L-glutamate(1-) (BioDeep_00000897955)
代谢物信息卡片
L-glutamate(1-)
化学式: C5H8NO4- (146.0453308)
中文名称:
谱图信息:
最多检出来源 Viridiplantae(plant) 19%
分子结构信息
SMILES: C(CC(=O)[O-])C(C(=O)[O-])[NH3+]
InChI: InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/p-1/t3-/m0/s1
描述信息
An alpha-amino-acid anion that is the conjugate base of L-glutamic acid, having anionic carboxy groups and a cationic amino group
同义名列表
1 个代谢物同义名
数据库引用编号
分类词条
相关代谢途径
Reactome(70)
- Metabolism
- Biological oxidations
- Aflatoxin activation and detoxification
- Metabolism of vitamins and cofactors
- Sensory Perception
- Metabolism of proteins
- Post-translational protein modification
- Disease
- Phase II - Conjugation of compounds
- Amino acid and derivative metabolism
- Drug ADME
- Asparagine N-linked glycosylation
- Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein
- Synthesis of substrates in N-glycan biosythesis
- Metabolism of lipids
- Diseases of metabolism
- Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism
- Amino acid metabolism
- Transport of small molecules
- SLC-mediated transmembrane transport
- Urea cycle
- Developmental Biology
- Signaling Pathways
- Purine metabolism
- Nucleotide metabolism
- Disorders of transmembrane transporters
- SLC transporter disorders
- Transport of inorganic cations/anions and amino acids/oligopeptides
- Biosynthesis of specialized proresolving mediators (SPMs)
- Fatty acid metabolism
- Amino acid synthesis and interconversion (transamination)
- Serine biosynthesis
- Metabolism of water-soluble vitamins and cofactors
- Azathioprine ADME
- Tryptophan catabolism
- Infectious disease
- Gene expression (Transcription)
- RNA Polymerase II Transcription
- Generic Transcription Pathway
- Transcriptional Regulation by TP53
- Leishmania infection
- Parasitic Infection Pathways
- Arachidonic acid metabolism
- Histidine catabolism
- Carbohydrate metabolism
- Glucose metabolism
- Lysine catabolism
- Phenylalanine and tyrosine catabolism
- Sulfur amino acid metabolism
- Degradation of cysteine and homocysteine
- Neuronal System
- Transmission across Chemical Synapses
- Neurotransmitter release cycle
- Aspartate and asparagine metabolism
- Phenylalanine and tyrosine metabolism
- Signaling by GPCR
- GPCR ligand binding
- GPCR downstream signalling
- G alpha (i) signalling events
- Gluconeogenesis
- Branched-chain amino acid catabolism
- Glutathione conjugation
- Glutathione synthesis and recycling
- APAP ADME
- Metabolic disorders of biological oxidation enzymes
- Nicotinate metabolism
- De novo synthesis of UMP
- Tyrosine catabolism
- Metabolism of folate and pterines
- Glutamate and glutamine metabolism
BioCyc(194)
- superpathway of pyrimidine ribonucleosides salvage
- UTP and CTP dephosphorylation I
- chitin biosynthesis
- O-antigen building blocks biosynthesis (E. coli)
- superpathway of L-phenylalanine biosynthesis
- L-glutamate degradation II
- superpathway of anaerobic energy metabolism (invertebrates)
- superpathway of L-methionine biosynthesis (transsulfuration)
- UDP-N-acetyl-D-glucosamine biosynthesis I
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis I
- superpathway of L-aspartate and L-asparagine biosynthesis
- superpathway of aromatic amino acid biosynthesis
- superpathway of L-tyrosine biosynthesis
- superpathway of chorismate metabolism
- aspartate superpathway
- superpathway of L-tryptophan biosynthesis
- superpathway of anaerobic sucrose degradation
- superpathway of UDP-N-acetylglucosamine-derived O-antigen building blocks biosynthesis
- glucosinolate biosynthesis from tyrosine
- superpathway of tryptophan utilization
- superpathway of cytosolic glycolysis (plants), pyruvate dehydrogenase and TCA cycle
- glycolysis IV (plant cytosol)
- L-lysine biosynthesis II
- L-lysine biosynthesis I
- superpathway of indole-3-acetate conjugate biosynthesis
- glucosinolate biosynthesis from hexahomomethionine
- superpathway of sterol biosynthesis
- nicotine degradation I (pyridine pathway)
- superpathway of arginine and polyamine biosynthesis
- superpathway of L-citrulline metabolism
- L-citrulline biosynthesis
- L-Nδ-acetylornithine biosynthesis
- L-arginine degradation VI (arginase 2 pathway)
- superpathway of L-arginine, putrescine, and 4-aminobutanoate degradation
- L-arginine degradation I (arginase pathway)
- L-arginine degradation XI
- superpathway of L-arginine and L-ornithine degradation
- superpathway of citrulline metabolism
- arginine degradation VI (arginase 2 pathway)
- citrulline biosynthesis
- L-Nδ-acetylornithine biosynthesis
- superpathway of arginine and ornithine degradation
- arginine degradation I (arginase pathway)
- superpathway of arginine, putrescine, and 4-aminobutyrate degradation
- arginine degradation VII
- superpathway of trimethylamine degradation
- ectoine biosynthesis
- methylamine degradation II
- glucosinolate biosynthesis from dihomomethionine
- purine nucleotide metabolism (phosphotransfer and nucleotide modification)
- purine nucleotides de novo biosynthesis I
- superpathway of histidine, purine, and pyrimidine biosynthesis
- purine nucleotides de novo biosynthesis II
- superpathway of quinolone and alkylquinolone biosynthesis
- superpathay of heme b biosynthesis from glutamate
- L-valine degradation I
- tetrapyrrole biosynthesis I (from glutamate)
- superpathway of proto- and siroheme biosynthesis
- 6-methylpretetramide biosynthesis
- superpathway of tetracycline and oxytetracycline biosynthesis
- CMP-pseudaminate biosynthesis
- phenazine-1-carboxylate biosynthesis
- CMP-legionaminate biosynthesis I
- serine biosynthesis
- IAA biosynthesis I
- NAD biosynthesis II (from tryptophan)
- alanine biosynthesis II
- tRNA charging pathway
- peptidoglycan and lipid A precursor biosynthesis
- superpathway of alanine biosynthesis
- UDP-N-acetylmuramoyl-pentapeptide biosynthesis III (meso-DAP-containing)
- alanine biosynthesis I
- superpathway of L-lysine degradation
- superpathway of guanosine nucleotides de novo biosynthesis I
- tetrahydrofolate biosynthesis
- superpathway of tetrahydrofolate biosynthesis
- superpathway of tetrahydrofolate biosynthesis and salvage
- guanosine ribonucleotides de novo biosynthesis
- L-phenylalanine degradation IV (mammalian, via side chain)
- pyridine nucleotide cycling
- gluconeogenesis I
- L-arginine biosynthesis II (acetyl cycle)
- UMP biosynthesis
- L-tyrosine biosynthesis I
- L-phenylalanine biosynthesis I
- validamycin biosynthesis
- glucosinolate biosynthesis from pentahomomethionine
- glutamate and glutamine biosynthesis
- glutamate biosynthesis II
- glutamine biosynthesis II
- glutamate degradation
- proline biosynthesis II (from arginine)
- histidine degradation III
- arginine biosynthesis IV
- superpathway of L-asparagine biosynthesis
- L-glutamate degradation X
- glutamate degradation V (via hydroxyglutarate)
- glutamate degradation I
- glutamate degradation VII (to butanoate)
- 4-aminobutyrate degradation V
- glutamate degradation VI (to pyruvate)
- tetrapyrrole biosynthesis I
- alanine degradation II (to D-lactate)
- superpathway of glutamate biosynthesis
- phenylalanine degradation IV (mammalian, via side chain)
- heme biosynthesis I
- ornithine degradation II (Stickland reaction)
- TCA cycle VI (obligate autotrophs)
- glutamine biosynthesis III
- glutamate degradation IX
- glutamate degradation II
- superpathway of threonine metabolism
- glutathione-mediated detoxification
- superpathway of aspartate and asparagine biosynthesis; interconversion of aspartate and asparagine
- superpathway of lysine, threonine and methionine biosynthesis II
- isoleucine biosynthesis I
- superpathway of lysine, threonine and methionine biosynthesis I
- formylTHF biosynthesis II
- formylTHF biosynthesis I
- isoleucine biosynthesis I (from threonine)
- Methanobacterium thermoautotrophicum biosynthetic metabolism
- L-lysine degradation IV
- L-lysine degradation III
- hopanoid biosynthesis (bacteria)
- lysine degradation I (saccharopine pathway)
- superpathway of 5-aminoimidazole ribonucleotide biosynthesis
- 5-aminoimidazole ribonucleotide biosynthesis II
- UDP-N-acetylmuramoyl-pentapeptide biosynthesis II (lysine-containing)
- UDP-N-acetylmuramoyl-pentapeptide biosynthesis I (meso-diaminopimelate containing)
- ammonia assimilation cycle III
- L-glutamine biosynthesis I
- rosmarinic acid biosynthesis II
- methylaspartate cycle
- L-glutamine degradation I
- L-glutamine degradation II
- TCA cycle V (2-oxoglutarate:ferredoxin oxidoreductase)
- superpathway of rosmarinic acid biosynthesis
- L-lysine degradation V
- L-lysine degradation XI (mammalian)
- L-tyrosine degradation II
- L-glutamate and L-glutamine biosynthesis
- superpathway of purine nucleotides de novo biosynthesis I
- anaerobic energy metabolism (invertebrates, cytosol)
- norspermidine biosynthesis
- peptidoglycan biosynthesis I (meso-diaminopimelate containing)
- peptidoglycan biosynthesis II (staphylococci)
- superpathway of polyamine biosynthesis III
- L-leucine degradation I
- factor 420 polyglutamylation
- superpathway of GDP-mannose-derived O-antigen building blocks biosynthesis
- L-histidine degradation I
- L-valine biosynthesis
- L-histidine biosynthesis
- UDP-N-acetyl-D-glucosamine biosynthesis II
- L-arginine biosynthesis I (via L-ornithine)
- L-ornithine biosynthesis I
- UTP and CTP dephosphorylation II
- superpathway of L-threonine metabolism
- trans-4-hydroxy-L-proline degradation I
- (S)-reticuline biosynthesis I
- superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis
- C4 photosynthetic carbon assimilation cycle, NAD-ME type
- superpathway of L-methionine salvage and degradation
- L-isoleucine biosynthesis IV
- L-isoleucine biosynthesis II
- glutathione degradation (DUG pathway - yeast)
- superpathway of glutathione metabolism (truncated γ-glutamyl cycle)
- glutathione degradation (DUG pathway)
- arginine biosynthesis I
- tetrahydrofolate biosynthesis I
- folate polyglutamylation I
- superpathway of pyrimidine nucleobases salvage
- histidine degradation I
- superpathway of mycolyl-arabinogalactan-peptidoglycan complex biosynthesis
- proline biosynthesis II
- L-valine degradation II
- valine degradation II
- nylon-6 oligomer degradation
- L-glutamate degradation VII (to butanoate)
- L-glutamate degradation VI (to pyruvate)
- superpathway of erythromycin biosynthesis
- superpathway of megalomicin A biosynthesis
- superpathway of L-threonine biosynthesis
- superpathway of L-isoleucine biosynthesis I
- tRNA charging
- dTDP-L-daunosamine biosynthesis
- isoleucine degradation I
- glucosinolate biosynthesis from tetrahomomethionine
- superpathway of 4-aminobutyrate degradation
- 4-aminobutyrate degradation II
- threonine biosynthesis
- lysine biosynthesis VI
- lysine biosynthesis I
- ornithine biosynthesis
PlantCyc(33)
- UTP and CTP dephosphorylation I
- superpathway of pyrimidine ribonucleosides salvage
- superpathway of anaerobic sucrose degradation
- glucosinolate biosynthesis from tyrosine
- glycolysis IV (plant cytosol)
- superpathway of cytosolic glycolysis (plants), pyruvate dehydrogenase and TCA cycle
- superpathway of indole-3-acetate conjugate biosynthesis
- superpathway of L-citrulline metabolism
- L-arginine degradation VI (arginase 2 pathway)
- L-citrulline biosynthesis
- L-arginine degradation I (arginase pathway)
- L-Nδ-acetylornithine biosynthesis
- Organic Nitrogen Assimilation
- superpathway of purine nucleotides de novo biosynthesis I
- guanosine ribonucleotides de novo biosynthesis
- superpathway of proto- and siroheme biosynthesis
- superpathway of Allium flavor precursors
- alliin metabolism
- glucosinolate biosynthesis from pentahomomethionine
- UMP biosynthesis I
- superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis
- superpathway of pyrimidine ribonucleotides de novo biosynthesis
- L-lysine degradation I
- L-proline degradation
- L-glutamate biosynthesis I
- Inorganic Nitrogen Assimilation
- C4 photosynthetic carbon assimilation cycle, NAD-ME type
- L-histidine biosynthesis
- (S)-reticuline biosynthesis I
- rosmarinic acid biosynthesis II
- superpathway of rosmarinic acid biosynthesis
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II
- glucosinolate biosynthesis from tetrahomomethionine
代谢反应
8296 个相关的代谢反应过程信息。
Reactome(948)
- Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Nucleotide metabolism:
H2O + XTP ⟶ PPi + XMP - Nucleobase biosynthesis:
ATP + H2O + L-Gln + XMP ⟶ AMP + GMP + L-Glu + PPi - Purine ribonucleoside monophosphate biosynthesis:
ATP + H2O + L-Gln + XMP ⟶ AMP + GMP + L-Glu + PPi - Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Nucleotide metabolism:
H2O + XTP ⟶ PPi + XMP - Nucleobase biosynthesis:
ATP + H2O + L-Gln + XMP ⟶ AMP + GMP + L-Glu + PPi - Purine ribonucleoside monophosphate biosynthesis:
ATP + H2O + L-Gln + XMP ⟶ AMP + GMP + L-Glu + PPi - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Nucleotide metabolism:
H2O + XTP ⟶ PPi + XMP - Nucleobase biosynthesis:
ATP + H2O + L-Gln + XMP ⟶ AMP + GMP + L-Glu + PPi - Purine ribonucleoside monophosphate biosynthesis:
ATP + H2O + L-Gln + XMP ⟶ AMP + GMP + L-Glu + PPi - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid synthesis and interconversion (transamination):
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid synthesis and interconversion (transamination):
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid synthesis and interconversion (transamination):
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Amino acid synthesis and interconversion (transamination):
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid synthesis and interconversion (transamination):
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid synthesis and interconversion (transamination):
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Amino acid synthesis and interconversion (transamination):
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Metabolism of lipids:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN - Fatty acid metabolism:
Ac-CoA + H2O ⟶ CH3COO- + CoA-SH - Arachidonic acid metabolism:
H2O + leukotriene A4 ⟶ leukotriene B4 - Synthesis of Leukotrienes (LT) and Eoxins (EX):
H2O + leukotriene A4 ⟶ leukotriene B4 - Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of lipids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Arachidonic acid metabolism:
H+ + e- + prostaglandin G2 ⟶ H2O + prostaglandin H2 - Synthesis of Leukotrienes (LT) and Eoxins (EX):
H2O + leukotriene C4 ⟶ L-Glu + leukotriene D4 - Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Arachidonic acid metabolism:
12S-HpETE + GSH ⟶ 12S-HETE + GSSG + H2O - Synthesis of Leukotrienes (LT) and Eoxins (EX):
H2O + leukotriene A4 ⟶ leukotriene B4 - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Arachidonic acid metabolism:
H+ + e- + prostaglandin G2 ⟶ H2O + prostaglandin H2 - Synthesis of Leukotrienes (LT) and Eoxins (EX):
H2O + leukotriene A4 ⟶ leukotriene B4 - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of lipids:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Arachidonic acid metabolism:
prostaglandin H2 ⟶ prostaglandin E2 - Synthesis of Leukotrienes (LT) and Eoxins (EX):
H2O + leukotriene A4 ⟶ leukotriene B4 - Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Arachidonic acid metabolism:
prostaglandin H2 ⟶ prostaglandin E2 - Synthesis of Leukotrienes (LT) and Eoxins (EX):
H2O + leukotriene A4 ⟶ leukotriene B4 - Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Arachidonic acid metabolism:
H+ + e- + prostaglandin G2 ⟶ H2O + prostaglandin H2 - Synthesis of Leukotrienes (LT) and Eoxins (EX):
H2O + leukotriene A4 ⟶ leukotriene B4 - Disease:
ADORA2B + Ade-Rib ⟶ ADORA2B:Ade-Rib - Infectious disease:
ADORA2B + Ade-Rib ⟶ ADORA2B:Ade-Rib - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Arachidonic acid metabolism:
H+ + e- + prostaglandin G2 ⟶ H2O + prostaglandin H2 - Synthesis of Leukotrienes (LT) and Eoxins (EX):
H2O + leukotriene A4 ⟶ leukotriene B4 - Metabolism of lipids:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN - Fatty acid metabolism:
Ac-CoA + H2O ⟶ CH3COO- + CoA-SH - Arachidonic acid metabolism:
H2O + leukotriene A4 ⟶ leukotriene B4 - Synthesis of Leukotrienes (LT) and Eoxins (EX):
H2O + leukotriene A4 ⟶ leukotriene B4 - Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Arachidonic acid metabolism:
H+ + e- + prostaglandin G2 ⟶ H2O + prostaglandin H2 - Synthesis of Leukotrienes (LT) and Eoxins (EX):
H2O + leukotriene A4 ⟶ leukotriene B4 - Metabolism:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine - Metabolism of lipids:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine - Fatty acid metabolism:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine - Arachidonic acid metabolism:
H2O + leukotriene A4 ⟶ leukotriene B4 - Synthesis of Leukotrienes (LT) and Eoxins (EX):
H2O + leukotriene A4 ⟶ leukotriene B4 - Metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Metabolism of lipids:
ACA + H+ + NADH ⟶ NAD + bHBA - Fatty acid metabolism:
ATP + CIT + CoA-SH ⟶ ADP + Ac-CoA + OA + Pi - Arachidonic acid metabolism:
H2O + leukotriene A4 ⟶ leukotriene B4 - Synthesis of Leukotrienes (LT) and Eoxins (EX):
H2O + leukotriene A4 ⟶ leukotriene B4 - Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Metabolism of lipids:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Fatty acid metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Arachidonic acid metabolism:
H+ + e- + prostaglandin G2 ⟶ H2O + prostaglandin H2 - Synthesis of Leukotrienes (LT) and Eoxins (EX):
H2O + leukotriene A4 ⟶ leukotriene B4 - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Arachidonic acid metabolism:
H+ + e- + prostaglandin G2 ⟶ H2O + prostaglandin H2 - Synthesis of Leukotrienes (LT) and Eoxins (EX):
GSH + leukotriene A4 ⟶ leukotriene C4 - Disease:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Infectious disease:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Leishmania infection:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Leishmania parasite growth and survival:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Anti-inflammatory response favouring Leishmania parasite infection:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - LTC4-CYSLTR mediated IL4 production:
H2O + leukotriene C4 ⟶ L-Glu + leukotriene D4 - Disease:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Infectious disease:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Leishmania infection:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Leishmania parasite growth and survival:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Anti-inflammatory response favouring Leishmania parasite infection:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - LTC4-CYSLTR mediated IL4 production:
H2O + leukotriene C4 ⟶ L-Glu + leukotriene D4 - Disease:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Infectious disease:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Leishmania infection:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Leishmania parasite growth and survival:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Anti-inflammatory response favouring Leishmania parasite infection:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - LTC4-CYSLTR mediated IL4 production:
H2O + leukotriene C4 ⟶ L-Glu + leukotriene D4 - Disease:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Infectious disease:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Leishmania infection:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Leishmania parasite growth and survival:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Anti-inflammatory response favouring Leishmania parasite infection:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - LTC4-CYSLTR mediated IL4 production:
H2O + leukotriene C4 ⟶ L-Glu + leukotriene D4 - Disease:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Infectious disease:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Leishmania infection:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Leishmania parasite growth and survival:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Anti-inflammatory response favouring Leishmania parasite infection:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - LTC4-CYSLTR mediated IL4 production:
H2O + leukotriene C4 ⟶ L-Glu + leukotriene D4 - Disease:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Infectious disease:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Leishmania infection:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Leishmania parasite growth and survival:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Anti-inflammatory response favouring Leishmania parasite infection:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - LTC4-CYSLTR mediated IL4 production:
H2O + leukotriene C4 ⟶ L-Glu + leukotriene D4 - Disease:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Infectious disease:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Leishmania infection:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Leishmania parasite growth and survival:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Anti-inflammatory response favouring Leishmania parasite infection:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - LTC4-CYSLTR mediated IL4 production:
H2O + leukotriene C4 ⟶ L-Glu + leukotriene D4 - Disease:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Infectious disease:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Leishmania infection:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Leishmania parasite growth and survival:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Anti-inflammatory response favouring Leishmania parasite infection:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - LTC4-CYSLTR mediated IL4 production:
H2O + leukotriene C4 ⟶ L-Glu + leukotriene D4 - Disease:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Infectious disease:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Leishmania infection:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Leishmania parasite growth and survival:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Anti-inflammatory response favouring Leishmania parasite infection:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - LTC4-CYSLTR mediated IL4 production:
H2O + leukotriene C4 ⟶ L-Glu + leukotriene D4 - Disease:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Infectious disease:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Leishmania infection:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Leishmania parasite growth and survival:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Anti-inflammatory response favouring Leishmania parasite infection:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - LTC4-CYSLTR mediated IL4 production:
H2O + leukotriene C4 ⟶ L-Glu + leukotriene D4 - Disease:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Infectious disease:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Leishmania infection:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Leishmania parasite growth and survival:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Anti-inflammatory response favouring Leishmania parasite infection:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - LTC4-CYSLTR mediated IL4 production:
H2O + leukotriene C4 ⟶ L-Glu + leukotriene D4 - Disease:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Infectious disease:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Leishmania infection:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Leishmania parasite growth and survival:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Anti-inflammatory response favouring Leishmania parasite infection:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - LTC4-CYSLTR mediated IL4 production:
H2O + leukotriene C4 ⟶ L-Glu + leukotriene D4 - Leishmania infection:
ADORA2B + Ade-Rib ⟶ ADORA2B:Ade-Rib - Leishmania parasite growth and survival:
ADORA2B + Ade-Rib ⟶ ADORA2B:Ade-Rib - Anti-inflammatory response favouring Leishmania parasite infection:
ADORA2B + Ade-Rib ⟶ ADORA2B:Ade-Rib - LTC4-CYSLTR mediated IL4 production:
CYSLTR1,CYSLTR2 + leukotriene C4 ⟶ LTC4:CyslTR1,2 - Parasitic Infection Pathways:
Adenylate cyclase (Mg2+ cofactor) + Gs:GTP ⟶ Gs-activated adenylate cyclase - Signaling Pathways:
ADORA2A,B + Ade-Rib ⟶ ADORA2A,B:Ade-Rib - Signaling by GPCR:
ADORA2A,B + Ade-Rib ⟶ ADORA2A,B:Ade-Rib - GPCR downstream signalling:
H2O + cAMP ⟶ AMP - G alpha (q) signalling events:
GTP + Ligand:GPCR complexes that activate Gq/11:Heterotrimeric G-protein Gq (inactive) ⟶ GDP + Ligand:GPCR complexes that activate Gq/11:Heterotrimeric G-protein Gq (active) - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by GPCR:
Ade-Rib ⟶ ADORA2A,B:Ade-Rib - GPCR downstream signalling:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - G alpha (q) signalling events:
