Glucose 6-phosphate (BioDeep_00000001753)
Secondary id: BioDeep_00000001723, BioDeep_00000271000, BioDeep_00000399926
natural product human metabolite PANOMIX_OTCML-2023 Endogenous blood metabolite BioNovoGene_Lab2019 Volatile Flavor Compounds
代谢物信息卡片
化学式: C6H13O9P (260.0297178)
中文名称: D-葡糖-6-磷酸, 6-磷酸葡萄糖, β-D-葡萄糖-6-磷酸钠盐
谱图信息:
最多检出来源 Homo sapiens(blood) 0.02%
分子结构信息
SMILES: C(C1C(C(C(C(O1)O)O)O)O)OP(=O)(O)O
InChI: 1,3-6,8-11H,2H2,(H2,12,13,14)
描述信息
Glucose 6 phosphate (alpha-D-glucose 6 phosphate or G6P) is the alpha-anomer of glucose-6-phosphate. There are two anomers of glucose 6 phosphate, the alpha anomer and the beta anomer. Glucose 6 phosphate is an ester of glucose with phosphoric acid, made in the course of glucose metabolism by mammalian and other cells. It is a normal constituent of resting muscle and probably is in constant equilibrium with fructose-6-phosphate. (Stedman, 26th ed). Glucose-6-phosphate is a phosphorylated glucose molecule on carbon 6. When glucose enters a cell, it is immediately phosphorylated to G6P. This is catalyzed with hexokinase enzymes, thus consuming one ATP. A major reason for immediate phosphorylation of the glucose is so that it cannot diffuse out of the cell. The phosphorylation adds a charged group so the G6P cannot easily cross cell membranes. G6P can travel down two metabolic pathways, glycolysis and the pentose phosphate pathway. In addition to the metabolic pathways, G6P can also be stored as glycogen in the liver if blood glucose levels are high. If the body needs energy or carbon skeletons for syntheses, G6P can be isomerized to Fructose-6-phosphate and then phosphorylated to Fructose-1,6-bisphosphate. Note, the molecule now has 2 phosphoryl groups attached. The addition of the 2nd phosphoryl group is an irreversible step, so once this happens G6P will enter glycolysis and be turned into pyruvate (ATP production occurs). If blood glucose levels are high, the body needs a way to store the excess glucose. After being converted to G6P, phosphoglucose mutase (isomerase) can turn the molecule into glucose-1-phosphate. Glucose-1-phosphate can then be combined with uridine triphosphate (UTP) to form UDP-glucose. This reaction is driven by the hydrolysis of pyrophosphate that is released in the reaction. Now, the activated UDP-glucose can add to a growing glycogen molecule with the help of glycogen synthase. This is a very efficient storage mechanism for glucose since it costs the body only 1 ATP to store the 1 glucose molecule and virtually no energy to remove it from storage. It is important to note that glucose-6-phosphate is an allosteric activator of glycogen synthase, which makes sense because when the level of glucose is high the body should store the excess glucose as glycogen. On the other hand, glycogen synthase is inhibited when it is phosphorylated by protein kinase a during times of high stress or low blood glucose levels. -- Wikipedia [HMDB]
Glucose 6-phosphate (G6P, sometimes called the Robison ester) is a glucose sugar phosphorylated at the hydroxy group on carbon 6. Glucose 6-phosphate (G6P) has two anomers: the alpha anomer and the beta anomer. Glucose 6-phosphate is an ester of glucose with phosphoric acid, made in the course of glucose metabolism by mammalian and other cells. It is a normal constituent of resting muscle and probably is in constant equilibrium with fructose 6-phosphate (Stedman, 26th ed). When glucose enters a cell, it is immediately phosphorylated to G6P. This is catalyzed with hexokinase enzymes, thus consuming one ATP. A major reason for immediate phosphorylation of the glucose is so that it cannot diffuse out of the cell. The phosphorylation adds a charged group so the G6P cannot easily cross cell membranes. G6P can travel down two metabolic pathways: glycolysis and the pentose phosphate pathway. In addition to the metabolic pathways, G6P can also be stored as glycogen in the liver if blood glucose levels are high. If the body needs energy or carbon skeletons for syntheses, G6P can be isomerized to fructose 6-phosphate and then phosphorylated to fructose 1,6-bisphosphate. Note, the molecule now has 2 phosphoryl groups attached. The addition of the 2nd phosphoryl group is an irreversible step, so once this happens G6P will enter glycolysis and be turned into pyruvate (ATP production occurs). If blood glucose levels are high, the body needs a way to store the excess glucose. After being converted to G6P, phosphoglucose mutase (an isomerase) can turn the molecule into glucose 1-phosphate. Glucose 1-phosphate can then be combined with uridine triphosphate (UTP) to form UDP-glucose. This reaction is driven by the hydrolysis of pyrophosphate that is released in the reaction. Now, the activated UDP-glucose can add to a growing glycogen molecule with the help of glycogen synthase. This is a very efficient storage mechanism for glucose since it costs the body only 1 ATP to store the 1 glucose molecule and virtually no energy to remove it from storage. It is important to note that glucose 6-phosphate is an allosteric activator of glycogen synthase, which makes sense because when the level of glucose is high the body should store the excess glucose as glycogen. On the other hand, glycogen synthase is inhibited when it is phosphorylated by protein kinase during times of high stress or low blood glucose levels.
Acquisition and generation of the data is financially supported in part by CREST/JST.
CONFIDENCE standard compound; INTERNAL_ID 237
KEIO_ID G003; [MS2] KO009109
KEIO_ID G003
同义名列表
22 个代谢物同义名
{[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy}phosphonic acid; D-Glucose-6-phosphate sodium salt; D-Glucopyranose 6-phosphoric acid; D-Glucose-6-dihydrogen phosphate; D(+)-Glucopyranose 6-phosphate; 6-O-Phosphono-D-glucopyranose; alpha-D-Glucose 6- phosphate; alpha-D-Glucose 6-phosphate; D-Glucose 6-phosphoric acid; alpha-D-Hexose 6-phosphate; Glucose 6-phosphoric acid; a-D-Glucose 6- phosphate; D-Glucose 6-phosphate; D-Glucose-6-phosphate; D-Hexose 6-phosphate; Glucose-6-phosphate; Glucose 6-phosphate; Glucose_6-phosphate; Robison ester; GLC6p; Glucose 6-phosphate (G6P); D-Glucose 6-phosphate
数据库引用编号
50 个数据库交叉引用编号
- ChEBI: CHEBI:4170
- KEGG: C00092
- PubChem: 5958
- HMDB: HMDB0001401
- Metlin: METLIN145
- ChEMBL: CHEMBL4283156
- Wikipedia: Glucose_6-phosphate
- MetaCyc: D-glucose-6-phosphate
- KNApSAcK: C00007306
- foodb: FDB021818
- chemspider: 5743
- CAS: 299-31-0
- CAS: 56-73-5
- MoNA: KO009109
- MoNA: KO002917
- MoNA: RP023713
- MoNA: RP023712
- MoNA: KO002915
- MoNA: PS020901
- MoNA: RP023701
- MoNA: PS020902
- MoNA: KO002914
- MoNA: KO000809
- MoNA: KO000811
- MoNA: RP023702
- MoNA: PS020909
- MoNA: KO009111
- MoNA: PS020907
- MoNA: PS020910
- MoNA: KO000813
- MoNA: KO000810
- MoNA: KO009110
- MoNA: PS020908
- MoNA: KO000812
- MoNA: KO002918
- MoNA: PR100547
- MoNA: KO002916
- MoNA: RP023703
- MoNA: RP023711
- PubChem: 3392
- PDB-CCD: BG6
- PDB-CCD: G6P
- 3DMET: B04630
- NIKKAJI: J166.116G
- NIKKAJI: J40.066A
- RefMet: Glucose 6-phosphate
- BioNovoGene_Lab2019: BioNovoGene_Lab2019-172
- BioNovoGene_Lab2019: BioNovoGene_Lab2019-96
- KNApSAcK: 4170
- LOTUS: LTS0123696
分类词条
相关代谢途径
BioCyc(57)
- chitin biosynthesis
- O-antigen building blocks biosynthesis (E. coli)
- trehalose degradation II (cytosolic)
- UDP-N-acetyl-D-glucosamine biosynthesis I
- sucrose degradation II (sucrose synthase)
- superpathway of anaerobic sucrose degradation
- superpathway of UDP-N-acetylglucosamine-derived O-antigen building blocks biosynthesis
- glycogen degradation I
- starch biosynthesis
- formaldehyde oxidation I
- superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass
- 1,3-propanediol biosynthesis (engineered)
- streptomycin biosynthesis
- superpathway of glycolysis and the Entner-Doudoroff pathway
- Entner-Doudoroff pathway I
- pentose phosphate pathway
- NAD/NADP-NADH/NADPH cytosolic interconversion (yeast)
- superpathway NAD/NADP - NADH/NADPH interconversion (yeast)
- gluconeogenesis I
- glycogen degradation II
- D-galactose degradation V (Leloir pathway)
- glycolysis I (from glucose 6-phosphate)
- UDP-α-D-glucose biosynthesis I
- myo-inositol biosynthesis
- dolichyl glucosyl phosphate biosynthesis
- superpathway NAD/NADP - NADH/NADPH interconversion
- NAD/NADP-NADH/NADPH cytosolic interconversion
- UDP-glucose biosynthesis
- D-galactose degradation I (Leloir pathway)
- gluconeogenesis II (Methanobacterium thermoautotrophicum)
- Methanobacterium thermoautotrophicum biosynthetic metabolism
- colanic acid building blocks biosynthesis
- sucrose biosynthesis II
- trehalose degradation IV
- GDP-mannose biosynthesis
- superpathway of GDP-mannose-derived O-antigen building blocks biosynthesis
- starch degradation III
- UDP-N-acetyl-D-glucosamine biosynthesis II
- glycolysis V (Pyrococcus)
- glycolysis III (from glucose)
- glycogen biosynthesis I (from ADP-D-Glucose)
- superpathway of UDP-glucose-derived O-antigen building blocks biosynthesis
- di-myo-inositol phosphate biosynthesis
- glucose and glucose-1-phosphate degradation
- trehalose biosynthesis I
- trehalose biosynthesis
- trehalose degradation
- superpathway of mycolyl-arabinogalactan-peptidoglycan complex biosynthesis
- trehalose degradation I (low osmolarity)
- trehalose degradation V
- glycogen biosynthesis III (from α-maltose 1-phosphate)
- trehalose biosynthesis II
- trehalose degradation II (trehalase)
- myo-inositol de novo biosynthesis
- 1D-myo-inositol hexakisphosphate biosynthesis IV (Dictyostelium)
- 1D-myo-inositol hexakisphosphate biosynthesis III (Spirodela polyrrhiza)
- starch degradation V
PlantCyc(0)
代谢反应
1204 个相关的代谢反应过程信息。
Reactome(42)
- Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Inositol phosphate metabolism:
ATP + I(3,4,5,6)P4 ⟶ ADP + I(1,3,4,5,6)P5
- Synthesis of IP2, IP, and Ins in the cytosol:
H2O + I4P ⟶ Ins + Pi
- Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Inositol phosphate metabolism:
H2O + I4P ⟶ Ins + Pi
- Synthesis of IP2, IP, and Ins in the cytosol:
H2O + I4P ⟶ Ins + Pi
- Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Inositol phosphate metabolism:
H2O + I4P ⟶ Ins + Pi
- Synthesis of IP2, IP, and Ins in the cytosol:
H2O + I4P ⟶ Ins + Pi
- Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi
- Inositol phosphate metabolism:
H2O + I4P ⟶ Ins + Pi
- Synthesis of IP2, IP, and Ins in the cytosol:
H2O + I4P ⟶ Ins + Pi
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Inositol phosphate metabolism:
H2O + I4P ⟶ Ins + Pi
- Synthesis of IP2, IP, and Ins in the cytosol:
H2O + I4P ⟶ Ins + Pi
- Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Inositol phosphate metabolism:
H2O + I4P ⟶ Ins + Pi
- Synthesis of IP2, IP, and Ins in the cytosol:
H2O + I4P ⟶ Ins + Pi
- Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Inositol phosphate metabolism:
H2O + I4P ⟶ Ins + Pi
- Synthesis of IP2, IP, and Ins in the cytosol:
H2O + I4P ⟶ Ins + Pi
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Inositol phosphate metabolism:
H2O + I4P ⟶ Ins + Pi
- Synthesis of IP2, IP, and Ins in the cytosol:
H2O + I4P ⟶ Ins + Pi
- Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Inositol phosphate metabolism:
ATP + I(1,3,4)P3 ⟶ ADP + I(1,3,4,5)P4
- Synthesis of IP2, IP, and Ins in the cytosol:
H2O + I4P ⟶ Ins + Pi
- Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Inositol phosphate metabolism:
H2O + I(1,4,5)P3 ⟶ I(1,4)P2 + Pi
- Synthesis of IP2, IP, and Ins in the cytosol:
H2O + I(1,4,5)P3 ⟶ I(1,4)P2 + Pi
- Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Inositol phosphate metabolism:
H2O + I4P ⟶ Ins + Pi
- Synthesis of IP2, IP, and Ins in the cytosol:
H2O + I4P ⟶ Ins + Pi
- Metabolism:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine
- Inositol phosphate metabolism:
H2O + I4P ⟶ Ins + Pi
- Synthesis of IP2, IP, and Ins in the cytosol:
H2O + I4P ⟶ Ins + Pi
- Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi
- Inositol phosphate metabolism:
H2O + I(1,4,5)P3 ⟶ I(1,4)P2 + Pi
- Synthesis of IP2, IP, and Ins in the cytosol:
H2O + I(1,4,5)P3 ⟶ I(1,4)P2 + Pi
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Inositol phosphate metabolism:
H2O + I4P ⟶ Ins + Pi
- Synthesis of IP2, IP, and Ins in the cytosol:
H2O + I4P ⟶ Ins + Pi
BioCyc(442)
- paromamine biosynthesis I:
2-deoxy-scyllo-inosamine + NAD(P)+ ⟶ 3-amino-2,3-dideoxy-scyllo-inosose + H+ + NAD(P)H
- paromamine biosynthesis II:
2-deoxy-L-scyllo-inosose + gln ⟶ 2-deoxy-scyllo-inosamine + 2-oxoglutaramate
- superpathway of neomycin biosynthesis:
2-deoxy-scyllo-inosamine + NAD(P)+ ⟶ 3-amino-2,3-dideoxy-scyllo-inosose + H+ + NAD(P)H
- kanamycin biosynthesis:
2-deoxy-L-scyllo-inosose + gln ⟶ 2-deoxy-scyllo-inosamine + 2-oxoglutaramate
- gluconeogenesis:
D-glucopyranose 6-phosphate + H2O ⟶ D-glucopyranose + phosphate
- glycogenolysis:
H2O + a α-limit dextrin with short branches ⟶ D-glucopyranose + a debranched α-limit dextrin
- pentose phosphate pathway (oxidative branch):
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- superpathway of conversion of glucose to acetyl CoA and entry into the TCA cycle:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- D-galactose degradation V (Leloir pathway):
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP + H+
- GDP-mannose biosynthesis:
D-glucopyranose 6-phosphate ⟶ F6P
- GDP-glucose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- UDP-N-acetyl-D-galactosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- UDP-α-D-glucose biosynthesis I:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- glycolysis:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- myo-inositol de novo biosynthesis:
H2O + Ins(3)P ⟶ myo-inositol + phosphate
- trehalose degradation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- NAD/NADP-NADH/NADPH cytosolic interconversion (yeast):
