S-Adenosylmethionine (BioDeep_00000018412)
Secondary id: BioDeep_00000003014, BioDeep_00001871780
human metabolite Endogenous blood metabolite BioNovoGene_Lab2019 Volatile Flavor Compounds natural product
代谢物信息卡片
化学式: C15H23N6O5S+ (399.1450568)
中文名称: S-腺苷甲硫氨酸, S-腺苷-L-蛋氨酸
谱图信息:
最多检出来源 Homo sapiens(feces) 0.03%
Last reviewed on 2024-06-29.
Cite this Page
S-Adenosylmethionine. BioDeep Database v3. PANOMIX ltd, a top metabolomics service provider from China.
https://query.biodeep.cn/s/s-adenosylmethionine (retrieved
2024-11-21) (BioDeep RN: BioDeep_00000018412). Licensed
under the Attribution-Noncommercial 4.0 International License (CC BY-NC 4.0).
分子结构信息
SMILES: C[S+](CCC(C(=O)O)N)CC1C(C(C(O1)N2C=NC3=C(N=CN=C32)N)O)O
InChI: InChI=1S/C15H22N6O5S/c1-27(3-2-7(16)15(24)25)4-8-10(22)11(23)14(26-8)21-6-20-9-12(17)18-5-19-13(9)21/h5-8,10-11,14,22-23H,2-4,16H2,1H3,(H2-,17,18,19,24,25)/p+1/t7-,8+,10+,11+,14+,27?/m0/s1
描述信息
S-adenosylmethionine, also known as sam or adomet, is a member of the class of compounds known as 5-deoxy-5-thionucleosides. 5-deoxy-5-thionucleosides are 5-deoxyribonucleosides in which the ribose is thio-substituted at the 5position by a S-alkyl group. S-adenosylmethionine is slightly soluble (in water) and a moderately acidic compound (based on its pKa). S-adenosylmethionine can be found in a number of food items such as common grape, half-highbush blueberry, jerusalem artichoke, and thistle, which makes S-adenosylmethionine a potential biomarker for the consumption of these food products. S-adenosylmethionine can be found primarily in blood, cerebrospinal fluid (CSF), feces, and urine, as well as throughout most human tissues. S-adenosylmethionine exists in all eukaryotes, ranging from yeast to humans. In humans, S-adenosylmethionine is involved in several metabolic pathways, some of which include phosphatidylcholine biosynthesis PC(22:1(13Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)), phosphatidylcholine biosynthesis PC(22:0/18:3(9Z,12Z,15Z)), phosphatidylcholine biosynthesis PC(24:0/24:0), and phosphatidylcholine biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:0). S-adenosylmethionine is also involved in several metabolic disorders, some of which include methylenetetrahydrofolate reductase deficiency (MTHFRD), 3-phosphoglycerate dehydrogenase deficiency, monoamine oxidase-a deficiency (MAO-A), and aromatic l-aminoacid decarboxylase deficiency. Moreover, S-adenosylmethionine is found to be associated with diabetes mellitus type 2 and neurodegenerative disease. S-adenosylmethionine is a non-carcinogenic (not listed by IARC) potentially toxic compound. S-Adenosyl methionine is a common cosubstrate involved in methyl group transfers, transsulfuration, and aminopropylation. Although these anabolic reactions occur throughout the body, most SAM-e is produced and consumed in the liver. More than 40 methyl transfers from SAM-e are known, to various substrates such as nucleic acids, proteins, lipids and secondary metabolites. It is made from adenosine triphosphate (ATP) and methionine by methionine adenosyltransferase (EC 2.5.1.6). SAM was first discovered by Giulio Cantoni in 1952 . Significant first-pass metabolism in the liver. Approximately 50\\\% of S-Adenosylmethionine (SAMe) is metabolized in the liver. SAMe is metabolized to S-adenosylhomocysteine, which is then metabolized to homocysteine. Homocysteine can either be metabolized to cystathionine and then cysteine or to methionine. The cofactor in the metabolism of homocysteine to cysteine is vitamin B6. Cofactors for the metabolism of homocysteine to methionine are folic acid, vitamin B12 and betaine (T3DB).
S-Adenosylmethionine (CAS: 29908-03-0), also known as SAM or AdoMet, is a physiologic methyl radical donor involved in enzymatic transmethylation reactions and present in all living organisms. It possesses anti-inflammatory activity and has been used in the treatment of chronic liver disease (From Merck, 11th ed). S-Adenosylmethionine is a natural substance present in the cells of the body. It plays a crucial biochemical role by donating a one-carbon methyl group in a process called transmethylation. S-Adenosylmethionine, formed from the reaction of L-methionine and adenosine triphosphate catalyzed by the enzyme S-adenosylmethionine synthetase, is the methyl-group donor in the biosynthesis of both DNA and RNA nucleic acids, phospholipids, proteins, epinephrine, melatonin, creatine, and other molecules.
同义名列表
46 个代谢物同义名
[(3S)-3-amino-3-carboxypropyl]({[(2S,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl})methylsulfanium; [1-(Adenin-9-yl)-1,5-dideoxy-beta-D-ribofuranos-5-yl][(3S)-3-amino-3-carboxypropyl](methyl)sulphonium; [1-(Adenin-9-yl)-1,5-dideoxy-beta-D-ribofuranos-5-yl][(3S)-3-amino-3-carboxypropyl](methyl)sulfonium; [1-(Adenin-9-yl)-1,5-dideoxy-β-D-ribofuranos-5-yl][(3S)-3-amino-3-carboxypropyl](methyl)sulphonium; [1-(Adenin-9-yl)-1,5-dideoxy-b-D-ribofuranos-5-yl][(3S)-3-amino-3-carboxypropyl](methyl)sulphonium; [1-(Adenin-9-yl)-1,5-dideoxy-b-D-ribofuranos-5-yl][(3S)-3-amino-3-carboxypropyl](methyl)sulfonium; [1-(Adenin-9-yl)-1,5-dideoxy-β-D-ribofuranos-5-yl][(3S)-3-amino-3-carboxypropyl](methyl)sulfonium; (3S)-5-[(3-Amino-3-carboxypropyl)methylsulphonio]-5-deoxyadenosine, inner salt; (3S)-5-[(3-Amino-3-carboxypropyl)methylsulfonio]-5-deoxyadenosine, inner salt; (3S)-5-[(3-Amino-3-carboxypropyl)methylsulfonio]-5-deoxyadenosine; Knoll brand OF brand OF ademetionine tosilate disulfate; 5-Deoxyadenosine-5-L-methionine disulphate ditosylate; 5-Deoxyadenosine-5-L-methionine disulfate ditosylate; ASTA medica brand OF ademetionine tosilate disulfate; S-Adenosyl-L-methionine disulphate tosylate; S-Adenosyl-L-methionine disulfate tosylate; Sulfate tosylate, S-adenosylmethionine; Tosylate, S-adenosylmethionine sulfate; S-Adenosylmethionine sulfate tosylate; S-(5-Deoxyadenosin-5-yl)-L-methionine; S Adenosylmethionine sulfate tosylate; Europharma brand OF ademetionine; Ademetionine europharma brand; S-(5-Adenosyl)-L-methionine; 2-S-Adenosyl-L-methionine; S-Adenosyl-L-methionine; S Adenosyl L methionine; L-S-Adenosylmethionine; S-Adenosyl methionine; S-Adenosyl-methionine; S Adenosylmethionine; S-Adenosylmethionine; Adenosylmethionine; Active methionine; Acylcarnitine; Ademetionine; Gumbaral; Amet, S; Donamet; S Amet; AdoMet; SAM-e; Samyr; SAMe; SAM; S-Adenosyl-L-methionine
数据库引用编号
21 个数据库交叉引用编号
- ChEBI: CHEBI:15414
- ChEBI: CHEBI:33442
- ChEBI: CHEBI:33440
- PubChem: 34756
- HMDB: HMDB0001185
- ChEMBL: CHEMBL224120
- Wikipedia: S-Adenosyl_methionine
- MeSH: S-Adenosylmethionine
- MetaCyc: S-ADENOSYLMETHIONINE
- KNApSAcK: C00007347
- foodb: FDB031152
- chemspider: 21169292
- CAS: 485-80-3
- RefMet: S-Adenosylmethionine
- CAS: 29908-03-0
- BioNovoGene_Lab2019: BioNovoGene_Lab2019-794
- KEGG: C00019
- PubChem: 3321
- KNApSAcK: 15414
- LOTUS: LTS0014803
- LOTUS: LTS0093657
分类词条
相关代谢途径
Reactome(23)
- Metabolism
- Metabolism of vitamins and cofactors
- Metabolism of proteins
- Post-translational protein modification
- Disease
- Amino acid and derivative metabolism
- Glyoxylate metabolism and glycine degradation
- Metabolism of cofactors
- Ubiquinol biosynthesis
- Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism
- Transport of small molecules
- SLC-mediated transmembrane transport
- Signaling Pathways
- Transport of inorganic cations/anions and amino acids/oligopeptides
- Infectious disease
- Metabolism of RNA
- tRNA processing
- tRNA modification in the nucleus and cytosol
- Viral Infection Pathways
- tRNA modification in the mitochondrion
- Signaling by Nuclear Receptors
- ESR-mediated signaling
- Extra-nuclear estrogen signaling
BioCyc(4)
PlantCyc(0)
代谢反应
2227 个相关的代谢反应过程信息。
Reactome(379)
- Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Metabolism of polyamines:
GAA + SAM ⟶ CRET + H+ + SAH
- Creatine metabolism:
GAA + SAM ⟶ CRET + H+ + SAH
- Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Metabolism of polyamines:
GAA + SAM ⟶ CRET + H+ + SAH
- Creatine metabolism:
GAA + SAM ⟶ CRET + H+ + SAH
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Metabolism of polyamines:
GAA + SAM ⟶ CRET + H+ + SAH
- Creatine metabolism:
GAA + SAM ⟶ CRET + H+ + SAH
- Metabolism of RNA:
Editosome for C to U editing + H2O ⟶ C to U edited ApoB RNA:Editosome complex + ammonia
- tRNA processing:
H2O ⟶ ammonia
- tRNA modification in the nucleus and cytosol:
H2O ⟶ ammonia
- Synthesis of wybutosine at G37 of tRNA(Phe):
2OG + dioxygen ⟶ SUCCA + carbon dioxide
- Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Gamma carboxylation, hypusine formation and arylsulfatase activation:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Synthesis of diphthamide-EEF2:
ATP + Homologues of diphthine EEF2 + NH4+ ⟶ AMP + Homologues of EEF2 + PPi
- Metabolism of proteins:
EIF5A2 + NAD + SPM ⟶ 1,3-diaminopropane + H+ + H0ZKZ7 + NADH
- Post-translational protein modification:
EIF5A2 + NAD + SPM ⟶ 1,3-diaminopropane + H+ + H0ZKZ7 + NADH
- Gamma carboxylation, hypusine formation and arylsulfatase activation:
EIF5A2 + NAD + SPM ⟶ 1,3-diaminopropane + H+ + H0ZKZ7 + NADH
- Synthesis of diphthamide-EEF2:
ATP + H0YRX1 + NH4+ ⟶ AMP + H0YRX1 + PPi
- Biological oxidations:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + SAH ⟶ Ade-Rib + HCYS
- Methylation:
H2O + SAH ⟶ Ade-Rib + HCYS
- Biological oxidations:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + SAH ⟶ Ade-Rib + HCYS
- Methylation:
H2O + SAH ⟶ Ade-Rib + HCYS
- Biological oxidations:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP
- Methylation:
H2O + SAH ⟶ Ade-Rib + HCYS
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Molybdenum cofactor biosynthesis:
ATP + MOCS2 + MOCS3-S-S(1-):Zn2+ ⟶ AMP + MOCS3:Zn2+ (ox.) + O22827 + PPi
- Metabolism of cofactors:
ISCIT + TPN ⟶ 2OG + H+ + TPNH + carbon dioxide
- Ubiquinol biosynthesis:
PHB + all-E-10PrP2 ⟶ DHB + PPi
- Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
CARN + SAM ⟶ Anserine + SAH
- Histidine catabolism:
CARN + SAM ⟶ Anserine + SAH
- Amine-derived hormones:
Dopa ⟶ DA + carbon dioxide
- Serotonin and melatonin biosynthesis:
5HTP ⟶ 5HT + carbon dioxide
- Glyoxylate metabolism and glycine degradation:
GCSH:SAMDLL + THF ⟶ 5,10-methylene-THF + GCSH:DHLL + ammonia
- Sulfur amino acid metabolism:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia
- Metabolism of RNA:
H2O ⟶ AMP + CMP + GMP + UMP
- mRNA Capping:
Capping complex (hydrolyzed) + GTP ⟶ Capping complex (intermediate) + GDP
- Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Translation:
48S complex + ATP ⟶ 48S complex + ADP + Pi
- Eukaryotic Translation Termination:
ETF1 dimer:eRF3:GTP + SAM ⟶ Me-Q185-ETF1 dimer:eRF3:GTP + SAH
- Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Gamma carboxylation, hypusine formation and arylsulfatase activation:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Synthesis of diphthamide-EEF2:
ATP + Homologues of diphthine EEF2 + NH4+ ⟶ AMP + Homologues of EEF2 + PPi
- Protein methylation:
Homologues of EEF1A1 + SAM ⟶ Homologues of Me3K79-EEF1A1 + SAH
- Protein repair:
SAM + isoAsp ⟶ MetAsp + SAH
- Signaling Pathways:
AMP + p-AMPK heterotrimer ⟶ p-AMPK heterotrimer:AMP
- Signaling by GPCR:
2AG + H2O ⟶ AA + Glycerol + H+
- GPCR downstream signalling:
2AG + H2O ⟶ AA + Glycerol + H+
- G alpha (i) signalling events:
ATP + H2O + atRAL ⟶ ADP + Pi + atRAL
- Visual phototransduction:
ATP + H2O + atRAL ⟶ ADP + Pi + atRAL
- The phototransduction cascade:
Homologues of GNAT1 ⟶ Homologues of GNAT1 (Met removed) + L-Met
- Inactivation, recovery and regulation of the phototransduction cascade:
Homologues of GNAT1 ⟶ Homologues of GNAT1 (Met removed) + L-Met
- Gene expression (Transcription):
ATP + pol II transcription complex containing 3 Nucleotide long transcript ⟶ AMP + PPi + pol II transcription complex containing 3 Nucleotide long transcript
- RNA Polymerase II Transcription:
ATP + pol II transcription complex containing 3 Nucleotide long transcript ⟶ AMP + PPi + pol II transcription complex containing 3 Nucleotide long transcript
- Generic Transcription Pathway:
GSSG + H+ + TPNH ⟶ GSH + TPN
- Transcriptional regulation by RUNX1:
RUNX1:CBFB:SIN3A,(SIN3B):PRMT6:HDAC1:ITGA2B gene:H3K4me2-Nucleosome + SAM ⟶ RUNX1:CBFB:SIN3A,(SIN3B):PRMT6:HDAC1:ITGA2B gene:H3K4me2,H3R2me2a-Nucleosome + SAH
- RUNX1 regulates genes involved in megakaryocyte differentiation and platelet function:
RUNX1:CBFB:SIN3A,(SIN3B):PRMT6:HDAC1:ITGA2B gene:H3K4me2-Nucleosome + SAM ⟶ RUNX1:CBFB:SIN3A,(SIN3B):PRMT6:HDAC1:ITGA2B gene:H3K4me2,H3R2me2a-Nucleosome + SAH
- Epigenetic regulation of gene expression:
DNMT1,3A,3B:PRC2:Chromatin + SAM ⟶ DNMT1,3A,3B:PRC2:Chromatin (5-mC, H3K27me3) + SAH
- PRC2 methylates histones and DNA:
DNMT1,3A,3B:PRC2:Chromatin + SAM ⟶ DNMT1,3A,3B:PRC2:Chromatin (5-mC, H3K27me3) + SAH
- DNA Repair:
MUTYH:(OGUA:Ade)-dsDNA ⟶ Ade + MUTYH:AP-dsDNA
- DNA Double-Strand Break Repair:
ATP + DNA DSBs:MRN:Ac-K3016-ATM dimer:KAT5 ⟶ ADP + DNA DSBs:MRN:p-S1981,Ac-K3016-ATM:KAT5 + Homologues of p-S1981,Ac-K3016-ATM
- DNA Double Strand Break Response:
ATP + DNA DSBs:MRN:Ac-K3016-ATM dimer:KAT5 ⟶ ADP + DNA DSBs:MRN:p-S1981,Ac-K3016-ATM:KAT5 + Homologues of p-S1981,Ac-K3016-ATM
- Recruitment and ATM-mediated phosphorylation of repair and signaling proteins at DNA double strand breaks:
ATP + DNA DSBs:MRN:p-S1981,Ac-K3016-ATM:KAT5 ⟶ ADP + DNA DSB:p-MRN:p-S1981,Ac-K3016-ATM:KAT5
- Cell Cycle:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide
- Cell Cycle, Mitotic:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide
- Mitotic G2-G2/M phases:
ATP + CCNA:p-T160-CDK2:E2F1/E2F3 ⟶ ADP + CCNA:p-T160-CDK2:p-E2F1/p-E2F3
- G2/M Transition:
ATP + CCNA:p-T14-CDK1 ⟶ ADP + CCNA:p-T14,T161-CDK1
- Cyclin A/B1/B2 associated events during G2/M transition:
ATP + CCNA:p-T14-CDK1 ⟶ ADP + CCNA:p-T14,T161-CDK1
- Chromatin organization:
2OG + Oxygen ⟶ CH2O + SUCCA + carbon dioxide
- Chromatin modifying enzymes:
2OG + Oxygen ⟶ CH2O + SUCCA + carbon dioxide
- PKMTs methylate histone lysines:
SAM ⟶ SAH
- RMTs methylate histone arginines:
SAM ⟶ SAH
- Cellular responses to external stimuli:
GSSG + H+ + TPNH ⟶ GSH + TPN
- Cellular responses to stress:
GSSG + H+ + TPNH ⟶ GSH + TPN
- Cellular Senescence:
ATP + DNA DSBs:MRN:Ac-K3016-ATM dimer:KAT5 ⟶ ADP + DNA DSBs:MRN:p-S1981,Ac-K3016-ATM:KAT5 + Homologues of p-S1981,Ac-K3016-ATM
- Oxidative Stress Induced Senescence:
ATP ⟶ ADP
- Senescence-Associated Secretory Phenotype (SASP):
ATP ⟶ ADP
- Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of cofactors:
ISCIT + TPN ⟶ 2OG + H+ + TPNH + carbon dioxide
- Ubiquinol biosynthesis:
PHB + all-E-10PrP2 ⟶ DHB + PPi
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK
- Glyoxylate metabolism and glycine degradation:
GCSH:SAMDLL + THF ⟶ 5,10-methylene-THF + GCSH:DHLL + ammonia
- Signaling Pathways:
ADORA2A,B + Ade-Rib ⟶ ADORA2A,B:Ade-Rib
- Signaling by Nuclear Receptors:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN
- ESR-mediated signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Protein methylation:
ETFB + SAM ⟶ Q9TXI4 + SAH
- Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Ubiquinol biosynthesis:
PHB + all-E-10PrP2 ⟶ DHB + PPi
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK
- Glyoxylate metabolism and glycine degradation:
GCSH:SAMDLL + THF ⟶ 5,10-methylene-THF + GCSH:DHLL + ammonia
- PRC2 methylates histones and DNA:
PRC2:Chromatin + SAM ⟶ PRC2:Chromatin (H3K27me3) + SAH
- Negative epigenetic regulation of rRNA expression:
Chromatin with acetylated H3 + NAD ⟶ 2'-O-acetyl-ADP-ribose + Chromatin + NAM
- SIRT1 negatively regulates rRNA expression:
Chromatin with acetylated H3 + NAD ⟶ 2'-O-acetyl-ADP-ribose + Chromatin + NAM
- Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Protein methylation:
ETFB + SAM ⟶ ETFB + SAH
- Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- Signaling by Nuclear Receptors:
E2QW22 + E2RPT1 + ESR1:ER:PGR:P4 + F6UTY3 + J9P0C0 ⟶ ESR1:ESTG:PGR:P4:FOXA1:GATA3:TLE3:NRIP:EP300
- ESR-mediated signaling:
E2QW22 + E2RPT1 + ESR1:ER:PGR:P4 + F6UTY3 + J9P0C0 ⟶ ESR1:ESTG:PGR:P4:FOXA1:GATA3:TLE3:NRIP:EP300
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Metabolism of vitamins and cofactors:
6x(PCCA:PCCB) + ATP + Btn ⟶ 6x(Btn-PCCA:PCCB) + AMP + PPi
- Metabolism of cofactors:
H+ + TPNH + sepiapterin ⟶ TPN + dihydrobiopterin
- Ubiquinol biosynthesis:
PHB + all-E-10PrP2 ⟶ DHB + PPi
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK
- Glyoxylate metabolism and glycine degradation:
GCSH:SAMDLL + THF ⟶ 5,10-methylene-THF + GCSH:DHLL + ammonia
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Ubiquinol biosynthesis:
PHB + all-E-10PrP2 ⟶ DHB + PPi
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK
- Glyoxylate metabolism and glycine degradation:
GCSH:SAMDLL + THF ⟶ 5,10-methylene-THF + GCSH:DHLL + ammonia
- Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Protein methylation:
SAM + etfb ⟶ SAH + etfb
- Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Ubiquinol biosynthesis:
PHB + all-E-10PrP2 ⟶ DHB + PPi
- Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK
- Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- Signaling by Nuclear Receptors:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + HSP90:HSP90 + Pi + Q9VH95 + Q9VL78
- ESR-mediated signaling:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + HSP90:HSP90 + Pi + Q9VH95 + Q9VL78
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Ubiquinol biosynthesis:
PHB + all-E-10PrP2 ⟶ DHB + PPi
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK
- Glyoxylate metabolism and glycine degradation:
GCSH:SAMDLL + THF ⟶ 5,10-methylene-THF + GCSH:DHLL + ammonia
- Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Ubiquinol biosynthesis:
PHB + all-E-10PrP2 ⟶ DHB + PPi
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK
- Glyoxylate metabolism and glycine degradation:
L-Ala + glyoxylate ⟶ Gly + PYR
- Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Ubiquinol biosynthesis:
MHDB ⟶ DMPhOH + carbon dioxide
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK
- Glyoxylate metabolism and glycine degradation:
GCSH:SAMDLL + THF ⟶ 5,10-methylene-THF + GCSH:DHLL + ammonia
- Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- Signaling by Nuclear Receptors:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + HSP90:HSP90 + Immunophilin FKBP52 + Pi + cPGES
- ESR-mediated signaling:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + HSP90:HSP90 + Immunophilin FKBP52 + Pi + cPGES
- Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Protein methylation:
ETFB + SAM ⟶ ETF-beta + SAH
- Disease:
ADORA2B + Ade-Rib ⟶ ADORA2B:Ade-Rib
- Infectious disease:
ADORA2B + Ade-Rib ⟶ ADORA2B:Ade-Rib
- rRNA processing:
SAM ⟶ SAH
- rRNA processing in the mitochondrion:
SAM ⟶ SAH
- rRNA modification in the mitochondrion:
SAM ⟶ SAH
- tRNA modification in the mitochondrion:
SAM ⟶ SAH
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Ubiquinol biosynthesis:
PHB + all-E-10PrP2 ⟶ DHB + PPi
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK
- Glyoxylate metabolism and glycine degradation:
GCSH:SAMDLL + THF ⟶ 5,10-methylene-THF + GCSH:DHLL + ammonia
- Negative epigenetic regulation of rRNA expression:
Chromatin with acetylated H3 + NAD ⟶ 2'-O-acetyl-ADP-ribose + Chromatin + NAM
- SIRT1 negatively regulates rRNA expression:
Chromatin with acetylated H3 + NAD ⟶ 2'-O-acetyl-ADP-ribose + Chromatin + NAM
- Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- Signaling by Nuclear Receptors:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + Fkbp4 + HSP90:HSP90 + Pi + Q9R0Q7
- ESR-mediated signaling:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + Fkbp4 + HSP90:HSP90 + Pi + Q9R0Q7
- Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Protein methylation:
Etfb + SAM ⟶ Etfb + SAH
- DNA Repair:
MUTYH:(OGUA:Ade)-dsDNA ⟶ Ade + MUTYH:AP-dsDNA
- DNA Double-Strand Break Repair:
ATP + p-T2609,S2612,T2638,T2647-PRKDC:XRCC5:XRCC6:p-S645-DCLRE1C:DNA DSB ends ⟶ ADP + p-T2609,S2612,T2638,T2647-PRKDC:XRCC5:XRCC6:p-S516,S645-DCLRE1C:DNA DSB ends
- DNA Double Strand Break Response:
ATP + DNA DSBs:MRN:Ac-K3016-ATM dimer:KAT5 ⟶ ADP + DNA DSBs:MRN:p-S1981,Ac-K3016-ATM:KAT5 + phospho-p-S1981,Ac-K3016-ATM
- Recruitment and ATM-mediated phosphorylation of repair and signaling proteins at DNA double strand breaks:
ATP + DNA DSBs:MRN:p-S1981,Ac-K3016-ATM:KAT5 ⟶ ADP + DNA DSB:p-MRN:p-S1981,Ac-K3016-ATM:KAT5
- Cellular responses to external stimuli:
GSSG + H+ + TPNH ⟶ GSH + TPN
- Cellular responses to stress:
GSSG + H+ + TPNH ⟶ GSH + TPN
- Cellular Senescence:
ATP ⟶ ADP
- Oxidative Stress Induced Senescence:
ATP ⟶ ADP
- Senescence-Associated Secretory Phenotype (SASP):
ATP ⟶ ADP
- Cell Cycle:
ATP + Q5N897 ⟶ ADP + phospho-p-CDC6
- Cell Cycle, Mitotic:
ATP + Q5N897 ⟶ ADP + phospho-p-CDC6
- Mitotic G2-G2/M phases:
ATP + CCNA:p-T160-CDK2:E2F1/E2F3 ⟶ ADP + CCNA:p-T160-CDK2:p-E2F1/p-E2F3
- G2/M Transition:
H2O + MeL-PP2A ⟶ PP2A + methanol
- Cyclin A/B1/B2 associated events during G2/M transition:
H2O + MeL-PP2A ⟶ PP2A + methanol
- Metabolism of RNA:
H2O ⟶ AMP + CMP + GMP + UMP
- mRNA Capping:
Capping complex (hydrolyzed) + GTP ⟶ Capping complex (intermediate) + GDP
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Molybdenum cofactor biosynthesis:
ATP + MOCS3-S-S(1-):Zn2+ + Q6Z2X3 ⟶ AMP + MOCS3:Zn2+ (ox.) + PPi + Q6Z2X3
- Metabolism of cofactors:
ISCIT + TPN ⟶ 2OG + H+ + TPNH + carbon dioxide
- Ubiquinol biosynthesis:
PHB + all-E-10PrP2 ⟶ DHB + PPi
- Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
CARN + SAM ⟶ Anserine + SAH