Heterotrimeric G-protein Gq/11 (inactive) + Ligand:GPCR complexes that activate Gq/11 ⟶ Ligand:GPCR complexes that activate Gq/11:Heterotrimeric G-protein Gq (inactive) - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by GPCR:
ADORA1,3 + Ade-Rib ⟶ ADORA1,3:Ade-Rib - GPCR downstream signalling:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - G alpha (q) signalling events:
Heterotrimeric G-protein Gq/11 (inactive) + Ligand:GPCR complexes that activate Gq/11 ⟶ Ligand:GPCR complexes that activate Gq/11:Heterotrimeric G-protein Gq (inactive) - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by GPCR:
Ade-Rib ⟶ ADORA1,3:Ade-Rib - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by GPCR:
ADORA1,3 + Ade-Rib ⟶ ADORA1,3:Ade-Rib - GPCR downstream signalling:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - G alpha (q) signalling events:
GTP + Ligand:GPCR complexes that activate Gq/11:Heterotrimeric G-protein Gq (inactive) ⟶ GDP + Ligand:GPCR complexes that activate Gq/11:Heterotrimeric G-protein Gq (active) - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by GPCR:
ADORA1,3 + Ade-Rib ⟶ ADORA1,3:Ade-Rib - GPCR downstream signalling:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - G alpha (q) signalling events:
Heterotrimeric G-protein Gq/11 (inactive) + Ligand:GPCR complexes that activate Gq/11 ⟶ Ligand:GPCR complexes that activate Gq/11:Heterotrimeric G-protein Gq (inactive) - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by GPCR:
ADORA2A,B + Ade-Rib ⟶ ADORA2A,B:Ade-Rib - GPCR downstream signalling:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - G alpha (q) signalling events:
Heterotrimeric G-protein Gq/11 (inactive) + Ligand:GPCR complexes that activate Gq/11 ⟶ Ligand:GPCR complexes that activate Gq/11:Heterotrimeric G-protein Gq (inactive) - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by GPCR:
ADORA1,3 + Ade-Rib ⟶ ADORA1,3:Ade-Rib - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by GPCR:
ADORA1,3 + Ade-Rib ⟶ ADORA1,3:Ade-Rib - GPCR downstream signalling:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - G alpha (q) signalling events:
Heterotrimeric G-protein Gq/11 (inactive) + Ligand:GPCR complexes that activate Gq/11 ⟶ Ligand:GPCR complexes that activate Gq/11:Heterotrimeric G-protein Gq (inactive) - Pyrimidine biosynthesis:
CAP + L-Asp ⟶ N-carbamoyl-L-aspartate + Pi - De novo synthesis of UMP:
CAP + L-Asp ⟶ N-carbamoyl-L-aspartate + Pi - Pyrimidine biosynthesis:
CAP + L-Asp ⟶ N-carbamoyl-L-aspartate + Pi - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH - Metabolism of vitamins and cofactors:
6x(PCCA:PCCB) + ATP + Btn ⟶ 6x(Btn-PCCA:PCCB) + AMP + PPi - Metabolism of water-soluble vitamins and cofactors:
6x(PCCA:PCCB) + ATP + Btn ⟶ 6x(Btn-PCCA:PCCB) + AMP + PPi - Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH - Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
H+ + PRPP + QUIN ⟶ NAMN + PPi + carbon dioxide - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
(ADP-D-ribosyl)(n)-acceptor + NAD ⟶ (ADP-D-ribosyl)(n+1)-acceptor + NAM - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
H+ + Oxygen + dh-beta-NAD ⟶ H2O2 + NAD - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of vitamins and cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - Metabolism of water-soluble vitamins and cofactors:
L-Cys + MOCS3:Zn2+ (red.) ⟶ L-Ala + MOCS3-S-S(1-):Zn2+ - Nicotinate metabolism:
ATP + NAD ⟶ ADP + H+ + TPN - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH - Metabolism of vitamins and cofactors:
4x(PC:Mn2+) + ATP + Btn ⟶ 4x(Btn-PC:Mn2+) + AMP + PPi - Metabolism of water-soluble vitamins and cofactors:
4x(PC:Mn2+) + ATP + Btn ⟶ 4x(Btn-PC:Mn2+) + AMP + PPi - Nicotinate metabolism:
H+ + PRPP + QUIN ⟶ NAMN + PPi + carbon dioxide - Metabolism of vitamins and cofactors:
4x(PC:Mn2+) + ATP + Btn ⟶ 4x(Btn-PC:Mn2+) + AMP + PPi - Metabolism of water-soluble vitamins and cofactors:
4x(PC:Mn2+) + ATP + Btn ⟶ 4x(Btn-PC:Mn2+) + AMP + PPi - Nicotinate metabolism:
ATP + NR ⟶ ADP + H+ + NMN - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Amino acid and derivative metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Amino acid and derivative metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
ATP + L-His + b-Ala ⟶ ADP + CARN + Pi - Tryptophan catabolism:
L-KYN + PYR ⟶ AP-DOBu + L-Ala - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - G alpha (i) signalling events:
ATP ⟶ PPi + cAMP - G alpha (i) signalling events:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - G alpha (i) signalling events:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - G alpha (i) signalling events:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - G alpha (i) signalling events:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - Signaling Pathways:
AMP + p-AMPK heterotrimer ⟶ p-AMPK heterotrimer:AMP - Signaling by GPCR:
H2O + cAMP ⟶ AMP - GPCR downstream signalling:
H2O + cAMP ⟶ AMP - G alpha (q) signalling events:
Heterotrimeric G-protein Gq/11 (inactive) + Ligand:GPCR complexes that activate Gq/11 ⟶ Ligand:GPCR complexes that activate Gq/11:Heterotrimeric G-protein Gq (inactive) - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by GPCR:
ADORA1,3 + Ade-Rib ⟶ ADORA1,3:Ade-Rib - GPCR downstream signalling:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - G alpha (q) signalling events:
GTP + Ligand:GPCR complexes that activate Gq/11:Heterotrimeric G-protein Gq (inactive) ⟶ GDP + Ligand:GPCR complexes that activate Gq/11:Heterotrimeric G-protein Gq (active) - G alpha (i) signalling events:
H2O + cAMP ⟶ AMP - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Histidine catabolism:
ATP + L-His + b-Ala ⟶ ADP + CARN + Pi - Histidine catabolism:
ATP + L-His + b-Ala ⟶ ADP + CARN + Pi - Histidine catabolism:
CARN + SAM ⟶ Anserine + SAH - Histidine catabolism:
ATP + L-His + b-Ala ⟶ ADP + CARN + Pi - Histidine catabolism:
ATP + L-His + b-Ala ⟶ ADP + CARN + Pi - Histidine catabolism:
ATP + L-His + b-Ala ⟶ ADP + CARN + Pi - Histidine catabolism:
ATP + L-His + b-Ala ⟶ ADP + CARN + Pi - Histidine catabolism:
ATP + L-His + b-Ala ⟶ ADP + CARN + Pi - Histidine catabolism:
CARN + SAM ⟶ Anserine + SAH - Histidine catabolism:
ATP + L-His + b-Ala ⟶ ADP + CARN + Pi - Biological oxidations:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN - Phase II - Conjugation of compounds:
H2O + SAH ⟶ Ade-Rib + HCYS - Glutathione conjugation:
GSH + H2O ⟶ CysGly + L-Glu - Glutathione synthesis and recycling:
GSH + H2O ⟶ CysGly + L-Glu - Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP - Glutathione conjugation:
GSH + H2O ⟶ CysGly + L-Glu - Glutathione synthesis and recycling:
GSH + H2O ⟶ CysGly + L-Glu - Biological oxidations:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN - Phase II - Conjugation of compounds:
H2O + SAH ⟶ Ade-Rib + HCYS - Glutathione conjugation:
GSH + H2O ⟶ CysGly + L-Glu - Glutathione synthesis and recycling:
GSH + H2O ⟶ CysGly + L-Glu - Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP - Glutathione conjugation:
GSH + H2O ⟶ CysGly + L-Glu - Glutathione synthesis and recycling:
GSH + H2O ⟶ CysGly + L-Glu - Biological oxidations:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Phase II - Conjugation of compounds:
H2O + SAH ⟶ Ade-Rib + HCYS - Glutathione conjugation:
GSH + H2O ⟶ CysGly + L-Glu - Glutathione synthesis and recycling:
GSH + H2O ⟶ CysGly + L-Glu - Biological oxidations:
H+ + Oxygen + TPNH + progesterone ⟶ 11DCORST + H2O + TPN - Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP - Glutathione conjugation:
GSH + H2O ⟶ CysGly + L-Glu - Glutathione synthesis and recycling:
GSH + H2O ⟶ CysGly + L-Glu - Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP - Glutathione conjugation:
GSH + H2O ⟶ CysGly + L-Glu - Glutathione synthesis and recycling:
GSH + H2O ⟶ CysGly + L-Glu - Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP - Glutathione conjugation:
GSH + H2O ⟶ CysGly + L-Glu - Glutathione synthesis and recycling:
GSH + H2O ⟶ CysGly + L-Glu - Biological oxidations:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN - Phase II - Conjugation of compounds:
H2O + SAH ⟶ Ade-Rib + HCYS - Glutathione conjugation:
GSH + H2O ⟶ CysGly + L-Glu - Glutathione synthesis and recycling:
GSH + H2O ⟶ CysGly + L-Glu - Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP - Glutathione conjugation:
GSH + H2O ⟶ CysGly + L-Glu - Glutathione synthesis and recycling:
GSH + H2O ⟶ CysGly + L-Glu - Biological oxidations:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Phase II - Conjugation of compounds:
H2O + SAH ⟶ Ade-Rib + HCYS - Glutathione conjugation:
GSH + H2O ⟶ CysGly + L-Glu - Glutathione synthesis and recycling:
GSH + H2O ⟶ CysGly + L-Glu - Biological oxidations:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Phase II - Conjugation of compounds:
H2O + SAH ⟶ Ade-Rib + HCYS - Glutathione conjugation:
GSH + H2O ⟶ CysGly + L-Glu - Glutathione synthesis and recycling:
GSH + H2O ⟶ CysGly + L-Glu - Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Phase II - Conjugation of compounds:
PAPS + beta-estradiol ⟶ E2-SO4 + PAP - Glutathione conjugation:
CysGly + H2O ⟶ Gly + L-Cys - Glutathione synthesis and recycling:
CysGly + H2O ⟶ Gly + L-Cys - Biological oxidations:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN - Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP - Glutathione conjugation:
GSH + H2O ⟶ CysGly + L-Glu - Glutathione synthesis and recycling:
GSH + H2O ⟶ CysGly + L-Glu - Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Glucose metabolism:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Gluconeogenesis:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Glucose metabolism:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Gluconeogenesis:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Amino acid synthesis and interconversion (transamination):
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Glucose metabolism:
ADP + Glc ⟶ AMP + G6P - Gluconeogenesis:
D-Fructose 1,6-bisphosphate + H2O ⟶ Fru(6)P + Pi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide biosynthesis:
ATP + CAIR + L-Asp ⟶ ADP + H+ + Pi + SAICAR - Pyrimidine biosynthesis:
CAP + L-Asp ⟶ H+ + N-carb-L-Asp + Pi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide biosynthesis:
ATP + CAIR + L-Asp ⟶ ADP + H+ + Pi + SAICAR - Pyrimidine biosynthesis:
H+ + OMP ⟶ UMP + carbon dioxide - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide biosynthesis:
GTP + IMP + L-Asp ⟶ ADS + GDP + H+ + Pi - Pyrimidine biosynthesis:
CAP + L-Asp ⟶ H+ + N-carb-L-Asp + Pi - Nucleotide metabolism:
ATP + Thy-dRib ⟶ ADP + TMP - Nucleotide biosynthesis:
GTP + IMP + L-Asp ⟶ ADS + GDP + H+ + Pi - Pyrimidine biosynthesis:
CAP + L-Asp ⟶ H+ + N-carb-L-Asp + Pi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide biosynthesis:
ATP + CAIR + L-Asp ⟶ ADP + H+ + Pi + SAICAR - Pyrimidine biosynthesis:
CAP + L-Asp ⟶ H+ + N-carb-L-Asp + Pi - Metabolism:
H2O + PBG ⟶ HMBL + ammonia - Nucleotide metabolism:
CAP + L-Asp ⟶ N-carb-L-Asp + Pi - Pyrimidine metabolism: de novo synthesis of UMP:
CAP + L-Asp ⟶ N-carb-L-Asp + Pi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide biosynthesis:
ATP + CAIR + L-Asp ⟶ ADP + H+ + Pi + SAICAR - Pyrimidine biosynthesis:
CAP + L-Asp ⟶ H+ + N-carb-L-Asp + Pi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide biosynthesis:
ATP + CAIR + L-Asp ⟶ ADP + H+ + Pi + SAICAR - Pyrimidine biosynthesis:
CAP + L-Asp ⟶ H+ + N-carb-L-Asp + Pi - Nucleotide metabolism:
GTP + IMP + L-Asp ⟶ ADS + GDP + H+ + Pi - Nucleotide biosynthesis:
GTP + IMP + L-Asp ⟶ ADS + GDP + H+ + Pi - Pyrimidine biosynthesis:
CAP + L-Asp ⟶ H+ + N-carb-L-Asp + Pi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide biosynthesis:
ATP + CAIR + L-Asp ⟶ ADP + H+ + Pi + SAICAR - Pyrimidine biosynthesis:
CAP + L-Asp ⟶ H+ + N-carb-L-Asp + Pi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide biosynthesis:
GTP + IMP + L-Asp ⟶ ADS + GDP + H+ + Pi - Pyrimidine biosynthesis:
CAP + L-Asp ⟶ H+ + N-carb-L-Asp + Pi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide biosynthesis:
GTP + IMP + L-Asp ⟶ ADS + GDP + H+ + Pi - Pyrimidine biosynthesis:
CAP + L-Asp ⟶ H+ + N-carb-L-Asp + Pi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide biosynthesis:
ATP + CAIR + L-Asp ⟶ ADP + H+ + Pi + SAICAR - Pyrimidine biosynthesis:
CAP + L-Asp ⟶ H+ + N-carb-L-Asp + Pi - Nucleotide metabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Nucleotide biosynthesis:
ATP + CAIR + L-Asp ⟶ ADP + H+ + Pi + SAICAR - Pyrimidine biosynthesis:
CAP + L-Asp ⟶ H+ + N-carb-L-Asp + Pi - G alpha (i) signalling events:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - G alpha (i) signalling events:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
CARN + SAM ⟶ Anserine + SAH - Lysine catabolism:
2OG + H+ + L-Lys + TPNH ⟶ H2O + SACN + TPN - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Lysine catabolism:
Oxygen + PPCA ⟶ H2O2 + P6C - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
CARN + SAM ⟶ Anserine + SAH - Lysine catabolism:
2OG + H+ + L-Lys + TPNH ⟶ H2O + SACN + TPN - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Lysine catabolism:
2OG + H+ + L-Lys + TPNH ⟶ H2O + SACN + TPN - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Lysine catabolism:
Oxygen + PPCA ⟶ H2O2 + P6C - Metabolism of folate and pterines:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Metabolism of folate and pterines:
FOLA + Q0VCN9 ⟶ FOLR2:FOLA - Metabolism of folate and pterines:
FOLA + H+ + TPNH ⟶ DHF + TPN - Metabolism of folate and pterines:
A0A5F4C041 + FOLA ⟶ FOLR2:FOLA - Metabolism of folate and pterines:
FOLA + folr ⟶ FOLR2:FOLA - Metabolism of folate and pterines:
FOLA + H+ + TPNH ⟶ DHF + TPN - Metabolism of folate and pterines:
FOLA + H+ + TPNH ⟶ DHF + TPN - Metabolism of folate and pterines:
F1N9X0 + FOLA ⟶ FOLR2:FOLA - Metabolism of folate and pterines:
FOLA + FOLR2_HUMAN ⟶ FOLR2:FOLA - Metabolism of folate and pterines:
FOLA + Folr2 ⟶ FOLR2:FOLA - Metabolism of folate and pterines:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Metabolism of folate and pterines:
D4A4S5 + FOLA ⟶ FOLR2:FOLA - Metabolism of folate and pterines:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Metabolism of folate and pterines:
FOLA + H+ + TPNH ⟶ DHF + TPN - Metabolism of folate and pterines:
A0A5G2QLX9 + FOLA ⟶ FOLR2:FOLA - Metabolism of folate and pterines:
FOLA + Homologues of FOLR2 ⟶ FOLR2:FOLA - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of folate and pterines:
FOLA + H+ + TPNH ⟶ DHF + TPN - G alpha (i) signalling events:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by GPCR:
Ade-Rib + AdoR ⟶ ADORA1,3:Ade-Rib - GPCR downstream signalling:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - G alpha (i) signalling events:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter receptors and postsynaptic signal transmission:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Activation of NMDA receptors and postsynaptic events:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Unblocking of NMDA receptors, glutamate binding and activation:
GRIN1:GRIN2 NMDA receptors:PSD proteins + Mg2+ ⟶ GRIN1:GRIN2 NMDA receptors:PSD proteins:Mg2+ - Proline catabolism:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 + H+ - Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia - Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia - Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia - Serine biosynthesis:
3POPA + L-Glu ⟶ 2OG + O-P-Ser - Serine biosynthesis:
3POPA + L-Glu ⟶ 2OG + O-P-Ser - Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia - Serine biosynthesis:
3POPA + L-Glu ⟶ 2OG + O-P-Ser - Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia - Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia - Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia - Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia - Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia - Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia - Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia - Serine biosynthesis:
3POPA + L-Glu ⟶ 2OG + O-P-Ser - Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia - Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - GABA synthesis, release, reuptake and degradation:
2OG + GABA + PXLP ⟶ Glu + PXLP + SUCCSA - Degradation of GABA:
2OG + GABA + PXLP ⟶ Glu + PXLP + SUCCSA - Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Synthesis of UDP-N-acetyl-glucosamine:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Synthesis of UDP-N-acetyl-glucosamine:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Metabolism of proteins:
EIF5A2 + NAD + SPM ⟶ 1,3-diaminopropane + H+ + H0ZKZ7 + NADH - Post-translational protein modification:
EIF5A2 + NAD + SPM ⟶ 1,3-diaminopropane + H+ + H0ZKZ7 + NADH - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Synthesis of UDP-N-acetyl-glucosamine:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Urea cycle:
H2O + L-Arg ⟶ L-Orn + Urea - Urea cycle:
ATP + L-Asp + L-Cit ⟶ AMP + ARSUA + PPi - Urea cycle:
CAP + L-Orn ⟶ L-Cit + Pi - Urea cycle:
H2O + L-Arg ⟶ L-Orn + Urea - Urea cycle:
ATP + L-Asp + L-Cit ⟶ AMP + ARSUA + PPi - Urea cycle:
ATP + L-Asp + L-Cit ⟶ AMP + ARSUA + PPi - Urea cycle:
CAP + L-Orn ⟶ L-Cit + Pi - Urea cycle:
CAP + L-Orn ⟶ L-Cit + Pi - Urea cycle:
CAP + L-Orn ⟶ L-Cit + Pi - Urea cycle:
ATP + L-Asp + L-Cit ⟶ AMP + ARSUA + PPi - Urea cycle:
H2O + L-Arg ⟶ L-Orn + Urea - Biosynthesis of specialized proresolving mediators (SPMs):
DHA + Oxygen ⟶ 17-HDHA - Biosynthesis of DHA-derived SPMs:
17(S)-Hp-DHA + TPN ⟶ 16S,17S-epoxy-DHA + TPNH - Biosynthesis of DHA-derived sulfido conjugates:
7(S),17(S)-diHp-DHA + TPN ⟶ 7S(8)-epoxy-17(S)-HDHA + TPNH - Biosynthesis of maresin conjugates in tissue regeneration (MCTR):
(13R)-S-glutathionyl-(14S)-hydroxy-(4Z,7Z,9E,11E,16Z,19Z)-docosahexaenoic acid + H2O ⟶ (13R)-S-cysteinylglycinyl-(14S)-hydroxy-(4Z,7Z,9E,11E,16Z,19Z)-docosahexaenoic acid + L-Glu - GABA synthesis:
H+ + L-Glu + PXLP ⟶ GABA + PXLP + carbon dioxide - Phenylalanine and tyrosine catabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Phenylalanine and tyrosine catabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Phenylalanine and tyrosine catabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Phenylalanine and tyrosine catabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Phenylalanine and tyrosine catabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Phenylalanine and tyrosine catabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Phenylalanine and tyrosine catabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Phenylalanine and tyrosine catabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Phenylalanine and tyrosine catabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Phenylalanine and tyrosine catabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Phenylalanine and tyrosine catabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Phenylalanine and tyrosine catabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Phenylalanine and tyrosine catabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Phenylalanine and tyrosine catabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Phenylalanine and tyrosine metabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Tyrosine catabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Phenylalanine and tyrosine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Tyrosine catabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Phenylalanine and tyrosine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Tyrosine catabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Phenylalanine and tyrosine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Tyrosine catabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Phenylalanine and tyrosine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Tyrosine catabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Phenylalanine and tyrosine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Tyrosine catabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Phenylalanine and tyrosine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Tyrosine catabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Phenylalanine and tyrosine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Tyrosine catabolism:
HGTA + Oxygen ⟶ 4MAA - Phenylalanine and tyrosine metabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Tyrosine catabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Phenylalanine and tyrosine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Tyrosine catabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Phenylalanine and tyrosine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Tyrosine catabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Phenylalanine and tyrosine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Tyrosine catabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Interconversion of nucleotide di- and triphosphates:
AMP + ATP ⟶ ADP - Interconversion of nucleotide di- and triphosphates:
AMP + ATP ⟶ ADP - Interconversion of nucleotide di- and triphosphates:
AMP + ATP ⟶ ADP - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - GABA synthesis, release, reuptake and degradation:
H+ + L-Glu ⟶ GABA + carbon dioxide - Degradation of GABA:
H2O + NAD + SUCCSA ⟶ H+ + NADH + SUCCA - Neuronal System:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Transmission across Chemical Synapses:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Neurotransmitter release cycle:
2OG + GABA ⟶ Glu + SUCCSA - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
2OG + GABA ⟶ Glu + SUCCSA - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neuronal System:
3MT + H2O + Oxygen ⟶ H2O2 + HVA + ammonia - Transmission across Chemical Synapses:
3MT + H2O + Oxygen ⟶ H2O2 + HVA + ammonia - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neuronal System:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Transmission across Chemical Synapses:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Neurotransmitter release cycle:
2OG + GABA ⟶ Glu + SUCCSA - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neuronal System:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Transmission across Chemical Synapses:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Neurotransmitter release cycle:
2OG + GABA ⟶ Glu + SUCCSA - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
2OG + GABA ⟶ Glu + SUCCSA - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
Ac-CoA + Cho ⟶ AcCho + CoA-SH - GABA synthesis, release, reuptake and degradation:
H+ + L-Glu ⟶ GABA + carbon dioxide - Degradation of GABA:
H2O + NAD + SUCCSA ⟶ H+ + NADH + SUCCA - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
Ac-CoA + Cho ⟶ AcCho + CoA-SH - GABA synthesis, release, reuptake and degradation:
H+ + L-Glu ⟶ GABA + carbon dioxide - Degradation of GABA:
H2O + NAD + SUCCSA ⟶ H+ + NADH + SUCCA - Neuronal System:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Transmission across Chemical Synapses:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Gene expression (Transcription):
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - RNA Polymerase II Transcription:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Generic Transcription Pathway:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Transcriptional Regulation by TP53:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - TP53 Regulates Metabolic Genes:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Glutamate Neurotransmitter Release Cycle:
H2O + L-Gln ⟶ Glu + NH4+ - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Glutamate Neurotransmitter Release Cycle:
H2O + L-Gln ⟶ Glu + NH4+ - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Gene expression (Transcription):
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - RNA Polymerase II Transcription:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Generic Transcription Pathway:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Transcriptional Regulation by TP53:
GSH + H2O2 ⟶ GSSG + H2O - TP53 Regulates Metabolic Genes:
GSH + H2O2 ⟶ GSSG + H2O - Glutamate Neurotransmitter Release Cycle:
H2O + L-Gln ⟶ Glu + NH4+ - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Gene expression (Transcription):
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - RNA Polymerase II Transcription:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Generic Transcription Pathway:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Transcriptional Regulation by TP53:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - TP53 Regulates Metabolic Genes:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Gene expression (Transcription):
