Acetate (BioDeep_00000837589)
代谢物信息卡片
化学式: C2H3O2- (59.0133)
中文名称:
谱图信息:
最多检出来源 Homo sapiens(blood) 97.06%
分子结构信息
SMILES: CC(=O)[O-]
InChI: InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/p-1
描述信息
A monocarboxylic acid anion resulting from the removal of a proton from the carboxy group of acetic acid.
Acetate, also known as acetic acid or ethanoate, is a member of the class of compounds known as carboxylic acids. Carboxylic acids are compounds containing a carboxylic acid group with the formula -C(=O)OH. Acetate is soluble (in water) and a weakly acidic compound (based on its pKa). Acetate can be found in a number of food items such as pitanga, soursop, green bean, and beech nut, which makes acetate a potential biomarker for the consumption of these food products. Acetate is a non-carcinogenic (not listed by IARC) potentially toxic compound. An acetate is a salt formed by the combination of acetic acid with an alkaline, earthy, or metallic base. "Acetate" also describes the conjugate base or ion (specifically, the negatively charged ion called an anion) typically found in aqueous solution and written with the chemical formula C2H3O2−. The neutral molecules formed by the combination of the acetate ion and a positive ion (called a cation) are also commonly called "acetates" (hence, acetate of lead, acetate of aluminum, etc.). The simplest of these is hydrogen acetate (called acetic acid) with corresponding salts, esters, and the polyatomic anion CH3CO2−, or CH3COO− . In cases of skin or eye exposure, the area should be flushed with water and burns covered with dry, sterile dressings after decontamination. If ingested, rinse mouth and administer 5 mL/kg up to 200 mL of water for dilution. Watch for signs of respiratory insufficiency and assist respiration if necessary (A569) (T3DB).
同义名列表
1 个代谢物同义名
数据库引用编号
8 个数据库交叉引用编号
- ChEBI: CHEBI:30089
- PubChem: 175
- DrugBank: DB14511
- ChEMBL: CHEMBL1354
- MeSH: Acetates
- foodb: FDB030644
- CAS: 71-50-1
- MetaboLights: MTBLC30089
分类词条
相关代谢途径
Reactome(18)
- Metabolism
- Biological oxidations
- Phase I - Functionalization of compounds
- Drug ADME
- Aspirin ADME
- Metabolism of lipids
- Chromatin organization
- Chromatin modifying enzymes
- Gene expression (Transcription)
- RNA Polymerase II Transcription
- Generic Transcription Pathway
- Transcriptional Regulation by TP53
- Phospholipid metabolism
- Glycerophospholipid biosynthesis
- Neuronal System
- Transmission across Chemical Synapses
- Neurotransmitter clearance
- APAP ADME
BioCyc(90)
- 4-hydroxyacetophenone degradation
- superpathway of L-phenylalanine biosynthesis
- superpathway of N-acetylglucosamine, N-acetylmannosamine and N-acetylneuraminate degradation
- acetate and ATP formation from acetyl-CoA I
- anaerobic energy metabolism (invertebrates, mitochondrial)
- superpathway of anaerobic energy metabolism (invertebrates)
- superpathway of N-acetylneuraminate degradation
- superpathway of aromatic amino acid biosynthesis
- chorismate biosynthesis I
- chorismate biosynthesis from 3-dehydroquinate
- superpathway of L-tyrosine biosynthesis
- superpathway of chorismate metabolism
- gallate degradation III (anaerobic)
- superpathway of L-tryptophan biosynthesis
- methanogenesis from acetate
- gallate biosynthesis
- Amaryllidacea alkaloids biosynthesis
- superpathway of tryptophan utilization
- superpathway of melatonin degradation
- L-lysine biosynthesis II
- superpathway of arginine and polyamine biosynthesis
- creatinine degradation III
- morphine biosynthesis
- propane degradation II
- phenylmercury acetate degradation
- chitin degradation to ethanol
- anhydromuropeptides recycling I
- chitin degradation I (archaea)
- chitosan biosynthesis
- anhydromuropeptides recycling
- 2,6-dinitrotoluene degradation
- superpathway of microbial D-galacturonate and D-glucuronate degradation
- mixed acid fermentation
- superpathway of L-lysine degradation
- L-lysine fermentation to acetate and butanoate
- superpathway of Clostridium acetobutylicum acidogenic and solventogenic fermentation
- pyruvate fermentation to acetone
- superpathway of Clostridium acetobutylicum solventogenic fermentation
- propane degradation I
- NAD/NADP-NADH/NADPH cytosolic interconversion (yeast)
- superpathway NAD/NADP - NADH/NADPH interconversion (yeast)
- superpathway NAD/NADP - NADH/NADPH interconversion
- NAD/NADP-NADH/NADPH cytosolic interconversion
- seleno-amino acid biosynthesis
- nivalenol biosynthesis
- T-2 toxin biosynthesis
- superpathway of trichothecene biosynthesis
- purine nucleotides degradation III (anaerobic)
- purine nucleotides degradation IV (anaerobic)
- glutamate degradation V (via hydroxyglutarate)
- lysine fermentation to acetate and butyrate
- glutamate degradation VII (to butanoate)
- 4-aminobutyrate degradation V
- glutamate degradation VI (to pyruvate)
- chitin derivatives degradation
- L-lysine degradation III
- ephedrine biosynthesis
- pyruvate fermentation to acetate and lactate II
- pyruvate fermentation to acetate I
- vitamin B6 degradation
- superpathway of Clostridium acetobutylicum acidogenic fermentation
- oxalate biosynthesis
- D-glucarate degradation I
- hexitol fermentation to lactate, formate, ethanol and acetate
- orcinol degradation
- superpathway of aromatic compound degradation via 2-hydroxypentadienoate
- purine nucleobases degradation I (anaerobic)
- purine nucleobases degradation II (anaerobic)
- superpathway of aromatic compound degradation via 3-oxoadipate
- phosphinothricin tripeptide biosynthesis
- puromycin biosynthesis
- L-arginine biosynthesis I (via L-ornithine)
- aromatic compounds degradation via β-ketoadipate
- L-ornithine biosynthesis I
- superpathway of D-glucarate and D-galactarate degradation
- chitobiose degradation
- epoxypseudoisoeugenol-2-methylbutanoate biosynthesis
- pyruvate to cytochrome bo oxidase electron transfer
- ethanolamine utilization
- versicolorin B biosynthesis
- 1,2-propanediol biosynthesis from lactate (engineered)
- t-anethole biosynthesis
- melatonin degradation II
- indole-3-acetate degradation
- sophorosyloxydocosanoate deacetylation
- L-glutamate degradation VII (to butanoate)
- L-glutamate degradation VI (to pyruvate)
- superpathway of seleno-compound metabolism
- ajmaline and sarpagine biosynthesis
- androgen biosynthesis
代谢反应
647 个相关的代谢反应过程信息。
Reactome(149)
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Ketone body metabolism:
ACA + H+ + NADH ⟶ NAD + bHBA
- Synthesis of Ketone Bodies:
ACA + H+ + NADH ⟶ NAD + bHBA
- Biological oxidations:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN
- Phase I - Functionalization of compounds:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN
- Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Drug ADME:
APAP + UDP-GlcA ⟶ APAP-GlcA + UDP
- APAP ADME:
APAP + UDP-GlcA ⟶ APAP-GlcA + UDP
- Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic
- APAP ADME:
APAP + UDP-GlcA ⟶ APAP-GlcA + UDP
- Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic
- APAP ADME:
APAP + UDP-GlcA ⟶ APAP-GlcA + UDP
- Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic
- APAP ADME:
APAP + UDP-GlcA ⟶ APAP-GlcA + UDP
- Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic
- APAP ADME:
APAP + UDP-GlcA ⟶ APAP-GlcA + UDP
- Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic
- APAP ADME:
APAP + UDP-GlcA ⟶ APAP-GlcA + UDP
- Drug ADME:
AMP + abacavir ⟶ Ade-Rib + xenobiotic
- APAP ADME:
APAP + UDP-GlcA ⟶ APAP-GlcA + UDP
- Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic
- APAP ADME:
APAP + UDP-GlcA ⟶ APAP-GlcA + UDP
- Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic
- APAP ADME:
APAP + UDP-GlcA ⟶ APAP-GlcA + UDP
- Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic
- APAP ADME:
APAP + UDP-GlcA ⟶ APAP-GlcA + UDP
- Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic
- APAP ADME:
APAP + UDP-GlcA ⟶ APAP-GlcA + UDP
- Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Biological oxidations:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN
- Phase I - Functionalization of compounds:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN
- Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Phase I - Functionalization of compounds:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Biological oxidations:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN
- Phase I - Functionalization of compounds:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Phase I - Functionalization of compounds:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Phase I - Functionalization of compounds:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Ethanol oxidation:
ATP + CH3COO- + CoA-SH ⟶ AMP + Ac-CoA + PPi
- Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi
- Biological oxidations:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN
- Phase I - Functionalization of compounds:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Biological oxidations:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Phase I - Functionalization of compounds:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Biological oxidations:
H+ + Oxygen + TPNH + progesterone ⟶ 11DCORST + H2O + TPN
- Phase I - Functionalization of compounds:
H+ + Oxygen + TPNH + progesterone ⟶ 11DCORST + H2O + TPN
- Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Phase I - Functionalization of compounds:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Phase I - Functionalization of compounds:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Biological oxidations:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN
- Phase I - Functionalization of compounds:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN
- Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Phase I - Functionalization of compounds:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Metabolism:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine
- Biological oxidations:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Phase I - Functionalization of compounds:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Metabolism:
GAA + SAM ⟶ CRET + H+ + SAH
- Biological oxidations:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Phase I - Functionalization of compounds:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi
- Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Phase I - Functionalization of compounds:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Phase I - Functionalization of compounds:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Neuronal System:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP
- Transmission across Chemical Synapses:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP
- Neurotransmitter clearance:
AcCho + H2O ⟶ Cho + acetate
- Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Phospholipid metabolism:
H2O + PETA ⟶ CH3CHO + Pi + ammonia
- Glycerophospholipid biosynthesis:
H2O + PETA ⟶ CH3CHO + Pi + ammonia
- Synthesis of PC:
AcCho + H2O ⟶ Cho + acetate
- Neuronal System:
DA + SAM ⟶ 3MT + SAH
- Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH
- Neurotransmitter clearance:
DA + SAM ⟶ 3MT + SAH
- Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Phospholipid metabolism:
H2O + PETA ⟶ CH3CHO + Pi + ammonia
- Glycerophospholipid biosynthesis:
H2O + PETA ⟶ CH3CHO + Pi + ammonia
- Synthesis of PC:
ATP + Cho ⟶ ADP + PCho
- Metabolism of lipids:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi
- Phospholipid metabolism:
1-acyl LPC + H2O ⟶ GPCho + LCFA(-)
- Glycerophospholipid biosynthesis:
1-acyl LPC + H2O ⟶ GPCho + LCFA(-)
- Synthesis of PC:
AcCho + H2O ⟶ Cho + acetate
- Neuronal System:
3MT + H2O + Oxygen ⟶ H2O2 + HVA + ammonia
- Transmission across Chemical Synapses:
3MT + H2O + Oxygen ⟶ H2O2 + HVA + ammonia
- Neurotransmitter clearance:
3MT + H2O + Oxygen ⟶ H2O2 + HVA + ammonia
- Neuronal System:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP
- Transmission across Chemical Synapses:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP
- Neurotransmitter clearance:
AcCho + H2O ⟶ Cho + acetate
- Metabolism of lipids:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA
- Phospholipid metabolism:
H2O + PETA ⟶ CH3CHO + Pi + ammonia
- Glycerophospholipid biosynthesis:
H2O + PETA ⟶ CH3CHO + Pi + ammonia
- Synthesis of PC:
Ac-CoA + Cho ⟶ AcCho + CoA-SH
- Neuronal System:
DA + SAM ⟶ 3MT + SAH
- Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH
- Neurotransmitter clearance:
DA + SAM ⟶ 3MT + SAH
- Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Phospholipid metabolism:
H2O + PETA ⟶ CH3CHO + Pi + ammonia
- Glycerophospholipid biosynthesis:
H2O + PETA ⟶ CH3CHO + Pi + ammonia
- Synthesis of PC:
ATP + Cho ⟶ ADP + PCho
- Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Phospholipid metabolism:
H2O + PETA ⟶ CH3CHO + Pi + ammonia
- Glycerophospholipid biosynthesis:
H2O + PETA ⟶ CH3CHO + Pi + ammonia
- Synthesis of PC:
AcCho + H2O ⟶ Cho + acetate
- Neuronal System:
DA + SAM ⟶ 3MT + SAH
- Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH
- Neurotransmitter clearance:
DA + SAM ⟶ 3MT + SAH
- Metabolism of lipids:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi
- Phospholipid metabolism:
H2O + PETA ⟶ CH3CHO + Pi + ammonia
- Glycerophospholipid biosynthesis:
H2O + PETA ⟶ CH3CHO + Pi + ammonia
- Synthesis of PC:
AcCho + H2O ⟶ Cho + acetate
- Neuronal System:
DA + SAM ⟶ 3MT + SAH
- Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH
- Neurotransmitter clearance:
DA + SAM ⟶ 3MT + SAH
- Neuronal System:
DA + SAM ⟶ 3MT + SAH
- Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH
- Neurotransmitter clearance:
DA + SAM ⟶ 3MT + SAH
- Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Phospholipid metabolism:
H2O + PETA ⟶ CH3CHO + Pi + ammonia
- Glycerophospholipid biosynthesis:
H2O + PETA ⟶ CH3CHO + Pi + ammonia
- Synthesis of PC:
Ac-CoA + Cho ⟶ AcCho + CoA-SH
BioCyc(382)
- deoxynivalenol biosynthesis:
7,8-dihydroxycalonectrin ⟶ 3,15-acetyldeoxynivalenol
- superpathway of trichothecene biosynthesis:
7,8-dihydroxycalonectrin ⟶ 3,15-acetyldeoxynivalenol
- propane degradation I:
NAD+ + propan-2-ol ⟶ H+ + NADH + acetone
- t-anethole biosynthesis:
trans-anol + SAM ⟶ t-anethole + H+ + SAH
- epoxypseudoisoeugenol-2-methylbutanoate biosynthesis:
2-methylbutanoate + pseudoisoeugenol ⟶ epoxypseudoisoeugenol-2-methylbutanoate
- phosalacine biosynthesis:
N-acetylphosphinothricyl-L-alanyl-L-leucine + H2O ⟶ acetate + phosalacine
- creatinine degradation III:
A(H2) + H2O + creatinine ⟶ A + acetate + methylguanidinium
- lupinate biosynthesis:
O-acetyl-L-serine + trans-zeatin ⟶ H+ + acetate + lupinate
- chitin degradation I (archaea):
β-D-glucosaminyl-(1→4)-N-acetyl-D-glucosamine + H2O ⟶ N-acetyl-D-glucosamine + D-glucosamine
- phenylmercury acetate degradation:
H+ + mercuriphenyl acetate ⟶ Hg2+ + acetate + benzene
- phenylmercury acetate degradation:
H+ + mercuriphenyl acetate ⟶ Hg2+ + acetate + benzene
- phenylmercury acetate degradation:
H+ + mercuriphenyl acetate ⟶ Hg2+ + acetate + benzene
- phenylmercury acetate degradation:
H+ + mercuriphenyl acetate ⟶ Hg2+ + acetate + benzene
- phenylmercury acetate degradation:
H+ + mercuriphenyl acetate ⟶ Hg2+ + acetate + benzene
- phenylmercury acetate degradation:
H+ + mercuriphenyl acetate ⟶ Hg2+ + acetate + benzene
- chitin degradation to ethanol:
H2O + chitin ⟶ acetate + chitosan
- chitin degradation to ethanol:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- chitosan biosynthesis:
H2O + chitin ⟶ acetate + chitosan
- D-cycloserine biosynthesis:
O-acetyl-L-serine + hydroxyurea ⟶ O-ureido-L-serine + H+ + acetate
- eugenol and isoeugenol biosynthesis:
acetyl-CoA + coniferyl alcohol ⟶ coenzyme A + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
acetyl-CoA + coniferyl alcohol ⟶ coenzyme A + coniferyl acetate
- nivalenol biosynthesis:
3,15-acetyldeoxynivalenol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3,15-diacetylnivalenol + H2O + an oxidized [NADPH-hemoprotein reductase]
- propane degradation II:
NAD+ + propan-2-ol ⟶ H+ + NADH + acetone
- androgen biosynthesis:
17-α-hydroxypregnenolone + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-β-hydroxyandrost-5-en-17-one + H+ + H2O + acetate + an oxidized [NADPH-hemoprotein reductase]
- androgen biosynthesis:
NADP+ + testosterone ⟶ H+ + NADPH + androst-4-ene-3,17-dione
- N-acetylglucosamine degradation I:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- N-acetylglucosamine degradation II:
N-acetyl-D-glucosamine + ATP ⟶ N-acetyl-D-glucosamine 6-phosphate + ADP + H+
- anhydromuropeptides recycling I:
N-acetyl-β-D-glucosamine-1,6-anhydro-N-acetyl-β-D-muramate + H2O ⟶ 1,6-anhydro-N-acetyl-β-muramate + GlcNAc
- phosphonoacetate degradation:
H2O + phosphonoacetate ⟶ H+ + acetate + phosphate
- superpathway of N-acetylglucosamine, N-acetylmannosamine and N-acetylneuraminate degradation:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- superpathway of N-acetylneuraminate degradation:
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate
- superpathway of arginine and polyamine biosynthesis:
cadaverine + dAdoMet ⟶ S-methyl-5'-thioadenosine + H+ + aminopropylcadaverine
- mycothiol biosynthesis:
acetyl-CoA + deacetylmycothiol ⟶ H+ + coenzyme A + mycothiol
- L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate
- L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate
- anhydromuropeptides recycling I:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- superpathway of N-acetylglucosamine, N-acetylmannosamine and N-acetylneuraminate degradation:
N-acetylneuraminate ⟶ N-acetyl-D-mannosamine + pyruvate
- N-acetylglucosamine degradation I:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu
- superpathway of arginine and polyamine biosynthesis:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu
- L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu
- mycothiol biosynthesis:
acetyl-CoA + deacetylmycothiol ⟶ H+ + coenzyme A + mycothiol
- willardiine and isowillardiine biosynthesis:
O-acetyl-L-serine + uracil ⟶ H+ + L-isowillardiine + acetate
- S-methyl-5-thio-α-D-ribose 1-phosphate degradation II:
1-(methylsulfanyl)xylulose 5-phosphate + A(H2) ⟶ 1-deoxy-D-xylulose 5-phosphate + A + methanethiol
- S-methyl-5-thio-α-D-ribose 1-phosphate degradation II:
O-acetyl-L-homoserine + methanethiol ⟶ H+ + acetate + met
- pyruvate to cytochrome bd oxidase electron transfer:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate
- pyruvate to cytochrome bo oxidase electron transfer:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate
- pyruvate to cytochrome bd oxidase electron transfer:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate
- pyruvate to cytochrome bo oxidase electron transfer:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate
- pyruvate oxidation pathway:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate
- pyruvate to cytochrome bo oxidase electron transfer:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate
- pyruvate to cytochrome bd terminal oxidase electron transfer:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate
- pyruvate oxidation pathway:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate
- pyruvate oxidation pathway:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate
- pyruvate oxidation pathway:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate
- pyruvate to cytochrome bo oxidase electron transfer:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate
- pyruvate to cytochrome bd oxidase electron transfer:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate
- pyruvate oxidation pathway:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate
- pyruvate oxidation pathway:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate
- pyruvate oxidation pathway:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate
- pyruvate oxidation pathway:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate
- pyruvate oxidation pathway:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate
- pyruvate to cytochrome bd terminal oxidase electron transfer:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate
- pyruvate to cytochrome bd terminal oxidase electron transfer:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate
- pyruvate to cytochrome bd oxidase electron transfer:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate
- pyruvate fermentation to propanoate II (acrylate pathway):
(R)-lactate + propanoyl-CoA ⟶ (R)-lactoyl-CoA + propanoate
- L-alanine fermentation to propanoate and acetate:
(R)-lactate + propanoyl-CoA ⟶ (R)-lactoyl-CoA + propanoate
- fermentation to 2-methylbutanoate:
acetyl-CoA + propanoate ⟶ acetate + propanoyl-CoA
- 2-methylbutyrate biosynthesis:
acetyl-CoA + propionate ⟶ acetate + propanoyl-CoA
- 2-methylbutyrate biosynthesis:
acetyl-CoA + propionate ⟶ acetate + propanoyl-CoA
- 2-methylbutanoate biosynthesis:
acetyl-CoA + propanoate ⟶ acetate + propanoyl-CoA
- 2-methylbutyrate biosynthesis:
acetyl-CoA + propionate ⟶ acetate + propanoyl-CoA
- pyruvate fermentation to propionate II (acrylate pathway):
acetyl-CoA + propanoate ⟶ acetate + propanoyl-CoA
- oxidative ethanol degradation III:
O2 + a reduced [NADPH-hemoprotein reductase] + ethanol ⟶ H2O + acetaldehyde + an oxidized [NADPH-hemoprotein reductase]
- ethanol degradation IV:
ethanol + hydrogen peroxide ⟶ H2O + acetaldehyde
- ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- NAD/NADP-NADH/NADPH cytosolic interconversion (yeast):
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- superpathway NAD/NADP - NADH/NADPH interconversion (yeast):
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- hypotaurine degradation:
2-sulfinoacetaldehyde + H2O ⟶ H+ + acetaldehyde + sulfite
- pyruvate fermentation to acetate VIII:
H2O + NADP+ + acetaldehyde ⟶ H+ + NADPH + acetate
- ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- ethanol degradation III:
O2 + a reduced [NADPH-hemoprotein reductase] + ethanol ⟶ H2O + acetaldehyde + an oxidized [NADPH-hemoprotein reductase]
- ethanol degradation IV:
ethanol + hydrogen peroxide ⟶ H2O + acetaldehyde
- superpathway NAD/NADP - NADH/NADPH interconversion:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH
- ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- NAD/NADP-NADH/NADPH cytosolic interconversion:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH
- pyruvate fermentation to acetate VIII:
H+ + pyruvate ⟶ CO2 + acetaldehyde
- ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- ethanol degradation IV (peroxisomal):
ethanol + hydrogen peroxide ⟶ H2O + acetaldehyde
- oxidative ethanol degradation III (microsomal):
H+ + NADPH + O2 + ethanol ⟶ H2O + NADP+ + acetaldehyde
- ethanol degradation II (cytosol):
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- ethanol degradation II:
H2O + NAD+ + acetaldehyde ⟶ H+ + NADH + acetate
- ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- ethanol degradation IV:
ethanol + hydrogen peroxide ⟶ H2O + acetaldehyde
- ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- ethanol degradation II (cytosol):
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- oxidative ethanol degradation III (microsomal):
H+ + NADPH + O2 + ethanol ⟶ H2O + NADP+ + acetaldehyde
- ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- ethanol degradation IV:
ethanol + hydrogen peroxide ⟶ H2O + acetaldehyde
- ethanol degradation IV (peroxisomal):
ethanol + hydrogen peroxide ⟶ H2O + acetaldehyde
- ethanol degradation II (cytosol):
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- ethanol degradation IV:
ethanol + hydrogen peroxide ⟶ H2O + acetaldehyde
- ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- succinate fermentation to butanoate:
acetate + butanoyl-CoA ⟶ acetyl-CoA + butanoate
- acetyl-CoA fermentation to butanoate II:
acetate + butanoyl-CoA ⟶ acetyl-CoA + butanoate
- L-glutamate degradation V (via hydroxyglutarate):
acetate + butanoyl-CoA ⟶ acetyl-CoA + butanoate
- 4-aminobutanoate degradation V:
acetate + butanoyl-CoA ⟶ acetyl-CoA + butanoate
- gallate degradation III (anaerobic):
acetate + butanoyl-CoA ⟶ acetyl-CoA + butanoate
- acetyl-CoA fermentation to butyrate II:
acetate + butanoyl-CoA ⟶ acetyl-CoA + butanoate
- glutamate degradation V (via hydroxyglutarate):
H2O + NAD+ + glt ⟶ 2-oxoglutarate + H+ + NADH + ammonia
- ethanol fermentation to acetate:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- 4-aminobutyrate degradation V:
H2O + NAD+ + glt ⟶ 2-oxoglutarate + H+ + NADH + ammonia
- acetyl-CoA fermentation to butanoate II:
ATP + acetate ⟶ ADP + acetyl phosphate
- acetyl-CoA fermentation to butyrate II:
acetate + butanoyl-CoA ⟶ acetyl-CoA + n-butanoate
- acetyl-CoA fermentation to butyrate II:
acetate + butanoyl-CoA ⟶ acetyl-CoA + n-butanoate
- acetyl-CoA fermentation to butanoate II:
acetate + butanoyl-CoA ⟶ acetyl-CoA + butanoate
- gallate degradation III (anaerobic):
3-hydroxy-5-oxohexanoate + acetyl-CoA ⟶ 3-hydroxy-5- oxohexanoyl-CoA + acetate
- gallate degradation III (anaerobic):
acetate + butanoyl-CoA ⟶ acetyl-CoA + butanoate
