(2S)-5-amino-2-ammonio-5-oxopentanoate (BioDeep_00000898789)
Main id: BioDeep_00000398103
代谢物信息卡片
(2S)-5-amino-2-ammonio-5-oxopentanoate
化学式: C5H10N2O3 (146.069139)
中文名称:
谱图信息:
最多检出来源 () 0%
分子结构信息
SMILES: C(CC(=O)N)C(C(=O)[O-])[NH3+]
InChI: InChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/t3-/m0/s1
相关代谢途径
Reactome(34)
- Metabolism
- Biological oxidations
- Metabolism of vitamins and cofactors
- Metabolism of proteins
- Post-translational protein modification
- Disease
- Phase II - Conjugation of compounds
- Amino acid and derivative metabolism
- Drug ADME
- Asparagine N-linked glycosylation
- Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein
- Synthesis of substrates in N-glycan biosythesis
- Diseases of metabolism
- Diseases of glycosylation
- Diseases associated with glycosylation precursor biosynthesis
- Transport of small molecules
- SLC-mediated transmembrane transport
- Purine metabolism
- Nucleotide metabolism
- Transport of inorganic cations/anions and amino acids/oligopeptides
- Amino acid synthesis and interconversion (transamination)
- Metabolism of water-soluble vitamins and cofactors
- Azathioprine ADME
- Gene expression (Transcription)
- RNA Polymerase II Transcription
- Generic Transcription Pathway
- Transcriptional Regulation by TP53
- Neuronal System
- Transmission across Chemical Synapses
- Neurotransmitter release cycle
- Aspartate and asparagine metabolism
- Nicotinate metabolism
- De novo synthesis of UMP
- Glutamate and glutamine metabolism
BioCyc(52)
- superpathway of pyrimidine ribonucleosides salvage
- UTP and CTP dephosphorylation I
- chitin biosynthesis
- O-antigen building blocks biosynthesis (E. coli)
- UDP-N-acetyl-D-glucosamine biosynthesis I
- superpathway of aromatic amino acid biosynthesis
- superpathway of chorismate metabolism
- aspartate superpathway
- superpathway of L-tryptophan biosynthesis
- superpathway of UDP-N-acetylglucosamine-derived O-antigen building blocks biosynthesis
- superpathway of tryptophan utilization
- superpathway of indole-3-acetate conjugate biosynthesis
- superpathway of arginine and polyamine biosynthesis
- superpathway of L-citrulline metabolism
- L-citrulline biosynthesis
- citrulline biosynthesis
- superpathway of quinolone and alkylquinolone biosynthesis
- streptomycin biosynthesis
- 6-methylpretetramide biosynthesis
- superpathway of tetracycline and oxytetracycline biosynthesis
- phenazine-1-carboxylate biosynthesis
- CMP-legionaminate biosynthesis I
- superpathway of guanosine nucleotides de novo biosynthesis I
- superpathway of tetrahydrofolate biosynthesis
- superpathway of tetrahydrofolate biosynthesis and salvage
- guanosine ribonucleotides de novo biosynthesis
- L-phenylalanine degradation IV (mammalian, via side chain)
- L-arginine biosynthesis II (acetyl cycle)
- UMP biosynthesis
- glutamate and glutamine biosynthesis
- superpathway of L-asparagine biosynthesis
- phenylalanine degradation IV (mammalian, via side chain)
- glutamine biosynthesis III
- superpathway of 5-aminoimidazole ribonucleotide biosynthesis
- 5-aminoimidazole ribonucleotide biosynthesis II
- ammonia assimilation cycle III
- L-glutamine biosynthesis I
- L-glutamine degradation I
- L-glutamine degradation II
- L-glutamate and L-glutamine biosynthesis
- superpathway of purine nucleotides de novo biosynthesis I
- superpathway of rifamycin B biosynthesis
- L-histidine biosynthesis
- UDP-N-acetyl-D-glucosamine biosynthesis II
- L-arginine biosynthesis I (via L-ornithine)
- UTP and CTP dephosphorylation II
- superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis
- superpathway of pyrimidine nucleobases salvage
- superpathway of mycolyl-arabinogalactan-peptidoglycan complex biosynthesis
- L-methionine salvage cycle I (bacteria and plants)
- L-methionine salvage cycle II (plants)
- tRNA charging
PlantCyc(16)
- UTP and CTP dephosphorylation I
- superpathway of pyrimidine ribonucleosides salvage
- superpathway of indole-3-acetate conjugate biosynthesis
- superpathway of L-citrulline metabolism
- L-citrulline biosynthesis
- Organic Nitrogen Assimilation
- superpathway of purine nucleotides de novo biosynthesis I
- guanosine ribonucleotides de novo biosynthesis
- UMP biosynthesis I
- superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis
- superpathway of pyrimidine ribonucleotides de novo biosynthesis
- L-glutamate biosynthesis I
- Inorganic Nitrogen Assimilation
- L-histidine biosynthesis
- L-methionine salvage cycle II (plants)
- L-methionine salvage cycle I (bacteria and plants)
代谢反应
4314 个相关的代谢反应过程信息。
Reactome(431)
- Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Nucleotide metabolism:
H2O + XTP ⟶ PPi + XMP - Nucleobase biosynthesis:
ATP + H2O + L-Gln + XMP ⟶ AMP + GMP + L-Glu + PPi - Purine ribonucleoside monophosphate biosynthesis:
ATP + H2O + L-Gln + XMP ⟶ AMP + GMP + L-Glu + PPi - Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Nucleotide metabolism:
H2O + XTP ⟶ PPi + XMP - Nucleobase biosynthesis:
ATP + H2O + L-Gln + XMP ⟶ AMP + GMP + L-Glu + PPi - Purine ribonucleoside monophosphate biosynthesis:
ATP + H2O + L-Gln + XMP ⟶ AMP + GMP + L-Glu + PPi - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Nucleotide metabolism:
H2O + XTP ⟶ PPi + XMP - Nucleobase biosynthesis:
ATP + H2O + L-Gln + XMP ⟶ AMP + GMP + L-Glu + PPi - Purine ribonucleoside monophosphate biosynthesis:
ATP + H2O + L-Gln + XMP ⟶ AMP + GMP + L-Glu + PPi - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid synthesis and interconversion (transamination):
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid synthesis and interconversion (transamination):
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid synthesis and interconversion (transamination):
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Amino acid synthesis and interconversion (transamination):
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid synthesis and interconversion (transamination):
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid synthesis and interconversion (transamination):
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Amino acid synthesis and interconversion (transamination):
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Pyrimidine biosynthesis:
CAP + L-Asp ⟶ N-carbamoyl-L-aspartate + Pi - De novo synthesis of UMP:
CAP + L-Asp ⟶ N-carbamoyl-L-aspartate + Pi - Pyrimidine biosynthesis:
CAP + L-Asp ⟶ N-carbamoyl-L-aspartate + Pi - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH - Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of vitamins and cofactors:
6x(PCCA:PCCB) + ATP + Btn ⟶ 6x(Btn-PCCA:PCCB) + AMP + PPi - Metabolism of water-soluble vitamins and cofactors:
6x(PCCA:PCCB) + ATP + Btn ⟶ 6x(Btn-PCCA:PCCB) + AMP + PPi - Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH - Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
H+ + PRPP + QUIN ⟶ NAMN + PPi + carbon dioxide - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
(ADP-D-ribosyl)(n)-acceptor + NAD ⟶ (ADP-D-ribosyl)(n+1)-acceptor + NAM - Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
H+ + Oxygen + dh-beta-NAD ⟶ H2O2 + NAD - Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of vitamins and cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - Metabolism of water-soluble vitamins and cofactors:
L-Cys + MOCS3:Zn2+ (red.) ⟶ L-Ala + MOCS3-S-S(1-):Zn2+ - Nicotinate metabolism:
ATP + NAD ⟶ ADP + H+ + TPN - Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH - Metabolism:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine - Metabolism of vitamins and cofactors:
4x(PC:Mn2+) + ATP + Btn ⟶ 4x(Btn-PC:Mn2+) + AMP + PPi - Metabolism of water-soluble vitamins and cofactors:
4x(PC:Mn2+) + ATP + Btn ⟶ 4x(Btn-PC:Mn2+) + AMP + PPi - Nicotinate metabolism:
H+ + PRPP + QUIN ⟶ NAMN + PPi + carbon dioxide - Metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Metabolism of vitamins and cofactors:
4x(PC:Mn2+) + ATP + Btn ⟶ 4x(Btn-PC:Mn2+) + AMP + PPi - Metabolism of water-soluble vitamins and cofactors:
4x(PC:Mn2+) + ATP + Btn ⟶ 4x(Btn-PC:Mn2+) + AMP + PPi - Nicotinate metabolism:
ATP + NR ⟶ ADP + H+ + NMN - Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide biosynthesis:
ATP + CAIR + L-Asp ⟶ ADP + H+ + Pi + SAICAR - Pyrimidine biosynthesis:
CAP + L-Asp ⟶ H+ + N-carb-L-Asp + Pi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide biosynthesis:
ATP + CAIR + L-Asp ⟶ ADP + H+ + Pi + SAICAR - Pyrimidine biosynthesis:
H+ + OMP ⟶ UMP + carbon dioxide - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide biosynthesis:
GTP + IMP + L-Asp ⟶ ADS + GDP + H+ + Pi - Pyrimidine biosynthesis:
CAP + L-Asp ⟶ H+ + N-carb-L-Asp + Pi - Nucleotide metabolism:
ATP + Thy-dRib ⟶ ADP + TMP - Nucleotide biosynthesis:
GTP + IMP + L-Asp ⟶ ADS + GDP + H+ + Pi - Pyrimidine biosynthesis:
CAP + L-Asp ⟶ H+ + N-carb-L-Asp + Pi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide biosynthesis:
ATP + CAIR + L-Asp ⟶ ADP + H+ + Pi + SAICAR - Pyrimidine biosynthesis:
CAP + L-Asp ⟶ H+ + N-carb-L-Asp + Pi - Metabolism:
H2O + PBG ⟶ HMBL + ammonia - Nucleotide metabolism:
CAP + L-Asp ⟶ N-carb-L-Asp + Pi - Pyrimidine metabolism: de novo synthesis of UMP:
CAP + L-Asp ⟶ N-carb-L-Asp + Pi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide biosynthesis:
ATP + CAIR + L-Asp ⟶ ADP + H+ + Pi + SAICAR - Pyrimidine biosynthesis:
CAP + L-Asp ⟶ H+ + N-carb-L-Asp + Pi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide biosynthesis:
ATP + CAIR + L-Asp ⟶ ADP + H+ + Pi + SAICAR - Pyrimidine biosynthesis:
CAP + L-Asp ⟶ H+ + N-carb-L-Asp + Pi - Nucleotide metabolism:
GTP + IMP + L-Asp ⟶ ADS + GDP + H+ + Pi - Nucleotide biosynthesis:
GTP + IMP + L-Asp ⟶ ADS + GDP + H+ + Pi - Pyrimidine biosynthesis:
CAP + L-Asp ⟶ H+ + N-carb-L-Asp + Pi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide biosynthesis:
ATP + CAIR + L-Asp ⟶ ADP + H+ + Pi + SAICAR - Pyrimidine biosynthesis:
CAP + L-Asp ⟶ H+ + N-carb-L-Asp + Pi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide biosynthesis:
GTP + IMP + L-Asp ⟶ ADS + GDP + H+ + Pi - Pyrimidine biosynthesis:
CAP + L-Asp ⟶ H+ + N-carb-L-Asp + Pi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide biosynthesis:
GTP + IMP + L-Asp ⟶ ADS + GDP + H+ + Pi - Pyrimidine biosynthesis:
CAP + L-Asp ⟶ H+ + N-carb-L-Asp + Pi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide biosynthesis:
ATP + CAIR + L-Asp ⟶ ADP + H+ + Pi + SAICAR - Pyrimidine biosynthesis:
CAP + L-Asp ⟶ H+ + N-carb-L-Asp + Pi - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Nucleotide metabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Nucleotide biosynthesis:
ATP + CAIR + L-Asp ⟶ ADP + H+ + Pi + SAICAR - Pyrimidine biosynthesis:
