d,l-serine (BioDeep_00000896638)
代谢物信息卡片
化学式: C3H7NO3 (105.0426)
中文名称:
谱图信息:
最多检出来源 Homo sapiens(blood) 57.14%
分子结构信息
SMILES: C(C(C(=O)[O-])[NH3+])O
InChI: InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m0/s1
相关代谢途径
Reactome(25)
- Metabolism
- Metabolism of vitamins and cofactors
- Metabolism of proteins
- Amino acid and derivative metabolism
- Metabolism of lipids
- Transport of small molecules
- SLC-mediated transmembrane transport
- Mycobacterium tuberculosis biological processes
- Transport of inorganic cations/anions and amino acids/oligopeptides
- Amino acid synthesis and interconversion (transamination)
- Serine biosynthesis
- Sulfur compound metabolism
- Metabolism of water-soluble vitamins and cofactors
- Selenoamino acid metabolism
- Metabolism of ingested SeMet, Sec, MeSec into H2Se
- Cysteine synthesis from O-acetylserine
- Phospholipid metabolism
- Glycerophospholipid biosynthesis
- Sulfur amino acid metabolism
- Cysteine formation from homocysteine
- Degradation of cysteine and homocysteine
- Sphingolipid metabolism
- Sphingolipid de novo biosynthesis
- Lipid metabolism
- Metabolism of folate and pterines
BioCyc(26)
- superpathway of aromatic amino acid biosynthesis
- superpathway of chorismate metabolism
- superpathway of L-tryptophan biosynthesis
- shinorine biosynthesis
- glycine betaine degradation I
- formaldehyde assimilation I (serine pathway)
- glycine betaine degradation
- N10-formyl-tetrahydrofolate biosynthesis
- seleno-amino acid biosynthesis
- cysteine biosynthesis II
- Serine degradation II
- cysteine biosynthesis III (mammalia)
- folate transformations II (plants)
- Methanobacterium thermoautotrophicum biosynthetic metabolism
- ammonia assimilation cycle III
- L-glutamine biosynthesis I
- archaetidylserine and archaetidylethanolamine biosynthesis
- gliotoxin biosynthesis
- L-glutamate and L-glutamine biosynthesis
- purine nucleobases degradation II (anaerobic)
- sphingolipid biosynthesis (plants)
- superpathway of L-methionine salvage and degradation
- superpathway of phospholipid biosynthesis II (plants)
- superpathway of seleno-compound metabolism
- prodigiosin biosynthesis
- tRNA charging
PlantCyc(4)
代谢反应
1629 个相关的代谢反应过程信息。
Reactome(201)
- Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Amino acid synthesis and interconversion (transamination):
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia
- Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp
- Amino acid synthesis and interconversion (transamination):
H2O + L-Asn ⟶ L-Asp + ammonia
- Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp
- Amino acid synthesis and interconversion (transamination):
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp
- Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp
- Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp
- Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Amino acid synthesis and interconversion (transamination):
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia
- Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp
- Amino acid synthesis and interconversion (transamination):
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Amino acid synthesis and interconversion (transamination):
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi
- Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp
- Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia
- Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp
- Mycobacterium tuberculosis biological processes:
CYSTA + H2O ⟶ 2OBUTA + L-Cys + ammonia
- Sulfur compound metabolism:
CYSTA + H2O ⟶ 2OBUTA + L-Cys + ammonia
- Sulfur amino acid metabolism:
CYSTA + H2O ⟶ 2OBUTA + L-Cys + ammonia
- Cysteine synthesis from O-acetylserine:
OAcSer + S(2-) ⟶ CH3COO- + L-Cys
- Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Sphingolipid metabolism:
H2O + dehydroepiandrosterone sulfate ⟶ DHEA + SO4(2-)
