Exact Mass: 185.0225258
Exact Mass Matches: 185.0225258
Found 168 metabolites which its exact mass value is equals to given mass value 185.0225258
,
within given mass tolerance error 0.01 dalton. Try search metabolite list with more accurate mass tolerance error
0.001 dalton.
2-Amino-3-carboxymuconic acid semialdehyde
2-Amino-3-carboxymuconic acid semialdehyde (CAS: 16597-58-3) is an intermediate metabolite of the tryptophan-niacin catabolic pathway. Current interest in the degradation of tryptophan is mostly due to the role of quinolinate and other metabolites in several neuropathological conditions. Quinolinate is a neurotoxin formed nonenzymatically from 2-amino-3-carboxymuconic semialdehyde in mammalian tissues. 2-Amino-3-carboxymuconic acid semialdehyde is enzymatically converted into 2-aminomuconate via 2-aminomuconic semialdehyde (PMID: 10510494, 16267312, 14275129). 2-amino-3-carboxymuconic acid semialdehyde is an intermediate metabolite of the tryptophan-niacin catabolic pathway. Current interest in the degradation of tryptophan is mostly due to the role of quinolinate and other metabolites in several neuropathological conditions. Quinolinate is a neurotoxin formed nonenzymatically from 2-amino-3-carboxymuconic semialdehyde in mammalian tissues. 2-Amino-3-carboxymuconic semialdehyde is enzymatically converted to 2-aminomuconate via 2-aminomuconic semialdehyde. (PMID: 10510494, 16267312, 14275129) [HMDB]
(4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate
(4s)-4-hydroxy-2,3,4,5-tetrahydro-(2s)-dipicolinate belongs to alpha amino acids and derivatives class of compounds. Those are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof (4s)-4-hydroxy-2,3,4,5-tetrahydro-(2s)-dipicolinate is soluble (in water) and a weakly acidic compound (based on its pKa). (4s)-4-hydroxy-2,3,4,5-tetrahydro-(2s)-dipicolinate can be found in a number of food items such as mamey sapote, red bell pepper, burbot, and kelp, which makes (4s)-4-hydroxy-2,3,4,5-tetrahydro-(2s)-dipicolinate a potential biomarker for the consumption of these food products.
L-alpha-amino-epsilon-keto-pimelate
L-alpha-amino-epsilon-keto-pimelate belongs to alpha amino acids and derivatives class of compounds. Those are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof. L-alpha-amino-epsilon-keto-pimelate is slightly soluble (in water) and a moderately acidic compound (based on its pKa). L-alpha-amino-epsilon-keto-pimelate can be found in a number of food items such as star fruit, cottonseed, black-eyed pea, and longan, which makes L-alpha-amino-epsilon-keto-pimelate a potential biomarker for the consumption of these food products.
Enaminomycin C
Enaminomycin C is a metabolite that has been isolated from Streptomyces species, which are a group of bacteria known for their ability to produce a wide array of secondary metabolites with diverse biological activities. Enaminomycin C is one such compound that has been identified and characterized from these bacteria. It belongs to the enediyne antibiotic class, which are complex natural products known for their potent antibacterial activity, particularly against Gram-positive bacteria. Enaminomycin C, like other enediyne antibiotics, is believed to exert its antibacterial effects by targeting the bacterial ribosome and forming a complex with the RNA, leading to the inhibition of protein synthesis and ultimately cell death. The structural features of Enaminomycin C contribute to its unique biological properties. It possesses an enediyne core, which is a key structural element responsible for its antibacterial activity. Additionally, it may have other functional groups or substituents that can influence its pharmacological properties, such as absorption, distribution, metabolism, and excretion. As a natural product with potential antimicrobial activity, Enaminomycin C and other related compounds have been of interest in the field of drug discovery and development. Researchers are interested in understanding their mechanisms of action, as well as exploring the potential for modifying these compounds to improve their therapeutic profiles, such as increasing potency, reducing toxicity, or expanding the spectrum of activity against drug-resistant bacteria. However, it is important to note that while Enaminomycin C has been identified and characterized from Streptomyces species, it may not have been extensively studied or developed into a therapeutic agent. Further research is needed to fully understand its potential as a novel antimicrobial agent and to address any challenges associated with its development, such as synthesis, scalability, and clinical trials.
