Uridine 5'-diphosphate (BioDeep_00000002945)
Secondary id: BioDeep_00001868748
natural product human metabolite Endogenous blood metabolite BioNovoGene_Lab2019
代谢物信息卡片
化学式: C9H14N2O12P2 (404.0022)
中文名称: 尿苷5'-二磷酸酯, 尿苷-5'-二磷酸, 尿苷-5'-二磷酸二钠盐水合物
谱图信息:
最多检出来源 Homo sapiens(blood) 11.17%
分子结构信息
SMILES: C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)O)O)O
InChI: InChI=1S/C9H14N2O12P2/c12-5-1-2-11(9(15)10-5)8-7(14)6(13)4(22-8)3-21-25(19,20)23-24(16,17)18/h1-2,4,6-8,13-14H,3H2,(H,19,20)(H,10,12,15)(H2,16,17,18)/t4-,6-,7-,8-/m1/s1
描述信息
Uridine 5-diphosphate, also known as 5-UDP, UDP or uridine diphosphoric acid, belongs to the class of organic compounds known as pyrimidine ribonucleoside diphosphates. These are pyrimidine ribonucleotides with diphosphate group linked to the ribose moiety. UDP is also classified as a nucleotide diphosphate. It is an ester of pyrophosphoric acid with the nucleoside uridine. UDP consists of a pyrophosphate group, a pentose sugar ribose, and the nucleobase uracil. UDP exists in all living species, ranging from bacteria to plants to humans. In mammals UDP is an important factor in glycogenesis or the formation of glycogen in the liver. Before glucose can be stored as glycogen in the liver and muscles, the enzyme UDP-glucose pyrophosphorylase forms a UDP-glucose unit by combining glucose 1-phosphate with uridine triphosphate, cleaving a pyrophosphate ion in the process. Then, the enzyme glycogen synthase combines UDP-glucose units to form a glycogen chain. UDP is also an important extracellular pyrimidine signaling molecule that mediates diverse biological effects via P1 and P2 purinergic receptors, such as the uptake of thymidine and proliferation of gliomas. UDP plays a key role in the function of Uridine 5-diphospho-glucuronosyltransferases (UDP-glucuronosyltransferases, UGTs) which catalyze the transfer of the glucuronic acid component of UDP-glucuronic acid to a small hydrophobic molecule. UDP-Glucuronosyltransferases are responsible for the process of glucuronidation, a major part of phase II metabolism. The reaction catalyzed by UGT enzymes involves the addition of a glucuronic acid moiety to xenobiotics and is the most important pathway for the human bodys elimination of the most frequently prescribed drugs. It is also the major pathway for foreign chemical (dietary, environmental, pharmaceutical) removal for most drugs, dietary substances, toxins and endogenous substances. UGT is present in humans, other animals, plants, and bacteria. Famously, UGT enzymes are not present in the genus Felis (PMID: 10862526) and this accounts for a number of unusual toxicities in the cat family.
Uridine-5-diphosphate, also known as udp or uridine 5-diphosphoric acid, is a member of the class of compounds known as pyrimidine ribonucleoside diphosphates. Pyrimidine ribonucleoside diphosphates are pyrimidine ribonucleotides with diphosphate group linked to the ribose moiety. Uridine-5-diphosphate is slightly soluble (in water) and a moderately acidic compound (based on its pKa). Uridine-5-diphosphate can be found in a number of food items such as napa cabbage, lichee, tea leaf willow, and parsnip, which makes uridine-5-diphosphate a potential biomarker for the consumption of these food products. Uridine-5-diphosphate can be found primarily in blood, as well as in human placenta, prostate and thyroid gland tissues. Uridine-5-diphosphate exists in all living species, ranging from bacteria to humans. In humans, uridine-5-diphosphate is involved in several metabolic pathways, some of which include morphine action pathway, androgen and estrogen metabolism, estrone metabolism, and amino sugar metabolism. Uridine-5-diphosphate is also involved in several metabolic disorders, some of which include 17-beta hydroxysteroid dehydrogenase III deficiency, acute intermittent porphyria, beta ureidopropionase deficiency, and g(m2)-gangliosidosis: variant B, tay-sachs disease.
Acquisition and generation of the data is financially supported in part by CREST/JST.
COVID info from COVID-19 Disease Map, WikiPathways
Corona-virus
Coronavirus
SARS-CoV-2
COVID-19
SARS-CoV
COVID19
SARS2
SARS
同义名列表
26 个代谢物同义名
[({[(2R,3S,4R,5R)-5-(2,4-dioxo-1,2,3,4-tetrahydropyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy]phosphonic acid; Uridine 5’-(trihydrogen pyrophosphate); Uridine 5-(trihydrogen pyrophosphate); Uridine-5-diphosphate sodium salt; Uridine 5’-pyrophosphoric acid; Uridine 5-pyrophosphoric acid; Uridine 5’-diphosphoric acid; Uridine 5-diphosphoric acid; Uridine 5-pyrophosphorate; Uridine diphosphoric acid; Uridine diphosphate (UDP); Uridine 5’-pyrophosphate; Uridine 5-pyrophosphate; Pyrophosphate, uridine; Uridine 5’-diphosphate; Uridine 5-diphosphate; Uridine-5-diphosphate; Uridine pyrophosphate; Diphosphate, uridine; Uridine diphosphate; UDP - Na; 5’-UDP; 5-UDP; UDP; Uridine 5'-diphosphate(UDP); UDP
数据库引用编号
34 个数据库交叉引用编号
- ChEBI: CHEBI:17659
- KEGG: C00015
- PubChem: 1158
- PubChem: 6031
- HMDB: HMDB0000295
- Metlin: METLIN97
- DrugBank: DB03435
- ChEMBL: CHEMBL130266
- Wikipedia: Uridine_Diphosphate
- MeSH: Uridine Diphosphate
- MetaCyc: UDP
- KNApSAcK: C00007313
- foodb: FDB031236
- chemspider: 5809
- MoNA: PS036607
- MoNA: PS036605
- MoNA: PS036612
- MoNA: PS036609
- MoNA: PS036610
- MoNA: PS036602
- MoNA: PS036606
- MoNA: PS036603
- MoNA: PS036608
- MoNA: PR100616
- PMhub: MS000007267
- PubChem: 3317
- CAS: 58-98-0
- PDB-CCD: UDP
- 3DMET: B01132
- NIKKAJI: J4.595K
- LOTUS: LTS0037887
- wikidata: Q412593
- BioNovoGene_Lab2019: BioNovoGene_Lab2019-372
- KNApSAcK: 17659
分类词条
相关代谢途径
Reactome(24)
- Metabolism
- Biological oxidations
- Metabolism of proteins
- Post-translational protein modification
- Disease
- Phase II - Conjugation of compounds
- Drug ADME
- Aspirin ADME
- Metabolism of lipids
- Signaling Pathways
- Mycobacterium tuberculosis biological processes
- Mycothiol metabolism
- Infectious disease
- Extracellular matrix organization
- Collagen formation
- Viral Infection Pathways
- Porphyrin metabolism
- Sphingolipid metabolism
- Glycosphingolipid metabolism
- Glycosphingolipid biosynthesis
- Mycothiol biosynthesis
- Trehalose biosynthesis
- O-linked glycosylation
- Heme degradation
BioCyc(8)
- purine and pyrimidine metabolism
- superpathway of histidine, purine, and pyrimidine biosynthesis
- peptidoglycan and lipid A precursor biosynthesis
- glycophosphatidylinositol (GPI) anchor biosynthesis
- lipophosphoglycan (LPG) biosynthesis
- glycoinositolphospholipid (GIPL) biosynthesis
- superpathway of histidine, purine and pyrimidine biosynthesis
- tetrahydrofolate biosynthesis I
PlantCyc(0)
代谢反应
1612 个相关的代谢反应过程信息。
Reactome(262)
- Mycobacterium tuberculosis biological processes:
CYSTA + H2O ⟶ 2OBUTA + L-Cys + ammonia
- Trehalose biosynthesis:
Mal ⟶ alpha,alpha-trehalose
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Porphyrin metabolism:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Heme degradation:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Biological oxidations:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP
- Glucuronidation:
BIL + UDP-GlcA ⟶ BMG + UDP
- Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Metabolism of proteins:
EIF5A2 + NAD + SPM ⟶ 1,3-diaminopropane + H+ + H0ZKZ7 + NADH
- Post-translational protein modification:
EIF5A2 + NAD + SPM ⟶ 1,3-diaminopropane + H+ + H0ZKZ7 + NADH
- Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Mycothiol metabolism:
GlcNAc-Ins + H2O ⟶ CH3COO- + GlcNI
- Mycothiol biosynthesis:
GlcNAc-Ins + H2O ⟶ CH3COO- + GlcNI
- Synthesis of substrates in N-glycan biosythesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu
- Synthesis of dolichyl-phosphate-glucose:
DOLP + UDP-Glc ⟶ DbGP + UDP
- Synthesis of substrates in N-glycan biosythesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu
- Synthesis of dolichyl-phosphate-glucose:
DOLP + UDP-Glc ⟶ DbGP + UDP
- Synthesis of substrates in N-glycan biosythesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu
- Synthesis of dolichyl-phosphate-glucose:
H2O + UDP-Glc ⟶ G1P + UMP
- Signaling Pathways:
AMP + p-AMPK heterotrimer ⟶ p-AMPK heterotrimer:AMP
- Signaling by GPCR:
H2O + cAMP ⟶ AMP
- GPCR downstream signalling:
H2O + cAMP ⟶ AMP
- G alpha (q) signalling events:
Heterotrimeric G-protein Gq/11 (inactive) + Ligand:GPCR complexes that activate Gq/11 ⟶ Ligand:GPCR complexes that activate Gq/11:Heterotrimeric G-protein Gq (inactive)
- Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Porphyrin metabolism:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Heme degradation:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP
- Glucuronidation:
BIL + UDP-GlcA ⟶ BMG + UDP
- Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi
- Porphyrin metabolism:
BIL + Homologues of GSTA1 ⟶ BIL:GSTA1, FABP1
- Biological oxidations:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + SAH ⟶ Ade-Rib + HCYS
- Glucuronidation:
BIL + UDP-GlcA ⟶ BMG + UDP
- Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Porphyrin metabolism:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Heme degradation:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Biological oxidations:
H+ + Oxygen + TPNH + progesterone ⟶ 11DCORST + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP
- Glucuronidation:
BIL + UDP-GlcA ⟶ BMG + UDP
- Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Porphyrin metabolism:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Heme degradation:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP
- Glucuronidation:
BIL + UDP-GlcA ⟶ BMG + UDP
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Porphyrin metabolism:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Heme degradation:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP
- Glucuronidation:
BIL + UDP-GlcA ⟶ BMG + UDP
- Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Porphyrin metabolism:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Heme degradation:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP
- Glucuronidation:
BIL + UDP-GlcA ⟶ BMG + UDP
- Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi
- Porphyrin metabolism:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Heme degradation:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Phase II - Conjugation of compounds:
PAPS + beta-estradiol ⟶ E2-SO4 + PAP
- Glucuronidation:
BIL + UDP-GlcA ⟶ BMG + UDP
- Heme degradation:
BIL + Homologues of GSTA1 ⟶ BIL:GSTA1, FABP1
- Signaling by Receptor Tyrosine Kinases:
H2O + cAMP ⟶ AMP
- Signaling by FGFR:
ATP + FGFR1b homodimer bound to FGF ⟶ ADP + Activated FGFR1b homodimer
- Signaling by FGFR3:
ATP + PP2A(A:C):SPRY2 ⟶ ADP + PP2A(A:C):Y55/Y227-pSPRY2
- FGFR3 ligand binding and activation:
ATP + FGFR3b homodimer bound to FGF ⟶ ADP + Activated FGFR3b homodimer
- FGFR3c ligand binding and activation:
ATP + FGFR3c homodimer bound to FGF ⟶ ADP + Activated FGFR3c homodimer
- O-linked glycosylation:
PAPS ⟶ PAP
- O-linked glycosylation of mucins:
PAPS ⟶ PAP
- Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN
- Glycosaminoglycan metabolism:
H2O ⟶ CH3COO-
- Chondroitin sulfate/dermatan sulfate metabolism:
PAPS + chondroitin(3)-core proteins ⟶ C4S-PG + PAP
- Chondroitin sulfate biosynthesis:
PAPS + chondroitin(3)-core proteins ⟶ C4S-PG + PAP
- Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Sphingolipid metabolism:
H2O + dehydroepiandrosterone sulfate ⟶ DHEA + SO4(2-)