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - RNA Polymerase II Transcription:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Generic Transcription Pathway:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Transcriptional Regulation by TP53:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - TP53 Regulates Metabolic Genes:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Glutamate Neurotransmitter Release Cycle:
H2O + L-Gln ⟶ Glu + NH4+ - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Glutamate Neurotransmitter Release Cycle:
H2O + L-Gln ⟶ Glu + NH4+ - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Gene expression (Transcription):
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - RNA Polymerase II Transcription:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Generic Transcription Pathway:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Transcriptional Regulation by TP53:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - TP53 Regulates Metabolic Genes:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Glutamate Neurotransmitter Release Cycle:
H2O + L-Gln ⟶ Glu + NH4+ - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Gene expression (Transcription):
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - RNA Polymerase II Transcription:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Generic Transcription Pathway:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Transcriptional Regulation by TP53:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - TP53 Regulates Metabolic Genes:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Glutamate Neurotransmitter Release Cycle:
H2O + L-Gln ⟶ Glu + NH4+ - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Gene expression (Transcription):
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - RNA Polymerase II Transcription:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Generic Transcription Pathway:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Transcriptional Regulation by TP53:
Cytochrome c-Fe2+ + H+ + Oxygen ⟶ Cytochrome c-Fe3+ + H+ + H2O - TP53 Regulates Metabolic Genes:
Cytochrome c-Fe2+ + H+ + Oxygen ⟶ Cytochrome c-Fe3+ + H+ + H2O - Gene expression (Transcription):
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - RNA Polymerase II Transcription:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Generic Transcription Pathway:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Transcriptional Regulation by TP53:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - TP53 Regulates Metabolic Genes:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Glutamate Neurotransmitter Release Cycle:
H2O + L-Gln ⟶ Glu + NH4+ - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Neuronal System:
HCN channels + cAMP ⟶ HCN channel bound to cAMP - Transmission across Chemical Synapses:
ATP ⟶ ADP - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Glutamate Neurotransmitter Release Cycle:
H2O + L-Gln ⟶ Glu + NH4+ - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Gene expression (Transcription):
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - RNA Polymerase II Transcription:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Generic Transcription Pathway:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Transcriptional Regulation by TP53:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - TP53 Regulates Metabolic Genes:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Gene expression (Transcription):
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - RNA Polymerase II Transcription:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Generic Transcription Pathway:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Transcriptional Regulation by TP53:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - TP53 Regulates Metabolic Genes:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Glutamate Neurotransmitter Release Cycle:
H2O + L-Gln ⟶ Glu + NH4+ - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Glutamate Neurotransmitter Release Cycle:
H2O + L-Gln ⟶ Glu + NH4+ - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Gene expression (Transcription):
p-AMPK heterotrimer:AMP ⟶ SESN1,2,3:p-AMPK heterotrimer:AMP - RNA Polymerase II Transcription:
p-AMPK heterotrimer:AMP ⟶ SESN1,2,3:p-AMPK heterotrimer:AMP - Generic Transcription Pathway:
p-AMPK heterotrimer:AMP ⟶ SESN1,2,3:p-AMPK heterotrimer:AMP - Transcriptional Regulation by TP53:
p-AMPK heterotrimer:AMP ⟶ SESN1,2,3:p-AMPK heterotrimer:AMP - TP53 Regulates Metabolic Genes:
p-AMPK heterotrimer:AMP ⟶ SESN1,2,3:p-AMPK heterotrimer:AMP - Gene expression (Transcription):
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - RNA Polymerase II Transcription:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Generic Transcription Pathway:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4 - Transcriptional Regulation by TP53:
H2O2 + TXN ⟶ F6ZMN7 + H2O - TP53 Regulates Metabolic Genes:
H2O2 + TXN ⟶ F6ZMN7 + H2O - Glutamate Neurotransmitter Release Cycle:
H2O + L-Gln ⟶ Glu + NH4+ - Neurotransmitter uptake and metabolism In glial cells:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Astrocytic Glutamate-Glutamine Uptake And Metabolism:
ATP + L-Glu + NH4+ ⟶ ADP + L-Gln + Pi - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Developmental Biology:
ATP + H0YPU3 ⟶ NCAM-1:ATP - Axon guidance:
ATP + H0YPU3 ⟶ NCAM-1:ATP - EPH-Ephrin signaling:
ATP ⟶ ADP - EPHB-mediated forward signaling:
ATP + RAC1:GTP:PAK1 dimer:RAC1:GTP ⟶ ADP + RAC1-GTP:p-S144,T423-PAK1 - Neurotransmitter receptors and postsynaptic signal transmission:
Kainate Receptors + L-Glu ⟶ Kainate receptor-glutamate complex - Activation of kainate receptors upon glutamate binding:
Kainate Receptors + L-Glu ⟶ Kainate receptor-glutamate complex - Ionotropic activity of kainate receptors:
Kainate Receptors + L-Glu ⟶ Kainate receptor-glutamate complex - Activation of Na-permeable kainate receptors:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Activation of Ca-permeable Kainate Receptor:
Kainate Receptors + L-Glu ⟶ Kainate receptor-glutamate complex - Presynaptic function of Kainate receptors:
GRIK 3 homomer + L-Glu ⟶ GRIK3 homomer glutamate complex - Neurotransmitter receptors and postsynaptic signal transmission:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Activation of kainate receptors upon glutamate binding:
Kainate Receptors + L-Glu ⟶ Kainate receptor-glutamate complex - Ionotropic activity of kainate receptors:
Kainate Receptors + L-Glu ⟶ Kainate receptor-glutamate complex - Activation of Na-permeable kainate receptors:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Activation of Ca-permeable Kainate Receptor:
Kainate Receptors + L-Glu ⟶ Kainate receptor-glutamate complex - Presynaptic function of Kainate receptors:
GRIK 3 homomer + L-Glu ⟶ GRIK3 homomer glutamate complex - Neurotransmitter receptors and postsynaptic signal transmission:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Activation of kainate receptors upon glutamate binding:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Ionotropic activity of kainate receptors:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Activation of Na-permeable kainate receptors:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Activation of Ca-permeable Kainate Receptor:
Kainate Receptors + L-Glu ⟶ Kainate receptor-glutamate complex - Presynaptic function of Kainate receptors:
GRIK 3 homomer + L-Glu ⟶ GRIK3 homomer glutamate complex - Activation of kainate receptors upon glutamate binding:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Ionotropic activity of kainate receptors:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Activation of Na-permeable kainate receptors:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Activation of Ca-permeable Kainate Receptor:
Kainate Receptors + L-Glu ⟶ Kainate receptor-glutamate complex - Presynaptic function of Kainate receptors:
GRIK 3 homomer + L-Glu ⟶ GRIK3 homomer glutamate complex - Neurotransmitter receptors and postsynaptic signal transmission:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Activation of kainate receptors upon glutamate binding:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Ionotropic activity of kainate receptors:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Activation of Na-permeable kainate receptors:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Presynaptic function of Kainate receptors:
GRIK 3 homomer + L-Glu ⟶ GRIK3 homomer glutamate complex - Neurotransmitter receptors and postsynaptic signal transmission:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Activation of kainate receptors upon glutamate binding:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Ionotropic activity of kainate receptors:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Activation of Na-permeable kainate receptors:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Activation of Ca-permeable Kainate Receptor:
Kainate Receptors + L-Glu ⟶ Kainate receptor-glutamate complex - Presynaptic function of Kainate receptors:
GRIK 3 homomer + L-Glu ⟶ GRIK3 homomer glutamate complex - Activation of kainate receptors upon glutamate binding:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Ionotropic activity of kainate receptors:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Activation of Na-permeable kainate receptors:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Activation of Ca-permeable Kainate Receptor:
Kainate Receptors + L-Glu ⟶ Kainate receptor-glutamate complex - Presynaptic function of Kainate receptors:
GRIK 3 homomer + L-Glu ⟶ GRIK3 homomer glutamate complex - Neurotransmitter receptors and postsynaptic signal transmission:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Activation of kainate receptors upon glutamate binding:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Ionotropic activity of kainate receptors:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Activation of Na-permeable kainate receptors:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Activation of Ca-permeable Kainate Receptor:
Kainate Receptors + L-Glu ⟶ Kainate receptor-glutamate complex - Presynaptic function of Kainate receptors:
GRIK 3 homomer + L-Glu ⟶ GRIK3 homomer glutamate complex - Neurotransmitter receptors and postsynaptic signal transmission:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Activation of kainate receptors upon glutamate binding:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Ionotropic activity of kainate receptors:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Activation of Na-permeable kainate receptors:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Activation of Ca-permeable Kainate Receptor:
Kainate Receptors + L-Glu ⟶ Kainate receptor-glutamate complex - Presynaptic function of Kainate receptors:
GRIK 3 homomer + L-Glu ⟶ GRIK3 homomer glutamate complex - Activation of kainate receptors upon glutamate binding:
GRIK 2 homomer + L-Glu ⟶ Kainate receptor-glutamate complex - Ionotropic activity of kainate receptors:
GRIK 2 homomer + L-Glu ⟶ Kainate receptor-glutamate complex - Activation of Ca-permeable Kainate Receptor:
GRIK 2 homomer + L-Glu ⟶ Kainate receptor-glutamate complex - Neurotransmitter receptors and postsynaptic signal transmission:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Activation of kainate receptors upon glutamate binding:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Ionotropic activity of kainate receptors:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Activation of Na-permeable kainate receptors:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Activation of Ca-permeable Kainate Receptor:
Kainate Receptors + L-Glu ⟶ Kainate receptor-glutamate complex - Presynaptic function of Kainate receptors:
GRIK 3 homomer + L-Glu ⟶ GRIK3 homomer glutamate complex - Neurotransmitter receptors and postsynaptic signal transmission:
ATP + Ca2+ ⟶ Ca2+ + PPi + cAMP - Activation of kainate receptors upon glutamate binding:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Ionotropic activity of kainate receptors:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Activation of Na-permeable kainate receptors:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Activation of Ca-permeable Kainate Receptor:
Kainate Receptors + L-Glu ⟶ Kainate receptor-glutamate complex - Presynaptic function of Kainate receptors:
GRIK 3 homomer + L-Glu ⟶ GRIK3 homomer glutamate complex - Neurotransmitter receptors and postsynaptic signal transmission:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Activation of kainate receptors upon glutamate binding:
GRIK 3 homomer + L-Glu ⟶ GRIK3 homomer glutamate complex - Ionotropic activity of kainate receptors:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Activation of Na-permeable kainate receptors:
Edited Kainate receptors + L-Glu ⟶ Edited Kainate Receptor-glutamate complex - Activation of Ca-permeable Kainate Receptor:
Kainate Receptors + L-Glu ⟶ Kainate receptor-glutamate complex - Presynaptic function of Kainate receptors:
GRIK 3 homomer + L-Glu ⟶ GRIK3 homomer glutamate complex - Activation of Ca-permeable Kainate Receptor:
Kainate Receptors + L-Glu ⟶ Kainate receptor-glutamate complex - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Synthesis of UDP-N-acetyl-glucosamine:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Synthesis of UDP-N-acetyl-glucosamine:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Synthesis of UDP-N-acetyl-glucosamine:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Synthesis of UDP-N-acetyl-glucosamine:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Metabolism of proteins:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a - Post-translational protein modification:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
ATP + MVA5PP ⟶ ADP + IPPP + Pi + carbon dioxide - Synthesis of UDP-N-acetyl-glucosamine:
AcGlcN1P + UTP ⟶ PPi + UDP-GlcNAc - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH + Q9GU68 - Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH + Q9GU68 - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Synthesis of UDP-N-acetyl-glucosamine:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Metabolism of proteins:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Post-translational protein modification:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Synthesis of UDP-N-acetyl-glucosamine:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Synthesis of UDP-N-acetyl-glucosamine:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Synthesis of UDP-N-acetyl-glucosamine:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
TPNH + pPNOL ⟶ DCHOL + TPN - Synthesis of UDP-N-acetyl-glucosamine:
AcGlcN1P + UTP ⟶ PPi + UDP-GlcNAc - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Synthesis of UDP-N-acetyl-glucosamine:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
ATP + MVA5PP ⟶ ADP + IPPP + Pi + carbon dioxide - Synthesis of UDP-N-acetyl-glucosamine:
AcGlcN1P + UTP ⟶ PPi + UDP-GlcNAc - Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
ATP + MVA5PP ⟶ ADP + IPPP + Pi + carbon dioxide - Synthesis of UDP-N-acetyl-glucosamine:
AcGlcN1P + UTP ⟶ PPi + UDP-GlcNAc - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Synthesis of UDP-N-acetyl-glucosamine:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P - Metabolism of proteins:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a - Post-translational protein modification:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a - Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Synthesis of substrates in N-glycan biosythesis:
ATP + MVA5PP ⟶ ADP + IPPP + Pi + carbon dioxide - Synthesis of UDP-N-acetyl-glucosamine:
AcGlcN1P + UTP ⟶ PPi + UDP-GlcNAc - Sulfur amino acid metabolism:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia - Degradation of cysteine and homocysteine:
H2O + HCYS ⟶ 2OBUTA + H2S + ammonia
BioCyc(781)
- purine nucleotide metabolism (phosphotransfer and nucleotide modification):
AMP + ATP ⟶ ADP + H+ - purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of histidine, purine, and pyrimidine biosynthesis:
glt + imidazole acetol-phosphate ⟶ 2-oxoglutarate + L-histidinol-phosphate - guanosine nucleotides de novo biosynthesis:
ATP + ammonia + xanthosine-5-phosphate ⟶ AMP + GMP + H+ + diphosphate - purine nucleotides de novo biosynthesis II:
adenylo-succinate ⟶ AMP + fumarate - dTDP-L-daunosamine biosynthesis:
2-oxoglutarate + dTDP-3-amino-4-dehydro-2,3,6-trideoxy-β-L-glucose ⟶ dTDP-3,4-didehydro-2,6-dideoxy-β-L-glucose + glu - uridine-5'-phosphate biosynthesis:
H+ + orotidine-5'-phosphate ⟶ CO2 + UMP - pyrimidine ribonucleotides de novo biosynthesis:
H+ + orotidine-5'-phosphate ⟶ CO2 + UMP - arginine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - superpathway of arginine and polyamine biosynthesis:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - pyrimidine ribonucleotides de novo biosynthesis:
H+ + orotidine-5'-phosphate ⟶ CO2 + UMP - uridine-5'-phosphate biosynthesis:
H+ + orotidine-5'-phosphate ⟶ CO2 + UMP - validamycin biosynthesis:
GDP-valienol + validamine 7-phosphate ⟶ GDP + H+ + validoxylamine A 7'-phosphate - pyridine nucleotide cycling (plants):
ATP + H2O + gln + nicotinate adenine dinucleotide ⟶ AMP + H+ + NAD+ + diphosphate + glt - NAD biosynthesis II (from tryptophan):
H+ + O2 + trp ⟶ N-formylkynurenine - NAD biosynthesis from 2-amino-3-carboxymuconate semialdehyde:
ATP + H2O + gln + nicotinate adenine dinucleotide ⟶ AMP + H+ + NAD+ + diphosphate + glt - aspartate superpathway:
ATP + ammonia + nicotinate adenine dinucleotide ⟶ AMP + H+ + NAD+ + diphosphate - NAD biosynthesis II (from tryptophan):
N-formylkynurenine + H2O ⟶ H+ + formate + kynurenine - NAD biosynthesis from 2-amino-3-carboxymuconate semialdehyde:
ATP + H2O + gln + nicotinate adenine dinucleotide ⟶ AMP + H+ + NAD+ + diphosphate + glt - NAD biosynthesis I (from aspartate):
ATP + ammonia + nicotinate adenine dinucleotide ⟶ AMP + H+ + NAD+ + diphosphate - pyridine nucleotide cycling:
ATP + ammonia + nicotinate adenine dinucleotide ⟶ AMP + H+ + NAD+ + diphosphate - camalexin biosynthesis:
2-(cystein-S-yl)-2-(1H-indol-3-yl)-acetonitrile + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (R)-dihydrocamalexate + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] + hydrogen cyanide - valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + bicarbonate + propanoyl-CoA - valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + bicarbonate + propanoyl-CoA - L-cysteine degradation I:
2-oxoglutarate + 3-sulfinoalanine ⟶ 3-sulfinyl-pyruvate + glt - folate polyglutamylation:
ATP + a tetrahydrofolate + glu ⟶ ADP + a tetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + glu ⟶ ADP + a tetrahydrofolate + phosphate - ornithine biosynthesis:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - superpathway of trimethylamine degradation:
H+ + NADPH + O2 + dimethylamine ⟶ H2O + NADP+ + formaldehyde + methylamine - methylamine degradation II:
N-methyl-L-glutamate + A + H2O ⟶ A(H2) + formaldehyde + glu - formylTHF biosynthesis I:
H+ + NAD+ + gly + tetrahydrofolate ⟶ 5,10-methylenetetrahydrofolate + CO2 + NADH + ammonia - formylTHF biosynthesis II:
H+ + NAD+ + gly + tetrahydrofolate ⟶ 5,10-methylenetetrahydrofolate + CO2 + NADH + ammonia - tetrahydrofolate biosynthesis:
7,8-dihydropteroate + ATP + glt ⟶ 7,8-dihydrofolate + ADP + H+ + phosphate - formylTHF biosynthesis I:
H+ + NAD+ + gly + tetrahydrofolate ⟶ 5,10-methylenetetrahydrofolate + CO2 + NADH + ammonia - tetrahydrofolate biosynthesis II:
ATP + glt + tetrahydrofolate ⟶ ADP + H+ + phosphate + tetrahydrofolate-L-glutamate - superpathay of heme b biosynthesis from glutamate:
ATP + glu ⟶ AMP + diphosphate - tRNA charging:
ATP + thr ⟶ AMP + diphosphate - tetrapyrrole biosynthesis I (from glutamate):
ATP + glu ⟶ AMP + diphosphate - tetrapyrrole biosynthesis I (from glutamate):
(S)-4-amino-5-oxopentanoate + NADP+ ⟶ H+ + NADPH - tRNA charging:
ATP + ala ⟶ AMP + diphosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
asp + carbamoyl phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
asp + carbamoyl phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - UMP biosynthesis:
asp + carbamoyl phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - UMP biosynthesis II:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - UMP biosynthesis III:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - UMP biosynthesis I:
(S)-dihydroorotate + H2O ⟶ N-carbamoyl-L-aspartate + H+ - superpathway of arginine and polyamine biosynthesis:
cadaverine + dAdoMet ⟶ S-methyl-5'-thioadenosine + H+ + aminopropylcadaverine - L-arginine biosynthesis III (via N-acetyl-L-citrulline):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis IV (archaebacteria):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis II (acetyl cycle):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + H2O ⟶ N-carbamoyl-L-aspartate + H+ - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
H2O + dUTP ⟶ H+ + dUMP + diphosphate - superpathway of arginine and polyamine biosynthesis:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
asp + carbamoyl phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
asp + carbamoyl phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
asp + carbamoyl phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - de novo biosynthesis of pyrimidine ribonucleotides:
asp + carbamoyl phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - arginine biosynthesis:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis II:
asp + carbamoyl phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - L-arginine biosynthesis II (acetyl cycle):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + Glu + H+ + carbamoyl phosphate + phosphate - UMP biosynthesis I:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + Glu + H+ + carbamoyl phosphate + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + Glu + H+ + carbamoyl phosphate + phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + Glu + H+ + carbamoyl phosphate + phosphate - L-arginine biosynthesis I (via L-ornithine):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + Glu + H+ + carbamoyl phosphate + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + Glu + H+ + carbamoyl phosphate + phosphate - UMP biosynthesis II:
asp + carbamoyl phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + Glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + Glu - arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
asp + carbamoyl-phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
asp + carbamoyl-phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - UMP biosynthesis:
asp + carbamoyl-phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - arginine biosynthesis IV (archaebacteria):
2-oxoglutarate + a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-ornithyl)-L-glutamate ⟶ a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-glutamate 5-semialdehyde-2-yl)-L-glutamate + glt - arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - uridine-5'-phosphate biosynthesis:
H+ + orotidine-5'-phosphate ⟶ CO2 + UMP - pyrimidine ribonucleotides de novo biosynthesis:
H+ + orotidine-5'-phosphate ⟶ CO2 + UMP - superpathway of arginine and polyamine biosynthesis:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - arginine biosynthesis III:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - arginine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - UMP biosynthesis I:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis I (via L-ornithine):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis II (acetyl cycle):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
asp + carbamoyl phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - UMP biosynthesis:
asp + carbamoyl phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
asp + carbamoyl phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - L-arginine biosynthesis IV (archaebacteria):
2-oxoglutarate + a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-ornithyl)-L-glutamate ⟶ a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-glutamate 5-semialdehyde-2-yl)-L-glutamate + glt - UMP biosynthesis I:
asp + carbamoyl phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
asp + carbamoyl phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
asp + carbamoyl phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - UMP biosynthesis:
asp + carbamoyl-phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
asp + carbamoyl-phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
asp + carbamoyl-phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - arginine biosynthesis IV (archaebacteria):
