ent-kaurene (BioDeep_00000638606)
Main id: BioDeep_00000006059
PANOMIX_OTCML-2023 natural product
代谢物信息卡片
化学式: C20H32 (272.2504)
中文名称:
谱图信息:
最多检出来源 () 0%
分子结构信息
SMILES: C1CCC(C)(C)[C@]2([H])[C@]1(C)[C@@]1([H])[C@]3(C[C@H](C(=C)C3)CC1)CC2
InChI: InChI=1S/C20H32/c1-14-12-20-11-8-16-18(2,3)9-5-10-19(16,4)17(20)7-6-15(14)13-20/h15-17H,1,5-13H2,2-4H3/t15-,16-,17+,19-,20-/m1/s1
描述信息
同义名列表
数据库引用编号
9 个数据库交叉引用编号
- ChEBI: CHEBI:15415
- PubChem: 11966109
- LipidMAPS: LMPR0104130002
- MeSH: Diterpenes, Kaurane
- CAS: 562-28-7
- KEGG: C06090
- PubChem: 8356
- KNApSAcK: 15415
- LOTUS: LTS0063025
分类词条
相关代谢途径
Reactome(0)
BioCyc(7)
PlantCyc(7)
代谢反应
735 个相关的代谢反应过程信息。
Reactome(0)
BioCyc(9)
- kauralexin biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- gibberellin biosynthesis IV (Gibberella fujikuroi):
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent -kaurene biosynthesis II:
GGPP ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + H+ + NADPH + O2 ⟶ ent-kaurenol + H2O + NADP+
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
WikiPathways(0)
Plant Reactome(339)
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
ent-copalyl diphosphate ⟶ PPi + ent-kaurene
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
ent-copalyl diphosphate ⟶ PPi + ent-kaurene
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
ent-copalyl diphosphate ⟶ PPi + ent-kaurene
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
ent-copalyl diphosphate ⟶ PPi + ent-kaurene
- Metabolism and regulation:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA
- Hormone signaling, transport, and metabolism:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate + Oxygen ⟶ CH3COO- + jasmonic acid
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
GPP + H2O ⟶ PPi + geraniol
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Ent-kaurene biosynthesis:
geranylgeranyl diphosphate ⟶ ent-copalyl diphosphate
INOH(0)
PlantCyc(387)
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin biosynthesis:
2-oxoglutarate + O2 + gibberellin A9 ⟶ CO2 + gibberellin A4 + succinate
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + H+ + NADPH + O2 ⟶ ent-kaurenol + H2O + NADP+
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- kauralexin biosynthesis:
ent-isokaurene + H+ + NADPH + O2 ⟶ H2O + NADP+ + kauralexin B1
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent -kaurene biosynthesis II:
GGPP ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin biosynthesis:
2-oxoglutarate + O2 + gibberellin A5 ⟶ CO2 + gibberellin A6 + succinate
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent -kaurene biosynthesis II:
GGPP ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- kauralexin biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin biosynthesis:
2-oxoglutarate + O2 + gibberellin44 (open lactone form) ⟶ CO2 + H2O + gibberellin A19 + succinate
- superpathway of gibberellin GA12 biosynthesis:
ent-kaur-16-en-19-oate + H+ + NADPH + O2 ⟶ ent-7α-hydroxykaur-16-en-19-oate + H2O + NADP+
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- steviol biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- steviol biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- steviol biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- steviol biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- steviol biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- steviol biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- GA12 biosynthesis:
ent-kaurenol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenal + H2O + an oxidized [NADPH-hemoprotein reductase]
- ent-kaurene biosynthesis I:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin GA12 biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- steviol biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- steviol biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- steviol biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- steviol biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- steviol biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- steviol biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- steviol biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- steviol biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- steviol biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- steviol biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- steviol biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- steviol biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- steviol biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- steviol biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- gibberellin A12 biosynthesis:
ent-kaurene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ ent-kaurenol + H2O + an oxidized [NADPH-hemoprotein reductase]
COVID-19 Disease Map(0)
PathBank(0)
PharmGKB(0)
114 个相关的物种来源信息
- 39847 - Agrostemma: LTS0063025
- 39848 - Agrostemma githago: 10.1104/PP.101.1.25
- 39848 - Agrostemma githago: LTS0063025
- 3563 - Amaranthaceae: LTS0063025
- 4037 - Apiaceae: LTS0063025
- 12947 - Aristolochia: LTS0063025
- 158574 - Aristolochia triangularis:
- 158574 - Aristolochia triangularis: 10.1016/0031-9422(90)85139-7
- 158574 - Aristolochia triangularis: LTS0063025
- 16727 - Aristolochiaceae: LTS0063025
- 4890 - Ascomycota: LTS0063025
- 4210 - Asteraceae: LTS0063025
- 41487 - Baccharis: LTS0063025
- 2707466 - Baccharis minutiflora: 10.1016/S0031-9422(00)95275-0
- 2707466 - Baccharis minutiflora: LTS0063025
- 121882 - Balsamorhiza: LTS0063025
- 230209 - Balsamorhiza sagittata: 10.1016/S0031-9422(00)83116-7
- 230209 - Balsamorhiza sagittata: LTS0063025
- 13807 - Bazzania: LTS0063025
- 3568 - Caryophyllaceae: LTS0063025
- 13414 - Chamaecyparis: LTS0063025
- 187461 - Chamaecyparis formosensis: 10.1016/S0031-9422(99)00074-6
- 187461 - Chamaecyparis formosensis: LTS0063025