- Glycosphingolipid metabolism:
H2O + dehydroepiandrosterone sulfate ⟶ DHEA + SO4(2-)
- Chondroitin sulfate biosynthesis:
Q8IG72 + UDP-GlcA ⟶ Q8IG72 + UDP
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP
- Glucuronidation:
AMPAG + H2O ⟶ GlcA + MPA
- Disease:
ADORA2B + Ade-Rib ⟶ ADORA2B:Ade-Rib
- Infectious disease:
ADORA2B + Ade-Rib ⟶ ADORA2B:Ade-Rib
- SARS-CoV Infections:
H2O + N-glycan Spike ⟶ beta-D-glucose + trimmed unfolded N-glycan Spike
- SARS-CoV-1 Infection:
H2O + N-glycan Spike ⟶ beta-D-glucose + trimmed unfolded N-glycan Spike
- Translation of Structural Proteins:
H2O + N-glycan Spike ⟶ beta-D-glucose + trimmed unfolded N-glycan Spike
- Maturation of protein 3a:
3a + UDP-GalNAc ⟶ GalNAc-O-3a + H+ + UDP
- SARS-CoV-2 Infection:
14-sugar N-glycan unfolded Spike + H2O ⟶ Man(9) N-glycan unfolded Spike + beta-D-glucose
- Translation of Structural Proteins:
14-sugar N-glycan unfolded Spike + H2O ⟶ Man(9) N-glycan unfolded Spike + beta-D-glucose
- Maturation of protein 3a:
3a + UDP-GalNAc ⟶ H+ + P0DTC3 + UDP
- Late SARS-CoV-2 Infection Events:
NAD + p-11S,2T-metR95,177-N ⟶ ADPr-p-11S,2T-metR95,177-N + H+ + NAM
- Viral Infection Pathways:
NAD + p-S177-N ⟶ ADPr-p-S177-N + H+ + NAM
- GPCR ligand binding:
Ade-Rib + H0YT13 ⟶ ADORA1,3:Ade-Rib
- Class A/1 (Rhodopsin-like receptors):
Ade-Rib + H0YT13 ⟶ ADORA1,3:Ade-Rib
- Nucleotide-like (purinergic) receptors:
Ade-Rib + H0YT13 ⟶ ADORA1,3:Ade-Rib
- P2Y receptors:
ATP + P2RY11 ⟶ P2RY11 :ATP
- Transport to the Golgi and subsequent modification:
ATP + RAB1:GTP:GBF1:USO1:ARF:GDP ⟶ ADP + RAB1:GTP:GBF1:USO1:ARF:GTP
- N-glycan trimming and elongation in the cis-Golgi:
(GlcNAc)2 (Man)9 ⟶ (GlcNAc)2 (Man)5 (Asn)1 + Man
- N-glycan antennae elongation in the medial/trans-Golgi:
(GlcNAc)3 (Man)5 (Asn)1 ⟶ (GlcNAc)3 (Man)3 (Asn)1 + Man
- Reactions specific to the complex N-glycan synthesis pathway:
(GlcNAc)3 (Man)5 (Asn)1 ⟶ (GlcNAc)3 (Man)3 (Asn)1 + Man
- Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- O-linked glycosylation:
Core 2 mucins + PAPS ⟶ Core 2S mucins + PAP
- O-glycosylation of TSR domain-containing proteins:
O-fuc-proteins + UDP-Glc ⟶ UDP + glc-fuc-proteins
- Metabolism of lipids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Sphingolipid metabolism:
H2O + dehydroepiandrosterone sulfate ⟶ DHEA + SO4(2-)
- Glycosphingolipid metabolism:
H2O + dehydroepiandrosterone sulfate ⟶ DHEA + SO4(2-)
- Extracellular matrix organization:
2OG + Oxygen + Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides ⟶ Prolyl 3-hydroxylases:Fe2+:3,4-Hyp collagen propeptides + SUCCA + carbon dioxide
- Collagen formation:
2OG + Oxygen + Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides ⟶ Prolyl 3-hydroxylases:Fe2+:3,4-Hyp collagen propeptides + SUCCA + carbon dioxide
- Collagen biosynthesis and modifying enzymes:
2OG + Oxygen + Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides ⟶ Prolyl 3-hydroxylases:Fe2+:3,4-Hyp collagen propeptides + SUCCA + carbon dioxide
- Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- O-linked glycosylation:
T antigens + UDP-GlcNAc ⟶ Core 2 mucins + UDP
- O-glycosylation of TSR domain-containing proteins:
UDP-Glc ⟶ UDP
- Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Sphingolipid metabolism:
3-ketosphinganine + H+ + TPNH ⟶ SPA + TPN
- Glycosphingolipid metabolism:
GM1 ganglioside + H2O ⟶ GM2 ganglioside + Gal
- Extracellular matrix organization:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia
- Collagen formation:
2OG + Lysyl hydroxylases:Lysyl hydroxylase procollagen substrates + Oxygen ⟶ Lysyl hydroxylases:Lysyl hydroxylated collagen propeptides + SUCCA + carbon dioxide
- Collagen biosynthesis and modifying enzymes:
2OG + Lysyl hydroxylases:Lysyl hydroxylase procollagen substrates + Oxygen ⟶ Lysyl hydroxylases:Lysyl hydroxylated collagen propeptides + SUCCA + carbon dioxide
- Extracellular matrix organization:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia
- Collagen formation:
2OG + Lysyl hydroxylases:Lysyl hydroxylase procollagen substrates + Oxygen ⟶ Lysyl hydroxylases:Lysyl hydroxylated collagen propeptides + SUCCA + carbon dioxide
- Collagen biosynthesis and modifying enzymes:
2OG + Lysyl hydroxylases:Lysyl hydroxylase procollagen substrates + Oxygen ⟶ Lysyl hydroxylases:Lysyl hydroxylated collagen propeptides + SUCCA + carbon dioxide
- Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- O-linked glycosylation:
PAPS ⟶ PAP
- O-glycosylation of TSR domain-containing proteins:
O-fuc-proteins + UDP-Glc ⟶ UDP + glc-fuc-proteins
- Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Sphingolipid metabolism:
H2O + dehydroepiandrosterone sulfate ⟶ DHEA + SO4(2-)
- Glycosphingolipid metabolism:
H2O + dehydroepiandrosterone sulfate ⟶ DHEA + SO4(2-)
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Sphingolipid metabolism:
H2O + dehydroepiandrosterone sulfate ⟶ DHEA + SO4(2-)
- Glycosphingolipid metabolism:
H2O + dehydroepiandrosterone sulfate ⟶ DHEA + SO4(2-)
- Extracellular matrix organization:
Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides
- Collagen formation:
Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides
- Collagen biosynthesis and modifying enzymes:
Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides
- Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- O-linked glycosylation:
PAPS ⟶ PAP
- O-glycosylation of TSR domain-containing proteins:
UDP-Glc ⟶ UDP
- Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH + Q9GU68
- Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH + Q9GU68
- O-linked glycosylation:
PAPS ⟶ PAP
- O-glycosylation of TSR domain-containing proteins:
O-fuc-proteins + UDP-Glc ⟶ UDP + glc-fuc-proteins
- Extracellular matrix organization:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia
- Collagen formation:
2OG + Lysyl hydroxylases:Lysyl hydroxylase procollagen substrates + Oxygen ⟶ Lysyl hydroxylases:Lysyl hydroxylated collagen propeptides + SUCCA + carbon dioxide
- Collagen biosynthesis and modifying enzymes:
2OG + Lysyl hydroxylases:Lysyl hydroxylase procollagen substrates + Oxygen ⟶ Lysyl hydroxylases:Lysyl hydroxylated collagen propeptides + SUCCA + carbon dioxide
- Extracellular matrix organization:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia
- Collagen formation:
H2O + Oxygen ⟶ H2O2 + ammonia
- Collagen biosynthesis and modifying enzymes:
2OG + Lysyl hydroxylases:Lysyl hydroxylase procollagen substrates + Oxygen ⟶ Lysyl hydroxylases:Lysyl hydroxylated collagen propeptides + SUCCA + carbon dioxide
- Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Sphingolipid metabolism:
H2O + dehydroepiandrosterone sulfate ⟶ DHEA + SO4(2-)
- Glycosphingolipid metabolism:
H2O + dehydroepiandrosterone sulfate ⟶ DHEA + SO4(2-)
- Metabolism of proteins:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Post-translational protein modification:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- O-linked glycosylation:
T antigens + UDP-GlcNAc ⟶ Core 2 mucins + UDP
- O-glycosylation of TSR domain-containing proteins:
O-fuc-proteins + UDP-Glc ⟶ UDP + glc-fuc-proteins
- Extracellular matrix organization:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides
- Collagen formation:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides
- Collagen biosynthesis and modifying enzymes:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides
- Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Sphingolipid metabolism:
H2O + dehydroepiandrosterone sulfate ⟶ DHEA + SO4(2-)
- Glycosphingolipid metabolism:
H2O + dehydroepiandrosterone sulfate ⟶ DHEA + SO4(2-)
- Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- Signaling by NOTCH:
Glc,Fuc-Pre-NOTCH + UDP-GlcNAc ⟶ Glc,GlcNAc-Fuc-Pre-NOTCH + UDP
- Pre-NOTCH Expression and Processing:
Glc,Fuc-Pre-NOTCH + UDP-GlcNAc ⟶ Glc,GlcNAc-Fuc-Pre-NOTCH + UDP
- Pre-NOTCH Processing in the Endoplasmic Reticulum:
Fuc-Pre-NOTCH + UDP-Glc ⟶ Glc,Fuc-Pre-NOTCH + UDP
- Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- O-linked glycosylation:
Core 2 mucins + PAPS ⟶ Core 2S mucins + PAP
- O-glycosylation of TSR domain-containing proteins:
O-fuc-proteins + UDP-Glc ⟶ UDP + glc-fuc-proteins
- Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Sphingolipid metabolism:
H2O + dehydroepiandrosterone sulfate ⟶ DHEA + SO4(2-)
- Glycosphingolipid metabolism:
H2O + dehydroepiandrosterone sulfate ⟶ DHEA + SO4(2-)
- Extracellular matrix organization:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides
- Collagen formation:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides
- Collagen biosynthesis and modifying enzymes:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides
- Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- O-linked glycosylation:
Core 2 mucins + PAPS ⟶ Core 2S mucins + PAP
- O-glycosylation of TSR domain-containing proteins:
O-fuc-proteins + UDP-Glc ⟶ UDP + glc-fuc-proteins
- Transport to the Golgi and subsequent modification:
ATP + RAB1:GTP:GBF1:USO1:ARF:GDP ⟶ ADP + RAB1:GTP:GBF1:USO1:ARF:GTP
- N-glycan trimming and elongation in the cis-Golgi:
(GlcNAc)2 (Man)9 ⟶ (GlcNAc)2 (Man)5 (Asn)1 + Man
- N-glycan antennae elongation in the medial/trans-Golgi:
(GlcNAc)3 (Man)5 (Asn)1 ⟶ (GlcNAc)3 (Man)3 (Asn)1 + Man
- Reactions specific to the complex N-glycan synthesis pathway:
(GlcNAc)3 (Man)5 (Asn)1 ⟶ (GlcNAc)3 (Man)3 (Asn)1 + Man
- Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Sphingolipid metabolism:
H2O + dehydroepiandrosterone sulfate ⟶ DHEA + SO4(2-)
- Glycosphingolipid metabolism:
H2O + dehydroepiandrosterone sulfate ⟶ DHEA + SO4(2-)
- Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- O-linked glycosylation:
PAPS ⟶ PAP
- O-glycosylation of TSR domain-containing proteins:
O-fuc-proteins + UDP-Glc ⟶ UDP + glc-fuc-proteins
- Extracellular matrix organization:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides
- Collagen formation:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides
- Collagen biosynthesis and modifying enzymes:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides
- Metabolism of lipids:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi
- Sphingolipid metabolism:
H2O + dehydroepiandrosterone sulfate ⟶ DHEA + SO4(2-)
- Glycosphingolipid metabolism:
H2O + dehydroepiandrosterone sulfate ⟶ DHEA + SO4(2-)
- Extracellular matrix organization:
2OG + Oxygen + Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides ⟶ Prolyl 3-hydroxylases:Fe2+:3,4-Hyp collagen propeptides + SUCCA + carbon dioxide
- Collagen formation:
2OG + Oxygen + Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides ⟶ Prolyl 3-hydroxylases:Fe2+:3,4-Hyp collagen propeptides + SUCCA + carbon dioxide
- Collagen biosynthesis and modifying enzymes:
2OG + Oxygen + Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides ⟶ Prolyl 3-hydroxylases:Fe2+:3,4-Hyp collagen propeptides + SUCCA + carbon dioxide
- Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- O-linked glycosylation:
Core 2 mucins + PAPS ⟶ Core 2S mucins + PAP
- O-glycosylation of TSR domain-containing proteins:
O-fuc-proteins + UDP-Glc ⟶ UDP + glc-fuc-proteins
- Post-translational modification: synthesis of GPI-anchored proteins:
GlcNAc-PI + H2O ⟶ CH3COO- + GlcN-PI
- Synthesis of glycosylphosphatidylinositol (GPI):
GlcNAc-PI + H2O ⟶ CH3COO- + GlcN-PI
- Sialic acid metabolism:
ATP + ManNAc ⟶ ADP + ManNAc-6-P
- O-glycosylation of TSR domain-containing proteins:
UDP-Glc ⟶ UDP
- Glycogen metabolism:
