Adenosine monophosphate (BioDeep_00000001261)
Secondary id: BioDeep_00001867750
natural product human metabolite PANOMIX_OTCML-2023 Endogenous blood metabolite Chemicals and Drugs BioNovoGene_Lab2019
Metabolite Card
Formula: C10H14N5O7P (347.0631)
Chinese Names: 單磷酸腺苷, 一磷酸腺苷, 单磷酸腺苷酸, 腺苷-5'-单磷酸 二钠盐, 5-腺苷酸
Spectrum Hits:
Top Source Homo sapiens(blood) 27.1%
Last reviewed on 2024-07-01.
Cite this Page
Adenosine monophosphate. BioDeep Database v3. PANOMIX ltd, a top metabolomics service provider from China.
https://query.biodeep.cn/s/adenosine_monophosphate (retrieved
2024-12-10) (BioDeep RN: BioDeep_00000001261). Licensed
under the Attribution-Noncommercial 4.0 International License (CC BY-NC 4.0).
Molecular Structure
SMILES: C1=NC(=C2C(=N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O)N
InChI: InChI=1S/C10H14N5O7P/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20)
Description
Adenosine monophosphate, also known as adenylic acid or amp, is a member of the class of compounds known as purine ribonucleoside monophosphates. Purine ribonucleoside monophosphates are nucleotides consisting of a purine base linked to a ribose to which one monophosphate group is attached. Adenosine monophosphate is slightly soluble (in water) and a moderately acidic compound (based on its pKa). Adenosine monophosphate can be found in a number of food items such as kiwi, taro, alaska wild rhubarb, and skunk currant, which makes adenosine monophosphate a potential biomarker for the consumption of these food products. Adenosine monophosphate can be found primarily in most biofluids, including blood, feces, cerebrospinal fluid (CSF), and urine, as well as throughout all human tissues. Adenosine monophosphate exists in all living species, ranging from bacteria to humans. In humans, adenosine monophosphate is involved in several metabolic pathways, some of which include josamycin action pathway, methacycline action pathway, nevirapine action pathway, and aspartate metabolism. Adenosine monophosphate is also involved in several metabolic disorders, some of which include hyperornithinemia-hyperammonemia-homocitrullinuria [hhh-syndrome], molybdenum cofactor deficiency, xanthinuria type I, and mitochondrial DNA depletion syndrome. Adenosine monophosphate is a drug which is used for nutritional supplementation, also for treating dietary shortage or imbalanc.
Adenosine monophosphate, also known as 5-adenylic acid and abbreviated AMP, is a nucleotide that is found in RNA. It is an ester of phosphoric acid with the nucleoside adenosine. AMP consists of the phosphate group, the pentose sugar ribose, and the nucleobase adenine. AMP can be produced during ATP synthesis by the enzyme adenylate kinase. AMP has recently been approved as a Bitter Blocker additive to foodstuffs. When AMP is added to bitter foods or foods with a bitter aftertaste it makes them seem sweeter. This potentially makes lower calorie food products more palatable.
[Spectral] AMP (exact mass = 347.06308) and Guanine (exact mass = 151.04941) and 3,4-Dihydroxy-L-phenylalanine (exact mass = 197.06881) and Glutathione disulfide (exact mass = 612.15196) were not completely separated on HPLC under the present analytical conditions as described in AC$XXX. Additionally some of the peaks in this data contains dimers and other unidentified ions.
[Spectral] AMP (exact mass = 347.06308) and Glutathione disulfide (exact mass = 612.15196) were not completely separated on HPLC under the present analytical conditions as described in AC$XXX. Additionally some of the peaks in this data contains dimers and other unidentified ions.
[Spectral] AMP (exact mass = 347.06308) and Adenine (exact mass = 135.0545) were not completely separated on HPLC under the present analytical conditions as described in AC$XXX. Additionally some of the peaks in this data contains dimers and other unidentified ions.
Adenosine monophosphate. CAS Common Chemistry. CAS, a division of the American Chemical Society, n.d. https://commonchemistry.cas.org/detail?cas_rn=67583-85-1 (retrieved 2024-07-01) (CAS RN: 61-19-8). Licensed under the Attribution-Noncommercial 4.0 International License (CC BY-NC 4.0).
Adenosine monophosphate is a key cellular metabolite regulating energy homeostasis and signal transduction.
Adenosine monophosphate is a key cellular metabolite regulating energy homeostasis and signal transduction.
Adenosine monophosphate is a key cellular metabolite regulating energy homeostasis and signal transduction.
Synonyms
70 synonym names
{[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}phosphonic acid; [5-(6-Aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate; Adenosine 5-(dihydrogen phosphoric acid); Adenosine-5-monophosphate sodium salt; Adenosine 5-(dihydrogen phosphate); Dipotassium, adenosine phosphate; Phosphate dipotassium, adenosine; Adenosine-5-monophosphoric acid; 5-Adenosine monophosphoric acid; Adenosine phosphate dipotassium; Adenosine 5-monophosphoric acid; Adenosine monophosphoric acid; Disodium, adenosine phosphate; Phosphate disodium, adenosine; Adenosine phosphate disodium; Adenosine 5-phosphoric acid; Adenosine-5-monophosphorate; Phosphoric acid dadenosine; monoPhosphate, 2-adenosine; Adenosine-5-monophosphate; Adenosine phosphoric acid; 2 Adenosine monophosphate; 5-Adenosine monophosphate; 2-Adenosine monophosphate; Adenosine 5-monophosphate; Adenosine-monophosphate; Adenosine 5-phosphorate; Adenosine monophosphate; 5-Phosphate, adenosine; 5-O-Phosphonoadenosine; Adenosine 2 phosphate; Adenosine 2-phosphate; Adenosine 3 phosphate; Adenosine 3-phosphate; Adenosine 5 phosphate; Adenosine 5-phosphate; Fosfato de adenosina; Muscle adenylic acid; Phosphate dadenosine; Adenosine-phosphate; Adenosine phosphate; Adenosini phosphas; Acid, 5-adenylic; Acid, 2-adenylic; Muscle adenylate; 5 Adenylic acid; 2-Adenylic acid; 5-Adenylic acid; 2 Adenylic acid; Phosphentaside; Adenylic acid; Adenosine-5p; 5-Adenylate; My-beta-den; Cardiomone; Phosphaden; Adenovite; Adenylate; Phosaden; My-b-den; Lycedan; Adenyl; Ado5p; 2-AMP; 5-AMP; PAdo; AMP; pA; Adenosine monophosphate (AMP); AMP
Cross Reference
61 cross reference id
- ChEBI: CHEBI:181501
- ChEBI: CHEBI:22256
- ChEBI: CHEBI:16027
- ChEBI: CHEBI:37096
- KEGG: C00020
- KEGGdrug: D02769
- PubChem: 6083
- HMDB: HMDB0000045
- Metlin: METLIN34478
- DrugBank: DB00131
- ChEMBL: CHEMBL16720
- ChEMBL: CHEMBL752
- Wikipedia: Adenylic_acid
- MeSH: Adenosine Monophosphate
- MeSH: Vidarabine Phosphate
- MeSH: Poly A
- MetaCyc: AMP
- KNApSAcK: C00019347
- foodb: FDB030677
- chemspider: 5858
- CAS: 61-19-8
- MoNA: KNA00450
- MoNA: KNA00199
- MoNA: PS011008
- MoNA: PR100065
- MoNA: KNA00448
- MoNA: KNA00599
- MoNA: PS011003
- MoNA: PR100064
- MoNA: PS011004
- MoNA: KNA00197
- MoNA: PS011002
- MoNA: PS011001
- MoNA: PR100515
- MoNA: KNA00447
- MoNA: KNA00817
- MoNA: PS011006
- MoNA: PS011009
- MoNA: KNA00819
- MoNA: KNA00597
- MoNA: KNA00449
- MoNA: PS075303
- MoNA: PS011005
- MoNA: KNA00818
- MoNA: PS011011
- MoNA: KNA00816
- MoNA: KNA00596
- MoNA: PS011010
- MoNA: PS011007
- PMhub: MS000000224
- PDB-CCD: A
- PDB-CCD: AMP
- PDB-CCD: AP7
- 3DMET: B01133
- NIKKAJI: J4.814C
- medchemexpress: HY-A0181
- BioNovoGene_Lab2019: BioNovoGene_Lab2019-191
- PubChem: 3322
- KNApSAcK: 16027
- LOTUS: LTS0007212
- LOTUS: LTS0080280
Classification Terms
Related Pathways
Reactome(7)
BioCyc(34)
- purine and pyrimidine metabolism
- salvage pathways of purine nucleosides
- purine nucleotide metabolism (phosphotransfer and nucleotide modification)
- salvage pathways of adenine, hypoxanthine, and their nucleosides
- purine nucleotides de novo biosynthesis I
- superpathway of histidine, purine, and pyrimidine biosynthesis
- purine nucleotides de novo biosynthesis II
- salvage pathways of purine nucleosides I
- NAD biosynthesis (from tryptophan)
- fatty acid oxidation pathway
- phenylacetate degradation
- acetate utilization
- pantothenate and coenzyme A biosynthesis
- superpathway of central carbon metabolism
- NAD biosynthesis II (from tryptophan)
- tRNA charging pathway
- pyridine nucleotide cycling
- superpathway of histidine, purine and pyrimidine biosynthesis
- superpathway of aspartate and asparagine biosynthesis; interconversion of aspartate and asparagine
- asparagine biosynthesis II
- thiamin (vitamin B1) biosynthesis
- acetyl-CoA degradation to acetate
- glycolysis I
- selenocysteine biosynthesis I (bacteria)
- superpathway of glycolysis, pyruvate dehydrogenase and TCA cycle
- ethanol degradation II (cytosol)
- fatty acid β-oxidation II (core pathway)
- oxidative ethanol degradation III (microsomal)
- ethanol degradation IV (peroxisomal)
- superpathway of glyoxylate cycle
- superpathway of glycolysis and Entner-Doudoroff
- glycolysis II
- arginine biosynthesis I
- tetrahydrofolate biosynthesis I
PlantCyc(0)
Biological Process
2783 related biological process reactions.
Reactome(281)
- Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Nucleotide metabolism:
H2O + XTP ⟶ PPi + XMP
- Nucleobase biosynthesis:
ATP + H2O + L-Gln + XMP ⟶ AMP + GMP + L-Glu + PPi
- Purine ribonucleoside monophosphate biosynthesis:
ATP + H2O + L-Gln + XMP ⟶ AMP + GMP + L-Glu + PPi
- Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Nucleotide metabolism:
H2O + XTP ⟶ PPi + XMP
- Nucleobase biosynthesis:
ATP + H2O + L-Gln + XMP ⟶ AMP + GMP + L-Glu + PPi
- Purine ribonucleoside monophosphate biosynthesis:
ATP + H2O + L-Gln + XMP ⟶ AMP + GMP + L-Glu + PPi
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Nucleotide metabolism:
H2O + XTP ⟶ PPi + XMP
- Nucleobase biosynthesis:
ATP + H2O + L-Gln + XMP ⟶ AMP + GMP + L-Glu + PPi
- Purine ribonucleoside monophosphate biosynthesis:
ATP + H2O + L-Gln + XMP ⟶ AMP + GMP + L-Glu + PPi
- Mycobacterium tuberculosis biological processes:
CYSTA + H2O ⟶ 2OBUTA + L-Cys + ammonia
- Mycothiol metabolism:
GlcNAc-Ins + H2O ⟶ CH3COO- + GlcNI
- Mycothiol biosynthesis:
GlcNAc-Ins + H2O ⟶ CH3COO- + GlcNI
- Metabolism of RNA:
H2O ⟶ AMP + CMP + GMP + UMP
- Deadenylation-dependent mRNA decay:
H2O ⟶ AMP + CMP + GMP + UMP
- mRNA decay by 3' to 5' exoribonuclease:
H2O ⟶ AMP + CMP + GMP + UMP
- Metabolism of RNA:
H2O ⟶ AMP + CMP + GMP + UMP
- Deadenylation-dependent mRNA decay:
H2O ⟶ AMP + CMP + GMP + UMP
- mRNA decay by 3' to 5' exoribonuclease:
H2O ⟶ AMP + CMP + GMP + UMP
- Metabolism of RNA:
H2O + Translatable mRNA Complex ⟶ AMP + Partially Deadenylated mRNA Complex
- Deadenylation-dependent mRNA decay:
H2O + Translatable mRNA Complex ⟶ AMP + Partially Deadenylated mRNA Complex
- mRNA decay by 3' to 5' exoribonuclease:
H2O ⟶ AMP + CMP + GMP + UMP
- Nucleobase catabolism:
H2O + XTP ⟶ PPi + XMP
- Purine catabolism:
H2O + XTP ⟶ PPi + XMP
- Phosphate bond hydrolysis by NUDT proteins:
ADP-D-ribose + H2O ⟶ AMP + R5P
- Nucleobase catabolism:
H2O + XTP ⟶ PPi + XMP
- Purine catabolism:
H2O + XTP ⟶ PPi + XMP
- Phosphate bond hydrolysis by NUDT proteins:
ADP-D-ribose + H2O ⟶ AMP + R5P
- Nucleobase catabolism:
H2O + XTP ⟶ PPi + XMP
- Purine catabolism:
H2O + XTP ⟶ PPi + XMP
- Phosphate bond hydrolysis by NUDT proteins:
ADP-D-ribose + H2O ⟶ AMP + R5P
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Nicotinate metabolism:
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Nicotinate metabolism:
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Nicotinate metabolism:
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- Amino Acid conjugation:
ATP + BENZA + CoA ⟶ AMP + BEZ-CoA + PPi
- Conjugation of carboxylic acids:
ATP + BENZA + CoA ⟶ AMP + BEZ-CoA + PPi
- Conjugation of benzoate with glycine:
ATP + BENZA + CoA ⟶ AMP + BEZ-CoA + PPi
- Biological oxidations:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP
- Amino Acid conjugation:
ATP + BENZA + CoA ⟶ AMP + BEZ-CoA + PPi
- Conjugation of carboxylic acids:
ATP + BENZA + CoA ⟶ AMP + BEZ-CoA + PPi
- Conjugation of benzoate with glycine:
ATP + BENZA + CoA ⟶ AMP + BEZ-CoA + PPi
- Metabolism of lipids:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN
- Fatty acid metabolism:
Ac-CoA + H2O ⟶ CH3COO- + CoA-SH
- Fatty acyl-CoA biosynthesis:
ATP + CoA-SH + VLCFA ⟶ AMP + PPi + VLCFA-CoA
- Synthesis of very long-chain fatty acyl-CoAs:
ATP + CoA-SH + VLCFA ⟶ AMP + PPi + VLCFA-CoA
- Metabolism of lipids:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN
- Fatty acid metabolism:
Ac-CoA + H2O ⟶ CH3COO- + CoA-SH
- Fatty acyl-CoA biosynthesis:
ATP + CoA-SH + VLCFA ⟶ AMP + PPi + VLCFA-CoA
- Synthesis of very long-chain fatty acyl-CoAs:
ATP + CoA-SH + VLCFA ⟶ AMP + PPi + VLCFA-CoA
- Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Fatty acyl-CoA biosynthesis:
ATP + CoA + VLCFA ⟶ AMP + PPi + VLCFA-CoA
- Synthesis of very long-chain fatty acyl-CoAs:
ATP + CoA + VLCFA ⟶ AMP + PPi + VLCFA-CoA
- Vitamin B1 (thiamin) metabolism:
ATP + THMN ⟶ AMP + TPP
- Vitamin B1 (thiamin) metabolism:
ATP + THMN ⟶ AMP + TPP
- Vitamin B1 (thiamin) metabolism:
ATP + THMN ⟶ AMP + TPP
- Vitamin B5 (pantothenate) metabolism:
ATP + L-Cys + PPanK ⟶ AMP + PPC + PPi
- Coenzyme A biosynthesis:
ATP + L-Cys + PPanK ⟶ AMP + PPC + PPi
- Vitamin B5 (pantothenate) metabolism:
ATP + L-Cys + PPanK ⟶ AMP + PPC + PPi
- Coenzyme A biosynthesis:
ATP + L-Cys + PPanK ⟶ AMP + PPC + PPi
- Vitamin B5 (pantothenate) metabolism:
ATP + L-Cys + PPanK ⟶ AMP + PPC + PPi
- Coenzyme A biosynthesis:
ATP + L-Cys + PPanK ⟶ AMP + PPC + PPi
- Biological oxidations:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN
- Phase I - Functionalization of compounds:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN
- Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Biological oxidations:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN
- Phase I - Functionalization of compounds:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN
- Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Ketone body metabolism:
ACA + H+ + NADH ⟶ NAD + bHBA
- Synthesis of Ketone Bodies:
ACA + H+ + NADH ⟶ NAD + bHBA
- Phase I - Functionalization of compounds:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN
- Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- alpha-linolenic (omega3) and linoleic (omega6) acid metabolism:
ALA + ATP + CoA-SH ⟶ ALA-CoA + AMP + PPi
- alpha-linolenic acid (ALA) metabolism:
ALA + ATP + CoA-SH ⟶ ALA-CoA + AMP + PPi
- alpha-linolenic (omega3) and linoleic (omega6) acid metabolism:
ALA + ATP + CoA-SH ⟶ ALA-CoA + AMP + PPi
- alpha-linolenic acid (ALA) metabolism:
ALA + ATP + CoA-SH ⟶ ALA-CoA + AMP + PPi
- alpha-linolenic (omega3) and linoleic (omega6) acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- alpha-linolenic acid (ALA) metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Molybdenum cofactor biosynthesis:
ATP + MOCS2 + MOCS3-S-S(1-):Zn2+ ⟶ AMP + MOCS3:Zn2+ (ox.) + O22827 + PPi
- Molybdenum cofactor biosynthesis:
ATP + MOCS3-S-S(1-):Zn2+ + Q6Z2X3 ⟶ AMP + MOCS3:Zn2+ (ox.) + PPi + Q6Z2X3
- Biotin transport and metabolism:
6xMCCC1:6xMCCC2 + ATP + Btn ⟶ 6x(Btn-MCCC1:MCCC2) + AMP + PPi
- Biotin transport and metabolism:
6xMCCC1:6xMCCC2 + ATP + Btn ⟶ 6x(Btn-MCCC1:MCCC2) + AMP + PPi
- Biotin transport and metabolism:
6x(PCCA:PCCB) + ATP + Btn ⟶ 6x(Btn-PCCA:PCCB) + AMP + PPi
- Signaling Pathways:
AMP + p-AMPK heterotrimer ⟶ p-AMPK heterotrimer:AMP
- Signaling by Receptor Tyrosine Kinases:
H2O + cAMP ⟶ AMP
- Signaling by Insulin receptor:
H2O + cAMP ⟶ AMP
- Insulin receptor signalling cascade:
H2O + cAMP ⟶ AMP
- IRS-mediated signalling:
H2O + cAMP ⟶ AMP
- PI3K Cascade:
H2O + cAMP ⟶ AMP
- PKB-mediated events:
H2O + cAMP ⟶ AMP
- PDE3B signalling:
H2O + cAMP ⟶ AMP
- Signaling by Type 1 Insulin-like Growth Factor 1 Receptor (IGF1R):
H2O + cAMP ⟶ AMP
- IGF1R signaling cascade:
H2O + cAMP ⟶ AMP
- IRS-related events triggered by IGF1R:
H2O + cAMP ⟶ AMP
- Signaling by GPCR:
H2O + cAMP ⟶ AMP
- GPCR downstream signalling:
H2O + cAMP ⟶ AMP
- G alpha (s) signalling events:
H2O + cAMP ⟶ AMP
- G alpha (i) signalling events:
H2O + cAMP ⟶ AMP
- Opioid Signalling:
H2O + cAMP ⟶ AMP
- G-protein mediated events:
H2O + cAMP ⟶ AMP
- PLC beta mediated events:
H2O + cAMP ⟶ AMP
- Ca-dependent events:
H2O + cAMP ⟶ AMP
- CaM pathway:
H2O + cAMP ⟶ AMP
- Calmodulin induced events:
H2O + cAMP ⟶ AMP
- Cam-PDE 1 activation:
H2O + cAMP ⟶ AMP
- DARPP-32 events:
H2O + cAMP ⟶ AMP
- Intracellular signaling by second messengers:
H2O + cAMP ⟶ AMP
- DAG and IP3 signaling:
H2O + cAMP ⟶ AMP
- Ketone body metabolism:
ACA + ATP + CoA-SH ⟶ ACA-CoA + AMP + PPi
- Synthesis of Ketone Bodies:
ACA + ATP + CoA-SH ⟶ ACA-CoA + AMP + PPi
- Ketone body metabolism:
ACA + ATP + CoA-SH ⟶ ACA-CoA + AMP + PPi
- Synthesis of Ketone Bodies:
ACA + ATP + CoA-SH ⟶ ACA-CoA + AMP + PPi
- Conjugation of phenylacetate with glutamine:
ATP + CoA + phenylacetate ⟶ AMP + PPi + phenylacetyl-CoA
- Conjugation of phenylacetate with glutamine:
ATP + CoA + phenylacetate ⟶ AMP + PPi + phenylacetyl-CoA
- Nucleotide salvage:
Ade + PRPP ⟶ AMP + PPi
- Purine salvage:
Ade + PRPP ⟶ AMP + PPi
- Nucleotide salvage:
Ade + PRPP ⟶ AMP + PPi
- Purine salvage:
Ade + PRPP ⟶ AMP + PPi
- Nucleotide salvage:
Ade + PRPP ⟶ AMP + PPi
- Purine salvage:
Ade + PRPP ⟶ AMP + PPi
- Nicotinamide salvaging:
AMP + H2O + NADH ⟶ H+ + NMNH
- Nicotinamide salvaging:
AMP + H2O + NADH ⟶ H+ + NMNH
- Nicotinamide salvaging:
AMP + H2O + NADH ⟶ H+ + NMNH
- Hemostasis:
AMP + GTP ⟶ ADP + GDP
- Factors involved in megakaryocyte development and platelet production:
AMP + GTP ⟶ ADP + GDP
- Selenocysteine synthesis:
ATP + H2O + H2Se ⟶ AMP + H+ + Pi + SELP
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Selenoamino acid metabolism:
ATP + H2O + H2Se ⟶ AMP + H+ + Pi + SELP
- Selenocysteine synthesis:
ATP + H2O + H2Se ⟶ AMP + H+ + Pi + SELP
- Cytosolic sulfonation of small molecules:
H2O + PNPB ⟶ BUT + PNP
- Metabolism of polyamines:
GAA + SAM ⟶ CRET + H+ + SAH
- Urea cycle:
ATP + L-Asp + L-Cit ⟶ AMP + ARSUA + PPi
- The citric acid (TCA) cycle and respiratory electron transport:
ETF:FAD + FADH2 ⟶ ETF:FADH2 + FAD
- Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins.:
ETF:FAD + FADH2 ⟶ ETF:FADH2 + FAD
- Respiratory electron transport:
ETF:FAD + FADH2 ⟶ ETF:FADH2 + FAD
- The citric acid (TCA) cycle and respiratory electron transport:
ETF:FAD + FADH2 ⟶ ETF:FADH2 + FAD
- Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins.:
ETF:FAD + FADH2 ⟶ ETF:FADH2 + FAD
- Respiratory electron transport:
ETF:FAD + FADH2 ⟶ ETF:FADH2 + FAD
- The citric acid (TCA) cycle and respiratory electron transport:
CoQ + ETF:FADH2 ⟶ ETF:FAD + ubiquinol
- Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins.:
ETF:FAD + FADH2 ⟶ ETF:FADH2 + FAD
- Respiratory electron transport:
ETF:FAD + FADH2 ⟶ ETF:FADH2 + FAD
- Linoleic acid (LA) metabolism:
ATP + CoA-SH + LA ⟶ AMP + LA-CoA + PPi
- Linoleic acid (LA) metabolism:
ATP + CoA-SH + LA ⟶ AMP + LA-CoA + PPi
- Linoleic acid (LA) metabolism:
ATP + CoA-SH + LA ⟶ AMP + LA-CoA + PPi
- Vitamin B2 (riboflavin) metabolism:
FAD + H2O ⟶ AMP + FMN
- Vitamin B2 (riboflavin) metabolism:
FAD + H2O ⟶ AMP + FMN
- Vitamin B2 (riboflavin) metabolism:
FAD + H2O ⟶ AMP + FMN
- Conjugation of salicylate with glycine:
ATP + CoA + SAL ⟶ 2-hydroxybenzoyl-CoA + AMP + PPi
- Conjugation of salicylate with glycine:
ATP + CoA + SAL ⟶ 2-hydroxybenzoyl-CoA + AMP + PPi
- Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN
- Glucose metabolism:
ADP + Glc ⟶ AMP + G6P
- Glycolysis:
ADP + Glc ⟶ AMP + G6P
- Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Sulfur compound metabolism:
CYSTA + H2O ⟶ 2OBUTA + L-Cys + ammonia
- Sulfur amino acid metabolism:
CYSTA + H2O ⟶ 2OBUTA + L-Cys + ammonia
- Cysteine synthesis from O-acetylserine:
OAcSer + S(2-) ⟶ CH3COO- + L-Cys
- Synthesis of bile acids and bile salts via 24-hydroxycholesterol:
ATP + CoA-SH + TetraHCA ⟶ 25(R) TetraHCA-CoA + AMP + H2O + PPi
- SeMet incorporation into proteins:
ATP + SeMet ⟶ AMP + PPi
- Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Gamma carboxylation, hypusine formation and arylsulfatase activation:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Synthesis of diphthamide-EEF2:
ATP + Homologues of diphthine EEF2 + NH4+ ⟶ AMP + Homologues of EEF2 + PPi
- Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Gamma carboxylation, hypusine formation and arylsulfatase activation:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Synthesis of diphthamide-EEF2:
ATP + Homologues of diphthine EEF2 + NH4+ ⟶ AMP + Homologues of EEF2 + PPi
- Metabolism of proteins:
EIF5A2 + NAD + SPM ⟶ 1,3-diaminopropane + H+ + H0ZKZ7 + NADH
- Post-translational protein modification:
EIF5A2 + NAD + SPM ⟶ 1,3-diaminopropane + H+ + H0ZKZ7 + NADH
- Gamma carboxylation, hypusine formation and arylsulfatase activation:
EIF5A2 + NAD + SPM ⟶ 1,3-diaminopropane + H+ + H0ZKZ7 + NADH
- Synthesis of diphthamide-EEF2:
ATP + H0YRX1 + NH4+ ⟶ AMP + H0YRX1 + PPi
- Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN
- Pentose phosphate pathway:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis:
ATP + R5P ⟶ AMP + PRPP
- Mitochondrial Fatty Acid Beta-Oxidation:
ATP + CoA + MCFA ⟶ AMP + MCFA-CoA + PPi
- Interconversion of nucleotide di- and triphosphates:
AMP + ATP ⟶ ADP
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Amino acid synthesis and interconversion (transamination):
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Immune System:
ATP + Mg2+ ⟶ AMP + E1 bound ubiquitin + Mg2+ + PPi
- Adaptive Immune System:
ATP + Mg2+ ⟶ AMP + E1 bound ubiquitin + Mg2+ + PPi
- Class I MHC mediated antigen processing & presentation:
ATP + Mg2+ ⟶ AMP + E1 bound ubiquitin + Mg2+ + PPi
- Antigen processing: Ubiquitination & Proteasome degradation:
ATP + Mg2+ ⟶ AMP + E1 bound ubiquitin + Mg2+ + PPi
- Cytokine Signaling in Immune system:
H2O ⟶ AMP + ATP + H+
- Interferon Signaling:
H2O ⟶ AMP + ATP + H+
- Antiviral mechanism by IFN-stimulated genes:
H2O ⟶ AMP + ATP + H+
- OAS antiviral response:
H2O ⟶ AMP + ATP + H+
- SUMOylation:
ATP + Homologues of SUMO1 + UBA2:SAE1 ⟶ AMP + PPi + SUMO1:UBA2:SAE1
- Processing and activation of SUMO:
ATP + Homologues of SUMO1 + UBA2:SAE1 ⟶ AMP + PPi + SUMO1:UBA2:SAE1
- SUMO is conjugated to E1 (UBA2:SAE1):
ATP + Homologues of SUMO1 + UBA2:SAE1 ⟶ AMP + PPi + SUMO1:UBA2:SAE1
- Neddylation:
ATP + Homologues of NEDD8 + UBA3:NAE1 ⟶ AMP + NEDD8-UBA3:NAE1 + PPi
- Gene expression (Transcription):
ATP + pol II transcription complex containing 3 Nucleotide long transcript ⟶ AMP + PPi + pol II transcription complex containing 3 Nucleotide long transcript
- RNA Polymerase II Transcription:
ATP + pol II transcription complex containing 3 Nucleotide long transcript ⟶ AMP + PPi + pol II transcription complex containing 3 Nucleotide long transcript
- RNA Polymerase II Transcription Initiation And Promoter Clearance:
ATP + pol II transcription complex containing 3 Nucleotide long transcript ⟶ AMP + PPi + pol II transcription complex containing 3 Nucleotide long transcript
- RNA Polymerase II Promoter Escape:
ATP + pol II transcription complex containing 3 Nucleotide long transcript ⟶ AMP + PPi + pol II transcription complex containing 3 Nucleotide long transcript
- DNA Repair:
MUTYH:(OGUA:Ade)-dsDNA ⟶ Ade + MUTYH:AP-dsDNA
- MMR:
ATP ⟶ AMP + PPi
- Mismatch repair (MMR) directed by MSH2:MSH6 (MutSalpha):
ATP ⟶ AMP + PPi
- Mismatch repair (MMR) directed by MSH2:MSH3 (MutSbeta):
ATP ⟶ AMP + PPi
- Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp
- Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp
- Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp
- Amino acid synthesis and interconversion (transamination):
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- OAS antiviral response:
H2O ⟶ AMP + ATP + H+
- Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp
- Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp
- Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp
- DNA Repair:
MUTYH:(OGUA:Ade)-dsDNA ⟶ Ade + MUTYH:AP-dsDNA
- MMR:
ATP ⟶ AMP + PPi
- Mismatch repair (MMR) directed by MSH2:MSH6 (MutSalpha):
ATP ⟶ AMP + PPi
- Mismatch repair (MMR) directed by MSH2:MSH3 (MutSbeta):
ATP ⟶ AMP + PPi
- Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN
- Pentose phosphate pathway:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis:
ATP + R5P ⟶ AMP + PRPP
- Mitochondrial Fatty Acid Beta-Oxidation:
ATP + CoA + MCFA ⟶ AMP + MCFA-CoA + PPi
- Interconversion of nucleotide di- and triphosphates:
AMP + ATP ⟶ ADP
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Amino acid synthesis and interconversion (transamination):
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Gene expression (Transcription):
ATP + pol II transcription complex containing 3 Nucleotide long transcript ⟶ AMP + PPi + pol II transcription complex containing 3 Nucleotide long transcript
- RNA Polymerase II Transcription:
ATP + pol II transcription complex containing 3 Nucleotide long transcript ⟶ AMP + PPi + pol II transcription complex containing 3 Nucleotide long transcript
- RNA Polymerase II Transcription Initiation And Promoter Clearance:
ATP + pol II transcription complex containing 3 Nucleotide long transcript ⟶ AMP + PPi + pol II transcription complex containing 3 Nucleotide long transcript
- RNA Polymerase II Promoter Escape:
ATP + pol II transcription complex containing 3 Nucleotide long transcript ⟶ AMP + PPi + pol II transcription complex containing 3 Nucleotide long transcript
- Immune System:
ATP + Mg2+ ⟶ AMP + E1 bound ubiquitin + Mg2+ + PPi
- Adaptive Immune System:
ATP + Mg2+ ⟶ AMP + E1 bound ubiquitin + Mg2+ + PPi
- Class I MHC mediated antigen processing & presentation:
ATP + Mg2+ ⟶ AMP + E1 bound ubiquitin + Mg2+ + PPi
- Antigen processing: Ubiquitination & Proteasome degradation:
ATP + Mg2+ ⟶ AMP + E1 bound ubiquitin + Mg2+ + PPi
- Cytokine Signaling in Immune system:
H2O ⟶ AMP + ATP + H+
- Interferon Signaling:
H2O ⟶ AMP + ATP + H+
- Antiviral mechanism by IFN-stimulated genes:
H2O ⟶ AMP + ATP + H+
- OAS antiviral response:
H2O ⟶ AMP + ATP + H+
- SUMOylation:
ATP + Homologues of SUMO1 + UBA2:SAE1 ⟶ AMP + PPi + SUMO1:UBA2:SAE1
- Processing and activation of SUMO:
ATP + Homologues of SUMO1 + UBA2:SAE1 ⟶ AMP + PPi + SUMO1:UBA2:SAE1
- SUMO is conjugated to E1 (UBA2:SAE1):
ATP + Homologues of SUMO1 + UBA2:SAE1 ⟶ AMP + PPi + SUMO1:UBA2:SAE1
- Neddylation:
ATP + Homologues of NEDD8 + UBA3:NAE1 ⟶ AMP + NEDD8-UBA3:NAE1 + PPi
- Amino acid synthesis and interconversion (transamination):
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp
- OAS antiviral response:
H2O ⟶ AMP + ATP + H+
- Amino acid synthesis and interconversion (transamination):
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Amino acid synthesis and interconversion (transamination):
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp
- Cellular responses to external stimuli:
HSP90:ATP:PTGES3:FKBP52:SHR:SH ⟶ ADP + H0ZSE5 + H0ZZA2 + HSP90-beta dimer + Pi + SHR:SH
- Macroautophagy:
ULK1:ATG13:RB1CC1:ATG101 + p-AMPK heterotrimer:AMP ⟶ p-AMPK heterotrimer:AMP:ULK1:ATG13:RB1CC1:ATG101
- Immune System:
ATP + Ag-substrate:E3:E2:Ub ⟶ AMP + E3:Ub:substrate + PPi
- Adaptive Immune System:
ATP + Ag-substrate:E3:E2:Ub ⟶ AMP + E3:Ub:substrate + PPi
- Class I MHC mediated antigen processing & presentation:
ATP + Ag-substrate:E3:E2:Ub ⟶ AMP + E3:Ub:substrate + PPi
- Antigen processing: Ubiquitination & Proteasome degradation:
ATP + Ag-substrate:E3:E2:Ub ⟶ AMP + E3:Ub:substrate + PPi
- Innate Immune System:
ATP + DAG:p-5Y-PKC-theta:CBM oligomer:TRAF6 oligomer + UBE2N:UBE2V1 ⟶ AMP + DAG:p-5Y-PKC-theta:CBM oligomer:oligo-K63-poly Ub-TRAF6 + PPi + UBE2N:UBE2V1
- Fc epsilon receptor (FCERI) signaling:
ATP + DAG:p-5Y-PKC-theta:CBM oligomer:TRAF6 oligomer + UBE2N:UBE2V1 ⟶ AMP + DAG:p-5Y-PKC-theta:CBM oligomer:oligo-K63-poly Ub-TRAF6 + PPi + UBE2N:UBE2V1
- FCERI mediated NF-kB activation:
ATP + DAG:p-5Y-PKC-theta:CBM oligomer:TRAF6 oligomer + UBE2N:UBE2V1 ⟶ AMP + DAG:p-5Y-PKC-theta:CBM oligomer:oligo-K63-poly Ub-TRAF6 + PPi + UBE2N:UBE2V1
- C-type lectin receptors (CLRs):
ATP + UBE2N:UBE2V1 + p-T231-CARD9:BCL10:MALT1:TRAF6 oligomers ⟶ AMP + PPi + UBE2N:UBE2V1 + p-T231-CARD9:BCL10:MALT1:K63polyUb-TRAF6 oligomers
- CLEC7A (Dectin-1) signaling:
ATP + UBE2N:UBE2V1 + p-T231-CARD9:BCL10:MALT1:TRAF6 oligomers ⟶ AMP + PPi + UBE2N:UBE2V1 + p-T231-CARD9:BCL10:MALT1:K63polyUb-TRAF6 oligomers
- Cytokine Signaling in Immune system:
H2O ⟶ AMP + ATP + H+
- Interferon Signaling:
H2O ⟶ AMP + ATP + H+
- Antiviral mechanism by IFN-stimulated genes:
H2O ⟶ AMP + ATP + H+
- OAS antiviral response:
H2O ⟶ AMP + ATP + H+
- Gene expression (Transcription):
p-AMPK heterotrimer:AMP ⟶ SESN1,2,3:p-AMPK heterotrimer:AMP
- RNA Polymerase II Transcription:
p-AMPK heterotrimer:AMP ⟶ SESN1,2,3:p-AMPK heterotrimer:AMP
- RNA Polymerase II Transcription Initiation And Promoter Clearance:
ATP + pol II transcription complex containing 3 Nucleotide long transcript ⟶ AMP + PPi + pol II transcription complex containing 3 Nucleotide long transcript
- RNA Polymerase II Promoter Escape:
ATP + pol II transcription complex containing 3 Nucleotide long transcript ⟶ AMP + PPi + pol II transcription complex containing 3 Nucleotide long transcript
- Pentose phosphate pathway:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis:
ATP + R5P ⟶ AMP + PRPP
- Mitochondrial Fatty Acid Beta-Oxidation:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi
- Recycling of bile acids and salts:
ATP + CoA-SH + cholate; chenodeoxycholate ⟶ AMP + H2O + PPi + choloyl-CoA; chenodeoxycholoyl-CoA
- Interconversion of nucleotide di- and triphosphates:
AMP + ATP ⟶ ADP
- Molybdenum cofactor biosynthesis:
ATP + H2O + MPT + MoO4(2-) ⟶ AMP + MoCo + PPi
- Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp
- Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp
- Glycogen metabolism:
AMP + PGYM dimer, b form ⟶ PGYM b dimer:AMP
- Glycogen breakdown (glycogenolysis):
AMP + PGYM dimer, b form ⟶ PGYM b dimer:AMP
- Glycogen metabolism:
AMP + PGYM dimer, b form ⟶ PGYM b dimer:AMP
- Glycogen breakdown (glycogenolysis):
AMP + PGYM dimer, b form ⟶ PGYM b dimer:AMP
BioCyc(74)
- purine nucleotide metabolism (phosphotransfer and nucleotide modification):
AMP + ATP ⟶ ADP + H+
- purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate
- superpathway of histidine, purine, and pyrimidine biosynthesis:
glt + imidazole acetol-phosphate ⟶ 2-oxoglutarate + L-histidinol-phosphate
- guanosine nucleotides de novo biosynthesis:
ATP + ammonia + xanthosine-5-phosphate ⟶ AMP + GMP + H+ + diphosphate
- purine nucleotides de novo biosynthesis II:
adenylo-succinate ⟶ AMP + fumarate
- acetate utilization:
ATP + acetate + coenzyme A ⟶ AMP + acetyl-CoA + pyrophosphate
- pyridine nucleotide cycling (plants):
ATP + H2O + gln + nicotinate adenine dinucleotide ⟶ AMP + H+ + NAD+ + diphosphate + glt
- NAD biosynthesis II (from tryptophan):
H+ + O2 + trp ⟶ N-formylkynurenine
- NAD biosynthesis from 2-amino-3-carboxymuconate semialdehyde:
ATP + H2O + gln + nicotinate adenine dinucleotide ⟶ AMP + H+ + NAD+ + diphosphate + glt
- aspartate superpathway:
ATP + ammonia + nicotinate adenine dinucleotide ⟶ AMP + H+ + NAD+ + diphosphate
- NAD biosynthesis II (from tryptophan):
N-formylkynurenine + H2O ⟶ H+ + formate + kynurenine
- NAD biosynthesis from 2-amino-3-carboxymuconate semialdehyde:
ATP + H2O + gln + nicotinate adenine dinucleotide ⟶ AMP + H+ + NAD+ + diphosphate + glt
- NAD biosynthesis I (from aspartate):
ATP + ammonia + nicotinate adenine dinucleotide ⟶ AMP + H+ + NAD+ + diphosphate
- pyridine nucleotide cycling:
ATP + ammonia + nicotinate adenine dinucleotide ⟶ AMP + H+ + NAD+ + diphosphate
- NAD biosynthesis (from tryptophan):
N-formylkynurenine + H2O ⟶ formate + kynurenine
- NAD salvage pathway:
ATP + H2O + L-glutamine + deamido-NAD ⟶ AMP + L-glutamate + NAD+ + pyrophosphate
- tRNA charging pathway:
ATP + arg ⟶ AMP + diphosphate
- tRNA charging pathway:
ATP + L-serine ⟶ AMP + pyrophosphate
- arginine biosynthesis:
ATP + L-aspartate + citrulline ⟶ AMP + L-arginino-succinate + pyrophosphate
- asparagine biosynthesis:
ATP + H2O + L-aspartate + L-glutamine ⟶ AMP + L-asparagine + L-glutamate + pyrophosphate
- superpathway of acetate utilization and formation:
ATP + acetate ⟶ ADP + H+ + acetylphosphate
- acetate conversion to acetyl-CoA:
ATP + acetate + coenzyme A ⟶ AMP + H+ + acetyl-CoA + diphosphate
- oxidative ethanol degradation III (microsomal):
H2O + NAD+ + acetaldehyde ⟶ H+ + NADH + acetate
- ethanol degradation IV (peroxisomal):
H2O + NAD+ + acetaldehyde ⟶ H+ + NADH + acetate
- ethanol degradation II (cytosol):
H2O + NAD+ + acetaldehyde ⟶ H+ + NADH + acetate
- adenosine nucleotides de novo biosynthesis:
adenylo-succinate ⟶ AMP + fumarate
- salvage pathways of purine nucleosides I:
adenosine + phosphate ⟶ α-D-ribose-1-phosphate + adenine
- β-alanine biosynthesis II:
FADH2 + acrylyl-CoA ⟶ FAD + H+ + propanoyl-CoA
- salvage pathways of purine nucleosides:
H2O + adenine ⟶ ammonia + hypoxanthine
- selenocysteine biosynthesis I (bacteria):
ATP + H2O + hydrogen selenide ⟶ AMP + H+ + phosphate + selenophosphate
- selenocysteine biosynthesis I (bacteria):
ATP + H2O + hydrogen selenide ⟶ AMP + H+ + phosphate + selenophosphate
- urea cycle:
ATP + L-citrulline + asp ⟶ AMP + H+ + L-arginino-succinate + diphosphate
- arginine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate
- superpathway of arginine and polyamine biosynthesis:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate
- asparagine biosynthesis:
ATP + ammonia + asp ⟶ AMP + H+ + asn + diphosphate
- superpathway of aspartate and asparagine biosynthesis; interconversion of aspartate and asparagine:
ATP + ammonia + asp ⟶ AMP + H+ + asn + diphosphate
- asparagine biosynthesis II:
ATP + ammonia + asp ⟶ AMP + H+ + asn + diphosphate
- salvage pathways of adenine, hypoxanthine, and their nucleosides:
adenosine + phosphate ⟶ α-D-ribose-1-phosphate + adenine
- purine and pyrimidine metabolism:
adenosine + phosphate ⟶ α-D-ribose-1-phosphate + adenine
- acetyl-CoA degradation to acetate:
ATP + acetate + coenzyme A ⟶ AMP + H+ + acetyl-CoA + diphosphate
- ethanol degradation II (cytosol):
ATP + acetate + coenzyme A ⟶ AMP + H+ + acetyl-CoA + diphosphate
- molybdenum cofactor biosynthesis:
molybdate + molybdopterin-AMP ⟶ AMP + H2O + molybdenum cofactor
- pantothenate and coenzyme A biosynthesis:
α-ketoglutarate + L-valine ⟶ 2-keto-isovalerate + L-glutamate
- anthranilate degradation III (anaerobic):
ATP + anthranilate + coenzyme A ⟶ 2-aminobenzoyl-CoA + AMP + H+ + diphosphate
- tetrahydrofolate biosynthesis I:
6-hydroxymethyl-7,8-dihydropterin + ATP ⟶ 6-hydroxymethyl-dihydropterin diphosphate + AMP + H+
- superpathway of central carbon metabolism:
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate
- glycolysis I:
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate
- gluconeogenesis I:
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate
- superpathway of glycolysis, pyruvate dehydrogenase and TCA cycle:
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate
- superpathway of glycolysis and Entner-Doudoroff:
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate
- glycolysis II:
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate
- glycolysis I:
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate
- superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate
- gluconeogenesis I:
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate
- selenocysteine biosynthesis:
ATP + L-serine ⟶ AMP + pyrophosphate
- PRPP biosynthesis I:
ATP + D-ribose-5-phosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + AMP + H+
- PRPP biosynthesis I:
ATP + D-ribose 5-phosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + AMP + H+
- superpathway of histidine, purine and pyrimidine biosynthesis:
ATP + D-ribose 5-phosphate ⟶ 5-phosphoribosyl 1-pyrophosphate + AMP
- PRPP biosynthesis:
ATP + D-ribose 5-phosphate ⟶ 5-phosphoribosyl 1-pyrophosphate + AMP
- salvage pathways of adenine, hypoxanthine, and their nucleosides:
AMP + H2O ⟶ D-ribose 5-phosphate + adenine
- mycothiol biosynthesis:
1-(2-acetamido-2-deoxy-α-D-glucopyranosyl)-1D-myo-inositol + H2O ⟶ 1-(2-amino-2-deoxy-α-D-glucopyranoside)-1D-myo-inositol + acetate
- fatty acid activation:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain acyl-CoA + diphosphate
- fatty acid β-oxidation:
ATP + a fatty acid + coenzyme A ⟶ AMP + H+ + a 2,3,4-saturated fatty acyl CoA + diphosphate
- phenylacetate degradation I (aerobic):
ATP + coenzyme A + phenylacetate ⟶ AMP + H+ + diphosphate + phenylacetyl-CoA
- phenylacetate degradation II (anaerobic):
ATP + coenzyme A + phenylacetate ⟶ AMP + H+ + diphosphate + phenylacetyl-CoA
- fatty acid β-oxidation II (core pathway):
ATP + a fatty acid + coenzyme A ⟶ AMP + H+ + a 2,3,4-saturated fatty acyl CoA + diphosphate
- fatty acid β-oxidation I:
ATP + a fatty acid + coenzyme A ⟶ AMP + H+ + a 2,3,4-saturated fatty acyl CoA + diphosphate
- superpathway of glyoxylate cycle:
ATP + a fatty acid + coenzyme A ⟶ AMP + H+ + a 2,3,4-saturated fatty acyl CoA + diphosphate
- thiamin (vitamin B1) biosynthesis:
ATP + thiamine ⟶ AMP + thiamin diphosphate
- tetrahydrofolate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- fatty acid oxidation pathway:
ATP + a fatty acid + coenzyme A ⟶ AMP + an acyl-CoA + pyrophosphate
- phenylacetate degradation:
ATP + coenzyme A + phenylacetate ⟶ AMP + phenylacetyl-CoA + pyrophosphate
- purine nucleotides de novo biosynthesis:
ATP + XMP + ammonia ⟶ AMP + GMP + pyrophosphate
- salvage pathways of purine nucleosides:
AMP + pyrophosphate ⟶ 5-phosphoribosyl 1-pyrophosphate + adenine
WikiPathways(7)
- NO/cGMP/PKG mediated neuroprotection:
cAMP ⟶ AMP
- Regucalcin in proximal tubule epithelial kidney cells:
AMP ⟶ cAMP
- Purine metabolism:
P1,P4-Bis(5'-xanthosyl) tetraphosphate ⟶ XTP
- Amino acid conjugation of benzoic acid:
Benzoic acid AMP ester ⟶ AMP
- Methionine metabolism leading to sulfur amino acids and related disorders:
Adenosine ⟶ AMP
- Amino acid conjugation of benzoic acid:
benzoyl-AMP ⟶ AMP
- Proteoglycan biosynthesis:
Phosphoadenosine phosphate ⟶ ADENOSINE MONOPHOSPHATE
Plant Reactome(1771)
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cofactor biosyntheses:
9-mercaptodethiobiotin ⟶ Btn
- Pantothenate biosynthesis I:
ATP + L-pantoate + b-Ala ⟶ AMP + PPi + PanK
- Pantothenate biosynthesis II:
ATP + L-pantoate + b-Ala ⟶ AMP + PPi + PanK
- Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Pantothenate biosynthesis I:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Pantothenate biosynthesis II:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Pantothenate biosynthesis I:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Pantothenate biosynthesis II:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Pantothenate biosynthesis I:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Pantothenate biosynthesis II:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Pantothenate biosynthesis I:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Pantothenate biosynthesis II:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Pantothenate biosynthesis I:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Pantothenate biosynthesis II:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Pantothenate biosynthesis I:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Pantothenate biosynthesis II:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Pantothenate biosynthesis I:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Pantothenate biosynthesis II:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Pantothenate biosynthesis I:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Pantothenate biosynthesis II:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Pantothenate biosynthesis I:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Pantothenate biosynthesis II:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Pantothenate biosynthesis I:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Pantothenate biosynthesis II:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Canavanine biosynthesis:
ATP + L-Asp + O-ureidohomoserine ⟶ AMP + PPi + canavaninosuccinate
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP
- PRPP biosynthesis I:
ATP + R5P ⟶ AMP + PRPP
- Fatty acid activation:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
INOH(20)
- Purine nucleotides and Nucleosides metabolism ( Purine nucleotides and Nucleosides metabolism ):
H2O + XTP ⟶ Pyrophosphate + XMP
- Arginine and Proline metabolism ( Arginine and Proline metabolism ):
ATP + Creatine ⟶ ADP + N-Phospho-creatine
- Nicotinate and Nicotinamide metabolism ( Nicotinate and Nicotinamide metabolism ):
ATP + Deamido-NAD+ + H2O + L-Glutamine ⟶ AMP + L-Glutamic acid + NAD+ + Pyrophosphate
- Glycine and Serine metabolism ( Glycine and Serine metabolism ):
Guanidino-acetic acid + S-Adenosyl-L-methionine ⟶ Creatine + S-Adenosyl-L-homocysteine
- Alanine,Aspartic acid and Asparagine metabolism ( Alanine,Aspartic acid and Asparagine metabolism ):
H2O + N-Acetyl-L-aspartic acid ⟶ Acetic acid + L-Aspartic acid
- Pyruvate metabolism ( Pyruvate metabolism ):
ATP + Acetic acid + CoA ⟶ AMP + Acetyl-CoA + Pyrophosphate
- Adenylo-succinic acid = AMP + Fumaric acid ( Purine nucleotides and Nucleosides metabolism ):
Adenylo-succinic acid ⟶ AMP + Fumaric acid
- Butanoate metabolism ( Butanoate metabolism ):
Acetoacetic acid + NADH ⟶ (R)-3-Hydroxy-butanoic acid + NAD+
- AMP + Pyrophosphate = Adenine + D-5-Phospho-ribosyl 1-diphosphate ( Purine nucleotides and Nucleosides metabolism ):
AMP + Pyrophosphate ⟶ Adenine + D-5-Phospho-ribosyl 1-diphosphate
- AMP + Pyrophosphate = Adenine + D-5-Phospho-ribosyl 1-diphosphate ( Purine nucleotides and Nucleosides metabolism ):
Adenine + D-5-Phospho-ribosyl 1-diphosphate ⟶ AMP + Pyrophosphate
- Glutamic acid and Glutamine metabolism ( Glutamic acid and Glutamine metabolism ):
ATP + L-Glutamine + tRNA(Gln) ⟶ AMP + L-Glutaminyl-tRNA(Gln) + Pyrophosphate
- Tryptophan degradation ( Tryptophan degradation ):
L-Tryptophan + O2 ⟶ N-Formyl-L-kynurenine
- Methionine and Cysteine metabolism ( Methionine and Cysteine metabolism ):
H2O + L-Cystathionine ⟶ 2-Oxo-butanoic acid + L-Cysteine + NH3
- Propanoate metabolism ( Propanoate metabolism ):
ATP + CoA + Propanoic acid ⟶ AMP + Propanoyl-CoA + Pyrophosphate
- Pyrimidine Nucleotides and Nucleosides metabolism ( Pyrimidine Nucleotides and Nucleosides metabolism ):
Deoxy-cytidine + H2O ⟶ Deoxy-uridine + NH3
- UTP + AMP = UDP + ADP ( Pyrimidine Nucleotides and Nucleosides metabolism ):
ADP + UDP ⟶ AMP + UTP
- ATP + D-Ribose 5-phosphate = AMP + D-5-Phospho-ribosyl 1-diphosphate ( Pyrimidine Nucleotides and Nucleosides metabolism ):
