Adenosine-5-monophosphate(2-) (BioDeep_00000897437)
代谢物信息卡片
Adenosine-5-monophosphate(2-)
化学式: C10H12N5O7P-2 (345.0474)
中文名称:
谱图信息:
最多检出来源 Viridiplantae(plant) 63.47%
分子结构信息
SMILES: C1=NC(=C2C(=N1)N(C=N2)C3C(C(C(O3)COP(=O)([O-])[O-])O)O)N
InChI: InChI=1S/C10H14N5O7P/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20)/p-2/t4-,6-,7-,10-/m1/s1
相关代谢途径
Reactome(79)
- Metabolism
- Biological oxidations
- Phase I - Functionalization of compounds
- Metabolism of vitamins and cofactors
- Metabolism of proteins
- Post-translational protein modification
- Gamma carboxylation, hypusinylation, hydroxylation, and arylsulfatase activation
- Disease
- Phase II - Conjugation of compounds
- Cytosolic sulfonation of small molecules
- Amino acid and derivative metabolism
- Drug ADME
- Aspirin ADME
- Metabolism of lipids
- Metabolism of steroids
- Urea cycle
- Developmental Biology
- DNA Repair
- Signaling Pathways
- Cell Cycle
- Cell Cycle, Mitotic
- Maternal to zygotic transition (MZT)
- Immune System
- Innate Immune System
- Purine metabolism
- Nucleotide metabolism
- Nucleotide catabolism
- Purine catabolism
- Fatty acid metabolism
- Mitochondrial Fatty Acid Beta-Oxidation
- mitochondrial fatty acid beta-oxidation of saturated fatty acids
- Metabolism of water-soluble vitamins and cofactors
- Azathioprine ADME
- Bile acid and bile salt metabolism
- Synthesis of bile acids and bile salts
- Signaling by Receptor Tyrosine Kinases
- Infectious disease
- Gene expression (Transcription)
- RNA Polymerase II Transcription
- Generic Transcription Pathway
- Transcriptional Regulation by TP53
- Adaptive Immune System
- Class I MHC mediated antigen processing & presentation
- Selenoamino acid metabolism
- Peroxisomal lipid metabolism
- Glycolysis
- Carbohydrate metabolism
- Glucose metabolism
- Fatty acyl-CoA biosynthesis
- The citric acid (TCA) cycle and respiratory electron transport
- SUMOylation
- Pentose phosphate pathway
- Integration of energy metabolism
- Metabolism of RNA
- tRNA processing
- tRNA modification in the nucleus and cytosol
- Aspartate and asparagine metabolism
- Viral Infection Pathways
- Signaling by GPCR
- GPCR downstream signalling
- G alpha (i) signalling events
- Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol
- Hemostasis
- Glycogen metabolism
- Glycogen breakdown (glycogenolysis)
- Gluconeogenesis
- Phosphate bond hydrolysis by NUDT proteins
- Biotin transport and metabolism
- Opioid Signalling
- DARPP-32 events
- Intracellular signaling by second messengers
- Nicotinate metabolism
- Cytokine Signaling in Immune system
- alpha-linolenic (omega3) and linoleic (omega6) acid metabolism
- alpha-linolenic acid (ALA) metabolism
- Linoleic acid (LA) metabolism
- Alpha-oxidation of phytanate
- Synthesis of bile acids and bile salts via 24-hydroxycholesterol
- Nicotinamide salvaging
BioCyc(167)
- nucleoside and nucleotide degradation (archaea)
- superpathway of pyrimidine ribonucleosides salvage
- salvage pathways of purine and pyrimidine nucleotides
- firefly bioluminescence
- superpathway of demethylmenaquinol-8 biosynthesis I
- superpathway of N-acetylneuraminate degradation
- superpathway of hexitol degradation (bacteria)
- superpathway of L-aspartate and L-asparagine biosynthesis
- 2-carboxy-1,4-naphthoquinol biosynthesis
- superpathway of menaquinol-8 biosynthesis I
- superpathway of chorismate metabolism
- aspartate superpathway
- superpathway of anaerobic sucrose degradation
- superpathway of tryptophan utilization
- superpathway of cytosolic glycolysis (plants), pyruvate dehydrogenase and TCA cycle
