)):
CDP-DG(18:0/18:1(9Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:0/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:1(11Z)):
CDP-DG(18:0/18:1(11Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:0/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:2(9Z,12Z)):
CDP-DG(18:0/18:2(9Z,12Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:0/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:3(6Z,9Z,12Z)):
CDP-DG(18:0/18:3(6Z,9Z,12Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:0/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:3(9Z,12Z,15Z)):
CDP-DG(18:0/18:3(9Z,12Z,15Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:0/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:0):
CDP-DG(18:0/20:0) + L-Serine ⟶ Cytidine monophosphate + PS(18:0/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:1(11Z)):
CDP-DG(18:0/20:1(11Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:0/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:1(13Z)):
CDP-DG(18:0/20:1(13Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:0/20:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/22:0):
CDP-DG(18:0/22:0) + L-Serine ⟶ Cytidine monophosphate + PS(18:0/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:0/22:1(13Z)):
CDP-DG(18:0/22:1(13Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:0/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/18:1(9Z)):
CDP-DG(18:1(9Z)/18:1(9Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:1(9Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/18:1(11Z)):
CDP-DG(18:1(9Z)/18:1(11Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:1(9Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/18:2(9Z,12Z)):
CDP-DG(18:1(9Z)/18:2(9Z,12Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:1(9Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/18:3(6Z,9Z,12Z)):
CDP-DG(18:1(9Z)/18:3(6Z,9Z,12Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:1(9Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/18:3(9Z,12Z,15Z)):
CDP-DG(18:1(9Z)/18:3(9Z,12Z,15Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:1(9Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:0):
CDP-DG(18:1(9Z)/20:0) + L-Serine ⟶ Cytidine monophosphate + PS(18:1(9Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:1(11Z)):
CDP-DG(18:1(9Z)/20:1(11Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:1(9Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:1(13Z)):
CDP-DG(18:1(9Z)/20:1(13Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:1(9Z)/20:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/22:0):
CDP-DG(18:1(9Z)/22:0) + L-Serine ⟶ Cytidine monophosphate + PS(18:1(9Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/22:1(13Z)):
CDP-DG(18:1(9Z)/22:1(13Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:1(9Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/18:1(11Z)):
CDP-DG(18:1(11Z)/18:1(11Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:1(11Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/18:2(9Z,12Z)):
CDP-DG(18:1(11Z)/18:2(9Z,12Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:1(11Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/18:3(6Z,9Z,12Z)):
CDP-DG(18:1(11Z)/18:3(6Z,9Z,12Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:1(11Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/18:3(9Z,12Z,15Z)):
CDP-DG(18:1(11Z)/18:3(9Z,12Z,15Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:1(11Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:0):
CDP-DG(18:1(11Z)/20:0) + L-Serine ⟶ Cytidine monophosphate + PS(18:1(11Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:1(11Z)):
CDP-DG(18:1(11Z)/20:1(11Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:1(11Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:1(13Z)):
CDP-DG(18:1(11Z)/20:1(13Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:1(11Z)/20:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/22:0):
CDP-DG(18:1(11Z)/22:0) + L-Serine ⟶ Cytidine monophosphate + PS(18:1(11Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/22:1(13Z)):
CDP-DG(18:1(11Z)/22:1(13Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:1(11Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/18:2(9Z,12Z)):
CDP-DG(18:2(9Z,12Z)/18:2(9Z,12Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:2(9Z,12Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)):
CDP-DG(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)):
CDP-DG(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:0):
CDP-DG(18:2(9Z,12Z)/20:0) + L-Serine ⟶ Cytidine monophosphate + PS(18:2(9Z,12Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:1(11Z)):
CDP-DG(18:2(9Z,12Z)/20:1(11Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:2(9Z,12Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:1(13Z)):
CDP-DG(18:2(9Z,12Z)/20:1(13Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:2(9Z,12Z)/20:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/22:0):
CDP-DG(18:2(9Z,12Z)/22:0) + L-Serine ⟶ Cytidine monophosphate + PS(18:2(9Z,12Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/22:1(13Z)):
CDP-DG(18:2(9Z,12Z)/22:1(13Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:2(9Z,12Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)):
CDP-DG(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)):
CDP-DG(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:0):
CDP-DG(18:3(6Z,9Z,12Z)/20:0) + L-Serine ⟶ Cytidine monophosphate + PS(18:3(6Z,9Z,12Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:1(11Z)):
CDP-DG(18:3(6Z,9Z,12Z)/20:1(11Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:3(6Z,9Z,12Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:1(13Z)):
CDP-DG(18:3(6Z,9Z,12Z)/20:1(13Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:3(6Z,9Z,12Z)/20:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/22:0):
CDP-DG(18:3(6Z,9Z,12Z)/22:0) + L-Serine ⟶ Cytidine monophosphate + PS(18:3(6Z,9Z,12Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/22:1(13Z)):
CDP-DG(18:3(6Z,9Z,12Z)/22:1(13Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:3(6Z,9Z,12Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)):
CDP-DG(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:0):
CDP-DG(18:3(9Z,12Z,15Z)/20:0) + L-Serine ⟶ Cytidine monophosphate + PS(18:3(9Z,12Z,15Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:1(11Z)):
CDP-DG(18:3(9Z,12Z,15Z)/20:1(11Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:3(9Z,12Z,15Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:1(13Z)):
CDP-DG(18:3(9Z,12Z,15Z)/20:1(13Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:3(9Z,12Z,15Z)/20:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/22:0):
CDP-DG(18:3(9Z,12Z,15Z)/22:0) + L-Serine ⟶ Cytidine monophosphate + PS(18:3(9Z,12Z,15Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/22:1(13Z)):
CDP-DG(18:3(9Z,12Z,15Z)/22:1(13Z)) + L-Serine ⟶ Cytidine monophosphate + PS(18:3(9Z,12Z,15Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:0):
CDP-DG(20:0/20:0) + L-Serine ⟶ Cytidine monophosphate + PS(20:0/20:0) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:1(11Z)):
CDP-DG(20:0/20:1(11Z)) + L-Serine ⟶ Cytidine monophosphate + PS(20:0/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:1(13Z)):
CDP-DG(20:0/20:1(13Z)) + L-Serine ⟶ Cytidine monophosphate + PS(20:0/20:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/22:0):
CDP-DG(20:0/22:0) + L-Serine ⟶ Cytidine monophosphate + PS(20:0/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:0/22:1(13Z)):
CDP-DG(20:0/22:1(13Z)) + L-Serine ⟶ Cytidine monophosphate + PS(20:0/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/20:1(11Z)):
CDP-DG(20:1(11Z)/20:1(11Z)) + L-Serine ⟶ Cytidine monophosphate + PS(20:1(11Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/20:1(13Z)):
CDP-DG(20:1(11Z)/20:1(13Z)) + L-Serine ⟶ Cytidine monophosphate + PS(20:1(11Z)/20:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/22:0):
CDP-DG(20:1(11Z)/22:0) + L-Serine ⟶ Cytidine monophosphate + PS(20:1(11Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/22:1(13Z)):
CDP-DG(20:1(11Z)/22:1(13Z)) + L-Serine ⟶ Cytidine monophosphate + PS(20:1(11Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(13Z)/20:1(13Z)):
CDP-DG(20:1(13Z)/20:1(13Z)) + L-Serine ⟶ Cytidine monophosphate + PS(20:1(13Z)/20:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(13Z)/22:0):
CDP-DG(20:1(13Z)/22:0) + L-Serine ⟶ Cytidine monophosphate + PS(20:1(13Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:1(13Z)/22:1(13Z)):
CDP-DG(20:1(13Z)/22:1(13Z)) + L-Serine ⟶ Cytidine monophosphate + PS(20:1(13Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/22:0):
CDP-DG(22:0/22:0) + L-Serine ⟶ Cytidine monophosphate + PS(22:0/22:0) - Phosphatidylethanolamine Biosynthesis PE(22:0/22:1(13Z)):
CDP-DG(22:0/22:1(13Z)) + L-Serine ⟶ Cytidine monophosphate + PS(22:0/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/22:1(13Z)):
CDP-DG(22:1(13Z)/22:1(13Z)) + L-Serine ⟶ Cytidine monophosphate + PS(22:1(13Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis:
L-Serine + Phosphatidylcholine ⟶ Choline + an L-1-phosphatidylserine - Phosphatidylethanolamine Biosynthesis PE(14:0/14:0):
L-Serine + PC(14:0/14:0) ⟶ Choline + PS(14:0/14:0) - Phosphatidylethanolamine Biosynthesis PE(14:0/14:1(9Z)):
L-Serine + PC(14:0/14:1(9Z)) ⟶ Choline + PS(14:0/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/15:0):
L-Serine + PC(14:0/15:0) ⟶ Choline + PS(14:0/15:0) - Phosphatidylethanolamine Biosynthesis PE(14:0/16:0):
L-Serine + PC(14:0/16:0) ⟶ Choline + PS(14:0/16:0) - Phosphatidylethanolamine Biosynthesis PE(14:0/16:1(9Z)):
L-Serine + PC(14:0/16:1(9Z)) ⟶ Choline + PS(14:0/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/18:0):
L-Serine + PC(14:0/18:0) ⟶ Choline + PS(14:0/18:0) - Phosphatidylethanolamine Biosynthesis PE(14:0/18:1(11Z)):
L-Serine + PC(14:0/18:1(11Z)) ⟶ Choline + PS(14:0/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/18:1(9Z)):
L-Serine + PC(14:0/18:1(9Z)) ⟶ Choline + PS(14:0/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/18:2(9Z,12Z)):
L-Serine + PC(14:0/18:2(9Z,12Z)) ⟶ Choline + PS(14:0/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/18:3(6Z,9Z,12Z)):
L-Serine + PC(14:0/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(14:0/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/18:3(9Z,12Z,15Z)):
L-Serine + PC(14:0/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(14:0/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(14:0/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(14:0/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:0):
L-Serine + PC(14:0/20:0) ⟶ Choline + PS(14:0/20:0) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:1(11Z)):
L-Serine + PC(14:0/20:1(11Z)) ⟶ Choline + PS(14:0/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:2(11Z,14Z)):
L-Serine + PC(14:0/20:2(11Z,14Z)) ⟶ Choline + PS(14:0/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:3(5Z,8Z,11Z)):
L-Serine + PC(14:0/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(14:0/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:3(8Z,11Z,14Z)):
L-Serine + PC(14:0/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(14:0/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(14:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(14:0/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(14:0/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(14:0/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(14:0/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(14:0/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/22:0):
L-Serine + PC(14:0/22:0) ⟶ Choline + PS(14:0/22:0) - Phosphatidylethanolamine Biosynthesis PE(14:0/22:1(13Z)):
L-Serine + PC(14:0/22:1(13Z)) ⟶ Choline + PS(14:0/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/22:2(13Z,16Z)):
L-Serine + PC(14:0/22:2(13Z,16Z)) ⟶ Choline + PS(14:0/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(14:0/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(14:0/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(14:0/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(14:0/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(14:0/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(14:0/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(14:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(14:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/24:0):
L-Serine + PC(14:0/24:0) ⟶ Choline + PS(14:0/24:0) - Phosphatidylethanolamine Biosynthesis PE(14:0/24:1(15Z)):
L-Serine + PC(14:0/24:1(15Z)) ⟶ Choline + PS(14:0/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/14:1(9Z)):
L-Serine + PC(14:1(9Z)/14:1(9Z)) ⟶ Choline + PS(14:1(9Z)/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/15:0):
L-Serine + PC(14:1(9Z)/15:0) ⟶ Choline + PS(14:1(9Z)/15:0) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/16:0):
L-Serine + PC(14:1(9Z)/16:0) ⟶ Choline + PS(14:1(9Z)/16:0) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/16:1(9Z)):
L-Serine + PC(14:1(9Z)/16:1(9Z)) ⟶ Choline + PS(14:1(9Z)/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/18:0):
L-Serine + PC(14:1(9Z)/18:0) ⟶ Choline + PS(14:1(9Z)/18:0) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/18:1(11Z)):
L-Serine + PC(14:1(9Z)/18:1(11Z)) ⟶ Choline + PS(14:1(9Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/18:1(9Z)):
L-Serine + PC(14:1(9Z)/18:1(9Z)) ⟶ Choline + PS(14:1(9Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/18:2(9Z,12Z)):
L-Serine + PC(14:1(9Z)/18:2(9Z,12Z)) ⟶ Choline + PS(14:1(9Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(14:1(9Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(14:1(9Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(14:1(9Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(14:1(9Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:0):
L-Serine + PC(14:1(9Z)/20:0) ⟶ Choline + PS(14:1(9Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:1(11Z)):
L-Serine + PC(14:1(9Z)/20:1(11Z)) ⟶ Choline + PS(14:1(9Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:2(11Z,14Z)):
L-Serine + PC(14:1(9Z)/20:2(11Z,14Z)) ⟶ Choline + PS(14:1(9Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(14:1(9Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(14:1(9Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(14:1(9Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(14:1(9Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(14:1(9Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(14:1(9Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(14:1(9Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(14:1(9Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(14:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(14:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/22:0):
L-Serine + PC(14:1(9Z)/22:0) ⟶ Choline + PS(14:1(9Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/22:1(13Z)):
L-Serine + PC(14:1(9Z)/22:1(13Z)) ⟶ Choline + PS(14:1(9Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/22:2(13Z,16Z)):
L-Serine + PC(14:1(9Z)/22:2(13Z,16Z)) ⟶ Choline + PS(14:1(9Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(14:1(9Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(14:1(9Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(14:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(14:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(14:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(14:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(14:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(14:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/24:0):
L-Serine + PC(14:1(9Z)/24:0) ⟶ Choline + PS(14:1(9Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/24:1(15Z)):
L-Serine + PC(14:1(9Z)/24:1(15Z)) ⟶ Choline + PS(14:1(9Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/15:0):
L-Serine + PC(15:0/15:0) ⟶ Choline + PS(15:0/15:0) - Phosphatidylethanolamine Biosynthesis PE(15:0/16:0):
L-Serine + PC(15:0/16:0) ⟶ Choline + PS(15:0/16:0) - Phosphatidylethanolamine Biosynthesis PE(15:0/16:1(9Z)):
L-Serine + PC(15:0/16:1(9Z)) ⟶ Choline + PS(15:0/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/18:0):
L-Serine + PC(15:0/18:0) ⟶ Choline + PS(15:0/18:0) - Phosphatidylethanolamine Biosynthesis PE(15:0/18:1(11Z)):
L-Serine + PC(15:0/18:1(11Z)) ⟶ Choline + PS(15:0/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/18:1(9Z)):
L-Serine + PC(15:0/18:1(9Z)) ⟶ Choline + PS(15:0/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/18:2(9Z,12Z)):
L-Serine + PC(15:0/18:2(9Z,12Z)) ⟶ Choline + PS(15:0/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/18:3(6Z,9Z,12Z)):
L-Serine + PC(15:0/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(15:0/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/18:3(9Z,12Z,15Z)):
L-Serine + PC(15:0/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(15:0/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(15:0/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(15:0/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:0):
L-Serine + PC(15:0/20:0) ⟶ Choline + PS(15:0/20:0) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:1(11Z)):
L-Serine + PC(15:0/20:1(11Z)) ⟶ Choline + PS(15:0/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:2(11Z,14Z)):
L-Serine + PC(15:0/20:2(11Z,14Z)) ⟶ Choline + PS(15:0/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:3(5Z,8Z,11Z)):
L-Serine + PC(15:0/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(15:0/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:3(8Z,11Z,14Z)):
L-Serine + PC(15:0/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(15:0/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(15:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(15:0/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(15:0/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(15:0/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(15:0/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(15:0/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/22:0):
L-Serine + PC(15:0/22:0) ⟶ Choline + PS(15:0/22:0) - Phosphatidylethanolamine Biosynthesis PE(15:0/22:1(13Z)):
L-Serine + PC(15:0/22:1(13Z)) ⟶ Choline + PS(15:0/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/22:2(13Z,16Z)):
L-Serine + PC(15:0/22:2(13Z,16Z)) ⟶ Choline + PS(15:0/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(15:0/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(15:0/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(15:0/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(15:0/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(15:0/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(15:0/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(15:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(15:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/24:0):
L-Serine + PC(15:0/24:0) ⟶ Choline + PS(15:0/24:0) - Phosphatidylethanolamine Biosynthesis PE(15:0/24:1(15Z)):
L-Serine + PC(15:0/24:1(15Z)) ⟶ Choline + PS(15:0/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/16:0):
L-Serine + PC(16:0/16:0) ⟶ Choline + PS(16:0/16:0) - Phosphatidylethanolamine Biosynthesis PE(16:0/16:1(9Z)):