ATP + PGYL dimer b form ⟶ ADP + PGYL dimer a form
- Glycogen synthesis:
G1P + UTP ⟶ PPi + UDP-Glc
- Keratan sulfate/keratin metabolism:
Keratan(4)-PG + PAPS ⟶ KSPG(1) + PAP
- Keratan sulfate biosynthesis:
Keratan(4)-PG + PAPS ⟶ KSPG(1) + PAP
- Heparan sulfate/heparin (HS-GAG) metabolism:
H2O ⟶ CH3COO-
- A tetrasaccharide linker sequence is required for GAG synthesis:
UDP-Xyl ⟶ UDP
- HS-GAG biosynthesis:
H2O ⟶ CH3COO-
- Extracellular matrix organization:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia
- Collagen formation:
2OG + Lysyl hydroxylases:Lysyl hydroxylase procollagen substrates + Oxygen ⟶ Lysyl hydroxylases:Lysyl hydroxylated collagen propeptides + SUCCA + carbon dioxide
- Collagen biosynthesis and modifying enzymes:
2OG + Lysyl hydroxylases:Lysyl hydroxylase procollagen substrates + Oxygen ⟶ Lysyl hydroxylases:Lysyl hydroxylated collagen propeptides + SUCCA + carbon dioxide
- Extracellular matrix organization:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides
- Collagen formation:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides
- Collagen biosynthesis and modifying enzymes:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides
- Metabolism of proteins:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a
- Post-translational protein modification:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a
- O-linked glycosylation:
PAPS ⟶ PAP
- O-glycosylation of TSR domain-containing proteins:
O-fuc-proteins + UDP-Glc ⟶ UDP + glc-fuc-proteins
- Collagen formation:
2OG + Lysyl hydroxylases:Lysyl hydroxylase procollagen substrates + Oxygen ⟶ Lysyl hydroxylases:Lysyl hydroxylated collagen propeptides + SUCCA + carbon dioxide
- Collagen biosynthesis and modifying enzymes:
2OG + Lysyl hydroxylases:Lysyl hydroxylase procollagen substrates + Oxygen ⟶ Lysyl hydroxylases:Lysyl hydroxylated collagen propeptides + SUCCA + carbon dioxide
- Maturation of spike protein:
H2O + N-glycan Spike ⟶ beta-D-glucose + trimmed unfolded N-glycan Spike
- Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic
- Aspirin ADME:
ASA- (GI cell) + H2O ⟶ H+ + ST (GI cell) + acetate
- Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic
- Aspirin ADME:
ASA- (GI cell) + H2O ⟶ H+ + ST (GI cell) + acetate
- Drug ADME:
AMP + abacavir ⟶ Ade-Rib + xenobiotic
- Aspirin ADME:
ASA + H2O ⟶ ASA- + H+ + H2O
- Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic
- Aspirin ADME:
ASA- (GI cell) + H2O ⟶ H+ + ST (GI cell) + acetate
- Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic
- Aspirin ADME:
ASA- (GI cell) + H2O ⟶ H+ + ST (GI cell) + acetate
- Glycosphingolipid biosynthesis:
CERA + UDP-Gal ⟶ GalCer + H+ + UDP
- Glycosphingolipid biosynthesis:
CERA + UDP-Gal ⟶ GalCer + H+ + UDP
- Glycosphingolipid biosynthesis:
CERA + UDP-Gal ⟶ GalCer + H+ + UDP
- Glycosphingolipid biosynthesis:
CERA + UDP-Gal ⟶ GalCer + H+ + UDP
- Glycosphingolipid biosynthesis:
CERA + UDP-Gal ⟶ GalCer + H+ + UDP
- Glycosphingolipid biosynthesis:
CERA + UDP-Gal ⟶ GalCer + H+ + UDP
- Glycosphingolipid biosynthesis:
CERA + UDP-Gal ⟶ GalCer + H+ + UDP
- Glycosphingolipid biosynthesis:
CERA + UDP-Gal ⟶ GalCer + H+ + UDP
- Glycosphingolipid biosynthesis:
CERA + UDP-Gal ⟶ GalCer + H+ + UDP
BioCyc(31)
- lipophosphoglycan (LPG) biosynthesis:
H2O + a 6-(N-acetyl-D-glucosaminyl)-1-phosphatidyl-1D-myo-inositol ⟶ 6-(α-D-glucosaminyl)-1-phosphatidyl-1D-myo-inositol + H+ + acetate
- glycoinositolphospholipid (GIPL) biosynthesis:
H2O + a 6-(N-acetyl-D-glucosaminyl)-1-phosphatidyl-1D-myo-inositol ⟶ 6-(α-D-glucosaminyl)-1-phosphatidyl-1D-myo-inositol + H+ + acetate
- pyrimidine nucleotide metabolism (phosphotransfer and nucleotide modification):
ATP + H2O + UTP + gln ⟶ ADP + CTP + H+ + glt + phosphate
- pyrimidine ribonucleotides interconversion:
ATP + H2O + UTP + gln ⟶ ADP + CTP + H+ + glt + phosphate
- pyrimidine ribonucleotides de novo biosynthesis:
H+ + orotidine-5'-phosphate ⟶ CO2 + UMP
- purine and pyrimidine metabolism:
adenosine + phosphate ⟶ α-D-ribose-1-phosphate + adenine
- superpathway of histidine, purine, and pyrimidine biosynthesis:
glt + imidazole acetol-phosphate ⟶ 2-oxoglutarate + L-histidinol-phosphate
- pyrimidine ribonucleotides de novo biosynthesis:
H+ + orotidine-5'-phosphate ⟶ CO2 + UMP
- pyrimidine ribonucleotides interconversion:
ATP + H2O + UTP + gln ⟶ ADP + CTP + H+ + glt + phosphate
- superpathway of histidine, purine and pyrimidine biosynthesis:
ATP + D-ribose 5-phosphate ⟶ 5-phosphoribosyl 1-pyrophosphate + AMP
- pyrimidine ribonucleotides de novo biosynthesis:
O2 + dihydroorotate ⟶ H2O2 + orotate
- dolichyl-diphosphooligosaccharide biosynthesis:
UDP-α-N-acetyl-D-glucosamine + a dolichyl phosphate ⟶ UMP + an N-acetylglucosaminyl-diphosphodolichol
- dolichyl-diphosphooligosaccharide biosynthesis:
UDP-α-N-acetyl-D-glucosamine + a dolichyl phosphate ⟶ UMP + an N-acetylglucosaminyl-diphosphodolichol
- trehalose biosynthesis:
β-D-glucose-6-phosphate + UDP-D-glucose ⟶ UDP + trehalose 6-phosphate
- sucrose biosynthesis:
β-D-fructofuranose + UDP-D-glucose ⟶ UDP + sucrose
- sucrose degradation III:
β-D-fructofuranose + UDP-D-glucose ⟶ UDP + sucrose
- sucrose degradation to ethanol and lactate (anaerobic):
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- sucrose degradation III:
β-D-fructofuranose + UDP-D-glucose ⟶ UDP + sucrose
- galactose degradation III:
α-D-galactose + ATP ⟶ α-D-galactose 1-phosphate + ADP + H+
- glycophosphatidylinositol (GPI) anchor biosynthesis:
H2O + a 6-(N-acetyl-D-glucosaminyl)-1-phosphatidyl-1D-myo-inositol ⟶ 6-(α-D-glucosaminyl)-1-phosphatidyl-1D-myo-inositol + H+ + acetate
- pyrimidine deoxyribonucleotides de novo biosynthesis I:
H2O + dCTP ⟶ ammonia + dUTP
- peptidoglycan and lipid A precursor biosynthesis:
ATP + UDP-N-acetylmuramate + ala ⟶ ADP + H+ + UDP-N-acetylmuramyl-L-Ala + phosphate
- peptidoglycan biosynthesis I (meso-diaminopimelate containing):
ATP + UDP-N-acetylmuramate + ala ⟶ ADP + H+ + UDP-N-acetylmuramyl-L-Ala + phosphate
- pyrimidine deoxyribonucleotides de novo biosynthesis I:
H2O + dCTP ⟶ ammonia + dUTP
- tetrahydrofolate biosynthesis I:
6-hydroxymethyl-7,8-dihydropterin + ATP ⟶ 6-hydroxymethyl-dihydropterin diphosphate + AMP + H+
- mycothiol biosynthesis:
1-(2-acetamido-2-deoxy-α-D-glucopyranosyl)-1D-myo-inositol + H2O ⟶ 1-(2-amino-2-deoxy-α-D-glucopyranoside)-1D-myo-inositol + acetate
- glycogen biosynthesis:
UDP-D-glucose + a 1,4-α-D-glucan ⟶ UDP + a 1,4-α-D-glucan
- sucrose degradation:
α-D-glucose + ATP ⟶ α-D-glucose-6-phosphate + ADP
- chitin biosynthesis:
UDP-N-acetyl-D-glucosamine ⟶ UDP + chitin
- pyrimidine deoxyribonucleotides de novo biosynthesis:
H2O + dCTP ⟶ ammonia + dUTP
- sphingolipid metabolism:
L-serine + palmitoyl CoA ⟶ 3-dehydrosphinganine + CO2 + coenzyme A
WikiPathways(3)
- Proteoglycan biosynthesis:
Phosphoadenosine phosphate ⟶ ADENOSINE MONOPHOSPHATE
- Valproic acid pathway:
3-Hydroxyvalproic acid CoA ⟶ Propionyl-CoA
- Pyrimidine metabolism:
Orotate ⟶ Orotidine 5'-phosphate
Plant Reactome(1119)
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Carbohydrate metabolism:
ATP + beta-D-glucose ⟶ ADP + H+ + beta-D-glucose-6-phosphate
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Carbohydrate metabolism:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Carbohydrate metabolism:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Carbohydrate metabolism:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Carbohydrate metabolism:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Carbohydrate metabolism:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Carbohydrate metabolism:
ATP + beta-D-glucose ⟶ ADP + H+ + beta-D-glucose-6-phosphate
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Carbohydrate metabolism:
ATP + Glycerol ⟶ ADP + G3P
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Trehalose biosynthesis:
G6P + UDP-Glc ⟶ H+ + UDP + alpha,alpha-trehalose 6-phosphate
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins conjugates biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-7-N-glucoside
- Cytokinins 9-N-glucoside biosynthesis:
UDP-Glc + kinetin ⟶ UDP + kinetin-9-N-glucoside
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
ATP + lipid A disaccharide ⟶ ADP + lipid IVA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Lipid-A-precursor biosynthesis:
UDP-2,3-bis(3-hydroxymyristoyl)glucosamine + lipid X ⟶ UDP + lipid A disaccharide
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Galactose degradation II:
Fru + UDP-Glc ⟶ Suc + UDP
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Cytokinins-O-glucoside biosynthesis:
UDP-Glc + trans-zeatin ⟶ UDP + trans-zeatin-O-glucoside
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Sucrose biosynthesis:
Fru(6)P + UDP-Glc ⟶ UDP + sucrose-6-phosphate
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
- Cellulose biosynthesis:
(1,4-beta-D-glucan) + UDP-Glc ⟶ (1,4-beta-D-glucan) + UDP
- Xylan biosynthesis:
(1->4)-beta-D-xylan + UDP-Xyl ⟶ (1->4)-beta-D-xylan + UDP
- Xyloglucan biosynthesis:
(1->4)-beta-D-glucan + UDP-Xyl ⟶ GXGG xyloglucan + UDP
- Xylogalacturonan biosynthesis:
UDP-Xyl + homogalacturonan ⟶ UDP + xylogalacturonan
INOH(6)
- Galactose metabolism ( Galactose metabolism ):
D-Glucose + UDP-D-galactose ⟶ Lactose + UDP
- Pyrimidine Nucleotides and Nucleosides metabolism ( Pyrimidine Nucleotides and Nucleosides metabolism ):
Deoxy-cytidine + H2O ⟶ Deoxy-uridine + NH3
- ATP + UMP = ADP + UDP ( Pyrimidine Nucleotides and Nucleosides metabolism ):
ATP + UMP ⟶ ADP + UDP
- Aminosugars metabolism ( Aminosugars metabolism ):
D-Fructose 6-phosphate + NH3 ⟶ D-Glucosamine 6-phosphate + H2O
- UTP + AMP = UDP + ADP ( Pyrimidine Nucleotides and Nucleosides metabolism ):
ADP + UDP ⟶ AMP + UTP
- ATP + UDP = ADP + UTP ( Pyrimidine Nucleotides and Nucleosides metabolism ):
ADP + UTP ⟶ ATP + UDP
PlantCyc(0)
COVID-19 Disease Map(2)
- @COVID-19 Disease
Map["name"]:
Adenosine + Pi ⟶ Adenine + _alpha_-D-Ribose 1-phosphate
- @COVID-19 Disease
Map["name"]:
cytidine ⟶ uridine
PathBank(189)
- Starch and Sucrose Metabolism:
D-Glucose + [PTS enzyme I]-N -phospho-L-histidine ⟶ -D-glucose 1-phosphate + [PTS enzyme I]-L-histidine
- Trehalose Biosynthesis I:
Glucose 6-phosphate + Uridine diphosphate glucose ⟶ , -Trehalose 6-phosphate + Hydrogen Ion + Uridine 5'-diphosphate
- Starch and Sucrose Metabolism:
Adenosine triphosphate + D-Glucose ⟶ Adenosine diphosphate + Glucose 6-phosphate
- Starch and Sucrose Metabolism:
-D-Glucose + Unknown ⟶ -D-Glucose 6-phosphate + Unknown
- Trehalose Biosynthesis I:
Glucose 6-phosphate + Uridine diphosphate glucose ⟶ , -Trehalose 6-phosphate + Hydrogen Ion + Uridine 5'-diphosphate
- Sorafenib Metabolism Pathway:
Oxygen + Sorafenib + Water ⟶ Hydrogen peroxide + Sorafenib N-oxide
- Secondary Metabolites: Enterobacterial Common Antigen Biosynthesis:
L-Glutamic acid + dTDP-4-dehydro-6-deoxy-D-glucose ⟶ Oxoglutaric acid + dTDP-thomosamine
- Secondary Metabolites: Enterobacterial Common Antigen Biosynthesis 2:
L-Glutamic acid + dTDP-4-dehydro-6-deoxy-D-glucose ⟶ Oxoglutaric acid + dTDP-thomosamine
- Secondary Metabolites: Enterobacterial Common Antigen Biosynthesis 3:
L-Glutamic acid + dTDP-4-dehydro-6-deoxy-D-glucose ⟶ Oxoglutaric acid + dTDP-D-Fucosamine
- Tamoxifen Action Pathway:
4-Hydroxytamoxifen + Phosphoadenosine phosphosulfate ⟶ 4-Hydroxytamoxifen sulfate + Adenosine 3',5'-diphosphate
- Tamoxifen Metabolism Pathway:
4-Hydroxytamoxifen + Phosphoadenosine phosphosulfate ⟶ 4-Hydroxytamoxifen sulfate + Adenosine 3',5'-diphosphate
- Nevirapine Metabolism Pathway:
12-Hydroxynevirapine + Oxygen + Water ⟶ 4-Carboxynevirapine + Hydrogen peroxide
- Porphyrin Metabolism:
AH2 + Heme + Oxygen ⟶ A + Biliverdin + Carbon monoxide + Fe2+ + Water
- Acute Intermittent Porphyria:
AH2 + Heme + Oxygen ⟶ A + Biliverdin + Carbon monoxide + Fe2+ + Water
- Porphyria Variegata (PV):
AH2 + Heme + Oxygen ⟶ A + Biliverdin + Carbon monoxide + Fe2+ + Water
- Congenital Erythropoietic Porphyria (CEP) or Gunther Disease:
AH2 + Heme + Oxygen ⟶ A + Biliverdin + Carbon monoxide + Fe2+ + Water
- Hereditary Coproporphyria (HCP):
AH2 + Heme + Oxygen ⟶ A + Biliverdin + Carbon monoxide + Fe2+ + Water
- Porphyrin Metabolism:
AH2 + Heme + Oxygen ⟶ A + Biliverdin + Carbon monoxide + Fe2+ + Water
- Porphyrin Metabolism:
AH2 + Heme + Oxygen ⟶ A + Biliverdin + Carbon monoxide + Fe2+ + Water
- Acute Intermittent Porphyria:
AH2 + Heme + Oxygen ⟶ A + Biliverdin + Carbon monoxide + Fe2+ + Water
- Congenital Erythropoietic Porphyria (CEP) or Gunther Disease:
AH2 + Heme + Oxygen ⟶ A + Biliverdin + Carbon monoxide + Fe2+ + Water
- Hereditary Coproporphyria (HCP):
AH2 + Heme + Oxygen ⟶ A + Biliverdin + Carbon monoxide + Fe2+ + Water
- Porphyria Variegata (PV):
AH2 + Heme + Oxygen ⟶ A + Biliverdin + Carbon monoxide + Fe2+ + Water
- Porphyrin Metabolism:
AH2 + Heme + Oxygen ⟶ A + Biliverdin + Carbon monoxide + Fe2+ + Water
- Porphyrin Metabolism:
AH2 + Heme + Oxygen ⟶ A + Biliverdin + Carbon monoxide + Fe2+ + Water
- Porphyrin Metabolism:
AH2 + Heme + Oxygen ⟶ A + Biliverdin + Carbon monoxide + Fe2+ + Water
- Acute Intermittent Porphyria:
AH2 + Heme + Oxygen ⟶ A + Biliverdin + Carbon monoxide + Fe2+ + Water
- Congenital Erythropoietic Porphyria (CEP) or Gunther Disease:
AH2 + Heme + Oxygen ⟶ A + Biliverdin + Carbon monoxide + Fe2+ + Water
- Hereditary Coproporphyria (HCP):
AH2 + Heme + Oxygen ⟶ A + Biliverdin + Carbon monoxide + Fe2+ + Water
- Porphyria Variegata (PV):
AH2 + Heme + Oxygen ⟶ A + Biliverdin + Carbon monoxide + Fe2+ + Water
- Pyrimidine Metabolism:
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine
- Lactose Synthesis:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate
- beta-Ureidopropionase Deficiency:
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine
- UMP Synthase Deficiency (Orotic Aciduria):
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine
- Dihydropyrimidinase Deficiency:
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine
- MNGIE (Mitochondrial Neurogastrointestinal Encephalopathy):
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine
- Congenital Disorder of Glycosylation CDG-IId:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate
- GLUT-1 Deficiency Syndrome:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate
- Pyrimidine Metabolism:
Hydrogen Ion + N-carbamoyl-L-aspartate ⟶ 4,5-Dihydroorotic acid + Water
- Pyrimidine Metabolism:
Hydrogen Ion + N-carbamoyl-L-aspartate ⟶ 4,5-Dihydroorotic acid + Water
- Lactose Synthesis:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate
- Pyrimidine Metabolism:
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine
- beta-Ureidopropionase Deficiency:
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine
- Dihydropyrimidinase Deficiency:
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine
- UMP Synthase Deficiency (Orotic Aciduria):
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine
- MNGIE (Mitochondrial Neurogastrointestinal Encephalopathy):
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine
- Congenital Disorder of Glycosylation CDG-IId:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate
- GLUT-1 Deficiency Syndrome:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate
- Lactose Synthesis:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate
- Pyrimidine Metabolism:
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine
- Lactose Synthesis:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate
- Pyrimidine Metabolism:
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine
- Lactose Synthesis:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate
- Pyrimidine Metabolism:
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine
- Lactose Synthesis:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate
- Pyrimidine Metabolism:
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine
- beta-Ureidopropionase Deficiency:
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine
- Dihydropyrimidinase Deficiency:
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine
- UMP Synthase Deficiency (Orotic Aciduria):
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine
- MNGIE (Mitochondrial Neurogastrointestinal Encephalopathy):
Deoxycytidine + Water ⟶ Ammonia + Deoxyuridine
- Congenital Disorder of Glycosylation CDG-IId:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate
- GLUT-1 Deficiency Syndrome:
Glucose 1-phosphate + Water ⟶ D-Glucose + Phosphate
- Pyrimidine Metabolism:
Hydrogen Ion + N-carbamoyl-L-aspartate ⟶ 4,5-Dihydroorotic acid + Water
- Anthocyanidin Sambubioside Biosynthesis:
Delphinidin 3-glucoside + UDP-D-Xylose ⟶ Delphinidin 3-sambubioside + Hydrogen Ion + Uridine 5'-diphosphate
- Estrone Metabolism:
2-Hydroxyestrone + S-Adenosylmethionine ⟶ 2-Methoxyestrone + S-Adenosylhomocysteine
- Estrone Metabolism:
2-Hydroxyestrone + S-Adenosylmethionine ⟶ 2-Methoxyestrone + S-Adenosylhomocysteine
- Estrone Metabolism:
2-Hydroxyestrone + S-Adenosylmethionine ⟶ 2-Methoxyestrone + S-Adenosylhomocysteine
- Estrone Metabolism:
2-Hydroxyestrone + S-Adenosylmethionine ⟶ 2-Methoxyestrone + S-Adenosylhomocysteine
- Estrone Metabolism:
2-Hydroxyestrone + S-Adenosylmethionine ⟶ 2-Methoxyestrone + S-Adenosylhomocysteine
- Estrone Metabolism:
2-Hydroxyestrone + S-Adenosylmethionine ⟶ 2-Methoxyestrone + S-Adenosylhomocysteine
- Flavone and Flavonol Biosynthesis:
Phosphoadenosine phosphosulfate + Quercetin ⟶ Adenosine 3',5'-diphosphate + Hydrogen Ion + Quercetin 3'-sulfate
- Galactose Metabolism:
D-Galactose + D-Mannose ⟶ Epimelibiose
- Galactosemia:
D-Galactose + D-Mannose ⟶ Epimelibiose
- Galactose Metabolism:
D-Galactose + D-Mannose ⟶ Epimelibiose
- Galactosemia:
D-Galactose + D-Mannose ⟶ Epimelibiose
- Galactose Metabolism:
D-Galactose + D-Mannose ⟶ Epimelibiose
- Galactose Metabolism:
D-Galactose + D-Mannose ⟶ Epimelibiose
- Galactosemia:
D-Galactose + D-Mannose ⟶ Epimelibiose
- Nicotine Action Pathway:
Nicotine ⟶ Nornicotine
- Nicotine Metabolism Pathway:
Nicotine ⟶ Nornicotine
- Valproic Acid Metabolism Pathway:
Adenosine triphosphate + Coenzyme A + Valproic acid ⟶ Adenosine monophosphate + Pyrophosphate + Valproic acid CoA
- Sphingolipid Metabolism:
Glucosylceramide (d18:1/18:0) + Water ⟶ Ceramide (d18:1/18:0) + D-Glucose
- Gaucher Disease:
Glucosylceramide (d18:1/18:0) + Water ⟶ Ceramide (d18:1/18:0) + D-Glucose
- Globoid Cell Leukodystrophy:
Glucosylceramide (d18:1/18:0) + Water ⟶ Ceramide (d18:1/18:0) + D-Glucose
- Metachromatic Leukodystrophy (MLD):
Glucosylceramide (d18:1/18:0) + Water ⟶ Ceramide (d18:1/18:0) + D-Glucose
- Fabry Disease:
Glucosylceramide (d18:1/18:0) + Water ⟶ Ceramide (d18:1/18:0) + D-Glucose
- Krabbe Disease:
Glucosylceramide (d18:1/18:0) + Water ⟶ Ceramide (d18:1/18:0) + D-Glucose
- Phenytoin (Antiarrhythmic) Action Pathway:
Hydrogen Ion + NADPH + Oxygen + Phenytoin ⟶ NADP + Phenytoin arene-oxide + Water
- Androgen and Estrogen Metabolism:
Estradiol + NADP ⟶ Estrone + NADPH
- 17-beta Hydroxysteroid Dehydrogenase III Deficiency:
Estradiol + NADP ⟶ Estrone + NADPH
- Aromatase Deficiency:
Estradiol + NADP ⟶ Estrone + NADPH
- Androgen and Estrogen Metabolism:
Estradiol + NADP ⟶ Estrone + NADPH
- 17-beta Hydroxysteroid Dehydrogenase III Deficiency:
Estradiol + NADP ⟶ Estrone + NADPH
- Aromatase Deficiency:
Estradiol + NADP ⟶ Estrone + NADPH
- Androgen and Estrogen Metabolism:
Estradiol + NADP ⟶ Estrone + NADPH
- Androgen and Estrogen Metabolism:
Estradiol + NADP ⟶ Estrone + NADPH
- Androgen and Estrogen Metabolism:
Estradiol + NADP ⟶ Estrone + NADPH
- Androgen and Estrogen Metabolism:
Estradiol + NADP ⟶ Estrone + NADPH
- 17-beta Hydroxysteroid Dehydrogenase III Deficiency:
Estradiol + NADP ⟶ Estrone + NADPH
- Aromatase Deficiency:
Estradiol + NADP ⟶ Estrone + NADPH
- Abscisic Acid Glucose Ester Metabolism:
Water + abscisic acid glucose ester ⟶ (S)-Abscisic acid + D-glucopyranose + Hydrogen Ion
- Androstenedione Metabolism:
Androstanedione + Hydrogen Ion + NADH ⟶ Androsterone + NAD
- Androstenedione Metabolism:
Androstanedione + Hydrogen Ion + NADH ⟶ Androsterone + NAD
- Androstenedione Metabolism:
Androstanedione + Hydrogen Ion + NADH ⟶ Androsterone + NAD
- Androstenedione Metabolism:
Androstanedione + Hydrogen Ion + NADH ⟶ Androsterone + NAD
- Androstenedione Metabolism:
Androstanedione + Hydrogen Ion + NADH ⟶ Androsterone + NAD
- Androstenedione Metabolism:
Androstanedione + Hydrogen Ion + NADH ⟶ Androsterone + NAD
- Morphine Action Pathway:
Morphine ⟶ Normorphine
- Morphine Metabolism Pathway:
Morphine ⟶ Normorphine
- Sphingolipid Metabolism:
Galactosylceramide (d18:1/16:0) + Phosphoadenosine phosphosulfate ⟶ 3-O-Sulfogalactosylceramide (d18:1/24:0) + Adenosine 3',5'-diphosphate
- Gaucher Disease:
Galactosylceramide (d18:1/16:0) + Phosphoadenosine phosphosulfate ⟶ 3-O-Sulfogalactosylceramide (d18:1/24:0) + Adenosine 3',5'-diphosphate
- Globoid Cell Leukodystrophy:
Galactosylceramide (d18:1/16:0) + Phosphoadenosine phosphosulfate ⟶ 3-O-Sulfogalactosylceramide (d18:1/24:0) + Adenosine 3',5'-diphosphate
- Metachromatic Leukodystrophy (MLD):
Galactosylceramide (d18:1/16:0) + Phosphoadenosine phosphosulfate ⟶ 3-O-Sulfogalactosylceramide (d18:1/24:0) + Adenosine 3',5'-diphosphate
- Fabry Disease:
Galactosylceramide (d18:1/16:0) + Phosphoadenosine phosphosulfate ⟶ 3-O-Sulfogalactosylceramide (d18:1/24:0) + Adenosine 3',5'-diphosphate
- Krabbe Disease:
Galactosylceramide (d18:1/16:0) + Phosphoadenosine phosphosulfate ⟶ 3-O-Sulfogalactosylceramide (d18:1/24:0) + Adenosine 3',5'-diphosphate
- Sphingolipid Metabolism:
Galactosylceramide (d18:1/16:0) + Phosphoadenosine phosphosulfate ⟶ 3-O-Sulfogalactosylceramide (d18:1/24:0) + Adenosine 3',5'-diphosphate
- Sphingolipid Metabolism:
Galactosylceramide (d18:1/16:0) + Phosphoadenosine phosphosulfate ⟶ 3-O-Sulfogalactosylceramide (d18:1/24:0) + Adenosine 3',5'-diphosphate
- Sphingolipid Metabolism:
Galactosylceramide (d18:1/16:0) + Phosphoadenosine phosphosulfate ⟶ 3-O-Sulfogalactosylceramide (d18:1/24:0) + Adenosine 3',5'-diphosphate
- Sphingolipid Metabolism:
Galactosylceramide (d18:1/16:0) + Phosphoadenosine phosphosulfate ⟶ 3-O-Sulfogalactosylceramide (d18:1/24:0) + Adenosine 3',5'-diphosphate
- Gaucher Disease:
Galactosylceramide (d18:1/16:0) + Phosphoadenosine phosphosulfate ⟶ 3-O-Sulfogalactosylceramide (d18:1/24:0) + Adenosine 3',5'-diphosphate
- Globoid Cell Leukodystrophy:
Galactosylceramide (d18:1/16:0) + Phosphoadenosine phosphosulfate ⟶ 3-O-Sulfogalactosylceramide (d18:1/24:0) + Adenosine 3',5'-diphosphate
- Metachromatic Leukodystrophy (MLD):
Galactosylceramide (d18:1/16:0) + Phosphoadenosine phosphosulfate ⟶ 3-O-Sulfogalactosylceramide (d18:1/24:0) + Adenosine 3',5'-diphosphate
- Fabry Disease:
Galactosylceramide (d18:1/16:0) + Phosphoadenosine phosphosulfate ⟶ 3-O-Sulfogalactosylceramide (d18:1/24:0) + Adenosine 3',5'-diphosphate
- Krabbe Disease:
Galactosylceramide (d18:1/16:0) + Phosphoadenosine phosphosulfate ⟶ 3-O-Sulfogalactosylceramide (d18:1/24:0) + Adenosine 3',5'-diphosphate
- Celecoxib Action Pathway:
Glutathione + Leukotriene A4 ⟶ Leukotriene C4
- Celecoxib Metabolism Pathway:
Celecoxib + Hydrogen Ion + NADPH + Oxygen ⟶ Hydroxycelecoxib + NADP + Water
- Codeine Action Pathway:
Codeine + NADH + Oxygen ⟶ Formaldehyde + Morphine + NAD + Water
- Codeine Metabolism Pathway:
Codeine + NADH + Oxygen ⟶ Formaldehyde + Morphine + NAD + Water
- Starch and Sucrose Metabolism:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Glycogen Synthetase Deficiency:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Glycogenosis, Type III. Cori Disease, Debrancher Glycogenosis:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Glycogenosis, Type IV. Amylopectinosis, Anderson Disease:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Glycogenosis, Type VI. Hers Disease:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Mucopolysaccharidosis VII. Sly Syndrome:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Sucrase-Isomaltase Deficiency:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Starch and Sucrose Metabolism:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Glycogen Synthetase Deficiency:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Glycogenosis, Type III. Cori Disease, Debrancher Glycogenosis:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Glycogenosis, Type IV. Amylopectinosis, Anderson Disease:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Glycogenosis, Type VI. Hers Disease:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Mucopolysaccharidosis VII. Sly Syndrome:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Sucrase-Isomaltase Deficiency:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Starch and Sucrose Metabolism:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Starch and Sucrose Metabolism:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Glycogen Synthetase Deficiency:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Glycogenosis, Type III. Cori Disease, Debrancher Glycogenosis:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Glycogenosis, Type IV. Amylopectinosis, Anderson Disease:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Glycogenosis, Type VI. Hers Disease:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Mucopolysaccharidosis VII. Sly Syndrome:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Sucrase-Isomaltase Deficiency:
Isovalerylglucuronide + Water ⟶ Alcohol + D-Glucuronic acid
- Amino Sugar Metabolism:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate
- Sialuria or French Type Sialuria:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate
- Salla Disease/Infantile Sialic Acid Storage Disease:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate
- Tay-Sachs Disease:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate
- G(M2)-Gangliosidosis: Variant B, Tay-Sachs Disease:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate
- Amino Sugar Metabolism:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate
- Sialuria or French Type Sialuria:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate
- Salla Disease/Infantile Sialic Acid Storage Disease:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate
- Tay-Sachs Disease:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate
- G(M2)-Gangliosidosis: Variant B, Tay-Sachs Disease:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate
- Amino Sugar Metabolism:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate
- Amino Sugar Metabolism:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate
- Amino Sugar Metabolism:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate
- Sialuria or French Type Sialuria:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate
- Salla Disease/Infantile Sialic Acid Storage Disease:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate
- Tay-Sachs Disease:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate
- G(M2)-Gangliosidosis: Variant B, Tay-Sachs Disease:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate
- Irinotecan Action Pathway:
Adenosine triphosphate + Irinotecan + Water ⟶ Adenosine diphosphate + Irinotecan + Phosphate
- Irinotecan Metabolism Pathway:
Adenosine triphosphate + Irinotecan + Water ⟶ Adenosine diphosphate + Irinotecan + Phosphate
- Lamivudine Metabolism Pathway:
Lamivudine + Oxygen + Water ⟶ Hydrogen peroxide + Lamivudine sulfoxide
- Mycophenolic Acid Metabolism Pathway:
Adenosine triphosphate + Mycophenolic acid + Water ⟶ Adenosine diphosphate + Mycophenolic acid + Phosphate
- cis-Zeatin-O-Glucoside Biosynthesis:
Water + cis-zeatin riboside ⟶ Cis-zeatin + D-ribofuranose
- cis-Zeatin-N-Glucoside Biosynthesis:
Water + cis-zeatin riboside ⟶ Cis-zeatin + D-ribofuranose
- Phenolic Malonylglucosides Biosynthesis:
2-Naphthol + Uridine diphosphate glucose ⟶ 2-naphthol glucoside + Hydrogen Ion + Uridine 5'-diphosphate
- Ibuprofen Action Pathway:
Glutathione + Leukotriene A4 ⟶ Leukotriene C4
- Etoposide Action Pathway:
Adenosine triphosphate + Etoposide + Water ⟶ Adenosine diphosphate + Etoposide + Phosphate
- Ibuprofen Metabolism Pathway:
3-Hydroxyibuprofen + Oxygen + Water ⟶ Carboxy-ibuprofen + Hydrogen peroxide
- Etoposide Metabolism Pathway:
Adenosine triphosphate + Etoposide + Water ⟶ Adenosine diphosphate + Etoposide + Phosphate
- Tramadol Metabolism Pathway:
NADH + Oxygen + Tramadol ⟶ Formaldehyde + N-Desmethyltramadol + NAD + Water
- Acetaminophen Metabolism Pathway:
Acetaminophen + Phosphoadenosine phosphosulfate ⟶ Adenosine 3',5'-diphosphate + Paracetamol sulfate
- Artemether Metabolism Pathway:
Artemether + NADH + Oxygen ⟶ Dihydroartemisinin (DHA) + Formaldehyde + NAD + Water
- Peptidoglycan Biosynthesis I:
Adenosine triphosphate + L-Alanine + UDP-N-acetyl- -D-muramate ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate + UDP-N-acetylmuramoyl-L-alanine
- Peptidoglycan Biosynthesis II:
Adenosine triphosphate + L-Alanine + UDP-N-acetyl- -D-muramate ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate + UDP-N-Acetylmuramyl-L-Ala
- Tryptophan Metabolism:
Phosphoadenosine phosphosulfate + indolylmethyl-desulfoglucosinolate ⟶ Adenosine 3',5'-diphosphate + Glucobrassicin + Hydrogen Ion
- Galactolipid Biosynthesis:
1,2-diacyl-sn-glycerol + UDP-galactose ⟶ 1,2-diacyl-3-O-(beta-D-galactopyranosyl)-sn-glycerol + Hydrogen Ion + Uridine 5'-diphosphate
- Ascorbate Biosynthesis:
Hydrogen Ion + NADPH + aldehydo-D-glucuronate ⟶ Gulonic acid + NADP
- Chitin Biosynthesis:
Fructose 6-phosphate + L-Glutamine ⟶ Glucosamine 6-phosphate + L-Glutamic acid
- Peptidoglycan Biosynthesis I:
Adenosine triphosphate + L-Alanine + UDP-N-acetyl- -D-muramate ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate + UDP-N-acetylmuramoyl-L-alanine
- Peptidoglycan Biosynthesis II:
Adenosine triphosphate + L-Alanine + UDP-N-acetyl- -D-muramate ⟶ Adenosine diphosphate + Hydrogen Ion + Phosphate + UDP-N-Acetylmuramyl-L-Ala
PharmGKB(0)
3 个相关的物种来源信息
在这里通过桑基图来展示出与当前的这个代谢物在我们的BioDeep知识库中具有相关联信息的其他代谢物。在这里进行关联的信息来源主要有:
- PubMed: 来源于PubMed文献库中的文献信息,我们通过自然语言数据挖掘得到的在同一篇文献中被同时提及的相关代谢物列表,这个列表按照代谢物同时出现的文献数量降序排序,取前10个代谢物作为相关研究中关联性很高的代谢物集合展示在桑基图中。
- NCBI Taxonomy: 通过文献数据挖掘,得到的代谢物物种来源信息关联。这个关联信息同样按照出现的次数降序排序,取前10个代谢物作为高关联度的代谢物集合展示在桑吉图上。
- Chemical Taxonomy: 在物质分类上处于同一个分类集合中的其他代谢物
- Chemical Reaction: 在化学反应过程中,存在为当前代谢物相关联的生化反应过程中的反应底物或者反应产物的关联代谢物信息。
点击图上的相关代谢物的名称,可以跳转到相关代谢物的信息页面。
文献列表
- Dong-Zhu Tu, Pei-Qi Liu, Guang-Hao Zhu, Hai-Rong Zeng, Yan-Yan Deng, Jian Huang, Xiao-Ting Niu, Yan-Fang Liu, Jing Hu, Xin-Miao Liang, Moshe Finel, Ping Wang, Guang-Bo Ge. Human UDP-glucuronosyltransferase 1As catalyze aristolochic acid D O-glucuronidation to form a lesser nephrotoxic glucuronide.
Journal of ethnopharmacology.
2024 Jun; 328(?):118116. doi:
10.1016/j.jep.2024.118116
. [PMID: 38548118] - Huidong Wang, Jing Song, Benjamin J Hunt, Kairan Zuo, Huiru Zhou, Angela Hayward, Bingbing Li, Yajuan Xiao, Xing Geng, Chris Bass, Shutang Zhou. UDP-glycosyltransferases act as key determinants of host plant range in generalist and specialist Spodoptera species.
Proceedings of the National Academy of Sciences of the United States of America.
2024 May; 121(19):e2402045121. doi:
10.1073/pnas.2402045121
. [PMID: 38683998] - Xiaoxuan Yuan, Ruiqiong Li, Weishen He, Wei Xu, Wen Xu, Guohong Yan, Shaohua Xu, Lixia Chen, Yaqian Feng, Hua Li. Progress in Identification of UDP-Glycosyltransferases for Ginsenoside Biosynthesis.
Journal of natural products.
2024 Apr; 87(4):1246-1267. doi:
10.1021/acs.jnatprod.3c00630
. [PMID: 38449105] - Tengfei Niu, Chaokang Huang, Rufeng Wang, Li Yang, Shujuan Zhao, Zhengtao Wang. Combinatorial metabolic engineering of Bacillus subtilis enables the efficient biosynthesis of isoquercitrin from quercetin.
Microbial cell factories.
2024 Apr; 23(1):114. doi:
10.1186/s12934-024-02390-5
. [PMID: 38641799] - Wenting Wang, Lan Wu, Yuhua Shi, Qinggang Yin, Xiaotong Wang, Mengyue Wang, Xiwen Li, Shi Qiu, Huihua Wan, Yongping Zhang, Bo Wang, Li Xiang, Ranran Gao, Yusup Matinur. Integrated Full-Length Transcriptomics and Metabolomics Reveal Glycosyltransferase Involved in the Biosynthesis of Flavonol Glycosides in Laportea bulbifera.
Journal of agricultural and food chemistry.
2024 Apr; 72(14):8269-8283. doi:
10.1021/acs.jafc.4c00488
. [PMID: 38557049] - Shan Li, Shuangshuang Luo, Xingying Zhao, Song Gao, Xiaoyu Shan, Jian Lu, Jingwen Zhou. Efficient Conversion of Stevioside to Rebaudioside M in Saccharomyces cerevisiae by a Engineering Hydrolase System and Prolonging the Growth Cycle.
Journal of agricultural and food chemistry.
2024 Apr; 72(14):8140-8148. doi:
10.1021/acs.jafc.4c01483
. [PMID: 38563232] - Xia Wang, Jin Yang, Haichao Hu, Tangyu Yuan, Yingjie Zhao, Ying Liu, Wei Li, Jiaqian Liu. Genome-Wide Analysis and Identification of UDP Glycosyltransferases Responsive to Chinese Wheat Mosaic Virus Resistance in Nicotiana benthamiana.
Viruses.
2024 03; 16(4):. doi:
10.3390/v16040489
. [PMID: 38675832] - Sunil Kumar, Neeti Singh, Vaibhavi Lahane, Vineeta Tripathi, Akhilesh Kumar Yadav, Rakesh Kumar Shukla. Methyl jasmonate inducible UGT79A18 is a novel glycosyltransferase involved in the bacoside biosynthetic pathway in Bacopa monnieri.
Physiologia plantarum.
2024 Mar; 176(2):e14260. doi:
10.1111/ppl.14260
. [PMID: 38511471] - Pilar Garcia-Jimenez, Diana Del Rosario-Santana, Rafael R Robaina. Jasmonates and Ethylene Shape Floridoside Synthesis during Carposporogenesis in the Red Seaweed Grateloupia imbricata.
Marine drugs.
2024 Feb; 22(3):. doi:
10.3390/md22030115
. [PMID: 38535456] - Mary C L Lethe, Dinh Bui, Ming Hu, Xiaoqiang Wang, Rashim Singh, Clement T Y Chan. Discovering New Substrates of a UDP-Glycosyltransferase with a High-Throughput Method.
International journal of molecular sciences.
2024 Feb; 25(5):. doi:
10.3390/ijms25052725
. [PMID: 38473971] - Mary Caroline L Lethe, Vincent Paris, Xiaoqiang Wang, Clement T Y Chan. Similarities in Structure and Function of UDP-Glycosyltransferase Homologs from Human and Plants.
International journal of molecular sciences.
2024 Feb; 25(5):. doi:
10.3390/ijms25052782
. [PMID: 38474028] - Xiaosa Chang, Xueting Fang, Yan Yao, Zhenni Xu, Chaoyan Wu, Li Lu. Identification and Characterization of Glycosyltransferases Involved in the Biosynthesis of Neodiosmin.
Journal of agricultural and food chemistry.