- ethanol fermentation to acetate:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- acetyl-CoA fermentation to butanoate II:
acetate + butanoyl-CoA ⟶ acetyl-CoA + butanoate
- acetyl-CoA fermentation to butyrate II:
acetate + butanoyl-CoA ⟶ acetyl-CoA + n-butanoate
- 4-aminobutyrate degradation V:
H2O + NAD+ + glt ⟶ 2-oxoglutarate + H+ + NADH + ammonia
- gallate degradation III (anaerobic):
3-hydroxy-5-oxohexanoate + acetyl-CoA ⟶ 3-hydroxy-5- oxohexanoyl-CoA + acetate
- acetyl-CoA fermentation to butyrate II:
acetate + butanoyl-CoA ⟶ acetyl-CoA + n-butanoate
- glutamate degradation V (via hydroxyglutarate):
H2O + NAD+ + glt ⟶ 2-oxoglutarate + H+ + NADH + ammonia
- 4-aminobutyrate degradation V:
H2O + NAD+ + glt ⟶ 2-oxoglutarate + H+ + NADH + ammonia
- 4-aminobutanoate degradation V:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium
- succinate fermentation to butanoate:
acetate + butanoyl-CoA ⟶ acetyl-CoA + butanoate
- gallate degradation III (anaerobic):
3-hydroxy-5- oxohexanoyl-CoA + acetate ⟶ 3-hydroxy-5-oxohexanoate + acetyl-CoA
- acetyl-CoA fermentation to butanoate II:
acetate + butanoyl-CoA ⟶ acetyl-CoA + butanoate
- succinate fermentation to butanoate:
acetate + succinyl-CoA ⟶ acetyl-CoA + succinate
- L-glutamate degradation V (via hydroxyglutarate):
(R)-2-hydroxyglutarate + NAD+ ⟶ 2-oxoglutarate + H+ + NADH
- 4-aminobutanoate degradation V:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium
- acetyl-CoA fermentation to butanoate II:
acetate + butanoyl-CoA ⟶ acetyl-CoA + butanoate
- acetyl-CoA fermentation to butanoate II:
ATP + acetate ⟶ ADP + acetyl phosphate
- acetyl-CoA fermentation to butanoate II:
ATP + acetate ⟶ ADP + acetyl phosphate
- 4-hydroxybenzoate biosynthesis IV (plants):
4-hydroxybenzaldehyde + H2O + NAD+ ⟶ 4-hydroxybenzoate + H+ + NADH
- 4-hydroxybenzoate biosynthesis I (eukaryotes):
4-hydroxybenzaldehyde + H2O + NAD+ ⟶ 4-hydroxybenzoate + H+ + NADH
- Amaryllidacea alkaloids biosynthesis:
4'-O-methylnorbelladine + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (4aS,10bR)-noroxomaritidine + H2O + an oxidized [NADPH-hemoprotein reductase]
- vanillin biosynthesis I:
4-hydroxybenzaldehyde + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3,4-dihydroxybenzaldehyde + H2O + an oxidized [NADPH-hemoprotein reductase]
- mycothiol biosynthesis:
1-(2-acetamido-2-deoxy-α-D-glucopyranosyl)-1D-myo-inositol + H2O ⟶ GlcN-Ins + acetate
- mycothiol biosynthesis:
1-(2-acetamido-2-deoxy-α-D-glucopyranosyl)-1D-myo-inositol + H2O ⟶ GlcN-Ins + acetate
- mycothiol biosynthesis:
1-(2-acetamido-2-deoxy-α-D-glucopyranosyl)-1D-myo-inositol + H2O ⟶ GlcN-Ins + acetate
- superpathway of tryptophan utilization:
N-formylkynurenine + H2O ⟶ H+ + L-kynurenine + formate
- superpathway of melatonin degradation:
hydrogen peroxide + melatonin ⟶ N1-acetyl-N2-formyl-5-methoxykynuramine + H2O
- melatonin degradation II:
5-methoxytryptamine + H+ + H2O + O2 ⟶ 5-methoxyindoleacetaldehyde + ammonium + hydrogen peroxide
- superpathway of melatonin degradation:
N1-acetyl-N2-formyl-5-methoxykynuramine + H2O ⟶ N-acetyl-5-methoxykynurenamine + H+ + formate
- melatonin degradation II:
5-methoxyindoleacetaldehyde + A(H2) ⟶ 5-methoxytryptophol + A
- superpathway of seleno-compound metabolism:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol
- seleno-amino acid biosynthesis (plants):
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
L-selenocysteine + O-phospho-L-homoserine ⟶ L-selenocystathionine + phosphate
- 4-hydroxyacetophenone degradation:
(4-hydroxyphenyl)acetate + H2O ⟶ acetate + hydroquinone
- L-lysine biosynthesis II:
L-2-acetamido-6-oxoheptanedioate + glu ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate
- L-lysine biosynthesis II:
L-2-acetamido-6-oxoheptanedioate + glu ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate
- lysine biosynthesis II:
L-2-acetamido-6-oxoheptanedioate + glt ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate
- lysine biosynthesis II:
L-2-acetamido-6-oxoheptanedioate + glt ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate
- L-lysine biosynthesis II:
Glu + L-2-acetamido-6-oxoheptanedioate ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate
- L-lysine biosynthesis II:
L-2-acetamido-6-oxoheptanedioate + glt ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate
- L-lysine biosynthesis II:
Glu + L-2-acetamido-6-oxoheptanedioate ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate
- L-lysine biosynthesis II:
Glu + L-2-acetamido-6-oxoheptanedioate ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate
- geranyl acetate biosynthesis:
H2O + geranyl acetate ⟶ H+ + acetate + geraniol
- pyruvate fermentation to acetate and lactate II:
ATP + acetate ⟶ ADP + acetyl phosphate
- pyruvate fermentation to acetate I:
ATP + acetate ⟶ ADP + acetyl phosphate
- superpathway of Clostridium acetobutylicum acidogenic and solventogenic fermentation:
H+ + acetoacetate ⟶ CO2 + acetone
- superpathway of Clostridium acetobutylicum acidogenic fermentation:
ATP + butanoate ⟶ ADP + butanoyl phosphate
- oxalate biosynthesis:
H2O + oxaloacetate ⟶ H+ + acetate + oxalate
- acetate and ATP formation from acetyl-CoA I:
acetyl-CoA + phosphate ⟶ acetyl phosphate + coenzyme A
- seleno-amino acid biosynthesis:
H2O + L-selenocystathionine ⟶ H+ + ammonia + pyruvate + selenohomocysteine
- benzoate biosynthesis II (CoA-independent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate
- benzoate biosynthesis II (CoA-independent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate
- pyruvate oxidation pathway:
ATP + acetate + coenzyme A ⟶ AMP + acetyl-CoA + diphosphate
- T-2 toxin biosynthesis:
3-acetylneosolaniol + isovaleryl-CoA ⟶ 3-acetyl T-2 toxin + coenzyme A
- thiosulfate assimilation:
O-acetyl-L-serine + thiosulfate ⟶ H+ + S-sulfo-L-cysteine + acetate
- vitamin B6 degradation:
4-pyridoxolactone + H2O ⟶ 4-pyridoxate + H+
- vitamin B6 degradation:
pyridoxamine + pyruvate ⟶ ala + pyridoxal
- vitamin B6 degradation:
2-(acetamidomethylene)succinate + H2O ⟶ CO2 + acetate + ammonia + succinate semialdehyde
- vitamin B6 degradation:
2-(acetamidomethylene)succinate + H2O ⟶ CO2 + acetate + ammonia + succinate semialdehyde
- β-pyrazole-1-ylalanine biosynthesis:
O-acetyl-L-serine + pyrazole ⟶ 3-(pyrazol-1-yl)-L-alanine + H+ + acetate
- rhizobitoxine biosynthesis:
H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster + dihydrorhizobitoxine ⟶ H2O + an oxidized ferredoxin [iron-sulfur] cluster + rhizobitoxine
- L-homocysteine biosynthesis:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- superpathway of sulfate assimilation and cysteine biosynthesis:
H2O + NADP+ + hydrogen sulfide ⟶ H+ + NADPH + sulfite
- L-methionine biosynthesis III:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- superpathway of L-methionine biosynthesis (by sulfhydrylation):
H2O + NADP+ + hydrogen sulfide ⟶ H+ + NADPH + sulfite
- superpathway of L-cysteine biosynthesis (fungi):
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- L-cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- superpathway of sulfur amino acid biosynthesis (Saccharomyces cerevisiae):
H2O + NADP+ + hydrogen sulfide ⟶ H+ + NADPH + sulfite
- L-cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phosphooxypyruvate + glu
- superpathway of sulfur amino acid biosynthesis (Saccharomyces cerevisiae):
ATP + H+ + sulfate ⟶ APS + diphosphate
- L-methionine biosynthesis:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- cysteine biosynthesis IV (fungi):
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- L-homocysteine biosynthesis:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- L-cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phosphooxypyruvate + Glu
- L-cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phospho-hydroxypyruvate + glt
- L-homocysteine biosynthesis:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- L-cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- L-methionine biosynthesis III:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- superpathway of L-methionine biosynthesis (by sulfhydrylation):
3',5'-ADP + H+ + an oxidized thioredoxin + sulfite ⟶ PAPS + a reduced thioredoxin
- superpathway of sulfate assimilation and cysteine biosynthesis:
3',5'-ADP + H+ + an oxidized thioredoxin + sulfite ⟶ PAPS + a reduced thioredoxin
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phospho-hydroxypyruvate + glt
- L-homocysteine biosynthesis:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- L-cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- L-methionine biosynthesis III:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- L-cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phospho-hydroxypyruvate + glt
- cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phospho-hydroxypyruvate + glt
- homocysteine biosynthesis:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- superpathway of methionine biosynthesis (by sulfhydrylation):
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phospho-hydroxypyruvate + glt
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phospho-hydroxypyruvate + glt
- L-homocysteine biosynthesis:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- L-cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- superpathway of L-methionine biosynthesis (by sulfhydrylation):
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- L-methionine biosynthesis III:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- L-methionine biosynthesis III:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- superpathway of L-methionine biosynthesis (by sulfhydrylation):
H2O + NADP+ + hydrogen sulfide ⟶ H+ + NADPH + sulfite
- L-homocysteine biosynthesis:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- L-cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- superpathway of sulfate assimilation and cysteine biosynthesis:
H2O + NADP+ + hydrogen sulfide ⟶ H+ + NADPH + sulfite
- L-methionine biosynthesis III:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- L-homocysteine biosynthesis:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- superpathway of L-methionine biosynthesis (by sulfhydrylation):
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phosphooxypyruvate + glu
- L-cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- L-cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phospho-hydroxypyruvate + glt
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phosphooxypyruvate + glu
- L-cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- L-homocysteine biosynthesis:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- superpathway of sulfur amino acid biosynthesis (Saccharomyces cerevisiae):
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- homocysteine biosynthesis:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- cysteine biosynthesis IV (fungi):
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- L-cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phospho-hydroxypyruvate + glt
- L-methionine biosynthesis III:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- L-homocysteine biosynthesis:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phospho-hydroxypyruvate + glt
- cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phospho-hydroxypyruvate + glt
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phospho-hydroxypyruvate + glt
- cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- homocysteine biosynthesis:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- homocysteine biosynthesis:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- homocysteine biosynthesis:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phospho-hydroxypyruvate + glt
- superpathway of methionine biosynthesis (by sulfhydrylation):
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- homocysteine biosynthesis:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phospho-hydroxypyruvate + glt
- homocysteine biosynthesis:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- L-methionine biosynthesis III:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- L-cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- L-homocysteine biosynthesis:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phospho-hydroxypyruvate + glt
- homocysteine biosynthesis:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- methionine biosynthesis III:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- superpathway of methionine biosynthesis (by sulfhydrylation):