L-Serine + PC(16:0/16:1(9Z)) ⟶ Choline + PS(16:0/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:0):
L-Serine + PC(16:0/18:0) ⟶ Choline + PS(16:0/18:0) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:1(11Z)):
L-Serine + PC(16:0/18:1(11Z)) ⟶ Choline + PS(16:0/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:1(9Z)):
L-Serine + PC(16:0/18:1(9Z)) ⟶ Choline + PS(16:0/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:2(9Z,12Z)):
L-Serine + PC(16:0/18:2(9Z,12Z)) ⟶ Choline + PS(16:0/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:3(6Z,9Z,12Z)):
L-Serine + PC(16:0/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(16:0/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:3(9Z,12Z,15Z)):
L-Serine + PC(16:0/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(16:0/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(16:0/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(16:0/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:0):
L-Serine + PC(16:0/20:0) ⟶ Choline + PS(16:0/20:0) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:1(11Z)):
L-Serine + PC(16:0/20:1(11Z)) ⟶ Choline + PS(16:0/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:2(11Z,14Z)):
L-Serine + PC(16:0/20:2(11Z,14Z)) ⟶ Choline + PS(16:0/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:3(5Z,8Z,11Z)):
L-Serine + PC(16:0/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(16:0/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:3(8Z,11Z,14Z)):
L-Serine + PC(16:0/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(16:0/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(16:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(16:0/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(16:0/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(16:0/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(16:0/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(16:0/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/22:0):
L-Serine + PC(16:0/22:0) ⟶ Choline + PS(16:0/22:0) - Phosphatidylethanolamine Biosynthesis PE(16:0/22:1(13Z)):
L-Serine + PC(16:0/22:1(13Z)) ⟶ Choline + PS(16:0/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/22:2(13Z,16Z)):
L-Serine + PC(16:0/22:2(13Z,16Z)) ⟶ Choline + PS(16:0/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(16:0/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(16:0/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(16:0/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(16:0/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(16:0/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(16:0/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(16:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(16:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/24:0):
L-Serine + PC(16:0/24:0) ⟶ Choline + PS(16:0/24:0) - Phosphatidylethanolamine Biosynthesis PE(16:0/24:1(15Z)):
L-Serine + PC(16:0/24:1(15Z)) ⟶ Choline + PS(16:0/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/16:1(9Z)):
L-Serine + PC(16:1(9Z)/16:1(9Z)) ⟶ Choline + PS(16:1(9Z)/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/18:0):
L-Serine + PC(16:1(9Z)/18:0) ⟶ Choline + PS(16:1(9Z)/18:0) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/18:1(11Z)):
L-Serine + PC(16:1(9Z)/18:1(11Z)) ⟶ Choline + PS(16:1(9Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/18:1(9Z)):
L-Serine + PC(16:1(9Z)/18:1(9Z)) ⟶ Choline + PS(16:1(9Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/18:2(9Z,12Z)):
L-Serine + PC(16:1(9Z)/18:2(9Z,12Z)) ⟶ Choline + PS(16:1(9Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(16:1(9Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(16:1(9Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(16:1(9Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(16:1(9Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(16:1(9Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(16:1(9Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:0):
L-Serine + PC(16:1(9Z)/20:0) ⟶ Choline + PS(16:1(9Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:1(11Z)):
L-Serine + PC(16:1(9Z)/20:1(11Z)) ⟶ Choline + PS(16:1(9Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:2(11Z,14Z)):
L-Serine + PC(16:1(9Z)/20:2(11Z,14Z)) ⟶ Choline + PS(16:1(9Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(16:1(9Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(16:1(9Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(16:1(9Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(16:1(9Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(16:1(9Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(16:1(9Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(16:1(9Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(16:1(9Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(16:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(16:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/22:0):
L-Serine + PC(16:1(9Z)/22:0) ⟶ Choline + PS(16:1(9Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/22:1(13Z)):
L-Serine + PC(16:1(9Z)/22:1(13Z)) ⟶ Choline + PS(16:1(9Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/22:2(13Z,16Z)):
L-Serine + PC(16:1(9Z)/22:2(13Z,16Z)) ⟶ Choline + PS(16:1(9Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(16:1(9Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(16:1(9Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(16:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(16:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(16:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(16:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(16:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(16:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/24:0):
L-Serine + PC(16:1(9Z)/24:0) ⟶ Choline + PS(16:1(9Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/24:1(15Z)):
L-Serine + PC(16:1(9Z)/24:1(15Z)) ⟶ Choline + PS(16:1(9Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:0):
L-Serine + PC(18:0/18:0) ⟶ Choline + PS(18:0/18:0) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:1(11Z)):
L-Serine + PC(18:0/18:1(11Z)) ⟶ Choline + PS(18:0/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:1(9Z)):
L-Serine + PC(18:0/18:1(9Z)) ⟶ Choline + PS(18:0/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:2(9Z,12Z)):
L-Serine + PC(18:0/18:2(9Z,12Z)) ⟶ Choline + PS(18:0/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:3(6Z,9Z,12Z)):
L-Serine + PC(18:0/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(18:0/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:3(9Z,12Z,15Z)):
L-Serine + PC(18:0/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:0/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(18:0/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(18:0/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:0):
L-Serine + PC(18:0/20:0) ⟶ Choline + PS(18:0/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:1(11Z)):
L-Serine + PC(18:0/20:1(11Z)) ⟶ Choline + PS(18:0/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:2(11Z,14Z)):
L-Serine + PC(18:0/20:2(11Z,14Z)) ⟶ Choline + PS(18:0/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:3(5Z,8Z,11Z)):
L-Serine + PC(18:0/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:0/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:3(8Z,11Z,14Z)):
L-Serine + PC(18:0/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:0/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(18:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:0/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(18:0/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:0/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(18:0/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:0/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/22:0):
L-Serine + PC(18:0/22:0) ⟶ Choline + PS(18:0/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:0/22:1(13Z)):
L-Serine + PC(18:0/22:1(13Z)) ⟶ Choline + PS(18:0/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/22:2(13Z,16Z)):
L-Serine + PC(18:0/22:2(13Z,16Z)) ⟶ Choline + PS(18:0/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(18:0/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:0/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(18:0/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:0/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:0/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:0/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/24:0):
L-Serine + PC(18:0/24:0) ⟶ Choline + PS(18:0/24:0) - Phosphatidylethanolamine Biosynthesis PE(18:0/24:1(15Z)):
L-Serine + PC(18:0/24:1(15Z)) ⟶ Choline + PS(18:0/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/18:1(11Z)):
L-Serine + PC(18:1(11Z)/18:1(11Z)) ⟶ Choline + PS(18:1(11Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/18:1(9Z)):
L-Serine + PC(18:1(11Z)/18:1(9Z)) ⟶ Choline + PS(18:1(11Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/18:2(9Z,12Z)):
L-Serine + PC(18:1(11Z)/18:2(9Z,12Z)) ⟶ Choline + PS(18:1(11Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(18:1(11Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(18:1(11Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(18:1(11Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:1(11Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(18:1(11Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(18:1(11Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:0):
L-Serine + PC(18:1(11Z)/20:0) ⟶ Choline + PS(18:1(11Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:1(11Z)):
L-Serine + PC(18:1(11Z)/20:1(11Z)) ⟶ Choline + PS(18:1(11Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:2(11Z,14Z)):
L-Serine + PC(18:1(11Z)/20:2(11Z,14Z)) ⟶ Choline + PS(18:1(11Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(18:1(11Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:1(11Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(18:1(11Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:1(11Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(18:1(11Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:1(11Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(18:1(11Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:1(11Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(18:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/22:0):
L-Serine + PC(18:1(11Z)/22:0) ⟶ Choline + PS(18:1(11Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/22:1(13Z)):
L-Serine + PC(18:1(11Z)/22:1(13Z)) ⟶ Choline + PS(18:1(11Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/22:2(13Z,16Z)):
L-Serine + PC(18:1(11Z)/22:2(13Z,16Z)) ⟶ Choline + PS(18:1(11Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(18:1(11Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:1(11Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(18:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/24:0):
L-Serine + PC(18:1(11Z)/24:0) ⟶ Choline + PS(18:1(11Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/24:1(15Z)):
L-Serine + PC(18:1(11Z)/24:1(15Z)) ⟶ Choline + PS(18:1(11Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/18:1(9Z)):
L-Serine + PC(18:1(9Z)/18:1(9Z)) ⟶ Choline + PS(18:1(9Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/18:2(9Z,12Z)):
L-Serine + PC(18:1(9Z)/18:2(9Z,12Z)) ⟶ Choline + PS(18:1(9Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(18:1(9Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(18:1(9Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(18:1(9Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:1(9Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(18:1(9Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(18:1(9Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:0):
L-Serine + PC(18:1(9Z)/20:0) ⟶ Choline + PS(18:1(9Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:1(11Z)):
L-Serine + PC(18:1(9Z)/20:1(11Z)) ⟶ Choline + PS(18:1(9Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:2(11Z,14Z)):
L-Serine + PC(18:1(9Z)/20:2(11Z,14Z)) ⟶ Choline + PS(18:1(9Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(18:1(9Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:1(9Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(18:1(9Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:1(9Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(18:1(9Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:1(9Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(18:1(9Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:1(9Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(18:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/22:0):
L-Serine + PC(18:1(9Z)/22:0) ⟶ Choline + PS(18:1(9Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/22:1(13Z)):
L-Serine + PC(18:1(9Z)/22:1(13Z)) ⟶ Choline + PS(18:1(9Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/22:2(13Z,16Z)):
L-Serine + PC(18:1(9Z)/22:2(13Z,16Z)) ⟶ Choline + PS(18:1(9Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(18:1(9Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:1(9Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(18:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/24:0):
L-Serine + PC(18:1(9Z)/24:0) ⟶ Choline + PS(18:1(9Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/24:1(15Z)):
L-Serine + PC(18:1(9Z)/24:1(15Z)) ⟶ Choline + PS(18:1(9Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/18:2(9Z,12Z)):
L-Serine + PC(18:2(9Z,12Z)/18:2(9Z,12Z)) ⟶ Choline + PS(18:2(9Z,12Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(18:2(9Z,12Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(18:2(9Z,12Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:0):
L-Serine + PC(18:2(9Z,12Z)/20:0) ⟶ Choline + PS(18:2(9Z,12Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:1(11Z)):
L-Serine + PC(18:2(9Z,12Z)/20:1(11Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:2(11Z,14Z)):
L-Serine + PC(18:2(9Z,12Z)/20:2(11Z,14Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(18:2(9Z,12Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(18:2(9Z,12Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(18:2(9Z,12Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(18:2(9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/22:0):
L-Serine + PC(18:2(9Z,12Z)/22:0) ⟶ Choline + PS(18:2(9Z,12Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/22:1(13Z)):
L-Serine + PC(18:2(9Z,12Z)/22:1(13Z)) ⟶ Choline + PS(18:2(9Z,12Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/22:2(13Z,16Z)):
L-Serine + PC(18:2(9Z,12Z)/22:2(13Z,16Z)) ⟶ Choline + PS(18:2(9Z,12Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(18:2(9Z,12Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:2(9Z,12Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(18:2(9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:2(9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:2(9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:2(9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/24:0):
L-Serine + PC(18:2(9Z,12Z)/24:0) ⟶ Choline + PS(18:2(9Z,12Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/24:1(15Z)):
L-Serine + PC(18:2(9Z,12Z)/24:1(15Z)) ⟶ Choline + PS(18:2(9Z,12Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:0):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:0) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:1(11Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:1(11Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:2(11Z,14Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:2(11Z,14Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/22:0):
L-Serine + PC(18:3(6Z,9Z,12Z)/22:0) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/22:1(13Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/22:1(13Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/22:2(13Z,16Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/22:2(13Z,16Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/24:0):
L-Serine + PC(18:3(6Z,9Z,12Z)/24:0) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/24:1(15Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/24:1(15Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:0):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:0) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:1(11Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:1(11Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:2(11Z,14Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:2(11Z,14Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/22:0):
L-Serine + PC(18:3(9Z,12Z,15Z)/22:0) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/22:1(13Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/22:1(13Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/22:2(13Z,16Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/22:2(13Z,16Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/24:0):
L-Serine + PC(18:3(9Z,12Z,15Z)/24:0) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/24:1(15Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/24:1(15Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:0):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:0) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:1(11Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:1(11Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:2(11Z,14Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:2(11Z,14Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/22:0):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/22:0) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/22:1(13Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/22:1(13Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/22:2(13Z,16Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/22:2(13Z,16Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/24:0):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/24:0) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/24:1(15Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/24:1(15Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:0):
L-Serine + PC(20:0/20:0) ⟶ Choline + PS(20:0/20:0) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:1(11Z)):
L-Serine + PC(20:0/20:1(11Z)) ⟶ Choline + PS(20:0/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:2(11Z,14Z)):
L-Serine + PC(20:0/20:2(11Z,14Z)) ⟶ Choline + PS(20:0/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:3(5Z,8Z,11Z)):
L-Serine + PC(20:0/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(20:0/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:3(8Z,11Z,14Z)):
L-Serine + PC(20:0/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(20:0/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(20:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:0/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(20:0/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:0/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:0/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:0/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/22:0):
L-Serine + PC(20:0/22:0) ⟶ Choline + PS(20:0/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:0/22:1(13Z)):
L-Serine + PC(20:0/22:1(13Z)) ⟶ Choline + PS(20:0/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/22:2(13Z,16Z)):