- 1804623 - Chenopodiaceae: LTS0063025
- 183012 - Coespeletia: LTS0063025
- 183013 - Coespeletia timotensis: 10.1016/S0031-9422(99)00346-5
- 1097172 - Conchidium: LTS0063025
- 3368 - Cryptomeria: LTS0063025
- 3369 - Cryptomeria japonica:
- 3369 - Cryptomeria japonica: 10.1016/S0031-9422(00)85694-0
- 3369 - Cryptomeria japonica: 10.1016/S0031-9422(00)97016-X
- 3369 - Cryptomeria japonica: LTS0063025
- 3650 - Cucurbitaceae: LTS0063025
- 3367 - Cupressaceae: LTS0063025
- 185152 - Espeletia: LTS0063025
- 1933562 - Espeletia guacharaca: 10.1016/S0031-9422(00)91035-5
- 185154 - Espeletia schultzii: 10.1016/S0040-4039(00)70745-3
- 185154 - Espeletia schultzii: LTS0063025
- 183013 - Espeletia timotensis: 10.1016/S0031-9422(99)00346-5
- 185155 - Espeletiopsis: LTS0063025
- 1933562 - Espeletiopsis guacharaca: 10.1016/S0031-9422(00)91035-5
- 2759 - Eukaryota: LTS0063025
- 3977 - Euphorbiaceae: LTS0063025
- 4751 - Fungi: LTS0063025
- 5506 - Fusarium: LTS0063025
- 5127 - Fusarium fujikuroi:
- 5127 - Fusarium fujikuroi: LTS0063025
- 43908 - Guarea: LTS0063025
- 485821 - Guarea kunthiana: 10.1590/S0103-50532004000500025
- 485821 - Guarea kunthiana: LTS0063025
- 4231 - Helianthus: LTS0063025
- 59430 - Helichrysum: LTS0063025
- 630325 - Helichrysum nudifolium: LTS0063025
- 630334 - Helichrysum schimperi: 10.1016/0031-9422(90)80127-3
- 630334 - Helichrysum schimperi: LTS0063025
- 4512 - Hordeum: LTS0063025
- 4513 - Hordeum vulgare: 10.1104/PP.96.4.1099
- 4513 - Hordeum vulgare: LTS0063025
- 186771 - Jungermanniopsida: LTS0063025
- 4136 - Lamiaceae: LTS0063025
- 13806 - Lepidoziaceae: LTS0063025
- 4447 - Liliopsida: LTS0063025
- 3398 - Magnoliopsida: LTS0063025
- 3982 - Manihot: LTS0063025
- 3983 - Manihot esculenta: 10.1016/0031-9422(88)83015-2
- 3983 - Manihot esculenta: LTS0063025
- 48241 - Marah: LTS0063025
- 48242 - Marah macrocarpa: 10.1021/JA00270A050
- 48242 - Marah macrocarpa: LTS0063025
- 3195 - Marchantiophyta: LTS0063025
- 43707 - Meliaceae: LTS0063025
- 110618 - Nectriaceae: LTS0063025
- 204149 - Ocimum tenuiflorum: 10.1371/JOURNAL.PONE.0207097
- 4747 - Orchidaceae: LTS0063025
- 4527 - Oryza: LTS0063025
- 4530 - Oryza sativa:
- 4530 - Oryza sativa: LTS0063025
- 58019 - Pinopsida: LTS0063025
- 53018 - Plagiochila: LTS0063025
- 261380 - Plagiochila pulcherrima: 10.1016/0031-9422(88)80209-7
- 261380 - Plagiochila pulcherrima: LTS0063025
- 53016 - Plagiochilaceae: LTS0063025
- 255982 - Pleurozia: LTS0063025
- 255983 - Pleurozia gigantea: 10.1016/0031-9422(90)85196-M
- 255983 - Pleurozia gigantea: LTS0063025
- 255981 - Pleuroziaceae: LTS0063025
- 4479 - Poaceae: LTS0063025
- 56942 - Porella: LTS0063025
- 446154 - Porella densifolia: 10.1016/S0031-9422(00)82340-7
- 446154 - Porella densifolia: LTS0063025
- 56912 - Porellaceae: LTS0063025
- 139771 - Sapium: LTS0063025
- 2650239 - Sapium stylare: 10.1016/0031-9422(93)85112-5
- 2650239 - Sapium stylare: LTS0063025
- 155231 - Sideritis: LTS0063025
- 403020 - Sideritis ferrensis: 10.1016/0031-9422(91)85278-8
- 403020 - Sideritis ferrensis: LTS0063025
- 403024 - Sideritis lotsyi: 10.1016/J.PHYTOCHEM.2009.05.011
- 403024 - Sideritis lotsyi: LTS0063025
- 155263 - Sideritis soluta: 10.1016/J.PHYTOCHEM.2009.05.011
- 155263 - Sideritis soluta: LTS0063025
- 147550 - Sordariomycetes: LTS0063025
- 3561 - Spinacia: LTS0063025
- 3562 - Spinacia oleracea: 10.1104/PP.101.1.25
- 3562 - Spinacia oleracea: LTS0063025
- 35493 - Streptophyta: LTS0063025
- 79021 - Thapsia: LTS0063025
- 571609 - Thapsia tenuifolia: 10.1021/NP50075A020
- 571609 - Thapsia tenuifolia: LTS0063025
- 58023 - Tracheophyta: LTS0063025
- 4564 - Triticum: LTS0063025
- 4565 - Triticum aestivum: 10.1007/BF00202655
- 4565 - Triticum aestivum: LTS0063025
- 33090 - Viridiplantae: LTS0063025
在这里通过桑基图来展示出与当前的这个代谢物在我们的BioDeep知识库中具有相关联信息的其他代谢物。在这里进行关联的信息来源主要有:
- PubMed: 来源于PubMed文献库中的文献信息,我们通过自然语言数据挖掘得到的在同一篇文献中被同时提及的相关代谢物列表,这个列表按照代谢物同时出现的文献数量降序排序,取前10个代谢物作为相关研究中关联性很高的代谢物集合展示在桑基图中。
- NCBI Taxonomy: 通过文献数据挖掘,得到的代谢物物种来源信息关联。这个关联信息同样按照出现的次数降序排序,取前10个代谢物作为高关联度的代谢物集合展示在桑吉图上。
- Chemical Taxonomy: 在物质分类上处于同一个分类集合中的其他代谢物
- Chemical Reaction: 在化学反应过程中,存在为当前代谢物相关联的生化反应过程中的反应底物或者反应产物的关联代谢物信息。
点击图上的相关代谢物的名称,可以跳转到相关代谢物的信息页面。
亚细胞结构定位 | 关联基因列表 |
---|
文献列表
- Shiying Ye, Xiangyan Hu, Shaowei Sun, Bo Su, Jiye Cai, Jinhuan Jiang. Oridonin promotes RSL3-induced ferroptosis in breast cancer cells by regulating the oxidative stress signaling pathway JNK/Nrf2/HO-1.
European journal of pharmacology.
2024 Jul; 974(?):176620. doi:
10.1016/j.ejphar.2024.176620
. [PMID: 38685305] - Heng Kong, Yuan-Yuan Han, Gai-Ling Yang, Kang Li, Lu Yu, Xun-Kai Xie, Guang-Yuan Xia, Peng-Ju Wei, Wan-Rong Zhang, Chu-Hua Li. Tenuifolin improves learning and memory by regulating long-term potentiation and dendritic structure of hippocampal CA1 area in healthy female mice but not male mice.
Behavioural brain research.
2024 May; 466(?):114974. doi:
10.1016/j.bbr.2024.114974
. [PMID: 38554850] - Joanna Śniegowska, Anita Biesiada, Alan Gasiński. Influence of the Nitrogen Fertilization on the Yield, Biometric Characteristics and Chemical Composition of Stevia rebaudiana Bertoni Grown in Poland.
Molecules (Basel, Switzerland).
2024 Apr; 29(8):. doi:
10.3390/molecules29081865
. [PMID: 38675686] - Shan Li, Shuangshuang Luo, Xingying Zhao, Song Gao, Xiaoyu Shan, Jian Lu, Jingwen Zhou. Efficient Conversion of Stevioside to Rebaudioside M in Saccharomyces cerevisiae by a Engineering Hydrolase System and Prolonging the Growth Cycle.
Journal of agricultural and food chemistry.
2024 Apr; 72(14):8140-8148. doi:
10.1021/acs.jafc.4c01483
. [PMID: 38563232] - Mei-Li Xu, Yuanxin Cheng, Mo Feng, Qingguo Lu, Yunhe Lian. Identifying Potential Sources of Phthalate Contamination in the Leaves of Stevia Rebaudiana (Bertoni) and the Development of Removal Technology.
Molecules (Basel, Switzerland).