- Histidine catabolism:
CARN + SAM ⟶ Anserine + SAH
- Amine-derived hormones:
Dopa ⟶ DA + carbon dioxide
- Serotonin and melatonin biosynthesis:
5HTP ⟶ 5HT + carbon dioxide
- Glyoxylate metabolism and glycine degradation:
GCSH:SAMDLL + THF ⟶ 5,10-methylene-THF + GCSH:DHLL + ammonia
- Sulfur amino acid metabolism:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia
- Chromatin organization:
2OG + MeK37-histone H3 + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide
- Chromatin modifying enzymes:
2OG + MeK37-histone H3 + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide
- PKMTs methylate histone lysines:
Histone H3 + SAM ⟶ MeK5-histone H3 + SAH
- RMTs methylate histone arginines:
Histone H3 + SAM ⟶ Me2sR3-histone H3 + SAH
- Gene expression (Transcription):
ATP + pol II transcription complex containing 3 Nucleotide long transcript ⟶ AMP + PPi + pol II transcription complex containing 3 Nucleotide long transcript
- Epigenetic regulation of gene expression:
DNMT1,3A,3B:PRC2:Chromatin + SAM ⟶ DNMT1,3A,3B:PRC2:Chromatin (5-mC, H3K27me3) + SAH
- PRC2 methylates histones and DNA:
DNMT1,3A,3B:PRC2:Chromatin + SAM ⟶ DNMT1,3A,3B:PRC2:Chromatin (5-mC, H3K27me3) + SAH
- Translation:
48S complex + ATP ⟶ 48S complex + ADP + Pi
- Eukaryotic Translation Termination:
ETF1 dimer:eRF3:GTP + SAM ⟶ Me-Q185-ETF1 dimer:eRF3:GTP + SAH
- Protein methylation:
EEF1A1 + SAM ⟶ Me3K79-EEF1A1 + SAH
- Protein repair:
SAM + isoAsp ⟶ MetAsp + SAH
- Signaling Pathways:
AMP + p-AMPK heterotrimer ⟶ p-AMPK heterotrimer:AMP
- Signaling by GPCR:
2AG + H2O ⟶ AA + Glycerol + H+
- GPCR downstream signalling:
2AG + H2O ⟶ AA + Glycerol + H+
- G alpha (i) signalling events:
ATP + Calmodulin:CaMK IV ⟶ ADP + phospho-CaMK IV:Calmodulin
- Visual phototransduction:
ATP + H2O + atRAL ⟶ ADP + Pi + atRAL
- The phototransduction cascade:
Homologues of GNAT1 ⟶ Homologues of GNAT1 (Met removed) + L-Met
- Inactivation, recovery and regulation of the phototransduction cascade:
Homologues of GNAT1 ⟶ Homologues of GNAT1 (Met removed) + L-Met
- Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Metabolism of vitamins and cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Metabolism of cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Ubiquinol biosynthesis:
PHB + all-E-10PrP2 ⟶ DHB + PPi
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
CARN + SAM ⟶ Anserine + SAH
- Glyoxylate metabolism and glycine degradation:
GCSH:SAMDLL + THF ⟶ 5,10-methylene-THF + GCSH:DHLL + ammonia
- Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Ubiquinol biosynthesis:
PHB + all-E-10PrP2 ⟶ DHB + PPi
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK
- Glyoxylate metabolism and glycine degradation:
GCSH:SAMDLL + THF ⟶ 5,10-methylene-THF + GCSH:DHLL + ammonia
- Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Protein methylation:
Etfb + SAM ⟶ Etfb + SAH
- Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- Signaling by Nuclear Receptors:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + HSP90:HSP90 + Pi + Ptges3 + Q9QVC8
- ESR-mediated signaling:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + HSP90:HSP90 + Pi + Ptges3 + Q9QVC8
- Transcriptional regulation by RUNX1:
RUNX1:CBFB:SIN3A,(SIN3B):PRMT6:HDAC1:ITGA2B gene:H3K4me2-Nucleosome + SAM ⟶ RUNX1:CBFB:SIN3A,(SIN3B):PRMT6:HDAC1:ITGA2B gene:H3K4me2,H3R2me2a-Nucleosome + SAH
- RUNX1 regulates genes involved in megakaryocyte differentiation and platelet function:
RUNX1:CBFB:SIN3A,(SIN3B):PRMT6:HDAC1:ITGA2B gene:H3K4me2-Nucleosome + SAM ⟶ RUNX1:CBFB:SIN3A,(SIN3B):PRMT6:HDAC1:ITGA2B gene:H3K4me2,H3R2me2a-Nucleosome + SAH
- Metabolism:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine
- Metabolism of vitamins and cofactors:
4x(PC:Mn2+) + ATP + Btn ⟶ 4x(Btn-PC:Mn2+) + AMP + PPi
- Metabolism of cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Ubiquinol biosynthesis:
PHB + all-E-10PrP2 ⟶ DHB + PPi
- Amino acid and derivative metabolism:
GAA + SAM ⟶ CRET + H+ + SAH
- Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK
- Glyoxylate metabolism and glycine degradation:
GCSH:SAMDLL + THF ⟶ 5,10-methylene-THF + GCSH:DHLL + ammonia
- Metabolism:
GAA + SAM ⟶ CRET + H+ + SAH
- Metabolism of vitamins and cofactors:
4x(PC:Mn2+) + ATP + Btn ⟶ 4x(Btn-PC:Mn2+) + AMP + PPi
- Metabolism of cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Ubiquinol biosynthesis:
PHB + all-E-10PrP2 ⟶ DHB + PPi
- Amino acid and derivative metabolism:
GAA + SAM ⟶ CRET + H+ + SAH
- Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
ATP + L-His + b-Ala ⟶ ADP + CARN + Pi
- Glyoxylate metabolism and glycine degradation:
GCSH:SAMDLL + THF ⟶ 5,10-methylene-THF + GCSH:DHLL + ammonia
- Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of cofactors:
H+ + TPNH + sepiapterin ⟶ TPN + dihydrobiopterin
- Ubiquinol biosynthesis:
PHB + all-E-10PrP2 ⟶ DHB + PPi
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK
- Glyoxylate metabolism and glycine degradation:
GCSH:SAMDLL + THF ⟶ 5,10-methylene-THF + GCSH:DHLL + ammonia
- Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- Signaling by Nuclear Receptors:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN
- ESR-mediated signaling:
SPG ⟶ S1P
- Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Protein methylation:
ETFB + SAM ⟶ ETFB + SAH
- Signaling Pathways:
AMP + p-AMPK heterotrimer ⟶ p-AMPK heterotrimer:AMP
- Signaling by GPCR:
H2O + cAMP ⟶ AMP
- GPCR downstream signalling:
H2O + cAMP ⟶ AMP
- G alpha (i) signalling events:
H2O + cAMP ⟶ AMP
- Visual phototransduction:
H+ + RBP2:atRAL + TPNH ⟶ RBP2:atROL + TPN
- The phototransduction cascade:
ATP + Q9IA36 ⟶ ADP + phospho-p-S334,338,343-at-retinyl-RHO
- Inactivation, recovery and regulation of the phototransduction cascade:
ATP + Q9IA36 ⟶ ADP + phospho-p-S334,338,343-at-retinyl-RHO
- Protein methylation:
H0Z8H2 + SAM ⟶ H0Z8H2 + SAH
- Protein repair:
R-MetO + TXN ⟶ B5G117 + L-Met
- Neuronal System:
DA + SAM ⟶ 3MT + SAH
- Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH
- Neurotransmitter clearance:
DA + SAM ⟶ 3MT + SAH
- Clearance of dopamine:
DA + SAM ⟶ 3MT + SAH
- Enzymatic degradation of dopamine by COMT:
DA + SAM ⟶ 3MT + SAH
- Enzymatic degradation of Dopamine by monoamine oxidase:
DA + H2O + Oxygen ⟶ 5HT-N-CH3 + ammonia
- Cellular responses to external stimuli:
HSP90:ATP:PTGES3:FKBP52:SHR:SH ⟶ ADP + H0ZSE5 + H0ZZA2 + HSP90-beta dimer + Pi + SHR:SH
- Cellular responses to stress:
HSP90:ATP:PTGES3:FKBP52:SHR:SH ⟶ ADP + H0ZSE5 + H0ZZA2 + HSP90-beta dimer + Pi + SHR:SH
- Cellular Senescence:
ATP + H0YQQ4 ⟶ ADP + phospho-p-T38-ETS1
- Oxidative Stress Induced Senescence:
ATP + MKK3, MKK6 ⟶ ADP + p-MKK3,p-MKK6
- Cell Cycle:
ATP + p21,p27 ⟶ ADP + p-T-CDKN1A/B
- Cell Cycle, Mitotic:
ATP + p21,p27 ⟶ ADP + p-T-CDKN1A/B
- Mitotic G2-G2/M phases:
ATP + CCNA:p-T14-CDK1 ⟶ ADP + CCNA:p-T14,T161-CDK1
- G2/M Transition:
ATP + CCNA:p-T14-CDK1 ⟶ ADP + CCNA:p-T14,T161-CDK1
- Cyclin A/B1/B2 associated events during G2/M transition:
ATP + CCNA:p-T14-CDK1 ⟶ ADP + CCNA:p-T14,T161-CDK1
- Chromatin organization:
H2O ⟶ ammonia
- Chromatin modifying enzymes:
H2O ⟶ ammonia
- PKMTs methylate histone lysines:
Homologues of HIST1H4 + SAM ⟶ Homologues of MeK-HIST1H4A + SAH
- RMTs methylate histone arginines:
H0Z8H2 + SAM ⟶ H0Z8H2 + SAH
- Gene expression (Transcription):
p-AMPK heterotrimer:AMP ⟶ SESN1,2,3:p-AMPK heterotrimer:AMP
- RNA Polymerase II Transcription:
p-AMPK heterotrimer:AMP ⟶ SESN1,2,3:p-AMPK heterotrimer:AMP
- Generic Transcription Pathway:
p-AMPK heterotrimer:AMP ⟶ SESN1,2,3:p-AMPK heterotrimer:AMP
- Transcriptional regulation by RUNX1:
ATP + Homologues of YAP1 ⟶ ADP + Homologues of p-Y407-YAP1
- RUNX1 regulates genes involved in megakaryocyte differentiation and platelet function:
RUNX1:CBFB:PRMT1 + SAM ⟶ MeR206,MeR210-RUNX1:CBFB:PRMT1 + SAH
- Epigenetic regulation of gene expression:
Chromatin with acetylated H3 + NAD ⟶ 2'-O-acetyl-ADP-ribose + Chromatin + NAM
- PRC2 methylates histones and DNA:
PRC2:Chromatin + SAM ⟶ PRC2:Chromatin (H3K27me3) + SAH
- Negative epigenetic regulation of rRNA expression:
Chromatin with acetylated H3 + NAD ⟶ 2'-O-acetyl-ADP-ribose + Chromatin + NAM
- SIRT1 negatively regulates rRNA expression:
Chromatin with acetylated H3 + NAD ⟶ 2'-O-acetyl-ADP-ribose + Chromatin + NAM
- Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Phospholipid metabolism:
H2O + PETA ⟶ CH3CHO + Pi + ammonia
- Glycerophospholipid biosynthesis:
H2O + PETA ⟶ CH3CHO + Pi + ammonia
- Synthesis of PC:
Ac-CoA + Cho ⟶ AcCho + CoA-SH
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Cobalamin (Cbl, vitamin B12) transport and metabolism:
Cbl + H+ + Homologues of MMACHC + TPNH ⟶ MMACHC:cob(II)alamin + TPN
- Molybdenum cofactor biosynthesis:
ATP + H2O + MPT + MoO4(2-) ⟶ AMP + MoCo + PPi
- Metabolism of cofactors:
ISCIT + TPN ⟶ 2OG + H+ + TPNH + carbon dioxide
- Ubiquinol biosynthesis:
PHB + all-E-10PrP2 ⟶ DHB + PPi
- Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK
- Histidine catabolism:
CARN + SAM ⟶ Anserine + SAH
- Amine-derived hormones:
Iodine + L-Tyr ⟶ HI + MIT
- Catecholamine biosynthesis:
DA + Oxygen + VitC ⟶ DHA + H2O + NAd
- Serotonin and melatonin biosynthesis:
5HTP ⟶ 5HT + carbon dioxide
- Glyoxylate metabolism and glycine degradation:
GCSH:SAMDLL + THF ⟶ 5,10-methylene-THF + GCSH:DHLL + ammonia
- Sulfur amino acid metabolism:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Ubiquinol biosynthesis:
PHB + all-E-10PrP2 ⟶ DHB + PPi
- Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK
- Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- Signaling by Nuclear Receptors:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ A0A310SUH5 + ADP + ESR1:ER:PGR:P4 + HSP90:HSP90 + Pi + Q5U4Z0
- ESR-mediated signaling:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ A0A310SUH5 + ADP + ESR1:ER:PGR:P4 + HSP90:HSP90 + Pi + Q5U4Z0
- Metabolism of proteins:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a
- Post-translational protein modification:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a
- Protein methylation:
A0A6I8RPG4 + SAM ⟶ A0A6I8RPG4 + SAH
- Extra-nuclear estrogen signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Extra-nuclear estrogen signaling:
SPG ⟶ S1P
- Extra-nuclear estrogen signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Extra-nuclear estrogen signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Extra-nuclear estrogen signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Extra-nuclear estrogen signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Extra-nuclear estrogen signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Extra-nuclear estrogen signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Transcriptional regulation by RUNX1:
RUNX1:CBFB:SIN3A,(SIN3B):PRMT6:HDAC1:ITGA2B gene:H3K4me2-Nucleosome + SAM ⟶ RUNX1:CBFB:SIN3A,(SIN3B):PRMT6:HDAC1:ITGA2B gene:H3K4me2,H3R2me2a-Nucleosome + SAH
- RUNX1 regulates genes involved in megakaryocyte differentiation and platelet function:
RUNX1:CBFB:SIN3A,(SIN3B):PRMT6:HDAC1:ITGA2B gene:H3K4me2-Nucleosome + SAM ⟶ RUNX1:CBFB:SIN3A,(SIN3B):PRMT6:HDAC1:ITGA2B gene:H3K4me2,H3R2me2a-Nucleosome + SAH
- Transcriptional regulation by RUNX1:
RUNX1:CBFB:SIN3A,(SIN3B):PRMT6:HDAC1:ITGA2B gene:H3K4me2-Nucleosome + SAM ⟶ RUNX1:CBFB:SIN3A,(SIN3B):PRMT6:HDAC1:ITGA2B gene:H3K4me2,H3R2me2a-Nucleosome + SAH
- RUNX1 regulates genes involved in megakaryocyte differentiation and platelet function:
RUNX1:CBFB:SIN3A,(SIN3B):PRMT6:HDAC1:ITGA2B gene:H3K4me2-Nucleosome + SAM ⟶ RUNX1:CBFB:SIN3A,(SIN3B):PRMT6:HDAC1:ITGA2B gene:H3K4me2,H3R2me2a-Nucleosome + SAH
- SARS-CoV Infections:
H2O + N-glycan Spike ⟶ beta-D-glucose + trimmed unfolded N-glycan Spike
- SARS-CoV-1 Infection:
H2O + N-glycan Spike ⟶ beta-D-glucose + trimmed unfolded N-glycan Spike
- SARS-CoV-1 Genome Replication and Transcription:
GTP + H2O + S-adenosyl-L-methionine + SARS-CoV-1 genomic RNA complement (minus strand):RTC ⟶ PPi + Pi + S-adenosyl-L-homocysteine + m7GpppA-capped SARS-CoV-1 genomic RNA complement (minus strand):RTC
- Replication of the SARS-CoV-1 genome:
GTP + H2O + S-adenosyl-L-methionine + SARS-CoV-1 genomic RNA complement (minus strand):RTC ⟶ PPi + Pi + S-adenosyl-L-homocysteine + m7GpppA-capped SARS-CoV-1 genomic RNA complement (minus strand):RTC
- Transcription of SARS-CoV-1 sgRNAs:
GTP + H2O + S-adenosyl-L-methionine + SARS-CoV-1 plus strand subgenomic mRNAs:RTC ⟶ PPi + Pi + S-adenosyl-L-homocysteine + m7GpppA-SARS-CoV-1 plus strand subgenomic mRNAs:RTC
- Negative epigenetic regulation of rRNA expression:
Chromatin with acetylated H3 + NAD ⟶ 2'-O-acetyl-ADP-ribose + Chromatin + NAM
- SIRT1 negatively regulates rRNA expression:
Chromatin with acetylated H3 + NAD ⟶ 2'-O-acetyl-ADP-ribose + Chromatin + NAM
- SARS-CoV-2 Infection:
14-sugar N-glycan unfolded Spike + H2O ⟶ Man(9) N-glycan unfolded Spike + beta-D-glucose
- SARS-CoV-2 Genome Replication and Transcription:
GTP + H2O + S-adenosyl-L-methionine + SARS-CoV-2 genomic RNA complement (minus strand):RTC ⟶ PPi + Pi + S-adenosyl-L-homocysteine + m7GpppA-capped SARS-CoV-2 genomic RNA complement (minus strand):RTC
- Replication of the SARS-CoV-2 genome:
GTP + H2O + S-adenosyl-L-methionine + SARS-CoV-2 genomic RNA complement (minus strand):RTC ⟶ PPi + Pi + S-adenosyl-L-homocysteine + m7GpppA-capped SARS-CoV-2 genomic RNA complement (minus strand):RTC
- Transcription of SARS-CoV-2 sgRNAs:
GTP + H2O + S-adenosyl-L-methionine + SARS-CoV-2 plus strand subgenomic mRNAs:RTC ⟶ PPi + Pi + S-adenosyl-L-homocysteine + m7GpppA-SARS-CoV-2 plus strand subgenomic mRNAs:RTC
- Translation of Structural Proteins:
14-sugar N-glycan unfolded Spike + H2O ⟶ Man(9) N-glycan unfolded Spike + beta-D-glucose
- Maturation of nucleoprotein:
NAD + p-11S,2T-metR95,177-N ⟶ ADPr-p-11S,2T-metR95,177-N + H+ + NAM
- PRC2 methylates histones and DNA:
PRC2:Chromatin + SAM ⟶ PRC2:Chromatin (H3K27me3) + SAH
- Early SARS-CoV-2 Infection Events:
GTP + nsp7 ⟶ N6GMPLys-nsp7 + PPi
- Late SARS-CoV-2 Infection Events:
NAD + p-11S,2T-metR95,177-N ⟶ ADPr-p-11S,2T-metR95,177-N + H+ + NAM
- Viral Infection Pathways:
NAD + p-S177-N ⟶ ADPr-p-S177-N + H+ + NAM
- Respiratory Syncytial Virus Infection Pathway:
GTP + H2O + S-adenosyl-L-methionine + hRSV A nascent mRNAs:RdRP:p-M2-1 ⟶ PPi + Pi + RSV m7GpppG-mRNAs:RdRP:p-M2-1 + S-adenosyl-L-homocysteine
- Respiratory syncytial virus (RSV) genome replication, transcription and translation:
GTP + H2O + S-adenosyl-L-methionine + hRSV A nascent mRNAs:RdRP:p-M2-1 ⟶ PPi + Pi + RSV m7GpppG-mRNAs:RdRP:p-M2-1 + S-adenosyl-L-homocysteine
- Respiratory syncytial virus genome transcription:
GTP + H2O + S-adenosyl-L-methionine + hRSV A nascent mRNAs:RdRP:p-M2-1 ⟶ PPi + Pi + RSV m7GpppG-mRNAs:RdRP:p-M2-1 + S-adenosyl-L-homocysteine
BioCyc(8)
- polyamine biosynthesis:
L-ornithine ⟶ CO2 + putrescine
- ubiquinone (coenzyme Q) biosynthesis:
L-tyrosine ⟶ ammonia + p-hydroxyphenylpyruvate
- siroheme biosynthesis:
SAM + uroporphyrinogen-III ⟶ S-adenosyl-homocysteine + dihydrosirohydrochlorin
- S-adenosylmethionine cycle:
ATP + H2O + L-methionine ⟶ SAM + phosphate + pyrophosphate
- phospholipid biosynthesis:
L-serine + a CDP-diacylglycerol ⟶ CMP + a 3-O-sn-phosphatidyl-L-serine
- ergosterol biosynthesis:
5,7,22,24(28)-ergostatetraenol + NADPH ⟶ NADP+ + ergosterol
- biotin biosynthesis:
7,8-diaminononanoate + ATP + CO2 ⟶ ADP + dethiobiotin + phosphate
- superpathway of ergosterol biosynthesis:
H+ + NADPH + O2 + lanosterol ⟶ 4,4-dimethyl-5-α-cholesta-8,14,24-trien-3-β-ol + NADP+ + formate
WikiPathways(9)
- Methionine de novo and salvage pathway:
Choline ⟶ Betaine
- Folate metabolism:
Thromboxane A2 ⟶ Thromboxane B2
- One-carbon donor:
Methionine ⟶ Decarboxylated SAM
- Vitamin B12 metabolism:
Thromboxane A2 ⟶ Thromboxane B2
- Glycerophospholipid biosynthetic pathway:
Serine ⟶ Ethanolamine
- Vitamin B12 metabolism:
Thromboxane A2 ⟶ Thromboxane B2
- Folate metabolism:
Thromboxane A2 ⟶ Thromboxane B2
- Ethanol effects on histone modifications:
Ethanol ⟶ Acetaldehyde
- 7q11.23 copy number variation syndrome:
S-adenosyl-L-methionine ⟶ S-adenosyl-L-homocysteine
Plant Reactome(1831)
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Fatty acid and lipid metabolism:
ATP + CoA-SH + fatty acid ⟶ AMP + FACoA + PPi
- Choline biosynthesis I:
Ser ⟶ ETA + carbon dioxide
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
SAM ⟶ 1-aminocyclopropane-1-carboxylate + 5'-methylthioadenosine
- Ethene biosynthesis from methionine:
SAM ⟶ 1-aminocyclopropane-1-carboxylate + 5'-methylthioadenosine
- Yang cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
SAM ⟶ 1-aminocyclopropane-1-carboxylate + 5'-methylthioadenosine
- Ethene biosynthesis from methionine:
SAM ⟶ 1-aminocyclopropane-1-carboxylate + 5'-methylthioadenosine
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
SAM ⟶ 5'-methylthioadenosine + nicotianamine
- Mugineic acid biosynthesis:
SAM ⟶ 5'-methylthioadenosine + nicotianamine
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
SAM ⟶ 1-aminocyclopropane-1-carboxylate + 5'-methylthioadenosine
- Ethene biosynthesis from methionine:
SAM ⟶ 1-aminocyclopropane-1-carboxylate + 5'-methylthioadenosine
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
SAM ⟶ 5'-methylthioadenosine + nicotianamine
- Mugineic acid biosynthesis:
SAM ⟶ 5'-methylthioadenosine + nicotianamine
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Mugineic acid biosynthesis:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Mugineic acid biosynthesis:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
SAM ⟶ 1-aminocyclopropane-1-carboxylate + 5'-methylthioadenosine
- Ethene biosynthesis from methionine:
SAM ⟶ 1-aminocyclopropane-1-carboxylate + 5'-methylthioadenosine
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
SAM ⟶ 5'-methylthioadenosine + nicotianamine
- Mugineic acid biosynthesis:
SAM ⟶ 5'-methylthioadenosine + nicotianamine
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Mugineic acid biosynthesis:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Mugineic acid biosynthesis:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Mugineic acid biosynthesis:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Mugineic acid biosynthesis:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Mugineic acid biosynthesis:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
SAM ⟶ 1-aminocyclopropane-1-carboxylate + 5'-methylthioadenosine
- Ethene biosynthesis from methionine:
SAM ⟶ 1-aminocyclopropane-1-carboxylate + 5'-methylthioadenosine
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
SAM ⟶ 5'-methylthioadenosine + nicotianamine
- Mugineic acid biosynthesis:
SAM ⟶ 5'-methylthioadenosine + nicotianamine
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Mugineic acid biosynthesis:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Yang cycle:
5-methylthioribose + ATP ⟶ 5-methylthioribose-1-phosphate + ADP
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Mugineic acid biosynthesis:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
Ac-CoA + H2O + OAA ⟶ CIT + CoA
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Mugineic acid biosynthesis:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Mugineic acid biosynthesis:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Yang cycle:
5-methylthioribose + ATP ⟶ 5-methylthioribose-1-phosphate + ADP
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Mugineic acid biosynthesis:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
SAM ⟶ 1-aminocyclopropane-1-carboxylate + 5'-methylthioadenosine
- Ethene biosynthesis from methionine:
SAM ⟶ 1-aminocyclopropane-1-carboxylate + 5'-methylthioadenosine
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
SAM ⟶ 5'-methylthioadenosine + nicotianamine
- Mugineic acid biosynthesis:
SAM ⟶ 5'-methylthioadenosine + nicotianamine
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
SAM ⟶ 1-aminocyclopropane-1-carboxylate + 5'-methylthioadenosine
- Ethene biosynthesis from methionine:
SAM ⟶ 1-aminocyclopropane-1-carboxylate + 5'-methylthioadenosine
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
SAM ⟶ 5'-methylthioadenosine + nicotianamine
- Mugineic acid biosynthesis:
SAM ⟶ 5'-methylthioadenosine + nicotianamine
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Mugineic acid biosynthesis:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Mugineic acid biosynthesis:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Mugineic acid biosynthesis:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Mugineic acid biosynthesis:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
SAM ⟶ 1-aminocyclopropane-1-carboxylate + 5'-methylthioadenosine
- Ethene biosynthesis from methionine:
SAM ⟶ 1-aminocyclopropane-1-carboxylate + 5'-methylthioadenosine
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
SAM ⟶ 5'-methylthioadenosine + nicotianamine
- Mugineic acid biosynthesis:
SAM ⟶ 5'-methylthioadenosine + nicotianamine
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
SAM ⟶ 1-aminocyclopropane-1-carboxylate + 5'-methylthioadenosine
- Ethene biosynthesis from methionine:
SAM ⟶ 1-aminocyclopropane-1-carboxylate + 5'-methylthioadenosine
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
SAM ⟶ 5'-methylthioadenosine + nicotianamine
- Mugineic acid biosynthesis:
SAM ⟶ 5'-methylthioadenosine + nicotianamine