AMP + D-5-Phospho-ribosyl 1-diphosphate ⟶ ATP + D-Ribose 5-phosphate
- Pentose phosphate cycle ( Pentose phosphate cycle ):
ATP + D-Ribose 5-phosphate ⟶ AMP + D-5-Phospho-ribosyl 1-diphosphate
- Histidine degradation ( Histidine degradation ):
H2O + L-Carnosine ⟶ L-Histidine + beta-Alanine
- ATP + AMP = 2 ADP ( Purine nucleotides and Nucleosides metabolism ):
AMP + ATP ⟶ ADP
PlantCyc(0)
COVID-19 Disease Map(1)
- @COVID-19 Disease
Map["name"]:
Adenosine + Pi ⟶ Adenine + _alpha_-D-Ribose 1-phosphate
PathBank(629)
- Glutamate Metabolism:
Adenosine triphosphate + L-Glutamine + Nicotinic acid adenine dinucleotide + Water ⟶ Adenosine monophosphate + L-Glutamic acid + NAD + Pyrophosphate
- Purine Metabolism:
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate
- 4-Hydroxybutyric Aciduria/Succinic Semialdehyde Dehydrogenase Deficiency:
Adenosine triphosphate + L-Glutamine + Nicotinic acid adenine dinucleotide + Water ⟶ Adenosine monophosphate + L-Glutamic acid + NAD + Pyrophosphate
- Homocarnosinosis:
Adenosine triphosphate + L-Glutamine + Nicotinic acid adenine dinucleotide + Water ⟶ Adenosine monophosphate + L-Glutamic acid + NAD + Pyrophosphate
- Hyperinsulinism-Hyperammonemia Syndrome:
Adenosine triphosphate + L-Glutamine + Nicotinic acid adenine dinucleotide + Water ⟶ Adenosine monophosphate + L-Glutamic acid + NAD + Pyrophosphate
- Adenosine Deaminase Deficiency:
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate
- Adenylosuccinate Lyase Deficiency:
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate
- Gout or Kelley-Seegmiller Syndrome:
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate
- Lesch-Nyhan Syndrome (LNS):
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate
- Molybdenum Cofactor Deficiency:
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate
- Xanthine Dehydrogenase Deficiency (Xanthinuria):
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate
- Purine Nucleoside Phosphorylase Deficiency:
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate
- AICA-Ribosiduria:
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate
- 2-Hydroxyglutric Aciduria (D and L Form):
Adenosine triphosphate + L-Glutamine + Nicotinic acid adenine dinucleotide + Water ⟶ Adenosine monophosphate + L-Glutamic acid + NAD + Pyrophosphate
- Azathioprine Action Pathway:
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate
- Mercaptopurine Action Pathway:
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate
- Thioguanine Action Pathway:
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate
- Xanthinuria Type I:
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate
- Xanthinuria Type II:
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate
- Adenine Phosphoribosyltransferase Deficiency (APRT):
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate
- Mitochondrial DNA Depletion Syndrome-3:
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate
- Myoadenylate Deaminase Deficiency:
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate
- Succinic Semialdehyde Dehydrogenase Deficiency:
Adenosine triphosphate + L-Glutamine + Nicotinic acid adenine dinucleotide + Water ⟶ Adenosine monophosphate + L-Glutamic acid + NAD + Pyrophosphate
- Purine Nucleotides De Novo Biosynthesis:
N(6)-(1,2-dicarboxyethyl)AMP ⟶ Adenosine monophosphate + Fumaric acid
- Purine Nucleotides De Novo Biosynthesis 2:
N(6)-(1,2-dicarboxyethyl)AMP ⟶ Adenosine monophosphate + Fumaric acid
- Purine Nucleotides De Novo Biosynthesis:
N(6)-(1,2-dicarboxyethyl)AMP ⟶ Adenosine monophosphate + Fumaric acid
- Glutamate Metabolism:
Adenosine triphosphate + L-Glutamine ⟶ Adenosine monophosphate + Pyrophosphate
- Purine Metabolism:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate
- 2-Hydroxyglutric Aciduria (D and L Form):
Adenosine triphosphate + L-Glutamine + Water + Xanthylic acid ⟶ Adenosine monophosphate + Guanosine monophosphate + L-Glutamic acid + Pyrophosphate
- 4-Hydroxybutyric Aciduria/Succinic Semialdehyde Dehydrogenase Deficiency:
Adenosine triphosphate + L-Glutamine + Water + Xanthylic acid ⟶ Adenosine monophosphate + Guanosine monophosphate + L-Glutamic acid + Pyrophosphate
- Adenosine Deaminase Deficiency:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate
- Adenylosuccinate Lyase Deficiency:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate
- AICA-Ribosiduria:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate
- Gout or Kelley-Seegmiller Syndrome:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate
- Homocarnosinosis:
Adenosine triphosphate + L-Glutamine + Water + Xanthylic acid ⟶ Adenosine monophosphate + Guanosine monophosphate + L-Glutamic acid + Pyrophosphate
- Hyperinsulinism-Hyperammonemia Syndrome:
Adenosine triphosphate + L-Glutamine + Water + Xanthylic acid ⟶ Adenosine monophosphate + Guanosine monophosphate + L-Glutamic acid + Pyrophosphate
- Xanthine Dehydrogenase Deficiency (Xanthinuria):
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate
- Lesch-Nyhan Syndrome (LNS):
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate
- Molybdenum Cofactor Deficiency:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate
- Purine Nucleoside Phosphorylase Deficiency:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate
- Xanthinuria Type I:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate
- Xanthinuria Type II:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate
- Adenine Phosphoribosyltransferase Deficiency (APRT):
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate
- Mitochondrial DNA Depletion Syndrome:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate
- Myoadenylate Deaminase Deficiency:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate
- Succinic Semialdehyde Dehydrogenase Deficiency:
Adenosine triphosphate + L-Glutamine + Water + Xanthylic acid ⟶ Adenosine monophosphate + Guanosine monophosphate + L-Glutamic acid + Pyrophosphate
- Glutamate Metabolism:
Adenosine triphosphate + L-Glutamine + Water + Xanthylic acid ⟶ Adenosine monophosphate + Guanosine monophosphate + L-Glutamic acid + Pyrophosphate
- Purine Metabolism:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate
- Glutamate Metabolism:
Adenosine triphosphate + L-Glutamine + Water + Xanthylic acid ⟶ Adenosine monophosphate + Guanosine monophosphate + L-Glutamic acid + Pyrophosphate
- Purine Metabolism:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate
- Glutamate Metabolism:
Adenosine triphosphate + L-Glutamine + Water + Xanthylic acid ⟶ Adenosine monophosphate + Guanosine monophosphate + L-Glutamic acid + Pyrophosphate
- Glutamate Metabolism:
Adenosine triphosphate + L-Glutamine + Water + Xanthylic acid ⟶ Adenosine monophosphate + Guanosine monophosphate + L-Glutamic acid + Pyrophosphate
- 2-Hydroxyglutric Aciduria (D and L Form):
Adenosine triphosphate + L-Glutamine ⟶ Adenosine monophosphate + Pyrophosphate
- 4-Hydroxybutyric Aciduria/Succinic Semialdehyde Dehydrogenase Deficiency:
Adenosine triphosphate + L-Glutamine ⟶ Adenosine monophosphate + Pyrophosphate
- Adenosine Deaminase Deficiency:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate
- Adenylosuccinate Lyase Deficiency:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate
- AICA-Ribosiduria:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate
- Gout or Kelley-Seegmiller Syndrome:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate
- Homocarnosinosis:
Adenosine triphosphate + L-Glutamine ⟶ Adenosine monophosphate + Pyrophosphate
- Hyperinsulinism-Hyperammonemia Syndrome:
Adenosine triphosphate + L-Glutamine ⟶ Adenosine monophosphate + Pyrophosphate
- Xanthine Dehydrogenase Deficiency (Xanthinuria):
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate
- Lesch-Nyhan Syndrome (LNS):
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate
- Molybdenum Cofactor Deficiency:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate
- Purine Nucleoside Phosphorylase Deficiency:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate
- Xanthinuria Type I:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate
- Xanthinuria Type II:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate
- Adenine Phosphoribosyltransferase Deficiency (APRT):
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate
- Mitochondrial DNA Depletion Syndrome:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate
- Myoadenylate Deaminase Deficiency:
Adenosine + Phosphate ⟶ Adenine + Ribose 1-phosphate
- Succinic Semialdehyde Dehydrogenase Deficiency:
Adenosine triphosphate + L-Glutamine ⟶ Adenosine monophosphate + Pyrophosphate
- Purine Nucleotides De Novo Biosynthesis:
N(6)-(1,2-dicarboxyethyl)AMP ⟶ Adenosine monophosphate + Fumaric acid
- Purine Nucleotides De Novo Biosynthesis 2:
N(6)-(1,2-dicarboxyethyl)AMP ⟶ Adenosine monophosphate + Fumaric acid
- Glycolysis and Pyruvate Dehydrogenase:
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water
- D-Glucarate and D-Galactarate Degradation:
Adenosine triphosphate + Pyruvic acid + Water ⟶ Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid
- Gluconeogenesis from L-Malic Acid:
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water
- Fructose Metabolism:
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water
- Glycerol Metabolism:
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water
- Glycerol Metabolism II:
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water
- Glycerol Metabolism III (sn-Glycero-3-Phosphoethanolamine):
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water
- Glycerol Metabolism IV (Glycerophosphoglycerol):
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water
- Glycerol Metabolism V (Glycerophosphoserine):
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water
- Gluconeogenesis from L-Malic Acid:
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water
- Glutamine Metabolism:
Adenosine triphosphate + Phosphate + Pyruvic acid ⟶ Adenosine monophosphate + Hydrogen Ion + Phosphoenolpyruvic acid + Pyrophosphate
- D-Glucarate and D-Galactarate Degradation:
Adenosine triphosphate + Pyruvic acid + Water ⟶ Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid
- Fructose Metabolism:
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water
- Glycerol Metabolism:
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water
- Glycerol Metabolism II:
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water
- Glycerol Metabolism III (sn-Glycero-3-Phosphoethanolamine):
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water
- Glycerol Metabolism IV (Glycerophosphoglycerol):
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water
- Glycerol Metabolism V (Glycerophosphoserine):
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water
- fatty acid oxidation (myristate):
Adenosine triphosphate + Coenzyme A + Myristic acid ⟶ Adenosine monophosphate + Tetradecanoyl-CoA
- Fatty Acid Oxidation (Myristate):
Adenosine triphosphate + Coenzyme A + Myristic acid ⟶ Adenosine monophosphate + Tetradecanoyl-CoA
- Flavanone Biosynthesis:
4-Hydroxycinnamic acid + Adenosine triphosphate + Coenzyme A ⟶ 4-Coumaroyl-CoA + Adenosine monophosphate + Pyrophosphate
- Pantothenate and CoA Biosynthesis:
-Ketoisovaleric acid + 5,10-Methylene-THF + Water ⟶ 2-dehydropantoate + Tetrahydrofolic acid
- beta-Alanine Metabolism:
(R)-pantoate + -Alanine + Adenosine triphosphate ⟶ Adenosine monophosphate + Hydrogen Ion + Pantothenic acid + Pyrophosphate
- beta-Alanine Metabolism:
(R)-pantoate + -Alanine + Adenosine triphosphate ⟶ Adenosine monophosphate + Hydrogen Ion + Pantothenic acid + Pyrophosphate
- Pantothenate and CoA Biosynthesis:
-Ketoisovaleric acid + 5,10-Methylene-THF + Water ⟶ 2-dehydropantoate + Tetrahydrofolic acid
- Pantothenate and CoA Biosynthesis:
-Ketoisovaleric acid + 5,10-Methylene-THF + Water ⟶ 2-dehydropantoate + Tetrahydrofolic acid
- fatty acid oxidation (Decanoate):
Adenosine triphosphate + Capric acid + Coenzyme A ⟶ Adenosine monophosphate + Decanoyl-CoA
- Fatty Acid Oxidation (Decanoate):
Adenosine triphosphate + Capric acid + Coenzyme A ⟶ Adenosine monophosphate + Decanoyl-CoA
- fatty acid oxidation (hexanoate):
Adenosine triphosphate + Caproic acid + Coenzyme A ⟶ Adenosine monophosphate + Hexanoyl-CoA
- Lipoic Acid Metabolism:
Lipoyl-AMP + a [lipoyl-carrier protein]-L-lysine ⟶ Adenosine monophosphate + Hydrogen Ion + Protein N6-(lipoyl)lysine
- Lipoic Acid Metabolism:
Lipoyl-AMP + apoprotein ⟶ Adenosine monophosphate + Protein N6-(lipoyl)lysine
- Lipoic Acid Metabolism:
Lipoyl-AMP + a [lipoyl-carrier protein]-L-lysine ⟶ Adenosine monophosphate + Protein N6-(lipoyl)lysine
- Nicotinate and Nicotinamide Metabolism:
NAD + Water ⟶ Adenosine monophosphate + Nicotinamide ribotide
- NAD Biosynthesis:
Adenosine triphosphate + L-Glutamine + Nicotinic acid adenine dinucleotide + Water ⟶ Adenosine monophosphate + Hydrogen Ion + L-Glutamic acid + NAD + Pyrophosphate
- NAD Salvage:
Adenosine triphosphate + L-Glutamine + Nicotinic acid adenine dinucleotide + Water ⟶ Adenosine monophosphate + Hydrogen Ion + L-Glutamic acid + NAD + Pyrophosphate
- NAD Metabolism:
N'-Formylkynurenine + Water ⟶ Formic acid + Hydrogen Ion + L-Kynurenine
- Nicotinate and Nicotinamide Metabolism:
Adenosine triphosphate + L-Glutamine + Nicotinic acid adenine dinucleotide + Water ⟶ Adenosine monophosphate + L-Glutamic acid + NAD + Pyrophosphate
- Nicotinate and Nicotinamide Metabolism:
Adenosine triphosphate + L-Glutamine + Nicotinic acid adenine dinucleotide + Water ⟶ Adenosine monophosphate + L-Glutamic acid + NAD + Pyrophosphate
- Nicotinate and Nicotinamide Metabolism:
Adenosine triphosphate + L-Glutamine + Nicotinic acid adenine dinucleotide + Water ⟶ Adenosine monophosphate + L-Glutamic acid + NAD + Pyrophosphate
- Nicotinate and Nicotinamide Metabolism:
Adenosine triphosphate + L-Glutamine + Nicotinic acid adenine dinucleotide + Water ⟶ Adenosine monophosphate + L-Glutamic acid + NAD + Pyrophosphate
- Nicotinate and Nicotinamide Metabolism:
Adenosine triphosphate + L-Glutamine + Nicotinic acid adenine dinucleotide + Water ⟶ Adenosine monophosphate + L-Glutamic acid + NAD + Pyrophosphate
- NAD Biosynthesis:
Adenosine triphosphate + Ammonium + Nicotinic acid adenine dinucleotide ⟶ Adenosine monophosphate + Hydrogen Ion + NAD + Pyrophosphate