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- superpathway NAD/NADP - NADH/NADPH interconversion (yeast):
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- chitin biosynthesis:
UDP-N-acetyl-α-D-glucosamine + chitin ⟶ UDP + chitin
- 1D-myo-inositol hexakisphosphate biosynthesis IV (Dictyostelium):
D-glucopyranose 6-phosphate ⟶ Ins(3)P
- 1D-myo-inositol hexakisphosphate biosynthesis III (Spirodela polyrrhiza):
D-glucopyranose 6-phosphate ⟶ Ins(3)P
- superpathway of mycolyl-arabinogalactan-peptidoglycan complex biosynthesis:
D-glucopyranose 6-phosphate ⟶ F6P
- formaldehyde oxidation I:
hexulose 6-phosphate ⟶ D-ribulose 5-phosphate + formaldehyde
- O-antigen building blocks biosynthesis (E. coli):
D-glucopyranose 6-phosphate ⟶ F6P
- superpathway of glycolysis and the Entner-Doudoroff pathway:
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate
- 1,5-anhydrofructose degradation:
1,5-anhydro-D-mannitol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ D-mannopyranose + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate
- colanic acid building blocks biosynthesis:
D-mannopyranose 6-phosphate ⟶ F6P
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- sucrose biosynthesis III:
D-glucopyranose 6-phosphate ⟶ F6P
- D-sorbitol biosynthesis I:
D-sorbitol 6-phosphate + NADP+ ⟶ D-glucopyranose 6-phosphate + H+ + NADPH
- phosphatidylinositol biosynthesis I (bacteria):
D-glucopyranose 6-phosphate ⟶ Ins(3)P
- trehalose degradation IV:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- trehalose degradation I (low osmolarity):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- trehalose degradation V:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- trehalose degradation II (cytosolic):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- Bifidobacterium shunt:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- 1,3-propanediol biosynthesis (engineered):
1,3-propanediol + NADP+ ⟶ 3-hydroxypropionaldehyde + H+ + NADPH
- glucosylglycerol biosynthesis:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- GDP-mannose biosynthesis:
D-mannopyranose 6-phosphate ⟶ F6P
- GDP-glucose biosynthesis:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- superpathway of GDP-mannose-derived O-antigen building blocks biosynthesis:
D-mannopyranose 6-phosphate ⟶ F6P
- mycothiol biosynthesis:
acetyl-CoA + deacetylmycothiol ⟶ H+ + coenzyme A + mycothiol
- starch degradation V:
D-glucopyranose + a maltodextrin ⟶ a maltodextrin + maltose
- starch degradation III:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- streptomycin biosynthesis:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- gluconeogenesis III:
ATP + hydrogencarbonate + pyruvate ⟶ ADP + H+ + oxaloacetate + phosphate
- gluconeogenesis I:
β-D-fructose 1,6-bisphosphate ⟶ D-glyceraldehyde 3-phosphate + DHAP
- gluconeogenesis II (Methanobacterium thermoautotrophicum):
CO + H2O + an oxidized ferredoxin [iron-sulfur] cluster ⟶ CO2 + H+ + a reduced ferredoxin [iron-sulfur] cluster
- glycogen degradation II:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- glycogen degradation I:
H2O + maltotriose ⟶ D-glucopyranose + maltose
- UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- D-galactose degradation V (Leloir pathway):
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- D-galactose degradation I (Leloir pathway):
α-D-galactose 1-phosphate + UDP-α-D-glucose ⟶ α-D-glucopyranose 1-phosphate + UDP-α-D-galactose
- UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucopyranose 6-phosphate ⟶ F6P
- kanosamine biosynthesis II:
D-glucopyranose 6-phosphate + NAD+ ⟶ 3-dehydro-D-glucose 6-phosphate + H+ + NADH
- Methanobacterium thermoautotrophicum biosynthetic metabolism:
CO + H2O + an oxidized ferredoxin [iron-sulfur] cluster ⟶ CO2 + H+ + a reduced ferredoxin [iron-sulfur] cluster
- sucrose degradation II (sucrose synthase):
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- glycolysis I (from glucose 6-phosphate):
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate
- glycolysis V (Pyrococcus):
D-glyceraldehyde 3-phosphate + H2O + an oxidized ferredoxin [iron-sulfur] cluster ⟶ 3-phospho-D-glycerate + H+ + a reduced ferredoxin [iron-sulfur] cluster
- sucrose degradation IV (sucrose phosphorylase):
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- glycolysis III (from glucose):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- sucrose degradation III (sucrose invertase):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- glycogen biosynthesis III (from α-maltose 1-phosphate):
α-maltose ⟶ α,α-trehalose
- glycogen biosynthesis I (from ADP-D-Glucose):
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- starch biosynthesis:
a (1,6)-α-D-glucosyl-(1,4)-α-glucan ⟶ amylopectin
- UDP-N-acetyl-D-galactosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- UDP-N-acetyl-D-galactosamine biosynthesis III:
D-glucopyranose 6-phosphate ⟶ F6P
- sucrose biosynthesis I (from photosynthesis):
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- UDP-α-D-glucose biosynthesis I:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- Entner-Doudoroff pathway I:
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate
- L-ascorbate biosynthesis V:
aldehydo-L-galactonate + H+ ⟶ H2O + L-galactono-1,4-lactone
- homolactic fermentation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- heterolactic fermentation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- superpathway of UDP-glucose-derived O-antigen building blocks biosynthesis:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- pentose phosphate pathway:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- pentose phosphate pathway (oxidative branch) I:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- myo-inositol biosynthesis:
D-glucopyranose 6-phosphate ⟶ Ins(3)P
- di-myo-inositol phosphate biosynthesis:
D-glucopyranose 6-phosphate ⟶ Ins(3)P
- superpathway of anaerobic sucrose degradation:
β-D-fructofuranose + ATP ⟶ ADP + F6P + H+
- superpathway of UDP-N-acetylglucosamine-derived O-antigen building blocks biosynthesis:
D-glucopyranose 6-phosphate ⟶ F6P
- glucose and glucose-1-phosphate degradation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- superpathway of glucose and xylose degradation:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- trehalose biosynthesis II:
ADP-α-D-glucose + D-glucopyranose 6-phosphate ⟶ α,α-trehalose 6-phosphate + ADP + H+
- trehalose biosynthesis I:
D-glucopyranose 6-phosphate + UDP-α-D-glucose ⟶ α,α-trehalose 6-phosphate + H+ + UDP
- pentose phosphate pathway (oxidative branch) I:
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- glycogen degradation I:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- glucose and glucose-1-phosphate degradation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- superpathway of glycolysis and the Entner-Doudoroff pathway:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA
- trehalose biosynthesis I:
α,α-trehalose 6-phosphate + H2O ⟶ α,α-trehalose + phosphate
- O-antigen building blocks biosynthesis (E. coli):
NADP+ + dTDP-β-L-rhamnose ⟶ H+ + NADPH + dTDP-4-dehydro-β-L-rhamnose
- gluconeogenesis I:
(S)-malate + NADP+ ⟶ CO2 + NADPH + pyruvate
- colanic acid building blocks biosynthesis:
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- glycogen biosynthesis I (from ADP-D-Glucose):
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- glycolysis I (from glucose 6-phosphate):
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate
- GDP-mannose biosynthesis:
D-glucopyranose 6-phosphate ⟶ F6P
- pentose phosphate pathway:
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- trehalose degradation I (low osmolarity):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- trehalose degradation II (cytosolic):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- UDP-α-D-glucose biosynthesis I:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- UDP-N-acetyl-D-glucosamine biosynthesis I:
α-D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A
- glucose-6-phosphate biosynthesis:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- dolichyl glucosyl phosphate biosynthesis:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- myo-inositol biosynthesis:
H2O + Ins(3)P ⟶ myo-inositol + phosphate
- D-galactose degradation V (Leloir pathway):
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP + H+
- glycogen degradation II:
H2O + a α-limit dextrin with short branches ⟶ D-glucopyranose + a debranched α-limit dextrin
- trehalose degradation II (cytosolic):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- superpathway NAD/NADP - NADH/NADPH interconversion:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH
- NAD/NADP-NADH/NADPH cytosolic interconversion:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH
- sucrose degradation III:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- GDP-mannose biosynthesis:
D-glucopyranose 6-phosphate ⟶ F6P
- UDP-glucose biosynthesis:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- pentose phosphate pathway (oxidative branch):
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- trehalose biosynthesis:
α,α-trehalose 6-phosphate + H2O ⟶ α,α-trehalose + phosphate
- pentose phosphate pathway:
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- glycolysis:
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate
- glycolysis III (from glucose):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- gluconeogenesis:
ATP + oxaloacetate ⟶ ADP + CO2 + phosphoenolpyruvate
- chitin biosynthesis:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- myo-inositol biosynthesis:
D-glucopyranose 6-phosphate ⟶ Ins(3)P
- D-galactose degradation I (Leloir pathway):
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- pentose phosphate pathway (oxidative branch) I:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- sucrose degradation II (sucrose synthase):
D-glucopyranose 6-phosphate ⟶ F6P
- sucrose biosynthesis II:
D-glucopyranose 6-phosphate ⟶ F6P
- glycolysis I (from glucose 6-phosphate):
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate
- sucrose biosynthesis I (from photosynthesis):
D-glucopyranose 6-phosphate ⟶ F6P
- starch biosynthesis:
α-amylose ⟶ H2O + amylopectin
- UDP-glucose biosynthesis:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- trehalose biosynthesis I:
D-glucopyranose 6-phosphate + UDP-α-D-glucose ⟶ α,α-trehalose 6-phosphate + H+ + UDP
- sucrose degradation III (sucrose invertase):
D-glucopyranose 6-phosphate ⟶ F6P
- glucose and glucose-1-phosphate degradation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- GDP-mannose biosynthesis:
D-glucopyranose 6-phosphate ⟶ F6P
- pentose phosphate pathway:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- trehalose degradation II (trehalase):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- 1D-myo-inositol hexakisphosphate biosynthesis III (Spirodela polyrrhiza):
D-glucopyranose 6-phosphate ⟶ Ins(3)P
- GDP-glucose biosynthesis:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- gluconeogenesis I:
D-glucopyranose 6-phosphate ⟶ F6P
- gluconeogenesis III:
ATP + hydrogencarbonate + pyruvate ⟶ ADP + H+ + oxaloacetate + phosphate
- superpathway of sucrose and starch metabolism I (non-photosynthetic tissue):
D-glucopyranose 6-phosphate ⟶ F6P
- myo-inositol biosynthesis:
1D-myo-inositol (3)-monophosphate + H2O ⟶ myo-inositol + phosphate
- mycothiol biosynthesis:
1-(2-acetamido-2-deoxy-α-D-glucopyranosyl)-1D-myo-inositol + H2O ⟶ 1-(2-amino-2-deoxy-α-D-glucopyranoside)-1D-myo-inositol + acetate
- myo-inositol biosynthesis:
1D-myo-inositol (3)-monophosphate + H2O ⟶ myo-inositol + phosphate
- UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A
- UDP-α-D-glucose biosynthesis I:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- gluconeogenesis I:
ATP + oxaloacetate ⟶ ADP + CO2 + phosphoenolpyruvate
- glycogen degradation I:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- trehalose degradation I (low osmolarity):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA
- superpathway of glycolysis and the Entner-Doudoroff pathway:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- pentose phosphate pathway (oxidative branch) I:
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- pentose phosphate pathway:
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- D-galactose degradation I (Leloir pathway):
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP + H+
- D-galactose degradation V (Leloir pathway):
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP + H+
- GDP-mannose biosynthesis:
D-glucopyranose 6-phosphate ⟶ F6P
- glycolysis I (from glucose 6-phosphate):
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate
- glycogen biosynthesis I (from ADP-D-Glucose):
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- trehalose degradation I (low osmolarity):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- myo-inositol biosynthesis:
H2O + Ins(3)P ⟶ myo-inositol + phosphate
- glycogenolysis II:
H2O + a α-limit dextrin with short branches ⟶ β-D-glucose + a debranched α-limit dextrin
- myo-inositol biosynthesis:
1D-myo-inositol (3)-monophosphate + H2O ⟶ myo-inositol + phosphate
- 1D-myo-inositol hexakisphosphate biosynthesis III (Spirodela polyrrhiza):
myo-inositol + ATP ⟶ 1D-myo-inositol (3)-monophosphate + ADP + H+
- UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucopyranose 6-phosphate ⟶ F6P
- mycothiol biosynthesis:
acetyl-CoA + deacetylmycothiol ⟶ H+ + coenzyme A + mycothiol
- pentose phosphate pathway (oxidative branch) I:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- pentose phosphate pathway:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- phosphatidylinositol biosynthesis I (bacteria):
D-glucopyranose 6-phosphate ⟶ Ins(3)P
- D-galactose degradation I (Leloir pathway):