2024 Apr; 29(7):. doi:
10.3390/molecules29071627
. [PMID: 38611906] - Xiuqiong Zhang, Tiantian Chen, Zaifang Li, Xinxin Wang, Han Bao, Chunxia Zhao, Xinjie Zhao, Xin Lu, Guowang Xu. Fine-Scale Characterization of Plant Diterpene Glycosides Using Energy-Resolved Untargeted LC-MS/MS Metabolomics Analysis.
Journal of the American Society for Mass Spectrometry.
2024 Mar; 35(3):603-612. doi:
10.1021/jasms.3c00420
. [PMID: 38391322] - Jing Liu, Qian Zhang, Yin Kwan Wong, Piao Luo, Junhui Chen, Lulin Xie, Jiayun Chen, Xueling He, Fei Shi, Ping Gong, Xueyan Liu, Jigang Wang. Single-Cell Transcriptomics Reveals the Ameliorative Effect of Oridonin on Septic Liver Injury.
Advanced biology.
2024 Mar; 8(3):e2300542. doi:
10.1002/adbi.202300542
. [PMID: 38408269] - Lan Wu, Ming Zhang, Wen-Hu Liu, Yan-Fang Chen, Xiu-Wen Yin, Zhengbin Han, Fu-Cai Ren, Xiang-Dong Pu, Xin-Hua Liu, Jing-Bo Shi, Chuan-Pu Shen. The intramolecular SN2 reaction tautomeric ent-Kauranoids isolated from the aerial parts of Isodon amethystoides.
Fitoterapia.
2024 Mar; 173(?):105788. doi:
10.1016/j.fitote.2023.105788
. [PMID: 38141880] - Tao-Yan Lin, Jun-Shuang Jia, Wei-Ren Luo, Xiao-Lin Lin, Sheng-Jun Xiao, Jie Yang, Jia-Wei Xia, Chen Zhou, Zhi-Hao Zhou, Shu-Jun Lin, Qi-Wen Li, Zhi-Zhi Yang, Ye Lei, Wen-Qing Yang, Hong-Fen Shen, Shi-Hao Huang, Sheng-Chun Wang, Lin-Bei Chen, Yu-Lin Yang, Shu-Wen Xue, Yong-Long Li, Guan-Qi Dai, Ying Zhou, Ying-Chun Li, Fang Wei, Xiao-Xiang Rong, Xiao-Jun Luo, Bing-Xia Zhao, Wen-Hua Huang, Dong Xiao, Yan Sun. ThermomiR-377-3p-induced suppression of Cirbp expression is required for effective elimination of cancer cells and cancer stem-like cells by hyperthermia.
Journal of experimental & clinical cancer research : CR.
2024 Feb; 43(1):62. doi:
10.1186/s13046-024-02983-3
. [PMID: 38419081] - Feifan Zhang, Yang Hao, Ning Yang, Man Liu, Yage Luo, Ying Zhang, Jian Zhou, Hongjian Liu, Jitian Li. Oridonin-induced ferroptosis and apoptosis: a dual approach to suppress the growth of osteosarcoma cells.
BMC cancer.
2024 Feb; 24(1):198. doi:
10.1186/s12885-024-11951-1
. [PMID: 38347435] - Samuel Simoni, Alberto Vangelisti, Clarissa Clemente, Gabriele Usai, Marco Santin, Maria Ventimiglia, Flavia Mascagni, Lucia Natali, Luciana G Angelini, Andrea Cavallini, Silvia Tavarini, Tommaso Giordani. Transcriptomic Analyses Reveal Insights into the Shared Regulatory Network of Phenolic Compounds and Steviol Glycosides in Stevia rebaudiana.
International journal of molecular sciences.
2024 Feb; 25(4):. doi:
10.3390/ijms25042136
. [PMID: 38396813] - Arianne Morissette, Alice de Wouters d'Oplinter, Diana Majolli Andre, Marilou Lavoie, Bruno Marcotte, Thibault V Varin, Jocelyn Trottier, Geneviève Pilon, Martin Pelletier, Patrice D Cani, Olivier Barbier, Vanessa P Houde, André Marette. Rebaudioside D decreases adiposity and hepatic lipid accumulation in a mouse model of obesity.
Scientific reports.
2024 02; 14(1):3077. doi:
10.1038/s41598-024-53587-y
. [PMID: 38321177] - Henglai Sun, Jijuan Nai, Biqi Deng, Zhen Zheng, Xuemei Chen, Chao Zhang, Huagang Sheng, Liqiao Zhu. Angelica Sinensis Polysaccharide-Based Nanoparticles for Liver-Targeted Delivery of Oridonin.
Molecules (Basel, Switzerland).
2024 Feb; 29(3):. doi:
10.3390/molecules29030731
. [PMID: 38338476] - Conglong Lian, Fei Zhang, Hao Yang, Xueyu Zhang, Jinxu Lan, Bao Zhang, Xiuyu Liu, Jingfan Yang, Suiqing Chen. Multi-omics analysis of small RNA, transcriptome, and degradome to identify putative miRNAs linked to MeJA regulated and oridonin biosynthesis in Isodon rubescens.
International journal of biological macromolecules.
2024 Feb; 258(Pt 2):129123. doi:
10.1016/j.ijbiomac.2023.129123
. [PMID: 38163496] - Lifen Zhang, Yao Yu, Qi Wang, Xi Huang, Zheng Feng, Zhi Li. Oridonin loaded peptide nanovesicles alleviate nonalcoholic fatty liver disease in mice.
Pharmaceutical development and technology.
2024 Feb; 29(2):123-130. doi:
10.1080/10837450.2024.2315460
. [PMID: 38327230] - Abdulbaset Al-Romaima, Guilin Hu, Yanbing Wang, Chenxi Quan, Haopeng Dai, Minghua Qiu. Identification of New Diterpenoids from the Pulp of Coffea arabica and Their α-Glucosidase Inhibition Activity.
Journal of agricultural and food chemistry.
2024 Jan; 72(3):1683-1694. doi:
10.1021/acs.jafc.3c05619
. [PMID: 38157425] - Shuling Zhang, Annamalai Vijayalakshmi, Lingjun Meng. Oridonin attenuated human PC-3 cell activity by modulating the Wnt/β-catenin signaling.
Advances in clinical and experimental medicine : official organ Wroclaw Medical University.
2024 Jan; ?(?):. doi:
10.17219/acem/175519
. [PMID: 38269477] - Yu Lin, Meng Liang, Hao Pang, Zilong Wang, Hai Bi, Yutuo Wei, Liqin Du. Production of Gibberellins via a Non-Natural Pathway Using Steviol as a Substrate.
Journal of agricultural and food chemistry.
2024 Jan; 72(1):540-548. doi:
10.1021/acs.jafc.3c06932
. [PMID: 38131295] - Ronald J Quinn, Tin Mak, Dene R Littler, Jamie Rossjohn, Miaomiao Liu. Discovery of Anti-SARS-CoV-2 Nsp9 Binders from Natural Products by a Native Mass Spectrometry Approach.
Journal of natural products.