CAP + L-Asp ⟶ H+ + N-carb-L-Asp + Pi - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid and derivative metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Amino acid and derivative metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Synthesis of UDP-N-acetyl-glucosamine:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Synthesis of UDP-N-acetyl-glucosamine:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Metabolism of proteins:
EIF5A2 + NAD + SPM ⟶ 1,3-diaminopropane + H+ + H0ZKZ7 + NADH - Post-translational protein modification:
EIF5A2 + NAD + SPM ⟶ 1,3-diaminopropane + H+ + H0ZKZ7 + NADH - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Synthesis of UDP-N-acetyl-glucosamine:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Interconversion of nucleotide di- and triphosphates:
AMP + ATP ⟶ ADP - Interconversion of nucleotide di- and triphosphates:
AMP + ATP ⟶ ADP - Interconversion of nucleotide di- and triphosphates:
AMP + ATP ⟶ ADP - Neuronal System:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Transmission across Chemical Synapses:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Gene expression (Transcription):
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - RNA Polymerase II Transcription:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Generic Transcription Pathway:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Transcriptional Regulation by TP53:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - TP53 Regulates Metabolic Genes:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - Glutamate Neurotransmitter Release Cycle:
H2O + L-Gln ⟶ Glu + NH4+ - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Neuronal System:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Transmission across Chemical Synapses:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Neurotransmitter release cycle:
2OG + GABA ⟶ Glu + SUCCSA - Glutamate Neurotransmitter Release Cycle:
H2O + L-Gln ⟶ Glu + NH4+ - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Gene expression (Transcription):
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - RNA Polymerase II Transcription:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Generic Transcription Pathway:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Transcriptional Regulation by TP53:
GSH + H2O2 ⟶ GSSG + H2O - TP53 Regulates Metabolic Genes:
GSH + H2O2 ⟶ GSSG + H2O - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - Glutamate Neurotransmitter Release Cycle:
H2O + L-Gln ⟶ Glu + NH4+ - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Gene expression (Transcription):
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - RNA Polymerase II Transcription:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Generic Transcription Pathway:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Transcriptional Regulation by TP53:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - TP53 Regulates Metabolic Genes:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Gene expression (Transcription):
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - RNA Polymerase II Transcription:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Generic Transcription Pathway:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Transcriptional Regulation by TP53:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - TP53 Regulates Metabolic Genes:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
2OG + GABA ⟶ Glu + SUCCSA - Glutamate Neurotransmitter Release Cycle:
H2O + L-Gln ⟶ Glu + NH4+ - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Neuronal System:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Transmission across Chemical Synapses:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Neurotransmitter release cycle:
2OG + GABA ⟶ Glu + SUCCSA - Glutamate Neurotransmitter Release Cycle:
H2O + L-Gln ⟶ Glu + NH4+ - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Gene expression (Transcription):
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - RNA Polymerase II Transcription:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Generic Transcription Pathway:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Transcriptional Regulation by TP53:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - TP53 Regulates Metabolic Genes:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - Glutamate Neurotransmitter Release Cycle:
H2O + L-Gln ⟶ Glu + NH4+ - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Gene expression (Transcription):
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - RNA Polymerase II Transcription:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Generic Transcription Pathway:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Transcriptional Regulation by TP53:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - TP53 Regulates Metabolic Genes:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - Glutamate Neurotransmitter Release Cycle:
H2O + L-Gln ⟶ Glu + NH4+ - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Gene expression (Transcription):
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - RNA Polymerase II Transcription:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Generic Transcription Pathway:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Transcriptional Regulation by TP53:
Cytochrome c-Fe2+ + H+ + Oxygen ⟶ Cytochrome c-Fe3+ + H+ + H2O - TP53 Regulates Metabolic Genes:
Cytochrome c-Fe2+ + H+ + Oxygen ⟶ Cytochrome c-Fe3+ + H+ + H2O - Gene expression (Transcription):
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - RNA Polymerase II Transcription:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Generic Transcription Pathway:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Transcriptional Regulation by TP53:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - TP53 Regulates Metabolic Genes:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - Glutamate Neurotransmitter Release Cycle:
H2O + L-Gln ⟶ Glu + NH4+ - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Neuronal System:
HCN channels + cAMP ⟶ HCN channel bound to cAMP - Transmission across Chemical Synapses:
ATP ⟶ ADP - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - Glutamate Neurotransmitter Release Cycle:
H2O + L-Gln ⟶ Glu + NH4+ - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Gene expression (Transcription):
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - RNA Polymerase II Transcription:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Generic Transcription Pathway:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Transcriptional Regulation by TP53:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - TP53 Regulates Metabolic Genes:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Neuronal System:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Transmission across Chemical Synapses:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Gene expression (Transcription):
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - RNA Polymerase II Transcription:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Generic Transcription Pathway:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Transcriptional Regulation by TP53:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - TP53 Regulates Metabolic Genes:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
Ac-CoA + Cho ⟶ AcCho + CoA-SH - Glutamate Neurotransmitter Release Cycle:
H2O + L-Gln ⟶ Glu + NH4+ - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - Glutamate Neurotransmitter Release Cycle:
H2O + L-Gln ⟶ Glu + NH4+ - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Gene expression (Transcription):
p-AMPK heterotrimer:AMP ⟶ SESN1,2,3:p-AMPK heterotrimer:AMP - RNA Polymerase II Transcription:
p-AMPK heterotrimer:AMP ⟶ SESN1,2,3:p-AMPK heterotrimer:AMP - Generic Transcription Pathway:
p-AMPK heterotrimer:AMP ⟶ SESN1,2,3:p-AMPK heterotrimer:AMP - Transcriptional Regulation by TP53:
p-AMPK heterotrimer:AMP ⟶ SESN1,2,3:p-AMPK heterotrimer:AMP - TP53 Regulates Metabolic Genes:
p-AMPK heterotrimer:AMP ⟶ SESN1,2,3:p-AMPK heterotrimer:AMP - Gene expression (Transcription):
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - RNA Polymerase II Transcription:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Generic Transcription Pathway:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Transcriptional Regulation by TP53:
H2O2 + TXN ⟶ F6ZMN7 + H2O - TP53 Regulates Metabolic Genes:
H2O2 + TXN ⟶ F6ZMN7 + H2O - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
Ac-CoA + Cho ⟶ AcCho + CoA-SH - Glutamate Neurotransmitter Release Cycle:
H2O + L-Gln ⟶ Glu + NH4+ - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Amino acid synthesis and interconversion (transamination):
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Synthesis of UDP-N-acetyl-glucosamine:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Synthesis of UDP-N-acetyl-glucosamine:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Synthesis of UDP-N-acetyl-glucosamine:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Synthesis of UDP-N-acetyl-glucosamine:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Metabolism of proteins:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a - Post-translational protein modification:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
ATP + MVA5PP ⟶ ADP + IPPP + Pi + carbon dioxide - Synthesis of UDP-N-acetyl-glucosamine:
AcGlcN1P + UTP ⟶ PPi + UDP-GlcNAc - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH + Q9GU68 - Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH + Q9GU68 - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Synthesis of UDP-N-acetyl-glucosamine:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Metabolism of proteins:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Post-translational protein modification:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Synthesis of UDP-N-acetyl-glucosamine:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Synthesis of UDP-N-acetyl-glucosamine:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Synthesis of UDP-N-acetyl-glucosamine:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
TPNH + pPNOL ⟶ DCHOL + TPN - Synthesis of UDP-N-acetyl-glucosamine:
AcGlcN1P + UTP ⟶ PPi + UDP-GlcNAc - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Synthesis of UDP-N-acetyl-glucosamine:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
ATP + MVA5PP ⟶ ADP + IPPP + Pi + carbon dioxide - Synthesis of UDP-N-acetyl-glucosamine:
AcGlcN1P + UTP ⟶ PPi + UDP-GlcNAc - Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
ATP + MVA5PP ⟶ ADP + IPPP + Pi + carbon dioxide - Synthesis of UDP-N-acetyl-glucosamine:
AcGlcN1P + UTP ⟶ PPi + UDP-GlcNAc - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Synthesis of UDP-N-acetyl-glucosamine:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Metabolism of proteins:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a - Post-translational protein modification:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
