(2E,6E)-3,7,11-Trimethyldodeca-2,6,10-trien-1-yl diphosphate (BioDeep_00000897455)
代谢物信息卡片
(2E,6E)-3,7,11-Trimethyldodeca-2,6,10-trien-1-yl diphosphate
化学式: C15H25O7P2-3 (379.107546)
中文名称:
谱图信息:
最多检出来源 Homo sapiens(blood) 16.67%
分子结构信息
SMILES: CC(=CCCC(=CCCC(=CCOP(=O)([O-])OP(=O)([O-])[O-])C)C)C
InChI: InChI=1S/C15H28O7P2/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-21-24(19,20)22-23(16,17)18/h7,9,11H,5-6,8,10,12H2,1-4H3,(H,19,20)(H2,16,17,18)/p-3/b14-9+,15-11+
描述信息
COVID info from COVID-19 Disease Map
Corona-virus
Coronavirus
SARS-CoV-2
COVID-19
SARS-CoV
COVID19
SARS2
SARS
同义名列表
相关代谢途径
Reactome(0)
BioCyc(42)
- staphyloxanthin biosynthesis
- superpathway of demethylmenaquinol-8 biosynthesis I
- superpathway of menaquinol-8 biosynthesis I
- superpathway of chorismate metabolism
- plant sterol biosynthesis
- bacteriochlorophyll e biosynthesis
- gossypol biosynthesis
- bacteriochlorophyll c biosynthesis
- bacteriochlorophyll d biosynthesis
- santalene biosynthesis II
- aurachin A, B, C and D biosynthesis
- ubiquinol-10 biosynthesis
- ubiquinol-10 biosynthesis (eukaryotic)
- superpathway of proto- and siroheme biosynthesis
- germacrene biosynthesis
- plant sterol biosynthesis II
- geosmin biosynthesis
- superpathway of trichothecene biosynthesis
- juvenile hormone III biosynthesis I
- juvenile hormone III biosynthesis II
- zerumbone biosynthesis
- Methanobacterium thermoautotrophicum biosynthetic metabolism
- superpathway of ergosterol biosynthesis I
- superpathway of ergosterol biosynthesis
- hopanoid biosynthesis (bacteria)
- trans, trans-farnesyl diphosphate biosynthesis
- farnesene biosynthesis
- geranylgeranyl diphosphate biosynthesis
- patchoulol biosynthesis
- plaunotol biosynthesis
- superpathway of geranylgeranyl diphosphate biosynthesis II (via MEP)
- taxadiene biosynthesis (engineered)
- artemisinin biosynthesis
- rubber biosynthesis
- superpathway of phylloquinol biosynthesis
- superpathway of ubiquinol-8 biosynthesis (prokaryotic)
- cholesterol biosynthesis I
- cholesterol biosynthesis III (via desmosterol)
- superpathway of cholesterol biosynthesis
- calonectrin biosynthesis
- cholesterol biosynthesis II (via 24,25-dihydrolanosterol)
- curcumene biosynthesis
PlantCyc(18)
- gossypol biosynthesis
- selinene biosynthesis
- ubiquinol-10 biosynthesis (eukaryotic)
- ubiquinol-10 biosynthesis (late decarboxylation)
- superpathway of proto- and siroheme biosynthesis
- germacrene biosynthesis
- δ-guaiene biosynthesis
- geosmin biosynthesis
- juvenile hormone III biosynthesis I
- zerumbone biosynthesis
- rubber biosynthesis
- plaunotol biosynthesis
- superpathway of phylloquinol biosynthesis
- artemisinin and arteannuin B biosynthesis
- cholesterol biosynthesis I
- santalene biosynthesis II
- curcumene biosynthesis
- botryococcenes and methylated squalene biosynthesis
代谢反应
806 个相关的代谢反应过程信息。
Reactome(0)
BioCyc(52)
- farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E)-β-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E)-β-farnesene + diphosphate - bisabolene biosynthesis (engineered):
(2E,6E)-farnesyl diphosphate ⟶ (E)-α-bisabolene + diphosphate - oleoresin sesquiterpene volatiles biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E)-α-bisabolene + diphosphate - superpathway of oleoresin turpentine biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E)-α-bisabolene + diphosphate - albaflavenone biosynthesis:
(5R)-albaflavenol + H+ + NADPH + O2 ⟶ H2O + NADP+ + albaflavenone - albaflavenone biosynthesis:
(+)-epi-isozizaene + H+ + NADPH + O2 ⟶ (5S)-albaflavenol + H2O + NADP+ - bacteriochlorophyll d biosynthesis:
(31R)-8-ethyl-12-methylbacteriochlorophyllide d ⟶ 8-ethyl-12-methyl-3-vinylbacteriochlorophyllide d + H2O - gossypol biosynthesis:
(+)-δ-cadinene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 8-hydroxy-(+)-δ-cadinene + H2O + an oxidized [NADPH-hemoprotein reductase] - lacinilene C biosynthesis:
(+)-δ-cadinene ⟶ 2,7-dihydroxycadalene - bacteriochlorophyll c biosynthesis:
(31R)-8-ethyl-12-methylbacteriochlorophyllide d ⟶ 8-ethyl-12-methyl-3-vinylbacteriochlorophyllide d + H2O - 6'-dechloromelleolide F biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ Δ2,4-protoilludene + diphosphate - curcumene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-curcumene + diphosphate - bacteriochlorophyll e biosynthesis:
(31R)-8-ethyl-12-methylbacteriochlorophyllide d ⟶ 8-ethyl-12-methyl-3-vinylbacteriochlorophyllide d + H2O - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (-)-germacrene D + diphosphate - capsidiol biosynthesis:
(+)-5-epi-aristolochene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 1-deoxycapsidiol + H2O + an oxidized [NADPH-hemoprotein reductase] - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - all-trans-farnesol biosynthesis:
(2E,6E)-farnesyl diphosphate + H2O ⟶ (2E,6E)-farnesol + diphosphate - juvenile hormone III biosynthesis II:
(2E,6E)-farnesol + NADP+ ⟶ (2E,6E)-farnesal + H+ + NADPH - juvenile hormone III biosynthesis II:
(2E,6E)-farnesol + NADP+ ⟶ (2E,6E)-farnesal + H+ + NADPH - aurachin RE biosynthesis:
H+ + NADPH + O2 + aurachin D ⟶ 9'-hydroxy-aurachin D + H2O + NADP+ - aurachin A, B, C and D biosynthesis:
aurachin B epoxide ⟶ aurachin A - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis:
(2E,6E)-farnesyl diphosphate + H2O ⟶ (3R,6E)-nerolidol + diphosphate - artemisinin biosynthesis:
(+)-amorpha-4,11-diene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + artemisinic alcohol - eudesmol biosynthesis:
(2E,6E)-farnesyl diphosphate + H2O ⟶ 10-epi-γ-eudesmol + diphosphate - selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ β-selinene + diphosphate - patchoulol biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ β-patchoulene + diphosphate - santalene biosynthesis II:
(2E,6E)-farnesyl diphosphate ⟶ (+)-α-santalene + diphosphate - cholesterol biosynthesis III (via desmosterol):
H+ + NADPH + desmosterol ⟶ NADP+ + cholesterol - superpathway of cholesterol biosynthesis:
H+ + O2 + a ferrocytochrome b5 + lathosterol ⟶ 7-dehydrocholesterol + H2O + a ferricytochrome b5 - cholesterol biosynthesis II (via 24,25-dihydrolanosterol):
H+ + O2 + a ferrocytochrome b5 + lathosterol ⟶ 7-dehydrocholesterol + H2O + a ferricytochrome b5 - cholesterol biosynthesis I:
H+ + O2 + a ferrocytochrome b5 + lathosterol ⟶ 7-dehydrocholesterol + H2O + a ferricytochrome b5 - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - superpathway of ergosterol biosynthesis II:
(3S)-2,3-epoxy-2,3-dihydrosqualene ⟶ cycloartenol - superpathway of ergosterol biosynthesis I:
(3S)-2,3-epoxy-2,3-dihydrosqualene ⟶ lanosterol - cholesterol biosynthesis II (via 24,25-dihydrolanosterol):
24,25-dihydrolanosterol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol + H2O + an oxidized [NADPH-hemoprotein reductase] - cholesterol biosynthesis I:
(3S)-2,3-epoxy-2,3-dihydrosqualene ⟶ lanosterol - cholesterol biosynthesis III (via desmosterol):
(3S)-2,3-epoxy-2,3-dihydrosqualene ⟶ lanosterol - superpathway of cholesterol biosynthesis:
24,25-dihydrolanosterol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis:
4α-formyl-ergosta-7,24(241)-dien-3β-ol + H+ + O2 + a ferrocytochrome b5 ⟶ 4α-carboxy-ergosta-7,24(241)-dien-3β-ol + H2O + a ferricytochrome b5 - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - superpathway of ergosterol biosynthesis:
NADP+ + ergosterol ⟶ H+ + NADPH + ergosta-5,7,22,24(28)-tetraen-3-β-ol - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (-)-β-caryophyllene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (-)-β-caryophyllene + diphosphate - bergamotene biosynthesis I:
(2E,6E)-farnesyl diphosphate ⟶ (-)-exo-α-bergamotene + diphosphate - zealexin biosynthesis:
(S)-β-macrocarpene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + [(4S)-4-(5,5-dimethylcyclohex-1-en-1-yl)-cyclohex-1-en-1-yl] methanol + an oxidized [NADPH-hemoprotein reductase] - botrydial biosynthesis:
O2 + presilphiperfolan-8β-ol ⟶ botrydial - zerumbone biosynthesis:
10-hydroxy-α-humulene + NAD+ ⟶ H+ + NADH + zerumbone - calonectrin biosynthesis:
15-decalonectrin + acetyl-CoA ⟶ calonectrin + coenzyme A - superpathway of trichothecene biosynthesis:
7,8-dihydroxycalonectrin ⟶ 3,15-acetyldeoxynivalenol
WikiPathways(0)
Plant Reactome(0)
INOH(0)
PlantCyc(753)
- farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E)-β-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E)-β-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E)-β-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (Z,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E)-β-farnesene + diphosphate - farnesene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-α-farnesene + diphosphate - oleoresin sesquiterpene volatiles biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E)-α-bisabolene + diphosphate - superpathway of oleoresin turpentine biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E)-α-bisabolene + diphosphate - bisabolene biosynthesis (engineered):
(2E,6E)-farnesyl diphosphate ⟶ (E)-α-bisabolene + diphosphate - gossypol biosynthesis:
H2O + O2 + desoxyhemigossypol ⟶ hemigossypol + hydrogen peroxide - superpathway of ergosterol biosynthesis II:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - cholesterol biosynthesis I:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - santalene biosynthesis II:
(2E,6E)-farnesyl diphosphate ⟶ (-)-β-santalene + diphosphate - curcumene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-curcumene + diphosphate - curcumene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-curcumene + diphosphate - curcumene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-curcumene + diphosphate - curcumene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-curcumene + diphosphate - curcumene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-curcumene + diphosphate - curcumene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-curcumene + diphosphate - curcumene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-curcumene + diphosphate - curcumene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-curcumene + diphosphate - curcumene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-curcumene + diphosphate - curcumene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-curcumene + diphosphate - curcumene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-curcumene + diphosphate - curcumene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-curcumene + diphosphate - curcumene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-curcumene + diphosphate - curcumene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-curcumene + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (-)-germacrene D + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (-)-germacrene D + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (E,E)-germacrene B + diphosphate - germacrene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (-)-germacrene D + diphosphate - capsidiol biosynthesis:
3-deoxycapsidiol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + capsidiol - capsidiol biosynthesis:
3-deoxycapsidiol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + capsidiol - capsidiol biosynthesis:
3-deoxycapsidiol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + capsidiol - capsidiol biosynthesis:
(+)-5-epi-aristolochene + H+ + NADPH + O2 ⟶ 3-deoxy-capsidiol + H2O + NADP+ - capsidiol biosynthesis:
3-deoxycapsidiol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + capsidiol - capsidiol biosynthesis:
(+)-5-epi-aristolochene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-deoxycapsidiol + H2O + an oxidized [NADPH-hemoprotein reductase] - capsidiol biosynthesis:
3-deoxycapsidiol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + capsidiol - capsidiol biosynthesis:
(+)-5-epi-aristolochene + H+ + NADPH + O2 ⟶ 3-deoxy-capsidiol + H2O + NADP+ - capsidiol biosynthesis:
3-deoxycapsidiol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + capsidiol - capsidiol biosynthesis:
1-deoxy-capsidiol + H+ + NADPH + O2 ⟶ H2O + NADP+ + capsidiol - capsidiol biosynthesis:
3-deoxycapsidiol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + capsidiol - capsidiol biosynthesis:
3-deoxycapsidiol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + capsidiol - capsidiol biosynthesis:
3-deoxycapsidiol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + capsidiol - capsidiol biosynthesis:
3-deoxycapsidiol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + capsidiol - capsidiol biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-5-epi-aristolochene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-valencene + diphosphate - valencene and 7-epi-α-selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ 7-epi-α-selinene + diphosphate - all-trans-farnesol biosynthesis:
(2E,6E)-farnesyl diphosphate + H2O ⟶ (2E,6E)-farnesol + diphosphate - all-trans-farnesol biosynthesis:
(2E,6E)-farnesyl diphosphate + H2O ⟶ (2E,6E)-farnesol + diphosphate - all-trans-farnesol biosynthesis:
(2E,6E)-farnesyl diphosphate + H2O ⟶ (2E,6E)-farnesol + diphosphate - all-trans-farnesol biosynthesis:
(2E,6E)-farnesyl diphosphate + H2O ⟶ (2E,6E)-farnesol + diphosphate - all-trans-farnesol biosynthesis:
(2E,6E)-farnesyl diphosphate + H2O ⟶ (2E,6E)-farnesol + diphosphate - all-trans-farnesol biosynthesis:
(2E,6E)-farnesyl diphosphate + H2O ⟶ (2E,6E)-farnesol + diphosphate - all-trans-farnesol biosynthesis:
(2E,6E)-farnesyl diphosphate + H2O ⟶ (2E,6E)-farnesol + diphosphate - all-trans-farnesol biosynthesis:
(2E,6E)-farnesyl diphosphate + H2O ⟶ (2E,6E)-farnesol + diphosphate - all-trans-farnesol biosynthesis:
(2E,6E)-farnesyl diphosphate + H2O ⟶ (2E,6E)-farnesol + diphosphate - all-trans-farnesol biosynthesis:
(2E,6E)-farnesyl diphosphate + H2O ⟶ (2E,6E)-farnesol + diphosphate - all-trans-farnesol biosynthesis:
(2E,6E)-farnesyl diphosphate + H2O ⟶ (2E,6E)-farnesol + diphosphate - all-trans-farnesol biosynthesis:
(2E,6E)-farnesyl diphosphate + H2O ⟶ (2E,6E)-farnesol + diphosphate - all-trans-farnesol biosynthesis:
(2E,6E)-farnesyl diphosphate + H2O ⟶ (2E,6E)-farnesol + diphosphate - all-trans-farnesol biosynthesis:
(2E,6E)-farnesyl diphosphate + H2O ⟶ (2E,6E)-farnesol + diphosphate - all-trans-farnesol biosynthesis:
(2E,6E)-farnesyl diphosphate + H2O ⟶ (2E,6E)-farnesol + diphosphate - patchoulol biosynthesis:
(2E,6E)-farnesyl diphosphate + H2O ⟶ (-)-patchoulol + diphosphate - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3S,6E)-nerolidol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + an oxidized [NADPH-hemoprotein reductase] + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(2E,6E)-farnesyl diphosphate + H2O ⟶ (3R,6E)-nerolidol + diphosphate - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3S,6E)-nerolidol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + an oxidized [NADPH-hemoprotein reductase] + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3S,6E)-nerolidol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + an oxidized [NADPH-hemoprotein reductase] + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3S,6E)-nerolidol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + an oxidized [NADPH-hemoprotein reductase] + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3S,6E)-nerolidol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + an oxidized [NADPH-hemoprotein reductase] + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3S,6E)-nerolidol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + an oxidized [NADPH-hemoprotein