OCP_186.0317_15.9
CONFIDENCE Tentative identification: most likely structure (Level 3); INTERNAL_ID 1307
(S)-2-CARBOXYMETHYL-PIPERIDINE-1-CARBOXYLICACIDTERT-BUTYLESTER
1,2,4-Triazine-3,5(2H,4H)-dione,6-(2-propen-1-ylthio)-
3-(AMINOMETHYL)TETRAHYDROTHIOPHENE 1,1-DIOXIDE HYDROCHLORIDE
4-Amino-2-(methylthio)pyrimidine-5-carboxylic acid
4-Chloro-6-fluoro-1H-benzo[d]imidazol-5-amine
C7H5ClFN3 (185.01560120000002)
6,7-DIHYDRO-4H-PYRANO[4,3-D]1,3-THIAZOLE-2-CARBOXYLIC ACID
2-CHLOROMETHYLPYRIDINE-5-CARBOXYLIC ACID METHYL ESTER
4-Aminotetrahydro-2H-Thiopyran 1,1-Dioxide Hydrochloride
1H-Pyrrolo[2,3-b]pyridin-3-amine, 5-chloro-4-fluoro-
C7H5ClFN3 (185.01560120000002)
5-Acetyl-3-chloro-6-methyl-1,2-dihydropyridin-2-one
2-Amino-5-chloro-6-fluorobenzimidazole
C7H5ClFN3 (185.01560120000002)
5-Amino-2-(methylthio)pyrimidine-4-carboxylic acid
5-METHOXY-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)NICOTINONITRILE
L-alpha-amino-epsilon-keto-pimelate
L-alpha-amino-epsilon-keto-pimelate belongs to alpha amino acids and derivatives class of compounds. Those are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof. L-alpha-amino-epsilon-keto-pimelate is slightly soluble (in water) and a moderately acidic compound (based on its pKa). L-alpha-amino-epsilon-keto-pimelate can be found in a number of food items such as star fruit, cottonseed, black-eyed pea, and longan, which makes L-alpha-amino-epsilon-keto-pimelate a potential biomarker for the consumption of these food products. L-α-amino-ε-keto-pimelate belongs to alpha amino acids and derivatives class of compounds. Those are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof. L-α-amino-ε-keto-pimelate is slightly soluble (in water) and a moderately acidic compound (based on its pKa). L-α-amino-ε-keto-pimelate can be found in a number of food items such as star fruit, cottonseed, black-eyed pea, and longan, which makes L-α-amino-ε-keto-pimelate a potential biomarker for the consumption of these food products.
(2e)-2-Amino-3-[(1e)-3-Oxoprop-1-En-1-Yl]but-2-Enedioic Acid
6-Sulfanylcarbonyl-1,2-dihydropyridine-2-carboxylic acid
(E,2E)-2-(hydroxymethylidene)-5-iminohex-3-enedioic acid
2-Amino-3-(3-oxoprop-1-enyl)but-2-enedioic acid
An oxo dicarboxylic acid that is but-2-enedioic acid substituted by an amino group at position 2 and a 3-oxoprop-1-enyl group at position 3.
2-amino-3-(3-oxoprop-1-en-1-yl)but-2-enedioic acid
The cis,cis-isomer of 2-amino-3-(3-oxoprop-1-enyl)but-2-enedioic acid.
(1s,5s,6s)-4-amino-5-hydroxy-2-oxo-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxylic acid
2-chloro-3,4-dimethyl-1-nitrobenzene
{"Ingredient_id": "HBIN005455","Ingredient_name": "2-chloro-3,4-dimethyl-1-nitrobenzene","Alias": "NA","Ingredient_formula": "C8H8ClNO2","Ingredient_Smile": "CC1=C(C(=C(C=C1)[N+](=O)[O-])Cl)C","Ingredient_weight": "185.61","OB_score": "NA","CAS_id": "52328-28-6","SymMap_id": "NA","TCMID_id": "NA","TCMSP_id": "NA","TCM_ID_id": "8673","PubChem_id": "67176205","DrugBank_id": "NA"}