ATP + MVA5PP ⟶ ADP + IPPP + Pi + carbon dioxide - Synthesis of UDP-N-acetyl-glucosamine:
AcGlcN1P + UTP ⟶ PPi + UDP-GlcNAc
BioCyc(353)
- paromamine biosynthesis I:
2-deoxy-scyllo-inosamine + NAD(P)+ ⟶ 3-amino-2,3-dideoxy-scyllo-inosose + H+ + NAD(P)H - paromamine biosynthesis II:
2-deoxy-L-scyllo-inosose + gln ⟶ 2-deoxy-scyllo-inosamine + 2-oxoglutaramate - superpathway of neomycin biosynthesis:
2-deoxy-scyllo-inosamine + NAD(P)+ ⟶ 3-amino-2,3-dideoxy-scyllo-inosose + H+ + NAD(P)H - kanamycin biosynthesis:
2-deoxy-L-scyllo-inosose + gln ⟶ 2-deoxy-scyllo-inosamine + 2-oxoglutaramate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
asp + carbamoyl phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
asp + carbamoyl phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - UMP biosynthesis:
asp + carbamoyl phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - UMP biosynthesis II:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - UMP biosynthesis III:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - UMP biosynthesis I:
(S)-dihydroorotate + H2O ⟶ N-carbamoyl-L-aspartate + H+ - superpathway of arginine and polyamine biosynthesis:
cadaverine + dAdoMet ⟶ S-methyl-5'-thioadenosine + H+ + aminopropylcadaverine - L-arginine biosynthesis III (via N-acetyl-L-citrulline):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis IV (archaebacteria):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis II (acetyl cycle):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + H2O ⟶ N-carbamoyl-L-aspartate + H+ - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
H2O + dUTP ⟶ H+ + dUMP + diphosphate - superpathway of arginine and polyamine biosynthesis:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
asp + carbamoyl phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
asp + carbamoyl phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
asp + carbamoyl phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - de novo biosynthesis of pyrimidine ribonucleotides:
asp + carbamoyl phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - arginine biosynthesis:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis II:
asp + carbamoyl phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - L-arginine biosynthesis II (acetyl cycle):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + Glu + H+ + carbamoyl phosphate + phosphate - UMP biosynthesis I:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + Glu + H+ + carbamoyl phosphate + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + Glu + H+ + carbamoyl phosphate + phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + Glu + H+ + carbamoyl phosphate + phosphate - L-arginine biosynthesis I (via L-ornithine):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + Glu + H+ + carbamoyl phosphate + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + Glu + H+ + carbamoyl phosphate + phosphate - UMP biosynthesis II:
asp + carbamoyl phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + Glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + Glu - arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
asp + carbamoyl-phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
asp + carbamoyl-phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - UMP biosynthesis:
asp + carbamoyl-phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - arginine biosynthesis IV (archaebacteria):
2-oxoglutarate + a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-ornithyl)-L-glutamate ⟶ a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-glutamate 5-semialdehyde-2-yl)-L-glutamate + glt - arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - UMP biosynthesis I:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis I (via L-ornithine):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis II (acetyl cycle):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
asp + carbamoyl phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - UMP biosynthesis:
asp + carbamoyl phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
asp + carbamoyl phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - L-arginine biosynthesis IV (archaebacteria):
2-oxoglutarate + a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-ornithyl)-L-glutamate ⟶ a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-glutamate 5-semialdehyde-2-yl)-L-glutamate + glt - UMP biosynthesis I:
asp + carbamoyl phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
asp + carbamoyl phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
asp + carbamoyl phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - UMP biosynthesis:
asp + carbamoyl-phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
asp + carbamoyl-phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
asp + carbamoyl-phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - arginine biosynthesis IV (archaebacteria):
2-oxoglutarate + a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-ornithyl)-L-glutamate ⟶ a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-glutamate 5-semialdehyde-2-yl)-L-glutamate + glt - arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
asp + carbamoyl-phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - UMP biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - arginine biosynthesis IV (archaebacteria):
2-oxoglutarate + a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-ornithyl)-L-glutamate ⟶ a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-glutamate 5-semialdehyde-2-yl)-L-glutamate + glt - arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + orotate - arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - arginine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + orotate - UMP biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - UMP biosynthesis I:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis I (via L-ornithine):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - UMP biosynthesis II:
(S)-dihydroorotate + fumarate ⟶ orotate + succinate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + fumarate ⟶ orotate + succinate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - UMP biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - uridine-5'-phosphate biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis III:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - UMP biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of arginine and polyamine biosynthesis:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - UMP biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis:
(S)-dihydroorotate + UQ ⟶ UQH2 + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + UQ ⟶ UQH2 + orotate - arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - superpathway of arginine and polyamine biosynthesis:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of arginine and polyamine biosynthesis:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - UMP biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - arginine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - uridine-5'-phosphate biosynthesis:
ATP + H2O + bicarbonate + gln ⟶ ADP + H+ + carbamoyl-phosphate + glt + phosphate - pyrimidine ribonucleotides de novo biosynthesis:
ATP + CMP ⟶ ADP + CDP - arginine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - uridine-5'-phosphate biosynthesis:
(S)-dihydroorotate + UQ ⟶ UQH2 + orotate - pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + UQ ⟶ UQH2 + orotate - arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - arginine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - pyrimidine ribonucleotides de novo biosynthesis:
ATP + CMP ⟶ ADP + CDP - uridine-5'-phosphate biosynthesis:
ATP + H2O + bicarbonate + gln ⟶ ADP + H+ + carbamoyl-phosphate + glt + phosphate - arginine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine-5'-phosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + orotate - UMP biosynthesis:
diphosphate + orotidine-5'-phosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine-5'-phosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + orotate - arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - arginine biosynthesis IV (archaebacteria):
2-oxoglutarate + a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-ornithyl)-L-glutamate ⟶ a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-glutamate 5-semialdehyde-2-yl)-L-glutamate + glt - arginine biosynthesis IV (archaebacteria):
2-oxoglutarate + a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-ornithyl)-L-glutamate ⟶ a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-glutamate 5-semialdehyde-2-yl)-L-glutamate + glt - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis II:
(S)-dihydroorotate + NAD+ ⟶ H+ + NADH + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + Glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + Glu - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - arginine biosynthesis IV (archaebacteria):
2-oxoglutarate + a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-ornithyl)-L-glutamate ⟶ a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-glutamate 5-semialdehyde-2-yl)-L-glutamate + glt - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis III:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + Glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis III:
(S)-dihydroorotate + NAD+ ⟶ H+ + NADH + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + Glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + Glu - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + Glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + Glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + Glu - L-arginine biosynthesis III (via N-acetyl-L-citrulline):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + Glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - UMP biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis IV (archaebacteria):
2-oxoglutarate + a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-ornithyl)-L-glutamate ⟶ a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-glutamate 5-semialdehyde-2-yl)-L-glutamate + glt - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + Glu - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + Glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + Glu - streptomycin biosynthesis:
D-1-guanidino-3-amino-1,3-dideoxy-scyllo-inositol + pyruvate ⟶ D-1-guanidino-1-deoxy-3-dehydro-scyllo-inositol + ala - streptomycin biosynthesis:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate - ammonia assimilation cycle III:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamate and L-glutamine biosynthesis:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle III:
NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + gln - factor 430 biosynthesis:
H+ + Ni-sirohydrochlorin ⟶ Ni2+ + sirohydrochlorin - glutamine biosynthesis:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutamine degradation/glutamate biosynthesis:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle II:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - superpathway of ammonia assimilation (plants):
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - nitrate reduction VI (assimilatory):
H2O + an oxidized ferredoxin [iron-sulfur] cluster + nitrite ⟶ H+ + a reduced ferredoxin [iron-sulfur] cluster + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction V (assimilatory):
H2O + NADP+ + nitrite ⟶ H+ + NADPH + nitrate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis III:
oxaloacetate + phosphate ⟶ hydrogencarbonate + phosphoenolpyruvate - superpathway of L-citrulline metabolism:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + phosphate - L-citrulline biosynthesis:
an electron-transfer quinone + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + an electron-transfer quinol - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutamine biosynthesis:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutamine degradation I:
H2O + gln ⟶ ammonium + glu - citrulline biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle I:
ATP + Glu + ammonium ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis III:
oxaloacetate + phosphate ⟶ hydrogencarbonate + phosphoenolpyruvate - L-glutamine biosynthesis I:
ATP + Glu + ammonium ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ Glu + ammonium - L-citrulline biosynthesis:
(S)-1-pyrroline-5-carboxylate + H+ + H2O ⟶ L-glutamate-5-semialdehyde - glutamate-glutamine shuttle:
ATP + Glu + ammonium ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle II:
ATP + Glu + ammonium ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle III:
Glu + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + gln - L-glutamine biosynthesis I:
ATP + Glu + ammonium ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ Glu + ammonium - ammonia assimilation cycle III:
NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + gln - glutamine biosynthesis I:
ATP + ammonium + glt ⟶ ADP + H+ + gln + phosphate - glutamine degradation I:
H2O + gln ⟶ ammonium + glt - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glt ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle III:
NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glt - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle III:
NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + gln - glutamine biosynthesis I:
ATP + ammonium + glt ⟶ ADP + H+ + gln + phosphate - glutamine degradation I:
H2O + gln ⟶ ammonium + glt - glutamine degradation I:
H2O + gln ⟶ ammonium + glt - glutamine biosynthesis I:
ATP + ammonium + glt ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle III:
NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + gln - glutamine biosynthesis I:
ATP + ammonium + glt ⟶ ADP + H+ + gln + phosphate - glutamine degradation I:
H2O + gln ⟶ ammonium + glt - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glt - L-glutamine biosynthesis I:
ATP + ammonium + glt ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle III:
NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + gln - L-glutamate and L-glutamine biosynthesis:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - ammonia assimilation cycle III:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle III:
NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + gln - glutamine degradation II:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - ammonia assimilation cycle III:
NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glt ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle III:
NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glt - ammonia assimilation cycle III:
NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glt ⟶ ADP + H+ + gln + phosphate - L-glutamate and L-glutamine biosynthesis:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glt ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis I:
ATP + ammonium + glt ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glt - nitrate reduction VI (assimilatory):
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - glutamine biosynthesis I:
ATP + ammonium + glt ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle III:
NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + gln - glutamine degradation I:
H2O + gln ⟶ ammonium + glt - glutamine degradation I:
H2O + gln ⟶ ammonium + glt - ammonia assimilation cycle III:
NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + gln - glutamine biosynthesis I:
ATP + ammonium + glt ⟶ ADP + H+ + gln + phosphate - glutamine degradation I:
H2O + gln ⟶ ammonium + glt - glutamine degradation I:
H2O + gln ⟶ ammonium + glt - glutamine degradation I:
H2O + gln ⟶ ammonium + glt - L-glutamine degradation I:
H2O + gln ⟶ Glu + ammonium - ammonia assimilation cycle III:
Glu + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + gln - L-glutamine biosynthesis I:
ATP + Glu + ammonium ⟶ ADP + H+ + gln + phosphate - glutamine biosynthesis I:
ATP + ammonium + glt ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle III:
NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + gln - glutamine degradation I:
H2O + gln ⟶ ammonium + glt - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glt ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
an oxidized ferredoxin [iron-sulfur] cluster + glt ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - ammonia assimilation cycle I:
NAD+ + glt ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glt - ammonia assimilation cycle III:
NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glt ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glt - ammonia assimilation cycle III:
NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glt ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ Glu + ammonium - ammonia assimilation cycle III:
Glu + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + gln - L-glutamine biosynthesis I:
ATP + Glu + ammonium ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle III:
Glu + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + gln - L-glutamine biosynthesis I:
ATP + Glu + ammonium ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ Glu + ammonium - L-glutamine degradation I:
H2O + gln ⟶ Glu + ammonium - L-glutamine biosynthesis I:
ATP + Glu + ammonium ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle III:
Glu + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + gln - L-glutamine degradation I:
H2O + gln ⟶ Glu + ammonium - ammonia assimilation cycle III:
Glu + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + gln - L-glutamine biosynthesis I:
ATP + Glu + ammonium ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle III:
NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glt - L-glutamine biosynthesis I:
ATP + ammonium + glt ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glt ⟶ 2-oxoglutarate + H+ + NADH + gln - superpathway of ammonia assimilation (plants):
an oxidized ferredoxin [iron-sulfur] cluster + glt ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glt ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction V (assimilatory):
Glu + H2O + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - ammonia assimilation cycle III:
Glu + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + gln - L-glutamine biosynthesis I:
ATP + Glu + ammonium ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ Glu + ammonium - L-glutamine degradation I:
H2O + gln ⟶ Glu + ammonium - L-glutamine biosynthesis I:
ATP + Glu + ammonium ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle III:
Glu + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + gln - UDP-N-acetyl-D-glucosamine biosynthesis II:
D-glucosamine 6-phosphate + acetyl-CoA ⟶ N-acetyl-D-glucosamine 6-phosphate + H+ + coenzyme A - CMP-legionaminate biosynthesis I:
2,4-diacetamido-2,4,6-trideoxy-α-D-mannopyranose + H2O + phosphoenolpyruvate ⟶ 5,7-diacetamido-3,5,7,9-tetradeoxy-D-glycero-D-galacto-nonulopyranosonate + phosphate - chitin biosynthesis:
UDP-N-acetyl-α-D-glucosamine + chitin ⟶ UDP + chitin - superpathway of mycolyl-arabinogalactan-peptidoglycan complex biosynthesis:
D-glucopyranose 6-phosphate ⟶ F6P - O-antigen building blocks biosynthesis (E. coli):
D-glucopyranose 6-phosphate ⟶ F6P - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucopyranose 6-phosphate ⟶ F6P - UDP-N-acetyl-D-galactosamine biosynthesis III:
D-glucopyranose 6-phosphate ⟶ F6P - superpathway of UDP-N-acetylglucosamine-derived O-antigen building blocks biosynthesis:
D-glucopyranose 6-phosphate ⟶ F6P - O-antigen building blocks biosynthesis (E. coli):
NADP+ + dTDP-β-L-rhamnose ⟶ H+ + NADPH + dTDP-4-dehydro-β-L-rhamnose - UDP-N-acetyl-D-glucosamine biosynthesis I:
α-D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis II:
D-glucosamine 6-phosphate + acetyl-CoA ⟶ N-acetyl-D-glucosamine 6-phosphate + H+ + coenzyme A - UDP-N-acetylglucosamine biosynthesis:
D-glucosamine 6-phosphate + acetyl-CoA ⟶ N-acetyl-D-glucosamine 6-phosphate + H+ + coenzyme A - chitin biosynthesis:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - O-antigen building blocks biosynthesis (E. coli):
NADP+ + dTDP-β-L-rhamnose ⟶ H+ + NADPH + dTDP-4-dehydro-β-L-rhamnose - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucopyranose 6-phosphate ⟶ F6P - superpathway of mycolyl-arabinogalactan-peptidoglycan complex biosynthesis:
D-glucopyranose 6-phosphate ⟶ F6P - O-antigen building blocks biosynthesis (E. coli):
NADP+ + dTDP-β-L-rhamnose ⟶ H+ + NADPH + dTDP-4-dehydro-β-L-rhamnose - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - superpathway of mycolyl-arabinogalactan-peptidoglycan complex biosynthesis:
NADP+ + dTDP-β-L-rhamnose ⟶ H+ + NADPH + dTDP-4-dehydro-β-L-rhamnose - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucopyranose 6-phosphate ⟶ F6P - O-antigen building blocks biosynthesis (E. coli):
D-glucopyranose 6-phosphate ⟶ F6P - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis II:
D-glucosamine 6-phosphate + acetyl-CoA ⟶ N-acetyl-D-glucosamine 6-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - peptidoglycan and lipid A precursor biosynthesis:
ATP + UDP-N-acetyl-α-D-muramate + ala ⟶ ADP + H+ + UDP-N-acetyl-α-D-muramoyl-L-alanine + phosphate - O-antigen building blocks biosynthesis (E. coli):
NADP+ + dTDP-β-L-rhamnose ⟶ H+ + NADPH + dTDP-4-dehydro-β-L-rhamnose - UDP-N-acetyl-D-glucosamine biosynthesis I:
α-D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis II:
D-glucosamine 6-phosphate + acetyl-CoA ⟶ N-acetyl-D-glucosamine 6-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - O-antigen building blocks biosynthesis (E. coli):
NADP+ + dTDP-β-L-rhamnose ⟶ H+ + NADPH + dTDP-4-dehydro-β-L-rhamnose - O-antigen building blocks biosynthesis (E. coli):
NADP+ + dTDP-β-L-rhamnose ⟶ H+ + NADPH + dTDP-4-dehydro-β-L-rhamnose - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - O-antigen building blocks biosynthesis (E. coli):
2-oxoglutarate + dTDP-viosamine ⟶ dTDP-4-dehydro-6-deoxy-α-D-glucopyranose + glt - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - O-antigen building blocks biosynthesis (E. coli):
NADP+ + dTDP-β-L-rhamnose ⟶ H+ + NADPH + dTDP-4-dehydro-β-L-rhamnose - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - O-antigen building blocks biosynthesis (E. coli):
NADP+ + dTDP-β-L-rhamnose ⟶ H+ + NADPH + dTDP-4-dehydro-β-L-rhamnose - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A
WikiPathways(0)
Plant Reactome(1253)
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
L-Ser + indole ⟶ H2O + L-Trp - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
L-Ser + indole ⟶ H2O + L-Trp - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
L-Ser + indole ⟶ H2O + L-Trp - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA - Amino acid metabolism:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA - Amino acid biosynthesis:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Arginine biosynthesis I:
H2O + N-acetyl-L-ornithine ⟶ CH3COO- + L-Orn - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
9-mercaptodethiobiotin ⟶ Btn - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
ATP + PRPP ⟶ PPi + phosphoribosyl-ATP - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
DMAPP + genistein ⟶ PPi + lupiwighteone - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
DMAPP + genistein ⟶ PPi + lupiwighteone - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
L-Phe ⟶ ammonia + trans-cinnamate - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Glutamate synthase cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Secondary metabolism:
GPP + H2O ⟶ PPi + geraniol - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu
INOH(0)
PlantCyc(2277)
- superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
ATP + H2O + XMP + gln ⟶ AMP + GMP + H+ + diphosphate + glu - superpathway of purine nucleotides de novo biosynthesis I:
ATP + H2O + XMP + gln ⟶ AMP + GMP + H+ + diphosphate + glu - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
SAICAR ⟶ AICAR + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
ATP + GMP ⟶ ADP + GDP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
ATP + GMP ⟶ ADP + GDP - superpathway of guanosine nucleotides de novo biosynthesis I:
ATP + GMP ⟶ ADP + GDP - guanosine ribonucleotides de novo biosynthesis:
ATP + GMP ⟶ ADP + GDP - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - superpathway of guanosine nucleotides de novo biosynthesis I:
ATP + H2O + XMP + gln ⟶ AMP + GMP + H+ + diphosphate + glu - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - UMP biosynthesis I:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis I (via L-ornithine):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis II (acetyl cycle):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis III:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis III:
(S)-dihydroorotate + NAD+ ⟶ H+ + NADH + orotate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis II:
(S)-dihydroorotate + fumarate ⟶ orotate + succinate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis II:
(S)-dihydroorotate + fumarate ⟶ orotate + succinate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis I (via L-ornithine):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis II (acetyl cycle):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis III:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis II:
(S)-dihydroorotate + fumarate ⟶ orotate + succinate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis II:
(S)-dihydroorotate + fumarate ⟶ orotate + succinate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis III:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis I (via L-ornithine):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis II (acetyl cycle):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - UMP biosynthesis I:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - UMP biosynthesis I:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis II (acetyl cycle):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
ATP + H2O + UTP + gln ⟶ ADP + CTP + H+ + glu + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + asp ⟶ AMP + H+ + IAA-Asp + diphosphate - superpathway of indole-3-acetate conjugate biosynthesis:
1-O-(indol-3-ylacetyl)-β-D-glucose + myo-inositol ⟶ 1D-1-O-(indol-3-yl)acetyl-myo-inositol + D-glucopyranose - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + val ⟶ AMP + H+ + IAA-Val + diphosphate - superpathway of indole-3-acetate conjugate biosynthesis:
1-O-(indol-3-ylacetyl)-β-D-glucose + myo-inositol ⟶ 1D-1-O-(indol-3-yl)acetyl-myo-inositol + D-glucopyranose - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + phe ⟶ AMP + H+ + IAA-Phe + diphosphate - superpathway of indole-3-acetate conjugate biosynthesis:
1-O-(indol-3-ylacetyl)-β-D-glucose + myo-inositol ⟶ 1D-1-O-(indol-3-yl)acetyl-myo-inositol + D-glucopyranose - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - superpathway of indole-3-acetate conjugate biosynthesis:
(indol-3-yl)acetate + ATP + gln ⟶ AMP + H+ + IAA-Gln + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + gln ⟶ AMP + H+ + IAA-Gln + diphosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-asparagine biosynthesis III (tRNA-dependent):
ammonium ⟶ H+ + phosphate - L-citrulline biosynthesis:
(S)-1-pyrroline-5-carboxylate + H+ + H2O ⟶ L-glutamate-5-semialdehyde - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - superpathway of L-citrulline metabolism:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + phosphate - ammonia assimilation cycle I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-citrulline biosynthesis:
an electron-transfer quinone + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + an electron-transfer quinol - L-asparagine biosynthesis III (tRNA-dependent):
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - Inorganic Nitrogen Assimilation:
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - superpathway of ammonia assimilation (plants):
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - Organic Nitrogen Assimilation:
H2O + O2 + urate ⟶ CO2 + allantoin + hydrogen peroxide - L-glutamine biosynthesis III:
oxaloacetate + phosphate ⟶ hydrogencarbonate + phosphoenolpyruvate - glutamate-glutamine shuttle:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis III:
oxaloacetate + phosphate ⟶ hydrogencarbonate + phosphoenolpyruvate - L-citrulline biosynthesis:
an electron-transfer quinone + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + an electron-transfer quinol - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle II:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis III:
oxaloacetate + phosphate ⟶ hydrogencarbonate + phosphoenolpyruvate - superpathway of ammonia assimilation (plants):
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - superpathway of L-citrulline metabolism:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + phosphate - glutamate-glutamine shuttle:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-citrulline biosynthesis:
H2O + gln ⟶ ammonium + glu - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis III:
ATP + phosphate + pyruvate ⟶ AMP + H+ + diphosphate + phosphoenolpyruvate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - Organic Nitrogen Assimilation:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - Inorganic Nitrogen Assimilation:
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
F6P + gln ⟶ D-glucosamine 6-phosphate + glu
COVID-19 Disease Map(0)
PathBank(0)
PharmGKB(0)
0 个相关的物种来源信息
在这里通过桑基图来展示出与当前的这个代谢物在我们的BioDeep知识库中具有相关联信息的其他代谢物。在这里进行关联的信息来源主要有：
- PubMed: 来源于PubMed文献库中的文献信息，我们通过自然语言数据挖掘得到的在同一篇文献中被同时提及的相关代谢物列表，这个列表按照代谢物同时出现的文献数量降序排序，取前10个代谢物作为相关研究中关联性很高的代谢物集合展示在桑基图中。
- NCBI Taxonomy: 通过文献数据挖掘，得到的代谢物物种来源信息关联。这个关联信息同样按照出现的次数降序排序，取前10个代谢物作为高关联度的代谢物集合展示在桑吉图上。
- Chemical Taxonomy: 在物质分类上处于同一个分类集合中的其他代谢物
- Chemical Reaction: 在化学反应过程中，存在为当前代谢物相关联的生化反应过程中的反应底物或者反应产物的关联代谢物信息。
点击图上的相关代谢物的名称，可以跳转到相关代谢物的信息页面。
文献列表
- Adam Skeens, Chathuranga Siriwardhana, Sophia E Massinople, Michelle M Wunder, Zachary L Ellis, Kaitlyn M Keith, Tyler Girman, Shelli L Frey, Justin Legleiter. The polyglutamine domain is the primary driver of seeding in huntingtin aggregation.
PloS one.
2024; 19(3):e0298323. doi:
10.1371/journal.pone.0298323. [PMID: 38483973] - Ernesto Llamas, Seda Koyuncu, Hyun Ju Lee, Markus Wehrmann, Ricardo Gutierrez-Garcia, Nick Dunken, Nyasha Charura, Salvador Torres-Montilla, Elena Schlimgen, Amrei M Mandel, Erik Boelen Theile, Jan Grossbach, Prerana Wagle, Jan-Wilm Lackmann, Bernhard Schermer, Thomas Benzing, Andreas Beyer, Pablo Pulido, Manuel Rodriguez-Concepcion, Alga Zuccaro, David Vilchez. In planta expression of human polyQ-expanded huntingtin fragment reveals mechanisms to prevent disease-related protein aggregation.
Nature aging.
2023 Oct; ?(?):. doi:
10.1038/s43587-023-00502-1. [PMID: 37783816] - Bin Huang, Qiang Guo, Marie L Niedermeier, Jingdong Cheng, Tatjana Engler, Melanie Maurer, Alexander Pautsch, Wolfgang Baumeister, Florian Stengel, Stefan Kochanek, Rubén Fernández-Busnadiego. Pathological polyQ expansion does not alter the conformation of the Huntingtin-HAP40 complex.
Structure (London, England : 1993).
2021 08; 29(8):804-809.e5. doi:
10.1016/j.str.2021.04.003. [PMID: 33909994] - Arnaud Marquette, Christopher Aisenbrey, Burkhard Bechinger. Membrane Interactions Accelerate the Self-Aggregation of Huntingtin Exon 1 Fragments in a Polyglutamine Length-Dependent Manner.
International journal of molecular sciences.
2021 Jun; 22(13):. doi:
10.3390/ijms22136725. [PMID: 34201610] - Daniela Vilasboas-Campos, Marta Daniela Costa, Andreia Teixeira-Castro, Rejaine Rios, Fabiano Guimarães Silva, Carlos Bessa, Alberto C P Dias, Patrícia Maciel. Neurotherapeutic effect of Hyptis spp. leaf extracts in Caenorhabditis elegans models of tauopathy and polyglutamine disease: Role of the glutathione redox cycle.
Free radical biology & medicine.
2021 01; 162(?):202-215. doi:
10.1016/j.freeradbiomed.2020.10.018. [PMID: 33096249] - Sharon E Groover, Maryssa Beasley, Visvanathan Ramamurthy, Justin Legleiter. Phosphomimetic Mutations Impact Huntingtin Aggregation in the Presence of a Variety of Lipid Systems.