2-oxoglutarate + a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-ornithyl)-L-glutamate ⟶ a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-glutamate 5-semialdehyde-2-yl)-L-glutamate + glt - arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
asp + carbamoyl-phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - UMP biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - arginine biosynthesis IV (archaebacteria):
2-oxoglutarate + a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-ornithyl)-L-glutamate ⟶ a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-glutamate 5-semialdehyde-2-yl)-L-glutamate + glt - arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + orotate - arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - arginine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + orotate - UMP biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - UMP biosynthesis I:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis I (via L-ornithine):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - UMP biosynthesis II:
(S)-dihydroorotate + fumarate ⟶ orotate + succinate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - uridine-5'-phosphate biosynthesis:
ATP + H2O + bicarbonate + gln ⟶ ADP + H+ + carbamoyl-phosphate + glt + phosphate - pyrimidine ribonucleotides de novo biosynthesis:
ATP + CDP ⟶ ADP + CTP - uridine-5'-phosphate biosynthesis:
ATP + H2O + bicarbonate + gln ⟶ ADP + H+ + carbamoyl-phosphate + glt + phosphate - pyrimidine ribonucleotides de novo biosynthesis:
ATP + UDP ⟶ ADP + H+ + UTP - pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + fumarate ⟶ orotate + succinate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - UMP biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - uridine-5'-phosphate biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis III:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - UMP biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of arginine and polyamine biosynthesis:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - arginine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - uridine-5'-phosphate biosynthesis:
ATP + H2O + bicarbonate + gln ⟶ ADP + H+ + carbamoyl-phosphate + glt + phosphate - pyrimidine ribonucleotides de novo biosynthesis:
ATP + H2O + bicarbonate + gln ⟶ ADP + H+ + carbamoyl-phosphate + glt + phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - UMP biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis:
(S)-dihydroorotate + UQ ⟶ UQH2 + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + UQ ⟶ UQH2 + orotate - arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - superpathway of arginine and polyamine biosynthesis:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of arginine and polyamine biosynthesis:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - UMP biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - arginine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - uridine-5'-phosphate biosynthesis:
ATP + H2O + bicarbonate + gln ⟶ ADP + H+ + carbamoyl-phosphate + glt + phosphate - pyrimidine ribonucleotides de novo biosynthesis:
ATP + CMP ⟶ ADP + CDP - arginine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - uridine-5'-phosphate biosynthesis:
(S)-dihydroorotate + UQ ⟶ UQH2 + orotate - pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + UQ ⟶ UQH2 + orotate - arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - arginine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - pyrimidine ribonucleotides de novo biosynthesis:
ATP + CMP ⟶ ADP + CDP - uridine-5'-phosphate biosynthesis:
ATP + H2O + bicarbonate + gln ⟶ ADP + H+ + carbamoyl-phosphate + glt + phosphate - arginine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine-5'-phosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + orotate - UMP biosynthesis:
diphosphate + orotidine-5'-phosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine-5'-phosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + orotate - arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - arginine biosynthesis IV (archaebacteria):
2-oxoglutarate + a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-ornithyl)-L-glutamate ⟶ a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-glutamate 5-semialdehyde-2-yl)-L-glutamate + glt - arginine biosynthesis IV (archaebacteria):
2-oxoglutarate + a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-ornithyl)-L-glutamate ⟶ a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-glutamate 5-semialdehyde-2-yl)-L-glutamate + glt - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis II:
(S)-dihydroorotate + NAD+ ⟶ H+ + NADH + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + Glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + Glu - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - arginine biosynthesis IV (archaebacteria):
2-oxoglutarate + a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-ornithyl)-L-glutamate ⟶ a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-glutamate 5-semialdehyde-2-yl)-L-glutamate + glt - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis III:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + Glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis III:
(S)-dihydroorotate + NAD+ ⟶ H+ + NADH + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + Glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + Glu - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + Glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + Glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + Glu - L-arginine biosynthesis III (via N-acetyl-L-citrulline):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + Glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - UMP biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis IV (archaebacteria):
2-oxoglutarate + a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-ornithyl)-L-glutamate ⟶ a [lysine-biosynthesis-protein LysW]-C-terminal-γ-(L-glutamate 5-semialdehyde-2-yl)-L-glutamate + glt - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + Glu - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + Glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + Glu - isoleucine degradation I:
2-methylacetoacetyl-CoA + coenzyme A ⟶ acetyl-CoA + propanoyl-CoA - superpathway of threonine metabolism:
2-oxobutanoate + coenzyme A ⟶ formate + propanoyl-CoA - isoleucine biosynthesis I:
thr ⟶ 2-oxobutanoate + H+ + ammonia - isoleucine biosynthesis I (from threonine):
thr ⟶ 2-oxobutanoate + H+ + ammonia - superpathway of ornithine degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ γ-glutamyl-γ-aminobutyraldehyde + ammonium + hydrogen peroxide - putrescine degradation I:
2-oxoglutarate + putrescine ⟶ 4-aminobutanal + glt - putrescine degradation II:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ γ-glutamyl-γ-aminobutyraldehyde + ammonium + hydrogen peroxide - superpathway of arginine and ornithine degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ γ-glutamyl-γ-aminobutyraldehyde + ammonium + hydrogen peroxide - superpathway of arginine, putrescine, and 4-aminobutyrate degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ γ-glutamyl-γ-aminobutyraldehyde + ammonium + hydrogen peroxide - phenylalanine degradation II (anaerobic):
glt + phenylpyruvate ⟶ 2-oxoglutarate + phe - alanine biosynthesis II:
2-oxoglutarate + ala ⟶ glt + pyruvate - alanine degradation III:
2-oxoglutarate + ala ⟶ glt + pyruvate - alanine degradation III:
2-oxoglutarate + ala ⟶ glt + pyruvate - superpathway of alanine biosynthesis:
pyruvate + val ⟶ 2-oxoisovalerate + ala - alanine biosynthesis II:
2-oxoglutarate + ala ⟶ glt + pyruvate - histidine biosynthesis:
glt + imidazole acetol-phosphate ⟶ 2-oxoglutarate + L-histidinol-phosphate - tetrahydrofolate biosynthesis I:
6-hydroxymethyl-7,8-dihydropterin + ATP ⟶ 6-hydroxymethyl-dihydropterin diphosphate + AMP + H+ - superpathway of lysine, threonine and methionine biosynthesis I:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate - lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt - superpathway of sterol biosynthesis:
4-methyl-2-oxopentanoate + NAD+ + coenzyme A ⟶ CO2 + NADH + isovaleryl-CoA - leucine degradation I:
4-methyl-2-oxopentanoate + NAD+ + coenzyme A ⟶ CO2 + NADH + isovaleryl-CoA - leucine degradation I:
2-oxoglutarate + leu ⟶ 4-methyl-2-oxopentanoate + glt - 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosyl-amine + ATP + gly ⟶ 5-phospho-ribosyl-glycineamide + ADP + H+ + phosphate - 5-aminoimidazole ribonucleotide biosynthesis II:
5-phospho-β-D-ribosyl-amine + ATP + gly ⟶ 5-phospho-ribosyl-glycineamide + ADP + H+ + phosphate - CMP-diacetamido-8-epilegionaminic acid biosynthesis:
5,7-diacetamido-3,5,7,9-tetradeoxy-L-glycero-D-galacto-non-2-ulosonate + CTP ⟶ CMP-5,7-diacetamido-3,5,7,9-tetradeoxy-L-glycero-D-galacto-non-2-ulosonate + diphosphate - arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate γ-semialdehyde + glt - arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate γ-semialdehyde + glt - arginine degradation VII:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + NAD(P)H + ammonia - folate polyglutamylation I:
H+ + ser + tetrahydrofolate ⟶ 5,10-methylene-THF + H2O + gly - folate polyglutamylation I:
H+ + ser + tetrahydrofolate ⟶ 5,10-methylenetetrahydrofolate + H2O + gly - aniline degradation:
1-aminocyclohexa-3,5-diene-1,2-diol ⟶ ammonium + catechol - proline degradation III:
(S)-1-pyrroline-5-carboxylate + H2O + NAD+ ⟶ H+ + NADH + glt - arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate γ-semialdehyde + glt - proline degradation II:
(S)-1-pyrroline-5-carboxylate + H2O + NAD(P)+ ⟶ H+ + NAD(P)H + glt - arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate γ-semialdehyde + glt - proline degradation:
(S)-1-pyrroline-5-carboxylate + H2O + NAD+ ⟶ H+ + NADH + glt - proline degradation II:
A + pro ⟶ (S)-1-pyrroline-5-carboxylate + A(H2) - proline degradation II:
A + pro ⟶ (S)-1-pyrroline-5-carboxylate + A(H2) - proline degradation:
(S)-1-pyrroline-5-carboxylate + H2O + NAD+ ⟶ H+ + NADH + glt - arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate γ-semialdehyde + glt - arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate γ-semialdehyde + glt - proline degradation:
(S)-1-pyrroline-5-carboxylate + H2O + NAD+ ⟶ H+ + NADH + glt - superpathway of serine and glycine biosynthesis I:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phospho-hydroxypyruvate + glt - serine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phospho-hydroxypyruvate + glt - tyrosine degradation II:
4-hydroxyphenylpyruvate + H+ + O2 ⟶ 4-hydroxyphenylacetate + CO2 + H2O - tyrosine degradation I:
2-oxoglutarate + tyr ⟶ 4-hydroxyphenylpyruvate + glt - superpathway of lysine, threonine and methionine biosynthesis II:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate - lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ H2O + H+ + glt + tetrahydrodipicolinate - γ-glutamyl cycle:
a 5-L-glutamyl-L-amino acid + cysteinylglycine ⟶ a standard α amino acid + glutathione - formylTHF biosynthesis II:
H+ + NAD+ + gly + tetrahydrofolate ⟶ 5,10-methylenetetrahydrofolate + CO2 + NADH + ammonia - formylTHF biosynthesis I:
H+ + NAD+ + gly + tetrahydrofolate ⟶ 5,10-methylenetetrahydrofolate + CO2 + NADH + ammonia - superpathway of 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutyrate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation I:
2-oxoglutarate + 4-aminobutyrate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutyrate ⟶ glt + succinate semialdehyde - IAA biosynthesis I:
acetate + indole ⟶ H+ + indole-3-acetate - tryptophan degradation:
2-oxoglutarate + trp ⟶ glt + indole-3-pyruvate - L-lysine biosynthesis II:
L-2-acetamido-6-oxoheptanedioate + glu ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate - L-lysine biosynthesis II:
L-2-acetamido-6-oxoheptanedioate + glu ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate - lysine biosynthesis II:
L-2-acetamido-6-oxoheptanedioate + glt ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate - lysine biosynthesis II:
L-2-acetamido-6-oxoheptanedioate + glt ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate - L-lysine biosynthesis II:
Glu + L-2-acetamido-6-oxoheptanedioate ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate - L-lysine biosynthesis II:
L-2-acetamido-6-oxoheptanedioate + glt ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate - L-lysine biosynthesis II:
Glu + L-2-acetamido-6-oxoheptanedioate ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate - L-lysine biosynthesis II:
Glu + L-2-acetamido-6-oxoheptanedioate ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate - glutathione biosynthesis:
ATP + L-γ-glutamylcysteine + gly ⟶ ADP + H+ + glutathione + phosphate - pyrimidine nucleotide metabolism (phosphotransfer and nucleotide modification):
ATP + H2O + UTP + gln ⟶ ADP + CTP + H+ + glt + phosphate - pyrimidine ribonucleotides interconversion:
ATP + H2O + UTP + gln ⟶ ADP + CTP + H+ + glt + phosphate - glutamine biosynthesis II:
ATP + ammonia + glt ⟶ ADP + H+ + gln + phosphate - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glt ⟶ ADP + a folylpolyglutamate(n) + phosphate - glutathione biosynthesis:
ATP + L-γ-glutamylcysteine + gly ⟶ ADP + H+ + glutathione + phosphate - pyrimidine ribonucleotides interconversion:
ATP + H2O + UTP + gln ⟶ ADP + CTP + H+ + glt + phosphate - glutamine biosynthesis II:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + NAD(P)H + ammonia - UDP-N-acetylglucosamine biosynthesis:
D-fructose-6-phosphate + gln ⟶ D-glucosamine-6-phosphate + glt - peptidoglycan and lipid A precursor biosynthesis:
ATP + UDP-N-acetylmuramate + ala ⟶ ADP + H+ + UDP-N-acetylmuramyl-L-Ala + phosphate - UDP-N-acetyl-D-glucosamine biosynthesis II:
D-fructose-6-phosphate + gln ⟶ D-glucosamine 6-phosphate + glt - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-fructose-6-phosphate + gln ⟶ D-glucosamine 6-phosphate + glt - ammonia assimilation cycle III:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamate and L-glutamine biosynthesis:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-histidine degradation I:
N-formimino-L-glutamate + H2O ⟶ formamide + glu - trans-4-hydroxy-L-proline degradation I:
Hyp + an electron-transfer quinone ⟶ (3R,5S)-3-hydroxy-1-pyrroline-5-carboxylate + H+ + an electron-transfer quinol - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle III:
NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + gln - lysine degradation II:
2-aminoadipate + 2-oxoglutarate ⟶ 2-oxoadipate + glt - lysine biosynthesis IV:
2-oxoglutarate + H2O + acetyl-CoA ⟶ (R)-homocitrate + H+ + coenzyme A - L-histidine degradation II:
N-formyl-L-glutamate + H2O ⟶ formate + glu - pyrimidine ribonucleotides interconversion:
ATP + UDP ⟶ ADP + H+ + UTP - pyrimidine ribonucleotides interconversion:
ATP + CDP ⟶ ADP + CTP + H+ - proline biosynthesis II:
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H - proline biosynthesis II:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + NAD(P)H + ammonia - 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - GABA shunt:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - nicotine degradation I (pyridine pathway):
2,6-dihydroxypyridine + H+ + NADH + O2 ⟶ 2,3,6-trihydroxypyridine + H2O + NAD+ - 4-aminobutanoate degradation III:
H2O + NAD(P)+ + succinate semialdehyde ⟶ H+ + NAD(P)H + succinate - 4-aminobutanoate degradation V:
acetate + butanoyl-CoA ⟶ acetyl-CoA + butanoate - 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - GABA shunt:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - superpathway of L-arginine, putrescine, and 4-aminobutanoate degradation:
H2O + agmatine ⟶ putrescine + urea - superpathway of L-arginine and L-ornithine degradation:
4-aminobutanal ⟶ 1-pyrroline + H2O - L-glutamate degradation IV:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - superpathway of L-arginine, putrescine, and 4-aminobutanoate degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ 4-(γ-L-glutamylamino)butanal + ammonium + hydrogen peroxide - superpathway of L-arginine and L-ornithine degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ 4-(γ-L-glutamylamino)butanal + ammonium + hydrogen peroxide - 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - glutamate degradation to succinate:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - L-glutamate degradation IV:
4-hydroxybutanoate + NAD(P)+ ⟶ H+ + NAD(P)H + succinate semialdehyde - 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - superpathway of 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - glutamate degradation IX (via 4-aminobutyrate):
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation V:
H2O + NAD+ + glt ⟶ 2-oxoglutarate + H+ + NADH + ammonia - 4-aminobutanoate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - GABA shunt:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - glutamate degradation IX (via 4-aminobutyrate):
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - superpathway of 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - glutamate degradation IX (via 4-aminobutyrate):
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation I:
2-oxoglutarate + 4-aminobutyrate ⟶ glt + succinate semialdehyde - glutamate degradation IV:
4-aminobutyrate + pyruvate ⟶ ala + succinate semialdehyde - glutamate degradation III (via 4-aminobutyrate):
2-oxoglutarate + 4-aminobutyrate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutyrate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation I:
2-oxoglutarate + 4-aminobutyrate ⟶ glt + succinate semialdehyde - superpathway of 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutyrate ⟶ glt + succinate semialdehyde - glutamate degradation IV:
4-aminobutyrate + pyruvate ⟶ ala + succinate semialdehyde - superpathway of arginine, putrescine, and 4-aminobutyrate degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ 4-(γ-glutamylamino)butanal + ammonium + hydrogen peroxide - superpathway of arginine and ornithine degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ 4-(γ-glutamylamino)butanal + ammonium + hydrogen peroxide - 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - superpathway of 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - superpathway of 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - superpathway of arginine, putrescine, and 4-aminobutyrate degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ 4-(γ-glutamylamino)butanal + ammonium + hydrogen peroxide - superpathway of arginine and ornithine degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ 4-(γ-glutamylamino)butanal + ammonium + hydrogen peroxide - 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutyrate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - glutamate degradation IX (via 4-aminobutyrate):
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation V:
H2O + NAD+ + glt ⟶ 2-oxoglutarate + H+ + NADH + ammonia - superpathway of 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation V:
H2O + NAD+ + glt ⟶ 2-oxoglutarate + H+ + NADH + ammonia - 4-aminobutanoate degradation V:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - 4-aminobutanoate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - 4-aminobutanoate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation V:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - 4-aminobutanoate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - factor 430 biosynthesis:
H+ + Ni-sirohydrochlorin ⟶ Ni2+ + sirohydrochlorin - indole-3-acetate inactivation VIII:
H2O + indole-3-acetyl-glutamate-N-β-D-glucose ⟶ IAA-N-Glc + glu - glucosinolate biosynthesis from tyrosine:
PAPS + desulfosinalbin ⟶ 3',5'-ADP + H+ + sinalbin - glutamate degradation IX:
H2O + NAD+ + glt ⟶ 2-oxoglutarate + H+ + NADH + ammonia - alanine biosynthesis I:
pyruvate + val ⟶ 2-oxoisovalerate + ala - roseoflavin biosynthesis:
8-amino-8-demethylriboflavin + SAM ⟶ 8-demethyl-8-(methylamino)riboflavin + H+ + SAH - gentamicin biosynthesis:
O2 + geneticin + glu ⟶ 2-oxoglutarate + JI-20B + hydrogen peroxide - glutamine biosynthesis:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutamine degradation/glutamate biosynthesis:
H2O + gln ⟶ ammonium + glu - ornithine de novo biosynthesis:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - glutamate biosynthesis/degradation:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - ammonia assimilation cycle I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle II:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - superpathway of ammonia assimilation (plants):
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ethylene biosynthesis IV (engineered):
2-oxoglutarate + H+ + O2 ⟶ CO2 + H2O + ethene - nitrate reduction VI (assimilatory):
H2O + an oxidized ferredoxin [iron-sulfur] cluster + nitrite ⟶ H+ + a reduced ferredoxin [iron-sulfur] cluster + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction V (assimilatory):
H2O + NADP+ + nitrite ⟶ H+ + NADPH + nitrate - methylaspartate cycle:
ATP + hydrogencarbonate + propanoyl-CoA ⟶ (S)-methylmalonyl-CoA + ADP + H+ + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - partial TCA cycle (obligate autotrophs):
oxaloacetate + phosphate ⟶ hydrogencarbonate + phosphoenolpyruvate - L-glutamine biosynthesis III:
oxaloacetate + phosphate ⟶ hydrogencarbonate + phosphoenolpyruvate - L-alanine degradation II (to D-lactate):
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine fermentation to propanoate and acetate:
(R)-lactate + propanoyl-CoA ⟶ (R)-lactoyl-CoA + propanoate - L-glutamate degradation V (via hydroxyglutarate):
acetate + butanoyl-CoA ⟶ acetyl-CoA + butanoate - superpathway of L-citrulline metabolism:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + phosphate - L-citrulline biosynthesis:
an electron-transfer quinone + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + an electron-transfer quinol - L-glutamate biosynthesis III:
H2O + NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamate biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation X:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamate biosynthesis III:
H2O + NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - glutamine biosynthesis:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutamate biosynthesis from ammonia:
H2O + NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - glutamine degradation I:
H2O + gln ⟶ ammonium + glu - citrulline biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - glutamate degradation to 2-oxoglutarate:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamate biosynthesis II:
Glu + H2O + NAD(P)+ ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - ammonia assimilation cycle I:
ATP + Glu + ammonium ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis III:
oxaloacetate + phosphate ⟶ hydrogencarbonate + phosphoenolpyruvate - L-glutamine biosynthesis I:
ATP + Glu + ammonium ⟶ ADP + H+ + gln + phosphate - L-alanine degradation II (to D-lactate):
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ Glu + ammonium - L-glutamate degradation I:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-ornithine biosynthesis II:
Glu + H2O + NAD(P)+ ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate biosynthesis III:
Glu + H2O + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-citrulline biosynthesis:
(S)-1-pyrroline-5-carboxylate + H+ + H2O ⟶ L-glutamate-5-semialdehyde - glutamate-glutamine shuttle:
ATP + Glu + ammonium ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle II:
ATP + Glu + ammonium ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle III:
Glu + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + gln - L-glutamine biosynthesis I:
ATP + Glu + ammonium ⟶ ADP + H+ + gln + phosphate - L-glutamate biosynthesis III:
Glu + H2O + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ Glu + ammonium - ammonia assimilation cycle III:
NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + gln - glutamine biosynthesis I:
ATP + ammonium + glt ⟶ ADP + H+ + gln + phosphate - glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - glutamine degradation I:
H2O + gln ⟶ ammonium + glt - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine biosynthesis I:
ATP + ammonium + glt ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle III:
NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + gln - L-glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glt - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - glutamate degradation X:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate biosynthesis III:
H2O + NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - ammonia assimilation cycle III:
NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + gln - glutamine biosynthesis I:
ATP + ammonium + glt ⟶ ADP + H+ + gln + phosphate - glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - glutamine degradation I:
H2O + gln ⟶ ammonium + glt - glutamate degradation X:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - glutamate biosynthesis II:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - glutamine degradation I:
H2O + gln ⟶ ammonium + glt - glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - glutamine biosynthesis I:
ATP + ammonium + glt ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle III:
NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + gln - glutamine biosynthesis I:
ATP + ammonium + glt ⟶ ADP + H+ + gln + phosphate - glutamine degradation I:
H2O + gln ⟶ ammonium + glt - glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamate biosynthesis II:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation X:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation I:
H2O + NAD+ + glt ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glt - L-glutamine biosynthesis I:
ATP + ammonium + glt ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle III:
NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + gln - L-glutamate and L-glutamine biosynthesis:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamate biosynthesis III:
H2O + NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - ammonia assimilation cycle III:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamate biosynthesis III:
H2O + NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamate biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation X:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle III:
NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + gln - glutamine degradation II:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - L-glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - ammonia assimilation cycle III:
NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + gln - L-ornithine biosynthesis II:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glt - L-glutamine biosynthesis I:
ATP + ammonium + glt ⟶ ADP + H+ + gln + phosphate - aspartate degradation:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - glutamate degradation:
H2O + NAD+ + glt ⟶ 2-oxoglutarate + H+ + NADH + ammonium - ammonia assimilation cycle III:
NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glt - ammonia assimilation cycle III:
NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + gln - L-glutamate biosynthesis II:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - proline biosynthesis II:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-ornithine biosynthesis II:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glt - L-glutamine biosynthesis I:
ATP + ammonium + glt ⟶ ADP + H+ + gln + phosphate - L-glutamate degradation X:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate and L-glutamine biosynthesis:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glt ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis I:
ATP + ammonium + glt ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glt - nitrate reduction VI (assimilatory):
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - glutamine biosynthesis I:
ATP + ammonium + glt ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle III:
NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + gln - glutamine degradation I:
H2O + gln ⟶ ammonium + glt - glutamine degradation I:
H2O + gln ⟶ ammonium + glt - ammonia assimilation cycle III:
NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + gln - glutamine biosynthesis I:
ATP + ammonium + glt ⟶ ADP + H+ + gln + phosphate - glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - glutamine degradation I:
H2O + gln ⟶ ammonium + glt - glutamine degradation I:
H2O + gln ⟶ ammonium + glt - glutamine degradation I:
H2O + gln ⟶ ammonium + glt - L-glutamate biosynthesis III:
Glu + H2O + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ Glu + ammonium - L-glutamate degradation I:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ Glu + pyruvate - ammonia assimilation cycle III:
Glu + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + gln - L-glutamine biosynthesis I:
ATP + Glu + ammonium ⟶ ADP + H+ + gln + phosphate - glutamine biosynthesis I:
ATP + ammonium + glt ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle III:
NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + gln - glutamine degradation I:
H2O + gln ⟶ ammonium + glt - glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glt ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
an oxidized ferredoxin [iron-sulfur] cluster + glt ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - ammonia assimilation cycle I:
NAD+ + glt ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glt - ammonia assimilation cycle III:
NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glt ⟶ ADP + H+ + gln + phosphate - L-glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glt - L-glutamate degradation I:
H2O + NAD+ + glt ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate degradation X:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate biosynthesis II:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - ammonia assimilation cycle III:
NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glt ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ Glu + ammonium - L-glutamate degradation X:
Glu + H2O + NAD(P)+ ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation I:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate degradation V (via hydroxyglutarate):
(R)-2-hydroxyglutarate + NAD+ ⟶ 2-oxoglutarate + H+ + NADH - L-glutamate biosynthesis III:
Glu + H2O + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamate biosynthesis II:
Glu + H2O + NAD(P)+ ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - ammonia assimilation cycle III:
Glu + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + gln - L-glutamine biosynthesis I:
ATP + Glu + ammonium ⟶ ADP + H+ + gln + phosphate - L-glutamate degradation X:
Glu + H2O + NAD(P)+ ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation I:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate biosynthesis III:
Glu + H2O + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamate biosynthesis II:
Glu + H2O + NAD(P)+ ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - ammonia assimilation cycle III:
Glu + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + gln - L-glutamine biosynthesis I:
ATP + Glu + ammonium ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ Glu + ammonium - L-glutamine degradation I:
H2O + gln ⟶ Glu + ammonium - L-glutamine biosynthesis I:
ATP + Glu + ammonium ⟶ ADP + H+ + gln + phosphate - L-glutamate degradation I:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate degradation X:
Glu + H2O + NAD(P)+ ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - ammonia assimilation cycle III:
Glu + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + gln - L-glutamate biosynthesis II:
Glu + H2O + NAD(P)+ ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate biosynthesis III:
Glu + H2O + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamate biosynthesis III:
Glu + H2O + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamate biosynthesis II:
Glu + H2O + NAD(P)+ ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamine degradation I:
H2O + gln ⟶ Glu + ammonium - L-glutamate degradation I:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate degradation X:
Glu + H2O + NAD(P)+ ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - ammonia assimilation cycle III:
Glu + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + gln - L-glutamine biosynthesis I:
ATP + Glu + ammonium ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle III:
NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glt - L-glutamine biosynthesis I:
ATP + ammonium + glt ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glt ⟶ 2-oxoglutarate + H+ + NADH + gln - superpathway of ammonia assimilation (plants):
an oxidized ferredoxin [iron-sulfur] cluster + glt ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glt ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamate biosynthesis III:
Glu + H2O + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - nitrate reduction V (assimilatory):
Glu + H2O + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ Glu + pyruvate - L-glutamate degradation I:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - ammonia assimilation cycle III:
Glu + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + gln - L-glutamine biosynthesis I:
ATP + Glu + ammonium ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ Glu + ammonium - L-glutamate degradation X:
Glu + H2O + NAD(P)+ ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation I:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ Glu + ammonium - L-glutamate biosynthesis II:
Glu + H2O + NAD(P)+ ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamine biosynthesis I:
ATP + Glu + ammonium ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle III:
Glu + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + gln - L-glutamate biosynthesis III:
Glu + H2O + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - glutamate degradation:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + NAD(P)H + ammonia - tRNA charging pathway:
ATP + arg ⟶ AMP + diphosphate - nitrate reduction II (assimilatory):
ATP + ammonia + glt ⟶ ADP + gln + phosphate - superpathway of citrulline metabolism:
ATP + CO2 + H2O + ammonia ⟶ ADP + H+ + carbamoyl-phosphate + phosphate - pyrimidine ribonucleotides interconversion:
ATP + H2O + UTP + gln ⟶ ADP + CTP + H+ + glt + phosphate - tetrahydrofolate biosynthesis II:
ADP + a 10-formyltetrahydrofolate + phosphate ⟶ ATP + a tetrahydrofolate + formate - purine nucleotides de novo biosynthesis II:
5'-phosphoribosyl-4-(N-succinocarboxamide)-5-aminoimidazole ⟶ aminoimidazole carboxamide ribonucleotide + fumarate - superpathway of ornithine degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ γ-glutamyl-γ-aminobutyraldehyde + ammonium + hydrogen peroxide - citrulline biosynthesis:
H2O + gln ⟶ H+ + ammonia + glt - NAD biosynthesis I (from aspartate):
ATP + ammonia + nicotinate adenine dinucleotide ⟶ AMP + NAD+ + diphosphate - γ-glutamyl cycle:
5-oxoproline + ATP + H2O ⟶ ADP + H+ + glt + phosphate - aspartate superpathway:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate - glutathione biosynthesis:
ATP + L-γ-glutamylcysteine + gly ⟶ ADP + H+ + glutathione + phosphate - proline biosynthesis I:
ATP + glt ⟶ ADP + L-glutamate-5-phosphate - tRNA charging pathway:
ATP + H+ + ala ⟶ AMP + diphosphate - folate polyglutamylation:
ATP + a 10-formyltetrahydrofolate + glt ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - 5-aminoimidazole ribonucleotide biosynthesis I:
5'-phosphoribosyl-N-formylglycineamide + ATP + H2O + gln ⟶ 5-phosphoribosyl-N-formylglycineamidine + ADP + H+ + glt + phosphate - 5-aminoimidazole ribonucleotide biosynthesis II:
5'-phosphoribosyl-N-formylglycineamide + ATP + H2O + gln ⟶ 5-phosphoribosyl-N-formylglycineamidine + ADP + H+ + glt + phosphate - putrescine degradation II:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ γ-glutamyl-γ-aminobutyraldehyde + ammonium + hydrogen peroxide - NAD salvage pathway I:
H2O + nicotinamide ⟶ H+ + ammonia + nicotinate - asparagine biosynthesis I:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glt - superpathway of tetrahydrofolate biosynthesis:
7,8-dihydropteroate + ATP + glt ⟶ 7,8-dihydrofolate monoglutamate + ADP + H+ + phosphate - superpathway of chorismate:
glt + phenylpyruvate ⟶ 2-oxoglutarate + phe - glutamine biosynthesis I:
ATP + ammonia + glt ⟶ ADP + gln + phosphate - tetrapyrrole biosynthesis I:
H2O + porphobilinogen ⟶ H+ + ammonia + hydroxymethylbilane - ammonia assimilation cycle II:
ATP + ammonia + glt ⟶ ADP + gln + phosphate - tetrahydrofolate biosynthesis:
7,8-dihydropteroate + ATP + glt ⟶ 7,8-dihydrofolate monoglutamate + ADP + H+ + phosphate - superpathway of tetrahydrofolate biosynthesis and salvage:
7,8-dihydropteroate + ATP + glt ⟶ 7,8-dihydrofolate monoglutamate + ADP + H+ + phosphate - γ-glutamyl cycle:
ATP + cys + glt ⟶ ADP + H+ + L-γ-glutamylcysteine + phosphate - pyrimidine ribonucleotides interconversion:
ATP + CDP ⟶ ADP + CTP - superpathway of citrulline metabolism:
H2O + gln ⟶ H+ + ammonia + glt - citrulline biosynthesis:
H2O + gln ⟶ H+ + ammonia + glt - tRNA charging pathway:
ATP + H+ + ala ⟶ AMP + diphosphate - superpathway of 5-aminoimidazole ribonucleotide biosynthesis:
5-phosphoribosyl-N-formylglycineamidine + ATP ⟶ 5-aminoimidazole ribonucleotide + ADP + H+ + phosphate - NAD biosynthesis from 2-amino-3-carboxymuconate semialdehyde:
ATP + H2O + gln + nicotinate adenine dinucleotide ⟶ AMP + H+ + NAD+ + diphosphate + glt - 5-aminoimidazole ribonucleotide biosynthesis II:
5-phosphoribosyl-N-formylglycineamidine + ATP ⟶ 5-aminoimidazole ribonucleotide + ADP + H+ + phosphate - proline biosynthesis II:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + NAD(P)H + ammonia - L-glutamine biosynthesis II (tRNA-dependent):
ATP + gln ⟶ ADP + glt + phosphate - glutamine biosynthesis II:
ATP + ammonia + glt ⟶ ADP + gln + phosphate - NAD biosynthesis II (from tryptophan):
3-hydroxy-L-kynurenine + H2O ⟶ 3-hydroxyanthranilate + H+ + ala - histamine degradation:
H2O + O2 + histamine ⟶ H+ + ammonia + hydrogen peroxide + imidazole acetaldehyde - folate polyglutamylation:
ATP + a tetrahydrofolate + glt ⟶ ADP + a tetrahydrofolate + phosphate - glutathione biosynthesis:
ATP + cys + glt ⟶ ADP + H+ + L-γ-glutamylcysteine + phosphate - arginine biosynthesis IV:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + NAD(P)H + ammonia - asparagine biosynthesis I:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glt - 5-aminoimidazole ribonucleotide biosynthesis I:
5-phosphoribosyl-N-formylglycineamidine + ATP ⟶ 5-aminoimidazole ribonucleotide + ADP + H+ + phosphate - pyridine nucleotide cycling:
ATP + ammonia + nicotinate adenine dinucleotide ⟶ AMP + NAD+ + diphosphate - 5-aminoimidazole ribonucleotide biosynthesis I:
5-phosphoribosyl-N-formylglycineamidine + ATP ⟶ 5-aminoimidazole ribonucleotide + ADP + H+ + phosphate - glutamine biosynthesis I:
ATP + ammonia + glt ⟶ ADP + H+ + gln + phosphate - purine nucleotides de novo biosynthesis II:
5'-phosphoribosyl-4-(N-succinocarboxamide)-5-aminoimidazole ⟶ aminoimidazole carboxamide ribonucleotide + fumarate - glutathione biosynthesis:
ATP + cys + glt ⟶ ADP + H+ + L-γ-glutamylcysteine + phosphate - proline biosynthesis III:
2-oxoglutarate + L-ornithine ⟶ L-glutamate γ-semialdehyde + glt - superpathway of glutamate biosynthesis:
ATP + ammonia + glt ⟶ ADP + H+ + gln + phosphate - folate polyglutamylation I:
ATP + a 10-formyltetrahydrofolate + glt ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - tRNA charging pathway:
ATP + ala ⟶ AMP + diphosphate - arginine biosynthesis IV:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + NAD(P)H + ammonia - purine nucleotides de novo biosynthesis II:
5'-phosphoribosyl-4-(N-succinocarboxamide)-5-aminoimidazole ⟶ aminoimidazole carboxamide ribonucleotide + fumarate - folate polyglutamylation I:
ATP + a 5,10-methylenetetrahydrofolate + glt ⟶ ADP + a 5,10-methylenetetrahydrofolate + phosphate - tRNA charging pathway:
ATP + ala ⟶ AMP + diphosphate - γ-glutamyl cycle:
ATP + L-γ-glutamylcysteine + gly ⟶ ADP + H+ + glutathione + phosphate - NAD biosynthesis from 2-amino-3-carboxymuconate semialdehyde:
ATP + H2O + gln + nicotinate adenine dinucleotide ⟶ AMP + H+ + NAD+ + diphosphate + glt - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glt ⟶ ADP + a folylpolyglutamate(n) + phosphate - NAD biosynthesis I (from aspartate):
ATP + ammonia + nicotinate adenine dinucleotide ⟶ AMP + H+ + NAD+ + diphosphate - NAD biosynthesis II (from tryptophan):
3-hydroxy-L-kynurenine + H2O ⟶ 3-hydroxyanthranilate + H+ + ala - glutamine biosynthesis I:
ATP + ammonia + glt ⟶ ADP + H+ + gln + phosphate - proline biosynthesis I:
ATP + glt ⟶ ADP + H+ + L-glutamate-5-phosphate - citrulline biosynthesis:
H2O + gln ⟶ H+ + ammonia + glt - nitrate reduction V (assimilatory):
ATP + ammonia + glt ⟶ ADP + H+ + gln + phosphate - NAD salvage pathway I:
H2O + nicotinamide ⟶ H+ + ammonia + nicotinate - glutathione biosynthesis:
ATP + L-γ-glutamylcysteine + gly ⟶ ADP + H+ + glutathione + phosphate - superpathway of NAD biosynthesis in eukaryotes:
H2O + nicotinamide ⟶ H+ + ammonia + nicotinate - asparagine biosynthesis I:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glt - 5-aminoimidazole ribonucleotide biosynthesis I:
5-phosphoribosyl-N-formylglycineamidine + ATP ⟶ 5-aminoimidazole ribonucleotide + ADP + H+ + phosphate - staphyloferrin B biosynthesis:
3-phospho-L-serine + glu ⟶ N-[(2S)-2-amino-2-carboxyethyl]-L-glutamate + phosphate - dapdiamides biosynthesis:
N-3-fumaramoyl-L-2,3-diaminopropanoate + ATP + val ⟶ ADP + H+ + dapdiamide A + phosphate - staphyloferrin B biosynthesis:
2-[(L-alanin-3-ylcarbamoyl)methyl]-3-(2-aminoethylcarbamoyl)-2-hydroxypropanoate + 2-oxoglutarate + ATP ⟶ AMP + H+ + diphosphate + staphyloferrin B - L-lysine biosynthesis I:
N-succinyl-L,L-2,6-diaminopimelate + H2O ⟶ L,L-diaminopimelate + succinate - superpathway of L-lysine, L-threonine and L-methionine biosynthesis I:
ATP + L-homoserine ⟶ ADP + H+ + O-phospho-L-homoserine - aspartate superpathway:
ATP + L-homoserine ⟶ ADP + H+ + O-phospho-L-homoserine - superpathway of L-lysine, L-threonine and L-methionine biosynthesis I:
2-oxoglutarate + asp ⟶ glu + oxaloacetate - L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glu - aspartate superpathway:
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-lysine, L-threonine and L-methionine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + Glu - aspartate superpathway:
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + Glu - L-lysine biosynthesis I:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate - L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt - L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glu - superpathway of L-lysine, L-threonine and L-methionine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt - L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt - aspartate superpathway:
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-lysine biosynthesis I:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH - L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glu - aspartate superpathway:
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-lysine, L-threonine and L-methionine biosynthesis I:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt - aspartate threonine lysine biosynthesis superpathway:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - superpathway of L-lysine, L-threonine and L-methionine biosynthesis I:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - aspartate superpathway:
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt - L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + Glu - UDP-N-acetyl-D-glucosamine biosynthesis II:
D-glucosamine 6-phosphate + acetyl-CoA ⟶ N-acetyl-D-glucosamine 6-phosphate + H+ + coenzyme A - CMP-legionaminate biosynthesis I:
2,4-diacetamido-2,4,6-trideoxy-α-D-mannopyranose + H2O + phosphoenolpyruvate ⟶ 5,7-diacetamido-3,5,7,9-tetradeoxy-D-glycero-D-galacto-nonulopyranosonate + phosphate - chitin biosynthesis:
UDP-N-acetyl-α-D-glucosamine + chitin ⟶ UDP + chitin - superpathway of mycolyl-arabinogalactan-peptidoglycan complex biosynthesis:
D-glucopyranose 6-phosphate ⟶ F6P - O-antigen building blocks biosynthesis (E. coli):
D-glucopyranose 6-phosphate ⟶ F6P - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucopyranose 6-phosphate ⟶ F6P - UDP-N-acetyl-D-galactosamine biosynthesis III:
D-glucopyranose 6-phosphate ⟶ F6P - superpathway of UDP-N-acetylglucosamine-derived O-antigen building blocks biosynthesis:
D-glucopyranose 6-phosphate ⟶ F6P - O-antigen building blocks biosynthesis (E. coli):
NADP+ + dTDP-β-L-rhamnose ⟶ H+ + NADPH + dTDP-4-dehydro-β-L-rhamnose - UDP-N-acetyl-D-glucosamine biosynthesis I:
α-D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis II:
D-glucosamine 6-phosphate + acetyl-CoA ⟶ N-acetyl-D-glucosamine 6-phosphate + H+ + coenzyme A - UDP-N-acetylglucosamine biosynthesis:
D-glucosamine 6-phosphate + acetyl-CoA ⟶ N-acetyl-D-glucosamine 6-phosphate + H+ + coenzyme A - chitin biosynthesis:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - O-antigen building blocks biosynthesis (E. coli):
NADP+ + dTDP-β-L-rhamnose ⟶ H+ + NADPH + dTDP-4-dehydro-β-L-rhamnose - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucopyranose 6-phosphate ⟶ F6P - superpathway of mycolyl-arabinogalactan-peptidoglycan complex biosynthesis:
D-glucopyranose 6-phosphate ⟶ F6P - O-antigen building blocks biosynthesis (E. coli):
NADP+ + dTDP-β-L-rhamnose ⟶ H+ + NADPH + dTDP-4-dehydro-β-L-rhamnose - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - superpathway of mycolyl-arabinogalactan-peptidoglycan complex biosynthesis:
NADP+ + dTDP-β-L-rhamnose ⟶ H+ + NADPH + dTDP-4-dehydro-β-L-rhamnose - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucopyranose 6-phosphate ⟶ F6P - O-antigen building blocks biosynthesis (E. coli):
D-glucopyranose 6-phosphate ⟶ F6P - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis II:
D-glucosamine 6-phosphate + acetyl-CoA ⟶ N-acetyl-D-glucosamine 6-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - peptidoglycan and lipid A precursor biosynthesis:
ATP + UDP-N-acetyl-α-D-muramate + ala ⟶ ADP + H+ + UDP-N-acetyl-α-D-muramoyl-L-alanine + phosphate - O-antigen building blocks biosynthesis (E. coli):
NADP+ + dTDP-β-L-rhamnose ⟶ H+ + NADPH + dTDP-4-dehydro-β-L-rhamnose - UDP-N-acetyl-D-glucosamine biosynthesis I:
α-D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis II:
D-glucosamine 6-phosphate + acetyl-CoA ⟶ N-acetyl-D-glucosamine 6-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - O-antigen building blocks biosynthesis (E. coli):
NADP+ + dTDP-β-L-rhamnose ⟶ H+ + NADPH + dTDP-4-dehydro-β-L-rhamnose - O-antigen building blocks biosynthesis (E. coli):
NADP+ + dTDP-β-L-rhamnose ⟶ H+ + NADPH + dTDP-4-dehydro-β-L-rhamnose - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - O-antigen building blocks biosynthesis (E. coli):
2-oxoglutarate + dTDP-viosamine ⟶ dTDP-4-dehydro-6-deoxy-α-D-glucopyranose + glt - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - O-antigen building blocks biosynthesis (E. coli):
NADP+ + dTDP-β-L-rhamnose ⟶ H+ + NADPH + dTDP-4-dehydro-β-L-rhamnose - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - O-antigen building blocks biosynthesis (E. coli):
NADP+ + dTDP-β-L-rhamnose ⟶ H+ + NADPH + dTDP-4-dehydro-β-L-rhamnose - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - UDP-N-acetyl-D-glucosamine biosynthesis I:
D-glucosamine 1-phosphate + acetyl-CoA ⟶ N-acetyl-α-D-glucosamine 1-phosphate + H+ + coenzyme A - L-histidine degradation I:
4-imidazolone-5-propanoate + H2O ⟶ N-formimino-L-glutamate - histidine degradation I:
N-formimino-L-glutamate + H2O ⟶ formamide + glt - L-histidine degradation I:
N-formimino-L-glutamate + H2O ⟶ formamide + glt - L-histidine degradation I:
4-imidazolone-5-propanoate + H2O ⟶ N-formimino-L-glutamate - L-histidine degradation I:
4-imidazolone-5-propanoate + H2O ⟶ N-formimino-L-glutamate - histidine degradation I:
N-formimino-L-glutamate + H2O ⟶ formamide + glt - L-histidine degradation I:
4-imidazolone-5-propanoate + H2O ⟶ N-formimino-L-glutamate
WikiPathways(0)
Plant Reactome(3322)
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
L-Ser + indole ⟶ H2O + L-Trp - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
L-Ser + indole ⟶ H2O + L-Trp - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
L-Ser + indole ⟶ H2O + L-Trp - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Metabolism and regulation:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pyridoxal 5'-phosphate biosynthesis:
Oxygen + PDXP ⟶ H2O2 + PXLP - Amino acid metabolism:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA - Amino acid biosynthesis:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA - Tryptophan biosynthesis:
indole-3-glycerol-phosphate ⟶ glyceraldehyde 3-phosphate + indole - Arginine biosynthesis I:
H2O + N-acetyl-L-ornithine ⟶ CH3COO- + L-Orn - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
9-mercaptodethiobiotin ⟶ Btn - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Lysine biosynthesis I:
L-Glu + N-succinyl-2-amino-6-ketopimelate ⟶ 2OG + N-succinyl-L,L-2,6-diaminopimelate - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Peptidoglycan biosynthesis I:
ATP + L-Ala + UDP-N-acetylmuramate ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanine - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + indole-3-acetonitrile ⟶ IAA + ammonia - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + indole-3-acetonitrile ⟶ IAA + ammonia - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + indole-3-acetonitrile ⟶ IAA + ammonia - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + indole-3-acetonitrile ⟶ IAA + ammonia - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + indole-3-acetonitrile ⟶ IAA + ammonia - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + indole-3-acetonitrile ⟶ IAA + ammonia - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + indole-3-acetonitrile ⟶ IAA + ammonia - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + indole-3-acetonitrile ⟶ IAA + ammonia - Hormone signaling, transport, and metabolism:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate + Oxygen ⟶ CH3COO- + jasmonic acid - IAA biosynthesis I:
CH3COO- + indole ⟶ IAA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + indole-3-acetonitrile ⟶ IAA + ammonia - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Inorganic nutrients metabolism:
Nitrite ⟶ H2O + ammonia - Response to iron deficiency:
2OG + nicotianamine ⟶ 3''-deamino-3''-oxonicotianamine + L-Glu - Mugineic acid biosynthesis:
2OG + nicotianamine ⟶ 3''-deamino-3''-oxonicotianamine + L-Glu - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
2OG + L-Asp ⟶ L-Glu + OA - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
2OG + L-Asp ⟶ L-Glu + OA - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
2OG + L-Val ⟶ Glu + KIV - Asparagine degradation I:
2OG + L-Asp ⟶ L-Glu + OA - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
2OG + L-Asp ⟶ L-Glu + OA - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
2OG + L-Asp ⟶ L-Glu + OA - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
2OG + L-Val ⟶ Glu + KIV - Asparagine degradation I:
2OG + L-Asp ⟶ L-Glu + OA - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
2OG + L-Val ⟶ Glu + KIV - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine biosynthesis I:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + SACN ⟶ L-Glu + NADH + allysine - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
2OG + L-Lys + TPNH ⟶ H2O + SACN + TPN - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + SACN ⟶ L-Glu + NADH + allysine - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
2OG + L-Lys + TPNH ⟶ H2O + SACN + TPN - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + SACN ⟶ L-Glu + NADH + allysine - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
2OG + L-Lys + TPNH ⟶ H2O + SACN + TPN - Lysine degradation II:
H2O + NAD + SACN ⟶ L-Glu + NADH + allysine - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
2OG + L-Lys + TPNH ⟶ H2O + SACN + TPN - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
2OG + L-Lys + TPNH ⟶ H2O + SACN + TPN - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + SACN ⟶ L-Glu + NADH + allysine - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
ADP + Pi + an N10-formyl-tetrahydrofolate ⟶ ATP + HCOOH + a tetrahydrofolate polyglutamate - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Cofactor biosyntheses:
5,10-methylene-THF + H2O + KIV ⟶ 2-dehydropantoate + THF - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
2OBUTA + PYR ⟶ 2-aceto-2-hydroxy-butyrate + carbon dioxide - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
2OBUTA + PYR ⟶ 2-aceto-2-hydroxy-butyrate + carbon dioxide - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Lysine biosynthesis II:
H2O + N-acetyl-L,L-2,6-diaminopimelate ⟶ CH3COO- + L,L-diaminopimelate - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
1PYR-5COOH + H2O + NAD ⟶ Glu + NADH - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Arginine degradation:
H2O + L-Arg ⟶ L-Orn + Urea - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
1PYR-5COOH + H2O + NAD ⟶ Glu + NADH - Arginine degradation:
H2O + L-Arg ⟶ L-Orn + Urea - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
1PYR-5COOH + H2O + NAD ⟶ Glu + NADH - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
1PYR-5COOH + H2O + NAD ⟶ Glu + NADH - Proline degradation:
1PYR-5COOH + H2O + NAD ⟶ Glu + NADH - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Arginine degradation:
H2O + L-Arg ⟶ L-Orn + Urea - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Arginine degradation:
1PYR-5COOH + H+ + NAD(P)H ⟶ L-Pro + NAD(P)+ - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
1PYR-5COOH + H2O + NAD ⟶ Glu + NADH - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Arginine degradation:
1PYR-5COOH + H+ + NAD(P)H ⟶ L-Pro + NAD(P)+ - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Arginine degradation:
1PYR-5COOH + NAD ⟶ Glu + H+ + NADH - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
1PYR-5COOH + H2O + NAD ⟶ Glu + NADH - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
1PYR-5COOH + H2O + NAD ⟶ Glu + NADH - Arginine degradation:
H2O + L-Arg ⟶ L-Orn + Urea - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
1PYR-5COOH + H2O + NAD ⟶ Glu + NADH - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Histidine biosynthesis I:
ATP + PRPP ⟶ PPi + phosphoribosyl-ATP - Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Lysine biosynthesis VI:
H2O + L-2,3,4,5-Tetrahydrodipicolinate + L-Glu ⟶ 2OG + LL-2,6-Diaminopimelate - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Gamma-glutamyl cycle:
ATP + H2O + OPRO ⟶ ADP + L-Glu + Pi - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis II (acetyl cycle):
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis II (acetyl cycle):
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis II (acetyl cycle):
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis II (acetyl cycle):
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis II (acetyl cycle):
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis II (acetyl cycle):
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Ornithine biosynthesis:
H2O + N-acetyl-L-ornithine ⟶ CH3COO- + L-Orn - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis II (acetyl cycle):
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
2-acetamido-5-oxopentanoic acid + L-Glu ⟶ 2OG + N-acetyl-L-ornithine - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
DMAPP + genistein ⟶ PPi + lupiwighteone - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
DMAPP + genistein ⟶ PPi + lupiwighteone - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
L-Phe ⟶ ammonia + trans-cinnamate - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
L-Phe + PYR ⟶ L-Ala + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - tyrosine degradation I:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis I:
2OG + H+ + TPNH + ammonia ⟶ H2O + L-Glu + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Proline biosynthesis I:
H+ + L-glutamate-5-phosphate + TPNH ⟶ L-Glu5S + Pi + TPN - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine degradation:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine degradation:
2OG + L-Val ⟶ Glu + KIV - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
KIV + L-Glu ⟶ 2OG + L-Val - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
KIV + L-Glu ⟶ 2OG + L-Val - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine degradation:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine degradation:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine degradation:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine degradation:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Valine degradation:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
KIV + L-Glu ⟶ 2OG + L-Val - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine degradation:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine degradation:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
2OG + L-Val ⟶ Glu + KIV - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine degradation:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
KIV + L-Glu ⟶ 2OG + L-Val - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine degradation:
2OG + L-Val ⟶ Glu + KIV - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Glutamate synthase cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis IV:
2OG + H+ + L-Gln + NADH ⟶ L-Glu + NAD - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + L-Glu + a tetrahydrofolate polyglutamate ⟶ ADP + Pi + a tetrahydrofolate polyglutamate - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + L-Glu + a tetrahydrofolate polyglutamate ⟶ ADP + Pi + a tetrahydrofolate polyglutamate - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Folate polyglutamylation I:
ATP + L-Glu + a tetrahydrofolate polyglutamate ⟶ ADP + Pi + a tetrahydrofolate polyglutamate - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Gamma-glutamyl cycle:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + L-Glu + a tetrahydrofolate polyglutamate ⟶ ADP + Pi + a tetrahydrofolate polyglutamate - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + L-Cys + L-Glu ⟶ ADP + Pi + gGluCys - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Glutathione biosynthesis:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Asparagine biosynthesis III:
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Glutamine biosynthesis I:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Folate polyglutamylation I:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi - Folate polyglutamylation II:
ATP + L-Glu + a folylpolyglutamate(n) ⟶ ADP + Pi + a folylpolyglutamate(n+1) - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Nitrate assimilation:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Secondary metabolism:
GPP + H2O ⟶ PPi + geraniol - UDP-N-acetylgalactosamine biosynthesis:
Fru(6)P + L-Gln ⟶ GlcN6P + L-Glu - Cysteine degradation:
H2O + L-Cys ⟶ PYR + S(2-) + ammonia
INOH(0)
PlantCyc(3245)
- superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
ATP + H2O + XMP + gln ⟶ AMP + GMP + H+ + diphosphate + glu - superpathway of purine nucleotides de novo biosynthesis I:
ATP + H2O + XMP + gln ⟶ AMP + GMP + H+ + diphosphate + glu - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
SAICAR ⟶ AICAR + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
ATP + GMP ⟶ ADP + GDP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
ATP + GMP ⟶ ADP + GDP - superpathway of guanosine nucleotides de novo biosynthesis I:
ATP + GMP ⟶ ADP + GDP - guanosine ribonucleotides de novo biosynthesis:
ATP + GMP ⟶ ADP + GDP - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - superpathway of guanosine nucleotides de novo biosynthesis I:
ATP + H2O + XMP + gln ⟶ AMP + GMP + H+ + diphosphate + glu - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - camalexin biosynthesis:
2-(cystein-S-yl)-2-(1H-indol-3-yl)-acetonitrile + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (R)-dihydrocamalexate + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] + hydrogen cyanide - camalexin biosynthesis:
(R)-dihydrocamalexate + H+ + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ CO2 + H2O + an oxidized [NADPH-hemoprotein reductase] + camalexin - camalexin biosynthesis:
(R)-dihydrocamalexate + H+ + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ CO2 + H2O + an oxidized [NADPH-hemoprotein reductase] + camalexin - camalexin biosynthesis:
(R)-dihydrocamalexate + H+ + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ CO2 + H2O + an oxidized [NADPH-hemoprotein reductase] + camalexin - camalexin biosynthesis:
(R)-dihydrocamalexate + H+ + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ CO2 + H2O + an oxidized [NADPH-hemoprotein reductase] + camalexin - camalexin biosynthesis:
(R)-dihydrocamalexate + H+ + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ CO2 + H2O + an oxidized [NADPH-hemoprotein reductase] + camalexin - camalexin biosynthesis:
2-(cystein-S-yl)-2-(1H-indol-3-yl)-acetonitrile + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (R)-dihydrocamalexate + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] + hydrogen cyanide - camalexin biosynthesis:
(R)-dihydrocamalexate + H+ + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ CO2 + H2O + an oxidized [NADPH-hemoprotein reductase] + camalexin - camalexin biosynthesis:
(R)-dihydrocamalexate + H+ + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ CO2 + H2O + an oxidized [NADPH-hemoprotein reductase] + camalexin - camalexin biosynthesis:
2-(cystein-S-yl)-2-(1H-indol-3-yl)-acetonitrile + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (R)-dihydrocamalexate + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] + hydrogen cyanide - camalexin biosynthesis:
(R)-dihydrocamalexate + H+ + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ CO2 + H2O + an oxidized [NADPH-hemoprotein reductase] + camalexin - camalexin biosynthesis:
(R)-dihydrocamalexate + H+ + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ CO2 + H2O + an oxidized [NADPH-hemoprotein reductase] + camalexin - camalexin biosynthesis:
(R)-dihydrocamalexate + H+ + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ CO2 + H2O + an oxidized [NADPH-hemoprotein reductase] + camalexin - camalexin biosynthesis:
(R)-dihydrocamalexate + H+ + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ CO2 + H2O + an oxidized [NADPH-hemoprotein reductase] + camalexin - camalexin biosynthesis:
(R)-dihydrocamalexate + H+ + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ CO2 + H2O + an oxidized [NADPH-hemoprotein reductase] + camalexin - camalexin biosynthesis:
(R)-dihydrocamalexate + H+ + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ CO2 + H2O + an oxidized [NADPH-hemoprotein reductase] + camalexin - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - UMP biosynthesis I:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis I (via L-ornithine):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis II (acetyl cycle):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis III:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis III:
(S)-dihydroorotate + NAD+ ⟶ H+ + NADH + orotate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
L-arginino-succinate ⟶ arg + fumarate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis II:
(S)-dihydroorotate + fumarate ⟶ orotate + succinate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis II:
(S)-dihydroorotate + fumarate ⟶ orotate + succinate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis I (via L-ornithine):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis II (acetyl cycle):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis III:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis II:
(S)-dihydroorotate + fumarate ⟶ orotate + succinate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis II:
(S)-dihydroorotate + fumarate ⟶ orotate + succinate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis III:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis I (via L-ornithine):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis II (acetyl cycle):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - UMP biosynthesis I:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-arginine biosynthesis II (acetyl cycle):
N-acetyl-L-ornithine + glu ⟶ N-acetyl-L-glutamate + L-ornithine - ornithine-citrulline shuttle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + H2O + carbamoyl phosphate - ornithine-citrulline shuttle:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - UMP biosynthesis I:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis II (acetyl cycle):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
ATP + H2O + UTP + gln ⟶ ADP + CTP + H+ + glu + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - folate polyglutamylation:
ATP + a 5,10-methylenetetrahydrofolate + glu ⟶ ADP + a 5,10-methylenetetrahydrofolate + phosphate - L-lysine degradation I:
5-aminopentanal + H2O + NAD+ ⟶ 5-aminopentanoate + H+ + NADH - L-lysine degradation I:
2-oxoglutarate + cadaverine ⟶ 5-aminopentanal + D-or-L-glutamate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin 3'-phosphate + H2O ⟶ 7,8-dihydroneopterin + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - folate polyglutamylation:
ATP + a tetrahydrofolate + glu ⟶ ADP + a tetrahydrofolate + phosphate - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate - folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - superpathway of indole-3-acetate conjugate biosynthesis:
(indol-3-yl)acetate + ATP + gln ⟶ AMP + H+ + IAA-Gln + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + gln ⟶ AMP + H+ + IAA-Gln + diphosphate - superpathway of tetrahydrofolate biosynthesis:
7,8-dihydroneopterin 3'-phosphate + H2O ⟶ 7,8-dihydroneopterin + phosphate - tetrahydrofolate biosynthesis:
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate - superpathway of tetrahydrofolate biosynthesis:
7,8-dihydroneopterin 3'-phosphate + H2O ⟶ 7,8-dihydroneopterin + phosphate - tetrahydrofolate biosynthesis:
(7,8-dihydropterin-6-yl)methyl diphosphate + 4-aminobenzoate ⟶ 7,8-dihydropteroate + diphosphate - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin 3'-phosphate + H2O ⟶ 7,8-dihydroneopterin + phosphate - superpathway of tetrahydrofolate biosynthesis:
GTP + H2O ⟶ 7,8-dihydroneopterin 3'-triphosphate + H+ + formate - tetrahydrofolate biosynthesis I:
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
4-amino-4-deoxychorismate ⟶ 4-aminobenzoate + H+ + pyruvate - tetrahydrofolate biosynthesis:
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate - superpathway of tetrahydrofolate biosynthesis:
4-amino-4-deoxychorismate ⟶ 4-aminobenzoate + H+ + pyruvate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + asp ⟶ AMP + H+ + IAA-Asp + diphosphate - superpathway of indole-3-acetate conjugate biosynthesis:
1-O-(indol-3-ylacetyl)-β-D-glucose + myo-inositol ⟶ 1D-1-O-(indol-3-yl)acetyl-myo-inositol + D-glucopyranose - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + asp ⟶ AMP + H+ + IAA-Asp + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + val ⟶ AMP + H+ + IAA-Val + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + asp ⟶ AMP + H+ + IAA-Asp + diphosphate - superpathway of indole-3-acetate conjugate biosynthesis:
1-O-(indol-3-ylacetyl)-β-D-glucose + myo-inositol ⟶ 1D-1-O-(indol-3-yl)acetyl-myo-inositol + D-glucopyranose - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + phe ⟶ AMP + H+ + IAA-Phe + diphosphate - superpathway of indole-3-acetate conjugate biosynthesis:
1-O-(indol-3-ylacetyl)-β-D-glucose + myo-inositol ⟶ 1D-1-O-(indol-3-yl)acetyl-myo-inositol + D-glucopyranose - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - GABA shunt II:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - GABA shunt II:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - GABA shunt II:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - GABA shunt II:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - GABA shunt II:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-asparagine biosynthesis III (tRNA-dependent):
ammonium ⟶ H+ + phosphate - L-alanine degradation II (to D-lactate):
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-citrulline biosynthesis:
(S)-1-pyrroline-5-carboxylate + H+ + H2O ⟶ L-glutamate-5-semialdehyde - L-glutamate biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamate biosynthesis III:
H2O + NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate biosynthesis III:
H2O + NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamate biosynthesis III:
H2O + NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - superpathway of L-citrulline metabolism:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + phosphate - L-glutamate biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - ammonia assimilation cycle I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-citrulline biosynthesis:
an electron-transfer quinone + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + an electron-transfer quinol - L-asparagine biosynthesis III (tRNA-dependent):
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamate biosynthesis III:
H2O + NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamate biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
ammonium ⟶ H+ + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - Inorganic Nitrogen Assimilation:
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - superpathway of ammonia assimilation (plants):
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - Organic Nitrogen Assimilation:
H2O + O2 + urate ⟶ CO2 + allantoin + hydrogen peroxide - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamine biosynthesis III:
oxaloacetate + phosphate ⟶ hydrogencarbonate + phosphoenolpyruvate - glutamate-glutamine shuttle:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
(R)-lactate + NAD+ ⟶ H+ + NADH + pyruvate - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
(R)-lactate + NAD+ ⟶ H+ + NADH + pyruvate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-alanine degradation II (to D-lactate):
(R)-lactate + NAD+ ⟶ H+ + NADH + pyruvate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - L-alanine degradation II (to D-lactate):
(R)-lactate + NAD+ ⟶ H+ + NADH + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
(R)-lactate + NAD+ ⟶ H+ + NADH + pyruvate - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
(R)-lactate + NAD+ ⟶ H+ + NADH + pyruvate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
(R)-lactate + NAD+ ⟶ H+ + NADH + pyruvate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis III:
oxaloacetate + phosphate ⟶ hydrogencarbonate + phosphoenolpyruvate - L-citrulline biosynthesis:
an electron-transfer quinone + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + an electron-transfer quinol - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - superpathway of ammonia assimilation (plants):
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - ammonia assimilation cycle II:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-alanine degradation II (to D-lactate):
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis III:
oxaloacetate + phosphate ⟶ hydrogencarbonate + phosphoenolpyruvate - superpathway of ammonia assimilation (plants):
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - superpathway of L-citrulline metabolism:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + phosphate - glutamate-glutamine shuttle:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-glutamine biosynthesis III:
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - ammonia assimilation cycle II:
an oxidized ferredoxin [iron-sulfur] cluster + glu ⟶ 2-oxoglutarate + H+ + a reduced ferredoxin [iron-sulfur] cluster + gln - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-glutamine biosynthesis III:
citrate ⟶ cis-aconitate + H2O - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-citrulline biosynthesis:
H2O + gln ⟶ ammonium + glu - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - ammonia assimilation cycle II:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamine degradation I:
H2O + gln ⟶ ammonium + glu - ammonia assimilation cycle I:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - L-alanine degradation II (to D-lactate):
(R)-lactate + NAD+ ⟶ H+ + NADH + pyruvate - glutaminyl-tRNAgln biosynthesis via transamidation:
H2O + gln ⟶ ammonium + glu - L-glutamine biosynthesis I:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-glutamine biosynthesis III:
ATP + phosphate + pyruvate ⟶ AMP + H+ + diphosphate + phosphoenolpyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - superpathway of ammonia assimilation (plants):
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - Organic Nitrogen Assimilation:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - Inorganic Nitrogen Assimilation:
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glu - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - UDP-N-acetyl-D-glucosamine biosynthesis II:
F6P + gln ⟶ D-glucosamine 6-phosphate + glu
COVID-19 Disease Map(0)
PathBank(0)
PharmGKB(0)
0 个相关的物种来源信息
在这里通过桑基图来展示出与当前的这个代谢物在我们的BioDeep知识库中具有相关联信息的其他代谢物。在这里进行关联的信息来源主要有：
- PubMed: 来源于PubMed文献库中的文献信息，我们通过自然语言数据挖掘得到的在同一篇文献中被同时提及的相关代谢物列表，这个列表按照代谢物同时出现的文献数量降序排序，取前10个代谢物作为相关研究中关联性很高的代谢物集合展示在桑基图中。
- NCBI Taxonomy: 通过文献数据挖掘，得到的代谢物物种来源信息关联。这个关联信息同样按照出现的次数降序排序，取前10个代谢物作为高关联度的代谢物集合展示在桑吉图上。
- Chemical Taxonomy: 在物质分类上处于同一个分类集合中的其他代谢物
- Chemical Reaction: 在化学反应过程中，存在为当前代谢物相关联的生化反应过程中的反应底物或者反应产物的关联代谢物信息。
点击图上的相关代谢物的名称，可以跳转到相关代谢物的信息页面。
文献列表
- Minako Oda, Kousuke Fujibayashi, Minoru Wakasa, Shintaro Takano, Wataru Fujita, Michihiko Kitayama, Hiroaki Nakanishi, Kazuyuki Saito, Yasuyuki Kawai, Kouji Kajinami. Increased plasma glutamate in non-smokers with vasospastic angina pectoris is associated with plasma cystine and antioxidant capacity.