- Sphingolipid de novo biosynthesis:
3-ketosphinganine + H+ + TPNH ⟶ SPA + TPN
- Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Selenoamino acid metabolism:
H2O + SeMet ⟶ 2OBUTA + MeSeH + ammonia
- Metabolism of ingested SeMet, Sec, MeSec into H2Se:
H2O + SeMet ⟶ 2OBUTA + MeSeH + ammonia
- Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia
- Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Serine biosynthesis:
3POPA + L-Glu ⟶ 2OG + O-P-Ser
- Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia
- Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia
- Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia
- Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia
- Metabolism:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine
- Amino acid and derivative metabolism:
GAA + SAM ⟶ CRET + H+ + SAH
- Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia
- Metabolism:
GAA + SAM ⟶ CRET + H+ + SAH
- Amino acid and derivative metabolism:
GAA + SAM ⟶ CRET + H+ + SAH
- Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia
- Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Serine biosynthesis:
3POPA + L-Glu ⟶ 2OG + O-P-Ser
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of folate and pterines:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of folate and pterines:
FOLA + Q0VCN9 ⟶ FOLR2:FOLA
- Metabolism of vitamins and cofactors:
6x(PCCA:PCCB) + ATP + Btn ⟶ 6x(Btn-PCCA:PCCB) + AMP + PPi
- Metabolism of water-soluble vitamins and cofactors:
6x(PCCA:PCCB) + ATP + Btn ⟶ 6x(Btn-PCCA:PCCB) + AMP + PPi
- Metabolism of folate and pterines:
A0A5F4C041 + FOLA ⟶ FOLR2:FOLA
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of folate and pterines:
FOLA + folr ⟶ FOLR2:FOLA
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of folate and pterines:
FOLA + H+ + TPNH ⟶ DHF + TPN
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of folate and pterines:
FOLA + FOLR2_HUMAN ⟶ FOLR2:FOLA
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of folate and pterines:
FOLA + Folr2 ⟶ FOLR2:FOLA
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of folate and pterines:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Metabolism of vitamins and cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Metabolism of water-soluble vitamins and cofactors:
L-Cys + MOCS3:Zn2+ (red.) ⟶ L-Ala + MOCS3-S-S(1-):Zn2+
- Metabolism of folate and pterines:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of folate and pterines:
D4A4S5 + FOLA ⟶ FOLR2:FOLA
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of folate and pterines:
A0A5G2QLX9 + FOLA ⟶ FOLR2:FOLA
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of folate and pterines:
FOLA + Homologues of FOLR2 ⟶ FOLR2:FOLA
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of folate and pterines:
FOLA + H+ + TPNH ⟶ DHF + TPN
- Transport of small molecules:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- SLC-mediated transmembrane transport:
H+ + L-Glu ⟶ Glu + H+
- Transport of inorganic cations/anions and amino acids/oligopeptides:
H+ + L-Glu ⟶ Glu + H+
- Amino acid transport across the plasma membrane:
Cys + Na+ + alanine, serine, threonine, or cysteine ⟶ L-Cys + Na+ + alanine, serine, threonine, or cysteine
- Transport of small molecules:
CHOL + NPC2 ⟶ NPC2:CHOL
- SLC-mediated transmembrane transport:
Cys + Na+ + alanine, serine, threonine, or cysteine ⟶ L-Cys + Na+ + alanine, serine, threonine, or cysteine
- Transport of inorganic cations/anions and amino acids/oligopeptides:
Cys + Na+ + alanine, serine, threonine, or cysteine ⟶ L-Cys + Na+ + alanine, serine, threonine, or cysteine
- Amino acid transport across the plasma membrane:
Cys + Na+ + alanine, serine, threonine, or cysteine ⟶ L-Cys + Na+ + alanine, serine, threonine, or cysteine
- Transport of small molecules:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- SLC-mediated transmembrane transport:
Cys + Na+ + alanine, serine, threonine, or cysteine ⟶ L-Cys + Na+ + alanine, serine, threonine, or cysteine
- Transport of inorganic cations/anions and amino acids/oligopeptides:
Cys + Na+ + alanine, serine, threonine, or cysteine ⟶ L-Cys + Na+ + alanine, serine, threonine, or cysteine
- Amino acid transport across the plasma membrane:
Cys + Na+ + alanine, serine, threonine, or cysteine ⟶ L-Cys + Na+ + alanine, serine, threonine, or cysteine
- Transport of small molecules:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- SLC-mediated transmembrane transport:
Cys + Na+ + alanine, serine, threonine, or cysteine ⟶ L-Cys + Na+ + alanine, serine, threonine, or cysteine
- Transport of inorganic cations/anions and amino acids/oligopeptides:
Cys + Na+ + alanine, serine, threonine, or cysteine ⟶ L-Cys + Na+ + alanine, serine, threonine, or cysteine
- Amino acid transport across the plasma membrane:
Cys + Na+ + alanine, serine, threonine, or cysteine ⟶ L-Cys + Na+ + alanine, serine, threonine, or cysteine
- Transport of small molecules:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- SLC-mediated transmembrane transport:
H+ + L-Glu ⟶ Glu + H+
- Transport of inorganic cations/anions and amino acids/oligopeptides:
H+ + L-Glu ⟶ Glu + H+
- Amino acid transport across the plasma membrane:
Cys + Na+ + alanine, serine, threonine, or cysteine ⟶ L-Cys + Na+ + alanine, serine, threonine, or cysteine
- Transport of small molecules:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- SLC-mediated transmembrane transport:
Cys + Na+ + alanine, serine, threonine, or cysteine ⟶ L-Cys + Na+ + alanine, serine, threonine, or cysteine
- Transport of inorganic cations/anions and amino acids/oligopeptides:
Cys + Na+ + alanine, serine, threonine, or cysteine ⟶ L-Cys + Na+ + alanine, serine, threonine, or cysteine
- Amino acid transport across the plasma membrane:
Cys + Na+ + alanine, serine, threonine, or cysteine ⟶ L-Cys + Na+ + alanine, serine, threonine, or cysteine
- Transport of small molecules:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- SLC-mediated transmembrane transport:
Cys + Na+ + alanine, serine, threonine, or cysteine ⟶ L-Cys + Na+ + alanine, serine, threonine, or cysteine
- Transport of inorganic cations/anions and amino acids/oligopeptides:
Cys + Na+ + alanine, serine, threonine, or cysteine ⟶ L-Cys + Na+ + alanine, serine, threonine, or cysteine
- Amino acid transport across the plasma membrane:
Cys + Na+ + alanine, serine, threonine, or cysteine ⟶ L-Cys + Na+ + alanine, serine, threonine, or cysteine
- Transport of small molecules:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- SLC-mediated transmembrane transport:
Cys + Na+ + alanine, serine, threonine, or cysteine ⟶ L-Cys + Na+ + alanine, serine, threonine, or cysteine
- Transport of inorganic cations/anions and amino acids/oligopeptides:
Cys + Na+ + alanine, serine, threonine, or cysteine ⟶ L-Cys + Na+ + alanine, serine, threonine, or cysteine
- Amino acid transport across the plasma membrane:
Cys + Na+ + alanine, serine, threonine, or cysteine ⟶ L-Cys + Na+ + alanine, serine, threonine, or cysteine
- Transport of small molecules:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- SLC-mediated transmembrane transport:
Cys + Na+ + alanine, serine, threonine, or cysteine ⟶ L-Cys + Na+ + alanine, serine, threonine, or cysteine
- Transport of inorganic cations/anions and amino acids/oligopeptides:
Cys + Na+ + alanine, serine, threonine, or cysteine ⟶ L-Cys + Na+ + alanine, serine, threonine, or cysteine
- Amino acid transport across the plasma membrane:
Cys + Na+ + alanine, serine, threonine, or cysteine ⟶ L-Cys + Na+ + alanine, serine, threonine, or cysteine
- Transport of small molecules:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- SLC-mediated transmembrane transport:
Cys + Na+ + alanine, serine, threonine, or cysteine ⟶ L-Cys + Na+ + alanine, serine, threonine, or cysteine