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- superpathway of L-methionine biosynthesis (by sulfhydrylation):
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- L-methionine biosynthesis III:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- L-homocysteine biosynthesis:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- L-cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- L-cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- L-methionine biosynthesis III:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- L-cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- L-homocysteine biosynthesis:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- L-cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- L-homocysteine biosynthesis:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- L-methionine biosynthesis III:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- L-methionine biosynthesis III:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- L-cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- L-homocysteine biosynthesis:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- L-methionine biosynthesis III:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- L-cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- L-homocysteine biosynthesis:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- L-cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- L-methionine biosynthesis III:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- L-homocysteine biosynthesis:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- L-methionine biosynthesis III:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- L-cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- L-homocysteine biosynthesis:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- L-methionine biosynthesis III:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- L-homocysteine biosynthesis:
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate
- L-cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- pyruvate fermentation to acetate III:
an oxidized ferredoxin [iron-sulfur] cluster + coenzyme A + pyruvate ⟶ CO2 + a reduced ferredoxin [iron-sulfur] cluster + acetyl-CoA
- Bifidobacterium shunt:
β-D-glucose + ATP ⟶ β-D-glucose-6-phosphate + ADP + H+
- lysine fermentation to acetate and butyrate:
L-3-aminobutyryl-CoA ⟶ H+ + ammonia + crotonyl-CoA
- acetate formation from acetyl-CoA II:
ATP + acetate + coenzyme A ⟶ ADP + acetyl-CoA + phosphate
- superpathway of acetate utilization and formation:
ATP + acetate ⟶ ADP + acetylphosphate
- acetate conversion to acetyl-CoA:
ATP + acetate + coenzyme A ⟶ AMP + acetyl-CoA + diphosphate
- acetate formation from acetyl-CoA I:
ATP + acetate ⟶ ADP + acetylphosphate
- glutamate degradation VII (to butanoate):
(2S, 3S)-3-methylaspartate ⟶ ammonia + mesaconate
- pyruvate fermentation to acetate and alanine:
2-oxoglutarate + ala ⟶ glt + pyruvate
- acetate conversion to acetyl-CoA:
ATP + acetate + coenzyme A ⟶ AMP + acetyl-CoA + diphosphate
- acetate formation from acetyl-CoA II:
ATP + acetate + coenzyme A ⟶ ADP + acetyl-CoA + phosphate
- acetate conversion to acetyl-CoA:
ATP + acetate + coenzyme A ⟶ AMP + H+ + acetyl-CoA + diphosphate
- pyruvate fermentation to acetate III:
ATP + acetate + coenzyme A ⟶ ADP + H+ + acetyl-CoA + phosphate
- acetate formation from acetyl-CoA II:
ATP + acetate + coenzyme A ⟶ ADP + H+ + acetyl-CoA + phosphate
- mixed acid fermentation:
citrate ⟶ cis-aconitate + H2O
- acetate conversion to acetyl-CoA:
ATP + acetate + coenzyme A ⟶ AMP + H+ + acetyl-CoA + diphosphate
- purine nucleotides degradation III (anaerobic):
4-aminoimidazole + H2O ⟶ 4-imidazolone + H+ + ammonia
- purine nucleotides degradation IV (anaerobic):
4-aminoimidazole + H2O ⟶ 4-imidazolone + H+ + ammonia
- noscapine biosynthesis:
(S)-canadine + SAM ⟶ (S)-N-methylcanadine + SAH
- mimosine biosynthesis:
3,4-dihydroxypyridin + O-acetyl-L-serine ⟶ H+ + L-mimosine + acetate
- N-acetylglucosamine degradation I:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- N-acetylglucosamine degradation II:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- chitin derivatives degradation:
N,N'-diacetylchitobiose + phosphate ⟶ N-acetyl-α-D-glucosamine 1-phosphate + N-acetyl-D-glucosamine
- superpathway of N-acetylglucosamine, N-acetylmannosamine and N-acetylneuraminate degradation:
N-acetylneuraminate ⟶ N-acetyl-D-mannosamine + pyruvate
- superpathway of N-acetylneuraminate degradation:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- N-acetylglucosamine degradation I:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- superpathway of N-acetylglucosamine, N-acetylmannosamine and N-acetylneuraminate degradation:
N-acetylneuraminate ⟶ N-acetyl-D-mannosamine + pyruvate
- superpathway of N-acetylneuraminate degradation:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- N-acetylglucosamine degradation I:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- N-acetylglucosamine degradation II:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- anhydromuropeptides recycling:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- N-acetylglucosamine degradation I:
α-D-glucosamine 6-phosphate + H2O ⟶ F6P + ammonium
- anhydromuropeptides recycling:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- N-acetylglucosamine degradation I:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- anhydromuropeptides recycling:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- N-acetylglucosamine degradation I:
α-D-glucosamine 6-phosphate + H2O ⟶ F6P + ammonium
- N-acetylglucosamine degradation II:
N-acetyl-D-glucosamine + ATP ⟶ N-acetyl-D-glucosamine 6-phosphate + ADP + H+
- superpathway of N-acetylglucosamine, N-acetylmannosamine and N-acetylneuraminate degradation:
N-acetylneuraminate ⟶ N-acetyl-D-mannosamine + pyruvate
- N-acetylglucosamine degradation I:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- N-acetylglucosamine degradation I:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- N-acetylglucosamine degradation I:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- superpathway of N-acetylneuraminate degradation:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- anhydromuropeptides recycling:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- N-acetylglucosamine degradation I:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- N-acetylglucosamine degradation I:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- superpathway of N-acetylglucosamine, N-acetylmannosamine and N-acetylneuraminate degradation:
N-acetylneuraminate ⟶ N-acetyl-D-mannosamine + pyruvate
- anhydromuropeptides recycling:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- anhydromuropeptides recycling:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- superpathway of N-acetylglucosamine, N-acetylmannosamine and N-acetylneuraminate degradation:
N-acetylneuraminate ⟶ N-acetyl-D-mannosamine + pyruvate
- N-acetylglucosamine degradation I:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- anhydromuropeptides recycling:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- N-acetylglucosamine degradation II:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- N-acetylglucosamine degradation I:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- superpathway of N-acetylglucosamine, N-acetylmannosamine and N-acetylneuraminate degradation:
N-acetylneuraminate ⟶ N-acetyl-D-mannosamine + pyruvate
- anhydromuropeptides recycling:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- N-acetylglucosamine degradation I:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- superpathway of N-acetylglucosamine, N-acetylmannosamine and N-acetylneuraminate degradation:
N-acetylneuraminate ⟶ N-acetyl-D-mannosamine + pyruvate
- N-acetylglucosamine degradation I:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- anhydromuropeptides recycling:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- N-acetylglucosamine degradation I:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- N-acetylglucosamine degradation I:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- anhydromuropeptides recycling:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- superpathway of N-acetylglucosamine, N-acetylmannosamine and N-acetylneuraminate degradation:
N-acetylneuraminate ⟶ N-acetyl-D-mannosamine + pyruvate
- anhydromuropeptides recycling:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- superpathway of N-acetylglucosamine, N-acetylmannosamine and N-acetylneuraminate degradation:
N-acetylneuraminate ⟶ N-acetyl-D-mannosamine + pyruvate
- N-acetylglucosamine degradation I:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- anhydromuropeptides recycling:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- superpathway of N-acetylglucosamine, N-acetylmannosamine and N-acetylneuraminate degradation:
N-acetylneuraminate ⟶ N-acetyl-D-mannosamine + pyruvate
- N-acetylglucosamine degradation I:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- superpathway of N-acetylglucosamine, N-acetylmannosamine and N-acetylneuraminate degradation:
N-acetylneuraminate ⟶ N-acetyl-D-mannosamine + pyruvate
- anhydromuropeptides recycling:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- N-acetylglucosamine degradation I:
N-acetyl-D-glucosamine 6-phosphate + H2O ⟶ D-glucosamine 6-phosphate + acetate
- heme b biosynthesis III (from siroheme):
12,18-didecarboxysiroheme + A(H2) + SAM ⟶ 5'-deoxyadenosine + A + H+ + acetate + coproheme III + met
- heme biosynthesis III (from siroheme):
12,18-didecarboxysiroheme + A(H2) + SAM ⟶ 5'-deoxyadenosine + A + Fe-coproporphyrin III + H+ + acetate + met
- indole-3-acetate degradation:
H+ + NAD(P)H + O2 + anthranilate ⟶ CO2 + NAD(P)+ + ammonium + catechol
- IAA biosynthesis I:
H2O + indole-3-acetamide ⟶ H+ + ammonia + indole-3-acetate
WikiPathways(4)
- Lipid metabolism pathway:
Acetate ⟶ Acetyl-CoA(cyt)
- Ethanol effects on histone modifications:
Ethanol ⟶ Acetaldehyde
- Folate-alcohol and cancer pathway hypotheses:
Cysteine ⟶ Cystathionine
- Acetylcholine synthesis:
Glycerophosphocholine ⟶ Choline
Plant Reactome(0)
INOH(0)
PlantCyc(112)
- t-anethole biosynthesis:
trans-anol + SAM ⟶ t-anethole + H+ + SAH
- t-anethole biosynthesis:
trans-anol + SAM ⟶ t-anethole + H+ + SAH
- t-anethole biosynthesis:
trans-anol + SAM ⟶ t-anethole + H+ + SAH
- t-anethole biosynthesis:
trans-anol + SAM ⟶ t-anethole + H+ + SAH
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- superpathway of seleno-compound metabolism:
H2O + O2 + dimethylselenopropanoate-amine ⟶ 3-dimethylselenopropionaldehyde + ammonium + hydrogen peroxide
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis (plants):
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis (plants):
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- superpathway of seleno-compound metabolism:
H2O + O2 + dimethylselenopropanoate-amine ⟶ 3-dimethylselenopropionaldehyde + ammonium + hydrogen peroxide
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- seleno-amino acid biosynthesis:
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- geranyl acetate biosynthesis:
acetyl-CoA + geraniol ⟶ coenzyme A + geranyl acetate
- geranyl acetate biosynthesis:
H2O + geranyl acetate ⟶ H+ + acetate + geraniol
- geranyl acetate biosynthesis:
H2O + geranyl acetate ⟶ H+ + acetate + geraniol
- geranyl acetate biosynthesis:
H2O + geranyl acetate ⟶ H+ + acetate + geraniol
- geranyl acetate biosynthesis:
H2O + geranyl acetate ⟶ H+ + acetate + geraniol
- geranyl acetate biosynthesis:
H2O + geranyl acetate ⟶ H+ + acetate + geraniol
- L-cysteine biosynthesis I:
O-acetyl-L-serine + hydrogen sulfide ⟶ H+ + acetate + cys
- mimosine biosynthesis:
3,4-dihydroxypyridin + O-acetyl-L-serine ⟶ H+ + L-mimosine + acetate
COVID-19 Disease Map(0)
PathBank(0)
PharmGKB(0)
0 个相关的物种来源信息
在这里通过桑基图来展示出与当前的这个代谢物在我们的BioDeep知识库中具有相关联信息的其他代谢物。在这里进行关联的信息来源主要有:
- PubMed: 来源于PubMed文献库中的文献信息,我们通过自然语言数据挖掘得到的在同一篇文献中被同时提及的相关代谢物列表,这个列表按照代谢物同时出现的文献数量降序排序,取前10个代谢物作为相关研究中关联性很高的代谢物集合展示在桑基图中。
- NCBI Taxonomy: 通过文献数据挖掘,得到的代谢物物种来源信息关联。这个关联信息同样按照出现的次数降序排序,取前10个代谢物作为高关联度的代谢物集合展示在桑吉图上。
- Chemical Taxonomy: 在物质分类上处于同一个分类集合中的其他代谢物
- Chemical Reaction: 在化学反应过程中,存在为当前代谢物相关联的生化反应过程中的反应底物或者反应产物的关联代谢物信息。
点击图上的相关代谢物的名称,可以跳转到相关代谢物的信息页面。
亚细胞结构定位 | 关联基因列表 |
---|
文献列表
- Bintao Hu, Chengwei Wang, Yue Wu, Chenglin Han, Jihong Liu, Ruibao Chen, Tao Wang. Revealing the mechanism of ethyl acetate extracts of Semen Impatientis against prostate cancer based on network pharmacology and transcriptomics.
