(2S)-2-azaniumyl-3-(1H-indol-3-yl)propanoate (BioDeep_00000896620)
Main id: BioDeep_00000398011
代谢物信息卡片
(2S)-2-azaniumyl-3-(1H-indol-3-yl)propanoate
化学式: C11H12N2O2 (204.0899)
中文名称:
谱图信息:
最多检出来源 () 0%
分子结构信息
SMILES: C1=CC=C2C(=C1)C(=CN2)CC(C(=O)[O-])[NH3+]
InChI: InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m0/s1
相关代谢途径
Reactome(6)
BioCyc(32)
- superpathway of L-phenylalanine biosynthesis
- superpathway of aromatic amino acid biosynthesis
- chorismate biosynthesis I
- superpathway of L-tyrosine biosynthesis
- superpathway of chorismate metabolism
- superpathway of L-tryptophan biosynthesis
- superpathway of tryptophan utilization
- indolmycin biosynthesis
- 12-epi-hapalindole biosynthesis
- hapalindole H biosynthesis
- 12-epi-fischerindole biosynthesis
- 3-[(E)-2-isocyanoethenyl]-1H-indole biosynthesis
- superpathway of roquefortine, meleagrin and neoxaline biosynthesis
- L-tryptophan degradation I (via anthranilate)
- superpathway of ergotamine biosynthesis
- L-phenylalanine biosynthesis I
- tryptophan degradation III (eukaryotic)
- tryptophan degradation X (mammalian, via tryptamine)
- terrequinone A biosynthesis
- secologanin and strictosidine biosynthesis
- ammonia assimilation cycle III
- L-glutamine biosynthesis I
- L-glutamate and L-glutamine biosynthesis
- superpathway of aromatic compound degradation via 2-hydroxypentadienoate
- superpathway of aromatic compound degradation via 3-oxoadipate
- 3-dehydroquinate biosynthesis I
- pyrrolnitrin biosynthesis
- fumitremorgin C biosynthesis
- superpathway of fumitremorgin biosynthesis
- fumiquinazoline D biosynthesis
- rebeccamycin biosynthesis
- tRNA charging
代谢反应
1172 个相关的代谢反应过程信息。
Reactome(80)
- Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of amine-derived hormones:
Iodine + L-Tyr ⟶ HI + MIT - Serotonin and melatonin biosynthesis:
5HT + Ac-CoA ⟶ Ac5HT + CoA-SH - Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of amine-derived hormones:
Iodine + L-Tyr ⟶ HI + MIT - Serotonin and melatonin biosynthesis:
5HTP ⟶ 5HT + carbon dioxide - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of amine-derived hormones:
Iodine + L-Tyr ⟶ HI + MIT - Serotonin and melatonin biosynthesis:
5HTP ⟶ 5HT + carbon dioxide - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of amine-derived hormones:
MIT + TPNH ⟶ I- + L-Tyr + TPN - Serotonin and melatonin biosynthesis:
5HTP ⟶ 5HT + carbon dioxide - Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of amine-derived hormones:
Iodine + L-Tyr ⟶ HI + MIT - Serotonin and melatonin biosynthesis:
L-Trp + Oxygen + Tetrahydrobiopterin ⟶ 4aOH-BH4 + 5HTP - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of amine-derived hormones:
Iodine + L-Tyr ⟶ HI + MIT - Serotonin and melatonin biosynthesis:
5HTP ⟶ 5HT + carbon dioxide - Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of amine-derived hormones:
Iodine + L-Tyr ⟶ HI + MIT - Serotonin and melatonin biosynthesis:
5HTP ⟶ 5HT + carbon dioxide - Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of amine-derived hormones:
Iodine + L-Tyr ⟶ HI + MIT - Serotonin and melatonin biosynthesis:
5HTP ⟶ 5HT + carbon dioxide - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of amine-derived hormones:
Iodine + L-Tyr ⟶ HI + MIT - Serotonin and melatonin biosynthesis:
5HTP ⟶ 5HT + carbon dioxide - Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of amine-derived hormones:
Iodine + L-Tyr ⟶ HI + MIT - Serotonin and melatonin biosynthesis:
5HTP ⟶ 5HT + carbon dioxide - Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of amine-derived hormones:
Iodine + L-Tyr ⟶ HI + MIT - Serotonin and melatonin biosynthesis:
5HTP ⟶ 5HT + carbon dioxide - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amine-derived hormones:
Iodine + L-Tyr ⟶ HI + MIT - Serotonin and melatonin biosynthesis:
5HTP ⟶ 5HT + carbon dioxide - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Metabolism:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine - Amino acid and derivative metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK
BioCyc(142)
- NAD de novo biosynthesis:
N-formylkynurenine + H2O ⟶ H+ + L-kynurenine + formate - tryptophan degradation:
N-formylkynurenine + H2O ⟶ H+ + L-kynurenine + formate - L-kynurenine degradation:
N-formylkynurenine + H2O ⟶ H+ + L-kynurenine + formate - superpathway of tryptophan utilization:
N-formylkynurenine + H2O ⟶ H+ + L-kynurenine + formate - tryptophan degradation to 2-amino-3-carboxymuconate semialdehyde:
N-formylkynurenine + H2O ⟶ H+ + L-kynurenine + formate - L-tryptophan degradation to 2-amino-3-carboxymuconate semialdehyde:
N-Formyl-L-kynurenine + H2O ⟶ H+ + L-kynurenine + formate - L-tryptophan degradation I (via anthranilate):
N-Formyl-L-kynurenine + H2O ⟶ H+ + L-kynurenine + formate - superpathway of aromatic compound degradation via 2-hydroxypentadienoate:
O2 + catechol ⟶ H+ + HMS - superpathway of aromatic compound degradation via 3-oxoadipate:
O2 + catechol ⟶ H+ + HMS - L-tryptophan degradation IX:
N-Formyl-L-kynurenine + H2O ⟶ H+ + L-kynurenine + formate - L-tryptophan degradation III (eukaryotic):
N-Formyl-L-kynurenine + H2O ⟶ H+ + L-kynurenine + formate - L-tryptophan degradation XII (Geobacillus):
N-Formyl-L-kynurenine + H2O ⟶ H+ + L-kynurenine + formate - L-tryptophan degradation XI (mammalian, via kynurenine):
N-Formyl-L-kynurenine + H2O ⟶ H+ + L-kynurenine + formate - 3-hydroxy-4-methyl-anthranilate biosynthesis I:
N-Formyl-L-kynurenine + H2O ⟶ H+ + L-kynurenine + formate - 3-hydroxy-4-methyl-anthranilate biosynthesis II:
N-Formyl-L-kynurenine + H2O ⟶ H+ + L-kynurenine + formate - NAD de novo biosynthesis II (from tryptophan):
N-Formyl-L-kynurenine + H2O ⟶ H+ + L-kynurenine + formate - superpathway of NAD biosynthesis in eukaryotes:
N-Formyl-L-kynurenine + H2O ⟶ H+ + L-kynurenine + formate - NAD de novo biosynthesis:
N-formylkynurenine + H2O ⟶ H+ + L-kynurenine + formate - tryptophan degradation to 2-amino-3-carboxymuconate semialdehyde:
N-formylkynurenine + H2O ⟶ H+ + L-kynurenine + formate - L-tryptophan degradation to 2-amino-3-carboxymuconate semialdehyde:
O2 + trp ⟶ N-formylkynurenine - L-tryptophan degradation I (via anthranilate):
O2 + trp ⟶ N-formylkynurenine - superpathway of aromatic compound degradation via 3-oxoadipate:
O2 + trp ⟶ N-formylkynurenine - L-tryptophan degradation I (via anthranilate):
O2 + trp ⟶ N-formylkynurenine - L-tryptophan degradation to 2-amino-3-carboxymuconate semialdehyde:
O2 + trp ⟶ N-formylkynurenine - L-tryptophan degradation XI (mammalian, via kynurenine):
O2 + trp ⟶ N-formylkynurenine - L-tryptophan degradation III (eukaryotic):
O2 + trp ⟶ N-formylkynurenine - 12-epi-hapalindole biosynthesis:
D-ribulose 5-phosphate + trp ⟶ (2S)-3-(1H-indol-3-yl)-2-isocyanopropanoate + H+ + H2O + acetol + formaldehyde + phosphate - hapalindole H biosynthesis:
D-ribulose 5-phosphate + trp ⟶ (2S)-3-(1H-indol-3-yl)-2-isocyanopropanoate + H+ + H2O + acetol + formaldehyde + phosphate - 12-epi-fischerindole biosynthesis:
D-ribulose 5-phosphate + trp ⟶ (2S)-3-(1H-indol-3-yl)-2-isocyanopropanoate + H+ + H2O + acetol + formaldehyde + phosphate - 3-[(E)-2-isocyanoethenyl]-1H-indole biosynthesis:
D-ribulose 5-phosphate + trp ⟶ (2S)-3-(1H-indol-3-yl)-2-isocyanopropanoate + H+ + H2O + acetol + formaldehyde + phosphate - superpathway of roquefortine, meleagrin and neoxaline biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + roquefortine D ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + roquefortine C - roquefortine C biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + roquefortine D ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + roquefortine C - 5-N-acetylardeemin biosynthesis:
DMAPP + ardeemin FQ ⟶ ardeemin + diphosphate - L-tryptophan degradation V (side chain pathway):
NAD(P)+ + indole-3-ethanol ⟶ (indol-3-yl)acetaldehyde + H+ + NAD(P)H - fumitremorgin C biosynthesis:
6-hydroxytryprostatin B + SAM ⟶ H+ + SAH + tryprostatin A - superpathway of fumitremorgin biosynthesis:
DMAPP + verruculogen ⟶ diphosphate + fumitremorgin A - fumiquinazoline D biosynthesis:
ATP + ala + fumiquinazoline F-indoline-2',3'-diol ⟶ AMP + H+ + H2O + diphosphate + fumiquinazoline A - indole-3-acetate biosynthesis III (bacteria):
O2 + trp ⟶ (indol-3-yl)acetamide + CO2 + H2O - indole-3-acetate biosynthesis III (bacteria):
(indol-3-yl)acetamide + H2O ⟶ (indol-3-yl)acetate + ammonium - violacein biosynthesis:
H+ + N-[2-(carboxylatoamino)-1,2-bis(1H-indol-3-yl)ethyl]carbamate ⟶ CO2 + ammonium + protodeoxyviolaceinate - K-252 biosynthesis:
K-252c + dTDP-2-deoxy-5-keto-dihydrostreptose ⟶ 2-deoxy-5-keto-dihydrostreptosyl-K252c + dTDP - staurosporine biosynthesis:
K-252c + dTDP-L-ristosamine ⟶ H+ + dTDP + holyrine A - tryptophan degradation II (via pyruvate):
H2O + trp ⟶ ammonium + indole + pyruvate - tryptophan degradation II (via pyruvate):
H2O + trp ⟶ ammonium + indole + pyruvate - tryptophan degradation II (via pyruvate):
H2O + trp ⟶ ammonium + indole + pyruvate - tRNA charging pathway:
ATP + H+ + ala ⟶ AMP + diphosphate - tRNA charging pathway:
ATP + H+ + ala ⟶ AMP + diphosphate - tRNA charging pathway:
ATP + ala ⟶ AMP + diphosphate - tRNA charging pathway:
ATP + ala ⟶ AMP + diphosphate - pyrrolnitrin biosynthesis:
7-chloro-L-tryptophan + A(H2) + O2 ⟶ A + CO2 + H2O + monodechloroaminopyrrolnitrin - rebeccamycin biosynthesis:
4'-O-demethylrebeccamycin + SAM ⟶ H+ + SAH + rebeccamycin - serotonin and melatonin biosynthesis:
5-hydroxy-L-tryptophan + H+ ⟶ CO2 + serotonin - serotonin and melatonin biosynthesis:
N-acetyl-serotonin + SAM ⟶ H+ + SAH + melatonin - asperlicin E biosynthesis:
H+ + NAD(P)H + O2 + asperlicin C ⟶ H2O + NAD(P)+ + asperlicin E - L-tryptophan degradation II (via pyruvate):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - superpathway of aromatic amino acid biosynthesis:
3-deoxy-D-arabino-heptulosonate 7-phosphate ⟶ 3-dehydroquinate + phosphate - superpathway of chorismate metabolism:
3-octaprenyl-4-hydroxybenzoate + H+ ⟶ 2-octaprenylphenol + CO2 - superpathway of L-tryptophan biosynthesis:
3-deoxy-D-arabino-heptulosonate 7-phosphate ⟶ 3-dehydroquinate + phosphate - superpathway of aromatic amino acid biosynthesis:
2-oxoglutarate + phe ⟶ 3-phenyl-2-oxopropanoate + glu - L-tryptophan degradation II (via pyruvate):
trp ⟶ 2-aminoprop-2-enoate + indole - superpathway of chorismate metabolism:
2-oxoglutarate + phe ⟶ 3-phenyl-2-oxopropanoate + glu - L-tryptophan biosynthesis:
1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate + H+ ⟶ (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate + CO2 + H2O - superpathway of phenylalanine, tyrosine and tryptophan biosynthesis:
pyruvate + tyr ⟶ 4-hydroxyphenylpyruvate + ala - tryptophan biosynthesis:
1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate + H+ ⟶ (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate + CO2 + H2O - superpathway of phenylalanine, tyrosine and tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate + H+ ⟶ (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate + CO2 + H2O - L-tryptophan degradation II (via pyruvate):
trp ⟶ 2-aminoprop-2-enoate + indole - superpathway of aromatic amino acid biosynthesis:
2-oxoglutarate + tyr ⟶ 4-hydroxyphenylpyruvate + Glu - superpathway of chorismate metabolism:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - superpathway of L-tryptophan biosynthesis:
1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate + H+ ⟶ (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate + CO2 + H2O - tryptophan biosynthesis:
1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate + H+ ⟶ (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate + CO2 + H2O - superpathway of phenylalanine, tyrosine, and tryptophan biosynthesis:
2-oxo-3-phenylpropanoate + glt ⟶ 2-oxoglutarate + phe - superpathway of chorismate metabolism:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - superpathway of tryptophan biosynthesis:
1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate + H+ ⟶ (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate + CO2 + H2O - tryptophan degradation II (via pyruvate):
trp ⟶ 2-aminoprop-2-enoate + H+ + indole - superpathway of phenylalanine, tyrosine, and tryptophan biosynthesis:
glt + phenylpyruvate ⟶ 2-oxoglutarate + phe - tryptophan biosynthesis:
1-(o-carboxyphenylamino)-1'-deoxyribulose-5'-phosphate + H+ ⟶ (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate + CO2 + H2O - superpathway of chorismate:
glt + phenylpyruvate ⟶ 2-oxoglutarate + phe - superpathway of L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - superpathway of phenylalanine, tyrosine, and tryptophan biosynthesis:
2-oxoglutarate + tyr ⟶ 4-hydroxyphenylpyruvate + glt - superpathway of tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - superpathway of tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - superpathway of phenylalanine, tyrosine, and tryptophan biosynthesis:
2-oxo-3-phenylpropanoate + glt ⟶ 2-oxoglutarate + phe - superpathway of chorismate metabolism:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - superpathway of phenylalanine, tyrosine, and tryptophan biosynthesis:
2-oxo-3-phenylpropanoate + glt ⟶ 2-oxoglutarate + phe - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - superpathway of aromatic amino acid biosynthesis:
2-oxo-3-phenylpropanoate + glt ⟶ 2-oxoglutarate + phe - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - superpathway of aromatic amino acid biosynthesis:
indole + ser ⟶ H2O + trp - superpathway of aromatic amino acid biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - superpathway of chorismate metabolism:
2-oxoglutarate + tyr ⟶ 4-hydroxyphenylpyruvate + glt - superpathway of phenylalanine, tyrosine, and tryptophan biosynthesis:
2-oxo-3-phenylpropanoate + glt ⟶ 2-oxoglutarate + phe - superpathway of aromatic amino acid biosynthesis:
2-oxoglutarate + tyr ⟶ 4-hydroxyphenylpyruvate + glt - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - superpathway of L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ D-glyceraldehyde-3-phosphate + indole - superpathway of L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - superpathway of phenylalanine, tyrosine, and tryptophan biosynthesis:
2-oxoglutarate + tyr ⟶ 4-hydroxyphenylpyruvate + glt - tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - superpathway of chorismate metabolism:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - superpathway of chorismate metabolism:
2-oxoglutarate + tyr ⟶ 4-hydroxyphenylpyruvate + glt - superpathway of tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - superpathway of phenylalanine, tyrosine, and tryptophan biosynthesis:
2-oxoglutarate + tyr ⟶ 4-hydroxyphenylpyruvate + glt - tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - superpathway of tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - superpathway of phenylalanine, tyrosine, and tryptophan biosynthesis:
2-oxoglutarate + tyr ⟶ 4-hydroxyphenylpyruvate + glt - tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - superpathway of tryptophan biosynthesis:
ATP + shikimate ⟶ ADP + H+ + shikimate-3-phosphate - tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - superpathway of phenylalanine, tyrosine, and tryptophan biosynthesis:
2-oxoglutarate + tyr ⟶ 4-hydroxyphenylpyruvate + glt - tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - superpathway of tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - superpathway of tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - tryptophan degradation II (via pyruvate):
trp ⟶ 2-aminoprop-2-enoate + H+ + indole - tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - superpathway of aromatic amino acid biosynthesis:
2-oxoglutarate + tyr ⟶ 4-hydroxyphenylpyruvate + glt - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - superpathway of L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - superpathway of L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - superpathway of L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - superpathway of L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - superpathway of L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
WikiPathways(0)
Plant Reactome(708)
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + indole-3-acetonitrile ⟶ IAA + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + indole-3-acetonitrile ⟶ IAA + ammonia - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + indole-3-acetonitrile ⟶ IAA + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + indole-3-acetonitrile ⟶ IAA + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + indole-3-acetonitrile ⟶ IAA + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + indole-3-acetonitrile ⟶ IAA + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + indole-3-acetonitrile ⟶ IAA + ammonia - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + indole-3-acetonitrile ⟶ IAA + ammonia - Metabolism and regulation:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA - Hormone signaling, transport, and metabolism:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate + Oxygen ⟶ CH3COO- + jasmonic acid - IAA biosynthesis I:
CH3COO- + indole ⟶ IAA - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + indole-3-acetonitrile ⟶ IAA + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
H2O + indole-3-acetyl-ala ⟶ IAA + L-Ala - IAA biosynthesis I:
indole-3-pyruvate ⟶ carbon dioxide + indole acetaldehyde - Secondary metabolism:
DMAPP + genistein ⟶ PPi + lupiwighteone - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