- NAD Salvage:
Adenosine triphosphate + L-Glutamine + Nicotinic acid adenine dinucleotide + Water ⟶ Adenosine monophosphate + Hydrogen Ion + L-Glutamic acid + NAD + Pyrophosphate
- AMP Degradation (Hypoxanthine Route):
Adenosine monophosphate + Hydrogen Ion + Water ⟶ Ammonium + Inosinic acid
- Selenoamino Acid Metabolism:
Selenocystathionine + Water ⟶ 2-Ketobutyric acid + Ammonia + Selenocysteine
- Selenocompound Metabolism:
Selenomethionine + Water ⟶ 2-Ketobutyric acid + Ammonia + methylselenol
- Selenoamino Acid Metabolism:
Selenocystathionine + Water ⟶ 2-Ketobutyric acid + Ammonia + Selenocysteine
- Selenoamino Acid Metabolism:
Selenocystathionine + Water ⟶ 2-Ketobutyric acid + Ammonia + Selenocysteine
- Selenoamino Acid Metabolism:
Selenocystathionine + Water ⟶ 2-Ketobutyric acid + Ammonia + Selenocysteine
- Selenoamino Acid Metabolism:
Selenocystathionine + Water ⟶ 2-Ketobutyric acid + Ammonia + Selenocysteine
- Selenoamino Acid Metabolism:
Selenocystathionine + Water ⟶ 2-Ketobutyric acid + Ammonia + Selenocysteine
- Pantothenate and CoA Biosynthesis:
Dephospho-CoA + Water ⟶ Adenosine monophosphate + Pantetheine 4'-phosphate
- Pantothenate and CoA Biosynthesis:
Dephospho-CoA + Water ⟶ Adenosine monophosphate + Pantetheine 4'-phosphate
- Pantothenate and CoA Biosynthesis:
Dephospho-CoA + Water ⟶ Adenosine monophosphate + Pantetheine 4'-phosphate
- Pantothenate and CoA Biosynthesis:
Dephospho-CoA + Water ⟶ Adenosine monophosphate + Pantetheine 4'-phosphate
- Pantothenate and CoA Biosynthesis:
Dephospho-CoA + Water ⟶ Adenosine monophosphate + Pantetheine 4'-phosphate
- Pantothenate and CoA Biosynthesis:
Dephospho-CoA + Water ⟶ Adenosine monophosphate + Pantetheine 4'-phosphate
- Phenylacetate Metabolism:
Adenosine triphosphate + Coenzyme A + Phenylacetic acid ⟶ Adenosine monophosphate + Phenylacetyl-CoA + Pyrophosphate
- Phenylethylamine Metabolism:
Adenosine triphosphate + Coenzyme A + Phenylacetic acid ⟶ Adenosine monophosphate + Phenylacetyl-CoA + Pyrophosphate
- Phenylacetate Metabolism:
Adenosine triphosphate + Coenzyme A + Phenylacetic acid ⟶ Adenosine monophosphate + Phenylacetyl-CoA + Pyrophosphate
- Phenylacetate Metabolism:
Adenosine triphosphate + Coenzyme A + Phenylacetic acid ⟶ Adenosine monophosphate + Phenylacetyl-CoA + Pyrophosphate
- Phenylacetate Metabolism:
Adenosine triphosphate + Coenzyme A + Phenylacetic acid ⟶ Adenosine monophosphate + Phenylacetyl-CoA + Pyrophosphate
- Butyrate Metabolism:
Adenosine triphosphate + Butyric acid + Coenzyme A ⟶ Adenosine monophosphate + Butyryl-CoA + Pyrophosphate
- Butyrate Metabolism:
Adenosine triphosphate + Butyric acid + Coenzyme A ⟶ Adenosine monophosphate + Butyryl-CoA + Pyrophosphate
- Butyrate Metabolism:
Adenosine triphosphate + Butyric acid + Coenzyme A ⟶ Adenosine monophosphate + Butyryl-CoA + Pyrophosphate
- Butyrate Metabolism:
Adenosine triphosphate + Butyric acid + Coenzyme A ⟶ Adenosine monophosphate + Butyryl-CoA + Pyrophosphate
- Fatty Acid Oxidation (Butanoate):
Adenosine triphosphate + Butyric acid + Coenzyme A ⟶ Adenosine monophosphate + Butyryl-CoA
- tRNA Charging:
Adenosine triphosphate + Hydrogen Ion + L-Arginine ⟶ Adenosine monophosphate + Pyrophosphate
- tRNA Charging 2:
Adenosine triphosphate + Hydrogen Ion + L-Arginine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Lysine:
Adenosine triphosphate + L-Lysine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Lysine:
Adenosine triphosphate + L-Lysine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Lysine:
Adenosine triphosphate + L-Lysine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Lysine:
Adenosine triphosphate + L-Lysine ⟶ Adenosine monophosphate + Pyrophosphate
- tRNA Charging:
Adenosine triphosphate + Hydrogen Ion + L-Arginine ⟶ Adenosine monophosphate + Pyrophosphate
- tRNA Charging 2:
Adenosine triphosphate + Hydrogen Ion + L-Arginine ⟶ Adenosine monophosphate + Pyrophosphate
- Thiamine Metabolism:
Adenosine triphosphate + Thiamine ⟶ Adenosine monophosphate + Thiamine pyrophosphate
- Vitamin B1/Thiamine Metabolism:
Adenosine triphosphate + Thiamine ⟶ Adenosine monophosphate + Hydrogen Ion + Thiamine pyrophosphate
- Thiamine Metabolism:
Adenosine triphosphate + Thiamine ⟶ Adenosine monophosphate + Thiamine pyrophosphate
- Thiamine Metabolism:
Adenosine triphosphate + Thiamine ⟶ Adenosine monophosphate + Thiamine pyrophosphate
- Thiamine Metabolism:
Adenosine triphosphate + Thiamine ⟶ Adenosine monophosphate + Thiamine pyrophosphate
- Valproic Acid Metabolism Pathway:
Adenosine triphosphate + Coenzyme A + Valproic acid ⟶ Adenosine monophosphate + Pyrophosphate + Valproic acid CoA
- Ethanol Degradation:
Acetaldehyde + NAD + Water ⟶ Acetic acid + Hydrogen Ion + NADH
- Disulfiram Action Pathway:
Homovanillin + NADP + Water ⟶ NADPH + p-Hydroxyphenylacetic acid
- Acetate Metabolism:
Acetylphosphate + Adenosine diphosphate ⟶ Acetic acid + Adenosine triphosphate
- Pyruvate Metabolism:
2-Isopropylmalic acid + Coenzyme A ⟶ -Ketoisovaleric acid + Acetyl-CoA + Water
- Ethanol Degradation:
Acetaldehyde + NAD + Water ⟶ Acetic acid + Hydrogen Ion + NADH
- Ethanol Degradation:
Acetaldehyde + NAD + Water ⟶ Acetic acid + Hydrogen Ion + NADH
- Ethanol Degradation:
Acetaldehyde + NAD + Water ⟶ Acetic acid + Hydrogen Ion + NADH
- Acetate Metabolism:
Acetylphosphate + Adenosine diphosphate ⟶ Acetic acid + Adenosine triphosphate
- Propanoate Metabolism:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA
- Malonic Aciduria:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA
- Methylmalonic Aciduria Due to Cobalamin-Related Disorders:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA
- Malonyl-CoA Decarboxylase Deficiency:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA
- Propanoate Metabolism:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA
- Malonic Aciduria:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA
- Methylmalonic Aciduria Due to Cobalamin-Related Disorders:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA
- Malonyl-CoA Decarboxylase Deficiency:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA
- Propanoate Metabolism:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA
- Propanoate Metabolism:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA
- Propanoate Metabolism:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA
- Propanoate Metabolism:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA
- Malonic Aciduria:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA
- Methylmalonic Aciduria Due to Cobalamin-Related Disorders:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA
- Malonyl-CoA Decarboxylase Deficiency:
2-Ketobutyric acid + Coenzyme A + NAD ⟶ NADH + Propionyl-CoA
- Protein Synthesis: Isoleucine:
Adenosine triphosphate + L-Isoleucine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Isoleucine:
Adenosine triphosphate + L-Isoleucine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Isoleucine:
Adenosine triphosphate + L-Isoleucine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Isoleucine:
Adenosine triphosphate + L-Isoleucine ⟶ Adenosine monophosphate + Pyrophosphate
- Molybdenum Cofactor Biosynthesis:
Hydrogen Ion + Molybdate + Molybdopterin-AMP ⟶ Adenosine monophosphate + Water + molybdenum cofactor (Moco)
- Thio-Molybdenum Cofactor Biosynthesis:
Hydrogen Ion + Molybdate + Molybdopterin-AMP ⟶ Adenosine monophosphate + Water + molybdenum cofactor (Moco)
- Phenylalanine and Tyrosine Metabolism:
Adenosine triphosphate + L-Phenylalanine ⟶ Adenosine monophosphate + Pyrophosphate
- Phenylketonuria:
Adenosine triphosphate + L-Phenylalanine ⟶ Adenosine monophosphate + Pyrophosphate
- Tyrosinemia Type 2 (or Richner-Hanhart Syndrome):
Adenosine triphosphate + L-Phenylalanine ⟶ Adenosine monophosphate + Pyrophosphate
- Tyrosinemia Type 3 (TYRO3):
Adenosine triphosphate + L-Phenylalanine ⟶ Adenosine monophosphate + Pyrophosphate
- Phenylalanine and Tyrosine Metabolism:
Adenosine triphosphate + L-Tyrosine ⟶ Adenosine monophosphate + Pyrophosphate
- Tyrosinemia Type 3 (TYRO3):
Adenosine triphosphate + L-Phenylalanine ⟶ Adenosine monophosphate + Pyrophosphate
- Tyrosinemia Type 2 (or Richner-Hanhart Syndrome):
Adenosine triphosphate + L-Phenylalanine ⟶ Adenosine monophosphate + Pyrophosphate
- Phenylketonuria:
Adenosine triphosphate + L-Phenylalanine ⟶ Adenosine monophosphate + Pyrophosphate
- Phenylalanine and Tyrosine Metabolism:
Adenosine triphosphate + L-Phenylalanine ⟶ Adenosine monophosphate + Pyrophosphate
- Phenylalanine and Tyrosine Metabolism:
Adenosine triphosphate + L-Phenylalanine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Phenylalanine:
Adenosine triphosphate + L-Phenylalanine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Phenylalanine:
Adenosine triphosphate + L-Phenylalanine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Phenylalanine:
Adenosine triphosphate + L-Phenylalanine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Phenylalanine:
Adenosine triphosphate + L-Phenylalanine ⟶ Adenosine monophosphate + Pyrophosphate
- Tyrosinemia Type 3 (TYRO3):
Adenosine triphosphate + L-Tyrosine ⟶ Adenosine monophosphate + Pyrophosphate
- Tyrosinemia Type 2 (or Richner-Hanhart Syndrome):
Adenosine triphosphate + L-Tyrosine ⟶ Adenosine monophosphate + Pyrophosphate
- Phenylketonuria:
Adenosine triphosphate + L-Tyrosine ⟶ Adenosine monophosphate + Pyrophosphate
- Biotin-Carboxyl Carrier Protein Assembly:
Adenosine triphosphate + Biotin + Biotin-Carboxyl Carrying Protein ⟶ Adenosine monophosphate + Biotinylated [BCCP monomer] + Hydrogen Ion + Pyrophosphate
- Biotin-Carboxyl Carrier Protein Assembly:
Adenosine triphosphate + Biotin + Biotin-Carboxyl Carrying Protein ⟶ Adenosine monophosphate + Biotinylated [BCCP monomer] + Hydrogen Ion + Pyrophosphate
- Propanoate Metabolism:
2-iminobutanoate + Hydrogen Ion + Water ⟶ 2-Ketobutyric acid + Ammonium
- Propanoate Metabolism:
2-Ketobutyric acid + Coenzyme A ⟶ Formic acid + Propionyl-CoA
- Asparagine Biosynthesis:
Adenosine triphosphate + L-Aspartic acid + L-Glutamine + Water ⟶ Adenosine monophosphate + Hydrogen Ion + L-Asparagine + L-Glutamic acid + Pyrophosphate
- Asparagine Metabolism:
Adenosine triphosphate + L-Aspartic acid + L-Glutamine + Water ⟶ Adenosine monophosphate + Hydrogen Ion + L-Asparagine + L-Glutamic acid + Pyrophosphate
- Asparagine Metabolism:
Adenosine triphosphate + L-Aspartic acid + L-Glutamine + Water ⟶ Adenosine monophosphate + Hydrogen Ion + L-Asparagine + L-Glutamic acid + Pyrophosphate
- Asparagine Biosynthesis:
Adenosine triphosphate + L-Aspartic acid + L-Glutamine + Water ⟶ Adenosine monophosphate + Hydrogen Ion + L-Asparagine + L-Glutamic acid + Pyrophosphate
- L-Carnitine Degradation I:
Adenosine triphosphate + Coenzyme A + L-Carnitine ⟶ Adenosine monophosphate + L-Carnitinyl-CoA + diphosphate
- L-Carnitine Degradation I:
Adenosine triphosphate + Coenzyme A + L-Carnitine ⟶ Adenosine monophosphate + L-Carnitinyl-CoA + diphosphate
- Cilostazol Action Pathway:
Water + cAMP ⟶ Adenosine monophosphate + Hydrogen Ion
- Alanine Metabolism:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate
- Primary Hyperoxaluria Type I:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate
- Pyruvate Carboxylase Deficiency:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate
- Lactic Acidemia:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate
- Alanine Metabolism:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate
- Lactic Acidemia:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate
- Pyruvate Carboxylase Deficiency:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate
- Primary Hyperoxaluria Type I:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate
- Alanine Metabolism:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate
- Alanine Metabolism:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate
- Alanine Metabolism:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate
- Alanine Metabolism:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Alanine:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Alanine:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Alanine:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Alanine:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate
- Lactic Acidemia:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate
- Pyruvate Carboxylase Deficiency:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate
- Primary Hyperoxaluria Type I:
Adenosine triphosphate + L-Alanine ⟶ Adenosine monophosphate + Pyrophosphate
- Pyruvate Metabolism:
Acetic acid + Coenzyme A ⟶ Acetyl-CoA + Water
- Leigh Syndrome:
Acetic acid + Coenzyme A ⟶ Acetyl-CoA + Water
- Pyruvate Decarboxylase E1 Component Deficiency (PDHE1 Deficiency):
Acetic acid + Coenzyme A ⟶ Acetyl-CoA + Water
- Pyruvate Dehydrogenase Complex Deficiency:
Acetic acid + Coenzyme A ⟶ Acetyl-CoA + Water
- Primary Hyperoxaluria II, PH2:
Acetic acid + Coenzyme A ⟶ Acetyl-CoA + Water
- Pyruvate Kinase Deficiency:
Acetic acid + Coenzyme A ⟶ Acetyl-CoA + Water
- Pyruvate Metabolism:
Acetaldehyde + NAD + Water ⟶ Acetic acid + Hydrogen Ion + NADH
- Leigh Syndrome:
Acetaldehyde + NAD + Water ⟶ Acetic acid + Hydrogen Ion + NADH
- Pyruvate Dehydrogenase Complex Deficiency:
Acetaldehyde + NAD + Water ⟶ Acetic acid + Hydrogen Ion + NADH
- Pyruvate Decarboxylase E1 Component Deficiency (PDHE1 Deficiency):
Acetaldehyde + NAD + Water ⟶ Acetic acid + Hydrogen Ion + NADH
- Primary Hyperoxaluria II, PH2:
Acetaldehyde + NAD + Water ⟶ Acetic acid + Hydrogen Ion + NADH
- Pyruvate Kinase Deficiency:
Acetaldehyde + NAD + Water ⟶ Acetic acid + Hydrogen Ion + NADH
- Pyruvate Metabolism:
Acetaldehyde + NAD + Water ⟶ Acetic acid + Hydrogen Ion + NADH
- Pyruvate Metabolism:
Acetaldehyde + NAD + Water ⟶ Acetic acid + Hydrogen Ion + NADH
- Pyruvate Metabolism:
Acetic acid + Coenzyme A ⟶ Acetyl-CoA + Water
- Pyruvate Metabolism:
Acetic acid + Coenzyme A ⟶ Acetyl-CoA + Water
- Leigh Syndrome:
Acetaldehyde + NAD + Water ⟶ Acetic acid + Hydrogen Ion + NADH
- Pyruvate Dehydrogenase Complex Deficiency:
Acetaldehyde + NAD + Water ⟶ Acetic acid + Hydrogen Ion + NADH