Journal of ethnopharmacology.
2024 Aug; 330(?):118228. doi:
10.1016/j.jep.2024.118228
. [PMID: 38643863] - Malihe Keramat, Mohammad-Taghi Golmakani. Antioxidant potency and inhibitory mechanism of curcumin and its derivatives in oleogel and emulgel produced by linseed oil.
Food chemistry.
2024 Jul; 445(?):138754. doi:
10.1016/j.foodchem.2024.138754
. [PMID: 38364496] - Zihan Cai, Weinan Huang, Jiahao Zhong, Jiayue Jin, Di Wu, Kunsong Chen. Methyl jasmonate-loaded composite biofilm sustainably alleviates chilling lignification of loquat fruit during postharvest storage.
Food chemistry.
2024 Jun; 444(?):138602. doi:
10.1016/j.foodchem.2024.138602
. [PMID: 38310778] - Peng-Wei Wei, Xu Wang, Cong Wang, Ming Chen, Meng-Zhu Liu, Wen-Xia Liu, Yan-Ling He, Guo-Bo Xu, Xiao-He Zheng, Hua Zhang, Hong-Mei Liu, Bing Wang. Ginkgo biloba L. exocarp petroleum ether extract inhibits methicillin-resistant Staphylococcus aureus by modulating ion transport, virulence, and biofilm formation in vitro and in vivo.
Journal of ethnopharmacology.
2024 Jun; 328(?):117957. doi:
10.1016/j.jep.2024.117957
. [PMID: 38493904] - Xi Zhang, Lujia Yu, Mengjiao Zhang, Ting Wu, Tingting Song, Yuncong Yao, Jie Zhang, Ji Tian. MdWER interacts with MdERF109 and MdJAZ2 to mediate methyl jasmonate- and light-induced anthocyanin biosynthesis in apple fruit.
The Plant journal : for cell and molecular biology.
2024 Jun; 118(5):1327-1342. doi:
10.1111/tpj.16671
. [PMID: 38319946] - Nana Liu, Caiyun Li, Feixue Wu, Yi Yang, Antai Yu, Ziteng Wang, Lei Zhao, Xinfu Zhang, Fengfeng Qu, Liping Gao, Tao Xia, Peiqiang Wang. Genome-wide identification and expression pattern analysis of WRKY transcription factors in response to biotic and abiotic stresses in tea plants (Camellia sinensis).
Plant physiology and biochemistry : PPB.
2024 Jun; 211(?):108670. doi:
10.1016/j.plaphy.2024.108670
. [PMID: 38703501] - Martha N Ofokansi, Eze C Nwoye, Chinenye J Ugwah-Oguejiofor, Festus B C Okoye, Peter A Akah. Evaluation of the antimalarial and CD4+ T-cell modulatory effects of leaf methanol extract of Phyllanthus muellerianus (Kuntze) Exell (Phyllanthaceae) in Plasmodium berghei-infected mice.
Journal of ethnopharmacology.
2024 May; 326(?):117936. doi:
10.1016/j.jep.2024.117936
. [PMID: 38382655] - Ishfaq Majid Hurrah, Amit Kumar, Nazia Abbas. Functional characterisation of Artemisia annua jasmonic acid carboxyl methyltransferase: a key enzyme enhancing artemisinin biosynthesis.
Planta.
2024 May; 259(6):152. doi:
10.1007/s00425-024-04433-y
. [PMID: 38735012] - Subhan Danish, Sundas Sana, Muhammad Baqir Hussain, Khadim Dawar, Hesham S Almoallim, Mohammad Javed Ansari, Misbah Hareem, Rahul Datta. Effect of methyl jasmonate and GA3 on canola (Brassica napus L.) growth, antioxidants activity, and nutrient concentration cultivated in salt-affected soils.
BMC plant biology.
2024 May; 24(1):363. doi:
10.1186/s12870-024-05074-9
. [PMID: 38724910] - Guohui Li, Muhammad Aamir Manzoor, Guoyu Wang, Shiping Huang, Xiaoyuan Ding, Muhammad Abdullah, Ming Zhang, Cheng Song. Comparative analysis of POD genes and their expression under multiple hormones in Pyrus bretschenedri.
BMC genomic data.
2024 May; 25(1):41. doi:
10.1186/s12863-024-01229-7
. [PMID: 38711007] - Xiaoqin Huang, Wei Chen, Yuqing Zhao, Jingjing Chen, Yuzeng Ouyang, Minxuan Li, Yu Gu, Qinqin Wu, Sen Cai, Foqin Guo, Panpan Zhu, Deyong Ao, Shijun You, Liette Vasseur, Yuanyuan Liu. Deep learning-based quantification and transcriptomic profiling reveal a methyl jasmonate-mediated glandular trichome formation pathway in Cannabis sativa.
The Plant journal : for cell and molecular biology.
2024 May; 118(4):1155-1173. doi:
10.1111/tpj.16663
. [PMID: 38332528] - Ziwei Ma, Yuming Yu, Ming Gao, Peng Chen, Huixia Hong, Dingle Yu, Zhenjiang Liang, Yu Bai, Qinlian Ye, Yachao Wang, Guodong Huang, Hui Tan. Protective Effect of Hop Ethyl Acetate Extract on Corticosterone-Induced PC12 and Improvement of Depression-like Behavior in Mice.
ACS chemical neuroscience.
2024 May; 15(9):1893-1903. doi:
10.1021/acschemneuro.4c00081
. [PMID: 38613492] - Juhong Wang, Yannan Yang, Fei Shao, Ying Meng, Dong Guo, Jie He, Zhimin Lu. Acetate reprogrammes tumour metabolism and promotes PD-L1 expression and immune evasion by upregulating c-Myc.
Nature metabolism.
2024 May; 6(5):914-932. doi:
10.1038/s42255-024-01037-4
. [PMID: 38702440] - Shuang Wei, Mengwan Li, Xuye Lang, Nicholas R Robertson, Sang-Youl Park, Sean R Cutler, Ian Wheeldon. Repurposing plant hormone receptors as chemically-inducible genetic switches for dynamic regulation in yeast.
Metabolic engineering.
2024 May; 83(?):102-109. doi:
10.1016/j.ymben.2024.03.006
. [PMID: 38554744] - Zhe Zhou, Mingzhu Wu, Bin Sun, Jie Li, Junde Li, Zhengtai Liu, Meng Gao, Lei Xue, Sheng Xu, Ren Wang. Identification of transcription factor genes responsive to MeJA and characterization of a LaMYC2 transcription factor positively regulates lycorine biosynthesis in Lycoris aurea.
Journal of plant physiology.
2024 May; 296(?):154218. doi:
10.1016/j.jplph.2024.154218
. [PMID: 38490054] - To Quyen Truong, Yun Ji Park, Je-Seung Jeon, Jaeyoung Choi, Song Yi Koo, Yeong Bin Choi, Phuong Kim Huynh, Jinyoung Moon, Sang Min Kim. Myrosinase isogenes in wasabi (Wasabia japonica Matsum) and their putative roles in glucosinolate metabolism.
BMC plant biology.
2024 May; 24(1):353. doi:
10.1186/s12870-024-05057-w
. [PMID: 38693493] - Guiping Gong, Linpei Liu, Bo Wu, Jianting Li, Mingxiong He, Guoquan Hu. Simultaneous production of algal biomass and lipid by heterotrophic cultivation of linoleic acid-rich oleaginous microalga Chlorella sorokiniana using high acetate dosage.
Bioresource technology.
2024 May; 399(?):130566. doi:
10.1016/j.biortech.2024.130566
. [PMID: 38467262] - Samavia Mubeen, Jiao Pan, Wajid Saeed, Dengjie Luo, Muzammal Rehman, Zhang Hui, Peng Chen. Exogenous methyl jasmonate enhanced kenaf (Hibiscus cannabinus) tolerance against lead (Pb) toxicity by improving antioxidant capacity and osmoregulators.
Environmental science and pollution research international.
2024 May; 31(21):30806-30818. doi:
10.1007/s11356-024-33189-x
. [PMID: 38613757] - Nanxin Xie, Haoyang Shi, Xiaoman Shang, Zixin Zhao, Yan Fang, Huimin Wu, Ping Luo, Yongyi Cui, Wen Chen. RhMED15a-like, a subunit of the Mediator complex, is involved in the drought stress response in Rosa hybrida.
BMC plant biology.
2024 Apr; 24(1):351. doi:
10.1186/s12870-024-05059-8
. [PMID: 38684962] - Wenting Chai, Bohui Yang, Shanshan Zhao, Zhiqiang Guo, Lixun Zhu, Jiali Fan, Wei Yang, Weijun Zhao, Yanping Hao, Jinhui Lü, Wenxian Sun, Chunlai Zhang. [Characterization of sequences, expression profiling, and natural allelic variation analysis of the MYC gene family in sorghum (Sorghum bicolor)].
Sheng wu gong cheng xue bao = Chinese journal of biotechnology.
2024 Apr; 40(4):1170-1194. doi:
10.13345/j.cjb.230641
. [PMID: 38658156] - Sara Lamei Javan, Arman Beyraghdar Kashkooli, AbdolAli Shojaeiyan, Sina Majidian. Transcriptomic data reveals the dynamics of terpenoids biosynthetic pathway of fenugreek.
BMC genomics.
2024 Apr; 25(1):390. doi:
10.1186/s12864-024-10253-x
. [PMID: 38649807] - Tingliang Xu, Xiaowen Zheng, Yi Yang, Shumin Yang, Xingwan Yi, Chao Yu, Le Luo, Jia Wang, Tangren Cheng, Qixiang Zhang, Huitang Pan. Indole-3 acetic acid negatively regulates rose black spot disease resistance through antagonizing the salicylic acid signaling pathway via jasmonic acid.
Planta.
2024 Apr; 259(6):129. doi:
10.1007/s00425-024-04406-1
. [PMID: 38639804] - Rong Li, Lingzhi Zhu, Peizhen Chen, Yu Chen, Qingqing Hao, Peihuang Zhu, Kongshu Ji. Functional Characterization of PmDXR, a Critical Rate-Limiting Enzyme, for Turpentine Biosynthesis in Masson Pine (Pinus massoniana Lamb.).
International journal of molecular sciences.
2024 Apr; 25(8):. doi:
10.3390/ijms25084415
. [PMID: 38673998] - Mengying Fu, Edisson Tello, Emmanuel Hatzakis, Devin G Peterson. Identification of Compounds That Impact Consumer Flavor Liking of American-European Hazelnut Hybrids Using Nontargeted LC/MS Analysis.
Journal of agricultural and food chemistry.
2024 Apr; 72(14):8092-8102. doi:
10.1021/acs.jafc.4c00304
. [PMID: 38536005] - Vinícius de C Oliveira, Sarah de O Rodrigues, Sabrinna M T Souto, Geraldo A da Silva, Wagner Vilegas, Bárbara Garcia Ferri, Ahmed M El-Gazzar, Gaber El-Saber Batiha, Mohamed H Mahmoud, Marcelo J D Silva, Jorge P Pagnossa, Marcelo A da Silva. Chemical profile and evaluation of the pharmacological activity of the dry extract and fraction of ethyl acetate obtained from the leaves of Mimosa caesalpiniifolia.