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Mugineic acid biosynthesis:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Mugineic acid biosynthesis:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Mugineic acid biosynthesis:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Mugineic acid biosynthesis:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Mugineic acid biosynthesis:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Mugineic acid biosynthesis:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
SAM ⟶ 1-aminocyclopropane-1-carboxylate + 5'-methylthioadenosine
- Ethene biosynthesis from methionine:
SAM ⟶ 1-aminocyclopropane-1-carboxylate + 5'-methylthioadenosine
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
SAM ⟶ 5'-methylthioadenosine + nicotianamine
- Mugineic acid biosynthesis:
SAM ⟶ 5'-methylthioadenosine + nicotianamine
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
H2O + N-Carbamoylputrescine ⟶ Putrescine + ammonia + carbon dioxide
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM ⟶ SAM + carbon dioxide
- Spermidine biosynthesis:
SAM ⟶ SAM + carbon dioxide
- Amine and polyamine biosynthesis:
H2O + N-Carbamoylputrescine ⟶ Putrescine + ammonia + carbon dioxide
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
H2O + N-Carbamoylputrescine ⟶ Putrescine + ammonia + carbon dioxide
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM ⟶ SAM + carbon dioxide
- Spermidine biosynthesis:
SAM ⟶ SAM + carbon dioxide
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
H2O + N-Carbamoylputrescine ⟶ Putrescine + ammonia + carbon dioxide
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Spermine biosynthesis:
SAM ⟶ SAM + carbon dioxide
- Spermidine biosynthesis:
SAM ⟶ SAM + carbon dioxide
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia
- Spermine biosynthesis:
SAM + SPM ⟶ 5'-methylthioadenosine + SPN
- Spermidine biosynthesis:
Putrescine + SAM ⟶ MTAD + SPM
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
SAM + luteolin ⟶ Chryseriol + SAH
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
2OG + Oxygen + naringenin ⟶ H2O + SUCCA + apigenin + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
SAM + luteolin ⟶ Chryseriol + SAH
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
2OG + Oxygen + naringenin ⟶ H2O + SUCCA + apigenin + carbon dioxide
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
2OG + Oxygen + naringenin ⟶ H2O + SUCCA + apigenin + carbon dioxide
- Secondary metabolism:
L-Phe ⟶ ammonia + trans-cinnamate
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Tricin biosynthesis:
SAM + luteolin ⟶ Chryseriol + SAH
- Metabolism and regulation:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Vitamin E biosynthesis:
HPPYRA + Oxygen ⟶ HGTA + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
L-Ala + pimeloyl-CoA ⟶ 7-keto-8-aminopelargonate + CoA-SH + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
9-mercaptodethiobiotin ⟶ Btn
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
L-Ala + pimeloyl-CoA ⟶ 7-keto-8-aminopelargonate + CoA-SH + carbon dioxide
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Hormone signaling, transport, and metabolism:
H2O + indole-3-acetyl-ala ⟶ IAA + L-Ala
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Secondary metabolism:
DMAPP + genistein ⟶ PPi + lupiwighteone
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Yang cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Hormone signaling, transport, and metabolism:
(22S)-22-hydroxycampest-4-en-3-one + H+ + TPNH ⟶ (22alpha)-hydroxy-5alpha-campestan-3-one + TPN
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Secondary metabolism:
DMAPP + genistein ⟶ PPi + lupiwighteone
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
L-Met + SAM ⟶ SAH + SMM
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Mugineic acid biosynthesis:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Yang cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Hormone signaling, transport, and metabolism:
(22S)-22-hydroxycampest-4-en-3-one + H+ + TPNH ⟶ (22alpha)-hydroxy-5alpha-campestan-3-one + TPN
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Secondary metabolism:
DMAPP + genistein ⟶ PPi + lupiwighteone
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
5-dehydro episterol + TPNH ⟶ 24-methylenecholesterol + TPN
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methylfecosterol ⟶ 24-methylenelophenol
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
5-dehydro episterol + TPNH ⟶ 24-methylenecholesterol + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Yang cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Hormone signaling, transport, and metabolism:
(22S)-22-hydroxycampest-4-en-3-one + H+ + TPNH ⟶ (22alpha)-hydroxy-5alpha-campestan-3-one + TPN
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- Mugineic acid biosynthesis:
3''-deamino-3''-oxonicotianamine + TPNH ⟶ 2'-deoxymugineic acid + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Hormone signaling, transport, and metabolism:
H2O + indole-3-acetyl-ala ⟶ IAA + L-Ala
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Secondary metabolism:
DMAPP + genistein ⟶ PPi + lupiwighteone
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- Inorganic nutrients metabolism:
Ac-CoA + H2O + OAA ⟶ CIT + CoA
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Yang cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Methionine biosynthesis II:
ATP + homoserine ⟶ ADP + O-phospho-L-homoserine
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Secondary metabolism:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu
- Sterol biosynthesis:
NAD(P)H + PSDP ⟶ NAD(P)+ + PPi + SQNE
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi
- Response to iron deficiency:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- Mugineic acid biosynthesis:
ATP + H2O + L-Met ⟶ HPO4(2-) + PPi + SAM
- vitamin K1:
ATP + CoA-SH + O-succinylbenzoate ⟶ 4-(2'-carboxyphenyl)-4-oxobutyryl-CoA + AMP + PPi
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-)
- Ethylene biosynthesis and signaling:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Ethene biosynthesis from methionine:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Sterol biosynthesis:
H+ + Oxygen + TPNH + obtusifoliol ⟶ 4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + H2O + HCOOH + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
- SMM cycle:
LHCYS + SMM ⟶ L-Met
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Sterol biosynthesis:
4alpha-methyl-5alpha-ergosta-8,14,24(28)-trien-3beta-ol + TPNH ⟶ 4alpha-methylfecosterol + TPN
INOH(0)
PlantCyc(0)
COVID-19 Disease Map(0)
PathBank(0)
PharmGKB(0)
35 个相关的物种来源信息
- 3701 - Arabidopsis: LTS0014803
- 3702 - Arabidopsis thaliana: 10.1104/PP.104.053793
- 3702 - Arabidopsis thaliana: 10.1186/1752-0509-5-1
- 3702 - Arabidopsis thaliana: LTS0014803
- 4890 - Ascomycota: LTS0014803
- 3700 - Brassicaceae: LTS0014803
- 7711 - Chordata: LTS0014803
- 33682 - Euglenozoa: LTS0014803
- 2759 - Eukaryota: LTS0014803
- 3803 - Fabaceae: LTS0014803
- 4751 - Fungi: LTS0014803
- 9604 - Hominidae: LTS0014803
- 9605 - Homo: LTS0014803
- 9606 - Homo sapiens: -
- 9606 - Homo sapiens: LTS0014803
- 9606 - Homo sapiens: NA
- 5653 - Kinetoplastea: LTS0014803
- 3398 - Magnoliopsida: LTS0014803
- 40674 - Mammalia: LTS0014803
- 33208 - Metazoa: LTS0014803
- 3887 - Pisum: LTS0014803
- 3888 - Pisum sativum: 10.1016/S0031-9422(00)85670-8
- 3888 - Pisum sativum: LTS0014803
- 4895 - Schizosaccharomyces: LTS0014803
- 4896 - Schizosaccharomyces pombe: LTS0014803
- 4894 - Schizosaccharomycetaceae: LTS0014803
- 147554 - Schizosaccharomycetes: LTS0014803
- 35493 - Streptophyta: LTS0014803
- 58023 - Tracheophyta: LTS0014803
- 5690 - Trypanosoma: LTS0014803
- 5691 - Trypanosoma brucei: 10.1371/JOURNAL.PNTD.0001618
- 5691 - Trypanosoma brucei: 10.1371/JOURNAL.PPAT.1006850
- 5691 - Trypanosoma brucei: LTS0014803
- 5654 - Trypanosomatidae: LTS0014803
- 33090 - Viridiplantae: LTS0014803
在这里通过桑基图来展示出与当前的这个代谢物在我们的BioDeep知识库中具有相关联信息的其他代谢物。在这里进行关联的信息来源主要有:
- PubMed: 来源于PubMed文献库中的文献信息,我们通过自然语言数据挖掘得到的在同一篇文献中被同时提及的相关代谢物列表,这个列表按照代谢物同时出现的文献数量降序排序,取前10个代谢物作为相关研究中关联性很高的代谢物集合展示在桑基图中。
- NCBI Taxonomy: 通过文献数据挖掘,得到的代谢物物种来源信息关联。这个关联信息同样按照出现的次数降序排序,取前10个代谢物作为高关联度的代谢物集合展示在桑吉图上。
- Chemical Taxonomy: 在物质分类上处于同一个分类集合中的其他代谢物
- Chemical Reaction: 在化学反应过程中,存在为当前代谢物相关联的生化反应过程中的反应底物或者反应产物的关联代谢物信息。
点击图上的相关代谢物的名称,可以跳转到相关代谢物的信息页面。
文献列表
- Qinhua Gan, Haifeng Zheng, Xinyu Li, Jing Li, Jingxue Ma, Yuji Zhang, Jiakun Han, Lin Zhang, Wenxu Zhou, Yandu Lu. Solving the Jigsaw puzzle of phytosterol diversity by a novel sterol methyltransferase from Zea mays.
The Journal of steroid biochemistry and molecular biology.
2024 Jun; 240(?):106498. doi:
10.1016/j.jsbmb.2024.106498
. [PMID: 38447903] - James T Carrillo, Dulal Borthakur. Characterization of a plant S-adenosylmethionine synthetase from Acacia koa.
Plant physiology and biochemistry : PPB.
2024 May; 210(?):108618. doi:
10.1016/j.plaphy.2024.108618
. [PMID: 38631157] - Yi Xiao, Chao Han, Xiaocong Li, Xinting Zhu, Sanhua Li, Nian Jiang, Changyan Yu, Yun Liu, Fang Liu. S-Adenosylmethionine (SAM) diet promotes innate immunity via histone H3K4me3 complex.
International immunopharmacology.
2024 Apr; 131(?):111837. doi:
10.1016/j.intimp.2024.111837
. [PMID: 38471365] - Vandana Sekhar, Houssine Ikhlef, Alexandra Bunea, Viet S Nguyen, Johan Joo, Mukund P Tantak, Holly Moots, Otto Phanstiel. The Development of LAT1 Efflux Agonists as Mechanistic Probes of Cellular Amino Acid Stress.
Biomolecules.
2024 Mar; 14(3):. doi:
10.3390/biom14030326
. [PMID: 38540746] - Daniel Leclerc, Karen E Christensen, Alaina M Reagan, Vafa Keser, Yan Luan, Olga V Malysheva, Brandi Wasek, Teodoro Bottiglieri, Marie A Caudill, Gareth R Howell, Rima Rozen. Folate Deficiency and/or the Genetic Variant Mthfr677C >T Can Drive Hepatic Fibrosis or Steatosis in Mice, in a Sex-Specific Manner.
Molecular nutrition & food research.
2024 Mar; 68(5):e2300355. doi:
10.1002/mnfr.202300355
. [PMID: 38327171] - Hong-Chao Duan, Chi Zhang, Peizhe Song, Junbo Yang, Ye Wang, Guifang Jia. C2-methyladenosine in tRNA promotes protein translation by facilitating the decoding of tandem m2A-tRNA-dependent codons.
Nature communications.
2024 Feb; 15(1):1025. doi:
10.1038/s41467-024-45166-6
. [PMID: 38310199] - Stephen G Andrews, Anthony M Koehle, Devendra Paudel, Thomas Neuberger, A Catharine Ross, Vishal Singh, Teodoro Bottiglieri, Rita Castro. Diet-Induced Severe Hyperhomocysteinemia Promotes Atherosclerosis Progression and Dysregulates the Plasma Metabolome in Apolipoprotein-E-Deficient Mice.
Nutrients.
2024 Jan; 16(3):. doi:
10.3390/nu16030330
. [PMID: 38337615] - Huan He, Ziwei Wang, Xueke Peng, Luolong Qing, Yu Zhang, Shaojuan Fu, Juan Xu, Yuanyuan Li, Silong Zhang. Identification of a Sonically Activated Degrader of Methionine Adenosyltransferase 2A by an in Silico Approach Assisted with the Hole-Electron Analysis.
Journal of medicinal chemistry.
