Exact Mass: 152.011
Exact Mass Matches: 152.011
Found 3 metabolites which its exact mass value is equals to given mass value 152.011,
within given mass tolerance error 0.001 dalton. Try search metabolite list with more accurate mass tolerance error
0.0002 dalton.
N-methylethanolamine phosphate
N-methylethanolamine phosphate is soluble (in water) and an extremely strong acidic compound (based on its pKa). N-methylethanolamine phosphate can be found in a number of food items such as sour cherry, garland chrysanthemum, swiss chard, and winged bean, which makes N-methylethanolamine phosphate a potential biomarker for the consumption of these food products.
5,6-dioxocyclohexa-1,3-diene-1-carboxylic acid
{"Ingredient_id": "HBIN011151","Ingredient_name": "5,6-dioxocyclohexa-1,3-diene-1-carboxylic acid","Alias": "5,6-diketocyclohexa-1,3-diene-1-carboxylic acid; 5,6-dioxo-1-cyclohexa-1,3-dienecarboxylic acid","Ingredient_formula": "C7H4O4","Ingredient_Smile": "C1=CC(=O)C(=O)C(=C1)C(=O)O","Ingredient_weight": "152.1 g/mol","OB_score": "72.72437541","CAS_id": "NA","SymMap_id": "SMIT12256","TCMID_id": "NA","TCMSP_id": "MOL011336","TCM_ID_id": "NA","PubChem_id": "20154716","DrugBank_id": "NA"}