L-Serine + PC(20:0/22:2(13Z,16Z)) ⟶ Choline + PS(20:0/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:0/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:0/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:0/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:0/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:0/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:0/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/24:0):
L-Serine + PC(20:0/24:0) ⟶ Choline + PS(20:0/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:0/24:1(15Z)):
L-Serine + PC(20:0/24:1(15Z)) ⟶ Choline + PS(20:0/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/20:1(11Z)):
L-Serine + PC(20:1(11Z)/20:1(11Z)) ⟶ Choline + PS(20:1(11Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/20:2(11Z,14Z)):
L-Serine + PC(20:1(11Z)/20:2(11Z,14Z)) ⟶ Choline + PS(20:1(11Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(20:1(11Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(20:1(11Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(20:1(11Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(20:1(11Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(20:1(11Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:1(11Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(20:1(11Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:1(11Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/22:0):
L-Serine + PC(20:1(11Z)/22:0) ⟶ Choline + PS(20:1(11Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/22:1(13Z)):
L-Serine + PC(20:1(11Z)/22:1(13Z)) ⟶ Choline + PS(20:1(11Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/22:2(13Z,16Z)):
L-Serine + PC(20:1(11Z)/22:2(13Z,16Z)) ⟶ Choline + PS(20:1(11Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:1(11Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:1(11Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/24:0):
L-Serine + PC(20:1(11Z)/24:0) ⟶ Choline + PS(20:1(11Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/24:1(15Z)):
L-Serine + PC(20:1(11Z)/24:1(15Z)) ⟶ Choline + PS(20:1(11Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/20:2(11Z,14Z)):
L-Serine + PC(20:2(11Z,14Z)/20:2(11Z,14Z)) ⟶ Choline + PS(20:2(11Z,14Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(20:2(11Z,14Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(20:2(11Z,14Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(20:2(11Z,14Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(20:2(11Z,14Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(20:2(11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:2(11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(20:2(11Z,14Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:2(11Z,14Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:2(11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:2(11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/22:0):
L-Serine + PC(20:2(11Z,14Z)/22:0) ⟶ Choline + PS(20:2(11Z,14Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/22:1(13Z)):
L-Serine + PC(20:2(11Z,14Z)/22:1(13Z)) ⟶ Choline + PS(20:2(11Z,14Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/22:2(13Z,16Z)):
L-Serine + PC(20:2(11Z,14Z)/22:2(13Z,16Z)) ⟶ Choline + PS(20:2(11Z,14Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:2(11Z,14Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:2(11Z,14Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:2(11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:2(11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:2(11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:2(11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:2(11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:2(11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/24:0):
L-Serine + PC(20:2(11Z,14Z)/24:0) ⟶ Choline + PS(20:2(11Z,14Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/24:1(15Z)):
L-Serine + PC(20:2(11Z,14Z)/24:1(15Z)) ⟶ Choline + PS(20:2(11Z,14Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/22:0):
L-Serine + PC(20:3(5Z,8Z,11Z)/22:0) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/22:1(13Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/22:1(13Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/22:2(13Z,16Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/22:2(13Z,16Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/24:0):
L-Serine + PC(20:3(5Z,8Z,11Z)/24:0) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/24:1(15Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/24:1(15Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/22:0):
L-Serine + PC(20:3(8Z,11Z,14Z)/22:0) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/22:1(13Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/22:1(13Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/22:2(13Z,16Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/22:2(13Z,16Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/24:0):
L-Serine + PC(20:3(8Z,11Z,14Z)/24:0) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/24:1(15Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/24:1(15Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/22:0):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/22:0) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/22:1(13Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/22:1(13Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/22:2(13Z,16Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/22:2(13Z,16Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/24:0):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/24:0) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/24:1(15Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/24:1(15Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/22:0):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/22:0) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/22:1(13Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/22:1(13Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/22:2(13Z,16Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/22:2(13Z,16Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/24:0):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/24:0) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/24:1(15Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/24:1(15Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:0):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:0) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:2(13Z,16Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:2(13Z,16Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/24:0):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/24:0) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/24:1(15Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/24:1(15Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/22:0):
L-Serine + PC(22:0/22:0) ⟶ Choline + PS(22:0/22:0) - Phosphatidylethanolamine Biosynthesis PE(22:0/22:1(13Z)):
L-Serine + PC(22:0/22:1(13Z)) ⟶ Choline + PS(22:0/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/22:2(13Z,16Z)):
L-Serine + PC(22:0/22:2(13Z,16Z)) ⟶ Choline + PS(22:0/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(22:0/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:0/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(22:0/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:0/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:0/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:0/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/24:0):
L-Serine + PC(22:0/24:0) ⟶ Choline + PS(22:0/24:0) - Phosphatidylethanolamine Biosynthesis PE(22:0/24:1(15Z)):
L-Serine + PC(22:0/24:1(15Z)) ⟶ Choline + PS(22:0/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/22:1(13Z)):
L-Serine + PC(22:1(13Z)/22:1(13Z)) ⟶ Choline + PS(22:1(13Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/22:2(13Z,16Z)):
L-Serine + PC(22:1(13Z)/22:2(13Z,16Z)) ⟶ Choline + PS(22:1(13Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(22:1(13Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:1(13Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(22:1(13Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:1(13Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:1(13Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:1(13Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/24:0):
L-Serine + PC(22:1(13Z)/24:0) ⟶ Choline + PS(22:1(13Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/24:1(15Z)):
L-Serine + PC(22:1(13Z)/24:1(15Z)) ⟶ Choline + PS(22:1(13Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/22:2(13Z,16Z)):
L-Serine + PC(22:2(13Z,16Z)/22:2(13Z,16Z)) ⟶ Choline + PS(22:2(13Z,16Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(22:2(13Z,16Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:2(13Z,16Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(22:2(13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:2(13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:2(13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:2(13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/24:0):
L-Serine + PC(22:2(13Z,16Z)/24:0) ⟶ Choline + PS(22:2(13Z,16Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/24:1(15Z)):
L-Serine + PC(22:2(13Z,16Z)/24:1(15Z)) ⟶ Choline + PS(22:2(13Z,16Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/24:0):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/24:0) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/24:1(15Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/24:1(15Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/24:0):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/24:0) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/24:1(15Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/24:1(15Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/24:0):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/24:0) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/24:1(15Z)):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/24:1(15Z)) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:0):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:0) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:1(15Z)):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:1(15Z)) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(24:0/24:0):
L-Serine + PC(24:0/24:0) ⟶ Choline + PS(24:0/24:0) - Phosphatidylethanolamine Biosynthesis PE(24:0/24:1(15Z)):
L-Serine + PC(24:0/24:1(15Z)) ⟶ Choline + PS(24:0/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/24:1(15Z)):
L-Serine + PC(24:1(15Z)/24:1(15Z)) ⟶ Choline + PS(24:1(15Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis:
L-Serine + Phosphatidylcholine ⟶ Choline + an L-1-phosphatidylserine - Phosphatidylethanolamine Biosynthesis PE(14:0/14:0):
L-Serine + PC(14:0/14:0) ⟶ Choline + PS(14:0/14:0) - Phosphatidylethanolamine Biosynthesis PE(14:0/14:1(9Z)):
L-Serine + PC(14:0/14:1(9Z)) ⟶ Choline + PS(14:0/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/15:0):
L-Serine + PC(14:0/15:0) ⟶ Choline + PS(14:0/15:0) - Phosphatidylethanolamine Biosynthesis PE(14:0/16:0):
L-Serine + PC(14:0/16:0) ⟶ Choline + PS(14:0/16:0) - Phosphatidylethanolamine Biosynthesis PE(14:0/16:1(9Z)):
L-Serine + PC(14:0/16:1(9Z)) ⟶ Choline + PS(14:0/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/18:0):
L-Serine + PC(14:0/18:0) ⟶ Choline + PS(14:0/18:0) - Phosphatidylethanolamine Biosynthesis PE(14:0/18:1(11Z)):
L-Serine + PC(14:0/18:1(11Z)) ⟶ Choline + PS(14:0/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/18:1(9Z)):
L-Serine + PC(14:0/18:1(9Z)) ⟶ Choline + PS(14:0/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/18:2(9Z,12Z)):
L-Serine + PC(14:0/18:2(9Z,12Z)) ⟶ Choline + PS(14:0/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/18:3(6Z,9Z,12Z)):
L-Serine + PC(14:0/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(14:0/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/18:3(9Z,12Z,15Z)):
L-Serine + PC(14:0/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(14:0/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(14:0/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(14:0/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:0):
L-Serine + PC(14:0/20:0) ⟶ Choline + PS(14:0/20:0) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:1(11Z)):
L-Serine + PC(14:0/20:1(11Z)) ⟶ Choline + PS(14:0/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:2(11Z,14Z)):
L-Serine + PC(14:0/20:2(11Z,14Z)) ⟶ Choline + PS(14:0/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:3(5Z,8Z,11Z)):
L-Serine + PC(14:0/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(14:0/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:3(8Z,11Z,14Z)):
L-Serine + PC(14:0/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(14:0/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(14:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(14:0/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(14:0/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(14:0/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(14:0/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(14:0/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/22:0):
L-Serine + PC(14:0/22:0) ⟶ Choline + PS(14:0/22:0) - Phosphatidylethanolamine Biosynthesis PE(14:0/22:1(13Z)):
L-Serine + PC(14:0/22:1(13Z)) ⟶ Choline + PS(14:0/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/22:2(13Z,16Z)):
L-Serine + PC(14:0/22:2(13Z,16Z)) ⟶ Choline + PS(14:0/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(14:0/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(14:0/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(14:0/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(14:0/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(14:0/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(14:0/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(14:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(14:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(14:0/24:0):
L-Serine + PC(14:0/24:0) ⟶ Choline + PS(14:0/24:0) - Phosphatidylethanolamine Biosynthesis PE(14:0/24:1(15Z)):
L-Serine + PC(14:0/24:1(15Z)) ⟶ Choline + PS(14:0/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/14:1(9Z)):
L-Serine + PC(14:1(9Z)/14:1(9Z)) ⟶ Choline + PS(14:1(9Z)/14:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/15:0):
L-Serine + PC(14:1(9Z)/15:0) ⟶ Choline + PS(14:1(9Z)/15:0) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/16:0):
L-Serine + PC(14:1(9Z)/16:0) ⟶ Choline + PS(14:1(9Z)/16:0) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/16:1(9Z)):
L-Serine + PC(14:1(9Z)/16:1(9Z)) ⟶ Choline + PS(14:1(9Z)/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/18:0):
L-Serine + PC(14:1(9Z)/18:0) ⟶ Choline + PS(14:1(9Z)/18:0) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/18:1(11Z)):
L-Serine + PC(14:1(9Z)/18:1(11Z)) ⟶ Choline + PS(14:1(9Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/18:1(9Z)):
L-Serine + PC(14:1(9Z)/18:1(9Z)) ⟶ Choline + PS(14:1(9Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/18:2(9Z,12Z)):
L-Serine + PC(14:1(9Z)/18:2(9Z,12Z)) ⟶ Choline + PS(14:1(9Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(14:1(9Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(14:1(9Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(14:1(9Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(14:1(9Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:0):
L-Serine + PC(14:1(9Z)/20:0) ⟶ Choline + PS(14:1(9Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:1(11Z)):
L-Serine + PC(14:1(9Z)/20:1(11Z)) ⟶ Choline + PS(14:1(9Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:2(11Z,14Z)):
L-Serine + PC(14:1(9Z)/20:2(11Z,14Z)) ⟶ Choline + PS(14:1(9Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(14:1(9Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(14:1(9Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(14:1(9Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(14:1(9Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(14:1(9Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(14:1(9Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(14:1(9Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(14:1(9Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(14:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(14:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/22:0):
L-Serine + PC(14:1(9Z)/22:0) ⟶ Choline + PS(14:1(9Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/22:1(13Z)):
L-Serine + PC(14:1(9Z)/22:1(13Z)) ⟶ Choline + PS(14:1(9Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/22:2(13Z,16Z)):
L-Serine + PC(14:1(9Z)/22:2(13Z,16Z)) ⟶ Choline + PS(14:1(9Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(14:1(9Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(14:1(9Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(14:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(14:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(14:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(14:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(14:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(14:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/24:0):
L-Serine + PC(14:1(9Z)/24:0) ⟶ Choline + PS(14:1(9Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(14:1(9Z)/24:1(15Z)):
L-Serine + PC(14:1(9Z)/24:1(15Z)) ⟶ Choline + PS(14:1(9Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/15:0):
L-Serine + PC(15:0/15:0) ⟶ Choline + PS(15:0/15:0) - Phosphatidylethanolamine Biosynthesis PE(15:0/16:0):
L-Serine + PC(15:0/16:0) ⟶ Choline + PS(15:0/16:0) - Phosphatidylethanolamine Biosynthesis PE(15:0/16:1(9Z)):
L-Serine + PC(15:0/16:1(9Z)) ⟶ Choline + PS(15:0/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/18:0):
L-Serine + PC(15:0/18:0) ⟶ Choline + PS(15:0/18:0) - Phosphatidylethanolamine Biosynthesis PE(15:0/18:1(11Z)):
L-Serine + PC(15:0/18:1(11Z)) ⟶ Choline + PS(15:0/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/18:1(9Z)):
L-Serine + PC(15:0/18:1(9Z)) ⟶ Choline + PS(15:0/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/18:2(9Z,12Z)):
L-Serine + PC(15:0/18:2(9Z,12Z)) ⟶ Choline + PS(15:0/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/18:3(6Z,9Z,12Z)):
L-Serine + PC(15:0/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(15:0/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/18:3(9Z,12Z,15Z)):
L-Serine + PC(15:0/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(15:0/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(15:0/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(15:0/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:0):
L-Serine + PC(15:0/20:0) ⟶ Choline + PS(15:0/20:0) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:1(11Z)):
L-Serine + PC(15:0/20:1(11Z)) ⟶ Choline + PS(15:0/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:2(11Z,14Z)):
L-Serine + PC(15:0/20:2(11Z,14Z)) ⟶ Choline + PS(15:0/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:3(5Z,8Z,11Z)):
L-Serine + PC(15:0/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(15:0/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:3(8Z,11Z,14Z)):