2024 Feb; 72(8):4348-4357. doi:
10.1021/acs.jafc.3c09308
. [PMID: 38354268] - Jia-Hao Liao, Shi Chen, Di Liu, Jing-Jing Zhang, Yi-Fei Liu. [Identification and expression of genome of uridine diphosphate glycosyltransferase (UGT) gene family from Chrysanthemum indicum].
Zhongguo Zhong yao za zhi = Zhongguo zhongyao zazhi = China journal of Chinese materia medica.
2024 Feb; 49(3):702-716. doi:
10.19540/j.cnki.cjcmm.20231115.102
. [PMID: 38621874] - Meng Yang, Daolin Du, Fang Zhu, Xiangrong Wang. Metabolomic analysis reveals the toxicity mechanisms of bisphenol A on the Microcystis aeruginosa under different phosphorus levels.
Environmental pollution (Barking, Essex : 1987).
2024 Feb; 342(?):123022. doi:
10.1016/j.envpol.2023.123022
. [PMID: 38008252] - Shuang-Yan Zhang, Yu-Qing Peng, Gui-Sheng Xiang, Wan-Ling Song, Lei Feng, Xin-Yue Jiang, Xue-Jiao Li, Si-Mei He, Sheng-Chao Yang, Yan Zhao, Guang-Hui Zhang. Functional characterization of genes related to triterpene and flavonoid biosynthesis in Cyclocarya paliurus.
Planta.
2024 Jan; 259(2):50. doi:
10.1007/s00425-023-04282-1
. [PMID: 38285114] - Zhiming Yang, Mengqing Deng, Wenxiu Wang, Tianxiang Xiao, Haoxue Peng, Zifan Huang, Kai Lu. Characterization and functional analysis of UDP-glycosyltransferases reveal their contribution to phytochemical flavone tolerance in Spodoptera litura.
International journal of biological macromolecules.
2024 Jan; 261(Pt 1):129745. doi:
10.1016/j.ijbiomac.2024.129745
. [PMID: 38286378] - Ning Xiao, Haizhen Ma, Wanxia Wang, Zengkun Sun, Panpan Li, Tao Xia. Overexpression of ZmSUS1 increased drought resistance of maize (Zea mays L.) by regulating sucrose metabolism and soluble sugar content.
Planta.
2024 Jan; 259(2):43. doi:
10.1007/s00425-024-04336-y
. [PMID: 38277077] - Xu Qiu, Xiao-Min Hu, Xi-Xiang Tang, Cai-Hua Huang, Hua-Hua Jian, Dong-Hai Lin. Metabolic adaptations of Microbacterium sediminis YLB-01 in deep-sea high-pressure environments.
Applied microbiology and biotechnology.
2024 Jan; 108(1):170. doi:
10.1007/s00253-023-12906-5
. [PMID: 38265689] - Subroto Chatterjee, Rebecca Yuan, Spriha Thapa, Resham Talwar. Central Role of β-1,4-GalT-V in Cancer Signaling, Inflammation, and Other Disease-Centric Pathways.
International journal of molecular sciences.
2023 Dec; 25(1):. doi:
10.3390/ijms25010483
. [PMID: 38203654] - Lei Ouyang, Yue Liu, Ruonan Yao, Dongli He, Liying Yan, Yuning Chen, Dongxin Huai, Zhihui Wang, Bolun Yu, Yanping Kang, Huifang Jiang, Yong Lei, Boshou Liao, Xin Wang. Genome-wide analysis of UDP-glycosyltransferase gene family and identification of a flavonoid 7-O-UGT (AhUGT75A) enhancing abiotic stress in peanut (Arachis hypogaea L.).
BMC plant biology.
2023 Dec; 23(1):626. doi:
10.1186/s12870-023-04656-3
. [PMID: 38062387] - Changli Yang, Fengyun Tian, Jie Ma, Mei Chen, Xingxing Shi, Dingli Chen, Youshudi Xie, Xingrong Zhou, Zhi Zhou, Xinlong Dai, Tao Xia, Liping Gao. Glycosylation of Secondary Metabolites: A Multifunctional UDP-Glycosyltransferase, CsUGT74Y1, Promotes the Growth of Plants.
Journal of agricultural and food chemistry.
2023 Dec; 71(48):18999-19009. doi:
10.1021/acs.jafc.3c05843
. [PMID: 37997954] - Joan Patrick, Pontus Pettersson, Lena Mäler. Lipid- and substrate-induced conformational and dynamic changes in a glycosyltransferase involved in E. coli LPS synthesis revealed by 19F and 31P NMR.
Biochimica et biophysica acta. Biomembranes.
2023 12; 1865(8):184209. doi:
10.1016/j.bbamem.2023.184209
. [PMID: 37558175] - Ricardo Hernandez Arriaza, Brendan Abiskaroon, Megha Patel, Leily Daneshian, Anna Kluza, Simon Snoeck, Maxwell B Watkins, Jesse B Hopkins, Thomas Van Leeuwen, Miodrag Grbic, Vojislava Grbic, Tomasz Borowski, Maksymilian Chruszcz. Structural and functional studies reveal the molecular basis of substrate promiscuity of a glycosyltransferase originating from a major agricultural pest.
The Journal of biological chemistry.
2023 Dec; 299(12):105421. doi:
10.1016/j.jbc.2023.105421
. [PMID: 37923139] - Xiaoyue Chen, Graham A Hudson, Charlotte Mineo, Bashar Amer, Edward E K Baidoo, Samantha A Crowe, Yuzhong Liu, Jay D Keasling, Henrik V Scheller. Deciphering triterpenoid saponin biosynthesis by leveraging transcriptome response to methyl jasmonate elicitation in Saponaria vaccaria.
Nature communications.
2023 Nov; 14(1):7101. doi:
10.1038/s41467-023-42877-0
. [PMID: 37925486] - Xi-Yu Yang, Wen Yang, Hui Zhao, Bing-Jie Wang, Yao Shi, Meng-Yu Wang, Shuang-Qing Liu, Xiao-Lan Liao, Li Shi. Functional analysis of UDP-glycosyltransferase genes conferring indoxacarb resistance in Spodoptera litura.
Pesticide biochemistry and physiology.
2023 Nov; 196(?):105589. doi:
10.1016/j.pestbp.2023.105589
. [PMID: 37945240] - Tian-Hua Du, Cheng Yin, Lian-You Gui, Jin-Jin Liang, Shao-Nan Liu, Bu-Li Fu, Chao He, Jing Yang, Xue-Gao Wei, Pei-Pan Gong, Ming-Jiao Huang, Hu Xue, Jin-Yu Hu, He Du, Yao Ji, Rong Zhang, Chao Wang, Cheng-Jia Zhang, Xin Yang, You-Jun Zhang. Over-expression of UDP-glycosyltransferase UGT353G2 confers resistance to neonicotinoids in whitefly (Bemisia tabaci).
Pesticide biochemistry and physiology.
2023 Nov; 196(?):105635. doi:
10.1016/j.pestbp.2023.105635
. [PMID: 37945266] - Nan Zhao, Gang Deng, Pei-Xin Yuan, Ya-Fen Zhang, Lu-Yi Jiang, Xiaolu Zhao, Bao-Liang Song. TMEM241 is a UDP-N-acetylglucosamine transporter required for M6P modification of NPC2 and cholesterol transport.
Journal of lipid research.
2023 Oct; ?(?):100465. doi:
10.1016/j.jlr.2023.100465
. [PMID: 37890669] - Mengdi Lu, Jing Guo, Dingxiao Dong, Meiyu Zhang, Qian Li, Yaoliang Cao, Yanlong Dong, Chao Chen, Xiaoxia Jin. UDP-glycosyltransferase gene SlUGT73C1 from Solanum lycopersicum regulates salt and drought tolerance in Arabidopsis thaliana L.
Functional & integrative genomics.
2023 Oct; 23(4):320. doi:
10.1007/s10142-023-01242-6
. [PMID: 37843675] - Hani Gharabli, Valeria Della Gala, Ditte Hededam Welner. The function of UDP-glycosyltransferases in plants and their possible use in crop protection.
Biotechnology advances.
2023 10; 67(?):108182. doi:
10.1016/j.biotechadv.2023.108182
. [PMID: 37268151] - Huiqiong Chen, Shuqing Zhang, Ruiqi Li, Guoqing Peng, Weipan Chen, Carsten Rautengarten, Minglong Liu, Liya Zhu, Yueping Xiao, Fengshun Song, Jinlong Ni, Jilei Huang, Aimin Wu, Zhenlan Liu, Chuxiong Zhuang, Joshua L Heazlewood, Yongyao Xie, Zhizhan Chu, Hai Zhou. BOTRYOID POLLEN 1 regulates ROS-triggered PCD and pollen wall development by controlling UDP-sugar homeostasis in rice.
The Plant cell.
2023 09; 35(9):3522-3543. doi:
10.1093/plcell/koad181
. [PMID: 37352123] - Xiaojing Wang, Lilin Yang, Xin Geng, Weijia Shi, Yuzhen Chen, Cunfu Lu. Integrative analysis of metabolome and transcriptome reveals the different metabolite biosynthesis profiles related to palatability in winter and spring shoot in moso bamboo.
Plant physiology and biochemistry : PPB.
2023 Sep; 202(?):107973. doi:
10.1016/j.plaphy.2023.107973
. [PMID: 37598446] - Gerit Bethke, Yadong Huang, Goetz Hensel, Shane Heinen, Chaochih Liu, Skylar R Wyant, Xin Li, Maureen B Quin, Susan McCormick, Peter L Morrell, Yanhong Dong, Jochen Kumlehn, Silvio Salvi, Franz Berthiller, Gary J Muehlbauer. UDP-glucosyltransferase HvUGT13248 Confers Type II Resistance to Fusarium graminearum in barley.
Plant physiology.
2023 Aug; ?(?):. doi:
10.1093/plphys/kiad467
. [PMID: 37610244] - Weijia Cheng, Xueting Fang, Zhifeng Guan, Yan Yao, Zhenni Xu, Yunya Bi, Kexin Ren, Jiwen Li, Fangfang Chen, Xiangsong Chen, Weihua Ma, Zhaohui Chu, Zixin Deng, Zhengyu Zhang, Li Lu. Functional characterization and structural basis of a reversible glycosyltransferase involves in plant chemical defence.
Plant biotechnology journal.
2023 Aug; ?(?):. doi:
10.1111/pbi.14157
. [PMID: 37581303] - Charles Grant, Kumar Saurabh Singh, Angela Hayward, Benjamin J Hunt, Bartlomiej J Troczka, Adam Pym, Seung-Joon Ahn, Bin Zeng, Cong-Fen Gao, Alicia Leroux, Eve Daum, Philip Süess, Dariane Souza, Jan Elias, Richard H Ffrench-Constant, John Vontas, Emmanouil Roditakis, Pablo Bielza, Christoph T Zimmer, Chris Bass. Overexpression of the UDP-glycosyltransferase UGT34A23 confers resistance to the diamide insecticide chlorantraniliprole in the tomato leafminer, Tuta absoluta.
Insect biochemistry and molecular biology.
2023 08; 159(?):103983. doi:
10.1016/j.ibmb.2023.103983
. [PMID: 37380137] - Yusen Zhou, Tian Zhang, Xiaocui Wang, Wenqiang Wu, Jingjing Xing, Zuliang Li, Xin Qiao, Chunrui Zhang, Xiaohang Wang, Guangshun Wang, Wenhui Li, Shenglong Bai, Zhi Li, Yuanzhen Suo, Jiajia Wang, Yanli Niu, Junli Zhang, Chen Lan, Zhubing Hu, Baozhu Li, Xuebin Zhang, Wei Wang, David W Galbraith, Yuhang Chen, Siyi Guo, Chun-Peng Song. A maize epimerase modulates cell wall synthesis and glycosylation during stomatal morphogenesis.
Nature communications.
2023 07; 14(1):4384. doi:
10.1038/s41467-023-40013-6
. [PMID: 37474494] - Ruihao Zhang, Baohua Zhu, Changze Sun, Yun Li, Guanpin Yang, Yan Zhao, Kehou Pan. UDP-glucose pyrophosphorylase as a target for regulating carbon flux distribution and antioxidant capacity in Phaeodactylum tricornutum.
Communications biology.
2023 07; 6(1):750. doi:
10.1038/s42003-023-05096-3
. [PMID: 37468748] - Youjun Zhang, Alisdair R Fernie. Leveraging glycoside-targeted metabolomics to gain insight into biological function.
Trends in plant science.
2023 07; 28(7):737-739. doi:
10.1016/j.tplants.2023.04.004
. [PMID: 37076401] - Min He, Si-Yuan Guo, Yan Yin, Chi Zhang, Xia-Nan Zhang. [Gene clone and functional identification of sterol glycosyltransferases from Paris polyphylla var. yunnanensis].
Zhongguo Zhong yao za zhi = Zhongguo zhongyao zazhi = China journal of Chinese materia medica.
2023 Jul; 48(14):3774-3785. doi:
10.19540/j.cnki.cjcmm.20230413.101
. [PMID: 37475069] - Qinggang Yin, Tianze Wu, Ranran Gao, Lan Wu, Yuhua Shi, Xingwen Wang, Mengyue Wang, Zhichao Xu, Yueliang Zhao, Xiaojia Su, Yanyan Su, Xiaoyan Han, Ling Yuan, Li Xiang, Shilin Chen. Multi-omics reveal key enzymes involved in the formation of phenylpropanoid glucosides in Artemisia annua.
Plant physiology and biochemistry : PPB.
2023 Jun; 201(?):107795. doi:
10.1016/j.plaphy.2023.107795
. [PMID: 37301186] - Yingxia Wang, Wenqian Huang, Weisheng Tian, Ting Mo, Yaru Yan, Xiaoxue Cui, Xiao Liu. Enzymatic biosynthesis of novel 2-(2-phenylethyl)chromone glycosides catalyzed by UDP-glycosyltransferase UGT71BD1.