- Pyruvate Decarboxylase E1 Component Deficiency (PDHE1 Deficiency):
Acetaldehyde + NAD + Water ⟶ Acetic acid + Hydrogen Ion + NADH
- Primary Hyperoxaluria II, PH2:
Acetaldehyde + NAD + Water ⟶ Acetic acid + Hydrogen Ion + NADH
- Pyruvate Kinase Deficiency:
Acetaldehyde + NAD + Water ⟶ Acetic acid + Hydrogen Ion + NADH
- Protein Synthesis: Leucine:
Adenosine triphosphate + L-Leucine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Leucine:
Adenosine triphosphate + L-Leucine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Leucine:
Adenosine triphosphate + L-Leucine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Leucine:
Adenosine triphosphate + L-Leucine ⟶ Adenosine monophosphate + Pyrophosphate
- Mitochondrial Beta-Oxidation of Medium Chain Saturated Fatty Acids:
Adenosine triphosphate + Coenzyme A + Dodecanoic acid ⟶ Adenosine monophosphate + Lauroyl-CoA + Pyrophosphate
- Fatty Acid Oxidation (Laurate):
Adenosine triphosphate + Coenzyme A + Dodecanoic acid ⟶ Adenosine monophosphate + Lauroyl-CoA
- Mitochondrial Beta-Oxidation of Medium Chain Saturated Fatty Acids:
Adenosine triphosphate + Coenzyme A + Dodecanoic acid ⟶ Adenosine monophosphate + Lauroyl-CoA + Pyrophosphate
- Mitochondrial Beta-Oxidation of Medium Chain Saturated Fatty Acids:
Adenosine triphosphate + Coenzyme A + Dodecanoic acid ⟶ Adenosine monophosphate + Lauroyl-CoA + Pyrophosphate
- Mitochondrial Beta-Oxidation of Medium Chain Saturated Fatty Acids:
Adenosine triphosphate + Coenzyme A + Dodecanoic acid ⟶ Adenosine monophosphate + Lauroyl-CoA + Pyrophosphate
- Mitochondrial Beta-Oxidation of Medium Chain Saturated Fatty Acids:
Adenosine triphosphate + Coenzyme A + Dodecanoic acid ⟶ Adenosine monophosphate + Lauroyl-CoA + Pyrophosphate
- Mitochondrial Beta-Oxidation of Medium Chain Saturated Fatty Acids:
Adenosine triphosphate + Coenzyme A + Dodecanoic acid ⟶ Adenosine monophosphate + Lauroyl-CoA + Pyrophosphate
- Fatty Acid Oxidation (Laurate):
Adenosine triphosphate + Coenzyme A + Dodecanoic acid ⟶ Adenosine monophosphate + Lauroyl-CoA
- Urea Cycle:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate
- Aspartate Metabolism:
N-Acetyl-L-aspartic acid + Water ⟶ Acetic acid + L-Aspartic acid
- Arginine and Proline Metabolism:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Prolidase Deficiency (PD):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Arginine: Glycine Amidinotransferase Deficiency (AGAT Deficiency):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Hyperprolinemia Type II:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Hyperprolinemia Type I:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Prolinemia Type II:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Guanidinoacetate Methyltransferase Deficiency (GAMT Deficiency):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Ornithine Aminotransferase Deficiency (OAT Deficiency):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Canavan Disease:
N-Acetyl-L-aspartic acid + Water ⟶ Acetic acid + L-Aspartic acid
- Hypoacetylaspartia:
N-Acetyl-L-aspartic acid + Water ⟶ Acetic acid + L-Aspartic acid
- Argininemia:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate
- Argininosuccinic Aciduria:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate
- Citrullinemia Type I:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate
- Ornithine Transcarbamylase Deficiency (OTC Deficiency):
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate
- Carbamoyl Phosphate Synthetase Deficiency:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate
- Creatine Deficiency, Guanidinoacetate Methyltransferase Deficiency:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Hyperornithinemia with Gyrate Atrophy (HOGA):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Hyperornithinemia-Hyperammonemia-Homocitrullinuria [HHH-syndrome]:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- L-Arginine:Glycine Amidinotransferase Deficiency:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Aspartate Metabolism:
Adenosine triphosphate + Ammonia + L-Aspartic acid ⟶ Adenosine monophosphate + L-Asparagine + Pyrophosphate
- Arginine Metabolism:
N-Acetylornithine + Water ⟶ Acetic acid + Ornithine
- Arginine Metabolism:
N-Acetylornithine + Water ⟶ Acetic acid + Ornithine
- Proline Metabolism:
N-Acetylornithine + Water ⟶ Acetic acid + Ornithine
- Arginine and Proline Metabolism:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Arginine and Proline Metabolism:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Aspartate Metabolism:
N-Acetyl-L-aspartic acid + Water ⟶ Acetic acid + L-Aspartic acid
- Urea Cycle:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate
- Arginine: Glycine Amidinotransferase Deficiency (AGAT Deficiency):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Argininemia:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate
- Argininosuccinic Aciduria:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate
- Canavan Disease:
N-Acetyl-L-aspartic acid + Water ⟶ Acetic acid + L-Aspartic acid
- Carbamoyl Phosphate Synthetase Deficiency:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate
- Citrullinemia Type I:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate
- Guanidinoacetate Methyltransferase Deficiency (GAMT Deficiency):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Hyperprolinemia Type I:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Hyperprolinemia Type II:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Hypoacetylaspartia:
N-Acetyl-L-aspartic acid + Water ⟶ Acetic acid + L-Aspartic acid
- Ornithine Aminotransferase Deficiency (OAT Deficiency):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Prolinemia Type II:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Prolidase Deficiency (PD):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Ornithine Transcarbamylase Deficiency (OTC Deficiency):
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate
- Creatine Deficiency, Guanidinoacetate Methyltransferase Deficiency:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Hyperornithinemia with Gyrate Atrophy (HOGA):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Hyperornithinemia-Hyperammonemia-Homocitrullinuria [HHH-syndrome]:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- L-Arginine:Glycine Amidinotransferase Deficiency:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Aspartate Metabolism:
N-Acetyl-L-aspartic acid + Water ⟶ Acetic acid + L-Aspartic acid
- Arginine and Proline Metabolism:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Urea Cycle:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate
- Aspartate Metabolism:
N-Acetyl-L-aspartic acid + Water ⟶ Acetic acid + L-Aspartic acid
- Arginine and Proline Metabolism:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Urea Cycle:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate
- Aspartate Metabolism:
N-Acetyl-L-aspartic acid + Water ⟶ Acetic acid + L-Aspartic acid
- Aspartate Metabolism:
N-Acetyl-L-aspartic acid + Water ⟶ Acetic acid + L-Aspartic acid
- Arginine: Glycine Amidinotransferase Deficiency (AGAT Deficiency):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Argininemia:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate
- Argininosuccinic Aciduria:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate
- Canavan Disease:
N-Acetyl-L-aspartic acid + Water ⟶ Acetic acid + L-Aspartic acid
- Carbamoyl Phosphate Synthetase Deficiency:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate
- Citrullinemia Type I:
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate
- Guanidinoacetate Methyltransferase Deficiency (GAMT Deficiency):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Hyperprolinemia Type I:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Hyperprolinemia Type II:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Hypoacetylaspartia:
N-Acetyl-L-aspartic acid + Water ⟶ Acetic acid + L-Aspartic acid
- Ornithine Aminotransferase Deficiency (OAT Deficiency):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Prolinemia Type II:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Prolidase Deficiency (PD):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Ornithine Transcarbamylase Deficiency (OTC Deficiency):
Adenosine triphosphate + Citrulline + L-Aspartic acid ⟶ Adenosine monophosphate + Argininosuccinic acid + Pyrophosphate
- Creatine Deficiency, Guanidinoacetate Methyltransferase Deficiency:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Hyperornithinemia with Gyrate Atrophy (HOGA):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Hyperornithinemia-Hyperammonemia-Homocitrullinuria [HHH-syndrome]:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- L-Arginine:Glycine Amidinotransferase Deficiency:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Aspartate Metabolism:
Adenosine triphosphate + L-Aspartic acid + L-Glutamine + Water ⟶ Adenosine monophosphate + L-Asparagine + L-Glutamic acid + Pyrophosphate
- Arginine Metabolism:
N-Acetylornithine + Water ⟶ Acetic acid + Ornithine
- Ammonia Recycling:
Adenosine triphosphate + L-Aspartic acid + L-Glutamine + Water ⟶ Adenosine monophosphate + L-Asparagine + L-Glutamic acid + Pyrophosphate
- Ammonia Recycling:
Adenosine triphosphate + L-Aspartic acid + L-Glutamine + Water ⟶ Adenosine monophosphate + L-Asparagine + L-Glutamic acid + Pyrophosphate
- Ammonia Recycling:
Adenosine triphosphate + L-Aspartic acid + L-Glutamine + Water ⟶ Adenosine monophosphate + L-Asparagine + L-Glutamic acid + Pyrophosphate
- Ammonia Recycling:
Adenosine triphosphate + L-Aspartic acid + L-Glutamine + Water ⟶ Adenosine monophosphate + L-Asparagine + L-Glutamic acid + Pyrophosphate
- Ammonia Recycling:
Adenosine triphosphate + L-Aspartic acid + L-Glutamine + Water ⟶ Adenosine monophosphate + L-Asparagine + L-Glutamic acid + Pyrophosphate
- Ammonia Recycling:
Adenosine triphosphate + L-Aspartic acid + L-Glutamine + Water ⟶ Adenosine monophosphate + L-Asparagine + L-Glutamic acid + Pyrophosphate
- Protein Synthesis: Asparagine:
Adenosine triphosphate + L-Asparagine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Asparagine:
Adenosine triphosphate + L-Asparagine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Asparagine:
Adenosine triphosphate + L-Asparagine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Asparagine:
Adenosine triphosphate + L-Asparagine ⟶ Adenosine monophosphate + Pyrophosphate
- Adenine and Adenosine Salvage III:
Adenosine + Water ⟶ -D-ribofuranose + Adenine
- Adenine and Adenosine Salvage III:
Adenosine + Water ⟶ -D-ribofuranose + Adenine
- Lysine Metabolism:
Adenosine triphosphate + Aminoadipic acid + holo-[LYS2 peptidyl-carrier-protein] ⟶ Adenosine monophosphate + L-2-aminoadipyl-[LYS2 peptidyl-carrier-protein] + Pyrophosphate
- Mercaptopurine Metabolism Pathway:
Adenosine triphosphate + L-Glutamine + Thioxanthine monophosphate + Water ⟶ 6-Thioguanosine monophosphate + Adenosine monophosphate + Pyrophosphate
- fatty acid oxidation (octanoate):
Adenosine triphosphate + Caprylic acid + Coenzyme A ⟶ Adenosine monophosphate + Octanoyl-CoA
- Fatty Acid Oxidation (Octanoate):
Adenosine triphosphate + Caprylic acid + Coenzyme A ⟶ Adenosine monophosphate + Octanoyl-CoA
- Porphyrin Metabolism:
Adenosine triphosphate + Hydrogen Ion + L-Glutamic acid ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Glutamic Acid:
Adenosine triphosphate + L-Glutamic acid ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Glutamic Acid:
Adenosine triphosphate + L-Glutamic acid ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Glutamic Acid:
Adenosine triphosphate + L-Glutamic acid ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Glutamic Acid:
Adenosine triphosphate + L-Glutamic acid ⟶ Adenosine monophosphate + Pyrophosphate
- Porphyrin Metabolism:
Adenosine triphosphate + Hydrogen Ion + L-Glutamic acid ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Tyrosine:
Adenosine triphosphate + L-Tyrosine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Tyrosine:
Adenosine triphosphate + L-Tyrosine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Tyrosine:
Adenosine triphosphate + L-Tyrosine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Tyrosine:
Adenosine triphosphate + L-Tyrosine ⟶ Adenosine monophosphate + Pyrophosphate
- Mitochondrial Beta-Oxidation of Short Chain Saturated Fatty Acids:
Adenosine triphosphate + Caproic acid + Coenzyme A ⟶ Adenosine monophosphate + Hexanoyl-CoA + Pyrophosphate
- Short-Chain 3-Hydroxyacyl-CoA Dehydrogenase Deficiency (SCHAD):
Adenosine triphosphate + Caproic acid + Coenzyme A ⟶ Adenosine monophosphate + Hexanoyl-CoA + Pyrophosphate
- Mitochondrial Beta-Oxidation of Short Chain Saturated Fatty Acids:
Adenosine triphosphate + Caproic acid + Coenzyme A ⟶ Adenosine monophosphate + Hexanoyl-CoA + Pyrophosphate
- Short-Chain 3-Hydroxyacyl-CoA Dehydrogenase Deficiency (SCHAD):
Adenosine triphosphate + Caproic acid + Coenzyme A ⟶ Adenosine monophosphate + Hexanoyl-CoA + Pyrophosphate
- Mitochondrial Beta-Oxidation of Short Chain Saturated Fatty Acids:
Adenosine triphosphate + Caproic acid + Coenzyme A ⟶ Adenosine monophosphate + Hexanoyl-CoA + Pyrophosphate
- Mitochondrial Beta-Oxidation of Short Chain Saturated Fatty Acids:
Adenosine triphosphate + Caproic acid + Coenzyme A ⟶ Adenosine monophosphate + Hexanoyl-CoA + Pyrophosphate
- Mitochondrial Beta-Oxidation of Short Chain Saturated Fatty Acids:
Adenosine triphosphate + Caproic acid + Coenzyme A ⟶ Adenosine monophosphate + Hexanoyl-CoA + Pyrophosphate
- Mitochondrial Beta-Oxidation of Short Chain Saturated Fatty Acids:
Adenosine triphosphate + Caproic acid + Coenzyme A ⟶ Adenosine monophosphate + Hexanoyl-CoA + Pyrophosphate
- Short-Chain 3-Hydroxyacyl-CoA Dehydrogenase Deficiency (SCHAD):
Adenosine triphosphate + Caproic acid + Coenzyme A ⟶ Adenosine monophosphate + Hexanoyl-CoA + Pyrophosphate
- Fatty Acid Oxidation (Hexanoate):
Adenosine triphosphate + Caproic acid + Coenzyme A ⟶ Adenosine monophosphate + Hexanoyl-CoA
- Citrate Lyase Activation:
Adenosine triphosphate + Dephospho-CoA + Hydrogen Ion ⟶ 2'-(5-Triphosphoribosyl)-3'-dephospho-CoA + Adenine