2024 Jan; 67(1):543-554. doi:
10.1021/acs.jmedchem.3c01770
. [PMID: 38166392] - Lucía Barbier-Torres, Jyoti Chhimwal, So Yeon Kim, Komal Ramani, Aaron Robinson, Heping Yang, Jenny Van Eyk, Suthat Liangpunsakul, Ekihiro Seki, José M Mato, Shelly C Lu. S-Adenosylmethionine Negatively Regulates the Mitochondrial Respiratory Chain Repressor MCJ in the Liver.
International journal of biological sciences.
2024; 20(4):1218-1237. doi:
10.7150/ijbs.90104
. [PMID: 38385082] - Jianying Yue, Yan Lu, Zhenqi Sun, Yuqing Guo, David San León, Fabio Pasin, Mingmin Zhao. Methyltransferase-like (METTL) homologues participate in Nicotiana benthamiana antiviral responses.
Plant signaling & behavior.
2023 12; 18(1):2214760. doi:
10.1080/15592324.2023.2214760
. [PMID: 37210738] - Yue Liu, Lianjing Ge, Huimeng Tang, Jinhui Zheng, Jinxiang Hu, Jingru Wang, Xiaoyu Yang, Ruimin Zhang, Xiaoyun Wang, Xiuming Li, Yan Zhang, Qinghua Shi. cGMP functions as an important messenger involved in SlSAMS1-regulated salt stress tolerance in tomato.
Plant physiology and biochemistry : PPB.
2023 Nov; 204(?):108097. doi:
10.1016/j.plaphy.2023.108097
. [PMID: 37864930] - Mengjie An, Doudou Chang, Xiaoli Wang, Kaiyong Wang. Protective effects of polymer amendment on specific metabolites in soil and cotton leaves under cadmium contamination.
Ecotoxicology and environmental safety.
2023 Sep; 264(?):115463. doi:
10.1016/j.ecoenv.2023.115463
. [PMID: 37714036] - Wenli Hu, Shuang Hu, Shaozhuang Li, Qi Zhou, Zijing Xie, Xiaohua Hao, Sha Wu, Lianfu Tian, Dongping Li. AtSAMS regulates floral organ development by DNA methylation and ethylene signaling pathway.
Plant science : an international journal of experimental plant biology.
2023 Sep; 334(?):111767. doi:
10.1016/j.plantsci.2023.111767
. [PMID: 37302530] - Hua Li, Lele Zhang, Baocun Wu, Yang Li, Huijuan Wang, Huixin Teng, Dongwei Wei, Zhiliang Yuan, Zuli Yuan. Physiological and proteomic analyses reveal the important role of arbuscular mycorrhizal fungi on enhancing photosynthesis in wheat under cadmium stress.
Ecotoxicology and environmental safety.
2023 Aug; 261(?):115105. doi:
10.1016/j.ecoenv.2023.115105
. [PMID: 37285679] - Zhong-Ce Hu, Yun-Chao Tao, Jun-Chao Pan, Chui-Mu Zheng, Yuan-Shan Wang, Ya-Ping Xue, Zhi-Qiang Liu, Yu-Guo Zheng. Breeding of Saccharomyces cerevisiae with a High-Throughput Screening Strategy for Improvement of S-Adenosyl-L-Methionine Production.
Applied biochemistry and biotechnology.
2023 Jul; ?(?):. doi:
10.1007/s12010-023-04622-7
. [PMID: 37418127] - Meijing Li, Zheyan Mi, Jinhao Wang, Zhongce Hu, Haibin Qin, Yuanshan Wang, Yuguo Zheng. [Microbial production of S-adenosyl-l-methionine: a review].
Sheng wu gong cheng xue bao = Chinese journal of biotechnology.
2023 Jun; 39(6):2248-2264. doi:
10.13345/j.cjb.220959
. [PMID: 37401593] - Timothy Salita, Yepy H Rustam, Vinzenz Hofferek, Michael Jackson, Isaac Tollestrup, Jeffrey P Sheridan, Vern L Schramm, Gary B Evans, Gavin E Reid, Andrew B Munkacsi. Phosphoinositide and redox dysregulation by the anticancer methylthioadenosine phosphorylase transition state inhibitor.
Biochimica et biophysica acta. Molecular and cell biology of lipids.
2023 Jun; ?(?):159346. doi:
10.1016/j.bbalip.2023.159346
. [PMID: 37301365] - Han Li, Lu Wu, Fuping Ye, Dapeng Wang, Li Wang, Wenqi Li, Yuan Xu, Zhenyang Li, Jingshu Zhang, Suhua Wang, Aihua Zhang, Qizhan Liu. As3MT via consuming SAM is involved in arsenic-induced nonalcoholic fatty liver disease by blocking m6A-mediated miR-142-5p maturation.
The Science of the total environment.
2023 Jun; 892(?):164746. doi:
10.1016/j.scitotenv.2023.164746
. [PMID: 37301390] - Li Yang, Xingxing Wang, Fuyong Zhao, Xianliang Zhang, Wei Li, Junsen Huang, Xiaoyu Pei, Xiang Ren, Yangai Liu, Kunlun He, Fei Zhang, Xiongfeng Ma, Daigang Yang. Roles of S-Adenosylmethionine and Its Derivatives in Salt Tolerance of Cotton.
International journal of molecular sciences.
2023 May; 24(11):. doi:
10.3390/ijms24119517
. [PMID: 37298464] - Pei-Yi Chu, Dev-Aur Chou, Po-Ming Chen, En-Pei Isabel Chiang. Translocation of Methionine Adenosyl Transferase MAT2A and Its Prognostic Relevance for Liver Hepatocellular Carcinoma.
International journal of molecular sciences.
2023 May; 24(10):. doi:
10.3390/ijms24109103
. [PMID: 37240447] - Adam Yasgar, Danielle Bougie, Richard T Eastman, Ruili Huang, Misha Itkin, Jennifer Kouznetsova, Caitlin Lynch, Crystal McKnight, Mitch Miller, Deborah K Ngan, Tyler Peryea, Pranav Shah, Paul Shinn, Menghang Xia, Xin Xu, Alexey V Zakharov, Anton Simeonov. Quantitative Bioactivity Signatures of Dietary Supplements and Natural Products.
ACS pharmacology & translational science.
2023 May; 6(5):683-701. doi:
10.1021/acsptsci.2c00194
. [PMID: 37200814] - Jun-Min Lee, Min-Ho Park, Bu-Soo Park, Min-Kyu Oh. Production of S-methyl-methionine using engineered Saccharomyces cerevisiae sake K6.
Journal of industrial microbiology & biotechnology.
2023 Feb; 50(1):. doi:
10.1093/jimb/kuad026
. [PMID: 37653437] - Tetsuya Hirabayashi, Mai Kawaguchi, Sayaka Harada, Misa Mouri, Rina Takamiya, Yoshimi Miki, Hiroyasu Sato, Yoshitaka Taketomi, Kohei Yokoyama, Tetsuyuki Kobayashi, Suzumi M Tokuoka, Yoshihiro Kita, Emiko Yoda, Shuntaro Hara, Kyohei Mikami, Yasumasa Nishito, Norihito Kikuchi, Rieko Nakata, Mari Kaneko, Hiroshi Kiyonari, Kohji Kasahara, Toshiki Aiba, Kazutaka Ikeda, Tomoyoshi Soga, Makoto Kurano, Yutaka Yatomi, Makoto Murakami. Hepatic phosphatidylcholine catabolism driven by PNPLA7 and PNPLA8 supplies endogenous choline to replenish the methionine cycle with methyl groups.
Cell reports.
2023 Jan; 42(2):111940. doi:
10.1016/j.celrep.2022.111940
. [PMID: 36719796] - Alex Bare, Jaime Thomas, Daniel Etoroma, Soon Goo Lee. Functional analysis of phosphoethanolamine N-methyltransferase in plants and parasites: Essential S-adenosylmethionine-dependent methyltransferase in choline and phospholipid metabolism.
Methods in enzymology.
2023; 680(?):101-137. doi:
10.1016/bs.mie.2022.08.028
. [PMID: 36710008] - Audrey Lashley, Ryan Miller, Stephanie Provenzano, Sara-Alexis Jarecki, Paul Erba, Vonny Salim. Functional Diversification and Structural Origins of Plant Natural Product Methyltransferases.
Molecules (Basel, Switzerland).
2022 Dec; 28(1):. doi:
10.3390/molecules28010043
. [PMID: 36615239] - Francisco J Arriaza-Gallardo, Sebastian Schaupp, Yu-Cong Zheng, Mohd Farid Abdul-Halim, Hui-Jie Pan, Jörg Kahnt, Georgia Angelidou, Nicole Paczia, Xile Hu, Kyle Costa, Seigo Shima. The Function of Two Radical-SAM Enzymes, HcgA and HcgG, in the Biosynthesis of the [Fe]-Hydrogenase Cofactor.
Angewandte Chemie (International ed. in English).
2022 12; 61(50):e202213239. doi:
10.1002/anie.202213239
. [PMID: 36264001] - Gopal Peddinti, Hannu Hotti, Teemu H Teeri, Heiko Rischer. De novo transcriptome assembly of Conium maculatum L. to identify candidate genes for coniine biosynthesis.
Scientific reports.
2022 10; 12(1):17562. doi:
10.1038/s41598-022-21728-w
. [PMID: 36266299] - Atsuko Kitano, Toshio Norikura, Isao Matsui-Yuasa, Hiromi Shimakawa, Makoto Kamezawa, Akiko Kojima-Yuasa. Black carrot extract protects against hepatic injury through epigenetic modifications.
Journal of food biochemistry.
2022 10; 46(10):e14292. doi:
10.1111/jfbc.14292
. [PMID: 35762419] - Qiang Luo, Jiezhen Mo, Hao Chen, Zetao Hu, Baihui Wang, Jiabing Wu, Ziyu Liang, Wenhao Xie, Kangxi Du, Maolin Peng, Yingping Li, Tianyang Li, Yangyi Zhang, Xiaoyan Shi, Wen-Hui Shen, Yang Shi, Aiwu Dong, Hailin Wang, Jinbiao Ma. Structural insights into molecular mechanism for N6-adenosine methylation by MT-A70 family methyltransferase METTL4.
Nature communications.
2022 09; 13(1):5636. doi:
10.1038/s41467-022-33277-x
. [PMID: 36163360] - Amna Devi, Romit Seth, Mamta Masand, Gopal Singh, Ashlesha Holkar, Shikha Sharma, Ashok Singh, Ram Kumar Sharma. Spatial Genomic Resource Reveals Molecular Insights into Key Bioactive-Metabolite Biosynthesis in Endangered Angelica glauca Edgew.
International journal of molecular sciences.
2022 Sep; 23(19):. doi:
10.3390/ijms231911064
. [PMID: 36232367] - Yeong-Biau Yu, Douglas O Adams, Shang Fa Yang. Reprint of: 1-Aminocyclopropanecarboxylate Synthase, a Key Enzyme in Ethylene Biosynthesis.
Archives of biochemistry and biophysics.
2022 09; 726(?):109238. doi:
10.1016/j.abb.2022.109238
. [PMID: 35680445] - Cody T Lloyd, David F Iwig, Bo Wang, Matteo Cossu, William W Metcalf, Amie K Boal, Squire J Booker. Discovery, structure and mechanism of a tetraether lipid synthase.
Nature.
2022 09; 609(7925):197-203. doi:
10.1038/s41586-022-05120-2
. [PMID: 35882349] - Pei-Wen Yang, Ju-Ying Jiao, Zhen Chen, Xiao-Yan Zhu, Chien-Shan Cheng. Keep a watchful eye on methionine adenosyltransferases, novel therapeutic opportunities for hepatobiliary and pancreatic tumours.
Biochimica et biophysica acta. Reviews on cancer.
2022 09; 1877(5):188793. doi:
10.1016/j.bbcan.2022.188793
. [PMID: 36089205] - Renata Orłowska, Jacek Zebrowski, Janusz Zimny, Piotr Androsiuk, Piotr Tomasz Bednarek. S-Adenosyl-L-Methionine and Cu(II) Impact Green Plant Regeneration Efficiency.
Cells.
2022 08; 11(17):. doi:
10.3390/cells11172700
. [PMID: 36078107] - Ayesha M Patel, Karl J Koebke, Timothy J Grunkemeyer, Colleen M Riordan, Youngsoo Kim, Ryan C Bailey, E Neil G Marsh. Purification of the full-length, membrane-associated form of the antiviral enzyme viperin utilizing nanodiscs.
Scientific reports.
2022 07; 12(1):11909. doi:
10.1038/s41598-022-16233-z
. [PMID: 35831548] - Yu Li, Wangdan Xiong, Feng He, Tianxiong Qi, Zhen Sun, Yuchen Liu, Shiqie Bai, Honglun Wang, Zhenying Wu, Chunxiang Fu. Down-regulation of PvSAMS impairs S-adenosyl-L-methionine and lignin biosynthesis, and improves cell wall digestibility in switchgrass.
Journal of experimental botany.
2022 06; 73(12):4157-4169. doi:
10.1093/jxb/erac147
. [PMID: 35383829] - Krisztina A Szigeti, Alexandra Kalmár, Orsolya Galamb, Gábor Valcz, Barbara K Barták, Zsófia B Nagy, Sára Zsigrai, Ildikó Felletár, Árpád V Patai, Tamás Micsik, Márton Papp, Eszter Márkus, Zsolt Tulassay, Peter Igaz, István Takács, Béla Molnár. Global DNA hypomethylation of colorectal tumours detected in tissue and liquid biopsies may be related to decreased methyl-donor content.
