L-ornithinium (BioDeep_00000897729)
代谢物信息卡片
L-ornithinium
化学式: C5H13N2O2+ (133.0977)
中文名称:
谱图信息:
最多检出来源 Viridiplantae(plant) 52.38%
分子结构信息
SMILES: C(CC(C(=O)[O-])[NH3+])C[NH3+]
InChI: InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/p+1/t4-/m0/s1
相关代谢途径
Reactome(7)
BioCyc(30)
- putrescine biosynthesis IV
- putrescine biosynthesis I
- urea cycle
- superpathway of polyamine biosynthesis I
- superpathway of arginine and polyamine biosynthesis
- superpathway of L-citrulline metabolism
- L-citrulline biosynthesis
- L-Nδ-acetylornithine biosynthesis
- L-arginine degradation VI (arginase 2 pathway)
- superpathway of L-arginine, putrescine, and 4-aminobutanoate degradation
- L-arginine degradation I (arginase pathway)
- L-arginine degradation III (arginine decarboxylase/agmatinase pathway)
- L-arginine degradation VII (arginase 3 pathway)
- superpathway of L-arginine and L-ornithine degradation
- superpathway of citrulline metabolism
- arginine degradation VI (arginase 2 pathway)
- citrulline biosynthesis
- L-Nδ-acetylornithine biosynthesis
- streptomycin biosynthesis
- L-arginine degradation V (arginine deiminase pathway)
- superpathway of L-lysine degradation
- L-arginine biosynthesis II (acetyl cycle)
- proline biosynthesis II (from arginine)
- arginine biosynthesis IV
- ornithine degradation II (Stickland reaction)
- lysine degradation I (saccharopine pathway)
- L-lysine degradation XI (mammalian)
- L-arginine biosynthesis I (via L-ornithine)
- L-ornithine biosynthesis I
- superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis
PlantCyc(9)
- superpathway of L-citrulline metabolism
- L-arginine degradation VI (arginase 2 pathway)
- L-citrulline biosynthesis
- L-arginine degradation I (arginase pathway)
- L-Nδ-acetylornithine biosynthesis
- urea cycle
- putrescine biosynthesis IV
- Organic Nitrogen Assimilation
- superpathway of hyoscyamine (atropine) and scopolamine biosynthesis
代谢反应
1058 个相关的代谢反应过程信息。
Reactome(57)
- Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Creatine metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Creatine metabolism:
ATP + CRET ⟶ ADP + Pcr - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Creatine metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Creatine metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Creatine metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Creatine metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Creatine metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Creatine metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Creatine metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Urea cycle:
H2O + L-Arg ⟶ L-Orn + Urea - Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Urea cycle:
H2O + L-Arg ⟶ L-Orn + Urea - Urea cycle:
ATP + L-Asp + L-Cit ⟶ AMP + ARSUA + PPi - Urea cycle:
CAP + L-Orn ⟶ L-Cit + Pi - Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Urea cycle:
H2O + L-Arg ⟶ L-Orn + Urea - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Urea cycle:
H2O + L-Arg ⟶ L-Orn + Urea - Urea cycle:
ATP + L-Asp + L-Cit ⟶ AMP + ARSUA + PPi - Metabolism:
H2O + PBG ⟶ HMBL + ammonia - Amino acid metabolism:
Glu + OAA ⟶ 2OG + L-Asp - Arginine metabolism:
ATP + L-Asp + L-Cit ⟶ ARSUA + PPi - Urea cycle:
ATP + L-Asp + L-Cit ⟶ AMP + ARSUA + PPi - Urea cycle:
ATP + L-Asp + L-Cit ⟶ AMP + ARSUA + PPi - Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Urea cycle:
H2O + L-Arg ⟶ L-Orn + Urea - Urea cycle:
CAP + L-Orn ⟶ L-Cit + Pi - Metabolism:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine - Amino acid and derivative metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Urea cycle:
CAP + L-Orn ⟶ L-Cit + Pi - Metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Amino acid and derivative metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Urea cycle:
CAP + L-Orn ⟶ L-Cit + Pi - Urea cycle:
ATP + L-Asp + L-Cit ⟶ AMP + ARSUA + PPi - Urea cycle:
H2O + L-Arg ⟶ L-Orn + Urea
BioCyc(75)
- D-cycloserine biosynthesis:
O-acetyl-L-serine + hydroxyurea ⟶ O-ureido-L-serine + H+ + acetate - superpathway of arginine and polyamine biosynthesis:
cadaverine + dAdoMet ⟶ S-methyl-5'-thioadenosine + H+ + aminopropylcadaverine - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - superpathway of arginine and polyamine biosynthesis:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - urea cycle:
ATP + L-citrulline + asp ⟶ AMP + H+ + L-arginino-succinate + diphosphate - arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - citrulline biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