Biochemistry.
2020 12; 59(49):4681-4693. doi:
10.1021/acs.biochem.0c00788. [PMID: 33256402] - Jae-Hoon Jung, Antonio D Barbosa, Stephanie Hutin, Janet R Kumita, Mingjun Gao, Dorothee Derwort, Catarina S Silva, Xuelei Lai, Elodie Pierre, Feng Geng, Sol-Bi Kim, Sujeong Baek, Chloe Zubieta, Katja E Jaeger, Philip A Wigge. A prion-like domain in ELF3 functions as a thermosensor in Arabidopsis.
Nature.
2020 09; 585(7824):256-260. doi:
10.1038/s41586-020-2644-7. [PMID: 32848244] - Lingyun Xiao, Haifeng Li, Jing Tian, Nanxiang Jin, Ju Zhang, Fan Yang, Ling Zhou, Qiangqiang Wang, Zebo Huang. The Traditional Formula Kai-Xin-San Alleviates Polyglutamine-Mediated Neurotoxicity by Modulating Proteostasis Network in Caenorhabditis elegans.
Rejuvenation research.
2020 Jun; 23(3):207-216. doi:
10.1089/rej.2018.2149. [PMID: 31985332] - Sunyuan Zhang, Elizabeth Hinde, Molly Parkyn Schneider, David A Jans, Marie A Bogoyevitch. Nuclear bodies formed by polyQ-ataxin-1 protein are liquid RNA/protein droplets with tunable dynamics.
Scientific reports.
2020 01; 10(1):1557. doi:
10.1038/s41598-020-57994-9. [PMID: 32005838] - Xin-Yan Chen, De-Chun Liao, Meng-Lu Sun, Xiang-Huan Cui, Hong-Bing Wang. Essential Oil of Acorus tatarinowii Schott Ameliorates Aβ-Induced Toxicity in Caenorhabditis elegans through an Autophagy Pathway.
Oxidative medicine and cellular longevity.
2020; 2020(?):3515609. doi:
10.1155/2020/3515609. [PMID: 33425207] - Chengfeng Xiao, Shuang Qiu, Xiao Li, Dan-Ju Luo, Gong-Ping Liu. EDTP/MTMR14: A novel target for improved survivorship to prolonged anoxia and cellular protein aggregates.
Neuroscience letters.
2019 07; 705(?):151-158. doi:
10.1016/j.neulet.2019.04.053. [PMID: 31029679] - Chengfeng Xiao, Shuang Qiu. Downregulation of EDTP in glial cells suppresses polyglutamine protein aggregates and extends lifespan in Drosophila melanogaster.
Neuroscience letters.
2019 02; 694(?):168-175. doi:
10.1016/j.neulet.2018.12.009. [PMID: 30528881] - I-Cheng Chen, Chia-Ning Chang, Wan-Ling Chen, Te-Hsien Lin, Chih-Ying Chao, Chih-Hsin Lin, Hsuan-Yuan Lin, Mei-Ling Cheng, Mu-Chun Chiang, Jung-Yaw Lin, Yih-Ru Wu, Guey-Jen Lee-Chen, Chiung-Mei Chen. Targeting Ubiquitin Proteasome Pathway with Traditional Chinese Medicine for Treatment of Spinocerebellar Ataxia Type 3.
The American journal of Chinese medicine.
2019; 47(1):63-95. doi:
10.1142/s0192415x19500046. [PMID: 30612452] - Alberto Ceccon, G Marius Clore, Vitali Tugarinov. Decorrelating Kinetic and Relaxation Parameters in Exchange Saturation Transfer NMR: A Case Study of N-Terminal Huntingtin Peptides Binding to Unilamellar Lipid Vesicles.
The journal of physical chemistry. B.
2018 12; 122(49):11271-11278. doi:
10.1021/acs.jpcb.8b07112. [PMID: 30156416] - Min Jee Kwon, Myeong Hoon Han, Joshua A Bagley, Do Young Hyeon, Byung Su Ko, Yun Mi Lee, In Jun Cha, Seung Yeol Kim, Dong Young Kim, Ho Min Kim, Daehee Hwang, Sung Bae Lee, Yuh Nung Jan. Coiled-coil structure-dependent interactions between polyQ proteins and Foxo lead to dendrite pathology and behavioral defects.
Proceedings of the National Academy of Sciences of the United States of America.
2018 11; 115(45):E10748-E10757. doi:
10.1073/pnas.1807206115. [PMID: 30348793] - Rajesh Mani, Manish Gupta, Anshu Malik, Ravi Tandon, Rajendra Prasad, Rakesh Bhatnagar, Nirupama Banerjee. Adjuvant Potential of Poly-α-l-Glutamine from the Cell Wall of Mycobacterium tuberculosis.
Infection and immunity.
2018 10; 86(10):. doi:
10.1128/iai.00537-18. [PMID: 30104212] - Anthony C Bryan, Jin Zhang, Jianjun Guo, Priya Ranjan, Vasanth Singan, Kerrie Barry, Jeremy Schmutz, Deborah Weighill, Daniel Jacobson, Sara Jawdy, Gerald A Tuskan, Jin-Gui Chen, Wellington Muchero. A Variable Polyglutamine Repeat Affects Subcellular Localization and Regulatory Activity of a Populus ANGUSTIFOLIA Protein.
G3 (Bethesda, Md.).
2018 07; 8(8):2631-2641. doi:
10.1534/g3.118.200188. [PMID: 29884614] - Alberto Ceccon, Thomas Schmidt, Vitali Tugarinov, Samuel A Kotler, Charles D Schwieters, G Marius Clore. Interaction of Huntingtin Exon-1 Peptides with Lipid-Based Micellar Nanoparticles Probed by Solution NMR and Q-Band Pulsed EPR.
Journal of the American Chemical Society.
2018 05; 140(20):6199-6202. doi:
10.1021/jacs.8b02619. [PMID: 29727175] - Anselm Gruber, Daniel Hornburg, Matthias Antonin, Natalie Krahmer, Javier Collado, Miroslava Schaffer, Greta Zubaite, Christian Lüchtenborg, Timo Sachsenheimer, Britta Brügger, Matthias Mann, Wolfgang Baumeister, F Ulrich Hartl, Mark S Hipp, Rubén Fernández-Busnadiego. Molecular and structural architecture of polyQ aggregates in yeast.
Proceedings of the National Academy of Sciences of the United States of America.
2018 04; 115(15):E3446-E3453. doi:
10.1073/pnas.1717978115. [PMID: 29581260] - Jessica Brunquell, Stephanie Morris, Alana Snyder, Sandy D Westerheide. Coffee extract and caffeine enhance the heat shock response and promote proteostasis in an HSF-1-dependent manner in Caenorhabditis elegans.
Cell stress & chaperones.
2018 01; 23(1):65-75. doi:
10.1007/s12192-017-0824-7. [PMID: 28674941] - Chang Geon Chung, Min Jee Kwon, Keun Hye Jeon, Do Young Hyeon, Myeong Hoon Han, Jeong Hyang Park, In Jun Cha, Jae Ho Cho, Kunhyung Kim, Sangchul Rho, Gyu Ree Kim, Hyobin Jeong, Jae Won Lee, TaeSoo Kim, Keetae Kim, Kwang Pyo Kim, Michael D Ehlers, Daehee Hwang, Sung Bae Lee. Golgi Outpost Synthesis Impaired by Toxic Polyglutamine Proteins Contributes to Dendritic Pathology in Neurons.
Cell reports.
2017 07; 20(2):356-369. doi:
10.1016/j.celrep.2017.06.059. [PMID: 28700938] - Adewale Adegbuyiro, Faezeh Sedighi, Albert W Pilkington, Sharon Groover, Justin Legleiter. Proteins Containing Expanded Polyglutamine Tracts and Neurodegenerative Disease.
Biochemistry.
2017 Mar; 56(9):1199-1217. doi:
10.1021/acs.biochem.6b00936. [PMID: 28170216] - Yanxia Xiang, Ju Zhang, Haifeng Li, Qiangqiang Wang, Lingyun Xiao, Huandi Weng, Xiaobin Zhou, Chung Wah Ma, Fangli Ma, Minghua Hu, Zebo Huang. Epimedium Polysaccharide Alleviates Polyglutamine-Induced Neurotoxicity in Caenorhabditis elegans by Reducing Oxidative Stress.
Rejuvenation research.
2017 Feb; 20(1):32-41. doi:
10.1089/rej.2016.1830. [PMID: 27222166] - Vinod K Nelson, Asif Ali, Naibedya Dutta, Suvranil Ghosh, Manas Jana, Arnab Ganguli, Andrei Komarov, Soumyadip Paul, Vibha Dwivedi, Subhrangsu Chatterjee, Nihar R Jana, Subhash C Lakhotia, Gopal Chakrabarti, Anup K Misra, Subhash C Mandal, Mahadeb Pal. Azadiradione ameliorates polyglutamine expansion disease in Drosophila by potentiating DNA binding activity of heat shock factor 1.
Oncotarget.
2016 Nov; 7(48):78281-78296. doi:
10.18632/oncotarget.12930. [PMID: 27835876] - Maxmore Chaibva, Sudi Jawahery, Albert W Pilkington, James R Arndt, Olivia Sarver, Stephen Valentine, Silvina Matysiak, Justin Legleiter. Acetylation within the First 17 Residues of Huntingtin Exon 1 Alters Aggregation and Lipid Binding.