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- trehalose degradation II (cytosolic):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- UDP-α-D-glucose biosynthesis I:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- GDP-mannose biosynthesis:
D-glucopyranose 6-phosphate ⟶ F6P
- superpathway of mycolyl-arabinogalactan-peptidoglycan complex biosynthesis:
D-glucopyranose 6-phosphate ⟶ F6P
- gluconeogenesis I:
D-glucopyranose 6-phosphate ⟶ F6P
- myo-inositol biosynthesis:
D-glucopyranose 6-phosphate ⟶ Ins(3)P
- glycolysis I (from glucose 6-phosphate):
D-glucopyranose 6-phosphate ⟶ F6P
- glycogen biosynthesis III (from α-maltose 1-phosphate):
α-maltose + ATP ⟶ α-maltose 1-phosphate + ADP + H+
- trehalose biosynthesis I:
D-glucopyranose 6-phosphate + UDP-α-D-glucose ⟶ α,α-trehalose 6-phosphate + H+ + UDP
- trehalose biosynthesis II:
ADP-α-D-glucose + D-glucopyranose 6-phosphate ⟶ α,α-trehalose 6-phosphate + ADP + H+
- mycothiol biosynthesis:
1-(2-acetamido-2-deoxy-α-D-glucopyranosyl)-1D-myo-inositol + H2O ⟶ GlcN-Ins + acetate
- O-antigen building blocks biosynthesis (E. coli):
NADP+ + dTDP-β-L-rhamnose ⟶ H+ + NADPH + dTDP-4-dehydro-β-L-rhamnose
- UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A
- glycogen degradation II:
H2O + a debranched α-limit dextrin ⟶ D-glucopyranose
- glycolysis III (from glucose):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- myo-inositol biosynthesis:
H2O + Ins(3)P ⟶ myo-inositol + phosphate
- GDP-mannose biosynthesis:
D-glucopyranose 6-phosphate ⟶ F6P
- glycogen biosynthesis I (from ADP-D-Glucose):
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- superpathway of mycolyl-arabinogalactan-peptidoglycan complex biosynthesis:
NADP+ + dTDP-β-L-rhamnose ⟶ H+ + NADPH + dTDP-4-dehydro-β-L-rhamnose
- pentose phosphate pathway (oxidative branch):
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- gluconeogenesis I:
(S)-malate + NADP+ ⟶ CO2 + NADPH + pyruvate
- superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH
- glucose and glucose-1-phosphate degradation:
D-glucopyranose + UQ ⟶ D-glucono-1,5-lactone + UQH2
- homolactic fermentation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- UDP-glucose biosynthesis:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- glycolysis I (from glucose 6-phosphate):
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate
- trehalose biosynthesis I:
α,α-trehalose 6-phosphate + H2O ⟶ α,α-trehalose + phosphate
- glycogen degradation I:
H2O + maltotriose ⟶ D-glucopyranose + maltose
- starch degradation V:
H2O + starch ⟶ D-glucopyranose + a maltodextrin + maltose
- superpathway of glycolysis and the Entner-Doudoroff pathway:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- UDP-α-D-glucose biosynthesis I:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- GDP-mannose biosynthesis:
D-glucopyranose 6-phosphate ⟶ F6P
- gluconeogenesis I:
(S)-malate + NADP+ ⟶ CO2 + NADPH + pyruvate
- UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A
- glycolysis I (from glucose 6-phosphate):
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate
- trehalose degradation I (low osmolarity):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- trehalose degradation I (low osmolarity):
α,α-trehalose 6-phosphate + H2O ⟶ β-D-glucose 6-phosphate + D-glucopyranose
- myo-inositol biosynthesis:
H2O + Ins(3)P ⟶ myo-inositol + phosphate
- myo-inositol biosynthesis:
1D-myo-inositol (3)-monophosphate + H2O ⟶ myo-inositol + phosphate
- UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A
- sucrose degradation III (sucrose invertase):
H2O + sucrose ⟶ β-D-fructofuranose + D-glucopyranose
- trehalose degradation I (low osmolarity):
α,α-trehalose 6-phosphate + H2O ⟶ D-glucopyranose + D-glucopyranose 6-phosphate
- UDP-glucose biosynthesis:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- glycolysis III (from glucose):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- glycolysis I (from glucose 6-phosphate):
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate
- glycogen biosynthesis I (from ADP-D-Glucose):
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- myo-inositol biosynthesis:
H2O + Ins(3)P ⟶ myo-inositol + phosphate
- pentose phosphate pathway (oxidative branch):
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- pentose phosphate pathway:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- gluconeogenesis I:
(S)-malate + NADP+ ⟶ CO2 + NADPH + pyruvate
- superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate
- UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucopyranose 6-phosphate ⟶ F6P
- pentose phosphate pathway (oxidative branch) I:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- pentose phosphate pathway:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- GDP-mannose biosynthesis:
D-glucopyranose 6-phosphate ⟶ F6P
- glycolysis III (from glucose):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- glycogen degradation I:
H2O + maltotriose ⟶ D-glucopyranose + maltose
- glycolysis I (from glucose 6-phosphate):
D-glucopyranose 6-phosphate ⟶ F6P
- glycogen biosynthesis I (from ADP-D-Glucose):
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- superpathway of glucose and xylose degradation:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- glucose and glucose-1-phosphate degradation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- superpathway of glycolysis and the Entner-Doudoroff pathway:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
D-glucopyranose 6-phosphate ⟶ F6P
- UDP-α-D-glucose biosynthesis I:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- sucrose degradation IV (sucrose phosphorylase):
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- Entner-Doudoroff pathway I:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- myo-inositol biosynthesis:
D-glucopyranose 6-phosphate ⟶ Ins(3)P
- gluconeogenesis I:
D-glucopyranose 6-phosphate ⟶ F6P
- D-galactose degradation I (Leloir pathway):
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- O-antigen building blocks biosynthesis (E. coli):
D-glucopyranose 6-phosphate ⟶ F6P
- colanic acid building blocks biosynthesis:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- trehalose biosynthesis I:
α,α-trehalose 6-phosphate + H2O ⟶ α,α-trehalose + phosphate
- D-galactose degradation I (Leloir pathway):
β-D-galactopyranose ⟶ α-D-galactopyranose
- pentose phosphate pathway (oxidative branch) I:
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- GDP-mannose biosynthesis:
D-glucopyranose 6-phosphate ⟶ F6P
- glycogen degradation I:
D-glucopyranose + maltotetraose ⟶ maltose + maltotriose
- glycogen biosynthesis I (from ADP-D-Glucose):
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- UDP-α-D-glucose biosynthesis I:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- gluconeogenesis I:
(S)-malate + NADP+ ⟶ CO2 + NADPH + pyruvate
- superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA
- glycolysis III (from glucose):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- superpathway of glucose and xylose degradation:
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- pentose phosphate pathway:
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate
- superpathway of glycolysis and the Entner-Doudoroff pathway:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- homolactic fermentation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- myo-inositol biosynthesis:
H2O + Ins(3)P ⟶ myo-inositol + phosphate
- glycolysis I (from glucose 6-phosphate):
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate
- UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A
- myo-inositol biosynthesis:
1D-myo-inositol (3)-monophosphate + H2O ⟶ myo-inositol + phosphate
- formaldehyde oxidation I:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- homolactic fermentation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- heterolactic fermentation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate
- GDP-mannose biosynthesis:
D-glucopyranose 6-phosphate ⟶ F6P
- superpathway of glycolysis and Entner-Doudoroff:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- Bifidobacterium shunt:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- myo-inositol biosynthesis:
H2O + Ins(3)P ⟶ myo-inositol + phosphate
- superpathway of glycolysis and TCA variant VIII:
2-oxoglutarate + H+ ⟶ CO2 + succinate semialdehyde
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- colanic acid building blocks biosynthesis:
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-α-D-mannose + H+ + NADPH
- UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A
- glycogen biosynthesis I (from ADP-D-Glucose):
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- pentose phosphate pathway:
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- glycogen degradation I:
D-glucopyranose + maltotetraose ⟶ maltose + maltotriose
- glycolysis I (from glucose 6-phosphate):
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate
- mycothiol biosynthesis:
1-(2-acetamido-2-deoxy-α-D-glucopyranosyl)-1D-myo-inositol + H2O ⟶ GlcN-Ins + acetate
- UDP-glucose biosynthesis:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- sucrose biosynthesis I (from photosynthesis):
H2O + sucrose 6F-phosphate ⟶ phosphate + sucrose
- starch biosynthesis:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- gluconeogenesis I:
(S)-malate + NADP+ ⟶ CO2 + NADPH + pyruvate
- glycolysis III (from glucose):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- pentose phosphate pathway (oxidative branch):
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- glycolysis I:
(S)-lactate + NAD+ ⟶ H+ + NADH + pyruvate
- trehalose degradation V:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- peptidoglycan and lipid A precursor biosynthesis:
ATP + UDP-N-acetyl-α-D-muramate + ala ⟶ ADP + H+ + UDP-N-acetyl-α-D-muramoyl-L-alanine + phosphate
- O-antigen building blocks biosynthesis (E. coli):
NADP+ + dTDP-β-L-rhamnose ⟶ H+ + NADPH + dTDP-4-dehydro-β-L-rhamnose
- glycolysis I (from glucose 6-phosphate):
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate
- kanosamine biosynthesis II:
2-oxoglutarate + D-kanosamine 6-phosphate ⟶ 3-dehydro-D-glucose 6-phosphate + glu
- pentose phosphate pathway (oxidative branch) I:
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- pentose phosphate pathway:
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate
- gluconeogenesis I:
D-glyceraldehyde 3-phosphate + NADP+ + phosphate ⟶ 13-DPG + H+ + NADPH
- glycogen degradation I:
H2O + maltotriose ⟶ D-glucopyranose + maltose
- superpathway of glycolysis and the Entner-Doudoroff pathway:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- GDP-mannose biosynthesis:
D-glucopyranose 6-phosphate ⟶ F6P
- UDP-N-acetyl-D-glucosamine biosynthesis I:
α-D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A
- trehalose degradation I (low osmolarity):
α,α-trehalose 6-phosphate + H2O ⟶ D-glucopyranose + D-glucopyranose 6-phosphate
- glycogen biosynthesis I (from ADP-D-Glucose):
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- GDP-glucose biosynthesis:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- glycogen degradation I:
H2O + maltotriose ⟶ D-glucopyranose + maltose
- pentose phosphate pathway (oxidative branch):
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- glycogen degradation II:
H2O + a α-limit dextrin with short branches ⟶ D-glucopyranose + a debranched α-limit dextrin
- GDP-mannose biosynthesis:
D-glucopyranose 6-phosphate ⟶ F6P
- gluconeogenesis I:
(S)-malate + NADP+ ⟶ CO2 + NADPH + pyruvate
- homolactic fermentation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- myo-inositol biosynthesis:
H2O + Ins(3)P ⟶ myo-inositol + phosphate
- glycolysis I (from glucose 6-phosphate):
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate
- Methanobacterium thermoautotrophicum biosynthetic metabolism:
2-oxoglutarate + ala ⟶ glt + pyruvate
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- trehalose degradation II (trehalase):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- UDP-glucose biosynthesis:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- colanic acid building blocks biosynthesis:
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-α-D-mannose + H+ + NADPH
- trehalose biosynthesis I:
α,α-trehalose 6-phosphate + H2O ⟶ α,α-trehalose + phosphate
- superpathway of glycolysis and Entner-Doudoroff:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- glycolysis III (from glucose):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- pentose phosphate pathway:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- glucose and glucose-1-phosphate degradation:
D-glucopyranose + UQ ⟶ D-glucono-1,5-lactone + UQH2
- gluconeogenesis II (Methanobacterium thermoautotrophicum):
NADP+ + formate ⟶ CO2 + NADPH
- myo-inositol biosynthesis:
1D-myo-inositol (3)-monophosphate + H2O ⟶ myo-inositol + phosphate
- myo-inositol biosynthesis:
H2O + Ins(3)P ⟶ myo-inositol + phosphate
- superpathway of glycolysis and Entner-Doudoroff:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- sucrose biosynthesis I (from photosynthesis):
H2O + sucrose 6F-phosphate ⟶ phosphate + sucrose
- GDP-mannose biosynthesis:
D-glucopyranose 6-phosphate ⟶ F6P
- glycolysis III (from glucose):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- glycolysis I (from glucose 6-phosphate):
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate
- glycogen biosynthesis I (from ADP-D-Glucose):
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- pentose phosphate pathway (oxidative branch):
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- pentose phosphate pathway:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A
- UDP-glucose biosynthesis:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- gluconeogenesis I:
(S)-malate + NADP+ ⟶ CO2 + NADPH + pyruvate