H+ + NAD(P)H + Oxygen + tryptamine ⟶ 5HT + NAD(P)+ + dihydrogen - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
5HT + caffeoyl-CoA ⟶ CoA-SH + H+ + caffeoylserotonin - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
5HT + caffeoyl-CoA ⟶ CoA-SH + H+ + caffeoylserotonin - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
H+ + NAD(P)H + Oxygen + tryptamine ⟶ 5HT + NAD(P)+ + dihydrogen - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
H+ + NAD(P)H + Oxygen + tryptamine ⟶ 5HT + NAD(P)+ + dihydrogen - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
H+ + NAD(P)H + Oxygen + tryptamine ⟶ 5HT + NAD(P)+ + dihydrogen - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
H+ + NAD(P)H + Oxygen + tryptamine ⟶ 5HT + NAD(P)+ + dihydrogen - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
H+ + NAD(P)H + Oxygen + tryptamine ⟶ 5HT + NAD(P)+ + dihydrogen - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
5HT + caffeoyl-CoA ⟶ CoA-SH + H+ + caffeoylserotonin - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
H+ + NAD(P)H + Oxygen + tryptamine ⟶ 5HT + NAD(P)+ + dihydrogen - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
H+ + NAD(P)H + Oxygen + tryptamine ⟶ 5HT + NAD(P)+ + dihydrogen - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
5HT + caffeoyl-CoA ⟶ CoA-SH + H+ + caffeoylserotonin - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
H+ + NAD(P)H + Oxygen + tryptamine ⟶ 5HT + NAD(P)+ + dihydrogen - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
H+ + NAD(P)H + Oxygen + tryptamine ⟶ 5HT + NAD(P)+ + dihydrogen - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
H+ + NAD(P)H + Oxygen + tryptamine ⟶ 5HT + NAD(P)+ + dihydrogen - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
5HT + caffeoyl-CoA ⟶ CoA-SH + H+ + caffeoylserotonin - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
H+ + NAD(P)H + Oxygen + tryptamine ⟶ 5HT + NAD(P)+ + dihydrogen - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
H+ + NAD(P)H + Oxygen + tryptamine ⟶ 5HT + NAD(P)+ + dihydrogen - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
5HT + caffeoyl-CoA ⟶ CoA-SH + H+ + caffeoylserotonin - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
5HT + caffeoyl-CoA ⟶ CoA-SH + H+ + caffeoylserotonin - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
5HT + caffeoyl-CoA ⟶ CoA-SH + H+ + caffeoylserotonin - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
H+ + NAD(P)H + Oxygen + tryptamine ⟶ 5HT + NAD(P)+ + dihydrogen - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
H+ + NAD(P)H + Oxygen + tryptamine ⟶ 5HT + NAD(P)+ + dihydrogen - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
5HT + caffeoyl-CoA ⟶ CoA-SH + H+ + caffeoylserotonin - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
5HT + caffeoyl-CoA ⟶ CoA-SH + H+ + caffeoylserotonin - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
5HT + caffeoyl-CoA ⟶ CoA-SH + H+ + caffeoylserotonin - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
L-Phe ⟶ ammonia + trans-cinnamate - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
5HT + caffeoyl-CoA ⟶ CoA-SH + H+ + caffeoylserotonin - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
5HT + caffeoyl-CoA ⟶ CoA-SH + H+ + caffeoylserotonin - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
H+ + NAD(P)H + Oxygen + tryptamine ⟶ 5HT + NAD(P)+ + dihydrogen - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
H+ + NAD(P)H + Oxygen + tryptamine ⟶ 5HT + NAD(P)+ + dihydrogen - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