ATP + L-citrulline + asp ⟶ AMP + H+ + L-arginino-succinate + diphosphate - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + phosphate - superpathway of L-citrulline metabolism:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + phosphate - L-citrulline biosynthesis:
an electron-transfer quinone + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + an electron-transfer quinol - L-Nδ-acetylornithine biosynthesis:
an electron-transfer quinone + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + an electron-transfer quinol - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VII (arginase 3 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + phosphate - putrescine biosynthesis IV:
H2O + agmatine ⟶ putrescine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
(S)-1-pyrroline-5-carboxylate + H+ + H2O ⟶ L-glutamate-5-semialdehyde - L-Nδ-acetylornithine biosynthesis:
(S)-1-pyrroline-5-carboxylate + H+ + H2O ⟶ L-glutamate-5-semialdehyde - L-arginine degradation VI (arginase 2 pathway):
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H - urea cycle:
ATP + L-citrulline + asp ⟶ AMP + H+ + L-arginino-succinate + diphosphate - superpathway of citrulline metabolism:
ATP + CO2 + H2O + ammonia ⟶ ADP + H+ + carbamoyl-phosphate + phosphate - urea cycle:
ATP + CO2 + H2O + ammonia ⟶ ADP + H+ + carbamoyl-phosphate + phosphate - citrulline biosynthesis:
H2O + gln ⟶ H+ + ammonia + glt - arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate γ-semialdehyde + glt - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glt - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glt - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VII (arginase 3 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + phosphate - urea cycle:
H2O + arg ⟶ L-ornithine + urea - superpathway of citrulline metabolism:
H2O + gln ⟶ H+ + ammonia + glt - citrulline biosynthesis:
H2O + gln ⟶ H+ + ammonia + glt - urea cycle:
ATP + CO2 + H2O + ammonia ⟶ ADP + H+ + carbamoyl-phosphate + phosphate - arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate γ-semialdehyde + glt - arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate γ-semialdehyde + glt - arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate γ-semialdehyde + glt - arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate γ-semialdehyde + glt - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glt - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glt - urea cycle:
ATP + CO2 + H2O + ammonia ⟶ ADP + H+ + carbamoyl-phosphate + phosphate - citrulline biosynthesis:
H2O + gln ⟶ H+ + ammonia + glt - arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate γ-semialdehyde + glt - arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate γ-semialdehyde + glt - urea cycle:
H2O + arg ⟶ L-ornithine + urea - arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate γ-semialdehyde + glt - arginine degradation VII (arginase 3 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
ATP + CO2 + H2O + ammonia ⟶ ADP + H+ + carbamoyl-phosphate + phosphate - citrulline biosynthesis:
H2O + gln ⟶ H+ + ammonia + glt - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate γ-semialdehyde + glt - putrescine biosynthesis IV:
H2O + agmatine ⟶ putrescine + urea - arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate γ-semialdehyde + glt - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ Glu + L-glutamate-5-semialdehyde - L-ornithine degradation I (L-proline biosynthesis):
L-ornithine ⟶ ammonium + pro - L-arginine degradation (Stickland reaction):
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H - L-proline biosynthesis II (from arginine):
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H - L-ornithine degradation I (L-proline biosynthesis):
L-ornithine ⟶ ammonium + pro - arginine, ornithine and proline interconversion:
D-proline + H+ + NADH ⟶ 5-aminopentanoate + NAD+ - L-ornithine degradation I (L-proline biosynthesis):
L-ornithine ⟶ ammonium + pro - L-ornithine degradation I (L-proline biosynthesis):
L-ornithine ⟶ ammonium + pro - ornithine degradation I (proline biosynthesis):
L-ornithine ⟶ ammonium + pro - ornithine degradation I (proline biosynthesis):
L-ornithine ⟶ ammonium + pro - L-ornithine degradation I (L-proline biosynthesis):
L-ornithine ⟶ ammonium + pro - arginine, ornithine and proline interconversion:
D-proline + H+ + NADH ⟶ 5-aminopentanoate + NAD+ - L-ornithine degradation I (L-proline biosynthesis):