2023 12; 86(12):2630-2637. doi:
10.1021/acs.jnatprod.3c00636
. [PMID: 37993134] - Yehai An, Qian Zhang, Yu Chen, Fei Xia, Yin-Kwan Wong, Hengkai He, Mingjing Hao, Jiahang Tian, Xiaoyong Zhang, Piao Luo, Jigang Wang. Chemoproteomics Reveals Glaucocalyxin A Induces Mitochondria-Dependent Apoptosis of Leukemia Cells via Covalently Binding to VDAC1.
Advanced biology.
2023 Dec; ?(?):e2300538. doi:
10.1002/adbi.202300538
. [PMID: 38105424] - Poonam Pal, Mamta Masand, Shikha Sharma, Romit Seth, Gopal Singh, Sanatsujat Singh, Ashok Kumar, Ram Kumar Sharma. Genome-wide transcriptional profiling and physiological investigation elucidating the molecular mechanism of multiple abiotic stress response in Stevia rebaudiana Bertoni.
Scientific reports.
2023 11; 13(1):19853. doi:
10.1038/s41598-023-46000-7
. [PMID: 37963906] - Khaing Zar Myint, Zhuoyu Zhou, Qiandai Shi, Junming Chen, Xinyu Dong, Yongmei Xia. Stevia Polyphenols, Their Antimicrobial and Anti-Inflammatory Properties, and Inhibitory Effect on Digestive Enzymes.
Molecules (Basel, Switzerland).
2023 Nov; 28(22):. doi:
10.3390/molecules28227572
. [PMID: 38005293] - Suzana Tiemi Ivamoto-Suzuki, José Miguel Celedón, Macaire M S Yuen, Cíntia Sorane Good Kitzberger, Douglas Silva Domingues, Jörg Bohlmann, Luiz Filipe Protasio Pereira. Functional Characterization of ent-Copalyl Diphosphate Synthase and Kaurene Synthase Genes from Coffea arabica L.
Journal of agricultural and food chemistry.
2023 Oct; ?(?):. doi:
10.1021/acs.jafc.2c09087
. [PMID: 37816128] - Pritom Biswas, Ankita Kumari, Arpan Modi, Nitish Kumar. Improvement and Regulation of Steviol Glycoside Biosynthesis in Stevia rebaudiana Bertoni.
Gene.
2023 Sep; ?(?):147809. doi:
10.1016/j.gene.2023.147809
. [PMID: 37722610] - Juan Zou, Jianghai Ye, Chenliang Zhao, Jingjie Zhang, Yahua Liu, Lutai Pan, Kang He, Hongjie Zhang. Guidongnins I-J: Two New 6,7-seco-7,20-Olide-ent-kaurene Diterpenes with Unusual Structures from Isodon rubescens.
International journal of molecular sciences.
2023 Aug; 24(17):. doi:
10.3390/ijms241713451
. [PMID: 37686256] - Yu Wang, Peiyu Xu, Wenxia Wang, Xiaochen Jia, Liping Zhu, Heng Yin. Oligosaccharides increased both leaf biomass and steviol glycosides content of Stevia rebaudiana.
Plant physiology and biochemistry : PPB.
2023 Aug; 202(?):107937. doi:
10.1016/j.plaphy.2023.107937
. [PMID: 37566994] - Muhammad Arslan Ahmad, Sadaf Chaudhary, Xu Deng, Mumtaz Cheema, Rabia Javed. Nano-stevia interaction: Past, present, and future.
Plant physiology and biochemistry : PPB.
2023 Aug; 201(?):107807. doi:
10.1016/j.plaphy.2023.107807
. [PMID: 37311291] - Xiaoxiao Pei, Yuxia Lou, Qianqian Ren, Yan Liu, Xiling Dai, Mingfu Ye, Guozheng Huang, Jianguo Cao. Anti-inflammatory activities of several diterpenoids isolated from Hemionitis albofusca.
Naunyn-Schmiedeberg's archives of pharmacology.
2023 Jul; ?(?):. doi:
10.1007/s00210-023-02626-y
. [PMID: 37462718] - Takehiro Watanabe, Kohki Fujikawa, Soichiro Urai, Kazunari Iwaki, Tadayoshi Hirai, Katsuro Miyagawa, Hiroshi Uratani, Tohru Yamagaki, Koji Nagao, Yoshiaki Yokoo, Keiko Shimamoto. Identification, Chemical Synthesis, and Sweetness Evaluation of Rhamnose or Xylose Containing Steviol Glycosides of Stevia (Stevia rebaudiana) Leaves.
Journal of agricultural and food chemistry.
2023 Jul; ?(?):. doi:
10.1021/acs.jafc.3c01753
. [PMID: 37432401] - Yuping Li, Yuan Qiu, Xin Xu, Ming Luo. Genome-wide identification of SrbHLH transcription factors highlights its potential role in rebaudioside A (RA) biosynthesis in Stevia rebaudiana.
BMC plant biology.
2023 Jul; 23(1):352. doi:
10.1186/s12870-023-04353-1
. [PMID: 37415121] - Qian Tan, Kun Hu, Xiao-Nian Li, Xing-Zhi Yang, Han-Dong Sun, Pema-Tenzin Puno. Cytotoxic C-20 non-oxygenated ent-kaurane diterpenoids from Isodon wardii.
Bioorganic chemistry.
2023 06; 135(?):106512. doi:
10.1016/j.bioorg.2023.106512
. [PMID: 37027948] - Yali Wang, Qinghua Jiang, Dejuan Sun, Na Zhang, Yu Lin, Hua Li, Lixia Chen. Ent-kauranes and ent-atisanes from Euphorbia wallichii and their anti-inflammatory activity.
Phytochemistry.
2023 Jun; 210(?):113643. doi:
10.1016/j.phytochem.2023.113643
. [PMID: 36933878] - Long Mu, Tian Li, Peng-Lin Wu, Ling-Qiao Cai, Shu-Ying Li, Zi-Yuan Wang, Yuan-Yuan Liu, Jie Wang, Dong Yan, Zheng-Yun Rao, Chao-Jun Wang, Jian Zhang, Yi Cao, Ke Pan, Zhi-Qi Yin. 5-epi-ent-Kaurane diterpenoids from the aerial parts of Isodon eriocalyx and their anti-atherosclerotic potential.
Phytochemistry.
2023 May; 209(?):113621. doi:
10.1016/j.phytochem.2023.113621
. [PMID: 36893826] - Camila de Souza Araújo, Daniel Amando Nery, Ana Paula de Oliveira, Raimundo Gonçalves de Oliveira-Júnior, Larissa Araújo Rolim, Norberto Peporine Lopes, Maria Francilene de Souza Silva, Cláudia do Ó Pessoa, Raimundo Braz-Filho, Lívia Macedo Dutra, Josean Fechine Tavares, Lucas Silva Abreu, Marcelo Sobral da Silva, Jackson Roberto Guedes da Silva Almeida. New ent-kaurene-type nor-diterpene and other compounds isolated from Annona vepretorum Mart. (Annonaceae).
Natural product research.
2023 May; 37(9):1565-1572. doi:
10.1080/14786419.2022.2027408
. [PMID: 35045773] - Vasile Coman, Violeta-Florina Scurtu, Cristina Coman, Doina Clapa, Ștefania D Iancu, Nicolae Leopold, Loredana-Florina Leopold. Effects of polystyrene nanoplastics exposure on in vitro-grown Stevia rebaudiana plants.