L-Serine + PC(15:0/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(15:0/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(15:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(15:0/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(15:0/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(15:0/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(15:0/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(15:0/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/22:0):
L-Serine + PC(15:0/22:0) ⟶ Choline + PS(15:0/22:0) - Phosphatidylethanolamine Biosynthesis PE(15:0/22:1(13Z)):
L-Serine + PC(15:0/22:1(13Z)) ⟶ Choline + PS(15:0/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/22:2(13Z,16Z)):
L-Serine + PC(15:0/22:2(13Z,16Z)) ⟶ Choline + PS(15:0/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(15:0/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(15:0/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(15:0/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(15:0/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(15:0/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(15:0/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(15:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(15:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(15:0/24:0):
L-Serine + PC(15:0/24:0) ⟶ Choline + PS(15:0/24:0) - Phosphatidylethanolamine Biosynthesis PE(15:0/24:1(15Z)):
L-Serine + PC(15:0/24:1(15Z)) ⟶ Choline + PS(15:0/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/16:0):
L-Serine + PC(16:0/16:0) ⟶ Choline + PS(16:0/16:0) - Phosphatidylethanolamine Biosynthesis PE(16:0/16:1(9Z)):
L-Serine + PC(16:0/16:1(9Z)) ⟶ Choline + PS(16:0/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:0):
L-Serine + PC(16:0/18:0) ⟶ Choline + PS(16:0/18:0) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:1(11Z)):
L-Serine + PC(16:0/18:1(11Z)) ⟶ Choline + PS(16:0/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:1(9Z)):
L-Serine + PC(16:0/18:1(9Z)) ⟶ Choline + PS(16:0/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:2(9Z,12Z)):
L-Serine + PC(16:0/18:2(9Z,12Z)) ⟶ Choline + PS(16:0/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:3(6Z,9Z,12Z)):
L-Serine + PC(16:0/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(16:0/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:3(9Z,12Z,15Z)):
L-Serine + PC(16:0/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(16:0/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(16:0/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(16:0/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:0):
L-Serine + PC(16:0/20:0) ⟶ Choline + PS(16:0/20:0) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:1(11Z)):
L-Serine + PC(16:0/20:1(11Z)) ⟶ Choline + PS(16:0/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:2(11Z,14Z)):
L-Serine + PC(16:0/20:2(11Z,14Z)) ⟶ Choline + PS(16:0/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:3(5Z,8Z,11Z)):
L-Serine + PC(16:0/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(16:0/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:3(8Z,11Z,14Z)):
L-Serine + PC(16:0/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(16:0/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(16:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(16:0/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(16:0/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(16:0/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(16:0/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(16:0/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/22:0):
L-Serine + PC(16:0/22:0) ⟶ Choline + PS(16:0/22:0) - Phosphatidylethanolamine Biosynthesis PE(16:0/22:1(13Z)):
L-Serine + PC(16:0/22:1(13Z)) ⟶ Choline + PS(16:0/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/22:2(13Z,16Z)):
L-Serine + PC(16:0/22:2(13Z,16Z)) ⟶ Choline + PS(16:0/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(16:0/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(16:0/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(16:0/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(16:0/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(16:0/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(16:0/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(16:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(16:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(16:0/24:0):
L-Serine + PC(16:0/24:0) ⟶ Choline + PS(16:0/24:0) - Phosphatidylethanolamine Biosynthesis PE(16:0/24:1(15Z)):
L-Serine + PC(16:0/24:1(15Z)) ⟶ Choline + PS(16:0/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/16:1(9Z)):
L-Serine + PC(16:1(9Z)/16:1(9Z)) ⟶ Choline + PS(16:1(9Z)/16:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/18:0):
L-Serine + PC(16:1(9Z)/18:0) ⟶ Choline + PS(16:1(9Z)/18:0) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/18:1(11Z)):
L-Serine + PC(16:1(9Z)/18:1(11Z)) ⟶ Choline + PS(16:1(9Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/18:1(9Z)):
L-Serine + PC(16:1(9Z)/18:1(9Z)) ⟶ Choline + PS(16:1(9Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/18:2(9Z,12Z)):
L-Serine + PC(16:1(9Z)/18:2(9Z,12Z)) ⟶ Choline + PS(16:1(9Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(16:1(9Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(16:1(9Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(16:1(9Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(16:1(9Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(16:1(9Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(16:1(9Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:0):
L-Serine + PC(16:1(9Z)/20:0) ⟶ Choline + PS(16:1(9Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:1(11Z)):
L-Serine + PC(16:1(9Z)/20:1(11Z)) ⟶ Choline + PS(16:1(9Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:2(11Z,14Z)):
L-Serine + PC(16:1(9Z)/20:2(11Z,14Z)) ⟶ Choline + PS(16:1(9Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(16:1(9Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(16:1(9Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(16:1(9Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(16:1(9Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(16:1(9Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(16:1(9Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(16:1(9Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(16:1(9Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(16:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(16:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/22:0):
L-Serine + PC(16:1(9Z)/22:0) ⟶ Choline + PS(16:1(9Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/22:1(13Z)):
L-Serine + PC(16:1(9Z)/22:1(13Z)) ⟶ Choline + PS(16:1(9Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/22:2(13Z,16Z)):
L-Serine + PC(16:1(9Z)/22:2(13Z,16Z)) ⟶ Choline + PS(16:1(9Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(16:1(9Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(16:1(9Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(16:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(16:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(16:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(16:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(16:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(16:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/24:0):
L-Serine + PC(16:1(9Z)/24:0) ⟶ Choline + PS(16:1(9Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(16:1(9Z)/24:1(15Z)):
L-Serine + PC(16:1(9Z)/24:1(15Z)) ⟶ Choline + PS(16:1(9Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:0):
L-Serine + PC(18:0/18:0) ⟶ Choline + PS(18:0/18:0) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:1(11Z)):
L-Serine + PC(18:0/18:1(11Z)) ⟶ Choline + PS(18:0/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:1(9Z)):
L-Serine + PC(18:0/18:1(9Z)) ⟶ Choline + PS(18:0/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:2(9Z,12Z)):
L-Serine + PC(18:0/18:2(9Z,12Z)) ⟶ Choline + PS(18:0/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:3(6Z,9Z,12Z)):
L-Serine + PC(18:0/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(18:0/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:3(9Z,12Z,15Z)):
L-Serine + PC(18:0/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:0/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(18:0/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(18:0/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:0):
L-Serine + PC(18:0/20:0) ⟶ Choline + PS(18:0/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:1(11Z)):
L-Serine + PC(18:0/20:1(11Z)) ⟶ Choline + PS(18:0/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:2(11Z,14Z)):
L-Serine + PC(18:0/20:2(11Z,14Z)) ⟶ Choline + PS(18:0/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:3(5Z,8Z,11Z)):
L-Serine + PC(18:0/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:0/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:3(8Z,11Z,14Z)):
L-Serine + PC(18:0/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:0/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(18:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:0/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(18:0/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:0/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(18:0/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:0/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/22:0):
L-Serine + PC(18:0/22:0) ⟶ Choline + PS(18:0/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:0/22:1(13Z)):
L-Serine + PC(18:0/22:1(13Z)) ⟶ Choline + PS(18:0/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/22:2(13Z,16Z)):
L-Serine + PC(18:0/22:2(13Z,16Z)) ⟶ Choline + PS(18:0/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(18:0/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:0/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(18:0/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:0/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:0/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:0/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:0/24:0):
L-Serine + PC(18:0/24:0) ⟶ Choline + PS(18:0/24:0) - Phosphatidylethanolamine Biosynthesis PE(18:0/24:1(15Z)):
L-Serine + PC(18:0/24:1(15Z)) ⟶ Choline + PS(18:0/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/18:1(11Z)):
L-Serine + PC(18:1(11Z)/18:1(11Z)) ⟶ Choline + PS(18:1(11Z)/18:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/18:1(9Z)):
L-Serine + PC(18:1(11Z)/18:1(9Z)) ⟶ Choline + PS(18:1(11Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/18:2(9Z,12Z)):
L-Serine + PC(18:1(11Z)/18:2(9Z,12Z)) ⟶ Choline + PS(18:1(11Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(18:1(11Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(18:1(11Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(18:1(11Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:1(11Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(18:1(11Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(18:1(11Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:0):
L-Serine + PC(18:1(11Z)/20:0) ⟶ Choline + PS(18:1(11Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:1(11Z)):
L-Serine + PC(18:1(11Z)/20:1(11Z)) ⟶ Choline + PS(18:1(11Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:2(11Z,14Z)):
L-Serine + PC(18:1(11Z)/20:2(11Z,14Z)) ⟶ Choline + PS(18:1(11Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(18:1(11Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:1(11Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(18:1(11Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:1(11Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(18:1(11Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:1(11Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(18:1(11Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:1(11Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(18:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/22:0):
L-Serine + PC(18:1(11Z)/22:0) ⟶ Choline + PS(18:1(11Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/22:1(13Z)):
L-Serine + PC(18:1(11Z)/22:1(13Z)) ⟶ Choline + PS(18:1(11Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/22:2(13Z,16Z)):
L-Serine + PC(18:1(11Z)/22:2(13Z,16Z)) ⟶ Choline + PS(18:1(11Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(18:1(11Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:1(11Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(18:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/24:0):
L-Serine + PC(18:1(11Z)/24:0) ⟶ Choline + PS(18:1(11Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(11Z)/24:1(15Z)):
L-Serine + PC(18:1(11Z)/24:1(15Z)) ⟶ Choline + PS(18:1(11Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/18:1(9Z)):
L-Serine + PC(18:1(9Z)/18:1(9Z)) ⟶ Choline + PS(18:1(9Z)/18:1(9Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/18:2(9Z,12Z)):
L-Serine + PC(18:1(9Z)/18:2(9Z,12Z)) ⟶ Choline + PS(18:1(9Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(18:1(9Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(18:1(9Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(18:1(9Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:1(9Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(18:1(9Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(18:1(9Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:0):
L-Serine + PC(18:1(9Z)/20:0) ⟶ Choline + PS(18:1(9Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:1(11Z)):
L-Serine + PC(18:1(9Z)/20:1(11Z)) ⟶ Choline + PS(18:1(9Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:2(11Z,14Z)):
L-Serine + PC(18:1(9Z)/20:2(11Z,14Z)) ⟶ Choline + PS(18:1(9Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(18:1(9Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:1(9Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(18:1(9Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:1(9Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(18:1(9Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:1(9Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(18:1(9Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:1(9Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(18:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/22:0):
L-Serine + PC(18:1(9Z)/22:0) ⟶ Choline + PS(18:1(9Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/22:1(13Z)):
L-Serine + PC(18:1(9Z)/22:1(13Z)) ⟶ Choline + PS(18:1(9Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/22:2(13Z,16Z)):
L-Serine + PC(18:1(9Z)/22:2(13Z,16Z)) ⟶ Choline + PS(18:1(9Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(18:1(9Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:1(9Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(18:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/24:0):
L-Serine + PC(18:1(9Z)/24:0) ⟶ Choline + PS(18:1(9Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/24:1(15Z)):
L-Serine + PC(18:1(9Z)/24:1(15Z)) ⟶ Choline + PS(18:1(9Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/18:2(9Z,12Z)):
L-Serine + PC(18:2(9Z,12Z)/18:2(9Z,12Z)) ⟶ Choline + PS(18:2(9Z,12Z)/18:2(9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(18:2(9Z,12Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(18:2(9Z,12Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:0):
L-Serine + PC(18:2(9Z,12Z)/20:0) ⟶ Choline + PS(18:2(9Z,12Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:1(11Z)):
L-Serine + PC(18:2(9Z,12Z)/20:1(11Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:2(11Z,14Z)):
L-Serine + PC(18:2(9Z,12Z)/20:2(11Z,14Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(18:2(9Z,12Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(18:2(9Z,12Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(18:2(9Z,12Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(18:2(9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:2(9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/22:0):
L-Serine + PC(18:2(9Z,12Z)/22:0) ⟶ Choline + PS(18:2(9Z,12Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/22:1(13Z)):
L-Serine + PC(18:2(9Z,12Z)/22:1(13Z)) ⟶ Choline + PS(18:2(9Z,12Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/22:2(13Z,16Z)):
L-Serine + PC(18:2(9Z,12Z)/22:2(13Z,16Z)) ⟶ Choline + PS(18:2(9Z,12Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(18:2(9Z,12Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:2(9Z,12Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(18:2(9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:2(9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:2(9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:2(9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/24:0):
L-Serine + PC(18:2(9Z,12Z)/24:0) ⟶ Choline + PS(18:2(9Z,12Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/24:1(15Z)):
L-Serine + PC(18:2(9Z,12Z)/24:1(15Z)) ⟶ Choline + PS(18:2(9Z,12Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:0):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:0) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:1(11Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:1(11Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:2(11Z,14Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:2(11Z,14Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/22:0):
L-Serine + PC(18:3(6Z,9Z,12Z)/22:0) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/22:1(13Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/22:1(13Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/22:2(13Z,16Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/22:2(13Z,16Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/24:0):
L-Serine + PC(18:3(6Z,9Z,12Z)/24:0) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(6Z,9Z,12Z)/24:1(15Z)):
L-Serine + PC(18:3(6Z,9Z,12Z)/24:1(15Z)) ⟶ Choline + PS(18:3(6Z,9Z,12Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:0):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:0) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:1(11Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:1(11Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:2(11Z,14Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:2(11Z,14Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/22:0):
L-Serine + PC(18:3(9Z,12Z,15Z)/22:0) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/22:1(13Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/22:1(13Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/22:2(13Z,16Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/22:2(13Z,16Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/24:0):
L-Serine + PC(18:3(9Z,12Z,15Z)/24:0) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(18:3(9Z,12Z,15Z)/24:1(15Z)):