- glycogen degradation II:
H2O + a debranched α-limit dextrin ⟶ D-glucopyranose
- L-ascorbate biosynthesis V:
aldehydo-L-galactonate + NADP+ ⟶ aldehydo-D-galacturonate + H+ + NADPH
- O-antigen building blocks biosynthesis (E. coli):
NADP+ + dTDP-β-L-rhamnose ⟶ H+ + NADPH + dTDP-4-dehydro-β-L-rhamnose
- trehalose degradation I (low osmolarity):
α,α-trehalose 6-phosphate + H2O ⟶ β-D-glucose 6-phosphate + D-glucopyranose
- trehalose degradation I (low osmolarity):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- myo-inositol biosynthesis:
β-D-glucose-6-phosphate + D-glucose 6-phosphate ⟶ D-myo-inositol (3)-monophosphate
- myo-inositol biosynthesis:
1D-myo-inositol (3)-monophosphate + H2O ⟶ myo-inositol + phosphate
- 1D-myo-inositol hexakisphosphate biosynthesis III (Spirodela polyrrhiza):
myo-inositol + ATP ⟶ 1D-myo-inositol (3)-monophosphate + ADP + H+
- myo-inositol biosynthesis:
1D-myo-inositol (3)-monophosphate + H2O ⟶ myo-inositol + phosphate
- UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A
- D-galactose degradation I (Leloir pathway):
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP + H+
- trehalose degradation I (low osmolarity):
α,α-trehalose 6-phosphate + H2O ⟶ D-glucopyranose + D-glucopyranose 6-phosphate
- gluconeogenesis I:
(S)-malate + NADP+ ⟶ CO2 + NADPH + pyruvate
- GDP-mannose biosynthesis:
D-glucopyranose 6-phosphate ⟶ F6P
- glycogen degradation I:
H2O + maltotriose ⟶ D-glucopyranose + maltose
- UDP-α-D-glucose biosynthesis I:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- glycogen biosynthesis I (from ADP-D-Glucose):
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- glycolysis I (from glucose 6-phosphate):
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate
- superpathway of oxidative and non-oxidative branches of pentose phosphate pathway:
6-phospho-D-gluconate + NAD(P)+ ⟶ CO2 + D-ribulose-5-phosphate + NAD(P)H
- trehalose biosynthesis:
β-D-glucose-6-phosphate + UDP-D-glucose ⟶ UDP + trehalose 6-phosphate
- oxidative branch of the pentose phosphate pathway:
6-phospho-D-gluconate + NAD(P)+ ⟶ CO2 + D-ribulose-5-phosphate + NAD(P)H
- trehalose degradation V:
α-D-glucose ⟶ β-D-glucose
- sucrose degradation:
α-D-glucose + ATP ⟶ α-D-glucose-6-phosphate + ADP
- gluconeogenesis:
NAD+ + malate ⟶ CO2 + NADH + pyruvate
- glycolysis:
3-phosphoglycerate + ATP ⟶ 1,3-diphosphateglycerate + ADP
- myo-inositol biosynthesis:
β-D-glucose-6-phosphate ⟶ D-myo-inositol (3)-monophosphate
- glycogenolysis II:
H2O + a α-limit dextrin with short branches ⟶ β-D-glucose + a debranched α-limit dextrin
- glycolysis VI (metazoan):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- myo-inositol biosynthesis:
H2O + Ins(3)P ⟶ myo-inositol + phosphate
- glycogenolysis II:
α-D-glucose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- homolactic fermentation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- D-galactose degradation I (Leloir pathway):
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP + H+
- UDP-glucose biosynthesis:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- starch degradation V:
H2O + starch ⟶ D-glucopyranose + a maltodextrin + maltose
- phosphatidylinositol biosynthesis I (bacteria):
D-glucopyranose 6-phosphate ⟶ Ins(3)P
- sucrose degradation III (sucrose invertase):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- GDP-mannose biosynthesis:
D-glucopyranose 6-phosphate ⟶ F6P
- glycolysis I (from glucose 6-phosphate):
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate
- glycolysis III (from glucose):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- trehalose biosynthesis I:
α,α-trehalose 6-phosphate + H2O ⟶ α,α-trehalose + phosphate
- gluconeogenesis I:
(S)-malate + NADP+ ⟶ CO2 + NADPH + pyruvate
- UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A
- mycothiol biosynthesis:
1-(2-acetamido-2-deoxy-α-D-glucopyranosyl)-1D-myo-inositol + H2O ⟶ GlcN-Ins + acetate
- myo-inositol biosynthesis:
H2O + Ins(3)P ⟶ myo-inositol + phosphate
- pentose phosphate pathway:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- pentose phosphate pathway (oxidative branch):
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- UDP-glucose biosynthesis:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- GDP-mannose biosynthesis:
D-glucopyranose 6-phosphate ⟶ F6P
- D-galactose degradation I (Leloir pathway):
β-D-galactose ⟶ α-D-galactose
- gluconeogenesis I:
(S)-malate + NADP+ ⟶ CO2 + NADPH + pyruvate
- homolactic fermentation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A
- heterolactic fermentation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- glycolysis III (from glucose):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- glycolysis I (from glucose 6-phosphate):
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate
- glycogen biosynthesis I (from ADP-D-Glucose):
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- homolactic fermentation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- heterolactic fermentation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A
- D-galactose degradation I (Leloir pathway):
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP + H+
- pentose phosphate pathway:
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- pentose phosphate pathway (oxidative branch) I:
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- superpathway of glucose and xylose degradation:
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- gluconeogenesis I:
(S)-malate + NADP+ ⟶ CO2 + NADPH + pyruvate
- glycolysis I (from glucose 6-phosphate):
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate
- glycolysis III (from glucose):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- glycogen biosynthesis I (from ADP-D-Glucose):
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- UDP-glucose biosynthesis:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- glycolysis I (from glucose 6-phosphate):
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate
- gluconeogenesis I:
(S)-malate + NADP+ ⟶ CO2 + NADPH + pyruvate
- UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A
- GDP-mannose biosynthesis:
D-glucopyranose 6-phosphate ⟶ F6P
- myo-inositol biosynthesis:
H2O + Ins(3)P ⟶ myo-inositol + phosphate
- gluconeogenesis I:
(S)-malate + NADP+ ⟶ CO2 + NADPH + pyruvate
- UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A
- D-galactose degradation I (Leloir pathway):
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP + H+
- UDP-glucose biosynthesis:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- glycolysis III (from glucose):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- glycolysis I (from glucose 6-phosphate):
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate
- glycogen biosynthesis I (from ADP-D-Glucose):
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- superpathway of glycolysis and Entner-Doudoroff:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- O-antigen building blocks biosynthesis (E. coli):
NADP+ + dTDP-β-L-rhamnose ⟶ H+ + NADPH + dTDP-4-dehydro-β-L-rhamnose
- glycolysis III (from glucose):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- glycolysis I (from glucose 6-phosphate):
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate
- gluconeogenesis I:
(S)-malate + NADP+ ⟶ CO2 + NADPH + pyruvate
- glycogen biosynthesis I (from ADP-D-Glucose):
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- GDP-mannose biosynthesis:
D-glucopyranose 6-phosphate ⟶ F6P
- D-galactose degradation I (Leloir pathway):
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP + H+
- UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A
- gluconeogenesis I:
(S)-malate + NADP+ ⟶ CO2 + NADPH + pyruvate
- sucrose biosynthesis I (from photosynthesis):
H2O + sucrose 6F-phosphate ⟶ phosphate + sucrose
- L-ascorbate biosynthesis V:
aldehydo-L-galactonate + NADP+ ⟶ aldehydo-D-galacturonate + H+ + NADPH
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- UDP-glucose biosynthesis:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- glycolysis I (from glucose 6-phosphate):
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate
- glycolysis I (from glucose 6-phosphate):
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate
- glycolysis III (from glucose):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- formaldehyde oxidation I:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- UDP-α-D-glucose biosynthesis I:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- pentose phosphate pathway (oxidative branch) I:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- pentose phosphate pathway:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- homolactic fermentation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- heterolactic fermentation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- D-galactose degradation I (Leloir pathway):
β-D-galactose ⟶ α-D-galactose
- trehalose degradation I (low osmolarity):
α,α-trehalose 6-phosphate + H2O ⟶ D-glucopyranose + D-glucopyranose 6-phosphate
- UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A
- gluconeogenesis I:
(S)-malate + NADP+ ⟶ CO2 + NADPH + pyruvate
- glycogen biosynthesis I (from ADP-D-Glucose):
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate
- UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A
- glycolysis I (from glucose 6-phosphate):
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate
- D-galactose degradation I (Leloir pathway):
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP + H+
- gluconeogenesis I:
(S)-malate + NADP+ ⟶ CO2 + NADPH + pyruvate
WikiPathways(13)
- Hexoses metabolism in proximal tubules:
Glucose ⟶ Sorbitol
- Glycolysis:
glucose ⟶ glucose 6-phosphate
- Starch metabolism:
fructose 6-phosphate ⟶ glucose 6-phosphate
- Sucrose metabolism:
glucose ⟶ glucose 6-phosphate
- Cori cycle:
Fructose 6P ⟶ Fructose 1,6-bisphosphate
- Cori cycle:
erythroses ⟶ D-Fructose-6-phosphate
- Thiamine metabolic pathways:
alpha-ketoglutarate ⟶ succinate
- Disorders of galactose metabolism:
galactose ⟶ Galactitol
- Disorders of fructose metabolism:
Sucrose ⟶ Fructose
- Metabolic pathways of fibroblasts:
Pyruvate ⟶ Lactic acid
- Lactate shuttle in glial cells:
D-Glucose 1-phosphate ⟶ D-Glucose 6-phosphate
- UDP-derived sugars synthesis in fibroblasts:
D-glucopyranose 6-phosphate ⟶ -D-glucose 6-phosphate
- 5q35 copy number variation:
D-glucose ⟶ D-glucose 6-phosphate
Plant Reactome(396)
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
DMAPP + genistein ⟶ PPi + lupiwighteone
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
Glc6P ⟶ I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Secondary metabolism:
DMAPP + genistein ⟶ PPi + lupiwighteone
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Secondary metabolism:
DMAPP + genistein ⟶ PPi + lupiwighteone
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
Glc6P ⟶ I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
Glc6P ⟶ I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Secondary metabolism:
DMAPP + genistein ⟶ PPi + lupiwighteone
- Lipid-independent phytate biosynthesis:
Glc6P ⟶ I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Secondary metabolism:
DMAPP + genistein ⟶ PPi + lupiwighteone
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
L-Phe ⟶ ammonia + trans-cinnamate
- Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA
- Secondary metabolism:
GPP + H2O ⟶ PPi + geraniol
- Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Myo-inositol biosynthesis:
H2O + I3P ⟶ Pi + myo-inositol
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
Glc6P ⟶ I3P
- Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
Glc6P ⟶ I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Lipid-independent phytate biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
Glc6P ⟶ I3P
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Myo-inositol biosynthesis:
Glc6P ⟶ I3P
- Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Lipid-independent phytate biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
Glc6P ⟶ I3P
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
H2O + I3P ⟶ Ins + Pi
- Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P
- Phytic acid biosynthesis:
ATP + Ins ⟶ ADP + I3P
INOH(6)
- Inositol phosphate metabolism ( Inositol phosphate metabolism ):
O2 + myo-Inositol ⟶ D-Glucuronic acid + H2O
- D-Glucose 6-phosphate = D-Fructose 6-phosphate ( Pentose phosphate cycle ):
D-Fructose 6-phosphate ⟶ D-Glucose 6-phosphate
- D-Glucose 1-phosphate = D-Glucose 6-phosphate ( Galactose metabolism ):
D-Glucose 1-phosphate ⟶ D-Glucose 6-phosphate
- Glycolysis and Gluconeogenesis ( Glycolysis and Gluconeogenesis ):
D-Glucose 6-phosphate + H2O ⟶ D-Glucose + Orthophosphate
- D-Glucose 1-phosphate = D-Glucose 6-phosphate ( Glycolysis and Gluconeogenesis ):
D-Glucose 6-phosphate ⟶ D-Glucose 1-phosphate
- Pentose phosphate cycle ( Pentose phosphate cycle ):
ATP + D-Ribose 5-phosphate ⟶ AMP + D-5-Phospho-ribosyl 1-diphosphate
PlantCyc(173)
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- gluconeogenesis III:
D-glucopyranose 6-phosphate + H2O ⟶ D-glucopyranose + phosphate
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- 1D-myo-inositol hexakisphosphate biosynthesis III (Spirodela polyrrhiza):
myo-inositol + ATP ⟶ ADP + H+ + Ins(3)P
- gluconeogenesis III:
D-glucopyranose 6-phosphate + H2O ⟶ D-glucopyranose + phosphate
- superpathway of anaerobic sucrose degradation:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- GDP-glucose biosynthesis:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- GDP-glucose biosynthesis:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- D-galactose degradation I (Leloir pathway):
β-D-galactose ⟶ α-D-galactose
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- D-galactose degradation I (Leloir pathway):
β-D-galactose ⟶ α-D-galactose