L-ornithine ⟶ ammonium + pro - L-ornithine degradation I (L-proline biosynthesis):
L-ornithine ⟶ ammonium + pro
WikiPathways(0)
Plant Reactome(8)
- Metabolism and regulation:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA - Amino acid metabolism:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA - Amino acid biosynthesis:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA - Arginine biosynthesis I:
H2O + N-acetyl-L-ornithine ⟶ CH3COO- + L-Orn - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
H2O + N-acetyl-L-ornithine ⟶ CH3COO- + L-Orn - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia
INOH(0)
PlantCyc(918)
- L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
L-arginino-succinate ⟶ arg + fumarate - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
ATP + H2O + gln + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + glu + phosphate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-ornithine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-arginine biosynthesis I (via L-ornithine):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-ornithine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glu - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
(S)-1-pyrroline-5-carboxylate + H+ + H2O ⟶ L-glutamate-5-semialdehyde - urea cycle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + phosphate - L-citrulline biosynthesis:
(S)-1-pyrroline-5-carboxylate + H+ + H2O ⟶ L-glutamate-5-semialdehyde - L-arginine degradation VI (arginase 2 pathway):
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + agmatine ⟶ putrescine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - superpathway of polyamine biosynthesis II:
H+ + arg ⟶ CO2 + agmatine - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - superpathway of polyamine biosynthesis II:
N-carbamoylputrescine + H+ + H2O ⟶ CO2 + ammonium + putrescine - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - superpathway of polyamine biosynthesis II:
H+ + L-ornithine ⟶ CO2 + putrescine - urea cycle:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - putrescine biosynthesis IV:
H2O + agmatine ⟶ putrescine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - putrescine biosynthesis IV:
H2O + agmatine ⟶ putrescine + urea - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - superpathway of polyamine biosynthesis II:
H+ + SAM ⟶ CO2 + dAdoMet - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - urea cycle:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - superpathway of polyamine biosynthesis II:
H+ + SAM ⟶ CO2 + dAdoMet - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - superpathway of polyamine biosynthesis II:
H+ + arg ⟶ CO2 + agmatine - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + agmatine ⟶ putrescine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of polyamine biosynthesis II:
H+ + arg ⟶ CO2 + agmatine - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - superpathway of polyamine biosynthesis II:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + agmatine ⟶ putrescine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of polyamine biosynthesis II:
N-carbamoylputrescine + H+ + H2O ⟶ CO2 + ammonium + putrescine - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - superpathway of L-citrulline metabolism:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + phosphate - L-arginine degradation VI (arginase 2 pathway):
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H - L-citrulline biosynthesis:
an electron-transfer quinone + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + an electron-transfer quinol - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
an electron-transfer quinone + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + an electron-transfer quinol - urea cycle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + phosphate - putrescine biosynthesis IV:
H2O + agmatine ⟶ putrescine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - superpathway of polyamine biosynthesis II:
dAdoMet + putrescine ⟶ S-methyl-5'-thioadenosine + H+ + spermidine - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - superpathway of hyoscyamine and scopolamine biosynthesis:
N-methylputrescine + H2O + O2 ⟶ N-methylaminobutanal + ammonium + hydrogen peroxide - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - superpathway of polyamine biosynthesis II:
dAdoMet + putrescine ⟶ S-methyl-5'-thioadenosine + H+ + spermidine - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - superpathway of polyamine biosynthesis II:
dAdoMet + spermidine ⟶ S-methyl-5'-thioadenosine + H+ + spermine - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + agmatine ⟶ putrescine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of polyamine biosynthesis II:
dAdoMet + putrescine ⟶ S-methyl-5'-thioadenosine + H+ + spermidine - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - superpathway of hyoscyamine and scopolamine biosynthesis:
N-methylputrescine + H2O + O2 ⟶ N-methylaminobutanal + ammonium + hydrogen peroxide - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - superpathway of polyamine biosynthesis II:
dAdoMet + spermidine ⟶ S-methyl-5'-thioadenosine + H+ + spermine - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + agmatine ⟶ putrescine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - superpathway of polyamine biosynthesis II:
dAdoMet + spermidine ⟶ S-methyl-5'-thioadenosine + H+ + spermine - putrescine biosynthesis IV:
H2O + agmatine ⟶ putrescine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - superpathway of polyamine biosynthesis II:
dAdoMet + spermidine ⟶ S-methyl-5'-thioadenosine + H+ + spermine - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - superpathway of polyamine biosynthesis II:
dAdoMet + putrescine ⟶ S-methyl-5'-thioadenosine + H+ + spermidine - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of polyamine biosynthesis II:
dAdoMet + spermidine ⟶ S-methyl-5'-thioadenosine + H+ + spermine - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
an electron-transfer quinone + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + an electron-transfer quinol - urea cycle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + phosphate - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H - L-Nδ-acetylornithine biosynthesis:
an electron-transfer quinone + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + an electron-transfer quinol - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - superpathway of polyamine biosynthesis II:
dAdoMet + spermidine ⟶ S-methyl-5'-thioadenosine + H+ + spermine - putrescine biosynthesis IV:
H2O + agmatine ⟶ putrescine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of L-citrulline metabolism:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + phosphate - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + gln ⟶ H+ + ammonia + glu - L-citrulline biosynthesis:
H2O + gln ⟶ H+ + ammonia + glu - L-arginine degradation VI (arginase 2 pathway):
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H - L-citrulline biosynthesis:
H2O + gln ⟶ ammonium + glu - L-arginine degradation VI (arginase 2 pathway):
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H - L-Nδ-acetylornithine biosynthesis:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-arginine degradation I (arginase pathway):
H2O + L-glutamate-5-semialdehyde + NAD+ ⟶ H+ + NADH + glu - urea cycle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + phosphate - L-arginine degradation VI (arginase 2 pathway):
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H - L-citrulline biosynthesis:
H2O + gln ⟶ H+ + ammonia + glu - L-citrulline biosynthesis:
H2O + gln ⟶ H+ + ammonia + glu - L-citrulline biosynthesis:
H2O + gln ⟶ H+ + ammonia + glu - L-citrulline biosynthesis:
H2O + gln ⟶ H+ + ammonia + glu - L-Nδ-acetylornithine biosynthesis:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-citrulline biosynthesis:
H2O + gln ⟶ H+ + ammonia + glu - superpathway of polyamine biosynthesis II:
N-carbamoylputrescine + H+ + H2O ⟶ CO2 + ammonium + putrescine - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - L-citrulline biosynthesis:
H2O + gln ⟶ H+ + ammonia + glu - L-citrulline biosynthesis:
H2O + gln ⟶ H+ + ammonia + glu - L-citrulline biosynthesis:
H2O + gln ⟶ H+ + ammonia + glu - Organic Nitrogen Assimilation:
H2O + O2 + urate ⟶ CO2 + allantoin + hydrogen peroxide - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln
COVID-19 Disease Map(0)
PathBank(0)
PharmGKB(0)
0 个相关的物种来源信息
在这里通过桑基图来展示出与当前的这个代谢物在我们的BioDeep知识库中具有相关联信息的其他代谢物。在这里进行关联的信息来源主要有：
- PubMed: 来源于PubMed文献库中的文献信息，我们通过自然语言数据挖掘得到的在同一篇文献中被同时提及的相关代谢物列表，这个列表按照代谢物同时出现的文献数量降序排序，取前10个代谢物作为相关研究中关联性很高的代谢物集合展示在桑基图中。
- NCBI Taxonomy: 通过文献数据挖掘，得到的代谢物物种来源信息关联。这个关联信息同样按照出现的次数降序排序，取前10个代谢物作为高关联度的代谢物集合展示在桑吉图上。
- Chemical Taxonomy: 在物质分类上处于同一个分类集合中的其他代谢物
- Chemical Reaction: 在化学反应过程中，存在为当前代谢物相关联的生化反应过程中的反应底物或者反应产物的关联代谢物信息。
点击图上的相关代谢物的名称，可以跳转到相关代谢物的信息页面。
| 亚细胞结构定位 | 关联基因列表 |
|---|