L-Serine + PC(18:3(9Z,12Z,15Z)/24:1(15Z)) ⟶ Choline + PS(18:3(9Z,12Z,15Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:0):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:0) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:0) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:1(11Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:1(11Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:2(11Z,14Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:2(11Z,14Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/22:0):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/22:0) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/22:1(13Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/22:1(13Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/22:2(13Z,16Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/22:2(13Z,16Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/24:0):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/24:0) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(18:4(6Z,9Z,12Z,15Z)/24:1(15Z)):
L-Serine + PC(18:4(6Z,9Z,12Z,15Z)/24:1(15Z)) ⟶ Choline + PS(18:4(6Z,9Z,12Z,15Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:0):
L-Serine + PC(20:0/20:0) ⟶ Choline + PS(20:0/20:0) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:1(11Z)):
L-Serine + PC(20:0/20:1(11Z)) ⟶ Choline + PS(20:0/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:2(11Z,14Z)):
L-Serine + PC(20:0/20:2(11Z,14Z)) ⟶ Choline + PS(20:0/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:3(5Z,8Z,11Z)):
L-Serine + PC(20:0/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(20:0/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:3(8Z,11Z,14Z)):
L-Serine + PC(20:0/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(20:0/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(20:0/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:0/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(20:0/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:0/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:0/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:0/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/22:0):
L-Serine + PC(20:0/22:0) ⟶ Choline + PS(20:0/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:0/22:1(13Z)):
L-Serine + PC(20:0/22:1(13Z)) ⟶ Choline + PS(20:0/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/22:2(13Z,16Z)):
L-Serine + PC(20:0/22:2(13Z,16Z)) ⟶ Choline + PS(20:0/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:0/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:0/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:0/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:0/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:0/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:0/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:0/24:0):
L-Serine + PC(20:0/24:0) ⟶ Choline + PS(20:0/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:0/24:1(15Z)):
L-Serine + PC(20:0/24:1(15Z)) ⟶ Choline + PS(20:0/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/20:1(11Z)):
L-Serine + PC(20:1(11Z)/20:1(11Z)) ⟶ Choline + PS(20:1(11Z)/20:1(11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/20:2(11Z,14Z)):
L-Serine + PC(20:1(11Z)/20:2(11Z,14Z)) ⟶ Choline + PS(20:1(11Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(20:1(11Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(20:1(11Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(20:1(11Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(20:1(11Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(20:1(11Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:1(11Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(20:1(11Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:1(11Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/22:0):
L-Serine + PC(20:1(11Z)/22:0) ⟶ Choline + PS(20:1(11Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/22:1(13Z)):
L-Serine + PC(20:1(11Z)/22:1(13Z)) ⟶ Choline + PS(20:1(11Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/22:2(13Z,16Z)):
L-Serine + PC(20:1(11Z)/22:2(13Z,16Z)) ⟶ Choline + PS(20:1(11Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:1(11Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:1(11Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/24:0):
L-Serine + PC(20:1(11Z)/24:0) ⟶ Choline + PS(20:1(11Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:1(11Z)/24:1(15Z)):
L-Serine + PC(20:1(11Z)/24:1(15Z)) ⟶ Choline + PS(20:1(11Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/20:2(11Z,14Z)):
L-Serine + PC(20:2(11Z,14Z)/20:2(11Z,14Z)) ⟶ Choline + PS(20:2(11Z,14Z)/20:2(11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(20:2(11Z,14Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(20:2(11Z,14Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(20:2(11Z,14Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(20:2(11Z,14Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(20:2(11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:2(11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(20:2(11Z,14Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:2(11Z,14Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:2(11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:2(11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/22:0):
L-Serine + PC(20:2(11Z,14Z)/22:0) ⟶ Choline + PS(20:2(11Z,14Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/22:1(13Z)):
L-Serine + PC(20:2(11Z,14Z)/22:1(13Z)) ⟶ Choline + PS(20:2(11Z,14Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/22:2(13Z,16Z)):
L-Serine + PC(20:2(11Z,14Z)/22:2(13Z,16Z)) ⟶ Choline + PS(20:2(11Z,14Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:2(11Z,14Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:2(11Z,14Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:2(11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:2(11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:2(11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:2(11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:2(11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:2(11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/24:0):
L-Serine + PC(20:2(11Z,14Z)/24:0) ⟶ Choline + PS(20:2(11Z,14Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:2(11Z,14Z)/24:1(15Z)):
L-Serine + PC(20:2(11Z,14Z)/24:1(15Z)) ⟶ Choline + PS(20:2(11Z,14Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/20:3(5Z,8Z,11Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/20:3(5Z,8Z,11Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/20:3(5Z,8Z,11Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/22:0):
L-Serine + PC(20:3(5Z,8Z,11Z)/22:0) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/22:1(13Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/22:1(13Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/22:2(13Z,16Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/22:2(13Z,16Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/24:0):
L-Serine + PC(20:3(5Z,8Z,11Z)/24:0) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:3(5Z,8Z,11Z)/24:1(15Z)):
L-Serine + PC(20:3(5Z,8Z,11Z)/24:1(15Z)) ⟶ Choline + PS(20:3(5Z,8Z,11Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/20:3(8Z,11Z,14Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/20:3(8Z,11Z,14Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/20:3(8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/22:0):
L-Serine + PC(20:3(8Z,11Z,14Z)/22:0) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/22:1(13Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/22:1(13Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/22:2(13Z,16Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/22:2(13Z,16Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/24:0):
L-Serine + PC(20:3(8Z,11Z,14Z)/24:0) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:3(8Z,11Z,14Z)/24:1(15Z)):
L-Serine + PC(20:3(8Z,11Z,14Z)/24:1(15Z)) ⟶ Choline + PS(20:3(8Z,11Z,14Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/22:0):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/22:0) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/22:1(13Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/22:1(13Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/22:2(13Z,16Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/22:2(13Z,16Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/24:0):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/24:0) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:4(5Z,8Z,11Z,14Z)/24:1(15Z)):
L-Serine + PC(20:4(5Z,8Z,11Z,14Z)/24:1(15Z)) ⟶ Choline + PS(20:4(5Z,8Z,11Z,14Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/20:4(8Z,11Z,14Z,17Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/20:4(8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/20:4(8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/22:0):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/22:0) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/22:1(13Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/22:1(13Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/22:2(13Z,16Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/22:2(13Z,16Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/24:0):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/24:0) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:4(8Z,11Z,14Z,17Z)/24:1(15Z)):
L-Serine + PC(20:4(8Z,11Z,14Z,17Z)/24:1(15Z)) ⟶ Choline + PS(20:4(8Z,11Z,14Z,17Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:0):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:0) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/22:0) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:2(13Z,16Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:2(13Z,16Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/24:0):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/24:0) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(20:5(5Z,8Z,11Z,14Z,17Z)/24:1(15Z)):
L-Serine + PC(20:5(5Z,8Z,11Z,14Z,17Z)/24:1(15Z)) ⟶ Choline + PS(20:5(5Z,8Z,11Z,14Z,17Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/22:0):
L-Serine + PC(22:0/22:0) ⟶ Choline + PS(22:0/22:0) - Phosphatidylethanolamine Biosynthesis PE(22:0/22:1(13Z)):
L-Serine + PC(22:0/22:1(13Z)) ⟶ Choline + PS(22:0/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/22:2(13Z,16Z)):
L-Serine + PC(22:0/22:2(13Z,16Z)) ⟶ Choline + PS(22:0/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(22:0/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:0/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(22:0/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:0/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:0/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:0/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:0/24:0):
L-Serine + PC(22:0/24:0) ⟶ Choline + PS(22:0/24:0) - Phosphatidylethanolamine Biosynthesis PE(22:0/24:1(15Z)):
L-Serine + PC(22:0/24:1(15Z)) ⟶ Choline + PS(22:0/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/22:1(13Z)):
L-Serine + PC(22:1(13Z)/22:1(13Z)) ⟶ Choline + PS(22:1(13Z)/22:1(13Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/22:2(13Z,16Z)):
L-Serine + PC(22:1(13Z)/22:2(13Z,16Z)) ⟶ Choline + PS(22:1(13Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(22:1(13Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:1(13Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(22:1(13Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:1(13Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:1(13Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:1(13Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/24:0):
L-Serine + PC(22:1(13Z)/24:0) ⟶ Choline + PS(22:1(13Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(22:1(13Z)/24:1(15Z)):
L-Serine + PC(22:1(13Z)/24:1(15Z)) ⟶ Choline + PS(22:1(13Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/22:2(13Z,16Z)):
L-Serine + PC(22:2(13Z,16Z)/22:2(13Z,16Z)) ⟶ Choline + PS(22:2(13Z,16Z)/22:2(13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(22:2(13Z,16Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:2(13Z,16Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(22:2(13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:2(13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:2(13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:2(13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/24:0):
L-Serine + PC(22:2(13Z,16Z)/24:0) ⟶ Choline + PS(22:2(13Z,16Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(22:2(13Z,16Z)/24:1(15Z)):
L-Serine + PC(22:2(13Z,16Z)/24:1(15Z)) ⟶ Choline + PS(22:2(13Z,16Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/22:4(7Z,10Z,13Z,16Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/22:4(7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/22:4(7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/24:0):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/24:0) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(22:4(7Z,10Z,13Z,16Z)/24:1(15Z)):
L-Serine + PC(22:4(7Z,10Z,13Z,16Z)/24:1(15Z)) ⟶ Choline + PS(22:4(7Z,10Z,13Z,16Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/24:0):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/24:0) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(22:5(4Z,7Z,10Z,13Z,16Z)/24:1(15Z)):
L-Serine + PC(22:5(4Z,7Z,10Z,13Z,16Z)/24:1(15Z)) ⟶ Choline + PS(22:5(4Z,7Z,10Z,13Z,16Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/24:0):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/24:0) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(22:5(7Z,10Z,13Z,16Z,19Z)/24:1(15Z)):
L-Serine + PC(22:5(7Z,10Z,13Z,16Z,19Z)/24:1(15Z)) ⟶ Choline + PS(22:5(7Z,10Z,13Z,16Z,19Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:0):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:0) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:0) - Phosphatidylethanolamine Biosynthesis PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:1(15Z)):
L-Serine + PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:1(15Z)) ⟶ Choline + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(24:0/24:0):
L-Serine + PC(24:0/24:0) ⟶ Choline + PS(24:0/24:0) - Phosphatidylethanolamine Biosynthesis PE(24:0/24:1(15Z)):
L-Serine + PC(24:0/24:1(15Z)) ⟶ Choline + PS(24:0/24:1(15Z)) - Phosphatidylethanolamine Biosynthesis PE(24:1(15Z)/24:1(15Z)):
L-Serine + PC(24:1(15Z)/24:1(15Z)) ⟶ Choline + PS(24:1(15Z)/24:1(15Z)) - Muscle/Heart Contraction:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Muscle/Heart Contraction:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Muscle/Heart Contraction:
Adenosine triphosphate + Calcium + Water ⟶ Adenosine diphosphate + Calcium + Phosphate - Ubiquitin Proteasome Pathway:
Ubiquitin-like modifier-activating enzyme 1 ⟶ Adenosine monophosphate - Ubiquitin Proteasome Pathway:
Ubiquitin-like modifier-activating enzyme 1 ⟶ Adenosine monophosphate - Ubiquitin Proteasome Pathway:
Ubiquitin-like modifier-activating enzyme 1 ⟶ Adenosine monophosphate - MEP/DOXP Pathway:
4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol + Adenosine diphosphate + Hydrogen Ion ⟶ 2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol + Adenosine triphosphate - Biosynthesis of Siderophore Group Nonribosomal Peptides:
2,3-Dihydroxybenzoic acid + Adenosine triphosphate + L-Serine ⟶ Adenosine monophosphate + Hydrogen Ion + Pyrophosphate + enterobactin - Biotin Metabolism:
Adenosine triphosphate + Biotin ⟶ Biotinyl-5'-AMP + diphosphate - tRNA Charging 2:
Adenosine triphosphate + Hydrogen Ion + L-Arginine ⟶ Adenosine monophosphate + Pyrophosphate - Galactitol and Galactonate Degradation:
Galactitol + Unknown ⟶ Galactose 1-phosphate + Unknown - Secondary Metabolites: Methylerythritol Phosphate and Polyisoprenoid Biosynthesis:
4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol + Adenosine triphosphate ⟶ 2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol + Adenosine diphosphate + Hydrogen Ion - Secondary Metabolites: Isoprenoid Biosynthesis (Nonmevalonate Pathway):
4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol + Adenosine triphosphate ⟶ 2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol + Adenosine diphosphate + Hydrogen Ion - Spermidine Biosynthesis I:
Decarboxy-SAM + Putrescine ⟶ 5'-Methylthioadenosine + Hydrogen Ion + Spermidine - 1,6-Anhydro-N-acetylmuramic Acid Recycling:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + D-glucosamine 6-phosphate
PharmGKB(0)
59 个相关的物种来源信息
- 3701 - Arabidopsis: LTS0160855
- 3702 - Arabidopsis thaliana: 10.1074/JBC.RA118.003351
- 3702 - Arabidopsis thaliana: LTS0160855
- 6656 - Arthropoda: LTS0045850
- 6656 - Arthropoda: LTS0160855
- 4890 - Ascomycota: LTS0160855
- 4210 - Asteraceae: LTS0045850
- 4210 - Asteraceae: LTS0160855
- 2 - Bacteria: LTS0160855
- 3700 - Brassicaceae: LTS0160855
- 7711 - Chordata: LTS0160855
- 543 - Enterobacteriaceae: LTS0160855
- 561 - Escherichia: LTS0160855
- 562 - Escherichia coli: LTS0160855
- 2759 - Eukaryota: LTS0045850
- 2759 - Eukaryota: LTS0160855
- 4751 - Fungi: LTS0160855
- 1236 - Gammaproteobacteria: LTS0160855
- 4231 - Helianthus: LTS0045850
- 4231 - Helianthus: LTS0160855
- 4233 - Helianthus tuberosus: 10.1080/00021369.1967.10858790
- 4233 - Helianthus tuberosus: LTS0045850
- 4233 - Helianthus tuberosus: LTS0160855
- 9604 - Hominidae: LTS0160855
- 9605 - Homo: LTS0160855
- 9606 - Homo sapiens:
- 9606 - Homo sapiens: -
- 9606 - Homo sapiens: 10.1007/S11306-012-0464-Y
- 9606 - Homo sapiens: 10.1038/NBT.2488
- 9606 - Homo sapiens: LTS0160855
- 50557 - Insecta: LTS0045850
- 50557 - Insecta: LTS0160855
- 3398 - Magnoliopsida: LTS0045850
- 3398 - Magnoliopsida: LTS0160855
- 40674 - Mammalia: LTS0160855
- 33208 - Metazoa: LTS0045850
- 33208 - Metazoa: LTS0160855
- 10066 - Muridae: LTS0160855
- 10088 - Mus: LTS0160855
- 10090 - Mus musculus: LTS0160855
- 10090 - Mus musculus: NA
- 7369 - Musca: LTS0045850
- 7369 - Musca: LTS0160855
- 7370 - Musca domestica: 10.1042/BJ0750038
- 7370 - Musca domestica: LTS0045850
- 7370 - Musca domestica: LTS0160855
- 7366 - Muscidae: LTS0045850
- 7366 - Muscidae: LTS0160855
- 4895 - Schizosaccharomyces: LTS0160855
- 4896 - Schizosaccharomyces pombe: 10.1039/C4MB00346B
- 4896 - Schizosaccharomyces pombe: LTS0160855
- 4894 - Schizosaccharomycetaceae: LTS0160855
- 147554 - Schizosaccharomycetes: LTS0160855
- 35493 - Streptophyta: LTS0045850
- 35493 - Streptophyta: LTS0160855
- 58023 - Tracheophyta: LTS0045850
- 58023 - Tracheophyta: LTS0160855
- 33090 - Viridiplantae: LTS0045850
- 33090 - Viridiplantae: LTS0160855
在这里通过桑基图来展示出与当前的这个代谢物在我们的BioDeep知识库中具有相关联信息的其他代谢物。在这里进行关联的信息来源主要有：
- PubMed: 来源于PubMed文献库中的文献信息，我们通过自然语言数据挖掘得到的在同一篇文献中被同时提及的相关代谢物列表，这个列表按照代谢物同时出现的文献数量降序排序，取前10个代谢物作为相关研究中关联性很高的代谢物集合展示在桑基图中。
- NCBI Taxonomy: 通过文献数据挖掘，得到的代谢物物种来源信息关联。这个关联信息同样按照出现的次数降序排序，取前10个代谢物作为高关联度的代谢物集合展示在桑吉图上。
- Chemical Taxonomy: 在物质分类上处于同一个分类集合中的其他代谢物
- Chemical Reaction: 在化学反应过程中，存在为当前代谢物相关联的生化反应过程中的反应底物或者反应产物的关联代谢物信息。
点击图上的相关代谢物的名称，可以跳转到相关代谢物的信息页面。
文献列表
- David Calderón Guzmán, Norma Osnaya Brizuela, Maribel Ortíz Herrera, Hugo Juárez Olguín, Armando Valenzuela Peraza, Norma Labra Ruíz, Gerardo Barragán Mejía. Intake of oligoelements with cytarabine or etoposide alters dopamine levels and oxidative damage in rat brain.
Scientific reports.
2024 05; 14(1):10835. doi:
10.1038/s41598-024-61766-0. [PMID: 38736022] - Jin Huang, Xuewen Liang, Minrui Zhao, Yue Zhang, Ziyang Chen. Metabolomics and network pharmacology reveal the mechanism of antithrombotic effect of Asperosaponin VI.
Biomedicine & pharmacotherapy = Biomedecine & pharmacotherapie.