Journal of ethnopharmacology.
2024 Apr; 323(?):117716. doi:
10.1016/j.jep.2024.117716
. [PMID: 38190955] - Ogocukwu Caroline Chiamah, Diana Atieno, Lewis Karani, Jean Chepng'etich, Maureen Osano, Beatrice Gachie, Gilbert Kipkoech, Mercy Jepkorir, Jecinta Wanjiru Ndungu, James Kuria, Francis Kimani, Sospeter Ngoci Njeru, Jeremiah Waweru Gathirwa. Evaluation of the antimalarial properties of Solanum incanum L. leaf extract fractions and its ability to downregulate delta aminolevulinate dehydratase to prevent the establishment of malaria infection.
Journal of ethnopharmacology.
2024 Apr; 323(?):117613. doi:
10.1016/j.jep.2023.117613
. [PMID: 38185259] - Chao Yang, Yongsheng Lin, Xuwen Xiang, Dandan Shao, Ziwen Qiu, Yongyu Li, Shaohua Wu. MbEOMT1 regulates methyleugenol biosynthesis in Melaleuca bracteata F. Muell.
Tree physiology.
2024 Apr; 44(4):. doi:
10.1093/treephys/tpae034
. [PMID: 38498320] - Ummuhan Cakmak. Phytochemical analyses by LC-HRMS, FTIR spectral analysis, antioxidant, antidiabetic and antityrosinase activity of Crataegus orientalis Pall. ex M. Bieb fruit extracted with various solvents.
Journal of the science of food and agriculture.
2024 Apr; 104(6):3767-3775. doi:
10.1002/jsfa.13261
. [PMID: 38284463] - Yang Xu, Dejuan Sun, Liangliang Xiong, Zhiqi Zhang, Yuxia Li, Kexin Liu, Hua Li, Lixia Chen. Phenolics and terpenoids with good anti-inflammatory activity from the fruits of Amomum villosum and the anti-inflammatory mechanism of active diterpene.
Bioorganic chemistry.
2024 Apr; 145(?):107190. doi:
10.1016/j.bioorg.2024.107190
. [PMID: 38377816] - Vignesh Narasimman, Saravanan Ramachandran. Purification, structural characterization, and neuroprotective effect of 3,6-diisobutyl-2,5-piperazinedione from Halomonas pacifica CARE-V15 against okadaic acid-induced neurotoxicity in zebrafish model.
Journal of biochemical and molecular toxicology.
2024 Apr; 38(4):e23708. doi:
10.1002/jbt.23708
. [PMID: 38597299] - Sankalan Dey, Sarmistha Sen Raychaudhuri. Methyl jasmonate improves selenium tolerance via regulating ROS signalling, hormonal crosstalk and phenylpropanoid pathway in Plantago ovata.
Plant physiology and biochemistry : PPB.
2024 Apr; 209(?):108533. doi:
10.1016/j.plaphy.2024.108533
. [PMID: 38520967] - Wanqian Guo, Chenping Kang, Xiaoxia Wang, Haoran Zhang, Lilan Yuan, Xuetao Wei, Qianqian Xiao, Weidong Hao. Chlorocholine chloride exposure induced spermatogenic dysfunction via iron overload caused by AhR/PERK axis-dependent ferritinophagy activation.
Ecotoxicology and environmental safety.
2024 Apr; 274(?):116193. doi:
10.1016/j.ecoenv.2024.116193
. [PMID: 38460407] - Milena Terzic, Shaimaa Fayez, Nouran M Fahmy, Omayma A Eldahshan, Abdullahi Ibrahim Uba, Sathish Kumar M Ponniya, Selami Selvi, Nilofar, Ismail Koyuncu, Özgür Yüksekdağ, Gokhan Zengin. Chemical characterization of three different extracts obtained from Chelidonium majus L. (Greater celandine) with insights into their in vitro, in silico and network pharmacological properties.
Fitoterapia.
2024 Apr; 174(?):105835. doi:
10.1016/j.fitote.2024.105835
. [PMID: 38301936] - Kamaraj Ragavendran, Jeyaraj Selvakumaran, Mariappan MuthuKanagavel, Savarimuthu Ignacimuthu, Naiyf S Alharbi, Muthu Thiruvengadam, Subramanian Mutheeswaran, Pathalam Ganesan. Effect of Mosquitocidal, histopathological alteration and non target effects of Sigesbeckia orientalis L. on Anopheles stephensi Liston, Culex quinquefasciatus say and Aedes aegypti L.
Veterinary parasitology, regional studies and reports.
2024 04; 49(?):100997. doi:
10.1016/j.vprsr.2024.100997
. [PMID: 38462302] - Omkar S Kulkarni, Mrinmoy Mazumder, Shruthi Kini, Eric D Hill, Johanan Shao Bing Aow, Samantha Mun Lin Phua, Untzizu Elejalde, Staffan Kjelleberg, Sanjay Swarup. Volatile methyl jasmonate from roots triggers host-beneficial soil microbiome biofilms.
Nature chemical biology.
2024 Apr; 20(4):473-483. doi:
10.1038/s41589-023-01462-8
. [PMID: 37957272] - Haslinda Mohd Salleh, Abdulwali Ablat, Soon-Lim Chong, Hazrina Hazni, Norsita Tohar, Nurulwahidah Fauzi, Habibah A Wahab, Muhamad Aqmal Othman, Sook Yee Liew, Khalijah Awang. The protective effects of Zingiber zerumbet rhizome against fevers in rats.
Die Naturwissenschaften.
2024 Apr; 111(2):20. doi:
10.1007/s00114-024-01907-7
. [PMID: 38558027] - Ramesh Kumar, Chavlesh Kumar, Debjani Roy Choudhury, Aashish Ranjan, Ritesh Kumar Raipuria, Kaushik Kumar Dhar Dubey, Ayushi Mishra, Chetan Kumar, Malik Muzafar Manzoor, Ashok Kumar, Abha Kumari, Kuldeep Singh, Gyanendra Pratap Singh, Rakesh Singh. Isolation, Characterization, and Expression Analysis of NAC Transcription Factor from Andrographis paniculata (Burm. f.) Nees and Their Role in Andrographolide Production.
Genes.
2024 Mar; 15(4):. doi:
10.3390/genes15040422
. [PMID: 38674357] - Yi-Dan Ma, Huan Zhou, Guo-Tai Lin, Ke-Huan Wu, Gong Xu, Xili Liu, Dan Xu. Design, Synthesis, and Fungicidal Activities of Novel N-(Pyrazol-5-yl)benzamide Derivatives Containing a Diphenylamine Moiety.
Journal of agricultural and food chemistry.
2024 Mar; 72(12):6691-6701. doi:
10.1021/acs.jafc.3c07567
. [PMID: 38498985] - Sahar Saleh Alghamdi, Sara Abdulaziz Alghashem, Rizwan Ali, Arwa Alsubait, Rasha Saad Suliman, Afrah E Mohammed, Zeyad Alehaideb, Raghad Abdullah Alshafi, Allulu Yousef Alturki, Ishrat Rahman. Exploring the potential of Ziziphus nummularia and luteolin-7-O-glucoside as tubulin inhibitors in cancer therapy and survival.
Scientific reports.
2024 03; 14(1):7202. doi:
10.1038/s41598-024-57680-0
. [PMID: 38531974] - Jiameng Zhang, Yanfang Wu, Chenyu Wang, Weidong Xu, Zichen Zhang, Suya Zhang, Xinyi Guan, Xinsheng Wang. The antioxidant, anti-inflammatory and analgesic activity effect of ethyl acetate extract from the flowers of Syringa pubescens Turcz.
Journal of ethnopharmacology.
2024 Mar; 322(?):117561. doi:
10.1016/j.jep.2023.117561
. [PMID: 38072290] - Ting Li, Xiaolong Ma, Ting Wang, Wenyan Tian, Jian Liu, Wenke Shen, Yuanyuan Liu, Yiwei Li, Xiaoxu Zhang, Junbai Ma, Xiaoxia Zhang, Jinhai Ma, Hao Wang. Clostridium butyricum inhibits the inflammation in children with primary nephrotic syndrome by regulating Th17/Tregs balance via gut-kidney axis.
BMC microbiology.
2024 Mar; 24(1):97. doi:
10.1186/s12866-024-03242-3
. [PMID: 38521894] - Walid Elsayed Abdallah, Khaled Ahmed Shams, Ashraf Moursi El-Shamy. Phytochemical analysis and evaluation of its antioxidant, antimicrobial, and cytotoxic activities for different extracts of Casuarina equisetifolia.
BMC complementary medicine and therapies.
2024 Mar; 24(1):128. doi:
10.1186/s12906-024-04422-4
. [PMID: 38509538] - Chun-Yu Fan, Xiao-Fang Yu, Yu-Jia Liu, Xiao-Xuan Zeng, Fu-Wen Luo, Xian-Tong Wang, Xuan Yang, Xiao-Yu Wang, Xiao Xue, Li-Juan Yang, Ting Lei, Ming-Yan Jiang, Bei-Bei Jiang, Su-Ping Gao, Xi Li. Methyl jasmonate regulation of pectin polysaccharides in Cosmos bipinnatus roots: A mechanistic insight into alleviating cadmium toxicity.
Environmental pollution (Barking, Essex : 1987).
2024 Mar; 345(?):123503. doi:
10.1016/j.envpol.2024.123503
. [PMID: 38331243] - Yuto Nishidono, Azis Saifudin, Ken Tanaka. Characterization of the Volatile Constituents of Plai (Zingiber purpureum) by Gas Chromatography-Mass Spectrometry.
Molecules (Basel, Switzerland).
2024 Mar; 29(6):. doi:
10.3390/molecules29061216
. [PMID: 38542853] - Ahmad Nasir Labaran, Zakariyya Uba Zango, Giriraj Tailor, Ahmed Alsadig, Fahad Usman, Muhammad Tukur Mukhtar, Alhassan Muhammad Garba, Raed Alhathlool, Khalid Hassan Ibnaouf, Osamah A Aldaghri. Biosynthesis of copper nanoparticles using Alstonia scholaris leaves and its antimicrobial studies.
Scientific reports.
2024 03; 14(1):5589. doi:
10.1038/s41598-024-56052-y
. [PMID: 38453990] - Muhammad Adil, Faten Zubair Filimban, Ambrin, Atifa Quddoos, Ayaz Ali Sher, Muhammad Naseer. Phytochemical screening, HPLC analysis, antimicrobial and antioxidant effect of Euphorbia parviflora L. (Euphorbiaceae Juss.).
Scientific reports.
2024 03; 14(1):5627. doi:
10.1038/s41598-024-55905-w
. [PMID: 38454096] - Shuyi Jin, Yveting Li, Chuan Luo, Xinyi Cheng, Wei Tao, Hongting Li, Wanli Wang, Minjian Qin, Guoyong Xie, Feng Han. Corydalis tomentella Franch. Exerts anti-inflammatory and analgesic effects by regulating the calcium signaling pathway.
Journal of ethnopharmacology.
2024 Mar; 321(?):117499. doi:
10.1016/j.jep.2023.117499
. [PMID: 38042392] - Preeti Pallavi, Pragnya Paramita Sahoo, Sudip Kumar Sen, Sangeeta Raut. Comparative evaluation of anti-biofilm and anti- adherence potential of plant extracts against Streptococcus mutans: A therapeutic approach for oral health.
Microbial pathogenesis.
2024 Mar; 188(?):106514. doi:
10.1016/j.micpath.2023.106514
. [PMID: 38296118] - Y N Shkryl, E A Vasyutkina, T V Gorpenchenko, A A Mironova, T V Rusapetova, P V Velansky, V P Bulgakov, Y A Yugay. Salicylic acid and jasmonic acid biosynthetic pathways are simultaneously activated in transgenic Arabidopsis expressing the rolB/C gene from Ipomoea batatas.
Plant physiology and biochemistry : PPB.