- glycogen degradation I
- glycolysis IV (plant cytosol)
- indolmycin biosynthesis
- shinorine biosynthesis
- superpathway of indole-3-acetate conjugate biosynthesis
- 2-methylpropene degradation
- urea cycle
- superpathway of arginine and polyamine biosynthesis
- clavulanate biosynthesis
- superpathway of L-citrulline metabolism
- superpathway of purines degradation in plants
- superpathway of citrulline metabolism
- phosphopantothenate biosynthesis I
- superpathway of coenzyme A biosynthesis I (bacteria)
- 6-hydroxymethyl-dihydropterin diphosphate biosynthesis IV (Plasmodium)
- aurachin A, B, C and D biosynthesis
- superpathway of pentose and pentitol degradation
- hentriaconta-3,6,9,12,15,19,22,25,28-nonaene biosynthesis
- 2-heptyl-3-hydroxy-4(1H)-quinolone biosynthesis
- superpathway of quinolone and alkylquinolone biosynthesis
- chitin degradation to ethanol
- chitin degradation I (archaea)
- superpathway of roquefortine, meleagrin and neoxaline biosynthesis
- superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass
- superpathay of heme b biosynthesis from glutamate
- TCA cycle I (prokaryotic)
- superpathway of microbial D-galacturonate and D-glucuronate degradation
- mixed acid fermentation
- streptomycin biosynthesis
- L-arginine degradation V (arginine deiminase pathway)
- superpathway of glyoxylate bypass and TCA
- tetrapyrrole biosynthesis I (from glutamate)
- superpathway of proto- and siroheme biosynthesis
- phenolphthiocerol biosynthesis
- 6-methylpretetramide biosynthesis
- superpathway of tetracycline and oxytetracycline biosynthesis
- superpathway of testosterone and androsterone degradation
- jasmonic acid biosynthesis
- purine nucleotides degradation II (aerobic)
- superpathway of guanosine nucleotides de novo biosynthesis I
- superpathway of tetrahydrofolate biosynthesis
- superpathway of tetrahydrofolate biosynthesis and salvage
- guanosine ribonucleotides de novo biosynthesis
- L-phenylalanine degradation IV (mammalian, via side chain)
- glyphosate degradation III
- acetone degradation II (to acetoacetate)
- superpathway of Clostridium acetobutylicum acidogenic and solventogenic fermentation
- bile acids degradation
- coumarins biosynthesis (engineered)
- simple coumarins biosynthesis
- tetrahydroxyxanthone biosynthesis (from benzoate)
- tetrahydroxyxanthone biosynthesis (from 3-hydroxybenzoate)
- superpathway of tetrahydroxyxanthone biosynthesis
- superpathway of glycolysis and the Entner-Doudoroff pathway
- photosynthetic 3-hydroxybutanoate biosynthesis (engineered)
- Entner-Doudoroff pathway I
- pentose phosphate pathway
- pentose phosphate pathway (non-oxidative branch)
- superpathway NAD/NADP - NADH/NADPH interconversion (yeast)
- gluconeogenesis I
- glycogen degradation II
- L-arginine biosynthesis II (acetyl cycle)
- glycolysis II (from fructose 6-phosphate)
- glycolysis I (from glucose 6-phosphate)
- ppGpp biosynthesis
- arginine biosynthesis IV
- L-asparagine biosynthesis II
- superpathway of L-asparagine biosynthesis
- glutamate degradation VII (to butanoate)
- tetrapyrrole biosynthesis I
- suberin biosynthesis
- phenylalanine degradation IV (mammalian, via side chain)
- heme biosynthesis I
- glutamine biosynthesis III
- gluconeogenesis II (Methanobacterium thermoautotrophicum)
- Methanobacterium thermoautotrophicum biosynthetic metabolism
- superpathway of cholesterol degradation II (cholesterol dehydrogenase)
- superpathway of cholesterol degradation I (cholesterol oxidase)