BMC cancer.
2022 Jun; 22(1):605. doi:
10.1186/s12885-022-09659-1
. [PMID: 35655145] - Fenglei Sun, Jun Ma, Penglong Wang, Yanlong Yang. Genome-Wide Identification of the SAMS Gene Family in Upland Cotton (Gossypium hirsutum L.) and Expression Analysis in Drought Stress Treatments.
Genes.
2022 05; 13(5):. doi:
10.3390/genes13050860
. [PMID: 35627245] - Takujiro Homma, Sho Kobayashi, Junichi Fujii. Methionine Deprivation Reveals the Pivotal Roles of Cell Cycle Progression in Ferroptosis That Is Induced by Cysteine Starvation.
Cells.
2022 05; 11(10):. doi:
10.3390/cells11101603
. [PMID: 35626640] - Amarnath Bollu, Aileen Peters, Andrea Rentmeister. Chemo-Enzymatic Modification of the 5' Cap To Study mRNAs.
Accounts of chemical research.
2022 05; 55(9):1249-1261. doi:
10.1021/acs.accounts.2c00059
. [PMID: 35420432] - Sarah E Steane, Vinod Kumar, James S M Cuffe, Karen M Moritz, Lisa K Akison. Prenatal Choline Supplementation Alters One Carbon Metabolites in a Rat Model of Periconceptional Alcohol Exposure.
Nutrients.
2022 Apr; 14(9):. doi:
10.3390/nu14091874
. [PMID: 35565848] - Rostom Ahmed-Belkacem, Marcel Hausdorff, Adrien Delpal, Priscila Sutto-Ortiz, Agathe M G Colmant, Franck Touret, Natacha S Ogando, Eric J Snijder, Bruno Canard, Bruno Coutard, Jean-Jacques Vasseur, Etienne Decroly, Françoise Debart. Potent Inhibition of SARS-CoV-2 nsp14 N7-Methyltransferase by Sulfonamide-Based Bisubstrate Analogues.
Journal of medicinal chemistry.
2022 04; 65(8):6231-6249. doi:
10.1021/acs.jmedchem.2c00120
. [PMID: 35439007] - Alexey Sulimov, Danil Kutov, Ivan Ilin, Yibei Xiao, Sheng Jiang, Vladimir Sulimov. Novel Inhibitors of 2'-O-Methyltransferase of the SARS-CoV-2 Coronavirus.
Molecules (Basel, Switzerland).
2022 Apr; 27(9):. doi:
10.3390/molecules27092721
. [PMID: 35566072] - Gokul G, Jogender Singh. Dithiothreitol causes toxicity in C. elegans by modulating the methionine-homocysteine cycle.
eLife.
2022 04; 11(?):. doi:
10.7554/elife.76021
. [PMID: 35438636] - Wen Fang, Yibing Zhu, Sen Yang, Xiaomeng Tong, Cunqi Ye. Reciprocal regulation of phosphatidylcholine synthesis and H3K36 methylation programs metabolic adaptation.
Cell reports.
2022 04; 39(2):110672. doi:
10.1016/j.celrep.2022.110672
. [PMID: 35417718] - Ferrol I Rome, Curtis C Hughey. Disrupted liver oxidative metabolism in glycine N-methyltransferase-deficient mice is mitigated by dietary methionine restriction.
Molecular metabolism.
2022 04; 58(?):101452. doi:
10.1016/j.molmet.2022.101452
. [PMID: 35121169] - Ibrahim H Eissa, Mohamed S Alesawy, Abdulrahman M Saleh, Eslam B Elkaeed, Bshra A Alsfouk, Abdul-Aziz M M El-Attar, Ahmed M Metwaly. Ligand and Structure-Based In Silico Determination of the Most Promising SARS-CoV-2 nsp16-nsp10 2'-o-Methyltransferase Complex Inhibitors among 3009 FDA Approved Drugs.
Molecules (Basel, Switzerland).
2022 Mar; 27(7):. doi:
10.3390/molecules27072287
. [PMID: 35408684] - Carolyn F McCabe, Jennifer L LaBarre, Steven E Domino, Marjorie C Treadwell, Ana Baylin, Charles F Burant, Dana C Dolinoy, Vasantha Padmanabhan, Jaclyn M Goodrich. Maternal and neonatal one-carbon metabolites and the epigenome-wide infant response.
The Journal of nutritional biochemistry.
2022 03; 101(?):108938. doi:
10.1016/j.jnutbio.2022.108938
. [PMID: 35017001] - Mingzhe Ma, Pengfei Kong, Yakai Huang, Jiangli Wang, Xiaocen Liu, YiRen Hu, Xingxing Chen, Chunyan Du, Hui Yang. Activation of MAT2A-ACSL3 pathway protects cells from ferroptosis in gastric cancer.
Free radical biology & medicine.
2022 03; 181(?):288-299. doi:
10.1016/j.freeradbiomed.2022.02.015
. [PMID: 35182729] - Hayley L Knox, Erica K Sinner, Craig A Townsend, Amie K Boal, Squire J Booker. Structure of a B12-dependent radical SAM enzyme in carbapenem biosynthesis.
Nature.
2022 02; 602(7896):343-348. doi:
10.1038/s41586-021-04392-4
. [PMID: 35110734] - Chunling Wang, Junbo Yang, Peizhe Song, Wei Zhang, Qiang Lu, Qiong Yu, Guifang Jia. FIONA1 is an RNA N6-methyladenosine methyltransferase affecting Arabidopsis photomorphogenesis and flowering.
Genome biology.
2022 01; 23(1):40. doi:
10.1186/s13059-022-02612-2
. [PMID: 35101091] - Manikandan Velayutham, Ajay Guru, Mariadhas Valan Arasu, Naif Abdullah Al-Dhabi, Ki Choon Choi, Preetham Elumalai, Ramasamy Harikrishnan, Aziz Arshad, Jesu Arockiaraj. GR15 peptide of S-adenosylmethionine synthase (SAMe) from Arthrospira platensis demonstrated antioxidant mechanism against H2O2 induced oxidative stress in in-vitro MDCK cells and in-vivo zebrafish larvae model.
Journal of biotechnology.
2021 Dec; 342(?):79-91. doi:
10.1016/j.jbiotec.2021.10.010
. [PMID: 34751134] - Lingmei Zeng, Mao Li, Yuting Cen, Zuanyu Wang. Effects of S-adenosyl-L-Methionine Combined with Ursodesoxycholic Acid on Serum Endotoxin, MMP-9 and IL-18 in Neonates with Cholestasis.
Journal of the College of Physicians and Surgeons--Pakistan : JCPSP.
2021 Dec; 31(12):1445-1448. doi:
10.29271/jcpsp.2021.12.1445
. [PMID: 34794285] - Jesús A Rosas-Rodríguez, Elisa M Valenzuela-Soto. The glycine betaine role in neurodegenerative, cardiovascular, hepatic, and renal diseases: Insights into disease and dysfunction networks.
Life sciences.
2021 Nov; 285(?):119943. doi:
10.1016/j.lfs.2021.119943
. [PMID: 34516992] - Ibrahim H Eissa, Mohamed M Khalifa, Eslam B Elkaeed, Elsayed E Hafez, Aisha A Alsfouk, Ahmed M Metwaly. In Silico Exploration of Potential Natural Inhibitors against SARS-Cov-2 nsp10.
Molecules (Basel, Switzerland).
2021 Oct; 26(20):. doi:
10.3390/molecules26206151
. [PMID: 34684735] - Si Liu, Ruyi Liao, Xin Dai, Honghui Guo, Dongliang Wang, Min Xia, Wenhua Ling, Yunjun Xiao. Association between plasma S-adenosylmethionine and risk of mortality in patients with coronary artery disease: A cohort study.
The American journal of clinical nutrition.
2021 10; 114(4):1360-1370. doi:
10.1093/ajcn/nqab210
. [PMID: 34192296] - Bianca Seminotti, Ana Cristina Roginski, Ângela Zanatta, Alexandre Umpierrez Amaral, Thabata Fernandes, Kaleb Pinto Spannenberger, Lucas Henrique Rodrigues da Silva, Rafael Teixeira Ribeiro, Guilhian Leipnitz, Moacir Wajner. S-adenosylmethionine induces mitochondrial dysfunction, permeability transition pore opening and redox imbalance in subcellular preparations of rat liver.
Journal of bioenergetics and biomembranes.
2021 10; 53(5):525-539. doi:
10.1007/s10863-021-09914-3
. [PMID: 34347214] - Pradeep Kumar Sheokand, Monika Narwal, Vandana Thakur, Asif Mohmmed. GlmS mediated knock-down of a phospholipase expedite alternate pathway to generate phosphocholine required for phosphatidylcholine synthesis in Plasmodium falciparum.
The Biochemical journal.
2021 09; 478(18):3429-3444. doi:
10.1042/bcj20200549
. [PMID: 34133721] - Marta Robledo, Natalia I García-Tomsig, Ana M Matia-González, Fernando M García-Rodríguez, José I Jiménez-Zurdo. Synthetase of the methyl donor S-adenosylmethionine from nitrogen-fixing α-rhizobia can bind functionally diverse RNA species.
RNA biology.
2021 08; 18(8):1111-1123. doi:
10.1080/15476286.2020.1829365
. [PMID: 33043803] - Xuanjin Cheng, Junran Yan, Yongxing Liu, Jiahe Wang, Stefan Taubert. eVITTA: a web-based visualization and inference toolbox for transcriptome analysis.
Nucleic acids research.
2021 07; 49(W1):W207-W215. doi:
10.1093/nar/gkab366
. [PMID: 34019643] - Mikyung Kim, Yunmee Rho, Rhoeun Park, Jeeyoun Jung, Geum-Sook Hwang, Youn Kyoung Seo, Ji Hae Seo, Yoonseok Heo, Tae Kyung Ha, Eunyoung Ha. Duodenal-jejunal bypass maintains hepatic S-adenosylmethionine/S-homocysteine ratio in diet-induced obese rats.
Surgery for obesity and related diseases : official journal of the American Society for Bariatric Surgery.
2021 Jul; 17(7):1359-1368. doi:
10.1016/j.soard.2021.02.011
. [PMID: 33753007] - Yan Luan, Daniel Leclerc, Marta Cosín-Tomás, Olga V Malysheva, Brandi Wasek, Teodoro Bottiglieri, Marie A Caudill, Rima Rozen. Moderate Folic Acid Supplementation in Pregnant Mice Results in Altered Methyl Metabolism and in Sex-Specific Placental Transcription Changes.
Molecular nutrition & food research.
2021 07; 65(14):e2100197. doi:
10.1002/mnfr.202100197
. [PMID: 34010503] - Gulin Amasya, Ahmet Dogan Ergin, Ozge Erkan Cakirci, Arif Tanju Ozçelikay, Zerrin Sezgin Bayindir, Nilufer Yuksel. A study to enhance the oral bioavailability of s-adenosyl-l-methionine (SAMe): SLN and SLN nanocomposite particles.
Chemistry and physics of lipids.
2021 07; 237(?):105086. doi:
10.1016/j.chemphyslip.2021.105086
. [PMID: 33930379] - George Minasov, Monica Rosas-Lemus, Ludmilla Shuvalova, Nicole L Inniss, Joseph S Brunzelle, Courtney M Daczkowski, Paul Hoover, Andrew D Mesecar, Karla J F Satchell. Mn2+ coordinates Cap-0-RNA to align substrates for efficient 2'-O-methyl transfer by SARS-CoV-2 nsp16.
Science signaling.
2021 06; 14(689):. doi:
10.1126/scisignal.abh2071
. [PMID: 34131072] - Melissa van Dülmen, Nils Muthmann, Andrea Rentmeister. Chemo-Enzymatic Modification of the 5' Cap Maintains Translation and Increases Immunogenic Properties of mRNA.
Angewandte Chemie (International ed. in English).
2021 06; 60(24):13280-13286. doi:
10.1002/anie.202100352
. [PMID: 33751748] - Kourosh H Ebrahimi, Javier Gilbert-Jaramillo, William S James, James S O McCullagh. Interferon-stimulated gene products as regulators of central carbon metabolism.
The FEBS journal.
2021 06; 288(12):3715-3726. doi:
10.1111/febs.15625
. [PMID: 33185982] - Jacob Joseph, Anna Giczewska, Brooke Alhanti, Amrita K Cheema, Diane E Handy, Douglas L Mann, Joseph Loscalzo, Michael M Givertz. Associations of methyl donor and methylation inhibitor levels during anti-oxidant therapy in heart failure.
Journal of physiology and biochemistry.
2021 May; 77(2):295-304. doi:
10.1007/s13105-021-00797-x
. [PMID: 33595776] - Xiaozhen Huang, Shudong Chen, Weiping Li, Lingli Tang, Yueqin Zhang, Ning Yang, Yupan Zou, Xiawan Zhai, Nan Xiao, Wei Liu, Pilong Li, Cao Xu. ROS regulated reversible protein phase separation synchronizes plant flowering.
Nature chemical biology.