2024 Apr; 173(?):116355. doi:
10.1016/j.biopha.2024.116355. [PMID: 38493592] - Artūras Polita, Rokas Žvirblis, Jelena Dodonova-Vaitkūnienė, Arun Prabha Shivabalan, Karolina Maleckaitė, Gintaras Valinčius. Bimodal effects on lipid droplets induced in cancer and non-cancer cells by chemotherapy drugs as revealed with a green-emitting BODIPY fluorescent probe.
Journal of materials chemistry. B.
2024 Mar; 12(12):3022-3030. doi:
10.1039/d3tb02979d. [PMID: 38426244] - Yue Wang, Ping Wang, Haiyan Li, Xiaoran Han, Haibin Zhu, Xiangqun Jin. Nanocrystal-Loaded Lipid Carriers for Improved Oral Absorption and Anticancer Efficacy of Etoposide: Formulation Development, Transport Mechanism, In Vitro and In Vivo Evaluation.
Molecular pharmaceutics.
2024 Mar; 21(3):1170-1181. doi:
10.1021/acs.molpharmaceut.3c00785. [PMID: 38329909] - Mohammed M Jalal, Claire S Whyte, Fraser P Coxon, Nicola J Mutch. Atorvastatin-mediated inhibition of prenylation of Rab27b and Rap1a in platelets attenuates their prothrombotic capacity and modulates clot structure.
Platelets.
2023 Dec; 34(1):2206921. doi:
10.1080/09537104.2023.2206921. [PMID: 37139869] - Andrzej M Woyda-Ploszczyca. Direct and indirect targets of carboxyatractyloside, including overlooked toxicity toward nucleoside diphosphate kinase (NDPK) and mitochondrial H+ leak.
Pharmaceutical biology.
2023 Dec; 61(1):372-390. doi:
10.1080/13880209.2023.2168704. [PMID: 36799406] - Alma Sarahi Cuellar González, Marisol Galván Valencia, Rodolfo Daniel Cervantes-Villagrana, Alondra Bocanegra Zapata, Alberto Rafael Cervantes-Villagrana. Cytotoxic and Antitumor Effects of the Hydroalcoholic Extract of Tagetes erecta in Lung Cancer Cells.
Molecules (Basel, Switzerland).
2023 Oct; 28(20):. doi:
10.3390/molecules28207055. [PMID: 37894532] - Liting Zhong, Xuejiao Meng, Jingjing Huang, Wenwen Hao, Yajing Zuo. Expression of YAP suppresses cell proliferation and elevates the sensitivity of chemotherapy in retinoblastoma cells through lipid-peroxidation induced ferroptosis.
Chinese clinical oncology.
2023 Oct; 12(5):52. doi:
10.21037/cco-23-97. [PMID: 37964544] - Z Y Shen, X C Chen, H R Shan, T Jia, W Y Gu, F Wang, Q L Teng, L Wang, C L Wang, Y Y Shi, H Zhang, Y Q Miao, T G Zhu, C Y Ji, J J Ye, M Z Zhang, X D Zhang, L Wang, K L Xu, W Sang. [Analysis of prognostic factors of extranodal NK/T-cell lymphoma treated with pegaspargase/L-asparaginase: a multicenter retrospective study].
Zhonghua xue ye xue za zhi = Zhonghua xueyexue zazhi.
2023 Aug; 44(8):642-648. doi:
10.3760/cma.j.issn.0253-2727.2023.08.005. [PMID: 37803837] - R Xu, S Li, H X Liu, D L Wei, Y Jiang, J J Wang, S S Liu, C Wang, J Zhu. [Efficacy and safety of TBI+rATG-based conditioning regimen for haploidentical allogeneic hematopoietic stem cell transplantation in 11 cases of chemotherapy-resistant advanced peripheral T-cell lymphoma].
Zhonghua xue ye xue za zhi = Zhonghua xueyexue zazhi.
2023 Jul; 44(7):578-581. doi:
10.3760/cma.j.issn.0253-2727.2023.07.010. [PMID: 37749039] - Tao Wang, Yilin Li, Xiaoqiang Zheng. Cost-effectiveness of the combination of immunotherapy and chemotherapy for extensive-stage small-cell lung cancer: a systematic review.
BMC health services research.
2023 Jun; 23(1):691. doi:
10.1186/s12913-023-09727-7. [PMID: 37365540] - Tomasz Tuzimski, Anna Petruczynik, Tomasz Plech, Barbara Kaproń, Anna Makuch-Kocka, Małgorzata Szultka-Młyńska, Justyna Misiurek, Bogusław Buszewski, Monika Waksmundzka-Hajnos. Determination of Selected Isoquinoline Alkaloids from Chelidonium majus, Mahonia aquifolium and Sanguinaria canadensis Extracts by Liquid Chromatography and Their In Vitro and In Vivo Cytotoxic Activity against Human Cancer Cells.
International journal of molecular sciences.
2023 Mar; 24(7):. doi:
10.3390/ijms24076360. [PMID: 37047332] - Mohammed Tanveer Ahmed, Sampa Sarkar, Ravi Shukla, Rajkumar Banerjee. Etoposide-Entrapped Progesterone-Cationic Lipid Nanoaggregates as Selective Therapeutics against Etoposide-Resistant Colorectal Cancer Cells.
Chembiochem : a European journal of chemical biology.
2023 Mar; ?(?):e202200650. doi:
10.1002/cbic.202200650. [PMID: 36905093] - Zhongsuzhi Chen, Meiying He, Yijie Zhou, Xi Chen, Hong Zhu, Bao Yang, Yueming Jiang, Hongxia Qu. Degradation of water-soluble polysaccharides in pulp of litchi during storage.
Food chemistry.
2023 Feb; 402(?):134289. doi:
10.1016/j.foodchem.2022.134289. [PMID: 36150360] - Mohammadzadeh Saied, Kiani Ali, Amiri Mosayeb. Rosemary (Rosmarinus officinalis L.) essential oil alleviates testis failure induced by Etoposide in male rats.
Tissue & cell.
2023 Jan; 81(?):102016. doi:
10.1016/j.tice.2023.102016. [PMID: 36640564] - Ting Li, Jiesen Yu, Mengyuan Hou, Sijie Zha, Qingqing Cheng, Qingshan Zheng, Lujin Li. Quantitative evaluation of therapy options for relapsed/refractory diffuse large B-cell lymphoma: A model-based meta-analysis.
Pharmacological research.
2023 01; 187(?):106592. doi:
10.1016/j.phrs.2022.106592. [PMID: 36470547] - Erva Ozkan, Filiz Bakar-Ates. Etoposide in combination with erastin synergistically altered iron homeostasis and induced ferroptotic cell death through regulating IREB2/FPN1 expression in estrogen receptor positive-breast cancer cells.
Life sciences.
2023 Jan; 312(?):121222. doi:
10.1016/j.lfs.2022.121222. [PMID: 36442526] - Dongsheng Yao, Heba Ahmed, Junqi Song. A Clickable NAD+ Analog-Based Assay of Poly(ADP-Ribosyl)ated Proteins.
Methods in molecular biology (Clifton, N.J.).
2023; 2609(?):147-155. doi:
10.1007/978-1-0716-2891-1_10. [PMID: 36515835] - Pengfei Hu, Jinchi Ying, Yusu Wang, Tiantian Jiang, Zheng Pan, Chen Zhao, Jiping Li, Chunyi Li. Extracellular Vesicles Derived From 3D Cultured Antler Stem Cells Serve as a New Drug Vehicle in Osteosarcoma Treatment.
Cell transplantation.
2023 Jan; 32(?):9636897231219830. doi:
10.1177/09636897231219830. [PMID: 38102784] - Leszek A Kleczkowski, Abir U Igamberdiev. Magnesium and cell energetics: At the junction of metabolism of adenylate and non-adenylate nucleotides.
Journal of plant physiology.
2023 Jan; 280(?):153901. doi:
10.1016/j.jplph.2022.153901. [PMID: 36549033] - Zahra Amri, Ikram Ben Amor, Amira Zarrouk, Raja Chaaba, Jalel Gargouri, Mohamed Hammami, Sonia Hammami. Anti-glycation, antiplatelet and antioxidant effects of different pomegranate parts.
BMC complementary medicine and therapies.
2022 Dec; 22(1):339. doi:
10.1186/s12906-022-03824-6. [PMID: 36575459] - G M Li, Y B Jin, Y Z Gan, C Chen, Y Jia, C Li. [Ruxolitinib as an effective treatment for panniculitis associated hemophagocytic syndrome: A report of 2 cases and literature review].
Beijing da xue xue bao. Yi xue ban = Journal of Peking University. Health sciences.
2022 Dec; 54(6):1208-1213. doi:
. [PMID: 36533357] - Viacheslav V Dolgikh, Igor V Senderskiy, Sergej A Timofeev, Vladimir S Zhuravlyov, Alexandra V Dolgikh, Elena V Seliverstova, Diloram A Ismatullaeva, Bakhtiyar A Mirzakhodjaev. Construction of scFv Antibodies against the Outer Loops of the Microsporidium Nosema bombycis ATP/ADP-Transporters and Selection of the Fragment Efficiently Inhibiting Parasite Growth.
International journal of molecular sciences.
2022 Dec; 23(23):. doi:
10.3390/ijms232315307. [PMID: 36499634] - Zhang Tao, Xingwang Kuai, Guangwei Wang, Sanfeng Liu, Kai Liu, Heng Zhang, Shujing Xia, Hua Zhu. Combination of chemotherapy and immune checkpoint therapy by the immunoconjugates-based nanocomplexes synergistically improves therapeutic efficacy in SCLC.
Drug delivery.
2022 Dec; 29(1):1571-1581. doi:
10.1080/10717544.2022.2039803. [PMID: 35612299] - Jixing Lyu, Chang Liu, Tianqi Zhang, Samantha Schrecke, Nicklaus P Elam, Charles Packianathan, Georg K A Hochberg, David Russell, Minglei Zhao, Arthur Laganowsky. Structural basis for lipid and copper regulation of the ABC transporter MsbA.
Nature communications.
2022 11; 13(1):7291. doi:
10.1038/s41467-022-34905-2. [PMID: 36435815] - Zhang Yong, Wang Ruiqi, Yang Yanan, Ma Ning, Zhou Zhi, Tan Yinfeng, Dong Lin, Li Yiying, Lu Weiying, Wu Chongming, Zhang Xiaopo. Laurolitsine ameliorates type 2 diabetes by regulating the hepatic LKB1-AMPK pathway and gut microbiota.
Phytomedicine : international journal of phytotherapy and phytopharmacology.
2022 Nov; 106(?):154423. doi:
10.1016/j.phymed.2022.154423. [PMID: 36075181] - Pan Wang, Xingrong Peng, Tao Hou, Fangfang Xu, Han Zhou, Yancheng Yu, Minghua Qiu, Yanfang Liu, Yaopeng Zhao, Zhimou Guo, Jixia Wang, Xinmiao Liang. Discovery and characterization of novel ATP citrate lyase inhibitors from natural products by a luminescence-based assay.
Chemico-biological interactions.
2022 Nov; 367(?):110199. doi:
10.1016/j.cbi.2022.110199. [PMID: 36174740] - Aveek Samanta, Saptadipa Banerjee, Tilak Raj Maity, Jangala Jahnavi, Siraj Datta. Towards establishment of a plant-based model to assess the novel anti-cancerous lead molecule(s): An in silico, in vivo and in vitro assessment of some potential anti-cancerous drugs on Lathyrus sativus L.
Protoplasma.
2022 Nov; 259(6):1455-1466. doi:
10.1007/s00709-022-01745-2. [PMID: 35195768] - James A Whitlock, Jemily Malvar, Luciano Dalla-Pozza, John M Goldberg, Lewis B Silverman, David S Ziegler, Andishe Attarbaschi, Patrick A Brown, Rebecca A Gardner, Paul S Gaynon, Raymond Hutchinson, Van T Huynh, Sima Jeha, Leigh Marcus, Yoav Messinger, Kirk R Schultz, Jeannette Cassar, Franco Locatelli, C Michel Zwaan, Brent L Wood, Richard Sposto, Lia Gore. Nelarabine, etoposide, and cyclophosphamide in relapsed pediatric T-acute lymphoblastic leukemia and T-lymphoblastic lymphoma (study T2008-002 NECTAR).
Pediatric blood & cancer.
2022 Nov; 69(11):e29901. doi:
10.1002/pbc.29901. [PMID: 35989458] - Stacie S Kim, Diego L Wengier, Carin J Ragland, Elizabeth S Sattely. Transcriptional Reactivation of Lignin Biosynthesis for the Heterologous Production of Etoposide Aglycone in Nicotiana benthamiana.
ACS synthetic biology.
2022 10; 11(10):3379-3387. doi:
10.1021/acssynbio.2c00289. [PMID: 36122905] - Ping-An Yao, Ke-Zhao Wei, Jia-Hua Feng, Xiao-Ning Liu, Xu Xu, Hong-Yan Cui, Xiao-Chen Zhang, Jian-Ping Gao. Sodium houttuyfonate protects against cardiac injury by regulating cardiac energy metabolism in diabetic rats.
European journal of pharmacology.
2022 Oct; 932(?):175236. doi:
10.1016/j.ejphar.2022.175236. [PMID: 36044971] - Daniel Mouzo, Raquel Rodríguez-Vázquez, Carlos Barrio, Lucio García, Carlos Zapata. Comparative Proteomics of Potato Cultivars with a Variable Dormancy Period.
Molecules (Basel, Switzerland).
2022 Oct; 27(19):. doi:
10.3390/molecules27196621. [PMID: 36235158] - Jun Gyou Park, Songwon Kim, Eunhong Jang, Seung Hun Choi, Hyunsu Han, Seulgi Ju, Ji Won Kim, Da Sol Min, Mi Sun Jin. The lysosomal transporter TAPL has a dual role as peptide translocator and phosphatidylserine floppase.
Nature communications.
2022 10; 13(1):5851. doi:
10.1038/s41467-022-33593-2. [PMID: 36195619] - Iehor A Hudz, Volodymyr O Chernyshenko, Ludmila O Kasatkina, Lesia P Urvant, Vitaliy M Klimashevskyi, Oksana S Tkachenko, Halyna V Kosiakova, Nadiia M Hula, Tetyana M Platonova. N-Stearoylethanolamine Inhibits Integrin-Mediated Activation, Aggregation, and Adhesion of Human Platelets.
The Journal of pharmacology and experimental therapeutics.
2022 Oct; 383(1):2-10. doi:
10.1124/jpet.122.001084. [PMID: 35963618] - Xiao Chang, Yanhong He, Ling Wang, Chuanjin Luo, Yuntao Liu, Rong Li. Puerarin Alleviates LPS-Induced H9C2 Cell Injury by Inducing Mitochondrial Autophagy.
Journal of cardiovascular pharmacology.
2022 10; 80(4):600-608. doi:
10.1097/fjc.0000000000001315. [PMID: 35881898] - Meitao Duan, Ahmed Mahal, Ban Mohammed, Yongyan Zhu, Huaming Tao, Shaoyu Mai, Maysoon Al-Haideri, Quanhong Zhu. Synthesis and antitumor activity of new tetrahydrocurcumin derivatives via click reaction.