- cholesterol degradation to androstenedione I (cholesterol oxidase)
- cholesterol degradation to androstenedione II (cholesterol dehydrogenase)
- terrequinone A biosynthesis
- phenylpropanoid biosynthesis
- purine nucleotides degradation
- superpathway of 5-aminoimidazole ribonucleotide biosynthesis
- 5-aminoimidazole ribonucleotide biosynthesis II
- ammonia assimilation cycle III
- L-glutamine biosynthesis I
- (aminomethyl)phosphonate degradation
- suberin monomers biosynthesis
- superpathway of pyrimidine deoxyribonucleosides degradation
- superpathway of rosmarinic acid biosynthesis
- superpathway of Clostridium acetobutylicum acidogenic fermentation
- grixazone biosynthesis
- L-glutamate and L-glutamine biosynthesis
- superpathway of purine deoxyribonucleosides degradation
- superpathway of adenosine nucleotides de novo biosynthesis I
- superpathway of purine nucleotides de novo biosynthesis I
- reductive TCA cycle I
- hexitol fermentation to lactate, formate, ethanol and acetate
- ferrichrome biosynthesis
- superpathway of rifamycin B biosynthesis
- novobiocin biosynthesis
- superpathway of penicillin, cephalosporin and cephamycin biosynthesis
- L-histidine biosynthesis
- adenine salvage
- UDP-N-acetyl-D-glucosamine biosynthesis II
- phosphinothricin tripeptide biosynthesis
- isopenicillin N biosynthesis
- L-arginine biosynthesis I (via L-ornithine)
- glycolysis V (Pyrococcus)
- glycogen biosynthesis I (from ADP-D-Glucose)
- androstenedione degradation
- Entner-Doudoroff pathway III (semi-phosphorylative)
- lipoate salvage II
- superpathway of phylloquinol biosynthesis
- superpathway of L-threonine metabolism
- superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis
- 2'-deoxy-α-D-ribose 1-phosphate degradation
- C4 photosynthetic carbon assimilation cycle, NAD-ME type
- L-isoleucine biosynthesis IV
- adenosine nucleotides de novo biosynthesis
- starch degradation II
- holomycin biosynthesis
- ethanol degradation I
- ethanolamine utilization
- L-threonine degradation IV
- pyruvate fermentation to ethanol I
- superpathway of pyrimidine nucleobases salvage
- sitosterol degradation to androstenedione
- 2-amino-3-hydroxycyclopent-2-enone biosynthesis
- nickel cofactor biosynthesis
- hyperxanthone E biosynthesis
- citronellol degradation
- superpathway of mycolyl-arabinogalactan-peptidoglycan complex biosynthesis
- polyacyltrehalose biosynthesis
- citrulline-nitric oxide cycle
- nitric oxide biosynthesis II (mammals)
- L-citrulline-nitric oxide cycle
- fumiquinazoline D biosynthesis
- salicortin biosynthesis
- benzoate biosynthesis I (CoA-dependent, β-oxidative)
- 4'-methoxyviridicatin biosynthesis
- curcuminoid biosynthesis
- umbelliferone biosynthesis
- superpathway of bitter acids biosynthesis
- colupulone and cohumulone biosynthesis
- L-glutamate degradation VII (to butanoate)
- indole-3-acetate inactivation VII
- superpathway of seleno-compound metabolism
- prodigiosin biosynthesis
- tRNA charging
- squid bioluminescence
PlantCyc(37)
- superpathway of anaerobic sucrose degradation
- glycolysis IV (plant cytosol)
- superpathway of cytosolic glycolysis (plants), pyruvate dehydrogenase and TCA cycle
- superpathway of indole-3-acetate conjugate biosynthesis
- superpathway of L-citrulline metabolism
- superpathway of purines degradation in plants
- urea cycle
- superpathway of adenosine nucleotides de novo biosynthesis I
- superpathway of purine nucleotides de novo biosynthesis I
- guanosine ribonucleotides de novo biosynthesis
- adenosine nucleotides degradation I
- adenosine ribonucleotides de novo biosynthesis