Biophysical journal.
2016 Jul; 111(2):349-362. doi:
10.1016/j.bpj.2016.06.018. [PMID: 27463137] - Masashi Ueda, Shimo Li, Masanori Itoh, Miao-Xing Wang, Miki Hayakawa, Saiful Islam, Tana, Kiyomi Nakagawa, Huayue Chen, Toshiyuki Nakagawa. Expanded polyglutamine embedded in the endoplasmic reticulum causes membrane distortion and coincides with Bax insertion.
Biochemical and biophysical research communications.
2016 05; 474(2):259-263. doi:
10.1016/j.bbrc.2016.04.034. [PMID: 27079237] - Chian Sing Ho, Nawal K Khadka, Fengyu She, Jianfeng Cai, Jianjun Pan. Polyglutamine aggregates impair lipid membrane integrity and enhance lipid membrane rigidity.
Biochimica et biophysica acta.
2016 Apr; 1858(4):661-70. doi:
10.1016/j.bbamem.2016.01.016. [PMID: 26806158] - Nadine Schwierz, Stefanie Krysiak, Thorsten Hugel, Martin Zacharias. Mechanism of Reversible Peptide-Bilayer Attachment: Combined Simulation and Experimental Single-Molecule Study.
Langmuir : the ACS journal of surfaces and colloids.
2016 Jan; 32(3):810-21. doi:
10.1021/acs.langmuir.5b03435. [PMID: 26717083] - Maximilian O Press, Amy Lanctot, Christine Queitsch. PIF4 and ELF3 Act Independently in Arabidopsis thaliana Thermoresponsive Flowering.
PloS one.
2016; 11(8):e0161791. doi:
10.1371/journal.pone.0161791. [PMID: 27564448] - Protiti Maiti, Priyanka Ghorai, Sumit Ghosh, Mohan Kamthan, Rakesh Kumar Tyagi, Asis Datta. Mapping of functional domains and characterization of the transcription factor Cph1 that mediate morphogenesis in Candida albicans.
Fungal genetics and biology : FG & B.
2015 Oct; 83(?):45-57. doi:
10.1016/j.fgb.2015.08.004. [PMID: 26291891] - Guobao Liu, Yueming Hu, Alan Tunnacliffe, Yizhi Zheng. A plant cell model of polyglutamine aggregation: Identification and characterisation of macromolecular and small-molecule anti-protein aggregation activity in vivo.
Journal of biotechnology.
2015 Aug; 207(?):39-46. doi:
10.1016/j.jbiotec.2015.05.003. [PMID: 26003885] - Jessica Brunquell, Philip Bowers, Sandy D Westerheide. Fluorodeoxyuridine enhances the heat shock response and decreases polyglutamine aggregation in an HSF-1-dependent manner in Caenorhabditis elegans.
Mechanisms of ageing and development.
2014 Nov; 141-142(?):1-4. doi:
10.1016/j.mad.2014.08.002. [PMID: 25168631] - Anu Nagarajan, Sudi Jawahery, Silvina Matysiak. The effects of flanking sequences in the interaction of polyglutamine peptides with a membrane bilayer.
The journal of physical chemistry. B.
2014 Jun; 118(24):6368-79. doi:
10.1021/jp407900c. [PMID: 24354677] - Lingyun Xiao, Haifeng Li, Ju Zhang, Fan Yang, Aizhen Huang, Jingjing Deng, Ming Liang, Fangli Ma, Minghua Hu, Zebo Huang. Salidroside protects Caenorhabditis elegans neurons from polyglutamine-mediated toxicity by reducing oxidative stress.
Molecules (Basel, Switzerland).
2014 Jun; 19(6):7757-69. doi:
10.3390/molecules19067757. [PMID: 24918543] - Kuo-Hsuan Chang, Wan-Ling Chen, Yih-Ru Wu, Te-Hsien Lin, Yi-Ci Wu, Chih-Ying Chao, Jung-Yaw Lin, Li-Ching Lee, Yi-Chun Chen, Guey-Jen Lee-Chen, Chiung-Mei Chen. Aqueous extract of Gardenia jasminoides targeting oxidative stress to reduce polyQ aggregation in cell models of spinocerebellar ataxia 3.
Neuropharmacology.
2014 Jun; 81(?):166-75. doi:
10.1016/j.neuropharm.2014.01.032. [PMID: 24486383] - Chiung-Mei Chen, Yu-Ting Weng, Wan-Ling Chen, Te-Hsien Lin, Chih-Ying Chao, Chih-Hsin Lin, I-Cheng Chen, Li-Ching Lee, Hsuan-Yuan Lin, Yih-Ru Wu, Yi-Chun Chen, Kuo-Hsuan Chang, Hsiang-Yu Tang, Mei-Ling Cheng, Guey-Jen Lee-Chen, Jung-Yaw Lin. Aqueous extract of Glycyrrhiza inflata inhibits aggregation by upregulating PPARGC1A and NFE2L2-ARE pathways in cell models of spinocerebellar ataxia 3.
Free radical biology & medicine.
2014 Jun; 71(?):339-350. doi:
10.1016/j.freeradbiomed.2014.03.023. [PMID: 24675225] - Kathleen A Burke, Kaitlin M Hensal, C Samuel Umbaugh, Maxmore Chaibva, Justin Legleiter. Huntingtin disrupts lipid bilayers in a polyQ-length dependent manner.
Biochimica et biophysica acta.
2013 Aug; 1828(8):1953-61. doi:
10.1016/j.bbamem.2013.04.025. [PMID: 23643759] - Kathleen A Burke, Karlina J Kauffman, C Samuel Umbaugh, Shelli L Frey, Justin Legleiter. The interaction of polyglutamine peptides with lipid membranes is regulated by flanking sequences associated with huntingtin.
The Journal of biological chemistry.
2013 May; 288(21):14993-5005. doi:
10.1074/jbc.m112.446237. [PMID: 23572526] - Kathleen A Burke, Justin Legleiter. Atomic force microscopy assays for evaluating polyglutamine aggregation in solution and on surfaces.
Methods in molecular biology (Clifton, N.J.).
2013; 1017(?):21-40. doi:
10.1007/978-1-62703-438-8_2. [PMID: 23719905] - Soledad Francisca Undurraga, Maximilian Oliver Press, Matthieu Legendre, Nora Bujdoso, Jacob Bale, Hui Wang, Seth J Davis, Kevin J Verstrepen, Christine Queitsch. Background-dependent effects of polyglutamine variation in the Arabidopsis thaliana gene ELF3.
Proceedings of the National Academy of Sciences of the United States of America.
2012 Nov; 109(47):19363-7. doi:
10.1073/pnas.1211021109. [PMID: 23129635] - Young Mi Song, Sun-Ok Song, Yong-Keun Jung, Eun-Seok Kang, Bong Soo Cha, Hyun Chul Lee, Byung-Wan Lee. Dimethyl sulfoxide reduces hepatocellular lipid accumulation through autophagy induction.
Autophagy.
2012 Jul; 8(7):1085-97. doi:
10.4161/auto.20260. [PMID: 22722716] - Mathilde Schindler, Christine Fabre, Jan de Weille, Serge Carreau, Marcel Mersel, Norbert Bakalara. Disruption of nongenomic testosterone signaling in a model of spinal and bulbar muscular atrophy.
Molecular endocrinology (Baltimore, Md.).
2012 Jul; 26(7):1102-16. doi:
10.1210/me.2011-1367. [PMID: 22570336] - Lisa Mapelli, Claudio Canale, Daniela Pesci, Stefania Averaimo, Fabiana Guizzardi, Valentina Fortunati, Laura Falasca, Mauro Piacentini, Alessandra Gliozzi, Annalisa Relini, Michele Mazzanti, Carla Jodice. Toxic effects of expanded ataxin-1 involve mechanical instability of the nuclear membrane.
Biochimica et biophysica acta.
2012 Jun; 1822(6):906-17. doi:
10.1016/j.bbadis.2012.01.016. [PMID: 22330095] - Surendra S Ambegaokar, George R Jackson. Functional genomic screen and network analysis reveal novel modifiers of tauopathy dissociated from tau phosphorylation.
Human molecular genetics.
2011 Dec; 20(24):4947-77. doi:
10.1093/hmg/ddr432. [PMID: 21949350] - Jessie C Jacobsen, Gillian C Gregory, Juliana M Woda, Morgan N Thompson, Kathryn R Coser, Vidya Murthy, Isaac S Kohane, James F Gusella, Ihn Sik Seong, Marcy E MacDonald, Toshi Shioda, Jong-Min Lee. HD CAG-correlated gene expression changes support a simple dominant gain of function.
Human molecular genetics.
2011 Jul; 20(14):2846-60. doi:
10.1093/hmg/ddr195. [PMID: 21536587] - Pierre Haldimann, Maude Muriset, László Vígh, Pierre Goloubinoff. The novel hydroxylamine derivative NG-094 suppresses polyglutamine protein toxicity in Caenorhabditis elegans.
The Journal of biological chemistry.
2011 May; 286(21):18784-94. doi:
10.1074/jbc.m111.234773. [PMID: 21471208] - Yun Liu, Sohini Chakrabortee, Ranhui Li, Yizhi Zheng, Alan Tunnacliffe. Both plant and animal LEA proteins act as kinetic stabilisers of polyglutamine-dependent protein aggregation.
FEBS letters.