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- gluconeogenesis III:
D-glucopyranose 6-phosphate + H2O ⟶ D-glucopyranose + phosphate
- 1D-myo-inositol hexakisphosphate biosynthesis III (Spirodela polyrrhiza):
myo-inositol + ATP ⟶ ADP + H+ + Ins(3)P
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- gluconeogenesis III:
D-glucopyranose 6-phosphate + H2O ⟶ D-glucopyranose + phosphate
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- gluconeogenesis III:
D-glucopyranose 6-phosphate + H2O ⟶ D-glucopyranose + phosphate
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- superpathway of anaerobic sucrose degradation:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- D-galactose degradation I (Leloir pathway):
β-D-galactose ⟶ α-D-galactose
- gluconeogenesis III:
D-glucopyranose 6-phosphate + H2O ⟶ D-glucopyranose + phosphate
- gluconeogenesis III:
D-glucopyranose 6-phosphate + H2O ⟶ D-glucopyranose + phosphate
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- gluconeogenesis III:
D-glucopyranose 6-phosphate + H2O ⟶ D-glucopyranose + phosphate
- gluconeogenesis III:
D-glucopyranose 6-phosphate + H2O ⟶ D-glucopyranose + phosphate
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- gluconeogenesis III:
D-glucopyranose 6-phosphate + H2O ⟶ D-glucopyranose + phosphate
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- gluconeogenesis III:
D-glucopyranose 6-phosphate + H2O ⟶ D-glucopyranose + phosphate
- trehalose biosynthesis I:
α,α-trehalose 6-phosphate + H2O ⟶ α,α-trehalose + phosphate
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- 1D-myo-inositol hexakisphosphate biosynthesis III (Spirodela polyrrhiza):
myo-inositol + ATP ⟶ ADP + H+ + Ins(3)P
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- gluconeogenesis III:
D-glucopyranose 6-phosphate + H2O ⟶ D-glucopyranose + phosphate
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- gluconeogenesis III:
D-glucopyranose 6-phosphate + H2O ⟶ D-glucopyranose + phosphate
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- gluconeogenesis III:
D-glucopyranose 6-phosphate + H2O ⟶ D-glucopyranose + phosphate
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- 1D-myo-inositol hexakisphosphate biosynthesis III (Spirodela polyrrhiza):
myo-inositol + ATP ⟶ ADP + H+ + Ins(3)P
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- gluconeogenesis III:
D-glucopyranose 6-phosphate + H2O ⟶ D-glucopyranose + phosphate
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- gluconeogenesis III:
D-glucopyranose 6-phosphate + H2O ⟶ D-glucopyranose + phosphate
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- GDP-glucose biosynthesis:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- gluconeogenesis III:
D-glucopyranose 6-phosphate + H2O ⟶ D-glucopyranose + phosphate
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- gluconeogenesis III:
D-glucopyranose 6-phosphate + H2O ⟶ D-glucopyranose + phosphate
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- D-galactose degradation I (Leloir pathway):
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP + H+
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- gluconeogenesis III:
D-glucopyranose 6-phosphate + H2O ⟶ D-glucopyranose + phosphate
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- 1D-myo-inositol hexakisphosphate biosynthesis III (Spirodela polyrrhiza):
myo-inositol + ATP ⟶ ADP + H+ + Ins(3)P
- GDP-glucose biosynthesis:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- gluconeogenesis III:
D-glucopyranose 6-phosphate + H2O ⟶ D-glucopyranose + phosphate
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- gluconeogenesis III:
D-glucopyranose 6-phosphate + H2O ⟶ D-glucopyranose + phosphate
- D-galactose degradation I (Leloir pathway):
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP + H+
- superpathway of anaerobic sucrose degradation:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- gluconeogenesis III:
D-glucopyranose 6-phosphate + H2O ⟶ D-glucopyranose + phosphate
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- gluconeogenesis III:
D-glucopyranose 6-phosphate + H2O ⟶ D-glucopyranose + phosphate
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- gluconeogenesis III:
D-glucopyranose 6-phosphate + H2O ⟶ D-glucopyranose + phosphate
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- superpathway of anaerobic sucrose degradation:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- gluconeogenesis III:
D-glucopyranose 6-phosphate + H2O ⟶ D-glucopyranose + phosphate
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- gluconeogenesis III:
D-glucopyranose 6-phosphate + H2O ⟶ D-glucopyranose + phosphate
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose degradation II (sucrose synthase):
β-D-fructofuranose + UDP-α-D-glucose ⟶ H+ + UDP + sucrose
- sucrose biosynthesis II:
D-glucopyranose + a plant soluble heteroglycan ⟶ a plant soluble heteroglycan + maltose
- gluconeogenesis III:
D-glucopyranose 6-phosphate + H2O ⟶ D-glucopyranose + phosphate
- superpathway of sucrose and starch metabolism I (non-photosynthetic tissue):
H2O + sucrose ⟶ β-D-fructofuranose + D-glucopyranose
- 1D-myo-inositol hexakisphosphate biosynthesis III (Spirodela polyrrhiza):
myo-inositol + ATP ⟶ ADP + H+ + Ins(3)P
- superpathway of sucrose and starch metabolism I (non-photosynthetic tissue):
H2O + sucrose ⟶ β-D-fructofuranose + D-glucopyranose
- superpathway of sucrose and starch metabolism I (non-photosynthetic tissue):
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
COVID-19 Disease Map(0)
PathBank(132)
- Starch and Sucrose Metabolism:
D-Glucose + [PTS enzyme I]-N -phospho-L-histidine ⟶ -D-glucose 1-phosphate + [PTS enzyme I]-L-histidine
- Trehalose Biosynthesis I:
Glucose 6-phosphate + Uridine diphosphate glucose ⟶ , -Trehalose 6-phosphate + Hydrogen Ion + Uridine 5'-diphosphate
- Starch and Sucrose Metabolism:
Adenosine triphosphate + D-Glucose ⟶ Adenosine diphosphate + Glucose 6-phosphate
- Starch and Sucrose Metabolism:
-D-Glucose + Unknown ⟶ -D-Glucose 6-phosphate + Unknown
- Trehalose Biosynthesis I:
Glucose 6-phosphate + Uridine diphosphate glucose ⟶ , -Trehalose 6-phosphate + Hydrogen Ion + Uridine 5'-diphosphate
- Pentose Phosphate Pathway:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate
- Glucose-6-phosphate Dehydrogenase Deficiency:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate
- Ribose-5-phosphate Isomerase Deficiency:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate
- Transaldolase Deficiency:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate
- Warburg Effect:
L-Glutamic acid + NAD + Water ⟶ Ammonia + NADH + Oxoglutaric acid
- Galactose Metabolism:
-D-Glucose + Phosphocarrier protein HPr ⟶ -D-Glucose 6-phosphate + Phosphocarrier protein HPr
- Colanic Acid Building Blocks Biosynthesis:
-D-Glucose + Phosphocarrier protein HPr ⟶ -D-Glucose 6-phosphate + Phosphocarrier protein HPr
- Pentose Phosphate Pathway:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate
- Glucose-6-phosphate Dehydrogenase Deficiency:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate
- Ribose-5-phosphate Isomerase Deficiency:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate
- Transaldolase Deficiency:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate
- Warburg Effect:
L-Glutamic acid + NAD + Water ⟶ Ammonia + NADH + Oxoglutaric acid
- Pentose Phosphate Pathway:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate
- Warburg Effect:
L-Glutamine + Water ⟶ Ammonia + L-Glutamic acid
- Pentose Phosphate Pathway:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate
- Warburg Effect:
L-Glutamine + Water ⟶ Ammonia + L-Glutamic acid
- Pentose Phosphate Pathway:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate
- Warburg Effect:
L-Glutamine + Water ⟶ Ammonia + L-Glutamic acid
- Pentose Phosphate Pathway:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate
- Warburg Effect:
L-Glutamine + Water ⟶ Ammonia + L-Glutamic acid
- Glucose-6-phosphate Dehydrogenase Deficiency:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate
- Ribose-5-phosphate Isomerase Deficiency:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate
- Transaldolase Deficiency:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate
- Glycolysis:
Adenosine triphosphate + D-Glucose ⟶ Adenosine diphosphate + Glucose 6-phosphate
- Gluconeogenesis:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate
- Galactose Metabolism:
D-Galactose + D-Mannose ⟶ Epimelibiose
- Nucleotide Sugars Metabolism:
Adenosine triphosphate + D-Galactose ⟶ Adenosine diphosphate + Galactose 1-phosphate
- Inositol Metabolism:
Oxygen + myo-Inositol ⟶ D-Glucuronic acid + Water
- Starch and Sucrose Metabolism:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Inositol Phosphate Metabolism:
1D-myo-Inositol 3-phosphate + Water ⟶ Phosphate + myo-Inositol
- Galactosemia:
D-Galactose + D-Mannose ⟶ Epimelibiose
- Glycogen Storage Disease Type 1A (GSD1A) or Von Gierke Disease:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate
- Galactosemia II (GALK):
Adenosine triphosphate + D-Galactose ⟶ Adenosine diphosphate + Galactose 1-phosphate
- Galactosemia III:
Adenosine triphosphate + D-Galactose ⟶ Adenosine diphosphate + Galactose 1-phosphate
- Glycogenosis, Type VII. Tarui Disease:
Adenosine triphosphate + D-Glucose ⟶ Adenosine diphosphate + Glucose 6-phosphate
- Glycogen Synthetase Deficiency:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Glycogenosis, Type III. Cori Disease, Debrancher Glycogenosis:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Glycogenosis, Type IV. Amylopectinosis, Anderson Disease:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Glycogenosis, Type VI. Hers Disease:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Mucopolysaccharidosis VII. Sly Syndrome:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Sucrase-Isomaltase Deficiency:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Phosphoenolpyruvate Carboxykinase Deficiency 1 (PEPCK1):
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate
- Fructose-1,6-diphosphatase Deficiency:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate
- Triosephosphate Isomerase Deficiency:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate
- Fanconi-Bickel Syndrome:
Adenosine triphosphate + D-Glucose ⟶ Adenosine diphosphate + Glucose 6-phosphate
- Glycogenosis, Type IB:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate
- Glycogenosis, Type IC:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate
- Glycogenosis, Type IA. Von Gierke Disease:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate
- Glycolysis:
Adenosine triphosphate + D-Glucose ⟶ Adenosine diphosphate + Glucose 6-phosphate
- Galactose Degradation/Leloir Pathway:
-D-Glucose + Phosphocarrier protein HPr ⟶ -D-Glucose 6-phosphate + Phosphocarrier protein HPr
- Amino Sugar and Nucleotide Sugar Metabolism II:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate
- Amino Sugar and Nucleotide Sugar Metabolism III:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate
- Trehalose Degradation I (Low Osmolarity):
-D-Glucopyranuronic acid + Adenosine triphosphate ⟶ Adenosine diphosphate + Glucose 6-phosphate + Hydrogen Ion
- Glycolysis I:
Adenosine triphosphate + D-Glucose ⟶ Adenosine diphosphate + Glucose 6-phosphate
- Fructose Metabolism:
-D-fructofuranose + Adenosine triphosphate ⟶ -D-Fructose 6-phosphate + Adenosine triphosphate + Hydrogen Ion
- Leloir Pathway:
-D-Galactose ⟶ D-Galactose
- Ethanol Fermentation:
Adenosine triphosphate + D-Glucose ⟶ Adenosine diphosphate + Glucose 6-phosphate
- Inositol Phosphate Metabolism:
Myo-inositol 1-phosphate + Water ⟶ Phosphate + myo-Inositol
- D-Galactose Degradation (Leloir pathway):
Beta-D-Galactose ⟶ D-Galactose
- Glycolysis:
Adenosine triphosphate + D-Glucose ⟶ Adenosine diphosphate + Glucose 6-phosphate
- Gluconeogenesis:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate
- Galactose Metabolism:
D-Galactose + D-Mannose ⟶ Epimelibiose
- Inositol Metabolism:
Oxygen + myo-Inositol ⟶ D-Glucuronic acid + Water
- Inositol Phosphate Metabolism:
Myo-inositol 1-phosphate + Water ⟶ Phosphate + myo-Inositol
- Nucleotide Sugars Metabolism:
Adenosine triphosphate + D-Galactose ⟶ Adenosine diphosphate + Galactose 1-phosphate
- Starch and Sucrose Metabolism:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Galactosemia:
D-Galactose + D-Mannose ⟶ Epimelibiose
- Glycogen Storage Disease Type 1A (GSD1A) or Von Gierke Disease:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate
- Galactosemia II (GALK):
Adenosine triphosphate + D-Galactose ⟶ Adenosine diphosphate + Galactose 1-phosphate
- Galactosemia III:
Adenosine triphosphate + D-Galactose ⟶ Adenosine diphosphate + Galactose 1-phosphate
- Glycogenosis, Type VII. Tarui Disease:
Adenosine triphosphate + D-Glucose ⟶ Adenosine diphosphate + Glucose 6-phosphate
- Glycogen Synthetase Deficiency:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Glycogenosis, Type III. Cori Disease, Debrancher Glycogenosis:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Glycogenosis, Type IV. Amylopectinosis, Anderson Disease:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Glycogenosis, Type VI. Hers Disease:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Mucopolysaccharidosis VII. Sly Syndrome:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Sucrase-Isomaltase Deficiency:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Phosphoenolpyruvate Carboxykinase Deficiency 1 (PEPCK1):
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate
- Fructose-1,6-diphosphatase Deficiency:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate
- Triosephosphate Isomerase Deficiency:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate
- Fanconi-Bickel Syndrome:
Adenosine triphosphate + D-Glucose ⟶ Adenosine diphosphate + Glucose 6-phosphate
- Glycogenosis, Type IB:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate
- Glycogenosis, Type IC:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate
- Glycogenosis, Type IA. Von Gierke Disease:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate
- Nucleotide Sugars Metabolism:
Adenosine triphosphate + D-Galactose ⟶ Adenosine diphosphate + Galactose 1-phosphate
- Glycolysis:
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate
- Gluconeogenesis:
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate
- Galactose Metabolism:
D-Galactose + D-Mannose ⟶ Epimelibiose
- Inositol Metabolism:
Oxygen + myo-Inositol ⟶ D-Glucuronic acid + Water
- Starch and Sucrose Metabolism:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Inositol Phosphate Metabolism:
Myo-inositol 1-phosphate + Water ⟶ Phosphate + myo-Inositol
- Nucleotide Sugars Metabolism:
Adenosine triphosphate + D-Galactose ⟶ Adenosine diphosphate + Galactose 1-phosphate
- Glycolysis:
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate
- Gluconeogenesis:
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate
- Galactose Metabolism:
D-Galactose + D-Mannose ⟶ Epimelibiose
- Inositol Metabolism:
Oxygen + myo-Inositol ⟶ D-Glucuronic acid + Water
- Starch and Sucrose Metabolism:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Inositol Phosphate Metabolism:
Myo-inositol 1-phosphate + Water ⟶ Phosphate + myo-Inositol
- Nucleotide Sugars Metabolism:
Adenosine triphosphate + D-Galactose ⟶ Adenosine diphosphate + Galactose 1-phosphate
- Glycolysis:
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate
- Inositol Metabolism:
Oxygen + myo-Inositol ⟶ D-Glucuronic acid + Water
- Inositol Phosphate Metabolism:
Myo-inositol 1-phosphate + Water ⟶ Phosphate + myo-Inositol
- Nucleotide Sugars Metabolism:
Adenosine triphosphate + D-Galactose ⟶ Adenosine diphosphate + Galactose 1-phosphate
- Glycolysis:
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate
- Inositol Metabolism:
Oxygen + myo-Inositol ⟶ D-Glucuronic acid + Water
- Inositol Phosphate Metabolism:
Myo-inositol 1-phosphate + Water ⟶ Phosphate + myo-Inositol
- Chitin Biosynthesis:
Fructose 6-phosphate + L-Glutamine ⟶ Glucosamine 6-phosphate + L-Glutamic acid
- Galactosemia:
D-Galactose + D-Mannose ⟶ Epimelibiose
- Glycogen Storage Disease Type 1A (GSD1A) or Von Gierke Disease:
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate
- Galactosemia II (GALK):
Adenosine triphosphate + D-Galactose ⟶ Adenosine diphosphate + Galactose 1-phosphate
- Galactosemia III:
Adenosine triphosphate + D-Galactose ⟶ Adenosine diphosphate + Galactose 1-phosphate
- Glycogenosis, Type VII. Tarui Disease:
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate
- Glycogen Synthetase Deficiency:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Glycogenosis, Type III. Cori Disease, Debrancher Glycogenosis:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Glycogenosis, Type IV. Amylopectinosis, Anderson Disease:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Glycogenosis, Type VI. Hers Disease:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Mucopolysaccharidosis VII. Sly Syndrome:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Sucrase-Isomaltase Deficiency:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Phosphoenolpyruvate Carboxykinase Deficiency 1 (PEPCK1):
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate
- Fructose-1,6-diphosphatase Deficiency:
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate
- Triosephosphate Isomerase Deficiency:
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate
- Fanconi-Bickel Syndrome:
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate
- Glycogenosis, Type IB:
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate
- Glycogenosis, Type IC:
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate
- Glycogenosis, Type IA. Von Gierke Disease:
-D-Glucose + Adenosine triphosphate ⟶ -D-Glucose 6-phosphate + Adenosine diphosphate
- Amino Sugar and Nucleotide Sugar Metabolism III:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate
- Trehalose Degradation I (Low Osmolarity):
-D-Glucopyranuronic acid + Adenosine triphosphate ⟶ Adenosine diphosphate + Glucose 6-phosphate + Hydrogen Ion
PharmGKB(0)
28 个相关的物种来源信息
- 2 - Bacteria: LTS0123696
- 2759 - Eukaryota: LTS0123696
- 3803 - Fabaceae: LTS0123696
- 1236 - Gammaproteobacteria: LTS0123696
- 9606 - Homo sapiens: -
- 9606 - Homo sapiens: 10.1007/S11306-016-1051-4
- 2063 - Kitasatospora: LTS0123696
- 1894 - Kitasatospora aureofaciens: 10.1007/BF00211140
- 1894 - Kitasatospora aureofaciens: 10.1007/BF02876980
- 1894 - Kitasatospora aureofaciens: LTS0123696
- 3398 - Magnoliopsida: LTS0123696
- 3877 - Medicago: LTS0123696
- 3879 - Medicago sativa: 10.3389/FPLS.2017.01208
- 3879 - Medicago sativa: LTS0123696
- 135621 - Pseudomonadaceae: LTS0123696
- 286 - Pseudomonas: LTS0123696
- 287 - Pseudomonas aeruginosa: LTS0123696
- 303 - Pseudomonas putida: 10.1073/PNAS.2016380117
- 303 - Pseudomonas putida: LTS0123696
- 1883 - Streptomyces: LTS0123696
- 1911 - Streptomyces griseus: 10.1007/BF00211140
- 1911 - Streptomyces griseus: LTS0123696
- 2062 - Streptomycetaceae: LTS0123696
- 35493 - Streptophyta: LTS0123696
- 58023 - Tracheophyta: LTS0123696
- 33090 - Viridiplantae: LTS0123696
- 29760 - Vitis vinifera: 10.1016/J.DIB.2020.106469
- 569774 - 金线莲: -
在这里通过桑基图来展示出与当前的这个代谢物在我们的BioDeep知识库中具有相关联信息的其他代谢物。在这里进行关联的信息来源主要有:
- PubMed: 来源于PubMed文献库中的文献信息,我们通过自然语言数据挖掘得到的在同一篇文献中被同时提及的相关代谢物列表,这个列表按照代谢物同时出现的文献数量降序排序,取前10个代谢物作为相关研究中关联性很高的代谢物集合展示在桑基图中。
- NCBI Taxonomy: 通过文献数据挖掘,得到的代谢物物种来源信息关联。这个关联信息同样按照出现的次数降序排序,取前10个代谢物作为高关联度的代谢物集合展示在桑吉图上。
- Chemical Taxonomy: 在物质分类上处于同一个分类集合中的其他代谢物
- Chemical Reaction: 在化学反应过程中,存在为当前代谢物相关联的生化反应过程中的反应底物或者反应产物的关联代谢物信息。
点击图上的相关代谢物的名称,可以跳转到相关代谢物的信息页面。
文献列表
- Margaret Carpenter, Nigel Joyce, Ruth Butler, Russell Genet, Gail Timmerman-Vaughan. A mass spectrometric method for quantifying C3 and C6 phosphorylation of starch.
Analytical biochemistry.
2012 Dec; 431(2):115-9. doi:
10.1016/j.ab.2012.09.004
. [PMID: 22982506] - Kimio Uematsu, Nobuaki Suzuki, Tomoko Iwamae, Masayuki Inui, Hideaki Yukawa. Expression of Arabidopsis plastidial phosphoglucomutase in tobacco stimulates photosynthetic carbon flow into starch synthesis.
Journal of plant physiology.
2012 Oct; 169(15):1454-62. doi:
10.1016/j.jplph.2012.05.008
. [PMID: 22705254] - Reza Hakkak, Ahmed Al-Dwairi, George J Fuchs, Soheila Korourian, Frank A Simmen. Dietary soy protein induces hepatic lipogenic enzyme gene expression while suppressing hepatosteatosis in obese female Zucker rats bearing DMBA-initiated mammary tumors.
Genes & nutrition.
2012 Oct; 7(4):549-58. doi:
10.1007/s12263-012-0294-6
. [PMID: 22528625] - Marcelo Hermes-Lima, Cecília Carreiro, Daniel C Moreira, Cássia Polcheira, Daniel P Machado, Elida G Campos. Glutathione status and antioxidant enzymes in a crocodilian species from the swamps of the Brazilian Pantanal.
Comparative biochemistry and physiology. Part A, Molecular & integrative physiology.
2012 Oct; 163(2):189-98. doi:
10.1016/j.cbpa.2012.06.006
. [PMID: 22750313] - Nandini Bhattacharjee, Anisur Rahman Khuda-Bukhsh. Two homeopathic remedies used intermittently provide additional protective effects against hepatotoxicity induced by carcinogens in mice.
Journal of acupuncture and meridian studies.
2012 Aug; 5(4):166-75. doi:
10.1016/j.jams.2012.05.004
. [PMID: 22898065] - Mohamed Koubaa, Sarra Mghaieth, Brigitte Thomasset, Albrecht Roscher. Gas chromatography-mass spectrometry analysis of 13C labeling in sugars for metabolic flux analysis.
Analytical biochemistry.
2012 Jun; 425(2):183-8. doi:
10.1016/j.ab.2012.03.020
. [PMID: 22475504] - Dilipkumar Pal, Upal Kanti Mazumder, Malaya Gupta. Fractionation of stigmasterol derivative and study of the effects of Celsia coromandelina aerial parts petroleum ether extract on appearance of puberty and ovarian steroidogenesis in immature mice.
Pharmaceutical biology.
2012 Jun; 50(6):747-53. doi:
10.3109/13880209.2011.628321
. [PMID: 22092072] - Vivek B Kute, Hargovind L Trivedi, Aruna V Vanikar, Pankaj R Shah, Manoj R Gumber, Himanshu V Patel, Jitendra G Goswami, Kamal V Kanodia. Plasmodium vivax malaria-associated acute kidney injury, India, 2010-2011.
Emerging infectious diseases.
2012 May; 18(5):842-5. doi:
10.3201/eid1805.111442
. [PMID: 22515936] - Joerg Fettke, Lydia Leifels, Henrike Brust, Karoline Herbst, Martin Steup. Two carbon fluxes to reserve starch in potato (Solanum tuberosum L.) tuber cells are closely interconnected but differently modulated by temperature.
Journal of experimental botany.
2012 May; 63(8):3011-29. doi:
10.1093/jxb/ers014
. [PMID: 22378944] - Amaia Gonzalez-Salgado, Michael E Steinmann, Eva Greganova, Monika Rauch, Pascal Mäser, Erwin Sigel, Peter Bütikofer. myo-Inositol uptake is essential for bulk inositol phospholipid but not glycosylphosphatidylinositol synthesis in Trypanosoma brucei.
The Journal of biological chemistry.
2012 Apr; 287(16):13313-23. doi:
10.1074/jbc.m112.344812
. [PMID: 22351763] - Heli Salmi, James V Leonard, Shamima Rahman, Risto Lapatto. Plasma thiol status is altered in children with mitochondrial diseases.
Scandinavian journal of clinical and laboratory investigation.
2012 Apr; 72(2):152-7. doi:
10.3109/00365513.2011.646299
. [PMID: 22208644] - Shinichi Takahashi, Yoshikane Izawa, Norihiro Suzuki. Astroglial pentose phosphate pathway rates in response to high-glucose environments.
ASN neuro.
2012 Mar; 4(2):. doi:
10.1042/an20120002
. [PMID: 22300409] - Axel Tiessen, Annika Nerlich, Benjamin Faix, Christine Hümmer, Simon Fox, Kay Trafford, Hans Weber, Winfriede Weschke, Peter Geigenberger. Subcellular analysis of starch metabolism in developing barley seeds using a non-aqueous fractionation method.
Journal of experimental botany.
2012 Mar; 63(5):2071-87. doi:
10.1093/jxb/err408
. [PMID: 22200665] - Muhammad Sajjad Haider, Jeremy D Barnes, John C Cushman, Anne M Borland. A CAM- and starch-deficient mutant of the facultative CAM species Mesembryanthemum crystallinum reconciles sink demands by repartitioning carbon during acclimation to salinity.
Journal of experimental botany.
2012 Mar; 63(5):1985-96. doi:
10.1093/jxb/err412
. [PMID: 22219316] - Amanda R Martins, Renato T Nachbar, Renata Gorjao, Marco A Vinolo, William T Festuccia, Rafael H Lambertucci, Maria F Cury-Boaventura, Leonardo R Silveira, Rui Curi, Sandro M Hirabara. Mechanisms underlying skeletal muscle insulin resistance induced by fatty acids: importance of the mitochondrial function.
Lipids in health and disease.
2012 Feb; 11(?):30. doi:
10.1186/1476-511x-11-30
. [PMID: 22360800] - Ranganathan Harini, Muthukrishnan Ezhumalai, Kodukkur Viswanathan Pugalendi. Antihyperglycemic effect of biochanin A, a soy isoflavone, on streptozotocin-diabetic rats.
European journal of pharmacology.
2012 Feb; 676(1-3):89-94. doi:
10.1016/j.ejphar.2011.11.051
. [PMID: 22178203] - Lin Yang, Jia-Hou Chen, Jie Lv, Qiong Wu, Tong Xu, Hua Zhang, Qiao-Hong Liu, Hong-Kun Yang. Rice protein improves adiposity, body weight and reduces lipids level in rats through modification of triglyceride metabolism.
Lipids in health and disease.
2012 Feb; 11(?):24. doi:
10.1186/1476-511x-11-24
. [PMID: 22330327] - Anne-Marie Boisson, Elisabeth Gout, Richard Bligny, Corinne Rivasseau. A simple and efficient method for the long-term preservation of plant cell suspension cultures.
Plant methods.
2012 Jan; 8(?):4. doi:
10.1186/1746-4811-8-4
. [PMID: 22289515] - Keqin Yu, Qiang Xu, Xinlei Da, Fei Guo, Yuduan Ding, Xiuxin Deng. Transcriptome changes during fruit development and ripening of sweet orange (Citrus sinensis).
BMC genomics.
2012 Jan; 13(?):10. doi:
10.1186/1471-2164-13-10
. [PMID: 22230690] - Barbara Dołęgowska, Wojciech Błogowski, Leszek Domański. Association between the perioperative antioxidative ability of platelets and early post-transplant function of kidney allografts: a pilot study.
PloS one.
2012; 7(1):e29779. doi:
10.1371/journal.pone.0029779
. [PMID: 22279544] - Sevki Adem, Mehmet Ciftci. Purification of rat kidney glucose 6-phosphate dehydrogenase, 6-phosphogluconate dehydrogenase, and glutathione reductase enzymes using 2',5'-ADP Sepharose 4B affinity in a single chromatography step.
Protein expression and purification.
2012 Jan; 81(1):1-4. doi:
10.1016/j.pep.2011.08.031
. [PMID: 21930213] - V B Kute, P R Shah, B C Munjappa, M R Gumber, H V Patel, S H Jain, D P Engineer, V V Sai Naresh, A V Vanikar, H L Trivedi. Outcome and prognostic factors of malaria-associated acute kidney injury requiring hemodialysis: A single center experience.
Indian journal of nephrology.
2012 Jan; 22(1):33-8. doi:
10.4103/0971-4065.83737
. [PMID: 22279340] - Chim W Chan, Rita Spathis, Dana M Reiff, Stacy E McGrath, Ralph M Garruto, J Koji Lum. Diversity of Plasmodium falciparum chloroquine resistance transporter (pfcrt) exon 2 haplotypes in the Pacific from 1959 to 1979.
PloS one.
2012; 7(1):e30213. doi:
10.1371/journal.pone.0030213
. [PMID: 22272308] - Ana L Colín-González, Ricardo A Santana, Carlos A Silva-Islas, Maria E Chánez-Cárdenas, Abel Santamaría, Perla D Maldonado. The antioxidant mechanisms underlying the aged garlic extract- and S-allylcysteine-induced protection.
Oxidative medicine and cellular longevity.
2012; 2012(?):907162. doi:
10.1155/2012/907162
. [PMID: 22685624] - Mingjun Li, Fengjuan Feng, Lailiang Cheng. Expression patterns of genes involved in sugar metabolism and accumulation during apple fruit development.
PloS one.
2012; 7(3):e33055. doi:
10.1371/journal.pone.0033055
. [PMID: 22412983] - Yoichi Shimoda, Junkyu Han, Kiyokazu Kawada, Abderrazak Smaoui, Hiroko Isoda. Metabolomics analysis of Cistus monspeliensis leaf extract on energy metabolism activation in human intestinal cells.