2024 Mar; 208(?):108521. doi:
10.1016/j.plaphy.2024.108521
. [PMID: 38484680] - Mahbobeh Karami, Mohammad Reza Naghavi, Jaber Nasiri, Narjes Farzin, Codruta Ignea. Enhanced production of withaferin A from the hairy root culture of Withania somnifera via synergistic effect of Methyl jasmonate and β-cyclodextrin.
Plant physiology and biochemistry : PPB.
2024 Mar; 208(?):108440. doi:
10.1016/j.plaphy.2024.108440
. [PMID: 38412705] - Ben A Chindo, Melanie-Jayne R Howes, Sawsan Abuhamdah, Danjuma Mallam, Timothy Micah, Rosemary I Awotula, Robin Battison, Paul L Chazot. Evaluation of the anti-nociceptive profile of essential oil from Melissa officinalis L. (lemon balm) in acute and chronic pain models.
Journal of ethnopharmacology.
2024 Mar; 321(?):117500. doi:
10.1016/j.jep.2023.117500
. [PMID: 38030022] - Viviane Lazari Simomura, Daniela Miorando, Beatriz Monteiro Magalhães de Oliveira, Aline Mânica, Lilian Caroline Bohnen, Maike Valentin Buzatto, Francine Mantelli Kunst, Lucas Damo Ansolin, Lincon Bordignon Somensi, Max Vidal Gutiérrez, Larissa Venzon, Thiago Farias de Queiroz E Silva, Luisa Mota da Silva, Walter Antônio Roman Junior. Aqueous extract of the bark of Uncaria tomentosa, an amazonian medicinal plant, promotes gastroprotection and accelerates gastric healing in rats.
Journal of ethnopharmacology.
2024 Mar; 321(?):117542. doi:
10.1016/j.jep.2023.117542
. [PMID: 38056537] - Shujie Ma, Han Zhao, Sijia Liu, Ci Tian, Ming Gao, Yizhen Wang, Jingao Dong, Lihui Zhang. 2,4-Di-tert-butylphenol and 7-hydroxy-3-(2-methylpropyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione: two natural products from Serratia marcescens Ha1 and their herbicidal activities.
Pest management science.
2024 Mar; 80(3):1016-1025. doi:
10.1002/ps.7833
. [PMID: 37831548] - Kyung Hee Jung, Sujin Lee, Han Sun Kim, Jin-Mo Kim, Yun Ji Lee, Min Seok Park, Myeong-Seong Seo, Misu Lee, Mijin Yun, Sunghyouk Park, Soon-Sun Hong. Acetyl-CoA synthetase 2 contributes to a better prognosis for liver cancer by switching acetate-glucose metabolism.
Experimental & molecular medicine.
2024 Mar; 56(3):721-733. doi:
10.1038/s12276-024-01185-3
. [PMID: 38528124] - Jiaojiao Yuan, Su Tuo, Xiuhong Shi, Junling Tu. A new combined technology: Macroporous adsorption resin and high speed counter current chromatography for hydroxytyrosol separation from olive leaf enzymatic hydrolysate.
Journal of chromatography. B, Analytical technologies in the biomedical and life sciences.
2024 Mar; 1235(?):124058. doi:
10.1016/j.jchromb.2024.124058
. [PMID: 38394917] - Sunil Kumar, Neeti Singh, Vaibhavi Lahane, Vineeta Tripathi, Akhilesh Kumar Yadav, Rakesh Kumar Shukla. Methyl jasmonate inducible UGT79A18 is a novel glycosyltransferase involved in the bacoside biosynthetic pathway in Bacopa monnieri.
Physiologia plantarum.
2024 Mar; 176(2):e14260. doi:
10.1111/ppl.14260
. [PMID: 38511471] - Zebo Liu, Xiaofeng Zhu, Ali Mohsin, Huijie Sun, Linxiao Du, Zhongping Yin, Yingping Zhuang, Meijin Guo. Uncovering the Role of Hydroxycinnamoyl Transferase in Boosting Chlorogenic Acid Accumulation in Carthamus tinctorius Cells under Methyl Jasmonate Elicitation.
International journal of molecular sciences.
2024 Feb; 25(5):. doi:
10.3390/ijms25052710
. [PMID: 38473957] - Lei Xu, Xiaoxi Zhu, Fengyan Yi, Yajiao Liu, Bilig Sod, Mingna Li, Lin Chen, Junmei Kang, Qingchuan Yang, Ruicai Long. A genome-wide study of the lipoxygenase gene families in Medicago truncatula and Medicago sativa reveals that MtLOX24 participates in the methyl jasmonate response.
BMC genomics.
2024 Feb; 25(1):195. doi:
10.1186/s12864-024-10071-1
. [PMID: 38373903] - Xiangyang Ye, Xiongzhi He, Zhenting Hu, Fengfeng Zheng, Xiaogang Huang, Xuemei Xie, Feihua Chen, Hanbing Ou, Rongxian Qiu. Metabolomic analysis identifies dysregulation of lipid metabolism in the immune clearance phase of chronic hepatitis B patients.
Journal of pharmaceutical and biomedical analysis.
2024 Feb; 239(?):115900. doi:
10.1016/j.jpba.2023.115900
. [PMID: 38064772] - Márjorie Castro Pinto Porfirio, Jonathan Barbosa Santos, Annie Nolasco Alves, Leandro Soares Santos, Renata Cristina Ferreira Bonomo, Rafael da Costa Ilhéu Fontan. Purification of pineapple bromelain by IMAC chromatography using chlorophyll-activated macroporous matrices.
Journal of chromatography. B, Analytical technologies in the biomedical and life sciences.
2024 Feb; 1234(?):124027. doi:
10.1016/j.jchromb.2024.124027
. [PMID: 38320436] - Suhail Anees, Ifrah Manzoor, Kaneez Fatima, Rabia Hamid, Showkat Ahmad Ganie. GC-MS analysis and potential therapeutic efficacy of extracts from Allium humile Kunth in lowering dyslipidemia in wistar rat models.
Journal of ethnopharmacology.
2024 Feb; 320(?):117478. doi:
10.1016/j.jep.2023.117478
. [PMID: 37989424] - Shuding Sun, Xuefang Liu, Di Zhao, Lishi Zheng, Xiaoxiao Han, Yange Tian, Suxiang Feng. Discovery of the Active Compounds of the Ethyl Acetate Extract Site of Ardisia japonica (Thunb.) Blume for the Treatment of Acute Lung Injury.
Molecules (Basel, Switzerland).
2024 Feb; 29(4):. doi:
10.3390/molecules29040770
. [PMID: 38398522] - Ningning Zhang, Benedikt Venn, Catherine E Bailey, Ming Xia, Erin M Mattoon, Timo Mühlhaus, Ru Zhang. Moderate high temperature is beneficial or detrimental depending on carbon availability in the green alga Chlamydomonas reinhardtii.
Journal of experimental botany.
2024 Feb; 75(3):979-1003. doi:
10.1093/jxb/erad405
. [PMID: 37877811] - Qianlu Yang, Sisi Deng, Heike Preibsch, Tim-Colin Schade, André Koch, Georgy Berezhnoy, Laimdota Zizmare, Anna Fischer, Brigitte Gückel, Annette Staebler, Andreas D Hartkopf, Bernd J Pichler, Christian la Fougère, Markus Hahn, Irina Bonzheim, Konstantin Nikolaou, Christoph Trautwein. Image-guided metabolomics and transcriptomics reveal tumour heterogeneity in luminal A and B human breast cancer beyond glucose tracer uptake.
Clinical and translational medicine.
2024 02; 14(2):e1550. doi:
10.1002/ctm2.1550
. [PMID: 38332687] - Giacomo Palai, Claudio D'Onofrio. Berry secondary metabolites and leaf physiological parameters are independently regulated by exogenous methyl jasmonate application in Sangiovese grapevines (Vitis vinifera L.).
Plant physiology and biochemistry : PPB.
2024 Feb; 207(?):108378. doi:
10.1016/j.plaphy.2024.108378
. [PMID: 38266562] - Jerome Ndudi Asiwe, Godwin D Yovwin, Nwoke Enekabokom Ekene, Simon Irikefe Ovuakporaye, Anthony Chibuzor Nnamudi, Eze Kingsley Nwangwa. Ginkgo biloba modulates ET-I/NO signalling in Lead Acetate induced rat model of endothelial dysfunction: Involvement of oxido-inflammatory mediators.
International journal of environmental health research.
2024 Feb; 34(2):979-990. doi:
10.1080/09603123.2023.2194612
. [PMID: 36960596] - Mohammad Irani, Parvaneh GhaderiShikhi Abadi, Mohammad Mahdi Ahmadian-Attari, Aryan Rezaee, Hananeh Kordbacheh, Pouya Goleij. In vitro and in vivo studies of Dragon's blood plant (D. cinnabari)-loaded electrospun chitosan/PCL nanofibers: Cytotoxicity, antibacterial, and wound healing activities.
International journal of biological macromolecules.
2024 Feb; 257(Pt 1):128634. doi:
10.1016/j.ijbiomac.2023.128634
. [PMID: 38065451] - Raúl Robles-Iglesias, Carla Fernández-Blanco, Jean-Marc Nicaud, María C Veiga, Christian Kennes. Unlocking the potential of one-carbon gases (CO2, CO) for concomitant bioproduction of β-carotene and lipids.
Ecotoxicology and environmental safety.
2024 Feb; 271(?):115950. doi:
10.1016/j.ecoenv.2024.115950
. [PMID: 38211510] - Liuyang Wang, Chaoxia Yang, Xiangdong Mei, Bingbo Guo, Xinling Yang, Tao Zhang, Jun Ning. Identification of sex pheromone in Macdunnoughia crassisigna Warren (Lepidoptera: Noctuidae) and field optimization of the sex attractant.
Pest management science.
2024 Feb; 80(2):577-585. doi:
10.1002/ps.7783
. [PMID: 37735837] - Zhi-Hui Fu, Lin Zhou, An-Zheng Nie. [Effect and mechanism of Maxing Shigan Decoction on reducing inflammatory response in rats with cough variant asthma via TLR4/MyD88/NF-κB and p38 MAPK signaling pathways].
Zhongguo Zhong yao za zhi = Zhongguo zhongyao zazhi = China journal of Chinese materia medica.
2024 Feb; 49(4):1000-1006. doi:
10.19540/j.cnki.cjcmm.20230921.406
. [PMID: 38621907] - Chan Wang, Lei Liu, Tian-Yu Huang, Yu Zhang, Yang Liu, Gui-Rong Wang. Characterization of the pheromone receptors in Mythimna loreyi reveals the differentiation of sex pheromone recognition in Mythimna species.
Insect science.
2024 Feb; 31(1):173-185. doi:
10.1111/1744-7917.13215
. [PMID: 37269179] - Wen Su, Shujing Jiang, Qi Liu, Conghao Sun, Xiaoqing Chen. Rapid screening and target-guided isolation of antioxidants from German chamomile by 2,2-diphenyl-1-picrylhydrazyl-ultra-high-performance liquid chromatography-mass spectrometry coupled with off-line two-dimensional high-speed countercurrent chromatography.
Journal of separation science.
2024 Feb; 47(4):e2300770. doi:
10.1002/jssc.202300770
. [PMID: 38403448] - Amanda Medeiros Martins, Camila Rodrigues Adão Malafaia, Rafaela Machado Nunes, Anete Souza Mecenas, Patricia Homobono Britto De Moura, Michele Frazão Muzitano, Thelma de Barros Machado, Carla da Silva Carneiro, Ivana Correa Ramos Leal. Nutritional, chemical and functional potential of Inga laurina (Fabaceae): A barely used edible species.
Food research international (Ottawa, Ont.).
2024 Feb; 178(?):113751. doi:
10.1016/j.foodres.2023.113751
. [PMID: 38309858] - Yun-Jung Choi, Jeff D Johnson, Jin-Ju Lee, Jiangao Song, Marcy Matthews, Marc K Hellerstein, Charles A McWherter. Seladelpar combined with complementary therapies improves fibrosis, inflammation, and liver injury in a mouse model of nonalcoholic steatohepatitis.