H+ + NAD(P)H + Oxygen + tryptamine ⟶ 5HT + NAD(P)+ + dihydrogen - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
H+ + NAD(P)H + Oxygen + tryptamine ⟶ 5HT + NAD(P)+ + dihydrogen - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
5HT + caffeoyl-CoA ⟶ CoA-SH + H+ + caffeoylserotonin - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
H+ + NAD(P)H + Oxygen + tryptamine ⟶ 5HT + NAD(P)+ + dihydrogen - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
GPP + H2O ⟶ PPi + geraniol - Serotonin biosynthesis:
H+ + NAD(P)H + Oxygen + tryptamine ⟶ 5HT + NAD(P)+ + dihydrogen - Secologanin and strictosidine biosynthesis:
GPP + H2O ⟶ PPi + geraniol - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
5HT + caffeoyl-CoA ⟶ CoA-SH + H+ + caffeoylserotonin - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
H+ + NAD(P)H + Oxygen + tryptamine ⟶ 5HT + NAD(P)+ + dihydrogen - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
5HT + caffeoyl-CoA ⟶ CoA-SH + H+ + caffeoylserotonin - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
5HT + caffeoyl-CoA ⟶ CoA-SH + H+ + caffeoylserotonin - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Serotonin biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - Secologanin and strictosidine biosynthesis:
L-Trp ⟶ carbon dioxide + tryptamine - IAA biosynthesis VI (via indole-3-acetamide):
H2O + indole-3-acetamide ⟶ IAA + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
L-Ser + indole ⟶ H2O + L-Trp - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
L-Ser + indole ⟶ H2O + L-Trp - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA - Amino acid biosynthesis:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
L-Ser + indole ⟶ H2O + L-Trp - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole
INOH(0)
PlantCyc(242)
- NAD de novo biosynthesis II (from tryptophan):
N-Formyl-L-kynurenine + H2O ⟶ H+ + L-kynurenine + formate - L-tryptophan degradation to 2-amino-3-carboxymuconate semialdehyde:
N-Formyl-L-kynurenine + H2O ⟶ H+ + L-kynurenine + formate - L-tryptophan degradation to 2-amino-3-carboxymuconate semialdehyde:
O2 + trp ⟶ N-Formyl-L-kynurenine - NAD de novo biosynthesis II (from tryptophan):
O2 + trp ⟶ N-Formyl-L-kynurenine - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan - serotonin and melatonin biosynthesis:
N-acetyl-serotonin + SAM ⟶ H+ + SAH + melatonin - indole-3-acetate biosynthesis III (bacteria):
O2 + trp ⟶ (indol-3-yl)acetamide + CO2 + H2O - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - superpathway of phenylalanine, tyrosine and tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
indole + ser ⟶ H2O + trp - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - L-tryptophan biosynthesis:
chorismate + gln ⟶ H+ + anthranilate + glu + pyruvate
COVID-19 Disease Map(0)
PathBank(0)
PharmGKB(0)
0 个相关的物种来源信息
在这里通过桑基图来展示出与当前的这个代谢物在我们的BioDeep知识库中具有相关联信息的其他代谢物。在这里进行关联的信息来源主要有：
- PubMed: 来源于PubMed文献库中的文献信息，我们通过自然语言数据挖掘得到的在同一篇文献中被同时提及的相关代谢物列表，这个列表按照代谢物同时出现的文献数量降序排序，取前10个代谢物作为相关研究中关联性很高的代谢物集合展示在桑基图中。
- NCBI Taxonomy: 通过文献数据挖掘，得到的代谢物物种来源信息关联。这个关联信息同样按照出现的次数降序排序，取前10个代谢物作为高关联度的代谢物集合展示在桑吉图上。
- Chemical Taxonomy: 在物质分类上处于同一个分类集合中的其他代谢物
- Chemical Reaction: 在化学反应过程中，存在为当前代谢物相关联的生化反应过程中的反应底物或者反应产物的关联代谢物信息。
点击图上的相关代谢物的名称，可以跳转到相关代谢物的信息页面。
| 亚细胞结构定位 | 关联基因列表 |
|---|
文献列表
- Chayne L Piscitelli, Eric Gouaux. Insights into transport mechanism from LeuT engineered to transport tryptophan.
The EMBO journal.
2012 Jan; 31(1):228-35. doi:
10.1038/emboj.2011.353. [PMID: 21952050]