Biochemical and biophysical research communications.
2023 Jun; 671(?):80-86. doi:
10.1016/j.bbrc.2023.05.128
. [PMID: 37300944] - Chao Wen, He-Chun Wu, Wen-Hong Ouyang, Jia-Xing Nie, Yi-Ping Guo, Feng Wang, Li-Li Hu, Jin-Hua Yang, Li-Juan Zheng, Jia-Lu Wang, Wei Huang, Guang-Ping Liang, Ren-Wang Jiang. Exploring the Catalytic Flexibility and Reversibility of Plant Glycosyltransferase HtUGT72AS1 for Glycodiversification of Phenolic Compounds.
Journal of agricultural and food chemistry.
2023 Jun; ?(?):. doi:
10.1021/acs.jafc.3c01459
. [PMID: 37260384] - Yushiro Fuji, Kai Uchida, Tomoyoshi Akashi, Takashi Ohtsuki, Hiroshi Matsufuji, Masami Yokota Hirai. Molecular Identification of UDP-Sugar Dependent Glycosyltransferase and Acyltransferase Involved in the Phenylethanoid Glycoside Biosynthesis Induced by Methyl Jasmonate in Sesamum indicum L.
Plant & cell physiology.
2023 May; ?(?):. doi:
10.1093/pcp/pcad053
. [PMID: 37233612] - Rotimi Fasimoye, Wentao Dong, Raja S Nirujogi, Eshaan S Rawat, Miharu Iguchi, Kwamina Nyame, Toan K Phung, Enrico Bagnoli, Alan R Prescott, Dario R Alessi, Monther Abu-Remaileh. Golgi-IP, a tool for multimodal analysis of Golgi molecular content.
Proceedings of the National Academy of Sciences of the United States of America.
2023 May; 120(20):e2219953120. doi:
10.1073/pnas.2219953120
. [PMID: 37155866] - Sufang Peng, Xiaobo Li, Weiwei Jiang, Yina Wang, Guisheng Xiang, Menghan Li, Yuanyuan Wang, Zijiang Yang, Ying Li, Xiangyu Liu, Guanghui Zhang, Chunhua Ma, Shengchao Yang. Identification of two key UDP-glycosyltransferases responsible for the ocotillol-type ginsenoside majonside-R2 biosynthesis in Panax vietnamensis var. fuscidiscus.
Planta.
2023 May; 257(6):119. doi:
10.1007/s00425-023-04143-x
. [PMID: 37178342] - Himabindu Kudapa, Arindam Ghatak, Rutwik Barmukh, Palak Chaturvedi, Aamir Khan, Sandip Kale, Lena Fragner, Annapurna Chitikineni, Wolfram Weckwerth, Rajeev K Varshney. Integrated multi-omics analysis reveals drought stress response mechanism in chickpea (Cicer arietinum L.).
The plant genome.
2023 May; ?(?):e20337. doi:
10.1002/tpg2.20337
. [PMID: 37165696] - Nan Wang, Yao Deng, Lisha Zhang, Yingchun Wan, Ting Lei, Yimin Yang, Can Wu, Hai Du, Ping Feng, Wuzhong Yin, Guanghua He. UDP-glucose epimerase 1, moonlighting as a transcriptional activator, is essential for tapetum degradation and male fertility in rice.
Molecular plant.
2023 05; 16(5):829-848. doi:
10.1016/j.molp.2023.03.008
. [PMID: 36926693] - Xiao-Na Shen, Xiao-Di Wang, Fang-Hao Wan, Zhi-Chuang Lü, Wan-Xue Liu. Gene Expression Analysis Reveals Potential Regulatory Factors Response to Temperature Stress in Bemisia tabaci Mediterranean.
Genes.
2023 04; 14(5):. doi:
10.3390/genes14051013
. [PMID: 37239372] - Yongqi He, Shan Sun, Jia Zhao, Zhibo Huang, Liling Peng, Chengwei Huang, Zhengbin Tang, Qianqian Huang, Zhoufei Wang. UDP-glucosyltransferase OsUGT75A promotes submergence tolerance during rice seed germination.
Nature communications.
2023 04; 14(1):2296. doi:
10.1038/s41467-023-38085-5
. [PMID: 37085517] - Qing Yang, Yinchao Zhang, Xiaoling Qu, Fengyan Wu, Xiuchun Li, Min Ren, Ying Tong, Xiuming Wu, Aiguo Yang, Yong Chen, Shuai Chen. Genome-wide analysis of UDP-glycosyltransferases family and identification of UGT genes involved in abiotic stress and flavonol biosynthesis in Nicotiana tabacum.
BMC plant biology.
2023 Apr; 23(1):204. doi:
10.1186/s12870-023-04208-9
. [PMID: 37076827] - Xuetao Shi, Yehui Xiong, Kai Zhang, Yinshan Zhang, Junqi Zhang, Lili Zhang, Yutao Xiao, Guo-Liang Wang, Wende Liu. The ANIP1-OsWRKY62 module regulates both basal defense and Pi9-mediated immunity against Magnaporthe oryzae in rice.
Molecular plant.
2023 04; 16(4):739-755. doi:
10.1016/j.molp.2023.03.001
. [PMID: 36872602] - Yuqian Liu, Qian Wang, Xiaonan Liu, Jian Cheng, Lei Zhang, Huanyu Chu, Ruoyu Wang, Haoran Li, Hong Chang, Nida Ahmed, Zhonghua Wang, Xiaoping Liao, Huifeng Jiang. pUGTdb: A comprehensive database of plant UDP-dependent glycosyltransferases.
Molecular plant.
2023 04; 16(4):643-646. doi:
10.1016/j.molp.2023.01.003
. [PMID: 36609142] - Neha Thakur, Flowerika, Siddhant Chaturvedi, Siddharth Tiwari. Wheat derived glucuronokinase as a potential target for regulating ascorbic acid and phytic acid content with increased root length under drought and ABA stresses in Arabidopsis thaliana.
Plant science : an international journal of experimental plant biology.
2023 Mar; 331(?):111671. doi:
10.1016/j.plantsci.2023.111671
. [PMID: 36931562] - Xu Lu, Lijin Huang, Henrik V Scheller, Jay D Keasling. Medicinal terpenoid UDP-glycosyltransferases in plants: recent advances and research strategies.
Journal of experimental botany.
2023 03; 74(5):1343-1357. doi:
10.1093/jxb/erac505
. [PMID: 36573380] - Keyan Zhang, Danqing Yao, Yue Chen, Haifan Wen, Jian Pan, Tingting Xiao, Duo Lv, Huanle He, Junsong Pan, Run Cai, Gang Wang. Mapping and identification of CsSF4, a gene encoding a UDP-N-acetyl glucosamine-peptide N-acetylglucosaminyltransferase required for fruit elongation in cucumber (Cucumis sativus L.).
TAG. Theoretical and applied genetics. Theoretische und angewandte Genetik.
2023 Mar; 136(3):54. doi:
10.1007/s00122-023-04246-9
. [PMID: 36912991] - Saravanan Konda Mani, Ramesh Thiyagarajan, Olli Yli-Harja, Meenakshisundaram Kandhavelu, Akshaya Murugesan. Structural analysis of human G-protein-coupled receptor 17 ligand binding sites.
Journal of cellular biochemistry.
2023 Feb; ?(?):. doi:
10.1002/jcb.30388
. [PMID: 36791278] - Tuo Li, Annika J E Borg, Leo Krammer, Rolf Breinbauer, Bernd Nidetzky. Reaction intensification for biocatalytic production of polyphenolic natural product di-C-β-glucosides.
Biotechnology and bioengineering.
2023 Feb; ?(?):. doi:
10.1002/bit.28354
. [PMID: 36787984] - Yong Guo, Fan Ji, Jun Qiao, Xiaofei Dong, Yuanming Wu, Xiaoyuan Wang. Overexpression of the key genes in the biosynthetic pathways of lipid A and peptidoglycan in Escherichia coli.
Biotechnology and applied biochemistry.
2023 Feb; 70(1):374-386. doi:
10.1002/bab.2364
. [PMID: 35644907] - Cecilie Cetti Hansen, Mette Sørensen, Matteo Bellucci, Wolfgang Brandt, Carl Erik Olsen, Jason Q D Goodger, Ian E Woodrow, Birger Lindberg Møller, Elizabeth H J Neilson. Recruitment of distinct UDP-glycosyltransferase families demonstrates dynamic evolution of chemical defense within Eucalyptus L'Hér.
The New phytologist.
2023 02; 237(3):999-1013. doi:
10.1111/nph.18581
. [PMID: 36305250] - Meng-Ling Chen, Shu-Xia Zhang, Peng-Yu Guo, Qing-Shi Qin, Li-Wei Meng, Guo-Rui Yuan, Jin-Jun Wang. Identification and characterization of UDP-glycosyltransferase genes and the potential role in response to insecticides exposure in Bactrocera dorsalis.
Pest management science.
2023 Feb; 79(2):666-677. doi:
10.1002/ps.7234
. [PMID: 36223172] - Zhiming Yang, Tianxiang Xiao, Kai Lu. Contribution of UDP-glycosyltransferases to chlorpyrifos resistance in Nilaparvata lugens.
Pesticide biochemistry and physiology.
2023 Feb; 190(?):105321. doi:
10.1016/j.pestbp.2022.105321
. [PMID: 36740334] - Patrick J Mason, Nam V Hoang, Frederik C Botha, Agnelo Furtado, Annelie Marquardt, Robert J Henry. Organ-specific expression of genes associated with the UDP-glucose metabolism in sugarcane (Saccharum spp. hybrids).
BMC genomics.
2023 Jan; 24(1):18. doi:
10.1186/s12864-023-09124-8
. [PMID: 36639618] - Rizky Pasthika Kirana, Kumar Gaurav, Sanu Arora, Gerlinde Wiesenberger, Maria Doppler, Sebastian Michel, Simone Zimmerl, Magdalena Matic, Chinedu E Eze, Mukesh Kumar, Ajla Topuz, Marc Lemmens, Rainer Schuhmacher, Gerhard Adam, Brande B H Wulff, Hermann Buerstmayr, Barbara Steiner. Identification of a UDP-glucosyltransferase conferring deoxynivalenol resistance in Aegilops tauschii and wheat.
Plant biotechnology journal.
2023 01; 21(1):109-121. doi:
10.1111/pbi.13928
. [PMID: 36121345] - Liangliang Zhu, Hui Lv, Ling Xiao, Yanyao Hou, Wenjuan Li, Guangbo Ge, Chunzhi Ai. Diverse effects of α-/β-estradiol on catalytic activities of human UDP-glucuronosyltransferases (UGT).
The Journal of steroid biochemistry and molecular biology.
2023 01; 225(?):106196. doi:
10.1016/j.jsbmb.2022.106196
. [PMID: 36181991] - Delphine Vincent, AnhDuyen Bui, Vilnis Ezernieks, Saleh Shahinfar, Timothy Luke, Doris Ram, Nicholas Rigas, Joe Panozzo, Simone Rochfort, Hans Daetwyler, Matthew Hayden. A community resource to mass explore the wheat grain proteome and its application to the late-maturity alpha-amylase (LMA) problem.
GigaScience.
2022 12; 12(?):. doi:
10.1093/gigascience/giad084
. [PMID: 37919977] - Huayi Pan, Liang Xiao, Kexin Tang, Haojun Xia, Yan Li, Honghua Jia, Ping Wei, Ming Yan. Screening UDP-Glycosyltransferases for Effectively Transforming Stevia Glycosides: Enzymatic Synthesis of Glucosylated Derivatives of Rubusoside.
Journal of agricultural and food chemistry.
2022 Dec; 70(48):15178-15188. doi:
10.1021/acs.jafc.2c06185
. [PMID: 36424346] - Yizhen Chen, Mingchuan Fu, Hao Li, Liguo Wang, Renzhong Liu, Zhanji Liu. Genome-wide characterization of the UDP-glycosyltransferase gene family reveals their potential roles in leaf senescence in cotton.
International journal of biological macromolecules.
2022 Dec; 222(Pt B):2648-2660. doi:
10.1016/j.ijbiomac.2022.10.047
. [PMID: 36228815] - Marc Caballé, Magda Faijes, Antoni Planas. Characterization of a Glycolipid Synthase Producing α-Galactosylceramide in Bacteroides fragilis.
International journal of molecular sciences.
2022 Nov; 23(22):. doi:
10.3390/ijms232213975
. [PMID: 36430454] - Mohammed S Almuhayawi, Soad K Al Jaouni, Samy Selim, Dalal Hussien M Alkhalifah, Romina Alina Marc, Sidra Aslam, Peter Poczai. Integrated Pangenome Analysis and Pharmacophore Modeling Revealed Potential Novel Inhibitors against Enterobacter xiangfangensis.
International journal of environmental research and public health.
2022 11; 19(22):. doi:
10.3390/ijerph192214812
. [PMID: 36429532] - Hongwei Li, Manish Tiwari, Yulou Tang, Lijuan Wang, Sen Yang, Haochi Long, Jiameng Guo, Yongchao Wang, Hao Wang, Qinghua Yang, S V Krishna Jagadish, Ruixin Shao. Metabolomic and transcriptomic analyses reveal that sucrose synthase regulates maize pollen viability under heat and drought stress.
Ecotoxicology and environmental safety.
2022 Nov; 246(?):114191. doi:
10.1016/j.ecoenv.2022.114191
. [PMID: 36265405] - Dan Zhao, Xiaomin Liu, Zhaorui Liu, HanWu, Xiujun Lu, Wei Guo. Identification and functional analysis of two potential RNAi targets for chitin degradation in Holotrichia parallela Motschulsky (Insecta Coleoptera).
Pesticide biochemistry and physiology.