Plant physiology and biochemistry : PPB.
2023 Apr; 197(?):107634. doi:
10.1016/j.plaphy.2023.03.011
. [PMID: 36965317] - Leilei Gou, Grace Gar-Lee Yue, Julia Kin-Ming Lee, Pema Tenzin Puno, Clara Bik-San Lau. Natural product Eriocalyxin B suppressed triple negative breast cancer metastasis both in vitro and in vivo.
Biochemical pharmacology.
2023 04; 210(?):115491. doi:
10.1016/j.bcp.2023.115491
. [PMID: 36898414] - Alireza S Tehranian, Hossein Askari, Hassan Rezadoost. The effect of alginate as an elicitor on transcription of steviol glycosides biosynthesis pathway related key genes and sweeteners content in in vitro cultured Stevia rebaudiana.
Molecular biology reports.
2023 Mar; 50(3):2283-2291. doi:
10.1007/s11033-022-07906-z
. [PMID: 36576674] - Liping He, Daili Yuchen, Shangzhi Zhang, Yangyang Hui, Namei Wei, Yangqing He. A partial peroxisome proliferator-activated receptor gamma agonist isolated from the roots of Euphorbia sikkimensis.
Natural product research.
2023 Feb; ?(?):1-5. doi:
10.1080/14786419.2023.2183201
. [PMID: 36840631] - Magdalena Simlat, Agata Ptak, Anita Jaglarz, Agnieszka Szewczyk, Michał Dziurka, Artur Gurgul. Seeds of Stevia rebaudiana Bertoni as a Source of Plant Growth-Promoting Endophytic Bacteria with the Potential to Synthesize Rebaudioside A.
International journal of molecular sciences.
2023 Jan; 24(3):. doi:
10.3390/ijms24032174
. [PMID: 36768498] - Shiying Ye, Shaowei Sun, Jiye Cai, Jinhuan Jiang. Research Progress and Future Development Potential of Oridonin in Pharmacological Activities.
Current molecular pharmacology.
2023; 16(7):691-706. doi:
10.2174/1874467216666221130163634
. [PMID: 36453482] - Nazima Nasrullah, Javed Ahmad, Monica Saifi, Irum Gul Shah, Umara Nissar, Syed Naved Quadri, Kudsiya Ashrafi, Malik Zainul Abdin. Enhancement of diterpenoid steviol glycosides by co-overexpressing SrKO and SrUGT76G1 genes in Stevia rebaudiana Bertoni.
PloS one.
2023; 18(2):e0260085. doi:
10.1371/journal.pone.0260085
. [PMID: 36745615] - Seikou Nakamura, Sachiko Sugimoto, Taichi Yoneda, Akari Shinozaki, Moe Yoshiji, Takahiro Matsumoto, Souichi Nakashima, Hisashi Matsuda. Antiproliferative Activities of Diterpenes from Leaves of Isodon trichocarpus against Cancer Stem Cells.
Chemical & pharmaceutical bulletin.
2023; 71(7):502-507. doi:
10.1248/cpb.c22-00914
. [PMID: 37394598] - Yuwei Sun, Jie Shao, Haili Liu, Hua Wang, Guangyi Wang, Jianhua Li, Yaping Mao, Zhuo Chen, Ke Ma, Lin Xu, Yong Wang. A chromosome-level genome assembly reveals that tandem-duplicated CYP706V oxidase genes control oridonin biosynthesis in the shoot apex of Isodon rubescens.
Molecular plant.
2022 Dec; ?(?):. doi:
10.1016/j.molp.2022.12.007
. [PMID: 36518072] - Roberta Ascrizzi, Marinella De Leo, Laura Pistelli, Claudia Giuliani, Ylenia Pieracci, Barbara Ruffoni, Carlo Mascarello, Gelsomina Fico, Guido Flamini, Luisa Pistelli. Resilience of Stevia rebaudiana (Bertoni) Bertoni in the Underwater Biospheres of Nemo's Garden®: Adaptation to New Cultivation Systems.
Molecules (Basel, Switzerland).
2022 Dec; 27(23):. doi:
10.3390/molecules27238602
. [PMID: 36500693] - Chao Xu, E Ou, Zhiyin Li, Zhenyu Chen, Qi Jia, Xiaojia Xu, Liping Luo, Geng Xu, Jiansong Liu, Zhengqiang Yuan, Yu Zhao. Synthesis and in vivo evaluation of new steviol derivatives that protect against cardiomyopathy by inhibiting ferroptosis.
Bioorganic chemistry.
2022 12; 129(?):106142. doi:
10.1016/j.bioorg.2022.106142
. [PMID: 36150232] - Huan Zhao, Lei Sun, ChuiHao Kong, WenLi Mei, HaoFu Dai, FengQing Xu, ShengZhuo Huang. Phytochemical and pharmacological review of diterpenoids from the genus Euphorbia Linn (2012-2021).
Journal of ethnopharmacology.
2022 Nov; 298(?):115574. doi:
10.1016/j.jep.2022.115574
. [PMID: 35944737] - Vartika Srivastava, Rakhi Chaturvedi. An interdisciplinary approach towards sustainable and higher steviol glycoside production from in vitro cultures of Stevia rebaudiana.
Journal of biotechnology.
2022 Nov; 358(?):76-91. doi:
10.1016/j.jbiotec.2022.08.018
. [PMID: 36075450] - Sherien H Abdallah, Nada M Mostafa, Marwa Abd El Hameed Mohamed, Ahmed S Nada, Abdel Nasser B Singab. UPLC-ESI-MS/MS profiling and hepatoprotective activities of Stevia leaves extract, butanol fraction and stevioside against radiation-induced toxicity in rats.
Natural product research.
2022 Nov; 36(21):5619-5625. doi:
10.1080/14786419.2021.2015594
. [PMID: 34894905] - Ashraf Elsayed, Amal M Abdelsattar, Yasmin M Heikal, Mohamed A El-Esawi. Synergistic effects of Azospirillum brasilense and Bacillus cereus on plant growth, biochemical attributes and molecular genetic regulation of steviol glycosides biosynthetic genes in Stevia rebaudiana.
Plant physiology and biochemistry : PPB.
2022 Oct; 189(?):24-34. doi:
10.1016/j.plaphy.2022.08.016
. [PMID: 36041365] - Wen-Jun Wei, Bingqiang Zhu, Yanpo Si, Tao Guo, Jihong Kang, Liping Dai. Cytotoxic ent-Kaurane Diterpenoids from Rabdosia Rubescens.
Chemistry & biodiversity.
2022 Oct; 19(10):e202200497. doi:
10.1002/cbdv.202200497
. [PMID: 36050280] - Christos Velesiotis, Marinos Kanellakis, Demitrios H Vynios. Steviol glycosides affect functional properties and macromolecular expression of breast cancer cells.
IUBMB life.
2022 10; 74(10):1012-1028. doi:
10.1002/iub.2669
. [PMID: 36054915] - Ya Li, Xingzhi Jiao, Tinghong Lv, Meili Yang, Kun Gao. Structurally diverse diterpenoids from the roots of Euphorbia fischeriana Steud.
Fitoterapia.