Natural product research.
2022 Oct; 36(20):5268-5276. doi:
10.1080/14786419.2021.1931181. [PMID: 34030539] - Archana Yadav, Chetna Singh. Cyclooxygenase-2 activates the free radical-mediated apoptosis of polymorphonuclear leukocytes in the maneb- and paraquat-intoxicated rats.
Pesticide biochemistry and physiology.
2022 Oct; 187(?):105202. doi:
10.1016/j.pestbp.2022.105202. [PMID: 36127053] - Sangsang Tang, Yuanming Shen, Xinyi Wei, Zhangjin Shen, Weiguo Lu, Junfen Xu. Olaparib synergizes with arsenic trioxide by promoting apoptosis and ferroptosis in platinum-resistant ovarian cancer.
Cell death & disease.
2022 09; 13(9):826. doi:
10.1038/s41419-022-05257-y. [PMID: 36163324] - Maryna Stasevych, Viktor Zvarych, Olena Yaremkevych, Mykhaylo Vovk, Alla Vaskevych, Tetiana Halenova, Olexii Savchuk. N-(9,10-Dioxo-9,10-dihydroanthracen-1(2)-yl)-2-(R-thio) Acetamides: Synthesis, Antioxidant and Antiplatelet Activity.
Acta chimica Slovenica.
2022 Sep; 69(3):584-595. doi:
10.17344/acsi.2022.7463. [PMID: 36196813] - Hai Shang, Yue Hu, Jingrong Li, Lingyu Li, Yu Tian, Xiaoxue Li, Qi Wu, Zhongmei Zou. The Synthesis and Biological Evaluation of Aloe-Emodin-Coumarin Hybrids as Potential Antitumor Agents.
Molecules (Basel, Switzerland).
2022 Sep; 27(19):. doi:
10.3390/molecules27196153. [PMID: 36234685] - Lyanne Rodríguez, Andrés Trostchansky, Hermine Vogel, Irene Wood, Iván Palomo, Sergio Wehinger, Eduardo Fuentes. A Comprehensive Literature Review on Cardioprotective Effects of Bioactive Compounds Present in Fruits of Aristotelia chilensis Stuntz (Maqui).
Molecules (Basel, Switzerland).
2022 Sep; 27(19):. doi:
10.3390/molecules27196147. [PMID: 36234679] - Nikolaos Fragakis, Antonios P Antoniadis, Melani Sotiriadou, Christina Virgiliou, Iris Ballauri, Helen G Gika, Dimitrios Bougiouklis, Spyros Gerou, Charalampos Lazaridis, Stavros Vergopoulos, Constantinos Bakogiannis, Georgios Giannopoulos, Georgios A Theodoridis, Christodoulos E Papadopoulos, Theodoros D Karamitsos, Vassilios Vassilikos. Syncope without prodromes is associated with excessive plasma release of adenosine at the time of syncope during head-up tilt table test.
International journal of cardiology.
2022 Sep; 363(?):43-48. doi:
10.1016/j.ijcard.2022.06.045. [PMID: 35716941] - Phong T Nguyen, Christine Deisl, Michael Fine, Trevor S Tippetts, Emiko Uchikawa, Xiao-Chen Bai, Beth Levine. Structural basis for gating mechanism of the human sodium-potassium pump.
Nature communications.
2022 09; 13(1):5293. doi:
10.1038/s41467-022-32990-x. [PMID: 36075933] - Robert Wolf, Sophie Grammbauer, Raghavendra Palankar, Céline Tolksdorf, Eileen Moritz, Andreas Böhm, Mahmoud Hasan, Annika Hafkemeyer, Andreas Greinacher, Mladen V Tzvetkov, Bernhard H Rauch, Gabriele Jedlitschky. Specific inhibition of the transporter MRP4/ABCC4 affects multiple signaling pathways and thrombus formation in human platelets.
Haematologica.
2022 09; 107(9):2206-2217. doi:
10.3324/haematol.2021.279761. [PMID: 35295075] - Zalina I Iskhakova, Darya E Zhuravleva, Christopher Heim, Marcus D Hartmann, Aleksandr V Laykov, Karl Forchhammer, Airat R Kayumov. PotN represents a novel energy-state sensing PII subfamily, occurring in firmicutes.
The FEBS journal.
2022 09; 289(17):5305-5321. doi:
10.1111/febs.16431. [PMID: 35285159] - Douglas Jardim-Messeder, Márcia Margis-Pinheiro, Gilberto Sachetto-Martins. Salicylic acid and adenine nucleotides regulate the electron transport system and ROS production in plant mitochondria.
Biochimica et biophysica acta. Bioenergetics.
2022 08; 1863(6):148559. doi:
10.1016/j.bbabio.2022.148559. [PMID: 35413247] - Piyas Gargari, Pradip Mukhopadhyay, Banshi Saboo, Anoop Misra, Sujoy Ghosh. Fabkin and glucose homeostasis.
Diabetes & metabolic syndrome.
2022 Aug; 16(8):102565. doi:
10.1016/j.dsx.2022.102565. [PMID: 35850074] - Marcos Castro-Guarda, Yennyfer Arancibia, Carina Chipón, Christofer Matamala, Paola Oyarzo, Gabriela Vargas, Alejandro Reyes, Mónica Salas, Francisco J Morera, Angara Zambrano. Metabolic changes induced by DNA damage in Ramos cells: exploring the role of mTORC1 complex.
FEBS open bio.
2022 08; 12(8):1509-1522. doi:
10.1002/2211-5463.13436. [PMID: 35538662] - Aolin Jia, Shijia Huang, Wen Song, Junli Wang, Yonggang Meng, Yue Sun, Lina Xu, Henriette Laessle, Jan Jirschitzka, Jiao Hou, Tiantian Zhang, Wenquan Yu, Giuliana Hessler, Ertong Li, Shoucai Ma, Dongli Yu, Jan Gebauer, Ulrich Baumann, Xiaohui Liu, Zhifu Han, Junbiao Chang, Jane E Parker, Jijie Chai. TIR-catalyzed ADP-ribosylation reactions produce signaling molecules for plant immunity.
Science (New York, N.Y.).
2022 07; 377(6605):eabq8180. doi:
10.1126/science.abq8180. [PMID: 35857644] - Shijia Huang, Aolin Jia, Wen Song, Giuliana Hessler, Yonggang Meng, Yue Sun, Lina Xu, Henriette Laessle, Jan Jirschitzka, Shoucai Ma, Yu Xiao, Dongli Yu, Jiao Hou, Ruiqi Liu, Huanhuan Sun, Xiaohui Liu, Zhifu Han, Junbiao Chang, Jane E Parker, Jijie Chai. Identification and receptor mechanism of TIR-catalyzed small molecules in plant immunity.
Science (New York, N.Y.).
2022 07; 377(6605):eabq3297. doi:
10.1126/science.abq3297. [PMID: 35857645] - Fang Guo, Hongbing Wang, Heshun Xia, Hongwei Shi, Peng Xu, Guoliang Pi. Lymph node metastasis as the initial symptom of a germ cell tumor in an adult: A case report.
Medicine.
2022 Jul; 101(30):e29281. doi:
10.1097/md.0000000000029281. [PMID: 35905234] - Yue Hong, Hui Xia, Xiao Li, Ruyi Fan, Qing Li, Zhewen Ouyang, Shan Tang, Liang Guo. Brassica napus BnaNTT1 modulates ATP homeostasis in plastids to sustain metabolism and growth.
Cell reports.
2022 07; 40(2):111060. doi:
10.1016/j.celrep.2022.111060. [PMID: 35830794] - K Onbasli, M Erkısa, G Demirci, A Muti, E Ulukaya, A Sennaroglu, H Yagci Acar. The improved killing of both androgen-dependent and independent prostate cancer cells by etoposide loaded SPIONs coupled with NIR irradiation.
Biomaterials science.
2022 Jul; 10(14):3951-3962. doi:
10.1039/d2bm00107a. [PMID: 35703472] - Guilherme Ruiz Leonardi, Caroline Honaiser Lescano, Jose Luiz Costa, Bruna Mazetto, Fernanda Andrade Orsi, Fabiola Zakia Monica. Adenosine diphosphate-induced aggregation is enhanced in platelets obtained from patients with thrombotic primary antiphospholipid syndrome (t-PAPS): Role of P2Y12 -cAMP signaling pathway.
Journal of thrombosis and haemostasis : JTH.
2022 07; 20(7):1699-1711. doi:
10.1111/jth.15724. [PMID: 35395698] - Yicong Bian, Jian Meng, Sheng Ma, Guangze Li, Yuya Wang, Shaorong Li, Linsheng Liu, Chenrong Huang, Hua Zhang, Dafang Zhong, Liyan Miao. Metabolite profiles and mass balance of fuzuloparib, a novel poly (ADP-ribose) polymerase inhibitor, in subjects with advanced solid cancers.
British journal of clinical pharmacology.
2022 07; 88(7):3307-3320. doi:
10.1111/bcp.15256. [PMID: 35112382] - Shaojie Yang, Yan Qu, Juan Wang, Feng Gao, Manman Ji, Pan Xie, Aisong Zhu, Bei Tan, Xuncui Wang, Guoqi Zhu. Anshen Dingzhi prescription in the treatment of PTSD in mice: Investigation of the underlying mechanism from the perspective of hippocampal synaptic function.
Phytomedicine : international journal of phytotherapy and phytopharmacology.
2022 Jul; 101(?):154139. doi:
10.1016/j.phymed.2022.154139. [PMID: 35523115] - Xiaojing Ma, Tong Wang, Zequan Yu, Junqian Shao, Jun Chu, Huixia Zhu, Risheng Yao. Formulation and Physicochemical and Biological Characterization of Etoposide-Loaded Submicron Emulsions with Biosurfactant of Sophorolipids.
AAPS PharmSciTech.
2022 Jul; 23(6):181. doi:
10.1208/s12249-022-02329-2. [PMID: 35773548] - Anja Eckelt, Franziska Wichmann, Franziska Bayer, John Eckelt, Jonathan Groß, Till Opatz, Kerstin Jurk, Christoph Reinhardt, Klytaimnistra Kiouptsi. Ethyl Hydroxyethyl Cellulose-A Biocompatible Polymer Carrier in Blood.
International journal of molecular sciences.
2022 Jun; 23(12):. doi:
10.3390/ijms23126432. [PMID: 35742876] - Carola Ledderose, Eleftheria-Angeliki Valsami, Wolfgang G Junger. Optimized HPLC method to elucidate the complex purinergic signaling dynamics that regulate ATP, ADP, AMP, and adenosine levels in human blood.
Purinergic signalling.
2022 06; 18(2):223-239. doi:
10.1007/s11302-022-09842-w. [PMID: 35132577] - Qiuzi Yi, Shihao Yao, Boyuan Ma, Xiaohui Cang. The effects of cardiolipin on the structural dynamics of the mitochondrial ADP/ATP carrier in its cytosol-open state.
Journal of lipid research.
2022 06; 63(6):100227. doi:
10.1016/j.jlr.2022.100227. [PMID: 35569528] - Edward Valera-Vera, Chantal Reigada, Melisa Sayé, Fabio A Digirolamo, Facundo Galceran, Mariana R Miranda, Claudio A Pereira. Trypanocidal activity of the anthocyanidin delphinidin, a non-competitive inhibitor of arginine kinase.
Natural product research.
2022 Jun; 36(12):3153-3157. doi:
10.1080/14786419.2021.1947270. [PMID: 34219561] - Natália Pontes Bona, Mayara Sandrielly Pereira Soares, Nathalia Stark Pedra, Luiza Spohr, Francieli da Silva Dos Santos, Alana Seixas de Farias, Fernando Lopez Alvez, Bernardo de Moraes Meine, Karina Pereira Luduvico, Roselia Maria Spanevello, Francieli Moro Stefanello. Tannic Acid Attenuates Peripheral and Brain Changes in a Preclinical Rat Model of Glioblastoma by Modulating Oxidative Stress and Purinergic Signaling.
Neurochemical research.
2022 Jun; 47(6):1541-1552. doi:
10.1007/s11064-022-03547-7. [PMID: 35178643] - Bongsoo Choi, Do Young Hyeon, Juhun Lee, Terri A Long, Daehee Hwang, Inhwan Hwang. E3 ligase BRUTUS Is a Negative Regulator for the Cellular Energy Level and the Expression of Energy Metabolism-Related Genes Encoded by Two Organellar Genomes in Leaf Tissues.
Molecules and cells.
2022 May; 45(5):294-305. doi:
10.14348/molcells.2022.2029. [PMID: 35422451] - Tianyun Fan, Yangyang Cheng, Wei Wei, Qingxuan Zeng, Xixi Guo, Zhihao Guo, Yinghong Li, Liping Zhao, Yulong Shi, Xintong Zhang, Jiandong Jiang, Yanxiang Wang, Weijia Kong, Danqing Song. Palmatine Derivatives as Potential Antiplatelet Aggregation Agents via Protein Kinase G/Vasodilator-Stimulated Phosphoprotein and Phosphatidylinositol 3-Kinase/Akt Phosphorylation.
Journal of medicinal chemistry.
2022 05; 65(10):7399-7413. doi:
10.1021/acs.jmedchem.2c00592. [PMID: 35549263] - Marta Zarà, Mauro Vismara, Gianluca De Dona, Silvia M G Trivigno, Patrizia Amadio, Leonardo Sandrini, Gianni F Guidetti, Silvia S Barbieri. The Impact of Platelet Isolation Protocol on the Release of Extracellular Vesicles.
Frontiers in bioscience (Landmark edition).
2022 05; 27(5):161. doi:
10.31083/j.fbl2705161. [PMID: 35638428] - Andrea Pagano, Lorena Zannino, Paola Pagano, Enrico Doria, Daniele Dondi, Anca Macovei, Marco Biggiogera, Susana de Sousa Araújo, Alma Balestrazzi. Changes in genotoxic stress response, ribogenesis and PAP (3'-phosphoadenosine 5'-phosphate) levels are associated with loss of desiccation tolerance in overprimed Medicago truncatula seeds.
Plant, cell & environment.
2022 05; 45(5):1457-1473. doi:
10.1111/pce.14295. [PMID: 35188276] - Johanna C Clauser, Judith Maas, Ilona Mager, Frank R Halfwerk, Jutta Arens. The porcine abattoir blood model-Evaluation of platelet function for in-vitro hemocompatibility investigations.
Artificial organs.
2022 May; 46(5):922-931. doi:
10.1111/aor.14146. [PMID: 34904246] - Saliha Sarfraz, Haleema Saeed. Feasibility and safety of outpatient administration of ifosfamide and etoposide for pediatric patients with Ewing sarcoma in a resource-limited setting amid the COVID-19 pandemic.
Pediatric blood & cancer.