Journal of biomedicine & biotechnology.
2012; 2012(?):428514. doi:
10.1155/2012/428514
. [PMID: 22523469] - Gianpiero Vigani. Does a similar metabolic reprogramming occur in fe-deficient plant cells and animal tumor cells?.
Frontiers in plant science.
2012; 3(?):47. doi:
10.3389/fpls.2012.00047
. [PMID: 22645588] - Catherine B Dieck, Wendy F Boss, Imara Y Perera. A role for phosphoinositides in regulating plant nuclear functions.
Frontiers in plant science.
2012; 3(?):50. doi:
10.3389/fpls.2012.00050
. [PMID: 22645589] - Kemal Simsek, Mehmet Ozler, Ali Osman Yildirim, Serdar Sadir, Seref Demirbas, Muzaffer Oztosun, Ahmet Korkmaz, Hakan Ay, Sukru Oter, Senol Yildiz. Evaluation of the oxidative effect of long-term repetitive hyperbaric oxygen exposures on different brain regions of rats.
TheScientificWorldJournal.
2012; 2012(?):849183. doi:
10.1100/2012/849183
. [PMID: 22454610] - Paduru Yadagiri Reddy, Nappan Veettil Giridharan, Geereddy Bhanuprakash Reddy. Activation of sorbitol pathway in metabolic syndrome and increased susceptibility to cataract in Wistar-Obese rats.
Molecular vision.
2012; 18(?):495-503. doi:
"
. [PMID: 22393276] - Cecilia C Sánchez, Gregory M Weber, Guangtu Gao, Beth M Cleveland, Jianbo Yao, Caird E Rexroad. Generation of a reference transcriptome for evaluating rainbow trout responses to various stressors.
BMC genomics.
2011 Dec; 12(?):626. doi:
10.1186/1471-2164-12-626
. [PMID: 22188770] - Aline A da Cunha, Andréa G K Ferreira, Maira J da Cunha, Carolina D Pederzolli, Débora L Becker, Juliana G Coelho, Carlos S Dutra-Filho, Angela T S Wyse. Chronic hyperhomocysteinemia induces oxidative damage in the rat lung.
Molecular and cellular biochemistry.
2011 Dec; 358(1-2):153-60. doi:
10.1007/s11010-011-0930-2
. [PMID: 21717134] - Yunliu Zeng, Zhiyong Pan, Yuduan Ding, Andan Zhu, Hongbo Cao, Qiang Xu, Xiuxin Deng. A proteomic analysis of the chromoplasts isolated from sweet orange fruits [Citrus sinensis (L.) Osbeck].
Journal of experimental botany.
2011 Nov; 62(15):5297-309. doi:
10.1093/jxb/err140
. [PMID: 21841170] - Janine Keller, Robert Ringseis, Steffen Priebe, Reinhard Guthke, Holger Kluge, Klaus Eder. Effect of L-carnitine on the hepatic transcript profile in piglets as animal model.
Nutrition & metabolism.
2011 Oct; 8(?):76. doi:
10.1186/1743-7075-8-76
. [PMID: 22040461] - Zhixin Zhao, Sarah M Assmann. The glycolytic enzyme, phosphoglycerate mutase, has critical roles in stomatal movement, vegetative growth, and pollen production in Arabidopsis thaliana.
Journal of experimental botany.
2011 Oct; 62(14):5179-89. doi:
10.1093/jxb/err223
. [PMID: 21813794] - S Liebel, C A Oliveira Ribeiro, R C Silva, W A Ramsdorf, M M Cestari, V F Magalhães, J R E Garcia, B M Esquivel, F Filipak Neto. Cellular responses of Prochilodus lineatus hepatocytes after cylindrospermopsin exposure.
Toxicology in vitro : an international journal published in association with BIBRA.
2011 Oct; 25(7):1493-500. doi:
10.1016/j.tiv.2011.05.010
. [PMID: 21600976] - Noriaki Shima, Izuru Miyawaki, Kiyoko Bando, Hiroshi Horie, Kei Zaitsu, Munehiro Katagi, Takeshi Bamba, Hitoshi Tsuchihashi, Eiichiro Fukusaki. Influences of methamphetamine-induced acute intoxication on urinary and plasma metabolic profiles in the rat.
Toxicology.
2011 Sep; 287(1-3):29-37. doi:
10.1016/j.tox.2011.05.012
. [PMID: 21645582] - Ashish Jacob Mathew, Jacob George. Acute kidney injury in the tropics.
Annals of Saudi medicine.
2011 Sep; 31(5):451-6. doi:
10.4103/0256-4947.84620
. [PMID: 21911980] - Zhanna Livshits, Robert S Hoffman, Kenneth B Hymes, Lewis S Nelson. If vitamins could kill: massive hemolysis following naturopathic vitamin infusion.
Journal of medical toxicology : official journal of the American College of Medical Toxicology.
2011 Sep; 7(3):224-6. doi:
10.1007/s13181-011-0140-z
. [PMID: 21336800] - Osbaldo Resendis-Antonio, Magdalena Hernández, Emmanuel Salazar, Sandra Contreras, Gabriel Martínez Batallar, Yolanda Mora, Sergio Encarnación. Systems biology of bacterial nitrogen fixation: high-throughput technology and its integrative description with constraint-based modeling.
BMC systems biology.
2011 Jul; 5(?):120. doi:
10.1186/1752-0509-5-120
. [PMID: 21801415] - Manuela Cardi, Kamel Chibani, Donata Cafasso, Nicolas Rouhier, Jean-Pierre Jacquot, Sergio Esposito. Abscisic acid effects on activity and expression of barley (Hordeum vulgare) plastidial glucose-6-phosphate dehydrogenase.
Journal of experimental botany.
2011 Jul; 62(11):4013-23. doi:
10.1093/jxb/err100
. [PMID: 21464159] - Kikuko Amo, Hidekazu Arai, Takashi Uebanso, Makiko Fukaya, Megumi Koganei, Hajime Sasaki, Hironori Yamamoto, Yutaka Taketani, Eiji Takeda. Effects of xylitol on metabolic parameters and visceral fat accumulation.
Journal of clinical biochemistry and nutrition.
2011 Jul; 49(1):1-7. doi:
10.3164/jcbn.10-111
. [PMID: 21765599] - Li Xiang, Katrien Le Roy, Mohammad-Reza Bolouri-Moghaddam, Mieke Vanhaecke, Willem Lammens, Filip Rolland, Wim Van den Ende. Exploring the neutral invertase-oxidative stress defence connection in Arabidopsis thaliana.
Journal of experimental botany.
2011 Jul; 62(11):3849-62. doi:
10.1093/jxb/err069
. [PMID: 21441406] - Ambarish Nag, Monte Lunacek, Peter A Graf, Christopher H Chang. Kinetic modeling and exploratory numerical simulation of chloroplastic starch degradation.
BMC systems biology.
2011 Jun; 5(?):94. doi:
10.1186/1752-0509-5-94
. [PMID: 21682905] - Pilar Martinez-Moya, Steven Alexander Watt, Karsten Niehaus, Jennifer Alcaíno, Marcelo Baeza, Víctor Cifuentes. Proteomic analysis of the carotenogenic yeast Xanthophyllomyces dendrorhous.
BMC microbiology.
2011 Jun; 11(?):131. doi:
10.1186/1471-2180-11-131
. [PMID: 21669001] - Berivan Tandogan, Ayşe Kuruüzüm-Uz, Cihangir Sengezer, Zuhal Güvenalp, L Ömür Demirezer, N Nuray Ulusu. In vitro effects of rosmarinic acid on glutathione reductase and glucose 6-phosphate dehydrogenase.
Pharmaceutical biology.
2011 Jun; 49(6):587-94. doi:
10.3109/13880209.2010.533187
. [PMID: 21554000] - Tracy P Torres, Noriyasu Sasaki, E Patrick Donahue, Brooks Lacy, Richard L Printz, Alan D Cherrington, Judith L Treadway, Masakazu Shiota. Impact of a glycogen phosphorylase inhibitor and metformin on basal and glucagon-stimulated hepatic glucose flux in conscious dogs.
The Journal of pharmacology and experimental therapeutics.
2011 Jun; 337(3):610-20. doi:
10.1124/jpet.110.177899
. [PMID: 21363927] - Nao Inoue, Koji Nagao, Kotaro Sakata, Naomi Yamano, Pathma Elgoda Ranawakage Gunawardena, Seo-Young Han, Toshiro Matsui, Toshihiro Nakamori, Hitoshi Furuta, Kiyoharu Takamatsu, Teruyoshi Yanagita. Screening of soy protein-derived hypotriglyceridemic di-peptides in vitro and in vivo.
Lipids in health and disease.
2011 May; 10(?):85. doi:
10.1186/1476-511x-10-85
. [PMID: 21600040] - Roseline Froissart, Monique Piraud, Alix Mollet Boudjemline, Christine Vianey-Saban, François Petit, Aurélie Hubert-Buron, Pascale Trioche Eberschweiler, Vincent Gajdos, Philippe Labrune. Glucose-6-phosphatase deficiency.
Orphanet journal of rare diseases.
2011 May; 6(?):27. doi:
10.1186/1750-1172-6-27
. [PMID: 21599942] - Xianping Fang, Huasheng Ma, Dezhao Lu, Hong Yu, Wenguo Lai, Songlin Ruan. Comparative proteomics analysis of proteins expressed in the I-1 and I-2 internodes of strawberry stolons.
Proteome science.
2011 May; 9(?):26. doi:
10.1186/1477-5956-9-26
. [PMID: 21569547] - Takeshi Izawa, Motohiro Mihara, Yuji Suzuki, Meenu Gupta, Hironori Itoh, Atsushi J Nagano, Ritsuko Motoyama, Yuji Sawada, Masahiro Yano, Masami Yokota Hirai, Amane Makino, Yoshiaki Nagamura. Os-GIGANTEA confers robust diurnal rhythms on the global transcriptome of rice in the field.
The Plant cell.
2011 May; 23(5):1741-55. doi:
10.1105/tpc.111.083238
. [PMID: 21571948] - Kumiko Saito, Suni Lee, Tetsuya Shiuchi, Chitoku Toda, Masahiro Kamijo, Kyoko Inagaki-Ohara, Shiki Okamoto, Yasuhiko Minokoshi. An enzymatic photometric assay for 2-deoxyglucose uptake in insulin-responsive tissues and 3T3-L1 adipocytes.
Analytical biochemistry.
2011 May; 412(1):9-17. doi:
10.1016/j.ab.2011.01.022
. [PMID: 21262191] - Abbas M Lafta, Karen Klotz Fugate. Metabolic profile of wound-induced changes in primary carbon metabolism in sugarbeet root.
Phytochemistry.
2011 Apr; 72(6):476-89. doi:
10.1016/j.phytochem.2010.12.016
. [PMID: 21315380] - T Sato, A Toyoshima, T Hiraki, Y Ohta, K Katayama, T Arai, H Tazaki. Effects of metformin on plasma concentrations of glucose and mannose, G6Pase and PEPCK activity, and mRNA expression in the liver and kidney of chickens.
British poultry science.
2011 Apr; 52(2):273-7. doi:
10.1080/00071668.2011.560595
. [PMID: 21491251] - R S Nithya, M M Anuja, S S Swathy, C Rajamanickam, M Indira. Effects on spermatogenesis in swiss mice of a protein isolated from the roots of Ricinus communis (Linn.) (Euphorbiaceae).
Journal of hazardous materials.
2011 Mar; 187(1-3):386-92. doi:
10.1016/j.jhazmat.2011.01.039
. [PMID: 21288636] - Xin Qu, Andrea Carolina Jimenez-Vergara, Dany J Munoz-Pinto, Diana Ortiz, Rebecca E McMahon, Deissy Cristancho, Silvia Becerra-Bayona, Viviana Guiza-Arguello, K Jane Grande-Allen, Mariah S Hahn. Regulation of smooth muscle cell phenotype by glycosaminoglycan identity.
Acta biomaterialia.
2011 Mar; 7(3):1031-9. doi:
10.1016/j.actbio.2010.11.020
. [PMID: 21094702] - Yumi Takiyama, Tatsuo Harumi, Jun Watanabe, Yukihiro Fujita, Jun Honjo, Norihiko Shimizu, Yuichi Makino, Masakazu Haneda. Tubular injury in a rat model of type 2 diabetes is prevented by metformin: a possible role of HIF-1α expression and oxygen metabolism.
Diabetes.
2011 Mar; 60(3):981-92. doi:
10.2337/db10-0655
. [PMID: 21282369] - Mahmoud Rushdi Abd Ellah. The role of liver biopsy in detection of hepatic oxidative stress.
Veterinary medicine international.
2011 Feb; 2011(?):613602. doi:
10.4061/2011/613602
. [PMID: 21403828] - Veronica Dominguez, Claudio Raimondi, Sangeeta Somanath, Marco Bugliani, Merewyn K Loder, Charlotte E Edling, Nullin Divecha, Gabriela da Silva-Xavier, Lorella Marselli, Shanta J Persaud, Mark D Turner, Guy A Rutter, Piero Marchetti, Marco Falasca, Tania Maffucci. Class II phosphoinositide 3-kinase regulates exocytosis of insulin granules in pancreatic beta cells.
The Journal of biological chemistry.
2011 Feb; 286(6):4216-25. doi:
10.1074/jbc.m110.200295
. [PMID: 21127054] - Michael A Kennedy, Nazir Kabbani, Jean-Philippe Lambert, Leigh Anne Swayne, Fida Ahmed, Daniel Figeys, Steffany A L Bennett, Jennnifer Bryan, Kristin Baetz. Srf1 is a novel regulator of phospholipase D activity and is essential to buffer the toxic effects of C16:0 platelet activating factor.
PLoS genetics.
2011 Feb; 7(2):e1001299. doi:
10.1371/journal.pgen.1001299
. [PMID: 21347278] - Stephen L Byrne, Alexandre Foito, Pete E Hedley, Jenny A Morris, Derek Stewart, Susanne Barth. Early response mechanisms of perennial ryegrass (Lolium perenne) to phosphorus deficiency.