2022 Nov; 188(?):105257. doi:
10.1016/j.pestbp.2022.105257
. [PMID: 36464362] - Ashraf Elsayed, Amal M Abdelsattar, Yasmin M Heikal, Mohamed A El-Esawi. Synergistic effects of Azospirillum brasilense and Bacillus cereus on plant growth, biochemical attributes and molecular genetic regulation of steviol glycosides biosynthetic genes in Stevia rebaudiana.
Plant physiology and biochemistry : PPB.
2022 Oct; 189(?):24-34. doi:
10.1016/j.plaphy.2022.08.016
. [PMID: 36041365] - Fei Guo, Xingwang Zhang, Cai You, Chengjie Zhang, Fengwei Li, Nan Li, Yuwei Xia, Mingyu Liu, Zetian Qiu, Xianliang Zheng, Li Ma, Gang Zhang, Lianzhong Luo, Fei Cao, Yingang Feng, Guang-Rong Zhao, Wei Zhang, Shengying Li, Lei Du. Diversification of phenolic glucosides by two UDP-glucosyltransferases featuring complementary regioselectivity.
Microbial cell factories.
2022 Oct; 21(1):208. doi:
10.1186/s12934-022-01935-w
. [PMID: 36217200] - Lillian F Hyde, Yang Kong, Lihong Zhao, Sriganesh Ramachandra Rao, Jieping Wang, Lisa Stone, Andrew Njaa, Gayle B Collin, Mark P Krebs, Bo Chang, Steven J Fliesler, Patsy M Nishina, Jürgen K Naggert. A Dpagt1 Missense Variant Causes Degenerative Retinopathy without Myasthenic Syndrome in Mice.
International journal of molecular sciences.
2022 Oct; 23(19):. doi:
10.3390/ijms231912005
. [PMID: 36233305] - Jie Wu, Wentao Zhu, Xiaotong Shan, Jinyue Liu, Lingling Zhao, Qiao Zhao. Glycoside-specific metabolomics combined with precursor isotopic labeling for characterizing plant glycosyltransferases.
Molecular plant.
2022 10; 15(10):1517-1532. doi:
10.1016/j.molp.2022.08.003
. [PMID: 35996753] - Ya-Bian Luo, Yan-Yao Hou, Zhen Wang, Xin-Man Hu, Wei Li, Yan Li, Yong Liu, Tong-Jiang Li, Chun-Zhi Ai. Computational prediction for the metabolism of human UDP-glucuronosyltransferase 1A1 substrates.
Computers in biology and medicine.
2022 10; 149(?):105959. doi:
10.1016/j.compbiomed.2022.105959
. [PMID: 36063691] - Wei Chen, Peng Cao, Yuansheng Liu, Ailing Yu, Dong Wang, Lei Chen, Rajamanikandan Sundarraj, Zhiguang Yuchi, Yong Gong, Hans Merzendorfer, Qing Yang. Structural basis for directional chitin biosynthesis.
Nature.
2022 10; 610(7931):402-408. doi:
10.1038/s41586-022-05244-5
. [PMID: 36131020] - Jinqian Chen, Hao Zhang, Xia Hu, Mengyuan Xu, Yanjun Su, Chunze Zhang, Yuan Yue, Xiaomin Zhang, Xinyu Wang, Wei Cui, Zhenyu Zhao, Xichuan Li. Phloretin exhibits potential food-drug interactions by inhibiting human UDP-glucuronosyltransferases in vitro.
Toxicology in vitro : an international journal published in association with BIBRA.
2022 Oct; 84(?):105447. doi:
10.1016/j.tiv.2022.105447
. [PMID: 35868516] - Ruiqin Zhong, Chanhui Lee, Dongtao Cui, Dennis R Phillips, Earle R Adams, Ho-Young Jeong, Ki-Hong Jung, Zheng-Hua Ye. Identification of xylan arabinosyl 2-O-xylosyltransferases catalyzing the addition of 2-O-xylosyl residue onto arabinosyl side chains of xylan in grass species.
The Plant journal : for cell and molecular biology.
2022 10; 112(1):193-206. doi:
10.1111/tpj.15939
. [PMID: 35959609] - Hafiz Mamoon Rehman, Uzair Muhammad Khan, Sehar Nawaz, Fozia Saleem, Nisar Ahmed, Iqrar Ahmad Rana, Rana Muhammad Atif, Nabeel Shaheen, Hyojin Seo. Genome Wide Analysis of Family-1 UDP Glycosyltransferases in Populus trichocarpa Specifies Abiotic Stress Responsive Glycosylation Mechanisms.
Genes.
2022 09; 13(9):. doi:
10.3390/genes13091640
. [PMID: 36140806] - Hongli He, M James C Crabbe, Zhumei Ren. Detoxification Gene Families at the Genome-Wide Level of Rhus Gall Aphid Schlechtendalia chinensis.
Genes.
2022 09; 13(9):. doi:
10.3390/genes13091627
. [PMID: 36140795] - Rita Del Giudice, Natalia Putkaradze, Bruna Marques Dos Santos, Cecilie Cetti Hansen, Christoph Crocoll, Mohammed Saddik Motawia, Folmer Fredslund, Tomas Laursen, Ditte Hededam Welner. Structure-guided engineering of key amino acids in UGT85B1 controlling substrate and stereo-specificity in aromatic cyanogenic glucoside biosynthesis.
The Plant journal : for cell and molecular biology.
2022 09; 111(6):1539-1549. doi:
10.1111/tpj.15904
. [PMID: 35819080] - Jian Fu, Ziyao He, Huixiao Fu, Yufen Xia, Inès N'Go, Huayong Lou, Jinglan Wu, Weidong Pan, Stéphane P Vincent. Synthesis and evaluation of inhibitors of Mycobacterium tuberculosis UGM using bioisosteric replacement.
Bioorganic & medicinal chemistry.
2022 09; 69(?):116896. doi:
10.1016/j.bmc.2022.116896
. [PMID: 35777270] - Reza Haghi, Asadollah Ahmadikhah, Arash Fazeli, Vahid Shariati. Candidate genes for anthocyanin pigmentation in rice stem revealed by GWAS and whole-genome resequencing.
The plant genome.
2022 09; 15(3):e20224. doi:
10.1002/tpg2.20224
. [PMID: 35703064] - Guo-Si Li, Fu-Cheng Zhu, Pei-Pei Wei, Fang-Li Gu, Qi-Ling Xu, Meng-Hua Ma. Development of an Escherichia coli whole cell biocatalyst for the production of hyperoside.
Biotechnology letters.
2022 Sep; 44(9):1073-1080. doi:
10.1007/s10529-022-03285-4
. [PMID: 35920962] - Amanda J Dowson, Adrian J Lloyd, Andrew C Cuming, David I Roper, Lorenzo Frigerio, Christopher G Dowson. Plant peptidoglycan precursor biosynthesis: Conservation between moss chloroplasts and Gram-negative bacteria.
Plant physiology.
2022 08; 190(1):165-179. doi:
10.1093/plphys/kiac176
. [PMID: 35471580] - Tushar K Dutta, Abhishek Mandal, Artha Kundu, Victor Phani, Chetna Mathur, Arudhimath Veeresh, Rohini Sreevathsa. RNAi-mediated knockdown of gut receptor-like genes prohibitin and α-amylase altered the susceptibility of Galleria mellonella to Cry1AcF toxin.
BMC genomics.
2022 Aug; 23(1):601. doi:
10.1186/s12864-022-08843-8
. [PMID: 35982422] - Yang Li, Fan Kong, Zheng'an Liu, Liping Peng, Qingyan Shu. PhUGT78A22, a novel glycosyltransferase in Paeonia 'He Xie', can catalyze the transfer of glucose to glucosylated anthocyanins during petal blotch formation.
BMC plant biology.
2022 Aug; 22(1):405. doi:
10.1186/s12870-022-03777-5
. [PMID: 35982415] - Yijun Tang, Meihan Wang, Liyu Cao, Zhengjun Dang, Nan Ruan, Ye Wang, Yingni Huang, Jiayi Wu, Mingfei Zhang, Zhengjin Xu, Wenfu Chen, Fengcheng Li, Quan Xu. OsUGE3-mediated cell wall polysaccharides accumulation improves biomass production, mechanical strength, and salt tolerance.
Plant, cell & environment.
2022 08; 45(8):2492-2507. doi:
10.1111/pce.14359
. [PMID: 35592911] - Qingzhu Gao, Bin Cheng, Chang Chen, Chong Lei, Xue Lin, Dan Nie, Jingjing Li, Luyi Huang, Xiaosong Li, Kai Wang, Ailong Huang, Ni Tang. Dysregulated glucuronic acid metabolism exacerbates hepatocellular carcinoma progression and metastasis through the TGFβ signalling pathway.
Clinical and translational medicine.
2022 08; 12(8):e995. doi:
10.1002/ctm2.995
. [PMID: 35979621] - Diana Dimunová, Petra Matoušková, Radka Podlipná, Iva Boušová, Lenka Skálová. The role of UDP-glycosyltransferases in xenobioticresistance.
Drug metabolism reviews.
2022 08; 54(3):282-298. doi:
10.1080/03602532.2022.2083632
. [PMID: 35635097] - Alfia Khairullina, Nikos Tsardakas Renhuldt, Gerlinde Wiesenberger, Johan Bentzer, David B Collinge, Gerhard Adam, Leif Bülow. Identification and Functional Characterisation of Two Oat UDP-Glucosyltransferases Involved in Deoxynivalenol Detoxification.
Toxins.
2022 06; 14(7):. doi:
10.3390/toxins14070446
. [PMID: 35878183] - Jaeho Choi, Chang Seok Ki. Ultrasonication, immune activity, and photocrosslinked microgel formation of pectic polysaccharide isolated from root bark of Ulmus davidiana var. japonica (Rehder) Nakai.
International journal of biological macromolecules.
2022 Jun; 211(?):535-544. doi:
10.1016/j.ijbiomac.2022.05.074
. [PMID: 35569684] - Bao Ao, Yangyang Han, Shengsheng Wang, Fan Wu, Jiyu Zhang. Genome-Wide Analysis and Profile of UDP-Glycosyltransferases Family in Alfalfa (Medicago sativa L.) under Drought Stress.
International journal of molecular sciences.
2022 Jun; 23(13):. doi:
10.3390/ijms23137243
. [PMID: 35806246] - Bhawana Israni, Katrin Luck, Samantha C W Römhild, Bettina Raguschke, Natalie Wielsch, Yvonne Hupfer, Michael Reichelt, Aleš Svatoš, Jonathan Gershenzon, Daniel Giddings Vassão. Alternative transcript splicing regulates UDP-glucosyltransferase-catalyzed detoxification of DIMBOA in the fall armyworm (Spodoptera frugiperda).
Scientific reports.
2022 06; 12(1):10343. doi:
10.1038/s41598-022-14551-w
. [PMID: 35725775] - Preeti Verma, Ritu Varshney, Shiv Pratap Singh Yadav, Bibekananda Kar, Partha Roy, Ashwani K Sharma. SAXS Analysis and Characterization of Anticancer Activity of PNP-UDP Family Protein from Putranjiva roxburghii.
The protein journal.
2022 06; 41(3):381-393. doi:
10.1007/s10930-022-10060-x
. [PMID: 35674860] - Yuandong Zheng, Hua Zhang, Mengling Liu, Guangze Li, Sheng Ma, Zhe Zhang, Hongda Lin, Yan Zhan, Zhendong Chen, Dafang Zhong, Liyan Miao, Xingxing Diao. Pharmacokinetics, Mass Balance, and Metabolism of the Novel Urate Transporter 1 Inhibitor [14C]HR011303 in Humans: Metabolism Is Mediated Predominantly by UDP-Glucuronosyltransferase.
Drug metabolism and disposition: the biological fate of chemicals.
2022 Jun; 50(6):798-808. doi:
10.1124/dmd.121.000581
. [PMID: 34862252] - Qing Xiong, Angel Tsz-Yau Wan, Xiaoyu Liu, Cathy Sin-Hang Fung, Xiaojun Xiao, Nat Malainual, Jinpao Hou, Lingyi Wang, Mingqiang Wang, Kevin Yi Yang, Yubao Cui, Elaine Lai-Han Leung, Wenyan Nong, Soo-Kyung Shin, Shannon Wing-Ngor Au, Kyoung Yong Jeong, Fook-Tim Chew, Jerome Ho-Lam Hui, Ting-Fan Leung, Anchalee Tungtrongchitr, Nanshan Zhong, Zhigang Liu, Stephen Kwok-Wing Tsui. Comparative Genomics Reveals Insights into the Divergent Evolution of Astigmatic Mites and Household Pest Adaptations.
Molecular biology and evolution.
2022 05; 39(5):. doi:
10.1093/molbev/msac097
. [PMID: 35535514] - Xiaolei Yang, Guanghao Zhu, Ying Zhang, Xubo Wu, Bei Liu, Ye Liu, Qing Yang, Wandi Du, Jingru Liang, Jiarong Hu, Ping Yang, Guangbo Ge, Weimin Cai, Guo Ma. Inhibition of Human UDP-Glucuronosyltransferases1A1-Mediated Bilirubin Glucuronidation by the Popular Flavonoids Baicalein, Baicalin, and Hyperoside Is Responsible for Herb (Shuang-Huang-Lian)-Induced Jaundice.
Drug metabolism and disposition: the biological fate of chemicals.
2022 05; 50(5):552-565. doi:
10.1124/dmd.121.000714
. [PMID: 35241486] - Xichuan Li, Ce Wang, Jinqian Chen, Xia Hu, Hao Zhang, Zhiying Li, Bei Lan, Wei Zhang, Yanjun Su, Chunze Zhang. Potential interactions among myricetin and dietary flavonols through the inhibition of human UDP-glucuronosyltransferase in vitro.
Toxicology letters.
2022 Apr; 358(?):40-47. doi:
10.1016/j.toxlet.2022.01.007
. [PMID: 35063619]