2022 05; 69(5):e29595. doi:
10.1002/pbc.29595. [PMID: 35234343] - Dominique-Maurice Kehlenbeck, Daouda A K Traore, Inokentijs Josts, Simon Sander, Martine Moulin, Michael Haertlein, Sylvain Prevost, V Trevor Forsyth, Henning Tidow. Cryo-EM structure of MsbA in saposin-lipid nanoparticles (Salipro) provides insights into nucleotide coordination.
The FEBS journal.
2022 05; 289(10):2959-2970. doi:
10.1111/febs.16327. [PMID: 34921499] - Ceren Eyileten, Aleksandra Gasecka, Anna Nowak, Joanna Jarosz-Popek, Marta Wolska, Al-Medina Dizdarevic, Irene M Lang, Marek Postula, Marcin Ufnal, Jolanta M Siller-Matula. High concentration of symmetric dimethylarginine is associated with low platelet reactivity and increased bleeding risk in patients with acute coronary syndrome.
Thrombosis research.
2022 05; 213(?):195-202. doi:
10.1016/j.thromres.2022.03.025. [PMID: 35398728] - Luba Marderfeld, Orith Waisbourd-Zinman, Neta Biran, Michal Rozenfeld Bar-Lev, Ari Silbermintz, Irit Poraz, Dana Reznik, Yifat Jack, Yael Mozer Glassberg, Raanan Shamir. Body composition correlates with laboratory parameters and disease severity in infants with biliary atresia.
Pediatric transplantation.
2022 05; 26(3):e14208. doi:
10.1111/petr.14208. [PMID: 34927330] - Shota Ueda, Keita Nakane, Sanae Namiki, Yasumichi Takeuchi, Makoto Kawase, Shinichi Takeuchi, Kota Kawase, Chie Nakai, Daiki Kato, Manabu Takai, Koji Iinuma, Tomohiro Tsuchiya, Tatsuhiko Miyazaki, Takuya Koie. [A Case Report of a Patient with Metastatic Adrenocortical Carcinoma who Received the Combination Etoposide, Doxorubicin, Cisplatin, and Mitotane Therapy and Achieved Remission].
Hinyokika kiyo. Acta urologica Japonica.
2022 May; 68(5):139-143. doi:
10.14989/actauroljap_68_5_139. [PMID: 35748231] - Natsumi Sekiguchi, Katsutomo Sasaki, Yoshimi Oshima, Nobutaka Mitsuda. Ectopic expression of AtNF-YA6-VP16 in petals results in a novel petal phenotype in Torenia fournieri.
Planta.
2022 Apr; 255(5):105. doi:
10.1007/s00425-022-03876-5. [PMID: 35429252] - Sandra C Bulla, Peres R Badial, Camilo Bulla. Canine Cancer Cells Activate Platelets via the Platelet P2Y12 Receptor.
Journal of comparative pathology.
2022 Apr; 192(?):41-49. doi:
10.1016/j.jcpa.2022.01.002. [PMID: 35305713] - Mahmoud F Kamel, Mahmoud Nassar, Amira Elbendary, Abdelrahman Gamal Abdelaziz Mohamed, Mahmoud Gouda Abdullah, Hassan Ramdan Abdelazeem Gomaa, Ebram Medhat Ibrahim Awad, Heba H Mahmoud, Mohamed A Elfiki, Nilly H Abdalla, Rehab M Abd Elkareem, Ayman S Soliman, Riem M Elmessiery. The potential use of urinary transferrin, urinary adiponectin, urinary Retinol Binding Protein, and serum zinc alpha 2 glycoprotein levels as novel biomarkers for early diagnosis of diabetic nephropathy: A case-control study.
Diabetes & metabolic syndrome.
2022 Apr; 16(4):102473. doi:
10.1016/j.dsx.2022.102473. [PMID: 35405355] - Chengcheng Fan, Douglas C Rees. Glutathione binding to the plant AtAtm3 transporter and implications for the conformational coupling of ABC transporters.
eLife.
2022 03; 11(?):. doi:
10.7554/elife.76140. [PMID: 35333177] - Alissa Groenendijk, Harm van Tinteren, Yilin Jiang, Ronald R de Krijger, Gordan M Vujanic, Jan Godzinski, Christian Rübe, Jens-Peter Schenk, Carlo Morosi, Kathy Pritchard-Jones, Reem Al-Saadi, Sucheta J Vaidya, Arnauld C Verschuur, Gema L Ramírez-Villar, Norbert Graf, Beatriz de Camargo, Jarno Drost, Daniela Perotti, Marry M van den Heuvel-Eibrink, Jesper Brok, Filippo Spreafico, Annelies M C Mavinkurve-Groothuis. Outcome of SIOP patients with low- or intermediate-risk Wilms tumour relapsing after initial vincristine and actinomycin-D therapy only - the SIOP 93-01 and 2001 protocols.
European journal of cancer (Oxford, England : 1990).
2022 03; 163(?):88-97. doi:
10.1016/j.ejca.2021.12.014. [PMID: 35042071] - Yan-Jun Lin, Kun-Li Jiao, Bo Liu, Lu Fang, Shu Meng. Antiplatelet and myocardial protective effect of Shexiang Tongxin Dropping Pill in patients undergoing percutaneous coronary intervention: A randomized controlled trial.
Journal of integrative medicine.
2022 03; 20(2):126-134. doi:
10.1016/j.joim.2022.01.001. [PMID: 35101369] - Cindy Banh, Kendall Valsvik, Alejandra Arredondo, Kassie Notbohm, Emad Elquza, Hani Babiker, Andrew Kraft, Alejandro Recio Boiles, Daniel Persky, Alicia Ortega, Ali McBride. Transitioning ifosfamide chemotherapy regimens to the ambulatory setting: reviewing cost savings and safety profile.
Supportive care in cancer : official journal of the Multinational Association of Supportive Care in Cancer.
2022 Mar; 30(3):2755-2766. doi:
10.1007/s00520-021-06653-4. [PMID: 34825982] - Mingyi Lv, Dengmei Xie, Xiaofeng Long. The effect of fenofibrate, a peroxisome proliferator-activated receptor α agonist, on cardiac damage from sepsis in BALB/c mice.
Cellular and molecular biology (Noisy-le-Grand, France).
2022 Feb; 67(6):260-266. doi:
10.14715/cmb/2021.67.6.34. [PMID: 35818188] - D-L Wang, X Li, R-N Wang, Y Sun, X-S Xia, W-J Tian, L Wang. A study of microRNA-223 in evaluating platelet reactivity in patients with acute ischemic stroke.
Journal of physiology and pharmacology : an official journal of the Polish Physiological Society.
2022 Feb; 73(1):. doi:
10.26402/jpp.2022.1.11. [PMID: 35793763] - Kang Chen, Yong Yao, Xinxin Mao, Hui You, Linjie Wang, Lian Duan, Kan Deng, Wen Zhang, Xin Lian, Huijuan Zhu. Sellar germinoma mimicking IgG4-related hypophysitis: a case report.
BMC endocrine disorders.
2022 Jan; 22(1):23. doi:
10.1186/s12902-021-00930-3. [PMID: 35033046] - Abderrahim Nemmar, Marc F Hoylaerts. Neutrophil Cathepsin G Enhances Thrombogenicity of Mildly Injured Arteries via ADP-Mediated Platelet Sensitization.
International journal of molecular sciences.
2022 Jan; 23(2):. doi:
10.3390/ijms23020744. [PMID: 35054930] - Magdalena Kluska, Michał Juszczak, Jerzy Żuchowski, Anna Stochmal, Katarzyna Woźniak. Effect of Kaempferol and Its Glycoside Derivatives on Antioxidant Status of HL-60 Cells Treated with Etoposide.
Molecules (Basel, Switzerland).
2022 Jan; 27(2):. doi:
10.3390/molecules27020333. [PMID: 35056649] - Tatiana R Rosenstock, Congxin Sun, Georgina Wynne Hughes, Katherine Winter, Sovan Sarkar. Analysis of Mitochondrial Dysfunction by Microplate Reader in hiPSC-Derived Neuronal Cell Models of Neurodegenerative Disorders.
Methods in molecular biology (Clifton, N.J.).
2022; 2549(?):1-21. doi:
10.1007/7651_2021_451. [PMID: 35347693] - Fabrice Lucien, Eduardo E Benarroch, Aidan Mullan, Farwa Ali, Bradley F Boeve, Michelle M Mielke, Ronald C Petersen, Yohan Kim, Cole Stang, Emanuele Camerucci, Owen A Ross, Zbigniew K Wszolek, David Knopman, James Bower, Wolfgang Singer, Rodolfo Savica. Poly (ADP-Ribose) and α-synuclein extracellular vesicles in patients with Parkinson disease: A possible biomarker of disease severity.
PloS one.
2022; 17(4):e0264446. doi:
10.1371/journal.pone.0264446. [PMID: 35395000] - Fangfei Li, Xiaoqiu Wu, Xuekun Fu, Jin Liu, Wangze Song, Gary Guishan Xiao, Aiping Lu, Ge Zhang. Poly (ADP-ribose) polymerase 1 (PARP1) inhibition promotes pulmonary metastasis of osteosarcoma by boosting ezrin phosphorylation.
International journal of biological sciences.
2022; 18(3):1238-1253. doi:
10.7150/ijbs.58784. [PMID: 35173550] - Shifen Fan, Jiao Chen, Zhouyang Liu, Juan Xiao, Fan Jiang, Xiaomei Liu, Yuan Sun. Efficacy of Allogeneic Hematopoietic Stem Cell Transplantation with Cocktail Conditioning Regimen for the Treatment of Pediatric Patients with Chronic Active Epstein-Barr Virus: A Retrospective Observational Study.
Stem cells and development.
2022 01; 31(1-2):26-31. doi:
10.1089/scd.2021.0205. [PMID: 34779276] - Kai Jakobs, Leander Reinshagen, Marianna Puccini, Julian Friebel, Anne-Christin Beatrice Wilde, Ayman Alsheik, Andi Rroku, Ulf Landmesser, Arash Haghikia, Nicolle Kränkel, Ursula Rauch-Kröhnert. Disease Severity in Moderate-to-Severe COVID-19 Is Associated With Platelet Hyperreactivity and Innate Immune Activation.
Frontiers in immunology.
2022; 13(?):844701. doi:
10.3389/fimmu.2022.844701. [PMID: 35359931] - Min Yu, Qian Zhang, Shan Xu, Ting Yin, Fei Li. Successful treatment of refractory retroperitoneal Epstein-Barr virus-positive diffuse large B-cell lymphoma with secondary hemophagocytic syndrome by sequential combination regimen of PD-1 blockade and chimeric antigen receptor T cells: a case report.
Anti-cancer drugs.
2022 01; 33(1):e769-e775. doi:
10.1097/cad.0000000000001187. [PMID: 34387604] - Monica Hoang, Emelien Jentz, Sarah M Janssen, Daniela Nasteska, Federica Cuozzo, David J Hodson, A Russell Tupling, Guo-Hua Fong, Jamie W Joseph. Isoform-specific Roles of Prolyl Hydroxylases in the Regulation of Pancreatic β-Cell Function.
Endocrinology.
2022 01; 163(1):. doi:
10.1210/endocr/bqab226. [PMID: 34718519] - Wei-Ling Yan, Shi-Long Yang, Fen-Ying Zhao, Xiao-Jun Xu. Ruxolitinib is an alternative to etoposide for patient with hemophagocytic lymphohistiocytosis complicated by acute renal injury: A case report.
Journal of oncology pharmacy practice : official publication of the International Society of Oncology Pharmacy Practitioners.
2022 Jan; 28(1):222-227. doi:
10.1177/10781552211020821. [PMID: 34074166] - Osama M Alshehri, Saleh Alshamrani, Mater H Mahnashi, Mohammed Merae Alshahrani, Jalwa Ali Khan, Muhammad Shah, Mohammed Ali Alshehri, Rehman Zafar, Muhammad Zahoor, Muhammad Saeed Jan, Syed Shams Ul Hassan, Abdul Sadiq. Phytochemical Analysis, Total Phenolic, Flavonoid Contents, and Anticancer Evaluations of Solvent Extracts and Saponins of H. digitata.
BioMed research international.
2022; 2022(?):9051678. doi:
10.1155/2022/9051678. [PMID: 36246962] - Natalia Rukoyatkina, Valentina Shpakova, Alina Bogoutdinova, Alexandra Kharazova, Igor Mindukshev, Stepan Gambaryan. Curcumin by activation of adenosine A2A receptor stimulates protein kinase a and potentiates inhibitory effect of cangrelor on platelets.
Biochemical and biophysical research communications.
2022 01; 586(?):20-26. doi:
10.1016/j.bbrc.2021.11.006. [PMID: 34823218] - Elena Díaz-García, Sara García-Tovar, Enrique Alfaro, Ester Zamarrón, Alberto Mangas, Raúl Galera, José Juan Ruíz-Hernández, Jordi Solé-Violán, Carlos Rodríguez-Gallego, Ana Van-Den-Rym, Rebeca Pérez-de-Diego, Kapil Nanwani-Nanwani, Eduardo López-Collazo, Francisco García-Rio, Carolina Cubillos-Zapata. Role of CD39 in COVID-19 Severity: Dysregulation of Purinergic Signaling and Thromboinflammation.
Frontiers in immunology.
2022; 13(?):847894. doi:
10.3389/fimmu.2022.847894. [PMID: 35173744] - Reham M Morsi, Doaa S Mansour, Amr M Mousa. Ameliorative potential role of Rosmarinus officinalis extract on toxicity induced by etoposide in male albino rats.
Brazilian journal of biology = Revista brasleira de biologia.
2022; 84(?):e258234. doi:
10.1590/1519-6984.258234. [PMID: 35830129] - Min Du, Jianbo Yin. Dual-Drug Nanosystem: Etoposide Prodrug and Cisplatin Coloaded Nanostructured Lipid Carriers for Lung Cancer Therapy.
Drug design, development and therapy.
2022; 16(?):4139-4149. doi:
10.2147/dddt.s386100. [PMID: 36506793] - Matthew J Murray, Rafael Moleron, Jennifer Adamski, Martin English, G A Amos Burke, Justin Cross, Thankamma Ajithkumar, Sara Stoneham, James C Nicholson. Vinblastine monotherapy induction prior to radiotherapy for patients with intracranial germinoma during the COVID-19 pandemic.
Pediatric blood & cancer.
2022 01; 69(1):e29359. doi:
10.1002/pbc.29359. [PMID: 34520101] - Devaraja Sannaningaiah, Ashwini Shivaiah, Jayanna Kengaiah, Chandramma Srinivasa, Sharath Kumar M Nandish, Chethana Ramachandraiah, Sujatha Hanumegowda, Bhagyalakshmi Manjappa, Sebastin Santosh Martin, Ramesh Komalapura Laxmaiah, Manohar Shinde. Sorghum Protein Extract Protects RBC from Sodium Nitrite-Induced Oxidative Stress and Exhibits Anticoagulant and Antiplatelet Activity.
Folia medica.
2021 Dec; 63(6):884-894. doi:
10.3897/folmed.63.e57713. [PMID: 35851225]