Annals of botany.
2011 Feb; 107(2):243-54. doi:
10.1093/aob/mcq234
. [PMID: 21148585] - David H Wasserman, Li Kang, Julio E Ayala, Patrick T Fueger, Robert S Lee-Young. The physiological regulation of glucose flux into muscle in vivo.
The Journal of experimental biology.
2011 Jan; 214(Pt 2):254-62. doi:
10.1242/jeb.048041
. [PMID: 21177945] - Kamal A Amin, Hamdy H Kamel, Mohamed A Abd Eltawab. Protective effect of Garcinia against renal oxidative stress and biomarkers induced by high fat and sucrose diet.
Lipids in health and disease.
2011 Jan; 10(?):6. doi:
10.1186/1476-511x-10-6
. [PMID: 21235803] - Mohammed Salman, Chandramouli Malleda, Narayanavari A Suneel, Insaf A Qureshi, Elizabeth A Frank, Cletus Jm D'Souza. Homology modeling of human serum paraoxonase1 and its molecular interaction studies with aspirin and cefazolin.
Bioinformation.
2011; 7(2):59-63. doi:
10.6026/97320630007059
. [PMID: 21938206] - Kalpana Kalaivanan, Kodukkur Vishwanthan Pugalendi. Antihyperglycemic effect of the alcoholic seed extract of Swietenia macrophylla on streptozotocin-diabetic rats.
Pharmacognosy research.
2011 Jan; 3(1):67-71. doi:
10.4103/0974-8490.79119
. [PMID: 21731399] - Mathieu Schue, Agnes Fekete, Philippe Ortet, Catherine Brutesco, Thierry Heulin, Philippe Schmitt-Kopplin, Wafa Achouak, Catherine Santaella. Modulation of metabolism and switching to biofilm prevail over exopolysaccharide production in the response of Rhizobium alamii to cadmium.
PloS one.
2011; 6(11):e26771. doi:
10.1371/journal.pone.0026771
. [PMID: 22096497] - Fabio Facchinelli, Andreas P M Weber. The metabolite transporters of the plastid envelope: an update.
Frontiers in plant science.
2011; 2(?):50. doi:
10.3389/fpls.2011.00050
. [PMID: 22645538] - Jaya Aseervatham, Shanthi Palanivelu, Sachdanandam Panchanadham. Semecarpus anacardium (Bhallataka) Alters the Glucose Metabolism and Energy Production in Diabetic Rats.
Evidence-based complementary and alternative medicine : eCAM.
2011; 2011(?):. doi:
10.1155/2011/142978
. [PMID: 20924498] - Juan M Sandoval, Felipe A Arenas, Claudio C Vásquez. Glucose-6-phosphate dehydrogenase protects Escherichia coli from tellurite-mediated oxidative stress.
PloS one.
2011; 6(9):e25573. doi:
10.1371/journal.pone.0025573
. [PMID: 21984934] - Jørgen Jensen, Per Inge Rustad, Anders Jensen Kolnes, Yu-Chiang Lai. The role of skeletal muscle glycogen breakdown for regulation of insulin sensitivity by exercise.
Frontiers in physiology.
2011; 2(?):112. doi:
10.3389/fphys.2011.00112
. [PMID: 22232606] - Anna Vidal-Alabró, Alícia G Gómez-Valadés, Andrés Méndez-Lucas, Jordi Llorens, Ramon Bartrons, Jordi Bermúdez, Jose C Perales. Liver Glucokinase(A456V) Induces Potent Hypoglycemia without Dyslipidemia through a Paradoxical Induction of the Catalytic Subunit of Glucose-6-Phosphatase.
International journal of endocrinology.
2011; 2011(?):707928. doi:
10.1155/2011/707928
. [PMID: 22194744] - Jyotsana Singhal, Lokesh Nagaprashantha, Rit Vatsyayan, Sanjay Awasthi, Sharad S Singhal. RLIP76, a glutathione-conjugate transporter, plays a major role in the pathogenesis of metabolic syndrome.
PloS one.
2011; 6(9):e24688. doi:
10.1371/journal.pone.0024688
. [PMID: 21931813] - Kristine E Bernard, Tony L Parkes, Thomas J S Merritt. A model of oxidative stress management: moderation of carbohydrate metabolizing enzymes in SOD1-null Drosophila melanogaster.
PloS one.
2011; 6(9):e24518. doi:
10.1371/journal.pone.0024518
. [PMID: 21909438] - Sébastien Proulx-Bonneau, Borhane Annabi. The primary cilium as a biomarker in the hypoxic adaptation of bone marrow-derived mesenchymal stromal cells: a role for the secreted frizzled-related proteins.
Biomarker insights.
2011; 6(?):107-18. doi:
10.4137/bmi.s8247
. [PMID: 22084569] - Pascal Dammeyer, Elias S J Arnér. Human Protein Atlas of redox systems - what can be learnt?.
Biochimica et biophysica acta.
2011 Jan; 1810(1):111-38. doi:
10.1016/j.bbagen.2010.07.004
. [PMID: 20647035] - Yazmin Macotela, Brice Emanuelli, Anneli M Bång, Daniel O Espinoza, Jeremie Boucher, Kirk Beebe, Walter Gall, C Ronald Kahn. Dietary leucine--an environmental modifier of insulin resistance acting on multiple levels of metabolism.
PloS one.
2011; 6(6):e21187. doi:
10.1371/journal.pone.0021187
. [PMID: 21731668] - Aldo Grefhorst, Marijke Schreurs, Maaike H Oosterveer, Victor A Cortés, Rick Havinga, Andreas W Herling, Dirk-Jan Reijngoud, Albert K Groen, Folkert Kuipers. Carbohydrate-response-element-binding protein (ChREBP) and not the liver X receptor α (LXRα) mediates elevated hepatic lipogenic gene expression in a mouse model of glycogen storage disease type 1.
The Biochemical journal.
2010 Dec; 432(2):249-54. doi:
10.1042/bj20101225
. [PMID: 20854262] - Ryota Hosomi, Kenji Fukunaga, Hirofumi Arai, Seiji Kanda, Toshimasa Nishiyama, Munehiro Yoshida. Effect of dietary protamine on lipid metabolism in rats.
Nutrition research and practice.
2010 Dec; 4(6):462-9. doi:
10.4162/nrp.2010.4.6.462
. [PMID: 21286403] - Ana Sanz, Cristina E Trenzado, Manuel J López-Rodríguez, Miriam Furné, J Manuel Tierno de Figueroa. Study of antioxidant defense in four species of Perloidea (Insecta, Plecoptera).
Zoological science.
2010 Dec; 27(12):952-8. doi:
10.2108/zsj.27.952
. [PMID: 21110722] - R H Patil, K Prakash, V L Maheshwari. Hypolipidemic Effect of Celastrus paniculatus in Experimentally Induced Hypercholesterolemic Wistar Rats.
Indian journal of clinical biochemistry : IJCB.
2010 Oct; 25(4):405-10. doi:
10.1007/s12291-010-0050-x
. [PMID: 21966115] - Max Sajitz-Hermstein, Zoran Nikoloski. A novel approach for determining environment-specific protein costs: the case of Arabidopsis thaliana.
Bioinformatics (Oxford, England).
2010 Sep; 26(18):i582-8. doi:
10.1093/bioinformatics/btq390
. [PMID: 20823325] - Imam A A Mekkawy, Usama M Mahmoud, Alaa G Osman, Alaa El-Din H Sayed. Effects of ultraviolet A on the activity of two metabolic enzymes, DNA damage and lipid peroxidation during early developmental stages of the African catfish, Clarias gariepinus (Burchell, 1822).
Fish physiology and biochemistry.
2010 Sep; 36(3):605-626. doi:
10.1007/s10695-009-9334-6
. [PMID: 19609701] - J Renugadevi, S Milton Prabu. Quercetin protects against oxidative stress-related renal dysfunction by cadmium in rats.
Experimental and toxicologic pathology : official journal of the Gesellschaft fur Toxikologische Pathologie.
2010 Sep; 62(5):471-81. doi:
10.1016/j.etp.2009.06.006
. [PMID: 19615871] - Megha Saraswat, Palla Suryanarayana, Paduru Yadagiri Reddy, Madhoosudan A Patil, Nagalla Balakrishna, Geereddy Bhanuprakash Reddy. Antiglycating potential of Zingiber officinalis and delay of diabetic cataract in rats.
Molecular vision.
2010 Aug; 16(?):1525-37. doi:
. [PMID: 20806076]
- Saltuk Buğrahan Ceyhun, Murat Sentürk, Deniz Ekinci, Orhan Erdoğan, Abdulkadir Ciltaş, Esat Mahmut Kocaman. Deltamethrin attenuates antioxidant defense system and induces the expression of heat shock protein 70 in rainbow trout.
Comparative biochemistry and physiology. Toxicology & pharmacology : CBP.
2010 Aug; 152(2):215-23. doi:
10.1016/j.cbpc.2010.04.008
. [PMID: 20417719] - Thanasekaran Jayakumar, Philip Aloysius Thomas, Elango Ramesh, Pitchairaj Geraldine. An extract of the pleurotus ostreatus mushroom bolsters the glutathione redox system in various organs of aged rats.
Journal of medicinal food.
2010 Aug; 13(4):771-8. doi:
10.1089/jmf.2009.1130
. [PMID: 20673055] - Cristina Fernandez-Aunión, Thouraya Ben Hamouda, Fernando Iglesias-Guerra, Montserrat Argandoña, Mercedes Reina-Bueno, Joaquín J Nieto, M Elarbi Aouani, Carmen Vargas. Biosynthesis of compatible solutes in rhizobial strains isolated from Phaseolus vulgaris nodules in Tunisian fields.
BMC microbiology.
2010 Jul; 10(?):192. doi:
10.1186/1471-2180-10-192
. [PMID: 20633304] - Sebastian J Padayatty, Andrew Y Sun, Qi Chen, Michael Graham Espey, Jeanne Drisko, Mark Levine. Vitamin C: intravenous use by complementary and alternative medicine practitioners and adverse effects.
PloS one.
2010 Jul; 5(7):e11414. doi:
10.1371/journal.pone.0011414
. [PMID: 20628650] - Ebenezer O Farombi, Isaac A Adedara, Azubike P Ebokaiwe, Roy Teberen, Theresa Ehwerhemuepha. Nigerian Bonny light crude oil disrupts antioxidant systems in testes and sperm of rats.
Archives of environmental contamination and toxicology.
2010 Jul; 59(1):166-74. doi:
10.1007/s00244-009-9443-3
. [PMID: 20037784] - A Brehm, M Krssák, A I Schmid, P Nowotny, W Waldhäusl, M Roden. Acute elevation of plasma lipids does not affect ATP synthesis in human skeletal muscle.
American journal of physiology. Endocrinology and metabolism.
2010 Jul; 299(1):E33-8. doi:
10.1152/ajpendo.00756.2009
. [PMID: 20442322] - Francesca Rossi, Simona Ruggiero, Mariapina Gallo, Gelsomina Simeone, Sofia Maria Rosaria Matarese, Bruno Nobili. Amoxicillin-induced hemolytic anemia in a child with glucose 6-phosphate isomerase deficiency.
The Annals of pharmacotherapy.
2010 Jul; 44(7-8):1327-9. doi:
10.1345/aph.1p030
. [PMID: 20516363] - Sadaf Khan, Scott C Rowe, Frank G Harmon. Coordination of the maize transcriptome by a conserved circadian clock.
BMC plant biology.
2010 Jun; 10(?):126. doi:
10.1186/1471-2229-10-126
. [PMID: 20576144] - Xristo Zárate, David C Henderson, Keenan C Phillips, April D Lake, David W Galbraith. Development of high-yield autofluorescent protein microarrays using hybrid cell-free expression with combined Escherichia coli S30 and wheat germ extracts.
Proteome science.
2010 Jun; 8(?):32. doi:
10.1186/1477-5956-8-32
. [PMID: 20546627] - Leonid E Fridlyand, Louis H Philipson. Glucose sensing in the pancreatic beta cell: a computational systems analysis.
Theoretical biology & medical modelling.
2010 May; 7(?):15. doi:
10.1186/1742-4682-7-15
. [PMID: 20497556] - Yuki Ogasawara, Kazuyuki Ishii. Exposure to chrysotile asbestos causes carbonylation of glucose 6-phosphate dehydrogenase through a reaction with lipid peroxidation products in human lung epithelial cells.
Toxicology letters.
2010 May; 195(1):1-8. doi:
10.1016/j.toxlet.2010.03.001
. [PMID: 20211231] - Daniel R Ruzicka, Felipe H Barrios-Masias, Natasha T Hausmann, Louise E Jackson, Daniel P Schachtman. Tomato root transcriptome response to a nitrogen-enriched soil patch.
BMC plant biology.
2010 Apr; 10(?):75. doi:
10.1186/1471-2229-10-75
. [PMID: 20423508] - Sabina Paglialunga, Alexandre Fisette, Mercedes Munkonda, Ying Gao, Denis Richard, Katherine Cianflone. The effects of acylation stimulating protein supplementation VS antibody neutralization on energy expenditure in wildtype mice.
BMC physiology.
2010 Apr; 10(?):4. doi:
10.1186/1472-6793-10-4
. [PMID: 20416070] - Aleksej Zelezniak, Tune H Pers, Simão Soares, Mary Elizabeth Patti, Kiran Raosaheb Patil. Metabolic network topology reveals transcriptional regulatory signatures of type 2 diabetes.
PLoS computational biology.
2010 Apr; 6(4):e1000729. doi:
10.1371/journal.pcbi.1000729
. [PMID: 20369014] - Søren K Rasmussen, Christina Rønn Ingvardsen, Anna Maria Torp. Mutations in genes controlling the biosynthesis and accumulation of inositol phosphates in seeds.
Biochemical Society transactions.
2010 Apr; 38(2):689-94. doi:
10.1042/bst0380689
. [PMID: 20298244]