- GTP Degradation and Molybdenum Cofactor Biosynthesis:
7,8-Dihydroneopterin ⟶ 6-hydroxymethyl-7,8-dihydropterin + Glycolaldehyde
- GTP Degradation and Molybdenum Cofactor Biosynthesis:
7,8-Dihydroneopterin ⟶ 6-hydroxymethyl-7,8-dihydropterin + Glycolaldehyde
- Mitochondrial Beta-Oxidation of Long Chain Saturated Fatty Acids:
Adenosine triphosphate + Coenzyme A + Stearic acid ⟶ Adenosine monophosphate + Pyrophosphate + Stearoyl-CoA
- fatty acid oxidation (steareate):
Adenosine triphosphate + Coenzyme A + Stearic acid ⟶ Adenosine monophosphate + Stearoyl-CoA
- Mitochondrial Beta-Oxidation of Long Chain Saturated Fatty Acids:
Adenosine triphosphate + Coenzyme A + Stearic acid ⟶ Adenosine monophosphate + Pyrophosphate + Stearoyl-CoA
- Mitochondrial Beta-Oxidation of Long Chain Saturated Fatty Acids:
Adenosine triphosphate + Coenzyme A + Stearic acid ⟶ Adenosine monophosphate + Pyrophosphate + Stearoyl-CoA
- Mitochondrial Beta-Oxidation of Long Chain Saturated Fatty Acids:
Adenosine triphosphate + Coenzyme A + Stearic acid ⟶ Adenosine monophosphate + Pyrophosphate + Stearoyl-CoA
- Mitochondrial Beta-Oxidation of Long Chain Saturated Fatty Acids:
Adenosine triphosphate + Coenzyme A + Stearic acid ⟶ Adenosine monophosphate + Pyrophosphate + Stearoyl-CoA
- Mitochondrial Beta-Oxidation of Long Chain Saturated Fatty Acids:
Adenosine triphosphate + Coenzyme A + Stearic acid ⟶ Adenosine monophosphate + Pyrophosphate + Stearoyl-CoA
- Fatty Acid Oxidation (Steareate):
Adenosine triphosphate + Coenzyme A + Stearic acid ⟶ Adenosine monophosphate + Stearoyl-CoA
- Biosynthesis of Siderophore Group Nonribosomal Peptides:
2,3-Dihydroxybenzoic acid + Adenosine triphosphate + L-Serine ⟶ Adenosine monophosphate + Hydrogen Ion + Pyrophosphate + enterobactin
- Biosynthesis of Siderophore Group Nonribosomal Peptides:
2,3-Dihydroxybenzoic acid + Adenosine triphosphate + L-Serine ⟶ Adenosine monophosphate + Hydrogen Ion + Pyrophosphate + enterobactin
- Folate Biosynthesis:
7,8-Dihydroneopterin ⟶ 6-hydroxymethyl-7,8-dihydropterin + Glycolaldehyde
- Tetrahydrofolate Biosynthesis:
7,8-Dihydroneopterin ⟶ 6-hydroxymethyl-7,8-dihydropterin + Glycolaldehyde
- Folate Biosynthesis:
7,8-Dihydroneopterin ⟶ 6-hydroxymethyl-7,8-dihydropterin + Glycolaldehyde
- Riboflavin Metabolism:
FAD + Water ⟶ Adenosine monophosphate + Flavin Mononucleotide
- Riboflavin Metabolism:
FAD + Water ⟶ Adenosine monophosphate + Flavin Mononucleotide
- Riboflavin Metabolism:
FAD + Water ⟶ Adenosine monophosphate + Flavin Mononucleotide
- Riboflavin Metabolism:
FAD + Water ⟶ Adenosine monophosphate + Flavin Mononucleotide
- Riboflavin Metabolism:
FAD + Water ⟶ Adenosine monophosphate + Flavin Mononucleotide
- Riboflavin Metabolism:
FAD + Water ⟶ Adenosine monophosphate + Flavin Mononucleotide
- Tryptophan Metabolism:
L-Tryptophan + Oxygen ⟶ N'-Formylkynurenine
- Tryptophan Metabolism:
L-Tryptophan + Oxygen ⟶ N'-Formylkynurenine
- Tryptophan Metabolism:
L-Tryptophan + Oxygen ⟶ N'-Formylkynurenine
- Tryptophan Metabolism:
L-Tryptophan + Oxygen ⟶ N'-Formylkynurenine
- Tryptophan Metabolism:
L-Tryptophan + Oxygen ⟶ N'-Formylkynurenine
- Protein Synthesis: Tryptophan:
Adenosine triphosphate + L-Tryptophan ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Tryptophan:
Adenosine triphosphate + L-Tryptophan ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Tryptophan:
Adenosine triphosphate + L-Tryptophan ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Tryptophan:
Adenosine triphosphate + L-Tryptophan ⟶ Adenosine monophosphate + Pyrophosphate
- Methionine Metabolism:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Cystathionine beta-Synthase Deficiency:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Hypermethioninemia:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- S-Adenosylhomocysteine (SAH) Hydrolase Deficiency:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Glycine N-Methyltransferase Deficiency:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Methylenetetrahydrofolate Reductase Deficiency (MTHFRD):
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Methionine Adenosyltransferase Deficiency:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Homocystinuria-Megaloblastic Anemia Due to Defect in Cobalamin Metabolism, cblG Complementation Type:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Methionine Metabolism:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Cystathionine beta-Synthase Deficiency:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Glycine N-Methyltransferase Deficiency:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Hypermethioninemia:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Methionine Adenosyltransferase Deficiency:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- S-Adenosylhomocysteine (SAH) Hydrolase Deficiency:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Homocystinuria-Megaloblastic Anemia Due to Defect in Cobalamin Metabolism, cblG Complementation Type:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Methionine Metabolism:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Methionine Metabolism:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Methionine Metabolism:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Methionine Metabolism:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Protein Synthesis: Methionine:
Adenosine triphosphate + L-Methionine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Methionine:
Adenosine triphosphate + L-Methionine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Methionine:
Adenosine triphosphate + L-Methionine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Methionine:
Adenosine triphosphate + L-Methionine ⟶ Adenosine monophosphate + Pyrophosphate
- Cystathionine beta-Synthase Deficiency:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Glycine N-Methyltransferase Deficiency:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Hypermethioninemia:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Methionine Adenosyltransferase Deficiency:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- S-Adenosylhomocysteine (SAH) Hydrolase Deficiency:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Homocystinuria-Megaloblastic Anemia Due to Defect in Cobalamin Metabolism, cblG Complementation Type:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Enterobactin Biosynthesis:
(2,3-Dihydroxybenzoyl)adenylic acid + a holo-[EntB isochorismatase/aryl-carrier protein] ⟶ Adenosine monophosphate + Hydrogen Ion + a 2,3-dihydroxybenzoyl-[EntB isochorismatase/aryl-carrier protein]
- Enterobactin Biosynthesis:
(2,3-Dihydroxybenzoyl)adenylic acid + a holo-[EntB isochorismatase/aryl-carrier protein] ⟶ Adenosine monophosphate + Hydrogen Ion + a 2,3-dihydroxybenzoyl-[EntB isochorismatase/aryl-carrier protein]
- Pentose Phosphate Pathway:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate
- Glucose-6-phosphate Dehydrogenase Deficiency:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate
- Ribose-5-phosphate Isomerase Deficiency:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate
- Transaldolase Deficiency:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate
- PRPP Biosynthesis:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Hydrogen Ion + Phosphoribosyl pyrophosphate
- Histidine Biosynthesis:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Hydrogen Ion + Phosphoribosyl pyrophosphate
- Pentose Phosphate Pathway:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate
- Glucose-6-phosphate Dehydrogenase Deficiency:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate
- Ribose-5-phosphate Isomerase Deficiency:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate
- Transaldolase Deficiency:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate
- Pentose Phosphate Pathway:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate
- Pentose Phosphate Pathway:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate
- Pentose Phosphate Pathway:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate
- Pentose Phosphate Pathway:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate
- Glucose-6-phosphate Dehydrogenase Deficiency:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate
- Ribose-5-phosphate Isomerase Deficiency:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate
- Transaldolase Deficiency:
Adenosine triphosphate + D-Ribose 5-phosphate ⟶ Adenosine monophosphate + Phosphoribosyl pyrophosphate
- Biotin Metabolism:
Dethiobiotin + Hydrogen Ion + S-Adenosylmethionine + a sulfurated [sulfur carrier] ⟶ 5'-Deoxyadenosine + Biotin + L-Methionine
- Biotin Metabolism:
Adenosine triphosphate + Biotin ⟶ Biotinyl-5'-AMP + diphosphate
- Cysteine Metabolism:
Adenosine triphosphate + L-Cysteine ⟶ Adenosine monophosphate + Pyrophosphate
- beta-Mercaptolactate-Cysteine Disulfiduria:
Adenosine triphosphate + L-Cysteine ⟶ Adenosine monophosphate + Pyrophosphate
- Cystinosis, Ocular Nonnephropathic:
Adenosine triphosphate + L-Cysteine ⟶ Adenosine monophosphate + Pyrophosphate
- Cysteine Metabolism:
Adenosine triphosphate + L-Cysteine ⟶ Adenosine monophosphate + Pyrophosphate
- Cystinosis, Ocular Nonnephropathic:
Adenosine triphosphate + L-Cysteine ⟶ Adenosine monophosphate + Pyrophosphate
- beta-Mercaptolactate-Cysteine Disulfiduria:
Adenosine triphosphate + L-Cysteine ⟶ Adenosine monophosphate + Pyrophosphate
- Cystinosis, Ocular Nonnephropathic:
Adenosine triphosphate + L-Cysteine ⟶ Adenosine monophosphate + Pyrophosphate
- Cysteine Metabolism:
Adenosine triphosphate + L-Cysteine ⟶ Adenosine monophosphate + Pyrophosphate
- Cysteine Metabolism:
Adenosine triphosphate + L-Cysteine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Cysteine:
Adenosine triphosphate + L-Cysteine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Cysteine:
Adenosine triphosphate + L-Cysteine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Cysteine:
Adenosine triphosphate + L-Cysteine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Cysteine:
Adenosine triphosphate + L-Cysteine ⟶ Adenosine monophosphate + Pyrophosphate
- beta-Mercaptolactate-Cysteine Disulfiduria:
Adenosine triphosphate + L-Cysteine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Proline:
Adenosine triphosphate + L-Proline ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Proline:
Adenosine triphosphate + L-Proline ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Proline:
Adenosine triphosphate + L-Proline ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Proline:
Adenosine triphosphate + L-Proline ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Threonine:
Adenosine triphosphate + L-Threonine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Threonine:
Adenosine triphosphate + L-Threonine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Threonine:
Adenosine triphosphate + L-Threonine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Threonine:
Adenosine triphosphate + L-Threonine ⟶ Adenosine monophosphate + Pyrophosphate
- Mannose Metabolism:
ADP-Mannose + Water ⟶ Adenosine monophosphate + D-Mannose 1-phosphate
- Menaquinol Biosythesis:
2-succinylbenzoate + Adenosine triphosphate + Coenzyme A ⟶ 2-Succinylbenzoyl-CoA + Adenosine monophosphate + Pyrophosphate
- Jasmonic Acid Biosynthesis:
8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoate + Adenosine triphosphate + Coenzyme A ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA + Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Valine:
Adenosine triphosphate + L-Valine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Valine:
Adenosine triphosphate + L-Valine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Valine:
Adenosine triphosphate + L-Valine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Valine:
Adenosine triphosphate + L-Valine ⟶ Adenosine monophosphate + Pyrophosphate
- Histidine Metabolism:
-Alanine + Adenosine triphosphate + L-Histidine ⟶ Adenosine diphosphate + Carnosine + Phosphate
- Histidinemia:
-Alanine + Adenosine triphosphate + L-Histidine ⟶ Adenosine diphosphate + Carnosine + Phosphate
- Histidine Metabolism:
Carnosine + Water ⟶ -Alanine + L-Histidine
- Histidinemia:
Carnosine + Water ⟶ -Alanine + L-Histidine
- Histidine Metabolism:
Carnosine + Water ⟶ -Alanine + L-Histidine
- Histidine Metabolism:
Carnosine + Water ⟶ -Alanine + L-Histidine
- Protein Synthesis: Histidine:
Adenosine triphosphate + L-Histidine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Histidine:
Adenosine triphosphate + L-Histidine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Histidine:
Adenosine triphosphate + L-Histidine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Histidine:
Adenosine triphosphate + L-Histidine ⟶ Adenosine monophosphate + Pyrophosphate
- Histidinemia:
Carnosine + Water ⟶ -Alanine + L-Histidine
- Adenosine Nucleotides Degradation:
Adenosine monophosphate + Water ⟶ Adenosine + Phosphate
- Glycine and Serine Metabolism:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Fatty Acid Metabolism:
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Ethylmalonic Encephalopathy:
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Glutaric Aciduria Type I:
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Short-Chain Acyl-CoA Dehydrogenase Deficiency (SCAD Deficiency):
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Dimethylglycine Dehydrogenase Deficiency:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Dihydropyrimidine Dehydrogenase Deficiency (DHPD):