- Transport of inorganic cations/anions and amino acids/oligopeptides:
Cys + Na+ + alanine, serine, threonine, or cysteine ⟶ L-Cys + Na+ + alanine, serine, threonine, or cysteine
- Amino acid transport across the plasma membrane:
Cys + Na+ + alanine, serine, threonine, or cysteine ⟶ L-Cys + Na+ + alanine, serine, threonine, or cysteine
- Transport of small molecules:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- SLC-mediated transmembrane transport:
ATP + GLUT1 / SLC2A1 tetramer ⟶ GLUT1:ATP tetramer
- Transport of inorganic cations/anions and amino acids/oligopeptides:
Cys + Na+ + alanine, serine, threonine, or cysteine ⟶ L-Cys + Na+ + alanine, serine, threonine, or cysteine
- Amino acid transport across the plasma membrane:
Cys + Na+ + alanine, serine, threonine, or cysteine ⟶ L-Cys + Na+ + alanine, serine, threonine, or cysteine
- Transport of small molecules:
ATP + CHOL + H2O ⟶ ADP + CHOL + Pi
- SLC-mediated transmembrane transport:
Cys + Na+ + alanine, serine, threonine, or cysteine ⟶ L-Cys + Na+ + alanine, serine, threonine, or cysteine
- Transport of inorganic cations/anions and amino acids/oligopeptides:
Cys + Na+ + alanine, serine, threonine, or cysteine ⟶ L-Cys + Na+ + alanine, serine, threonine, or cysteine
- Amino acid transport across the plasma membrane:
Cys + Na+ + alanine, serine, threonine, or cysteine ⟶ L-Cys + Na+ + alanine, serine, threonine, or cysteine
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp
- Serine biosynthesis:
3POPA + L-Glu ⟶ 2OG + O-P-Ser
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Amino acid synthesis and interconversion (transamination):
H2O + L-Asn ⟶ L-Asp + ammonia
- Serine biosynthesis:
3POPA + L-Glu ⟶ 2OG + O-P-Ser
- Sulfur amino acid metabolism:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia
- Cysteine formation from homocysteine:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia
- Sulfur amino acid metabolism:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia
- Cysteine formation from homocysteine:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia
- Sulfur amino acid metabolism:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia
- Cysteine formation from homocysteine:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia
- Sulfur amino acid metabolism:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia
- Cysteine formation from homocysteine:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia
- Sulfur amino acid metabolism:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia
- Cysteine formation from homocysteine:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia
- Sulfur amino acid metabolism:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia
- Cysteine formation from homocysteine:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia
- Sulfur amino acid metabolism:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia
- Cysteine formation from homocysteine:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia
- Sulfur amino acid metabolism:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia
- Cysteine formation from homocysteine:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia
- Sulfur amino acid metabolism:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia
- Cysteine formation from homocysteine:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia
- Sulfur amino acid metabolism:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia
- Cysteine formation from homocysteine:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia
- Sulfur amino acid metabolism:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia
- Cysteine formation from homocysteine:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia
- Sulfur amino acid metabolism:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia
- Cysteine formation from homocysteine:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia
- Sulfur amino acid metabolism:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia
- Cysteine formation from homocysteine:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia
- Sulfur amino acid metabolism:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia
- Cysteine formation from homocysteine:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia
- Sulfur amino acid metabolism:
MTAD + Pi ⟶ Ade + MTRIBP
- Cysteine formation from homocysteine:
HCYS + Ser ⟶ H2O + L-Cystathionine
- Degradation of cysteine and homocysteine:
H2O + HCYS ⟶ 2OBUTA + H2S + ammonia
- Degradation of cysteine and homocysteine:
H2O + HCYS ⟶ 2OBUTA + H2S + ammonia
- Degradation of cysteine and homocysteine:
H2O + HCYS ⟶ 2OBUTA + H2S + ammonia
- Metabolism:
H2O + PBG ⟶ HMBL + ammonia
- Lipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
BioCyc(102)
- superpathway of chorismate metabolism:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- enterobactin biosynthesis:
H2O + isochorismate ⟶ (2S,3S)-2,3-dihydroxy-2,3-dihydrobenzoate + pyruvate
- enterobactin biosynthesis:
H2O + isochorismate ⟶ (2S,3S)-2,3-dihydroxy-2,3-dihydrobenzoate + pyruvate
- enterobactin biosynthesis:
H2O + isochorismate ⟶ (2S,3S)-2,3-dihydroxy-2,3-dihydrobenzoate + pyruvate
- superpathway of chorismate metabolism:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- enterobactin biosynthesis:
H2O + isochorismate ⟶ (2S,3S)-2,3-dihydroxy-2,3-dihydrobenzoate + pyruvate
- superpathway of chorismate metabolism:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- nocardicin A biosynthesis:
H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster + nocardicin C ⟶ H2O + an oxidized ferredoxin [iron-sulfur] cluster + nocardicin A
- ceramide de novo biosynthesis:
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine + CO2 + coenzyme A
- sphingolipid biosynthesis (mammals):
D-erythro-sphinganine + an acyl-CoA ⟶ H+ + a dihydroceramide + coenzyme A
- ceramide de novo biosynthesis:
D-erythro-sphinganine + an acyl-CoA ⟶ H+ + a dihydroceramide + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + O2 + a dihydroceramide + a ferrocytochrome b5 ⟶ H2O + a ferricytochrome b5 + a phytoceramide
- sphingolipid biosynthesis (yeast):
D-erythro-sphinganine + NADP+ ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis:
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine + CO2 + coenzyme A
- ceramide de novo biosynthesis:
D-erythro-sphinganine + NADP+ ⟶ 3-dehydrosphinganine + H+ + NADPH
- prodigiosin biosynthesis:
2-methyl-3-pentyl-1H-pyrrole + 4-methoxy-2,2'-bipyrrole-5-carbaldehyde + ATP ⟶ ADP + H+ + phosphate + prodigiosin
- hydrogen sulfide biosynthesis II (mammalian):
H2O + cys ⟶ ammonium + hydrogen sulfide + pyruvate
- hydrogen sulfide biosynthesis II (mammalian):
H2O + cys ⟶ ammonium + hydrogen sulfide + pyruvate
- L-serine degradation:
ser ⟶ ammonium + pyruvate
- selenocysteine biosynthesis I (bacteria):
ATP + H2O + hydrogen selenide ⟶ AMP + phosphate + selenophosphate
- tRNA charging pathway:
ATP + H+ + ala ⟶ AMP + diphosphate
- tRNA charging pathway:
ATP + H+ + ala ⟶ AMP + diphosphate
- selenocysteine biosynthesis II (archaea and eukaryotes):
ATP + H2O + hydrogen selenide ⟶ AMP + phosphate + selenophosphate
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- superpathway of aromatic amino acid biosynthesis:
3-deoxy-D-arabino-heptulosonate 7-phosphate ⟶ 3-dehydroquinate + phosphate
- superpathway of chorismate metabolism:
3-octaprenyl-4-hydroxybenzoate + H+ ⟶ 2-octaprenylphenol + CO2
- superpathway of L-tryptophan biosynthesis:
3-deoxy-D-arabino-heptulosonate 7-phosphate ⟶ 3-dehydroquinate + phosphate
- superpathway of aromatic amino acid biosynthesis:
2-oxoglutarate + phe ⟶ 3-phenyl-2-oxopropanoate + glu
- superpathway of chorismate metabolism:
2-oxoglutarate + phe ⟶ 3-phenyl-2-oxopropanoate + glu
- L-tryptophan biosynthesis:
1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate + H+ ⟶ (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate + CO2 + H2O
- superpathway of phenylalanine, tyrosine and tryptophan biosynthesis:
pyruvate + tyr ⟶ 4-hydroxyphenylpyruvate + ala
- tryptophan biosynthesis:
1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate + H+ ⟶ (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate + CO2 + H2O
- superpathway of phenylalanine, tyrosine and tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate + H+ ⟶ (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate + CO2 + H2O
- superpathway of aromatic amino acid biosynthesis:
2-oxoglutarate + tyr ⟶ 4-hydroxyphenylpyruvate + Glu
- superpathway of chorismate metabolism:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- superpathway of L-tryptophan biosynthesis:
1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate + H+ ⟶ (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate + CO2 + H2O
- tryptophan biosynthesis:
1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate + H+ ⟶ (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate + CO2 + H2O
- superpathway of phenylalanine, tyrosine, and tryptophan biosynthesis:
2-oxo-3-phenylpropanoate + glt ⟶ 2-oxoglutarate + phe
- superpathway of tryptophan biosynthesis:
1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate + H+ ⟶ (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate + CO2 + H2O
- superpathway of phenylalanine, tyrosine, and tryptophan biosynthesis:
glt + phenylpyruvate ⟶ 2-oxoglutarate + phe
- tryptophan biosynthesis:
1-(o-carboxyphenylamino)-1'-deoxyribulose-5'-phosphate + H+ ⟶ (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate + CO2 + H2O
- superpathway of chorismate:
glt + phenylpyruvate ⟶ 2-oxoglutarate + phe
- superpathway of L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- superpathway of phenylalanine, tyrosine, and tryptophan biosynthesis:
2-oxoglutarate + tyr ⟶ 4-hydroxyphenylpyruvate + glt
- superpathway of tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- superpathway of tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- superpathway of phenylalanine, tyrosine, and tryptophan biosynthesis:
2-oxo-3-phenylpropanoate + glt ⟶ 2-oxoglutarate + phe
- tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- superpathway of phenylalanine, tyrosine, and tryptophan biosynthesis:
2-oxo-3-phenylpropanoate + glt ⟶ 2-oxoglutarate + phe
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- superpathway of aromatic amino acid biosynthesis:
2-oxo-3-phenylpropanoate + glt ⟶ 2-oxoglutarate + phe
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- superpathway of aromatic amino acid biosynthesis:
indole + ser ⟶ H2O + trp
- superpathway of aromatic amino acid biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- superpathway of chorismate metabolism:
2-oxoglutarate + tyr ⟶ 4-hydroxyphenylpyruvate + glt
- superpathway of phenylalanine, tyrosine, and tryptophan biosynthesis:
2-oxo-3-phenylpropanoate + glt ⟶ 2-oxoglutarate + phe
- superpathway of aromatic amino acid biosynthesis:
2-oxoglutarate + tyr ⟶ 4-hydroxyphenylpyruvate + glt
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- superpathway of L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- superpathway of L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- superpathway of phenylalanine, tyrosine, and tryptophan biosynthesis:
2-oxoglutarate + tyr ⟶ 4-hydroxyphenylpyruvate + glt
- tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- superpathway of chorismate metabolism:
2-oxoglutarate + tyr ⟶ 4-hydroxyphenylpyruvate + glt
- superpathway of tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- superpathway of phenylalanine, tyrosine, and tryptophan biosynthesis:
2-oxoglutarate + tyr ⟶ 4-hydroxyphenylpyruvate + glt
- tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- superpathway of tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- superpathway of phenylalanine, tyrosine, and tryptophan biosynthesis:
2-oxoglutarate + tyr ⟶ 4-hydroxyphenylpyruvate + glt
- tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- superpathway of tryptophan biosynthesis:
ATP + shikimate ⟶ ADP + H+ + shikimate-3-phosphate
- tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- superpathway of phenylalanine, tyrosine, and tryptophan biosynthesis:
2-oxoglutarate + tyr ⟶ 4-hydroxyphenylpyruvate + glt
- tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- superpathway of tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- superpathway of tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- superpathway of aromatic amino acid biosynthesis:
2-oxoglutarate + tyr ⟶ 4-hydroxyphenylpyruvate + glt
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- superpathway of L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- superpathway of L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- superpathway of L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- superpathway of L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- superpathway of L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
Plant Reactome(888)
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- PCO cycle:
glycolate ⟶ glyoxylate
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
5,10-methylene-THF + Gly + H2O ⟶ Ser + THF
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + L-Glu + a tetrahydrofolate polyglutamate ⟶ ADP + Pi + a tetrahydrofolate polyglutamate
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
9-mercaptodethiobiotin ⟶ Btn
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
5,10-methylene-THF + Gly + H2O ⟶ Ser + THF
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
5,10-methylene-THF + Gly + H2O ⟶ Ser + THF
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Folate polyglutamylation I:
5,10-methylene-THF + Gly + H2O ⟶ Ser + THF
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + L-Glu + a tetrahydrofolate polyglutamate ⟶ ADP + Pi + a tetrahydrofolate polyglutamate
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + L-Glu + a tetrahydrofolate polyglutamate ⟶ ADP + Pi + a tetrahydrofolate polyglutamate
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + L-Glu + a tetrahydrofolate polyglutamate ⟶ ADP + Pi + a tetrahydrofolate polyglutamate
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Glycine biosynthesis I:
Ser + THF ⟶ 5,10-methylene-THF + Gly + H2O
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Amino acid metabolism:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA
- Amino acid biosynthesis:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA
- Cysteine biosynthesis I:
H2S + OAcSer ⟶ CH3COO- + L-Cys
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
L-Ser + indole ⟶ H2O + L-Trp
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
L-Ser + indole ⟶ H2O + L-Trp
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
L-Ser + indole ⟶ H2O + L-Trp
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
- Fatty acid and lipid metabolism:
NAD(P)H + Oxygen + lathosterol ⟶ H2O + NAD(P)+ + Provitamin D3
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
INOH(0)
PlantCyc(437)
- glycine biosynthesis I:
a tetrahydrofolate + ser ⟶ H2O + a 5,10-methylenetetrahydrofolate + gly
- glycine biosynthesis:
a tetrahydrofolate + ser ⟶ H2O + a 5,10-methylenetetrahydrofolate + gly
- folate polyglutamylation:
ATP + a 5,10-methylenetetrahydrofolate + glu ⟶ ADP + a 5,10-methylenetetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation:
ATP + a tetrahydrofolate + glu ⟶ ADP + a tetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- ceramide de novo biosynthesis:
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- phosphatidylserine and phosphatidylethanolamine biosynthesis I:
H+ + a 3-sn-phosphatidyl-L-serine ⟶ CO2 + an L-1-phosphatidylethanolamine
- phosphatidylserine and phosphatidylethanolamine biosynthesis I:
H+ + a 3-sn-phosphatidyl-L-serine ⟶ CO2 + an L-1-phosphatidylethanolamine
- phosphatidylserine and phosphatidylethanolamine biosynthesis I:
H+ + a 3-sn-phosphatidyl-L-serine ⟶ CO2 + an L-1-phosphatidylethanolamine
- phosphatidylserine and phosphatidylethanolamine biosynthesis I:
H+ + a 3-sn-phosphatidyl-L-serine ⟶ CO2 + an L-1-phosphatidylethanolamine
- phosphatidylserine and phosphatidylethanolamine biosynthesis I:
H+ + a 3-sn-phosphatidyl-L-serine ⟶ CO2 + an L-1-phosphatidylethanolamine
- phosphatidylserine and phosphatidylethanolamine biosynthesis I:
H+ + a 3-sn-phosphatidyl-L-serine ⟶ CO2 + an L-1-phosphatidylethanolamine
- phosphatidylserine and phosphatidylethanolamine biosynthesis I:
H+ + a 3-sn-phosphatidyl-L-serine ⟶ CO2 + an L-1-phosphatidylethanolamine
- phosphatidylserine and phosphatidylethanolamine biosynthesis I:
H+ + a 3-sn-phosphatidyl-L-serine ⟶ CO2 + an L-1-phosphatidylethanolamine
- phosphatidylserine and phosphatidylethanolamine biosynthesis I:
H+ + a 3-sn-phosphatidyl-L-serine ⟶ CO2 + an L-1-phosphatidylethanolamine
- phosphatidylserine and phosphatidylethanolamine biosynthesis I:
H+ + a 3-sn-phosphatidyl-L-serine ⟶ CO2 + an L-1-phosphatidylethanolamine
- phosphatidylserine and phosphatidylethanolamine biosynthesis I:
H+ + a 3-sn-phosphatidyl-L-serine ⟶ CO2 + an L-1-phosphatidylethanolamine
- phosphatidylserine and phosphatidylethanolamine biosynthesis I:
H+ + a 3-sn-phosphatidyl-L-serine ⟶ CO2 + an L-1-phosphatidylethanolamine
- phosphatidylserine and phosphatidylethanolamine biosynthesis I:
H+ + a phosphatidylserine ⟶ CO2 + a phosphatidylethanolamine
- phosphatidylserine and phosphatidylethanolamine biosynthesis I:
H+ + a phosphatidylserine ⟶ CO2 + a phosphatidylethanolamine
- phosphatidylserine and phosphatidylethanolamine biosynthesis I:
H+ + a phosphatidylserine ⟶ CO2 + a phosphatidylethanolamine
- phosphatidylserine and phosphatidylethanolamine biosynthesis I:
H+ + a phosphatidylserine ⟶ CO2 + a phosphatidylethanolamine
- phosphatidylserine and phosphatidylethanolamine biosynthesis I:
H+ + a phosphatidylserine ⟶ CO2 + a phosphatidylethanolamine
- phosphatidylserine and phosphatidylethanolamine biosynthesis I:
H+ + a phosphatidylserine ⟶ CO2 + a phosphatidylethanolamine
- phosphatidylserine and phosphatidylethanolamine biosynthesis I:
H+ + a phosphatidylserine ⟶ CO2 + a phosphatidylethanolamine
- phosphatidylserine and phosphatidylethanolamine biosynthesis I:
a CDP-diacylglycerol + ser ⟶ CMP + H+ + a phosphatidylserine
- phosphatidylserine and phosphatidylethanolamine biosynthesis I:
a CDP-diacylglycerol + ser ⟶ CMP + H+ + a phosphatidylserine
- phosphatidylserine and phosphatidylethanolamine biosynthesis I:
a CDP-diacylglycerol + ser ⟶ CMP + H+ + a phosphatidylserine
- phosphatidylserine and phosphatidylethanolamine biosynthesis I:
H+ + a phosphatidylserine ⟶ CO2 + a phosphatidylethanolamine
- phosphatidylserine and phosphatidylethanolamine biosynthesis I:
a CDP-diacylglycerol + ser ⟶ CMP + H+ + a phosphatidylserine
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- superpathway of phenylalanine, tyrosine and tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- L-tryptophan biosynthesis:
chorismate + gln ⟶ H+ + anthranilate + glu + pyruvate
COVID-19 Disease Map(0)
PathBank(0)
PharmGKB(0)
0 个相关的物种来源信息
在这里通过桑基图来展示出与当前的这个代谢物在我们的BioDeep知识库中具有相关联信息的其他代谢物。在这里进行关联的信息来源主要有:
- PubMed: 来源于PubMed文献库中的文献信息,我们通过自然语言数据挖掘得到的在同一篇文献中被同时提及的相关代谢物列表,这个列表按照代谢物同时出现的文献数量降序排序,取前10个代谢物作为相关研究中关联性很高的代谢物集合展示在桑基图中。
- NCBI Taxonomy: 通过文献数据挖掘,得到的代谢物物种来源信息关联。这个关联信息同样按照出现的次数降序排序,取前10个代谢物作为高关联度的代谢物集合展示在桑吉图上。
- Chemical Taxonomy: 在物质分类上处于同一个分类集合中的其他代谢物
- Chemical Reaction: 在化学反应过程中,存在为当前代谢物相关联的生化反应过程中的反应底物或者反应产物的关联代谢物信息。
点击图上的相关代谢物的名称,可以跳转到相关代谢物的信息页面。
亚细胞结构定位 | 关联基因列表 |
---|