2022 Oct; 162(?):105296. doi:
10.1016/j.fitote.2022.105296
. [PMID: 36087821] - Maria Laura Bellone, Lorenzo Fiengo, Carmen Cerchia, Roberta Cotugno, Ammar Bader, Antonio Lavecchia, Nunziatina De Tommasi, Fabrizio Dal Piaz. Impairment of Nucleolin Activity and Phosphorylation by a Trachylobane Diterpene from Psiadia punctulata in Cancer Cells.
International journal of molecular sciences.
2022 Sep; 23(19):. doi:
10.3390/ijms231911390
. [PMID: 36232690] - Ying Mei, Hui Hu, Liangjun Deng, Xiaoou Sun, Wen Tan. Isosteviol sodium attenuates high fat/high cholesterol-induced myocardial dysfunction by regulating the Sirt1/AMPK pathway.
Biochemical and biophysical research communications.
2022 09; 621(?):80-87. doi:
10.1016/j.bbrc.2022.06.044
. [PMID: 35810595] - Yan Liu, Dan-Dan Wu, Yong-Qiang Zhou, Jia-Tong Wu, Zi-Tang Qi, Adnan Mohammed Algradi, Juan Pan, Wei Guan, Bing-You Yang, Hai-Xue Kuang. A new ent-kaurane diterpenoid from the pericarps of Datura metel.
Journal of Asian natural products research.
2022 Sep; 24(9):884-890. doi:
10.1080/10286020.2021.1981874
. [PMID: 34647831] - Yuwei Sun, Zhuo Chen, Guangyi Wang, Huajun Lv, Yaping Mao, Ke Ma, Yong Wang. De novo production of versatile oxidized kaurene diterpenes in Escherichia coli.
Metabolic engineering.
2022 09; 73(?):201-213. doi:
10.1016/j.ymben.2022.08.001
. [PMID: 35934176] - Ying Mei, Hui Hu, Liangjun Deng, Xiaoou Sun, Wen Tan. Therapeutic effects of isosteviol sodium on non-alcoholic fatty liver disease by regulating autophagy via Sirt1/AMPK pathway.
Scientific reports.
2022 07; 12(1):12857. doi:
10.1038/s41598-022-16119-0
. [PMID: 35896572] - Zhipeng Chen, Heqian Liu, Xiaoqi Zhao, Subinur Mamateli, Cheng Liu, Lei Wang, Jing Yu, Yutong Liu, Jing Cai, Tong Qiao. Oridonin attenuates low shear stress-induced endothelial cell dysfunction and oxidative stress by activating the nuclear factor erythroid 2-related factor 2 pathway.
BMC complementary medicine and therapies.
2022 Jul; 22(1):180. doi:
10.1186/s12906-022-03658-2
. [PMID: 35799227] - Cai-Ling Qiu, Zhen-Nan Ye, Bing-Chao Yan, Kun Hu, Jin Yang, Xing-Zhi Yang, Hong-Mei Li, Xiao-Nian Li, Han-Dong Sun, Pema-Tenzin Puno. Structurally diverse diterpenoids from Isodon oresbius and their bioactivity.
Bioorganic chemistry.
2022 07; 124(?):105811. doi:
10.1016/j.bioorg.2022.105811
. [PMID: 35452916] - Xiaoqi Zhao, Yutong Liu, Lei Wang, Chaolong Yan, Han Liu, Wenxin Zhang, Hongting Zhao, Chen Cheng, Zhipeng Chen, Tianze Xu, Kuanyu Li, Jing Cai, Tong Qiao. Oridonin attenuates hind limb ischemia-reperfusion injury by modulating Nrf2-mediated oxidative stress and NLRP3-mediated inflammation.
Journal of ethnopharmacology.
2022 Jun; 292(?):115206. doi:
10.1016/j.jep.2022.115206
. [PMID: 35301099] - Yuzhou Shen, Haitao Ma. Oridonin-loaded lipid-coated calcium phosphate nanoparticles: preparation, characterization, and application in A549 lung cancer.
Pharmaceutical development and technology.
2022 Jun; 27(5):598-605. doi:
10.1080/10837450.2022.2090958
. [PMID: 35734959] - Weiwei Xie, Dedong Zhang, Xuqing Wen, Yuqian Zhang, Zhiqing Zhang, Yiran Jin, Yingfeng Du. A practical technique for rapid characterisation of ent-kaurane diterpenoids in Isodon serra (Maxim.) Hara by UHPLC-Q-TOF-MS/MS.
Phytochemical analysis : PCA.
2022 Jun; 33(4):517-532. doi:
10.1002/pca.3106
. [PMID: 35144310] - Yameng Xu, Xinglong Wang, Chenyang Zhang, Xuan Zhou, Xianhao Xu, Luyao Han, Xueqin Lv, Yanfeng Liu, Song Liu, Jianghua Li, Guocheng Du, Jian Chen, Rodrigo Ledesma-Amaro, Long Liu. De novo biosynthesis of rubusoside and rebaudiosides in engineered yeasts.
Nature communications.
2022 06; 13(1):3040. doi:
10.1038/s41467-022-30826-2
. [PMID: 35650215] - Xin Wang, Ming-Jing He, Xiao-Jie Chen, Yu-Ting Bai, Gang Zhou. Glaucocalyxin A impairs tumor growth via amplification of the ATF4/CHOP/CHAC1 cascade in human oral squamous cell carcinoma.
Journal of ethnopharmacology.
2022 May; 290(?):115100. doi:
10.1016/j.jep.2022.115100
. [PMID: 35151835] - Huahong Yang, Lidong Wang, Manshi Yang, Jianqiang Hu, Erli Zhang, Liping Peng. Oridonin attenuates LPS-induced early pulmonary fibrosis by regulating impaired autophagy, oxidative stress, inflammation and EMT.
European journal of pharmacology.
2022 May; 923(?):174931. doi:
10.1016/j.ejphar.2022.174931
. [PMID: 35398392] - Baodang Guo, Zhiwei Deng, Fei Meng, Qingfu Wang, Yan Zhang, Zhenbo Yuan, Yijian Rao. Enhancement of Rebaudioside M Production by Structure-Guided Engineering of Glycosyltransferase UGT76G1.
Journal of agricultural and food chemistry.
2022 Apr; 70(16):5088-5094. doi:
10.1021/acs.jafc.2c01209
. [PMID: 35417157] - Juan-Juan Hu, Bai-Lin Li, Jin-Dan Xie, Hui-Jun Liang, Qian-Ran Li, Jie Yuan, Jie-Wei Wu. Two new 7,20-epoxy-ent-kaurane diterpenoids from the aerial parts of Isodon serra.
Natural product research.
2022 Apr; 36(8):2021-2027. doi:
10.1080/14786419.2020.1841189
. [PMID: 33131334] - Rui-Fang Wu, Wen-Qiong Wang, Bing-Duo Zhou, Yi Wang, Ya-Ding Li, Sheng-Liang Zhu, Li-Jiang Xuan. Anti-inflammatory sesquiterpene dimers and diterpenes from the aerial part of Inula japonica.
Journal of Asian natural products research.
2022 Apr; 24(4):328-335. doi:
10.1080/10286020.2021.1923012
. [PMID: 34009074] - Tie Yao, Jiaxin Wang, Shijie Cao, Da Liu, Jingshi Duan, Yaqin Yu, Ning Kang, Feng Qiu. Two new ent-kaurane glucosides from the fruits of Xanthium strumarium subsp. sibiricum.