2021 05; 17(5):549-557. doi:
10.1038/s41589-021-00739-0
. [PMID: 33633378] - Tao Guo, Zhe Dai, Ke You, Shyue-Fang Battaglia-Hsu, Juan Feng, Fengliang Wang, Bao Li, Jian Yang, Zhen Li. S-adenosylmethionine upregulates the angiotensin receptor-binding protein ATRAP via the methylation of HuR in NAFLD.
Cell death & disease.
2021 03; 12(4):306. doi:
10.1038/s41419-021-03591-1
. [PMID: 33753727] - Jie Liu, Jun Huang, Peikun Xin, Guiting Liu, Jun Wu. Biomedical applications of methionine-based systems.
Biomaterials science.
2021 Mar; 9(6):1961-1973. doi:
10.1039/d0bm02180f
. [PMID: 33537687] - Annalisa Roberti, Agustín F Fernández, Mario F Fraga. Nicotinamide N-methyltransferase: At the crossroads between cellular metabolism and epigenetic regulation.
Molecular metabolism.
2021 03; 45(?):101165. doi:
10.1016/j.molmet.2021.101165
. [PMID: 33453420] - Pooja Dhiman, Raji Ramachandran Pillai, Anand Babu Wilson, Nancy Premkumar, Balaji Bharadwaj, Veena P Ranjan, Soundravally Rajendiran. Cross-sectional association between vitamin B12 status and probable postpartum depression in Indian women.
BMC pregnancy and childbirth.
2021 Feb; 21(1):146. doi:
10.1186/s12884-021-03622-x
. [PMID: 33596868] - Maria Petrovna Kruglova, Alexander Vladimirovich Ivanov, Edward Danielevich Virus, Polina Olegovna Bulgakova, Andrey Segeevich Samokhin, Anatolij Nikolaevich Fedoseev, Sergej Vital'evich Grachev, Aslan Amirkhanovich Kubatiev. Urine S-Adenosylmethionine are Related to Degree of Renal Insufficiency in Patients with Chronic Kidney Disease.
Laboratory medicine.
2021 Jan; 52(1):47-56. doi:
10.1093/labmed/lmaa034
. [PMID: 32702115] - Xiaofan Yang, Ting Huang, Tiantian Wang, Hongbo Gao, Haitao Zhang, Wen Peng, Jiacong Zhao, Shujing Hu, Panpan Lu, Zhongsi Hong, Bo Li, Kai Deng. MAT2A-Mediated S-Adenosylmethionine Level in CD4+ T Cells Regulates HIV-1 Latent Infection.
Frontiers in immunology.
2021; 12(?):745784. doi:
10.3389/fimmu.2021.745784
. [PMID: 34616406] - George Stojan, Jessica Li, Tian Liu, Maureen A Kane, Michelle A Petri. Intracellular homocysteine metabolites in SLE: plasma S-adenosylhomocysteine correlates with coronary plaque burden.
Lupus science & medicine.
2021 01; 8(1):. doi:
10.1136/lupus-2020-000453
. [PMID: 33479047] - Evgeny Vladimirovich Kryukov, Alexander Vladimirovich Ivanov, Vladimir Olegovich Karpov, Valery Vasil'evich Aleksandrin, Alexander Mikhaylovich Dygai, Maria Petrovna Kruglova, Gennady Ivanovich Kostiuchenko, Sergei Petrovich Kazakov, Aslan Amirkhanovich Kubatiev. Plasma S-Adenosylmethionine Is Associated with Lung Injury in COVID-19.
Disease markers.
2021; 2021(?):7686374. doi:
10.1155/2021/7686374
. [PMID: 34956420] - Chie Yokouchi, Yukari Nishimura, Hirohiko Goto, Makoto Sato, Yuya Hidoh, Kenji Takeuchi, Yuji Ishii. Reduction of fatty liver in rats by nicotinamide via the regeneration of the methionine cycle and the inhibition of aldehyde oxidase.
The Journal of toxicological sciences.
2021; 46(1):31-42. doi:
10.2131/jts.46.31
. [PMID: 33408299] - Johanna Rapp, Pascal Rath, Joachim Kilian, Klaus Brilisauer, Stephanie Grond, Karl Forchhammer. A bioactive molecule made by unusual salvage of radical SAM enzyme byproduct 5-deoxyadenosine blurs the boundary of primary and secondary metabolism.
The Journal of biological chemistry.
2021 Jan; 296(?):100621. doi:
10.1016/j.jbc.2021.100621
. [PMID: 33811856] - Vivian Robert Jeyachandran, Jay V Pendyala, Erin L McCarthy, Amie K Boal, Squire J Booker. Biochemical Approaches to Probe the Role of the Auxiliary Iron-Sulfur Cluster of Lipoyl Synthase from Mycobacterium Tuberculosis.
Methods in molecular biology (Clifton, N.J.).
2021; 2353(?):307-332. doi:
10.1007/978-1-0716-1605-5_16
. [PMID: 34292556] - Salman Sahid, Chandan Roy, Soumitra Paul, Riddhi Datta. Rice lectin protein r40c1 imparts drought tolerance by modulating S-adenosylmethionine synthase 2, stress-associated protein 8 and chromatin-associated proteins.
Journal of experimental botany.
2020 12; 71(22):7331-7346. doi:
10.1093/jxb/eraa400
. [PMID: 32853345] - Beth R Cameron, Ludvina Ferreira, I David MacDonald. Pharmacokinetic study of a novel oral formulation of S-adenosylmethionine (MSI-195) in healthy subjects: dose escalation, food effect and comparison to a commercial nutritional supplement product.
BMC pharmacology & toxicology.
2020 12; 21(1):88. doi:
10.1186/s40360-020-00466-7
. [PMID: 33317621] - Amna Mhamdi. Here, There, and Everywhere: Plastid- and Nuclear-Localized WHIRLY1 Regulates Salicylic Acid Homeostasis during Developmental Senescence.
Plant physiology.
2020 12; 184(4):1620-1621. doi:
10.1104/pp.20.01475
. [PMID: 33277328] - Mi Young Heo, Ra-Mi Park, Bit-Na Kim, Ngoc-Han Thi Nguyen, Hye Weon Jang, Yang-Hoon Kim, Jiho Min. Lysosomes Alteration in HeLa Cell Exposed with 1-Aminocyclopropane-1-Carboxylic Acid, the Ethylene Precursor of Plant Hormones.
Molecular biotechnology.
2020 Dec; 62(11-12):557-562. doi:
10.1007/s12033-020-00272-w
. [PMID: 32949367] - Justin G P Miller, Ankur Jamwal, Yaroslav Ilnytskyy, Alice Hontela, Steve B Wiseman. Dicamba elevates concentrations of S-adenosyl methionine but does not induce oxidative stress or alter DNA methylation in rainbow trout (Oncorhynchus mykiss) hepatocytes.
Comparative biochemistry and physiology. Part D, Genomics & proteomics.
2020 12; 36(?):100744. doi:
10.1016/j.cbd.2020.100744
. [PMID: 32950925] - Shijun Xing, Ling Shi, Guangjuan Liu, Mingrui Zhu, Yanli Xu, Dan Liu, Xin He, Zirong Wang. S-Adenosyl-l-Methionine Promotes Metabolism of Fungicides in Cabernet Sauvignon (Vitis vinifera L.) Berries.
Journal of agricultural and food chemistry.
2020 Nov; 68(44):12413-12420. doi:
10.1021/acs.jafc.0c04016
. [PMID: 33104344] - E Kilanczyk, J M Banales, E Wunsch, O Barbier, M A Avila, J M Mato, M Milkiewicz, P Milkiewicz. S-adenosyl-L-methionine (SAMe) halts the autoimmune response in patients with primary biliary cholangitis (PBC) via antioxidant and S-glutathionylation processes in cholangiocytes.
Biochimica et biophysica acta. Molecular basis of disease.
2020 11; 1866(11):165895. doi:
10.1016/j.bbadis.2020.165895
. [PMID: 32681864] - Annika Rogstam, Maria Nyblom, Signe Christensen, Celeste Sele, Vladimir O Talibov, Therese Lindvall, Anna Andersson Rasmussen, Ingemar André, Zoë Fisher, Wolfgang Knecht, Frank Kozielski. Crystal Structure of Non-Structural Protein 10 from Severe Acute Respiratory Syndrome Coronavirus-2.
International journal of molecular sciences.
2020 Oct; 21(19):. doi:
10.3390/ijms21197375
. [PMID: 33036230] - Rajavel Elango. Methionine Nutrition and Metabolism: Insights from Animal Studies to Inform Human Nutrition.
The Journal of nutrition.
2020 10; 150(Suppl 1):2518S-2523S. doi:
10.1093/jn/nxaa155
. [PMID: 33000159] - Monica Rosas-Lemus, George Minasov, Ludmilla Shuvalova, Nicole L Inniss, Olga Kiryukhina, Joseph Brunzelle, Karla J F Satchell. High-resolution structures of the SARS-CoV-2 2'-O-methyltransferase reveal strategies for structure-based inhibitor design.
Science signaling.
2020 09; 13(651):. doi:
10.1126/scisignal.abe1202
. [PMID: 32994211] - Laura Vergani, Francesca Baldini, Mohamad Khalil, Adriana Voci, Pietro Putignano, Niccolò Miraglia. New Perspectives of S-Adenosylmethionine (SAMe) Applications to Attenuate Fatty Acid-Induced Steatosis and Oxidative Stress in Hepatic and Endothelial Cells.
Molecules (Basel, Switzerland).
2020 Sep; 25(18):. doi:
10.3390/molecules25184237
. [PMID: 32942773] - Rostom Ahmed-Belkacem, Priscila Sutto-Ortiz, Mathis Guiraud, Bruno Canard, Jean-Jacques Vasseur, Etienne Decroly, Françoise Debart. Synthesis of adenine dinucleosides SAM analogs as specific inhibitors of SARS-CoV nsp14 RNA cap guanine-N7-methyltransferase.
European journal of medicinal chemistry.
2020 Sep; 201(?):112557. doi:
10.1016/j.ejmech.2020.112557
. [PMID: 32563813] - Sheng Lin, Hua Chen, Fei Ye, Zimin Chen, Fanli Yang, Yue Zheng, Yu Cao, Jingxin Qiao, Shengyong Yang, Guangwen Lu. Crystal structure of SARS-CoV-2 nsp10/nsp16 2'-O-methylase and its implication on antiviral drug design.
Signal transduction and targeted therapy.
2020 07; 5(1):131. doi:
10.1038/s41392-020-00241-4
. [PMID: 32728018] - Narendranath Bhokisham, Yi Liu, Adam D Brown, Gregory F Payne, James N Culver, William E Bentley. Transglutaminase-mediated assembly of multi-enzyme pathway onto TMV brush surfaces for synthesis of bacterial autoinducer-2.
Biofabrication.
2020 07; 12(4):045017. doi:
10.1088/1758-5090/ab9e7a
. [PMID: 32559753] - Kate F Walker, Lucy C Chappell, William M Hague, Philippa Middleton, Jim G Thornton. Pharmacological interventions for treating intrahepatic cholestasis of pregnancy.
The Cochrane database of systematic reviews.
2020 07; 7(?):CD000493. doi:
10.1002/14651858.cd000493.pub3
. [PMID: 32716060] - Thiruselvam Viswanathan, Shailee Arya, Siu-Hong Chan, Shan Qi, Nan Dai, Anurag Misra, Jun-Gyu Park, Fatai Oladunni, Dmytro Kovalskyy, Robert A Hromas, Luis Martinez-Sobrido, Yogesh K Gupta. Structural basis of RNA cap modification by SARS-CoV-2.
Nature communications.
2020 07; 11(1):3718. doi:
10.1038/s41467-020-17496-8
. [PMID: 32709886] - Courtney A Whalen, Floyd J Mattie, Cristina Florindo, Bertrand van Zelst, Neil K Huang, Isabel Tavares de Almeida, Sandra G Heil, Thomas Neuberger, A Catharine Ross, Rita Castro. No Effect of Diet-Induced Mild Hyperhomocysteinemia on Vascular Methylating Capacity, Atherosclerosis Progression, and Specific Histone Methylation.
Nutrients.
2020 Jul; 12(8):. doi:
10.3390/nu12082182
. [PMID: 32717800] - Ramaian Santhaseela Anand, Dhasarathan Ganesan, Senthilraja Selvam, Sudarshana Rajasekaran, Tamilselvan Jayavelu. Distinct utilization of biotin in and between adipose and brain during aging is associated with a lipogenic shift in Wistar rat brain.
Nutrition research (New York, N.Y.).
2020 07; 79(?):68-76. doi:
10.1016/j.nutres.2020.06.004
. [PMID: 32650222] - Robert M Hoffman, Qinghong Han. Oral Methioninase for Covid-19 Methionine-restriction Therapy.
In vivo (Athens, Greece).
2020 Jun; 34(3 Suppl):1593-1596. doi:
10.21873/invivo.11948
. [PMID: 32503816] - Bartosz Sekula, Milosz Ruszkowski, Zbigniew Dauter. S-adenosylmethionine synthases in plants: Structural characterization of type I and II isoenzymes from Arabidopsis thaliana and Medicago truncatula.
International journal of biological macromolecules.
2020 May; 151(?):554-565. doi:
10.1016/j.ijbiomac.2020.02.100
. [PMID: 32057875]