American journal of physiology. Gastrointestinal and liver physiology.
2024 Feb; 326(2):G120-G132. doi:
10.1152/ajpgi.00158.2023
. [PMID: 38014444] - Jiawei Zhou, Yumin Sang, Zhuang Wang, Jiacheng Feng, Linjiang Zhu, Xiaolong Chen. Enhancing the Enantioselectivity and Catalytic Efficiency of Esterase from Bacillus subtilis for Kinetic Resolution of l-Menthol through Semirational Design.
Journal of agricultural and food chemistry.
2024 Jan; 72(4):2277-2286. doi:
10.1021/acs.jafc.3c08321
. [PMID: 38235660] - Sanghee Han, Sung-Lyul Lim, Hail Kim, Hyunjin Choi, Min Young Lee, Sun-Yup Shim, Duc Dat Le, In Jin Ha, Mina Lee, Seok-Geun Lee. Ethyl acetate fraction of Osmanthus fragrans var. aurantiacus and its triterpenoids suppress proliferation and survival of colorectal cancer cells by inhibiting NF-κB and COX2.
Journal of ethnopharmacology.
2024 Jan; 319(Pt 3):117362. doi:
10.1016/j.jep.2023.117362
. [PMID: 38380575] - Yongshuo Ma, Yi Shang, Gregory Stephanopoulos. Engineering peroxisomal biosynthetic pathways for maximization of triterpene production in Yarrowia lipolytica.
Proceedings of the National Academy of Sciences of the United States of America.
2024 Jan; 121(5):e2314798121. doi:
10.1073/pnas.2314798121
. [PMID: 38261612] - Qianqian Cheng, Bin Lyu, Jingweng Hu, Zhiqiang Zhang, Yusheng Huang, Zhenhua Wang. Research on the antipruritic active ingredients of Mikania micrantha.
Fitoterapia.
2024 Jan; 174(?):105837. doi:
10.1016/j.fitote.2024.105837
. [PMID: 38286314] - Xiaoxia Wang, Chenping Kang, Wanqian Guo, Lilan Yuan, Haoran Zhang, Qiong Zhang, Qianqian Xiao, Weidong Hao. Chlormequat chloride induced activation of calmodulin mediated PI3K/AKT signaling pathway led to impaired sperm quality in pubertal mice.
Food and chemical toxicology : an international journal published for the British Industrial Biological Research Association.
2024 Jan; 185(?):114475. doi:
10.1016/j.fct.2024.114475
. [PMID: 38286265] - Thien Khanh Tran, Pham Thi Thu Ha, Robert J Henry, Dang Nguyen Thao Nguyen, Phung Thi Tuyen, Nguyen Thanh Liem. Polyphenol Contents, Gas Chromatography-Mass Spectrometry (GC-MS) and Antibacterial Activity of Methanol Extract and Fractions of Sonneratia Caseolaris Fruits from Ben Tre Province in Vietnam.
Journal of microbiology and biotechnology.
2024 Jan; 34(1):94-102. doi:
10.4014/jmb.2304.04019
. [PMID: 38282409] - Supachai Changphuek, Thaneeya Chetiyanukornkul, Yaowatat Boongla. Simulation analysis of hazardous chemicals released from the furniture plant using ALOHA software.
Environmental monitoring and assessment.
2024 Jan; 196(2):207. doi:
10.1007/s10661-024-12322-w
. [PMID: 38280056] - Nghia Le-Trung, Kenji Kanaori, Tomonori Waku, Thao Thi Phuong Dang, Kaeko Kamei. Acetylmelodorinol isolated from Sphaerocoryne affinis seeds inhibits cell proliferation and activates apoptosis on HeLa cells.
BMC complementary medicine and therapies.
2024 Jan; 24(1):59. doi:
10.1186/s12906-024-04357-w
. [PMID: 38281034] - Yuan Sun, Zhaoyao Qi, Yuanhui Xu, Chenyang Li, Jun Zhao, Tao Liu. Anti-inflammatory, analgesic, antitussive and antipyretic activities of polyphenol-enriched fraction from Nymphaea candida.
Journal of ethnopharmacology.
2024 Jan; 324(?):117789. doi:
10.1016/j.jep.2024.117789
. [PMID: 38266950] - Bassant Philip, Said I Behiry, Mohamed Z M Salem, Mostafa A Amer, Ibrahim A El-Samra, Ahmed Abdelkhalek, Ahmed Heflish. Trichoderma afroharzianum TRI07 metabolites inhibit Alternaria alternata growth and induce tomato defense-related enzymes.
Scientific reports.
2024 01; 14(1):1874. doi:
10.1038/s41598-024-52301-2
. [PMID: 38253713] - Chia-Hung Tsai, Hui-Chi Huang, Kuan-Jung Lin, Jui-Ming Liu, Guan-Lin Chen, Yi-Hsien Yeh, Te-Ling Lu, Hsiang-Wen Lin, Meng-Tien Lu, Po-Chen Chu. Inhibition of Autophagy Aggravates Arachis hypogaea L. Skin Extracts-Induced Apoptosis in Cancer Cells.
International journal of molecular sciences.
2024 Jan; 25(2):. doi:
10.3390/ijms25021345
. [PMID: 38279345] - Nosrat Rahmani, Tayebeh Radjabian. Integrative effects of phytohormones in the phenolic acids production in Salvia verticillata L. under multi-walled carbon nanotubes and methyl jasmonate elicitation.
BMC plant biology.
2024 Jan; 24(1):56. doi:
10.1186/s12870-023-04719-5
. [PMID: 38238679] - Antônio Kleiton de Sousa, Maria Vieira de Brito, Rafael da Silva Prudêncio, Stefany Guimarães Sousa, André Dos Santos Carvalho, Tino Marcos Lino da Silva, Viviane Pinheiro Alves de Almeida, João Janilson da Silva Sousa, Paulo Roberto Carneiro Gomes, Ricardo de Araújo Marques, Tarcisio Vieira de Brito, Daniel Fernando Pereira Vasconcelos, Elias Borges do Nascimento Junior, Maria da Conceição Ferreira de Oliveira, Diva de Aguiar Magalhães, André Luiz Dos Reis Barbosa. The annonalide diterpene extracted from Casimirella ampla (Miers) reduces inflammatory and antinociceptive events in general models of inflammation.
Journal of ethnopharmacology.
2024 Jan; 324(?):117707. doi:
10.1016/j.jep.2024.117707
. [PMID: 38232858] - Cristián Balbontín, Camilo Gutiérrez, Lukas Schreiber, Viktoria V Zeisler-Diehl, Juan C Marín, Victoria Urrutia, Juan Hirzel, Carlos R Figueroa. Alkane biosynthesis is promoted in methyl jasmonate-treated sweet cherry (Prunus avium) fruit cuticles.
Journal of the science of food and agriculture.
2024 Jan; 104(1):530-535. doi:
10.1002/jsfa.12891
. [PMID: 37515815] - Pratibha Demiwal, Sajad Un Nabi, Javid Iqbal Mir, Mahendra K Verma, Shri Ram Yadav, Partha Roy, Debabrata Sircar. Methyl jasmonate improves resistance in scab-susceptible Red Delicious apple by altering ROS homeostasis and enhancing phenylpropanoid biosynthesis.
Plant physiology and biochemistry : PPB.
2024 Jan; 207(?):108371. doi:
10.1016/j.plaphy.2024.108371
. [PMID: 38271863] - Taiyu Zhang, Jie Yuan, Yuzhao Guo, Xinyu Wang, Qing X Li, Jie Zhang, Jia Xie, Weiguo Miao, Yongmei Fan. Combined toxicity of trifloxystrobin and fluopyram to zebrafish embryos and the effect on bone development.
Aquatic toxicology (Amsterdam, Netherlands).
2024 Jan; 268(?):106834. doi:
10.1016/j.aquatox.2024.106834
. [PMID: 38281391] - Xiaochuan Zheng, Xiaodi Xu, Mingyang Liu, Jie Yang, Meng Yuan, Cunxin Sun, Qunlan Zhou, Jianming Chen, Bo Liu. Bile acid and short chain fatty acid metabolism of gut microbiota mediate high-fat diet induced intestinal barrier damage in Macrobrachium rosenbergii.
Fish & shellfish immunology.
2024 Jan; 146(?):109376. doi:
10.1016/j.fsi.2024.109376
. [PMID: 38218421] - Surbhi Gupta, Prabhat Singh, Bhupesh Sharma. Montelukast Ameliorates 2K1C-Hypertension Induced Endothelial Dysfunction and Associated Vascular Dementia.
Current hypertension reviews.
2024 Jan; ?(?):. doi:
10.2174/0115734021276985231204092425
. [PMID: 38192137] - Sajeesh Kappachery, Mohamed AlHosani, Tanveer Alam Khan, Sara Nouh AlKharoossi, Nemah AlMansoori, Sara Ali Saeed AlShehhi, Hamda AlMansoori, Maha AlKarbi, Shina Sasi, Sameera Karumannil, Sampath Kumar Elangovan, Iltaf Shah, Mayank Anand Gururani. Modulation of antioxidant defense and PSII components by exogenously applied acetate mitigates salinity stress in Avena sativa.
Scientific reports.
2024 01; 14(1):620. doi:
10.1038/s41598-024-51302-5
. [PMID: 38182773] - Haroldo X L Volpe, Michele Carmo-Sousa, Rejane A G Luvizotto, Renato de Freitas, Victoria Esperança, Josiane C Darolt, Abner A L Pegoraro, Diego M Magalhães, Arodi P Favaris, Nelson A Wulff, Marcelo P Miranda, José Maurício S Bento, Walter S Leal. The greening-causing agent alters the behavioral and electrophysiological responses of the Asian citrus psyllid to a putative sex pheromone.
Scientific reports.
2024 01; 14(1):455. doi:
10.1038/s41598-023-50983-8
. [PMID: 38172384] - L F Martins, S F Cueva, C F A Lage, M Ramin, T Silvestre, J Tricarico, A N Hristov. A meta-analysis of methane-mitigation potential of feed additives evaluated in vitro.
Journal of dairy science.
2024 Jan; 107(1):288-300. doi:
10.1016/s0022-0302(23)00819-6
. [PMID: 38353472] - Jie Wang, Jiayun Xin, Xike Xu, Wei Chen, Yanhui Lv, Yanping Wei, Xintong Wei, Zhanhong Li, Qianqian Ding, Houyu Zhao, Yukun Wen, Xiuyun Zhang, Yiqun Fang, Xianpeng Zu. Bacopaside I alleviates depressive-like behaviors by modulating the gut microbiome and host metabolism in CUMS-induced mice.
Biomedicine & pharmacotherapy = Biomedecine & pharmacotherapie.
2024 Jan; 170(?):115679. doi:
10.1016/j.biopha.2023.115679
. [PMID: 38113632] - Ramachandra Mohan Rao Pandhari, Tarikere Chandrashekharappa Taranath. In-vitro Antioxidant Activity and Flow Cytometric Analysis of Simarouba glauca DC Bark Extract Induced Apoptosis in Triple Negative Breast Cancer Cells.
Asian Pacific journal of cancer prevention : APJCP.
2024 Jan; 25(1):201-210. doi:
10.31557/apjcp.2024.25.1.201
. [PMID: 38285785] - Nokuthula Ndaba, Marthe Carine Djuidje Fotsing, Penny Poomani Govender. Assessment of Drimia delagoensis (Jessop) Baker Total Phenol, Flavonoids Content and Antioxidant Activity of Both Bulb and Leaves.
Chemistry & biodiversity.
2024 Jan; 21(1):e202301402. doi:
10.1002/cbdv.202301402
. [PMID: 38100129] - Tatiane Batista Dos Santos, Denilson Dos Santos Gomes, Agenor Gomes Dos Santos Neto, Lívia Maria do Amorim Costa Gaspar, Daniela Droppa-Almeida. Botanical Extracts and Compounds of Castanea Plants and Methods of Use: US20190125818A1 - The United States Patent Evaluation.
Recent patents on biotechnology.
2024; 18(2):152-161. doi:
10.2174/1872208317666230420105000
. [PMID: 38282444]