reductase] + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3S,6E)-nerolidol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + an oxidized [NADPH-hemoprotein reductase] + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3S,6E)-nerolidol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + an oxidized [NADPH-hemoprotein reductase] + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3S,6E)-nerolidol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + an oxidized [NADPH-hemoprotein reductase] + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3S,6E)-nerolidol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + an oxidized [NADPH-hemoprotein reductase] + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3S,6E)-nerolidol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + an oxidized [NADPH-hemoprotein reductase] + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3S,6E)-nerolidol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + an oxidized [NADPH-hemoprotein reductase] + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3S,6E)-nerolidol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + an oxidized [NADPH-hemoprotein reductase] + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(2E,6E)-farnesyl diphosphate + H2O ⟶ (3R,6E)-nerolidol + diphosphate - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one - artemisinin and arteannuin B biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-amorpha-4,11-diene + diphosphate - eudesmol biosynthesis:
(2E,6E)-farnesyl diphosphate + H2O ⟶ 10-epi-γ-eudesmol + diphosphate - eudesmol biosynthesis:
(2E,6E)-farnesyl diphosphate + H2O ⟶ 10-epi-γ-eudesmol + diphosphate - eudesmol biosynthesis:
(2E,6E)-farnesyl diphosphate + H2O ⟶ 10-epi-γ-eudesmol + diphosphate - eudesmol biosynthesis:
(2E,6E)-farnesyl diphosphate + H2O ⟶ 10-epi-γ-eudesmol + diphosphate - gossypol biosynthesis:
H2O + O2 + desoxyhemigossypol ⟶ hemigossypol + hydrogen peroxide - lacinilene C biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-δ-cadinene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (-)-β-caryophyllene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (-)-β-caryophyllene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (-)-β-caryophyllene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (-)-β-caryophyllene + diphosphate - patchoulol biosynthesis:
(2E,6E)-farnesyl diphosphate + H2O ⟶ (-)-patchoulol + diphosphate - patchoulol biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ γ-patchoulene + diphosphate - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - β-caryophyllene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-humulene + diphosphate - bergamotene biosynthesis I:
(2E,6E)-farnesyl diphosphate ⟶ (-)-exo-α-bergamotene + diphosphate - bergamotene biosynthesis I:
(2E,6E)-farnesyl diphosphate ⟶ (-)-exo-α-bergamotene + diphosphate - β-cubebene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (-)-β-cubebene + diphosphate - β-cubebene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (-)-β-cubebene + diphosphate - β-cubebene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (-)-β-cubebene + diphosphate - β-cubebene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (-)-β-cubebene + diphosphate - β-cubebene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (-)-β-cubebene + diphosphate - β-cubebene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (-)-β-cubebene + diphosphate - β-cubebene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (-)-β-cubebene + diphosphate - β-cubebene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (-)-β-cubebene + diphosphate - β-cubebene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (-)-β-cubebene + diphosphate - β-cubebene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (-)-β-cubebene + diphosphate - β-cubebene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (-)-β-cubebene + diphosphate - β-cubebene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (-)-β-cubebene + diphosphate - β-cubebene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (-)-β-cubebene + diphosphate - β-cubebene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (-)-β-cubebene + diphosphate - β-cubebene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (-)-β-cubebene + diphosphate - β-cubebene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (-)-β-cubebene + diphosphate - β-cubebene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (-)-β-cubebene + diphosphate - β-cubebene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (-)-β-cubebene + diphosphate - zealexin biosynthesis:
4-(5,5-dimethylcyclohex-1-en-1-yl)cyclohex-1-ene-1-carbaldehyde + NADPH + O2 ⟶ H2O + NADP+ + zealexin A1 - zealexin biosynthesis:
4-(5,5-dimethylcyclohex-1-en-1-yl)cyclohex-1-ene-1-carbaldehyde + NADPH + O2 ⟶ H2O + NADP+ + zealexin A1 - zealexin biosynthesis:
4-(5,5-dimethylcyclohex-1-en-1-yl)cyclohex-1-ene-1-carbaldehyde + NADPH + O2 ⟶ H2O + NADP+ + zealexin A1 - zealexin biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (S)-β-bisabolene + diphosphate - zealexin biosynthesis:
4-(5,5-dimethylcyclohex-1-en-1-yl)cyclohex-1-ene-1-carbaldehyde + NADPH + O2 ⟶ H2O + NADP+ + zealexin A1 - zealexin biosynthesis:
4-(5,5-dimethylcyclohex-1-en-1-yl)cyclohex-1-ene-1-carbaldehyde + NADPH + O2 ⟶ H2O + NADP+ + zealexin A1 - zealexin biosynthesis:
4-(5,5-dimethylcyclohex-1-en-1-yl)cyclohex-1-ene-1-carbaldehyde + NADPH + O2 ⟶ H2O + NADP+ + zealexin A1 - zealexin biosynthesis:
O2 + [(4S)-4-(5,5-dimethylcyclohex-1-en-1-yl)-cyclohex-1-en-1-yl] methanol + a reduced [NADPH-hemoprotein reductase] ⟶ (4S)-4-(5,5-dimethylcyclohex-1-en-1-yl)cyclohex-1-ene-1-carbaldehyde + H2O + an oxidized [NADPH-hemoprotein reductase] - zealexin biosynthesis:
4-(5,5-dimethylcyclohex-1-en-1-yl)cyclohex-1-ene-1-carbaldehyde + NADPH + O2 ⟶ H2O + NADP+ + zealexin A1 - zealexin biosynthesis:
H+ + NADPH + O2 + [4-(5,5-dimethylcyclohex-1-en-1-yl)-cyclohex-1-en-1-yl] methanol ⟶ 4-(5,5-dimethylcyclohex-1-en-1-yl)cyclohex-1-ene-1-carbaldehyde + H2O + NADP+ - zealexin biosynthesis:
4-(5,5-dimethylcyclohex-1-en-1-yl)cyclohex-1-ene-1-carbaldehyde + NADPH + O2 ⟶ H2O + NADP+ + zealexin A1 - zealexin biosynthesis:
4-(5,5-dimethylcyclohex-1-en-1-yl)cyclohex-1-ene-1-carbaldehyde + NADPH + O2 ⟶ H2O + NADP+ + zealexin A1 - geosmin biosynthesis:
(1E,4S,5E,7R)-germacra-1(10),5-dien-11-ol ⟶ (8S,9S,10S)-8,10-dimethyl-1-octalin + acetone - selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-selinene + diphosphate - selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ β-selinene + diphosphate - selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-selinene + diphosphate - selinene biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ α-selinene + diphosphate - zerumbone biosynthesis:
α-humulene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 10-hydroxy-α-humulene + H2O + an oxidized [NADPH-hemoprotein reductase]
COVID-19 Disease Map(1)
- @COVID-19 Disease
Map["name"]:
2-Methyl-3-acetoacetyl-CoA + Coenzyme A ⟶ Acetyl-CoA + Propanoyl-CoA
PathBank(0)
PharmGKB(0)
0 个相关的物种来源信息
在这里通过桑基图来展示出与当前的这个代谢物在我们的BioDeep知识库中具有相关联信息的其他代谢物。在这里进行关联的信息来源主要有：
- PubMed: 来源于PubMed文献库中的文献信息，我们通过自然语言数据挖掘得到的在同一篇文献中被同时提及的相关代谢物列表，这个列表按照代谢物同时出现的文献数量降序排序，取前10个代谢物作为相关研究中关联性很高的代谢物集合展示在桑基图中。
- NCBI Taxonomy: 通过文献数据挖掘，得到的代谢物物种来源信息关联。这个关联信息同样按照出现的次数降序排序，取前10个代谢物作为高关联度的代谢物集合展示在桑吉图上。
- Chemical Taxonomy: 在物质分类上处于同一个分类集合中的其他代谢物
- Chemical Reaction: 在化学反应过程中，存在为当前代谢物相关联的生化反应过程中的反应底物或者反应产物的关联代谢物信息。
点击图上的相关代谢物的名称，可以跳转到相关代谢物的信息页面。
文献列表
- Michelle C Y Chang, Rachel A Eachus, William Trieu, Dae-Kyun Ro, Jay D Keasling. Engineering Escherichia coli for production of functionalized terpenoids using plant P450s.
Nature chemical biology.
2007 May; 3(5):274-7. doi:
10.1038/nchembio875. [PMID: 17438551]