Natural product research.
2022 Apr; 36(7):1820-1826. doi:
10.1080/14786419.2020.1819268
. [PMID: 32954869] - Jiang-Nan Xia, Kun Hu, Xiao-Zheng Su, Jian-Wei Tang, Xiao-Nian Li, Han-Dong Sun, Pema-Tenzin Puno. Discovery of ent-kaurane diterpenoids, characteristic metabolites of Isodon species, from an endophytic fungal strain Geopyxis sp. XY93 inhabiting Isodon parvifolia.
Fitoterapia.
2022 Apr; 158(?):105160. doi:
10.1016/j.fitote.2022.105160
. [PMID: 35182695] - Xiao-Jing Zhao, Hai-Yan Zhu, Xiao-Liang Wang, Xiao-Wei Lu, Cai-Long Pan, Lu Xu, Xue Liu, Ning Xu, Zhi-Yuan Zhang. Oridonin Ameliorates Traumatic Brain Injury-Induced Neurological Damage by Improving Mitochondrial Function and Antioxidant Capacity and Suppressing Neuroinflammation through the Nrf2 Pathway.
Journal of neurotrauma.
2022 04; 39(7-8):530-543. doi:
10.1089/neu.2021.0466
. [PMID: 35102762] - Miey Park, Hana Baek, Jin-Young Han, Hae-Jeung Lee. Stevioside Enhances the Anti-Adipogenic Effect and β-Oxidation by Activating AMPK in 3T3-L1 Cells and Epididymal Adipose Tissues of db/db Mice.
Cells.
2022 03; 11(7):. doi:
10.3390/cells11071076
. [PMID: 35406641] - Ying Xin, Jia Xu, Jun-Jiang Lv, Hong-Tao Zhu, Dong Wang, Chong-Ren Yang, Ying-Jun Zhang. New ent-Kaurane and cleistanthane diterpenoids with potential cytotoxicity from Phyllanthus acidus (L.) Skeels.
Fitoterapia.
2022 Mar; 157(?):105133. doi:
10.1016/j.fitote.2022.105133
. [PMID: 35114336] - Soo Yee Lee, Khozirah Shaari. LC-MS metabolomics analysis of Stevia rebaudiana Bertoni leaves cultivated in Malaysia in relation to different developmental stages.
Phytochemical analysis : PCA.
2022 Mar; 33(2):249-261. doi:
10.1002/pca.3084
. [PMID: 34490671] - Haixia Wang, Hong Huang, Ning Jiang, Yiwen Zhang, Jingwei Lv, Xinmin Liu. Tenuifolin ameliorates chronic restraint stress-induced cognitive impairment in C57BL/6J mice.
Phytotherapy research : PTR.
2022 Mar; 36(3):1402-1412. doi:
10.1002/ptr.7402
. [PMID: 35129236] - Nikos Iatridis, Anastasia Kougioumtzi, Katerina Vlataki, Styliani Papadaki, Angeliki Magklara. Anti-Cancer Properties of Stevia rebaudiana; More than a Sweetener.
Molecules (Basel, Switzerland).
2022 Feb; 27(4):. doi:
10.3390/molecules27041362
. [PMID: 35209150] - Karel Vives Hernández, Jordi Moreno-Romero, Martha Hernández de la Torre, Claudia Pérez Manríquez, Darcy Ríos Leal, Jaime F Martínez-Garcia. Effect of light intensity on steviol glycosides production in leaves of Stevia rebaudiana plants.
Phytochemistry.
2022 Feb; 194(?):113027. doi:
10.1016/j.phytochem.2021.113027
. [PMID: 34861537] - Jerome G Ganzon, Chia-Ching Liaw, Yu-Chi Lin, Zhi-Hu Lin, Chang-Hung Wang, Che-Yi Chen, Kuo-Hsiang Chuang, Yao-Haur Kuo. New ent-kaurene and germacrene derivatives from Mesona procumbens Hemseley and their biological activity.
Natural product research.
2022 Feb; ?(?):1-9. doi:
10.1080/14786419.2022.2034811
. [PMID: 35105219] - Su-Juan Wang, Min Yu, Hua Li, Gui-Jie Zhang. Structures and Biological Activities of Polyacylated ent-Kaurane Diterpenoid Glycosides from the Aerial Parts of Inula hupehensis.
Journal of natural products.
2022 01; 85(1):185-195. doi:
10.1021/acs.jnatprod.1c00947
. [PMID: 34964626] - De-Fu Hong, Gui-Lin Hu, Xing-Rong Peng, Xiao-Yuan Wang, Yan-Bing Wang, Abdulbaset Al-Romaima, Zhong-Rong Li, Ming-Hua Qiu. Unusual ent-Kaurane Diterpenes from the Coffea Cultivar S288 Coffee Beans and Molecular Docking to α-Glucosidase.
Journal of agricultural and food chemistry.
2022 Jan; 70(2):615-625. doi:
10.1021/acs.jafc.1c06524
. [PMID: 35005957] - Narendren Rengasamy, Rofina Y Othman, Hang S Che, Jennifer A Harikrishna. Beyond the PAR spectra: impact of light quality on the germination, flowering, and metabolite content of Stevia rebaudiana (Bertoni).
Journal of the science of food and agriculture.
2022 Jan; 102(1):299-311. doi:
10.1002/jsfa.11359
. [PMID: 34091912] - Marcela Hollá, Dalibor Šatínský, František Švec, Hana Sklenářová. UHPLC coupled with charged aerosol detector for rapid separation of steviol glycosides in commercial sweeteners and extract of Stevia rebaudiana.
Journal of pharmaceutical and biomedical analysis.
2022 Jan; 207(?):114398. doi:
10.1016/j.jpba.2021.114398
. [PMID: 34626939] - Şemsi Gül Yılmaz, Aslı Uçar, Serkan Yılmaz. Do steviol glycosides affect the oxidative and genotoxicity parameters in BALB/c mice?.
Drug and chemical toxicology.
2022 Jan; 45(1):464-469. doi:
10.1080/01480545.2020.1716000
. [PMID: 31959022] - Hyemin Gu, Mi-Gyeong Gwon, Jong Hyun Kim, Jaechan Leem, Sun-Jae Lee. Oridonin Attenuates Cisplatin-Induced Acute Kidney Injury via Inhibiting Oxidative Stress, Apoptosis, and Inflammation in Mice.
BioMed research international.
2022; 2022(?):3002962. doi:
10.1155/2022/3002962
. [PMID: 35469348] - Susumu Kawakami, Chieko Kanagawa, Liva Harinantenaina Rakotondraibe, Masanori Inagaki, Motohiro Nishimura, Hideaki Otsuka, Toshio Seyama, Katsuyoshi Matsunami, Falitiana Marrino Rakotoarisoa, Stéphan Richard Rakotonandrasana, Alain Michel Ratsimbason. Omphalines A-E: ent-Rosane-Type Diterpenoids from the Madagascar Endemic Plant, Omphalea oppositifolia.
Chemical & pharmaceutical bulletin.