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Sarcosinemia:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Non-Ketotic Hyperglycinemia:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Clomocycline Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Azithromycin Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Clarithromycin Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Clindamycin Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Erythromycin Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Roxithromycin Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Telithromycin Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Amikacin Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Gentamicin Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Kanamycin Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Neomycin Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Netilmicin Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Spectinomycin Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Streptomycin Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Demeclocycline Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Doxycycline Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Minocycline Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Oxytetracycline Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Tetracycline Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Lymecycline Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Dimethylglycine Dehydrogenase Deficiency:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Hyperglycinemia, Non-Ketotic:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Carnitine Palmitoyl Transferase Deficiency I:
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Long Chain Acyl-CoA Dehydrogenase Deficiency (LCAD):
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Very-Long-Chain Acyl-CoA Dehydrogenase Deficiency (VLCAD):
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Carnitine Palmitoyl Transferase Deficiency II:
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Medium Chain Acyl-CoA Dehydrogenase Deficiency (MCAD):
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Trifunctional Protein Deficiency:
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Tobramycin Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Tigecycline Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Arbekacin Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Paromomycin Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- 3-Phosphoglycerate Dehydrogenase Deficiency:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Rolitetracycline Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Methacycline Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Lincomycin Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Chloramphenicol Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Troleandomycin Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Josamycin Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Abacavir Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Delavirdine Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Didanosine Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Efavirenz Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Emtricitabine Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Lamivudine Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Nevirapine Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Rilpivirine Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Stavudine Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Zalcitabine Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Zidovudine Action Pathway:
Adenosine triphosphate ⟶ Adenosine monophosphate + Pyrophosphate
- Fatty Acid Oxidation:
Adenosine triphosphate + Coenzyme A + a 2,3,4- saturated fatty acid ⟶ Adenosine monophosphate + Pyrophosphate + a 2,3,4-saturated fatty acyl CoA
- fatty acid oxidation (palmitate):
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA
- Selenium Metabolism:
Adenosine triphosphate + hydrogen selenide ion ⟶ Adenosine monophosphate + Phosphate + Selenophosphate
- D-Arabinose Degradation I:
Adenosine triphosphate + D-Ribulose ⟶ Adenosine monophosphate + D-Ribulose-1-phosphate + Hydrogen Ion
- Biosynthesis of Unsaturated Fatty Acids:
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Biosynthesis of Unsaturated Fatty Acids (Tetracosanoyl-CoA):
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Biosynthesis of Unsaturated Fatty Acids (Docosanoyl-CoA):
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Biosynthesis of Unsaturated Fatty Acids (Icosanoyl-CoA):
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Biosynthesis of Unsaturated Fatty Acids (Stearoyl-CoA):
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Fatty Acid Metabolism:
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Pterin Biosynthesis (Folate Precursor):
Adenosine triphosphate + HMDHP ⟶ Adenosine monophosphate + HMDHP pyrophosphate + Hydrogen Ion
- Folate Biosynthesis:
Adenosine triphosphate + HMDHP ⟶ Adenosine monophosphate + HMDHP pyrophosphate + Hydrogen Ion
- Fatty Acid Beta-Oxidation I:
Adenosine triphosphate + Coenzyme A + a 2,3,4- saturated fatty acid ⟶ Adenosine monophosphate + Pyrophosphate + a 2,3,4-saturated fatty acyl CoA
- Fatty Acid Metabolism:
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Glycine and Serine Metabolism:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- 3-Phosphoglycerate Dehydrogenase Deficiency:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Dihydropyrimidine Dehydrogenase Deficiency (DHPD):
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Dimethylglycine Dehydrogenase Deficiency:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Ethylmalonic Encephalopathy:
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Short-Chain Acyl-CoA Dehydrogenase Deficiency (SCAD Deficiency):
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Sarcosinemia:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Non-Ketotic Hyperglycinemia:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Hyperglycinemia, Non-Ketotic:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Carnitine Palmitoyl Transferase Deficiency I:
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Long Chain Acyl-CoA Dehydrogenase Deficiency (LCAD):
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Very-Long-Chain Acyl-CoA Dehydrogenase Deficiency (VLCAD):
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Carnitine Palmitoyl Transferase Deficiency II:
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Medium Chain Acyl-CoA Dehydrogenase Deficiency (MCAD):
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Trifunctional Protein Deficiency:
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- 3-Phosphoglycerate Dehydrogenase Deficiency:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Fatty Acid Metabolism:
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Glycine and Serine Metabolism:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Fatty Acid Metabolism:
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Glycine and Serine Metabolism:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Fatty Acid Metabolism:
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Glycine and Serine Metabolism:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Fatty Acid Metabolism:
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Glycine and Serine Metabolism:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Protein Synthesis: Arginine:
Adenosine triphosphate + L-Arginine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Aspartic Acid:
Adenosine triphosphate + L-Aspartic acid ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Glutamine:
Adenosine triphosphate + L-Glutamine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Glycine:
Adenosine triphosphate + Glycine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Serine:
Adenosine triphosphate + L-Serine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Arginine:
Adenosine triphosphate + L-Arginine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Aspartic Acid:
Adenosine triphosphate + L-Aspartic acid ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Glutamine:
Adenosine triphosphate + L-Glutamine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Glycine:
Adenosine triphosphate + Glycine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Serine:
Adenosine triphosphate + L-Serine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Arginine:
Adenosine triphosphate + L-Arginine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Aspartic Acid:
Adenosine triphosphate + L-Aspartic acid ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Glutamine:
Adenosine triphosphate + L-Glutamine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Glycine:
Adenosine triphosphate + Glycine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Serine:
Adenosine triphosphate + L-Serine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Arginine:
Adenosine triphosphate + L-Arginine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Aspartic Acid:
Adenosine triphosphate + L-Aspartic acid ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Glutamine:
Adenosine triphosphate + L-Glutamine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Glycine:
Adenosine triphosphate + Glycine ⟶ Adenosine monophosphate + Pyrophosphate
- Protein Synthesis: Serine:
Adenosine triphosphate + L-Serine ⟶ Adenosine monophosphate + Pyrophosphate
- Dihydropyrimidine Dehydrogenase Deficiency (DHPD):
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Dimethylglycine Dehydrogenase Deficiency:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Ethylmalonic Encephalopathy:
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Short-Chain Acyl-CoA Dehydrogenase Deficiency (SCAD Deficiency):
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Sarcosinemia:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Non-Ketotic Hyperglycinemia:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Hyperglycinemia, Non-Ketotic:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Carnitine Palmitoyl Transferase Deficiency I:
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Long Chain Acyl-CoA Dehydrogenase Deficiency (LCAD):
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Very-Long-Chain Acyl-CoA Dehydrogenase Deficiency (VLCAD):
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Carnitine Palmitoyl Transferase Deficiency II:
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Medium Chain Acyl-CoA Dehydrogenase Deficiency (MCAD):
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Trifunctional Protein Deficiency:
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
- Fatty Acid Oxidation:
Adenosine triphosphate + Coenzyme A + a 2,3,4- saturated fatty acid ⟶ Adenosine monophosphate + Pyrophosphate + a 2,3,4-saturated fatty acyl CoA
- Fatty Acid Oxidation (Palmitate):
Adenosine triphosphate + Coenzyme A + Palmitic acid ⟶ Adenosine monophosphate + Palmityl-CoA
- Selenium Metabolism:
Adenosine triphosphate + hydrogen selenide ion ⟶ Adenosine monophosphate + Phosphate + Selenophosphate
- D-Arabinose Degradation I:
Adenosine triphosphate + D-Ribulose ⟶ Adenosine monophosphate + D-Ribulose-1-phosphate + Hydrogen Ion
PharmGKB(0)
161 organism taxonomy source information
- 155619 - Agaricomycetes: LTS0007212
- 3701 - Arabidopsis: LTS0007212
- 3701 - Arabidopsis: LTS0080280
- 3702 - Arabidopsis thaliana:
- 3702 - Arabidopsis thaliana: 10.1104/PP.109.148031
- 3702 - Arabidopsis thaliana: 10.1186/1752-0509-1-53
- 3702 - Arabidopsis thaliana: LTS0007212
- 3702 - Arabidopsis thaliana: LTS0080280
- 13345 - Ardisia crenata: 10.3389/FMOLB.2021.683671
- 6656 - Arthropoda: LTS0007212
- 6656 - Arthropoda: LTS0080280
- 4890 - Ascomycota: LTS0007212
- 4210 - Asteraceae: LTS0007212
- 4210 - Asteraceae: LTS0080280
- 3078 - Auxenochlorella pyrenoidosa: 10.1135/CCCC19653361
- 33852 - Bacillariaceae: LTS0007212
- 33849 - Bacillariophyceae: LTS0007212
- 2836 - Bacillariophyta: LTS0007212
- 2 - Bacteria: LTS0007212
- 5204 - Basidiomycota: LTS0007212
- 7089 - Bombycidae: LTS0007212
- 7090 - Bombyx: LTS0007212
- 7091 - Bombyx mori: 10.1371/JOURNAL.PGEN.1008980
- 7091 - Bombyx mori: LTS0007212
- 3700 - Brassicaceae: LTS0007212
- 3700 - Brassicaceae: LTS0080280
- 3051 - Chlamydomonadaceae: LTS0007212
- 3052 - Chlamydomonas: LTS0007212
- 3055 - Chlamydomonas reinhardtii: 10.1111/TPJ.12747
- 3055 - Chlamydomonas reinhardtii: LTS0007212
- 3071 - Chlorella: LTS0007212
- 3071 - Chlorella: LTS0080280
- 3077 - Chlorella vulgaris: 10.1135/CCCC19653361
- 35461 - Chlorellaceae: LTS0007212
- 35461 - Chlorellaceae: LTS0080280
- 3166 - Chlorophyceae: LTS0007212
- 3041 - Chlorophyta: LTS0007212
- 3041 - Chlorophyta: LTS0080280
- 7711 - Chordata: LTS0007212
- 1890464 - Chroococcaceae: LTS0007212
- 3028117 - Cyanophyceae: LTS0007212
- 128016 - Dimocarpus: LTS0007212
- 128016 - Dimocarpus: LTS0080280
- 128017 - Dimocarpus longan: 10.1055/S-1999-14055
- 128017 - Dimocarpus longan: LTS0007212
- 128017 - Dimocarpus longan: LTS0080280
- 1972655 - Dimocarpus longan subsp. longan: 10.1055/S-1999-14055
- 1972655 - Dimocarpus longan subsp. longan: LTS0007212
- 1972655 - Dimocarpus longan subsp. longan: LTS0080280
- 7227 - Drosophila melanogaster: 10.1038/S41467-019-11933-Z
- 543 - Enterobacteriaceae: LTS0007212
- 561 - Escherichia: LTS0007212
- 562 - Escherichia coli: LTS0007212
- 3039 - Euglena gracilis: 10.3389/FBIOE.2021.662655
- 33682 - Euglenozoa: LTS0007212
- 2759 - Eukaryota: LTS0007212
- 2759 - Eukaryota: LTS0080280
- 1541327 - Euphoria: LTS0007212
- 1541327 - Euphoria: LTS0080280
- 4751 - Fungi: LTS0007212
- 1236 - Gammaproteobacteria: LTS0007212
- 4231 - Helianthus: LTS0007212
- 4231 - Helianthus: LTS0080280
- 4233 - Helianthus tuberosus: 10.1080/00021369.1967.10858790
- 4233 - Helianthus tuberosus: LTS0007212
- 4233 - Helianthus tuberosus: LTS0080280
- 9604 - Hominidae: LTS0007212
- 9605 - Homo: LTS0007212
- 9606 - Homo sapiens:
- 9606 - Homo sapiens: -
- 9606 - Homo sapiens: 10.1007/S11306-012-0464-Y
- 9606 - Homo sapiens: LTS0007212
- 50557 - Insecta: LTS0007212
- 50557 - Insecta: LTS0080280
- 204130 - Isodon: LTS0007212
- 587669 - Isodon rubescens: 10.1016/J.JCHROMB.2011.07.046
- 587669 - Isodon rubescens: LTS0007212
- 5653 - Kinetoplastea: LTS0007212
- 4136 - Lamiaceae: LTS0007212
- 3398 - Magnoliopsida: LTS0007212
- 3398 - Magnoliopsida: LTS0080280
- 40674 - Mammalia: LTS0007212
- 1890428 - Merismopediaceae: LTS0007212
- 33208 - Metazoa: LTS0007212
- 33208 - Metazoa: LTS0080280
- 31969 - Mollicutes: LTS0007212
- 10066 - Muridae: LTS0007212
- 10088 - Mus: LTS0007212
- 10090 - Mus musculus: LTS0007212
- 10090 - Mus musculus: NA
- 7369 - Musca: LTS0007212