Scandinavian cardiovascular journal : SCJ.
2022 12; 56(1):180-186. doi:
10.1080/14017431.2022.2085884. [PMID: 35695518] - Laura M McNair, Graeme F Mason, Golam Mi Chowdhury, Lihong Jiang, Xiaoxian Ma, Douglas L Rothman, Helle S Waagepetersen, Kevin L Behar. Rates of pyruvate carboxylase, glutamate and GABA neurotransmitter cycling, and glucose oxidation in multiple brain regions of the awake rat using a combination of [2-13C]/[1-13C]glucose infusion and 1H-[13C]NMR ex vivo.
Journal of cerebral blood flow and metabolism : official journal of the International Society of Cerebral Blood Flow and Metabolism.
2022 08; 42(8):1507-1523. doi:
10.1177/0271678x221074211. [PMID: 35048735] - Domenica Donatella Li Puma, Cristian Ripoli, Giulia Puliatti, Francesco Pastore, Giacomo Lazzarino, Barbara Tavazzi, Ottavio Arancio, Roberto Piacentini, Claudio Grassi. Extracellular tau oligomers affect extracellular glutamate handling by astrocytes through downregulation of GLT-1 expression and impairment of NKA1A2 function.
Neuropathology and applied neurobiology.
2022 08; 48(5):e12811. doi:
10.1111/nan.12811. [PMID: 35274343] - Yanhua Chen, Qianlun Pu, Fengting Yu, Xian Ding, Yu Sun, Qinglan Guo, Jiangong Shi, Jianjun Zhang, Zeper Abliz. Comprehensive quantitative method for neurotransmitters to study the activity of a sedative-hypnotic candidate using microdialysis and LC×LC-MS/MS.
Talanta.
2022 Aug; 245(?):123418. doi:
10.1016/j.talanta.2022.123418. [PMID: 35472683] - Marzieh Jafari Fakharbad, Mohammad Moshiri, Mohammad Mehdi Ommati, Mehdi Talebi, Leila Etemad. A review of basic to clinical studies of the association between hyperammonemia, methamphetamine.
Naunyn-Schmiedeberg's archives of pharmacology.
2022 08; 395(8):921-931. doi:
10.1007/s00210-022-02248-w. [PMID: 35604430] - Santi Devi Upadhaya, Sang Seon Lee, Young Hwa Kim, Zhenlong Wu, In Ho Kim. Effects of supplementation of graded level of glutamic acid to crude protein reduced diets on the performance of growing pigs.
Journal of animal physiology and animal nutrition.
2022 Jul; 106(4):825-831. doi:
10.1111/jpn.13625. [PMID: 34423869] - Lucia Caffino, Francesca Mottarlini, Giorgia Targa, Michel M M Verheij, Fabio Fumagalli, Judith R Homberg. Responsivity of serotonin transporter knockout rats to short and long access to cocaine: Modulation of the glutamate signalling in the nucleus accumbens shell.
British journal of pharmacology.
2022 07; 179(14):3727-3739. doi:
10.1111/bph.15823. [PMID: 35174489] - María Paz Guerrero-Molina, Montserrat Morales-Conejo, Aitor Delmiro, María Morán, Cristina Domínguez-González, Elena Arranz-Canales, Ana Ramos-González, Joaquín Arenas, Miguel A Martín, Jesús González de la Aleja. Elevated glutamate and decreased glutamine levels in the cerebrospinal fluid of patients with MELAS syndrome.
Journal of neurology.
2022 Jun; 269(6):3238-3248. doi:
10.1007/s00415-021-10942-7. [PMID: 35088140] - Yue Yang, Pingya He, Yuhao Hou, Zhicheng Liu, Xiaoping Zhang, Ning Li. Osmundacetone modulates mitochondrial metabolism in non-small cell lung cancer cells by hijacking the glutamine/glutamate/α-KG metabolic axis.
Phytomedicine : international journal of phytotherapy and phytopharmacology.
2022 Jun; 100(?):154075. doi:
10.1016/j.phymed.2022.154075. [PMID: 35413646] - Harald John, Philipp Hörmann, Michael Schrader, Horst Thiermann. Alkylated glutamic acid and histidine derived from protein-adducts indicate exposure to sulfur mustard in avian serum.
Drug testing and analysis.
2022 Jun; 14(6):1140-1148. doi:
10.1002/dta.3236. [PMID: 35137544] - Wanting Chen, Qian Li, Ranran Hou, Huaguo Liang, Yongli Zhang, Yongxia Yang. An integrated metabonomics study to reveal the inhibitory effect and metabolism regulation of taurine on breast cancer.
Journal of pharmaceutical and biomedical analysis.
2022 May; 214(?):114711. doi:
10.1016/j.jpba.2022.114711. [PMID: 35306435] - Yanru Zhu, Feng Wang, Yunli Zhao, Miao Yu, Mingyan Ma, Zhiguo Yu. A sensitive HILIC-MS/MS method for quantification of theanine in rat plasma and tissues: Application to preclinical pharmacokinetic study.
Journal of chromatography. B, Analytical technologies in the biomedical and life sciences.
2022 May; 1198(?):123248. doi:
10.1016/j.jchromb.2022.123248. [PMID: 35428008] - S Kent Dickeson, Sunil Kumar, Mao-Fu Sun, Bassem M Mohammed, Dennis R Phillips, James C Whisstock, Adam J Quek, Edward P Feener, Ruby H P Law, David Gailani. A mechanism for hereditary angioedema caused by a lysine 311-to-glutamic acid substitution in plasminogen.
Blood.
2022 05; 139(18):2816-2829. doi:
10.1182/blood.2021012945. [PMID: 35100351] - Gergely Pallag, Sara Nazarian, Dora Ravasz, David Bui, Timea Komlódi, Carolina Doerrier, Erich Gnaiger, Thomas N Seyfried, Christos Chinopoulos. Proline Oxidation Supports Mitochondrial ATP Production When Complex I Is Inhibited.
International journal of molecular sciences.
2022 May; 23(9):. doi:
10.3390/ijms23095111. [PMID: 35563503] - Jonas Holm, Gabriele Ferrari, Anders Holmgren, Farkas Vanky, Örjan Friberg, Mårten Vidlund, Rolf Svedjeholm. Effect of glutamate infusion on NT-proBNP after coronary artery bypass grafting in high-risk patients (GLUTAMICS II): A randomized controlled trial.
PLoS medicine.
2022 05; 19(5):e1003997. doi:
10.1371/journal.pmed.1003997. [PMID: 35533197] - Shuo Gu, Tingting Mou, Jian Chen, Jing Wang, Ying Zhang, Meirong Cui, Wenqian Hao, Yue Sun, Chengqin Zhang, Tiantian Zhao, Binbin Wei. Develop a stepwise integrated method to screen biomarkers of Baihe-Dihuang Tang on the treatment of depression in rats applying with composition screened, untargeted, and targeted metabolomics analysis.
Journal of separation science.
2022 May; 45(10):1656-1671. doi:
10.1002/jssc.202100841. [PMID: 35234356] - Chae Gyu Park, Min Kyung Chu. Interictal plasma glutamate levels are elevated in individuals with episodic and chronic migraine.
Scientific reports.
2022 04; 12(1):6921. doi:
10.1038/s41598-022-10883-9. [PMID: 35484312] - Kouji Fukuyama, Motohiro Okada. Brivaracetam and Levetiracetam Suppress Astroglial L-Glutamate Release through Hemichannel via Inhibition of Synaptic Vesicle Protein.
International journal of molecular sciences.
2022 Apr; 23(9):. doi:
10.3390/ijms23094473. [PMID: 35562864] - Yinan Chen, Lei Hu, Hexin Lin, Huangdao Yu, Jun You. Serum metabolomic profiling for patients with adenocarcinoma of the esophagogastric junction.
Metabolomics : Official journal of the Metabolomic Society.
2022 04; 18(5):26. doi:
10.1007/s11306-022-01883-x. [PMID: 35441991] - S Hisadomi, A Haruno, T Fujieda, T Sugino, M Oba. Effects of rumen-protected glutamate supplementation during the periparturient period on digestibility, inflammation, metabolic responses, and performance in dairy cows.
Journal of dairy science.
2022 Apr; 105(4):3129-3141. doi:
10.3168/jds.2021-21357. [PMID: 35086702] - Lise Verbruggen, Gamze Ates, Olaya Lara, Jolien De Munck, Agnès Villers, Laura De Pauw, Sigrid Ottestad-Hansen, Sho Kobayashi, Pauline Beckers, Pauline Janssen, Hideyo Sato, Yun Zhou, Emmanuel Hermans, Rose Njemini, Lutgarde Arckens, Niels C Danbolt, Dimitri De Bundel, Joeri L Aerts, Kurt Barbé, Benoit Guillaume, Laurence Ris, Eduard Bentea, Ann Massie. Lifespan extension with preservation of hippocampal function in aged system xc--deficient male mice.
Molecular psychiatry.
2022 Apr; 27(4):2355-2368. doi:
10.1038/s41380-022-01470-5. [PMID: 35181756] - Claudia Sikorski, Sandi Azab, Russell J de Souza, Meera Shanmuganathan, Dipika Desai, Koon Teo, Stephanie A Atkinson, Katherine Morrison, Milan Gupta, Philip Britz-McKibbin, Sonia S Anand. Serum metabolomic signatures of gestational diabetes in South Asian and white European women.
BMJ open diabetes research & care.
2022 04; 10(2):. doi:
10.1136/bmjdrc-2021-002733. [PMID: 35450870] - Remy Verhaeghe, Vance Gao, Sara Morley-Fletcher, Hammou Bouwalerh, Gilles Van Camp, Francesca Cisani, Ferdinando Nicoletti, Stefania Maccari. Maternal stress programs a demasculinization of glutamatergic transmission in stress-related brain regions of aged rats.
GeroScience.
2022 04; 44(2):1047-1069. doi:
10.1007/s11357-021-00375-5. [PMID: 33983623] - Kouji Fukuyama, Eishi Motomura, Takashi Shiroyama, Motohiro Okada. Impact of 5-HT7 receptor inverse agonism of lurasidone on monoaminergic tripartite synaptic transmission and pathophysiology of lower risk of weight gain.
Biomedicine & pharmacotherapy = Biomedecine & pharmacotherapie.
2022 Apr; 148(?):112750. doi:
10.1016/j.biopha.2022.112750. [PMID: 35219120] - Sudhish Gupta, Rajesh Chetiwal, Amit Kumar, Priyank Rastogi, Saurabh Gupta, Pradeep Tomar. Serum Glutamic Oxaloacetic Transaminase - Predictor in Detection of Early Neurological Deterioration in Acute Ischemic Stroke.
The Journal of the Association of Physicians of India.
2022 Apr; 70(4):11-12. doi:
NULL. [PMID: 35443420] - Jefrin Sultana, Dibya Jyoti Sharma. Evaluation of Serum Ferritin as a Prognostic Marker in Acute Ischemic Stroke Patients-A Prospective Cohort Study.
The Journal of the Association of Physicians of India.
2022 Apr; 70(4):11-12. doi:
NULL. [PMID: 35443413] - Yindan Lin, Ze Yang, Jingjia Li, Yandi Sun, Xueyun Zhang, Zihao Qu, Yan Luo, Lihong Zhang. Effects of glutamate and aspartate on prostate cancer and breast cancer: a Mendelian randomization study.
BMC genomics.
2022 Mar; 23(1):213. doi:
10.1186/s12864-022-08442-7. [PMID: 35296245] - Laura Sánchez-Marín, Maria Flores-López, Antoni Pastor, Ana Luisa Gavito, Juan Suárez, Rafael de la Torre, Francisco Javier Pavón, Fernando Rodríguez de Fonseca, Antonia Serrano. Acute stress and alcohol exposure during adolescence result in an anxious phenotype in adulthood: Role of altered glutamate/endocannabinoid transmission mechanisms.
Progress in neuro-psychopharmacology & biological psychiatry.
2022 03; 113(?):110460. doi:
10.1016/j.pnpbp.2021.110460. [PMID: 34695542] - Anna Szeliga, Ewa Rudnicka, Marzena Maciejewska-Jeske, Marek Kucharski, Anna Kostrzak, Marta Hajbos, Olga Niwczyk, Roman Smolarczyk, Blazej Meczekalski. Neuroendocrine Determinants of Polycystic Ovary Syndrome.
International journal of environmental research and public health.
2022 03; 19(5):. doi:
10.3390/ijerph19053089. [PMID: 35270780] - Thaysa Mara Gazzotto Neves, Estefania Simoes, Maria Concepcíon García Otaduy, Elie Leal de Barros Calfat, Pâmela Bertolazzi, Naomi Antunes da Costa, Fábio Luís de Souza Duran, Joanna Correia-Lima, Maria da Graça Morais Martin, Marília Cerqueira Leite Seelander, Victor Henrique Oyamada Otani, Thais Zélia Dos Santos Otani, Daniel Augusto Corrêa Vasques, Geraldo Busatto Filho, Cristiane Kochi, Ricardo Riyoiti Uchida. Inverse Association Between Hypothalamic N-Acetyl Aspartate/Creatine Ratio and Indices of Body Mass in Adolescents with Obesity.
The Journal of nutrition.
2022 03; 152(3):663-670. doi:
10.1093/jn/nxab415. [PMID: 34888674] - Carla Perego, Eliana S Di Cairano, Alessandra Galli, Stefania Moretti, Elena Bazzigaluppi, Victoria Frolich Centonze, Amalia Gastaldelli, Emma Assi, Paolo Fiorina, Massimo Federici, Ottavia Porzio, Federico Bertuzzi, Alberto M Davalli, Franco Folli. Autoantibodies against the glial glutamate transporter GLT1/EAAT2 in Type 1 diabetes mellitus-Clues to novel immunological and non-immunological therapies.
Pharmacological research.
2022 03; 177(?):106130. doi:
10.1016/j.phrs.2022.106130. [PMID: 35151858] - Dilşad Yıldız Miniksar, Mehmet Akif Cansız, Mahmut Kılıç, Ayşe Yeşim Göçmen. Relationship between sleep problems and chronotypes of children and adolescents with attention deficit and hyperactivity disorder and serum GABA, glutamate and homocysteine levels.
Chronobiology international.
2022 03; 39(3):386-397. doi:
10.1080/07420528.2021.2018452. [PMID: 34961406] - Thitigun Jaimipuk, Saranya Sachdev, Sutee Yoksan, Chutima Thepparit. A Small-Plaque Isolate of the Zika Virus with Envelope Domain III Mutations Affect Viral Entry and Replication in Mammalian but Not Mosquito Cells.
Viruses.
2022 02; 14(3):. doi:
10.3390/v14030480. [PMID: 35336887] - Wei-Hao Peng, Hung-Wei Kan, Yu-Cheng Ho. Periaqueductal gray is required for controlling chronic stress-induced depression-like behavior.
Biochemical and biophysical research communications.
2022 02; 593(?):28-34. doi:
10.1016/j.bbrc.2022.01.025. [PMID: 35051779] - Waleed A El-Said, Ramy M Qaisi, Virginie Placide, Jeong-Woo Choi. A stable naked-eye colorimetric sensor for monitoring release of extracellular gamma-aminobutyric acid (GABA) neurotransmitter from SH-SY5Y cells.
Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy.
2022 Feb; 267(Pt 2):120517. doi:
10.1016/j.saa.2021.120517. [PMID: 34739892] - Mengge Bai, Heming Yu, Chong Chen, Xingzhe Xu, Yong He, Yue Wang, Yu Tian, Zhonghao Wu, Tianlan Lan, Yan Li, Xiangyu Chen, Zhi Chen, Libo Zhao, Liang Fang, Deyu Yang, Ke Cheng, Peng Xie. Pigment epithelium-derived factor may induce antidepressant phenotypes in mice by the prefrontal cortex.
Neuroscience letters.
2022 02; 771(?):136423. doi:
10.1016/j.neulet.2021.136423. [PMID: 34965441] - Vanessa Castro-Rodríguez, Thomas J Kleist, Nicoline M Gappel, Fatiha Atanjaoui, Sakiko Okumoto, Mackenzie Machado, Tom Denyer, Marja C P Timmermans, Wolf B Frommer, Michael M Wudick. Sponging of glutamate at the outer plasma membrane surface reveals roles for glutamate in development.
The Plant journal : for cell and molecular biology.
2022 02; 109(3):664-674. doi:
10.1111/tpj.15585. [PMID: 34783104] - Lin Wang, Xi Xing, Xianfeng Zeng, S RaElle Jackson, Tara TeSlaa, Osama Al-Dalahmah, Laith Z Samarah, Katharine Goodwin, Lifeng Yang, Melanie R McReynolds, Xiaoxuan Li, Jeremy J Wolff, Joshua D Rabinowitz, Shawn M Davidson. Spatially resolved isotope tracing reveals tissue metabolic activity.
Nature methods.
2022 02; 19(2):223-230. doi:
10.1038/s41592-021-01378-y. [PMID: 35132243] - Mingyan Cao, Niluka De Mel, Jihong Wang, Conner Parthemore, Yang Jiao, Weimin Chen, Shihua Lin, Dengfeng Liu, Greg Kilby, Xiaoyu Chen. Characterization of N-Terminal Glutamate Cyclization in Monoclonal Antibody and Bispecific Antibody Using Charge Heterogeneity Assays and Hydrophobic Interaction Chromatography.
Journal of pharmaceutical sciences.
2022 02; 111(2):335-344. doi:
10.1016/j.xphs.2021.09.006. [PMID: 34516988] - Gavin Boerboom, Javier Martín-Tereso, Teun Veldkamp, Jan van Harn, Paul Bikker, Ronald Busink. Tolerance and safety evaluation of L-glutamic acid, N,N-diacetic acid as a feed additive in broiler diets.
Poultry science.
2022 Feb; 101(2):101623. doi:
10.1016/j.psj.2021.101623. [PMID: 34936962] - Wei Shi, Yajie Deng, Chenyang Zhao, Wei Xiao, Zhenzhong Wang, Zhili Xiong, Longshan Zhao. Integrative serum metabolomic analysis for preventive effects of Yaobitong capsule in adjuvant-induced rheumatoid arthritis rat based on RP/HILIC-UHPLC-Q-TOF MS.
Analytical biochemistry.
2022 01; 637(?):114474. doi:
10.1016/j.ab.2021.114474. [PMID: 34801482] - Hannah E Greenwood, Richard Edwards, Norman Koglin, Mathias Berndt, Friedrich Baark, Jana Kim, George Firth, Eman Khalil, Andre Mueller, Timothy H Witney. Radiotracer stereochemistry affects substrate affinity and kinetics for improved imaging of system xC - in tumors.
Theranostics.
2022; 12(4):1921-1936. doi:
10.7150/thno.63237. [PMID: 35198080] - Laia Reverté, Elena Yeregui, Montserrat Olona, Alicia Gutiérrez-Valencia, Maria José Buzón, Anna Martí, Frederic Gómez-Bertomeu, Teresa Auguet, Luis F López-Cortés, Joaquin Burgos, Clara Benavent-Bofill, Carme Boqué, Graciano García-Pardo, Ezequiel Ruiz-Mateos, Maria Teresa Mestre, Francesc Vidal, Consuelo Viladés, Joaquim Peraire, Anna Rull. Fetuin-A, inter-α-trypsin inhibitor, glutamic acid and ChoE (18:0) are key biomarkers in a panel distinguishing mild from critical coronavirus disease 2019 outcomes.
Clinical and translational medicine.
2022 01; 12(1):e704. doi:
10.1002/ctm2.704. [PMID: 35075803] - Claudia Alleva, Jan-Philipp Machtens, Daniel Kortzak, Ingo Weyand, Christoph Fahlke. Molecular Basis of Coupled Transport and Anion Conduction in Excitatory Amino Acid Transporters.
Neurochemical research.
2022 Jan; 47(1):9-22. doi:
10.1007/s11064-021-03252-x. [PMID: 33587237] - Xiaomin Liu, Xin Tong, Yuanqiang Zou, Xiaoqian Lin, Hui Zhao, Liu Tian, Zhuye Jie, Qi Wang, Zhe Zhang, Haorong Lu, Liang Xiao, Xuemei Qiu, Jin Zi, Rong Wang, Xun Xu, Huanming Yang, Jian Wang, Yang Zong, Weibin Liu, Yong Hou, Shida Zhu, Huijue Jia, Tao Zhang. Mendelian randomization analyses support causal relationships between blood metabolites and the gut microbiome.
Nature genetics.
2022 01; 54(1):52-61. doi:
10.1038/s41588-021-00968-y. [PMID: 34980918] - Kehinde S Olaniyi, Isaiah W Sabinari, Adesola A Oniyide, Nifesimi T Akinnagbe, Toluwani B Agunbiade, Oluwole O Alese. Aqueous Extract of Cola nitida and Garcinia kola Synergistically Enhances Hippocampal-hypothalamic Glutamate and Na+ /K+ -ATPase Activity in Male Wistar Rats.
Current drug discovery technologies.
2022; 19(1):e290321192495. doi:
10.2174/1570163818666210329102207. [PMID: 33781191] - Sharlene D Newman, Ashley M Schnakenberg Martin, David Raymond, Hu Cheng, Landon Wilson, Stephen Barnes, Brian F O'Donnell. The relationship between cannabis use and taurine: A MRS and metabolomics study.
PloS one.
2022; 17(6):e0269280. doi:
10.1371/journal.pone.0269280. [PMID: 35653401] - Jiali Wang, Laura Zielewicz, Yang Dong, Christof Grewer. Pre-Steady-State Kinetics and Reverse Transport in Rat Glutamate Transporter EAAC1 with an Immobilized Transport Domain.