2022; 70(12):901-906. doi:
10.1248/cpb.c22-00648
. [PMID: 36450588] - Tingting Zhang, Chenxin Xu, Peisen Zheng, Xiaoxian Zhang, Chenyu Qiu, Fengjiao Wu, Jundixia Chen, Zhongxiang Xiao, Jiandong Zhu, Jingjing Zhang, Peng Zou, Daoyong Ni. Glaucocalyxin B Attenuates Ovarian Cancer Cell Growth and Cisplatin Resistance In Vitro via Activating Oxidative Stress.
Oxidative medicine and cellular longevity.
2022; 2022(?):6324292. doi:
10.1155/2022/6324292
. [PMID: 35251480] - Esra Dandin, Ünsal Veli Üstündağ, İsmail Ünal, Perihan Seda Ateş-Kalkan, Derya Cansız, Merih Beler, Esin Ak, A Ata Alturfan, Ebru Emekli-Alturfan. Stevioside ameliorates hyperglycemia and glucose intolerance, in a diet-induced obese zebrafish model, through epigenetic, oxidative stress and inflammatory regulation.
Obesity research & clinical practice.
2022 Jan; 16(1):23-29. doi:
10.1016/j.orcp.2022.01.002
. [PMID: 35031270] - Newman Osafo, Aaron O Antwi, Sarah Otu-Boakye. Xylopic Acid Suppresses Adjuvant-induced Arthritis in Sprague Dawley Rats via Reduction in Serum Levels of IL-6 and TNF-alpha.
Anti-inflammatory & anti-allergy agents in medicinal chemistry.
2022; 21(1):46-61. doi:
10.2174/1871523021666220310094218
. [PMID: 35272600] - Jin-A Ko, So-Yeon Kim, Hye-Soo Ahn, Jae-Gyune Go, Young-Bae Ryu, Woo Song Lee, Young-Jung Wee, Jun-Seong Park, Doman Kim, Young-Min Kim. Characterization of a lactic acid bacterium-derived β-glucosidase for the production of rubusoside from stevioside.
Enzyme and microbial technology.
2022 Jan; 153(?):109939. doi:
10.1016/j.enzmictec.2021.109939
. [PMID: 34798448] - Yanfang Liu, Weifeng Dai, Qihui Cao, Mi Zhang. The Anti-inflammatory Effects of Two Ent-kaurane Diterpenes from the Stems and Leaves of Gochnatia decora.
Combinatorial chemistry & high throughput screening.
2022; 25(11):1907-1913. doi:
10.2174/1386207325666211005152100
. [PMID: 34610781] - Xu Liu, Chun-Xia Chen, Ji-Zhou Wu. [Diterpenoids from Rabdosia flexicaulis].
Zhongguo Zhong yao za zhi = Zhongguo zhongyao zazhi = China journal of Chinese materia medica.
2022 Jan; 47(2):433-436. doi:
10.19540/j.cnki.cjcmm.20210907.201
. [PMID: 35178986] - Shanping Wang, Jiandong Huang, Keai Sinn Tan, Liangjun Deng, Fei Liu, Wen Tan. Isosteviol Sodium Ameliorates Dextran Sodium Sulfate-Induced Chronic Colitis through the Regulation of Metabolic Profiling, Macrophage Polarization, and NF-κB Pathway.
Oxidative medicine and cellular longevity.
2022; 2022(?):4636618. doi:
10.1155/2022/4636618
. [PMID: 35126813] - Keiko Hosohata, Denan Jin, Shinji Takai. Glaucocalyxin A Ameliorates Hypoxia/Reoxygenation-Induced Injury in Human Renal Proximal Tubular Epithelial Cell Line HK-2 Cells.
International journal of molecular sciences.
2021 Dec; 23(1):. doi:
10.3390/ijms23010446
. [PMID: 35008870] - Nisar Ahmad, Palwasha Khan, Abdullah Khan, Maliha Usman, Mohammad Ali, Hina Fazal, Durrishahwar, Muhammad Nazir Uddin, Christophe Hano, Bilal Haider Abbasi. Elicitation of Submerged Adventitious Root Cultures of Stevia rebaudiana with Cuscuta reflexa for Production of Biomass and Secondary Metabolites.
Molecules (Basel, Switzerland).
2021 Dec; 27(1):. doi:
10.3390/molecules27010014
. [PMID: 35011247] - Abilasha Deenadayalan, Vijayalakshmi Subramanian, Vijayalakshmi Paramasivan, Vishnu Priya Veeraraghavan, Gayathri Rengasamy, Janaki Coiambatore Sadagopan, Ponnulakshmi Rajagopal, Selvaraj Jayaraman. Stevioside Attenuates Insulin Resistance in Skeletal Muscle by Facilitating IR/IRS-1/Akt/GLUT 4 Signaling Pathways: An In Vivo and In Silico Approach.
Molecules (Basel, Switzerland).
2021 Dec; 26(24):. doi:
10.3390/molecules26247689
. [PMID: 34946771] - Tatsuya Shirahata, Rintaro Miyaishi, Tatsuki Kitazoe, Masaya Saito, Yuki Taneoka, Shuhei Hidaka, Masaki Yokoyama, Takayori Tojima, Tatsuya Katsumi, Nozomu Hirata, Takashi Nishino, Eisuke Kaji, Haruki Yamada, Takayuki Nagai, Hiroaki Kiyohara, Shunsuke Nakamori, Naruki Konishi, Yoshinori Kobayashi. Preparation of Tenuifolin from Polygala senega L. Root Using a Hydrolytic Continuous Flow System under High-Temperature, High-Pressure Conditions.
The Journal of organic chemistry.
2021 12; 86(23):16268-16277. doi:
10.1021/acs.joc.1c01125
. [PMID: 34730980] - Jinzhu Zhang, Minghai Tang, Yujie Chen, Dan Ke, Jie Zhou, Xinyu Xu, Wenxian Yang, Jianxiong He, Haohao Dong, Yuquan Wei, James H Naismith, Yi Lin, Xiaofeng Zhu, Wei Cheng. Catalytic flexibility of rice glycosyltransferase OsUGT91C1 for the production of palatable steviol glycosides.
Nature communications.
2021 12; 12(1):7030. doi:
10.1038/s41467-021-27144-4
. [PMID: 34857750] - Yu Zhu, Shuiliang Ruan, Heping Shen, Qiaobing Guan, Liping Zhai, Yi Yang. Oridonin regulates the polarized state of Kupffer cells to alleviate nonalcoholic fatty liver disease through ROS-NF-κB.
International immunopharmacology.
2021 Dec; 101(Pt B):108290. doi:
10.1016/j.intimp.2021.108290
. [PMID: 34717194] - Shahnawaz, Devendra Kumar Pandey, Merinashwari Konjengbam, Padmanabh Dwivedi, Prabhjot Kaur, Vijay Kumar, Durga Ray, Puja Ray, Romaan Nazir, Harmeet Kaur, Sidharth Parida, Abhijit Dey. Biotechnological interventions of in vitro propagation and production of valuable secondary metabolites in Stevia rebaudiana.
Applied microbiology and biotechnology.
2021 Dec; 105(23):8593-8614. doi:
10.1007/s00253-021-11580-9
. [PMID: 34708277]