2011 Feb; 585(4):630-4. doi:
10.1016/j.febslet.2011.01.020. [PMID: 21251910] - Alessandra Bertoni, Paola Giuliano, Mario Galgani, Deborah Rotoli, Luca Ulianich, Annagrazia Adornetto, Maria Rosaria Santillo, Antonio Porcellini, Vittorio Enrico Avvedimento. Early and late events induced by polyQ-expanded proteins: identification of a common pathogenic property of polYQ-expanded proteins.
The Journal of biological chemistry.
2011 Feb; 286(6):4727-41. doi:
10.1074/jbc.m110.156521. [PMID: 21115499] - Nai-Kuei Huang, Jung-Hsin Lin, Jiun-Tsai Lin, Chia-I Lin, Eric Minwei Liu, Chun-Jung Lin, Wan-Ping Chen, Yuh-Chiang Shen, Hui-Mei Chen, Jhih-Bin Chen, Hsing-Lin Lai, Chieh-Wen Yang, Ming-Chang Chiang, Yu-Shuo Wu, Chen Chang, Jiang-Fan Chen, Jim-Min Fang, Yun-Lian Lin, Yijuang Chern. A new drug design targeting the adenosinergic system for Huntington's disease.
PloS one.
2011; 6(6):e20934. doi:
10.1371/journal.pone.0020934. [PMID: 21713039] - Zhenze Xie, Congyan Wang, Ke Wang, Shunli Wang, Xiaohui Li, Zhao Zhang, Wujun Ma, Yueming Yan. Molecular characterization of the celiac disease epitope domains in α-gliadin genes in Aegilops tauschii and hexaploid wheats (Triticum aestivum L.).
TAG. Theoretical and applied genetics. Theoretische und angewandte Genetik.
2010 Nov; 121(7):1239-51. doi:
10.1007/s00122-010-1384-8. [PMID: 20556595] - Maria Goutou, Christina Sakka, Nikos Stakias, Ioannis Stefanidis, Georgios N Koukoulis. AR CAG repeat length is not associated with serum gonadal steroids and lipid levels in healthy men.
International journal of andrology.
2009 Dec; 32(6):616-22. doi:
10.1111/j.1365-2605.2008.00908.x. [PMID: 18657194] - Kimberly B Kegel, Vitali Schewkunow, Ellen Sapp, Nicholas Masso, Erich E Wanker, Marian DiFiglia, Wolfgang H Goldmann. Polyglutamine expansion in huntingtin increases its insertion into lipid bilayers.
Biochemical and biophysical research communications.
2009 Sep; 387(3):472-5. doi:
10.1016/j.bbrc.2009.07.039. [PMID: 19607813] - Kimberly B Kegel, Ellen Sapp, Jonathan Alexander, Antonio Valencia, Patrick Reeves, Xueyi Li, Nicholas Masso, Lindsay Sobin, Neil Aronin, Marian DiFiglia. Polyglutamine expansion in huntingtin alters its interaction with phospholipids.
Journal of neurochemistry.
2009 Sep; 110(5):1585-97. doi:
10.1111/j.1471-4159.2009.06255.x. [PMID: 19566678] - Chia-Ron Yang, Robert K Yu. Intracerebral transplantation of neural stem cells combined with trehalose ingestion alleviates pathology in a mouse model of Huntington's disease.
Journal of neuroscience research.
2009 Jan; 87(1):26-33. doi:
10.1002/jnr.21817. [PMID: 18683244] - Rie Miyata, Masaharu Hayashi, Naoyuki Tanuma, Kei Shioda, Ryou Fukatsu, Shuki Mizutani. Oxidative stress in neurodegeneration in dentatorubral-pallidoluysian atrophy.
Journal of the neurological sciences.
2008 Jan; 264(1-2):133-9. doi:
10.1016/j.jns.2007.08.025. [PMID: 17949751] - Sunjay Barton, Ron Jacak, Sagar D Khare, Feng Ding, Nikolay V Dokholyan. The length dependence of the polyQ-mediated protein aggregation.
The Journal of biological chemistry.
2007 Aug; 282(35):25487-92. doi:
10.1074/jbc.m701600200. [PMID: 17591778] - Charlotte Lindqvist, Liisa Laakkonen, Victor A Albert. Polyglutamine variation in a flowering time protein correlates with island age in a Hawaiian plant radiation.
BMC evolutionary biology.
2007 Jul; 7(?):105. doi:
10.1186/1471-2148-7-105. [PMID: 17605781] - Fernanda Ricchelli, Paola Fusi, Paolo Tortora, Marco Valtorta, Matteo Riva, Giuseppe Tognon, Katia Chieregato, Silvia Bolognin, Paolo Zatta. Destabilization of non-pathological variants of ataxin-3 by metal ions results in aggregation/fibrillogenesis.
The international journal of biochemistry & cell biology.
2007; 39(5):966-77. doi:
10.1016/j.biocel.2007.01.012. [PMID: 17300980] - Anat Yanai, Kun Huang, Rujun Kang, Roshni R Singaraja, Pamela Arstikaitis, Lu Gan, Paul C Orban, Asher Mullard, Catherine M Cowan, Lynn A Raymond, Renaldo C Drisdel, William N Green, Brinda Ravikumar, David C Rubinsztein, Alaa El-Husseini, Michael R Hayden. Palmitoylation of huntingtin by HIP14 is essential for its trafficking and function.
Nature neuroscience.
2006 Jun; 9(6):824-31. doi:
10.1038/nn1702. [PMID: 16699508] - S Jonathan Singer, Nazneen N Dewji. Evidence that Perutz's double-beta-stranded subunit structure for beta-amyloids also applies to their channel-forming structures in membranes.
Proceedings of the National Academy of Sciences of the United States of America.
2006 Jan; 103(5):1546-50. doi:
10.1073/pnas.0509892103. [PMID: 16432204] - Teun W J M van Herpen, Svetlana V Goryunova, Johanna van der Schoot, Makedonka Mitreva, Elma Salentijn, Oscar Vorst, Martijn F Schenk, Peter A van Veelen, Frits Koning, Loek J M van Soest, Ben Vosman, Dirk Bosch, Rob J Hamer, Luud J W J Gilissen, Marinus J M Smulders. Alpha-gliadin genes from the A, B, and D genomes of wheat contain different sets of celiac disease epitopes.
BMC genomics.
2006 Jan; 7(?):1. doi:
10.1186/1471-2164-7-1. [PMID: 16403227] - Kimberly B Kegel, Ellen Sapp, Jennifer Yoder, Benjamin Cuiffo, Lindsay Sobin, Yun J Kim, Zheng-Hong Qin, Michael R Hayden, Neil Aronin, David L Scott, Gerhard Isenberg, Wolfgang H Goldmann, Marian DiFiglia. Huntingtin associates with acidic phospholipids at the plasma membrane.
The Journal of biological chemistry.
2005 Oct; 280(43):36464-73. doi:
10.1074/jbc.m503672200. [PMID: 16085648] - Anatoli B Meriin, Xiaoqian Zhang, Nicholas B Miliaras, Alex Kazantsev, Yury O Chernoff, J Michael McCaffery, Beverly Wendland, Michael Y Sherman. Aggregation of expanded polyglutamine domain in yeast leads to defects in endocytosis.
Molecular and cellular biology.
2003 Nov; 23(21):7554-65. doi:
10.1128/mcb.23.21.7554-7565.2003. [PMID: 14560003] - Simonetta Sipione, Dorotea Rigamonti, Marta Valenza, Chiara Zuccato, Luciano Conti, Joel Pritchard, Charles Kooperberg, James M Olson, Elena Cattaneo. Early transcriptional profiles in huntingtin-inducible striatal cells by microarray analyses.
Human molecular genetics.
2002 08; 11(17):1953-65. doi:
10.1093/hmg/11.17.1953. [PMID: 12165557] - Hideki Nishitoh, Atsushi Matsuzawa, Kei Tobiume, Kaoru Saegusa, Kohsuke Takeda, Kiyoshi Inoue, Seiji Hori, Akira Kakizuka, Hidenori Ichijo. ASK1 is essential for endoplasmic reticulum stress-induced neuronal cell death triggered by expanded polyglutamine repeats.
Genes & development.
2002 Jun; 16(11):1345-55. doi:
10.1101/gad.992302. [PMID: 12050113] - B L Kagan, Y Hirakura, R Azimov, R Azimova. The channel hypothesis of Huntington's disease.
Brain research bulletin.
2001 Oct; 56(3-4):281-4. doi:
10.1016/s0361-9230(01)00654-2. [PMID: 11719262] - D Desveaux, C Després, A Joyeux, R Subramaniam, N Brisson. PBF-2 is a novel single-stranded DNA binding factor implicated in PR-10a gene activation in potato.
The Plant cell.
2000 Aug; 12(8):1477-89. doi:
10.1105/tpc.12.8.1477. [PMID: 10948264] - H Monoi, S Futaki, S Kugimiya, H Minakata, K Yoshihara. Poly-L-glutamine forms cation channels: relevance to the pathogenesis of the polyglutamine diseases.
Biophysical journal.
2000 Jun; 78(6):2892-9. doi:
10.1016/s0006-3495(00)76830-5. [PMID: 10827970] - Y Hirakura, R Azimov, R Azimova, B L Kagan. Polyglutamine-induced ion channels: a possible mechanism for the neurotoxicity of Huntington and other CAG repeat diseases.
Journal of neuroscience research.
2000 May; 60(4):490-4. doi:
10.1002/(sici)1097-4547(20000515)60:4<490::aid-jnr7>3.0.co;2-9. [PMID: 10797551] - . .
.
. doi:
. [PMID: 19483696]