Neurochemical research.
2022 Jan; 47(1):148-162. doi:
10.1007/s11064-021-03247-8. [PMID: 33550531] - Cécile Loï, Luc Cynober. Glutamate: A Safe Nutrient, Not Just a Simple Additive.
Annals of nutrition & metabolism.
2022; 78(3):133-146. doi:
10.1159/000522482. [PMID: 35172302] - Xinyue Wang, Ruiyue Yang, Wenduo Zhang, Siming Wang, Hongna Mu, Hongxia Li, Jun Dong, Wenxiang Chen, Xue Yu, Fusui Ji. Serum glutamate and glutamine-to-glutamate ratio are associated with coronary angiography defined coronary artery disease.
Nutrition, metabolism, and cardiovascular diseases : NMCD.
2022 01; 32(1):186-194. doi:
10.1016/j.numecd.2021.09.021. [PMID: 34906414] - Penghao Sun, Mengli Wang, Zhuoni Li, Jingjing Wei, Feng Liu, Wei Zheng, Xiaoyan Zhu, Xuejun Chai, Shanting Zhao. Eucommiae cortex polysaccharides mitigate obesogenic diet-induced cognitive and social dysfunction via modulation of gut microbiota and tryptophan metabolism.
Theranostics.
2022; 12(8):3637-3655. doi:
10.7150/thno.72756. [PMID: 35664075] - Keming Yang, Xin Li, Oana A Zeleznik, A Heather Eliassen, Clary B Clish, Eunyoung Cho, Ally-Khan B Somani, Abrar A Qureshi, Edward L Giovannucci, Hongmei Nan. Higher susceptibility to sunburn is associated with decreased plasma glutamine and increased plasma glutamate levels among US women: An analysis of the Nurses' Health Study I and II.
Journal of the American Academy of Dermatology.
2022 01; 86(1):169-172. doi:
10.1016/j.jaad.2020.12.081. [PMID: 33444667] - Rafael Paez, Chirayu Shah, Angelina J Cords, Anel Muterspaugh, John E Helton, Sanja Antic, Rosana Eisenberg, Heidi Chen, Eric L Grogan, Henry C Manning, Ronald C Walker, Pierre P Massion. 18F-FSPG PET imaging for the evaluation of indeterminate pulmonary nodules.
PloS one.
2022; 17(3):e0265427. doi:
10.1371/journal.pone.0265427. [PMID: 35294486] - Touhid Feghhi, Roberto X Hernandez, Michal Stawarski, Connon I Thomas, Naomi Kamasawa, A W C Lau, Gregory T Macleod. Computational modeling predicts ephemeral acidic microdomains in the glutamatergic synaptic cleft.
Biophysical journal.
2021 12; 120(24):5575-5591. doi:
10.1016/j.bpj.2021.11.011. [PMID: 34774503] - Sylvain Perriot, Mathieu Canales, Amandine Mathias, Renaud Du Pasquier. Differentiation of functional astrocytes from human-induced pluripotent stem cells in chemically defined media.
STAR protocols.
2021 12; 2(4):100902. doi:
10.1016/j.xpro.2021.100902. [PMID: 34746863] - Kiran Sapkota, Erica S Burnell, Mark W Irvine, Guangyu Fang, Dinesh Y Gawande, Shashank M Dravid, David E Jane, Daniel T Monaghan. Pharmacological characterization of a novel negative allosteric modulator of NMDA receptors, UBP792.
Neuropharmacology.
2021 12; 201(?):108818. doi:
10.1016/j.neuropharm.2021.108818. [PMID: 34610288] - Hassan Nasrollahpour, Abdolhossein Naseri, Mohammad-Reza Rashidi, Balal Khalilzadeh. Application of green synthesized WO3-poly glutamic acid nanobiocomposite for early stage biosensing of breast cancer using electrochemical approach.
Scientific reports.
2021 12; 11(1):23994. doi:
10.1038/s41598-021-03209-8. [PMID: 34907220] - Venkatesh Gunasekaran, Anitta Augustine, Jinu Avarachan, Abdul Khayum, Arivukkarasu Ramasamy. 3-O-Acetyl-11-keto-β-boswellic acid ameliorates chronic unpredictable mild stress induced HPA axis dysregulation in relation with glutamate/GABA aberration in depressive rats.
Clinical and experimental pharmacology & physiology.
2021 12; 48(12):1633-1641. doi:
10.1111/1440-1681.13567. [PMID: 34343356] - Mohamed S Abdel-Bakky, Elham Amin, Tarek M Faris, Ahmed A H Abdellatif. Mental depression: Relation to different disease status, newer treatments and its association with COVID-19 pandemic (Review).
Molecular medicine reports.
2021 Dec; 24(6):. doi:
10.3892/mmr.2021.12479. [PMID: 34633054] - Abhilasha Tripathi, Jayantee Kalita, Usha K Misra. A study of glutamate excitotoxicity in seizures related to tuberculous meningitis.
Epilepsy research.
2021 12; 178(?):106789. doi:
10.1016/j.eplepsyres.2021.106789. [PMID: 34800755] - Jingtong Zhao, Meng Liu, Tongfei Shi, Mohan Gao, Yuqian Lv, Yawei Zhao, Jing Li, Ming Zhang, Hansi Zhang, Fengying Guan, Kan He, Li Chen. Analysis of Serum Metabolomics in Rats with Osteoarthritis by Mass Spectrometry.
Molecules (Basel, Switzerland).
2021 Nov; 26(23):. doi:
10.3390/molecules26237181. [PMID: 34885759] - Ludi Zhang, Jing Wang, Chenxu Niu, Yu Zhang, Tiantian Zhu, Dongyang Huang, Jing Ma, Hui Sun, Nikita Gamper, Xiaona Du, Hailin Zhang. Activation of parabrachial nucleus - ventral tegmental area pathway underlies the comorbid depression in chronic neuropathic pain in mice.
Cell reports.
2021 11; 37(5):109936. doi:
10.1016/j.celrep.2021.109936. [PMID: 34731609] - Zhijun Diao, Li Yao, Qiangqiang Cheng, Meilin Wu, Yuanyuan Di, Zhaoqiang Qian, Chunling Wei, Yingxun Liu, Yingfang Tian, Wei Ren. Involvement of Midbrain Dopamine Neuron Activity in Negative Reinforcement Learning in Mice.
Molecular neurobiology.
2021 Nov; 58(11):5667-5681. doi:
10.1007/s12035-021-02515-6. [PMID: 34387814] - Jayantee Kalita, Vijay Kumar, Vasudev Parashar, Usha K Misra. Neuropsychiatric Manifestations of Wilson Disease: Correlation with MRI and Glutamate Excitotoxicity.
Molecular neurobiology.
2021 Nov; 58(11):6020-6031. doi:
10.1007/s12035-021-02525-4. [PMID: 34435331] - Manabu Kubota, Yasuyuki Kimura, Masafumi Shimojo, Yuhei Takado, Joao Mn Duarte, Hiroyuki Takuwa, Chie Seki, Hitoshi Shimada, Hitoshi Shinotoh, Keisuke Takahata, Soichiro Kitamura, Sho Moriguchi, Kenji Tagai, Takayuki Obata, Jin Nakahara, Yutaka Tomita, Masaki Tokunaga, Jun Maeda, Kazunori Kawamura, Ming-Rong Zhang, Masanori Ichise, Tetsuya Suhara, Makoto Higuchi. Dynamic alterations in the central glutamatergic status following food and glucose intake: in vivo multimodal assessments in humans and animal models.
Journal of cerebral blood flow and metabolism : official journal of the International Society of Cerebral Blood Flow and Metabolism.
2021 11; 41(11):2928-2943. doi:
10.1177/0271678x211004150. [PMID: 34039039] - Deepak Kumar, Navneeta Bansal, Ashish Gupta, Anil Mandhani, Hira Lal, Manoj Kumar, Satya Narain Sankhwar. Metabolomics of prostate cancer: Knock-in versus knock-out prostate.
Journal of pharmaceutical and biomedical analysis.
2021 Oct; 205(?):114333. doi:
10.1016/j.jpba.2021.114333. [PMID: 34461489] - Jialiang Shao, Tiezhu Shi, Hua Yu, Yufeng Ding, Liping Li, Xiang Wang, Xiongjun Wang. Cytosolic GDH1 degradation restricts protein synthesis to sustain tumor cell survival following amino acid deprivation.
The EMBO journal.
2021 10; 40(20):e107480. doi:
10.15252/embj.2020107480. [PMID: 34269483] - Suk-Yun Kang, Su Yeon Seo, Se Kyun Bang, Seong Jin Cho, Kwang-Ho Choi, Yeonhee Ryu. Inhibition of Spinal TRPV1 Reduces NMDA Receptor 2B Phosphorylation and Produces Anti-Nociceptive Effects in Mice with Inflammatory Pain.
International journal of molecular sciences.
2021 Oct; 22(20):. doi:
10.3390/ijms222011177. [PMID: 34681836] - Marco Gelpi, Flora Mikaeloff, Andreas D Knudsen, Rui Benfeitas, Shuba Krishnan, Sara Svenssson Akusjärvi, Julie Høgh, Daniel D Murray, Henrik Ullum, Ujjwal Neogi, Susanne D Nielsen. The central role of the glutamate metabolism in long-term antiretroviral treated HIV-infected individuals with metabolic syndrome.
Aging.
2021 10; 13(19):22732-22751. doi:
10.18632/aging.203622. [PMID: 34635603] - Li-Ching Lee, Ming-Tsan Su, Hsing-Ying Huang, Ying-Chun Cho, Ting-Kuang Yeh, Chun-Yen Chang. Association of CaMK2A and MeCP2 signaling pathways with cognitive ability in adolescents.
Molecular brain.
2021 10; 14(1):152. doi:
10.1186/s13041-021-00858-8. [PMID: 34607601] - T V Davydova, T I Nevidimova, L A Vetrile, I A Zakharova, D N Savochkina, S A Galkin, N A Bokhan. Correlation of Antibodies to Neurotransmitters in the Sera of Women with Alcohol Dependence and Depressive Disorders.
Bulletin of experimental biology and medicine.
2021 Oct; 171(6):704-706. doi:
10.1007/s10517-021-05299-w. [PMID: 34705169] - Claudia Salcedo, Antonie Wagner, Jens V Andersen, Kasper Tore Vinten, Helle S Waagepetersen, Arne Schousboe, Kristine K Freude, Blanca I Aldana. Downregulation of GABA Transporter 3 (GAT3) is Associated with Deficient Oxidative GABA Metabolism in Human Induced Pluripotent Stem Cell-Derived Astrocytes in Alzheimer's Disease.
Neurochemical research.
2021 Oct; 46(10):2676-2686. doi:
10.1007/s11064-021-03276-3. [PMID: 33710537] - Wei Wang, Yanchuan Wu, Xiaoling Li, Lin Li, Ke Sun, Suying Yan. Altered plasma glutamate and glutamine levels in patients with drug-resistant and drug-responsive symptomatic focal epilepsy.
Neurosciences (Riyadh, Saudi Arabia).
2021 Oct; 26(4):315-322. doi:
10.17712/nsj.2021.4.20210041. [PMID: 34663703] - Patricia Martínez-Miguel, Marta Albalate, Violeta Durán-Laforet, Carolina Peña-Martínez, Patricia de Sequera, Hanane Bouarich, Korina Peña-Esparragoza, Susana López-Ongil, Ignacio Lizasoain, José Sánchez-Prieto, Magdalena Torres, María Ángeles Moro, Diego Rodríguez-Puyol. Effective glutamate clearance from the systemic circulation by hemodialysis: Potential relevance for cerebral ischemia management.
Artificial organs.
2021 Oct; 45(10):1183-1188. doi:
10.1111/aor.13933. [PMID: 33560549] - Vedrana Montana, Daniel Flint, Helle S Waagepetersen, Arne Schousboe, Vladimir Parpura. Two Metabolic Fuels, Glucose and Lactate, Differentially Modulate Exocytotic Glutamate Release from Cultured Astrocytes.
Neurochemical research.
2021 Oct; 46(10):2551-2579. doi:
10.1007/s11064-021-03340-y. [PMID: 34057673] - Anna Kamynina, Noemi Esteras, Dmitry O Koroev, Plamena R Angelova, Olga M Volpina, Andrey Y Abramov. Activation of RAGE leads to the release of glutamate from astrocytes and stimulates calcium signal in neurons.
Journal of cellular physiology.
2021 09; 236(9):6496-6506. doi:
10.1002/jcp.30324. [PMID: 33570767] - Kathleen F Holton, Shalini S Ramachandra, Sidney L Murray, Michael Baron, James N Baraniuk. Effect of the low glutamate diet on inflammatory cytokines in veterans with Gulf War Illness (GWI): A pilot study.
Life sciences.
2021 Sep; 280(?):119637. doi:
10.1016/j.lfs.2021.119637. [PMID: 34015284] - Lisa Felix, Jonathan Stephan, Christine R Rose. Astrocytes of the early postnatal brain.
The European journal of neuroscience.
2021 09; 54(5):5649-5672. doi:
10.1111/ejn.14780. [PMID: 32406559] - Yaqing Yang, Encheng Xie, Lingyu Du, Yu Yang, Bin Wu, Liming Sun, Shuqing Wang, Bo OuYang. Positive Charges in the Brace Region Facilitate the Membrane Disruption of MLKL-NTR in Necroptosis.
Molecules (Basel, Switzerland).
2021 Aug; 26(17):. doi:
10.3390/molecules26175194. [PMID: 34500630] - Valentina Medici, Anna Czlonkowska, Tomasz Litwin, Cecilia Giulivi. Diagnosis of Wilson Disease and Its Phenotypes by Using Artificial Intelligence.
Biomolecules.
2021 08; 11(8):. doi:
10.3390/biom11081243. [PMID: 34439909] - Yuwei Zhao, Lei Liang, Guanghui Liu, Yongqing Liu, Hong Zheng, Liying Dai. The effects of short time hyperoxia on glutamate concentration and glutamate transporters expressions in brain of neonatal rats.
Neuroscience letters.
2021 07; 758(?):136013. doi:
10.1016/j.neulet.2021.136013. [PMID: 34111510] - Yona Goldshmit, Rita Perelroizen, Alex Yakovchuk, Evgeni Banyas, Lior Mayo, Sari David, Amit Benbenishty, Pablo Blinder, Moshe Shalom, Angela Ruban. Blood glutamate scavengers increase pro-apoptotic signaling and reduce metastatic melanoma growth in-vivo.
Scientific reports.
2021 07; 11(1):14644. doi:
10.1038/s41598-021-94183-8. [PMID: 34282238] - Jae Hyun Yoo, Ji-Won Chun, Mi Ran Choi, Hyun Cho, Jin-Young Kim, Jihye Choi, Dai-Jin Kim. Caudate nucleus volume mediates the link between glutamatergic neurotransmission and problematic smartphone use in youth.
Journal of behavioral addictions.
2021 Jul; 10(2):338-346. doi:
10.1556/2006.2021.00024. [PMID: 33905351] - A A Savchenko, A G Borisov, V D Belenyuk, A V Moshev. Changes in the Subpopulation Composition and Phagocytic Activity of Monocytes in Patients with Kidney Cancer under the Influence of Metabolites In Vitro.
Bulletin of experimental biology and medicine.
2021 Jul; 171(3):362-366. doi:
10.1007/s10517-021-05228-x. [PMID: 34297298] - Jennifer M Coughlin, Kun Yang, Anouk Marsman, Subechhya Pradhan, Min Wang, Rebecca E Ward, Susanne Bonekamp, Emily B Ambinder, Cecilia P Higgs, Pearl K Kim, Jamie A Edwards, Mark Varvaris, Hongxing Wang, Sotirios Posporelis, Shuangchao Ma, Tsuyoshi Tsujimura, Richard A E Edden, Martin G Pomper, Thomas W Sedlak, Margot Fournier, David J Schretlen, Nicola G Cascella, Peter B Barker, Akira Sawa. A multimodal approach to studying the relationship between peripheral glutathione, brain glutamate, and cognition in health and in schizophrenia.
Molecular psychiatry.
2021 07; 26(7):3502-3511. doi:
10.1038/s41380-020-00901-5. [PMID: 33077854] - Navatha Alugubelly, Afzaal N Mohammed, Russell L Carr. Persistent proteomic changes in glutamatergic and GABAergic signaling in the amygdala of adolescent rats exposed to chlorpyrifos as juveniles.
Neurotoxicology.
2021 07; 85(?):234-244. doi:
10.1016/j.neuro.2021.05.012. [PMID: 34058248] - Guozhi Bi, Min Su, Nan Li, Yu Liang, Song Dang, Jiachao Xu, Meijuan Hu, Jizong Wang, Minxia Zou, Yanan Deng, Qiyu Li, Shijia Huang, Jiejie Li, Jijie Chai, Kangmin He, Yu-Hang Chen, Jian-Min Zhou. The ZAR1 resistosome is a calcium-permeable channel triggering plant immune signaling.
Cell.
2021 06; 184(13):3528-3541.e12. doi:
10.1016/j.cell.2021.05.003. [PMID: 33984278] - Lingling Mao, Shuhong Fang, Meirong Zhao, Weiping Liu, Hangbiao Jin. Effects of Bisphenol A and Bisphenol S Exposure at Low Doses on the Metabolome of Adolescent Male Sprague-Dawley Rats.
Chemical research in toxicology.
2021 06; 34(6):1578-1587. doi:
10.1021/acs.chemrestox.1c00018. [PMID: 34019419] - Motohiro Okada, Kouji Fukuyama, Takashi Shiroyama, Yuto Ueda. Brivaracetam prevents astroglial l-glutamate release associated with hemichannel through modulation of synaptic vesicle protein.
Biomedicine & pharmacotherapy = Biomedecine & pharmacotherapie.
2021 Jun; 138(?):111462. doi:
10.1016/j.biopha.2021.111462. [PMID: 33706129] - Shi-Feng Chu, Zhao Zhang, Xin Zhou, Wen-Bin He, Bo Yang, Li-Yuan Cui, Hong-Yuan He, Zhen-Zhen Wang, Nai-Hong Chen. Low corticosterone levels attenuate late life depression and enhance glutamatergic neurotransmission in female rats.
Acta pharmacologica Sinica.
2021 Jun; 42(6):848-860. doi:
10.1038/s41401-020-00536-w. [PMID: 33028984] - Kuan-Ming Chiu, Tzu-Yu Lin, Ming-Yi Lee, Cheng-Wei Lu, Ming-Jiuh Wang, Su-Jane Wang. Typhaneoside Suppresses Glutamate Release Through Inhibition of Voltage-Dependent Calcium Entry in Rat Cerebrocortical Nerve Terminals.
Chemical research in toxicology.
2021 05; 34(5):1286-1295. doi:
10.1021/acs.chemrestox.0c00446. [PMID: 33621091] - H-Y Wang, C-H Zhu, D-S Liu, Y Wang, J-B Zhang, S-P Wang, Y-N Song. Rehabilitation training improves cognitive disorder after cerebrovascular accident by improving BDNF Bcl-2 and Bax expressions in regulating the JMK pathway.
European review for medical and pharmacological sciences.
2021 05; 25(10):3807-3821. doi:
10.26355/eurrev_202105_25949. [PMID: 34109590] - Umit Haluk Yesilkaya, Meltem Sen, Yasin Hasan Balcioglu. COVID-19-related cognitive dysfunction may be associated with transient disruption in the DLPFC glutamatergic pathway.
Journal of clinical neuroscience : official journal of the Neurosurgical Society of Australasia.
2021 May; 87(?):153-155. doi:
10.1016/j.jocn.2021.03.007. [PMID: 33863524] - Imène Sakhi, Yohan Bignon, Nadia Frachon, Marguerite Hureaux, Bárbara Arévalo, Wendy González, Rosa Vargas-Poussou, Stéphane Lourdel. Diversity of functional alterations of the ClC-5 exchanger in the region of the proton glutamate in patients with Dent disease 1.
Human mutation.
2021 05; 42(5):537-550. doi:
10.1002/humu.24184. [PMID: 33600050] - Meng-Ting Zuo, Yong Wu, Zi-Yuan Wang, Na Wang, Si-Juan Huang, Hui Yu, Xue-Jiao Zhao, Chong-Yin Huang, Zhao-Ying Liu. A comprehensive toxicity evaluation in rats after long-term oral Gelsemium elegans exposure.
Biomedicine & pharmacotherapy = Biomedecine & pharmacotherapie.
2021 May; 137(?):111284. doi:
10.1016/j.biopha.2021.111284. [PMID: 33561641] - Aven Lee, Buddhika Jayakody Arachchige, Robert Henderson, David Pow, Sarah Reed, James Aylward, Pamela Ann McCombe. Elevated plasma levels of D-serine in some patients with amyotrophic lateral sclerosis.
Amyotrophic lateral sclerosis & frontotemporal degeneration.
2021 05; 22(3-4):206-210. doi:
10.1080/21678421.2020.1832120. [PMID: 33908331] - Ching-On Wong, Nicholas E Karagas, Jewon Jung, Qiaochu Wang, Morgan A Rousseau, Yufang Chao, Ryan Insolera, Pushpanjali Soppina, Catherine A Collins, Yong Zhou, John F Hancock, Michael X Zhu, Kartik Venkatachalam. Regulation of longevity by depolarization-induced activation of PLC-β-IP3R signaling in neurons.
Proceedings of the National Academy of Sciences of the United States of America.
2021 04; 118(16):. doi:
10.1073/pnas.2004253118. [PMID: 33859040] - Kouji Fukuyama, Tomosuke Nakano, Takashi Shiroyama, Motohiro Okada. Chronic Administrations of Guanfacine on Mesocortical Catecholaminergic and Thalamocortical Glutamatergic Transmissions.
International journal of molecular sciences.
2021 Apr; 22(8):. doi:
10.3390/ijms22084122. [PMID: 33923533] - Clemens L Schöpf, Cornelia Ablinger, Stefanie M Geisler, Ruslan I Stanika, Marta Campiglio, Walter A Kaufmann, Benedikt Nimmervoll, Bettina Schlick, Johannes Brockhaus, Markus Missler, Ryuichi Shigemoto, Gerald J Obermair. Presynaptic α2δ subunits are key organizers of glutamatergic synapses.
Proceedings of the National Academy of Sciences of the United States of America.
2021 04; 118(14):. doi:
10.1073/pnas.1920827118. [PMID: 33782113]