- purine nucleotides degradation I (plants)
- superpathway of proto- and siroheme biosynthesis
- simple coumarins biosynthesis
- simplecoumarins biosynthesis
- coumarins biosynthesis (engineered)
- tetrahydroxyxanthone biosynthesis (from 3-hydroxybenzoate)
- superpathway of tetrahydroxyxanthone biosynthesis
- tetrahydroxyxanthone biosynthesis (from benzoate)
- superpathway of glyoxylate cycle and fatty acid degradation
- assimilatory sulfate reduction II
- phenylpropanoid biosynthesis
- C4 photosynthetic carbon assimilation cycle, NAD-ME type
- superpathway of phylloquinol biosynthesis
- suberin monomers biosynthesis
- superpathway of rosmarinic acid biosynthesis
- 2-carboxy-1,4-naphthoquinol biosynthesis
- superpathway of seleno-compound metabolism
- selenate reduction
- starch degradation II
- canavanine biosynthesis
- hyperxanthone E biosynthesis
- jasmonic acid biosynthesis
- curcuminoid biosynthesis
- umbelliferone biosynthesis
- ppGpp biosynthesis
代谢反应
4149 个相关的代谢反应过程信息。
Reactome(682)
- Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of lipids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of lipids:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Alpha-oxidation of phytanate:
ATP + CoA-SH + Phytanate ⟶ AMP + PPi + Phytanoyl-CoA - Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine - Metabolism of lipids:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine - Fatty acid metabolism:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine - Peroxisomal lipid metabolism:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Metabolism of lipids:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Fatty acid metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Peroxisomal lipid metabolism:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH - Metabolism of vitamins and cofactors:
6x(PCCA:PCCB) + ATP + Btn ⟶ 6x(Btn-PCCA:PCCB) + AMP + PPi - Metabolism of water-soluble vitamins and cofactors:
6x(PCCA:PCCB) + ATP + Btn ⟶ 6x(Btn-PCCA:PCCB) + AMP + PPi - Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH - Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
H+ + PRPP + QUIN ⟶ NAMN + PPi + carbon dioxide - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
(ADP-D-ribosyl)(n)-acceptor + NAD ⟶ (ADP-D-ribosyl)(n+1)-acceptor + NAM - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
H+ + Oxygen + dh-beta-NAD ⟶ H2O2 + NAD - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH - Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of vitamins and cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - Metabolism of water-soluble vitamins and cofactors:
L-Cys + MOCS3:Zn2+ (red.) ⟶ L-Ala + MOCS3-S-S(1-):Zn2+ - Nicotinate metabolism:
ATP + NAD ⟶ ADP + H+ + TPN - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH - Metabolism of vitamins and cofactors:
4x(PC:Mn2+) + ATP + Btn ⟶ 4x(Btn-PC:Mn2+) + AMP + PPi - Metabolism of water-soluble vitamins and cofactors:
4x(PC:Mn2+) + ATP + Btn ⟶ 4x(Btn-PC:Mn2+) + AMP + PPi - Nicotinate metabolism:
H+ + PRPP + QUIN ⟶ NAMN + PPi + carbon dioxide - Metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Metabolism of vitamins and cofactors:
4x(PC:Mn2+) + ATP + Btn ⟶ 4x(Btn-PC:Mn2+) + AMP + PPi - Metabolism of water-soluble vitamins and cofactors:
4x(PC:Mn2+) + ATP + Btn ⟶ 4x(Btn-PC:Mn2+) + AMP + PPi - Nicotinate metabolism:
ATP + NR ⟶ ADP + H+ + NMN - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH - Amino Acid conjugation:
ATP + CoA + ST ⟶ AMP + PPi + ST-CoA - Conjugation of carboxylic acids:
ATP + CoA + ST ⟶ AMP + PPi + ST-CoA - Conjugation of benzoate with glycine:
ATP + BENZA + CoA ⟶ AMP + BEZ-CoA + PPi - Drug ADME:
APAP + UDP-GlcA ⟶ APAP-GlcA + UDP - Aspirin ADME:
ASA- (GI cell) + H2O ⟶ H+ + ST (GI cell) + acetate - Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic - Aspirin ADME:
ASA- (GI cell) + H2O ⟶ H+ + ST (GI cell) + acetate - Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic - Aspirin ADME:
ASA- (GI cell) + H2O ⟶ H+ + ST (GI cell) + acetate - Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic - Aspirin ADME:
ASA- (GI cell) + H2O ⟶ H+ + ST (GI cell) + acetate - Drug ADME:
AMP + abacavir ⟶ Ade-Rib + xenobiotic - Aspirin ADME:
ASA + H2O ⟶ ASA- + H+ + H2O - Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic - Aspirin ADME:
ASA- (GI cell) + H2O ⟶ H+ + ST (GI cell) + acetate - Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic - Aspirin ADME:
ASA- (GI cell) + H2O ⟶ H+ + ST (GI cell) + acetate - Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic - Aspirin ADME:
ASA- (hepatocyte) + H2O ⟶ H+ + ST (hepatocyte) + acetate - Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic - Aspirin ADME:
ASA- (GI cell) + H2O ⟶ H+ + ST (GI cell) + acetate - alpha-linolenic (omega3) and linoleic (omega6) acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - alpha-linolenic acid (ALA) metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - alpha-linolenic (omega3) and linoleic (omega6) acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - alpha-linolenic acid (ALA) metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - alpha-linolenic (omega3) and linoleic (omega6) acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - alpha-linolenic acid (ALA) metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of lipids:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Fatty acid metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - alpha-linolenic (omega3) and linoleic (omega6) acid metabolism:
Oxygen + THA-CoA ⟶ H2O2 + delta2-THA-CoA - alpha-linolenic acid (ALA) metabolism:
Oxygen + THA-CoA ⟶ H2O2 + delta2-THA-CoA - alpha-linolenic (omega3) and linoleic (omega6) acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - alpha-linolenic acid (ALA) metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - alpha-linolenic (omega3) and linoleic (omega6) acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - alpha-linolenic acid (ALA) metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - alpha-linolenic (omega3) and linoleic (omega6) acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - alpha-linolenic acid (ALA) metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of lipids:
H2O + lysoPC ⟶ GPCho + LCFA(-) - Fatty acid metabolism:
12S-HpETE + GSH ⟶ 12S-HETE + GSSG + H2O - alpha-linolenic (omega3) and linoleic (omega6) acid metabolism:
Malonyl-CoA + SDA-CoA + TPNH ⟶ CoA-SH + ETA-CoA + H2O + TPN + carbon dioxide - alpha-linolenic acid (ALA) metabolism:
Malonyl-CoA + SDA-CoA + TPNH ⟶ CoA-SH + ETA-CoA + H2O + TPN + carbon dioxide - alpha-linolenic (omega3) and linoleic (omega6) acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - alpha-linolenic acid (ALA) metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - alpha-linolenic (omega3) and linoleic (omega6) acid metabolism:
Oxygen + THA-CoA ⟶ H2O2 + delta2-THA-CoA - alpha-linolenic acid (ALA) metabolism:
Oxygen + THA-CoA ⟶ H2O2 + delta2-THA-CoA - alpha-linolenic (omega3) and linoleic (omega6) acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - alpha-linolenic acid (ALA) metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Molybdenum cofactor biosynthesis:
L-Cys + MOCS3:Zn2+ (red.) ⟶ L-Ala + MOCS3-S-S(1-):Zn2+ - Biotin transport and metabolism:
6x(PCCA:PCCB) + ATP + Btn ⟶ 6x(Btn-PCCA:PCCB) + AMP + PPi - Biotin transport and metabolism:
6x(PCCA:PCCB) + ATP + Btn ⟶ 6x(Btn-PCCA:PCCB) + AMP + PPi - Biotin transport and metabolism:
6x(PCCA:PCCB) + ATP + Btn ⟶ 6x(Btn-PCCA:PCCB) + AMP + PPi - Biotin transport and metabolism:
6x(PCCA:PCCB) + ATP + Btn ⟶ 6x(Btn-PCCA:PCCB) + AMP + PPi - Biotin transport and metabolism:
BCTN ⟶ Btn + L-Lys - Biotin transport and metabolism:
6x(PCCA:PCCB) + ATP + Btn ⟶ 6x(Btn-PCCA:PCCB) + AMP + PPi - Biotin transport and metabolism:
6x(PCCA:PCCB) + ATP + Btn ⟶ 6x(Btn-PCCA:PCCB) + AMP + PPi - Biotin transport and metabolism:
6x(PCCA:PCCB) + ATP + Btn ⟶ 6x(Btn-PCCA:PCCB) + AMP + PPi - Biotin transport and metabolism:
6x(PCCA:PCCB) + ATP + Btn ⟶ 6x(Btn-PCCA:PCCB) + AMP + PPi - Biotin transport and metabolism:
4x(PC:Mn2+) + ATP + Btn ⟶ 4x(Btn-PC:Mn2+) + AMP + PPi - Biotin transport and metabolism:
4x(PC:Mn2+) + ATP + Btn ⟶ 4x(Btn-PC:Mn2+) + AMP + PPi - Biotin transport and metabolism:
6x(PCCA:PCCB) + ATP + Btn ⟶ 6x(Btn-PCCA:PCCB) + AMP + PPi - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Biotin transport and metabolism:
4x(PC:Mn2+) + ATP + Btn ⟶ 4x(Btn-PC:Mn2+) + AMP + PPi - Biotin transport and metabolism:
ACACA:2Mn2+ + ATP + Btn ⟶ AMP + Btn-ACACA:2Mn2+ + PPi - Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP - Amino Acid conjugation:
ATP + CoA + ST ⟶ AMP + PPi + ST-CoA - Conjugation of carboxylic acids:
ATP + CoA + ST ⟶ AMP + PPi + ST-CoA - Conjugation of phenylacetate with glutamine:
ATP + CoA + phenylacetate ⟶ AMP + PPi + phenylacetyl-CoA - Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP - Amino Acid conjugation:
ATP + CoA + ST ⟶ AMP + PPi + ST-CoA - Conjugation of carboxylic acids:
ATP + CoA + ST ⟶ AMP + PPi + ST-CoA - Conjugation of phenylacetate with glutamine:
ATP + CoA + phenylacetate ⟶ AMP + PPi + phenylacetyl-CoA - Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP - Amino Acid conjugation:
ATP + CoA + ST ⟶ AMP + PPi + ST-CoA - Conjugation of carboxylic acids:
ATP + CoA + ST ⟶ AMP + PPi + ST-CoA - Conjugation of phenylacetate with glutamine:
ATP + CoA + phenylacetate ⟶ AMP + PPi + phenylacetyl-CoA - Biological oxidations:
H+ + Oxygen + TPNH + progesterone ⟶ 11DCORST + H2O + TPN - Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP - Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP - Amino Acid conjugation:
L-Gln + phenylacetyl-CoA ⟶ CoA + phenylacetyl glutamine - Conjugation of carboxylic acids:
L-Gln + phenylacetyl-CoA ⟶ CoA + phenylacetyl glutamine - Conjugation of phenylacetate with glutamine:
L-Gln + phenylacetyl-CoA ⟶ CoA + phenylacetyl glutamine - Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP - Amino Acid conjugation:
ATP + CoA + ST ⟶ AMP + PPi + ST-CoA - Conjugation of carboxylic acids:
ATP + CoA + ST ⟶ AMP + PPi + ST-CoA - Conjugation of phenylacetate with glutamine:
ATP + CoA + phenylacetate ⟶ AMP + PPi + phenylacetyl-CoA - Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP - Amino Acid conjugation:
ATP + CoA + ST ⟶ AMP + PPi + ST-CoA - Conjugation of carboxylic acids:
ATP + CoA + ST ⟶ AMP + PPi + ST-CoA - Conjugation of phenylacetate with glutamine:
ATP + CoA + phenylacetate ⟶ AMP + PPi + phenylacetyl-CoA - Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Phase II - Conjugation of compounds:
PAPS + beta-estradiol ⟶ E2-SO4 + PAP - Amino Acid conjugation:
ATP + CoA + ST ⟶ AMP + PPi + ST-CoA - Conjugation of carboxylic acids:
ATP + CoA + ST ⟶ AMP + PPi + ST-CoA - Conjugation of phenylacetate with glutamine:
ATP + CoA + phenylacetate ⟶ AMP + PPi + phenylacetyl-CoA - Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP - Conjugation of phenylacetate with glutamine:
ATP + CoA + phenylacetate ⟶ AMP + PPi + phenylacetyl-CoA - Amino Acid conjugation:
ATP + CoA + ST ⟶ AMP + PPi + ST-CoA - Conjugation of carboxylic acids:
ATP + CoA + ST ⟶ AMP + PPi + ST-CoA - Conjugation of phenylacetate with glutamine:
ATP + CoA + phenylacetate ⟶ AMP + PPi + phenylacetyl-CoA - Amino Acid conjugation:
ATP + CoA + ST ⟶ AMP + PPi + ST-CoA - Conjugation of carboxylic acids:
ATP + CoA + ST ⟶ AMP + PPi + ST-CoA - Conjugation of phenylacetate with glutamine:
ATP + CoA + phenylacetate ⟶ AMP + PPi + phenylacetyl-CoA - Metabolism of RNA:
Editosome for C to U editing + H2O ⟶ C to U edited ApoB RNA:Editosome complex + ammonia - tRNA processing:
H2O ⟶ ammonia - tRNA modification in the nucleus and cytosol:
H2O ⟶ ammonia - Mitochondrial Fatty Acid Beta-Oxidation:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - mitochondrial fatty acid beta-oxidation of saturated fatty acids:
ATP + BUT ⟶ AMP + BT-CoA + PPi - Beta oxidation of butanoyl-CoA to acetyl-CoA:
ATP + BUT ⟶ AMP + BT-CoA + PPi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide salvage:
Ade + PRPP ⟶ AMP + PPi - Purine salvage:
Ade + PRPP ⟶ AMP + PPi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide salvage:
Ade + PRPP ⟶ AMP + PPi - Purine salvage:
Ade + PRPP ⟶ AMP + PPi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide salvage:
Ade + PRPP ⟶ AMP + PPi - Purine salvage:
Ade + PRPP ⟶ AMP + PPi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide salvage:
Ade + PRPP ⟶ AMP + PPi - Purine salvage:
Ade + PRPP ⟶ AMP + PPi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide salvage:
Ade + PRPP ⟶ AMP + PPi - Purine salvage:
Ade + PRPP ⟶ AMP + PPi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide salvage:
Ade + PRPP ⟶ AMP + PPi - Purine salvage:
Ade + PRPP ⟶ AMP + PPi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide salvage:
Ade + PRPP ⟶ AMP + PPi - Purine salvage:
Ade + PRPP ⟶ AMP + PPi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide salvage:
Ade + PRPP ⟶ AMP + PPi - Purine salvage:
Ade + PRPP ⟶ AMP + PPi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide salvage:
Ade + PRPP ⟶ AMP + PPi - Purine salvage:
Ade + PRPP ⟶ AMP + PPi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide salvage:
Ade + PRPP ⟶ AMP + PPi - Purine salvage:
Ade + PRPP ⟶ AMP + PPi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide salvage:
Ade + PRPP ⟶ AMP + PPi - Purine salvage:
Ade + PRPP ⟶ AMP + PPi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide salvage:
Ade + PRPP ⟶ AMP + PPi - Purine salvage:
Ade + PRPP ⟶ AMP + PPi - Nucleotide metabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Nucleotide salvage:
Gua + R1P, dRibP ⟶ G, dG + Pi - Purine salvage:
Gua + R1P, dRibP ⟶ G, dG + Pi - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Selenoamino acid metabolism:
Sec ⟶ H2Se + L-Ala - Selenocysteine synthesis:
ATP + H2O + H2Se ⟶ AMP + H+ + Pi + SELP - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Selenoamino acid metabolism:
Sec ⟶ H2Se + L-Ala - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Selenoamino acid metabolism:
Sec ⟶ H2Se + L-Ala - Selenocysteine synthesis:
ATP + H2O + H2Se ⟶ AMP + H+ + Pi + SELP - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Selenoamino acid metabolism:
ATP + H2O + SeMet ⟶ AdoSeMet + PPi + Pi - Selenocysteine synthesis:
ATP + H2O + H2Se ⟶ AMP + H+ + Pi + SELP - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Selenoamino acid metabolism:
H+ + MeSeO2H + TPNH ⟶ H2O + MeSeOH + TPN - Selenocysteine synthesis:
ATP + H2O + H2Se ⟶ AMP + H+ + Pi + SELP - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Selenoamino acid metabolism:
H2O + SeMet ⟶ 2OBUTA + MeSeH + ammonia - Selenocysteine synthesis:
80S:Met-tRNAi:mRNA:SECISBP2:Sec-tRNA(Sec):EEFSEC:GTP + H2O ⟶ 80S:Met-tRNAi:mRNA:SECISBP2:Sec + EEFSEC:GDP + Pi - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Selenoamino acid metabolism:
Sec ⟶ H2Se + L-Ala - Selenocysteine synthesis:
ATP + H2O + H2Se ⟶ AMP + H+ + Pi + SELP - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Selenoamino acid metabolism:
H+ + MeSeO2H + TPNH ⟶ H2O + MeSeOH + TPN - Selenocysteine synthesis:
ATP + H2O + H2Se ⟶ AMP + H+ + Pi + SELP - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Selenoamino acid metabolism:
Sec ⟶ H2Se + L-Ala - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Selenoamino acid metabolism:
Sec ⟶ H2Se + L-Ala - Selenocysteine synthesis:
ATP + H2O + H2Se ⟶ AMP + H+ + Pi + SELP - Selenocysteine synthesis:
ATP + H2O + H2Se ⟶ AMP + H+ + Pi + SELP - Selenocysteine synthesis:
ATP + H2O + H2Se ⟶ AMP + H+ + Pi + SELP - Selenocysteine synthesis:
ATP + H2O + H2Se ⟶ AMP + H+ + Pi + SELP - Cytosolic sulfonation of small molecules:
H2O + PNPB ⟶ BUT + PNP - Biological oxidations:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN - Phase II - Conjugation of compounds:
H2O + SAH ⟶ Ade-Rib + HCYS - Cytosolic sulfonation of small molecules:
PAPS + beta-estradiol ⟶ E2-SO4 + PAP - Cytosolic sulfonation of small molecules:
H2O + PNPB ⟶ BUT + PNP - Cytosolic sulfonation of small molecules:
H2O + PNPB ⟶ BUT + PNP - Biological oxidations:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN - Phase II - Conjugation of compounds:
H2O + SAH ⟶ Ade-Rib + HCYS - Cytosolic sulfonation of small molecules:
H2O + PAP ⟶ AMP + Pi - Biological oxidations:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Phase II - Conjugation of compounds:
H2O + SAH ⟶ Ade-Rib + HCYS - Cytosolic sulfonation of small molecules:
H2O + PAP ⟶ AMP + Pi - Cytosolic sulfonation of small molecules:
H2O + PNPB ⟶ BUT + PNP - Cytosolic sulfonation of small molecules:
H2O + PNPB ⟶ BUT + PNP - Cytosolic sulfonation of small molecules:
H2O + PNPB ⟶ BUT + PNP - Cytosolic sulfonation of small molecules:
PAPS + beta-estradiol ⟶ E2-SO4 + PAP - Cytosolic sulfonation of small molecules:
H2O + PNPB ⟶ BUT + PNP - Phase I - Functionalization of compounds:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Phase I - Functionalization of compounds:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Phase I - Functionalization of compounds:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Phase I - Functionalization of compounds:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Phase I - Functionalization of compounds:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Phase I - Functionalization of compounds:
H+ + Oxygen + TPNH + progesterone ⟶ 11DCORST + H2O + TPN - Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Phase I - Functionalization of compounds:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Phase I - Functionalization of compounds:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Biological oxidations:
ATP + CH3COO- + CoA-SH ⟶ AMP + Ac-CoA + PPi - Phase I - Functionalization of compounds:
ATP + CH3COO- + CoA-SH ⟶ AMP + Ac-CoA + PPi - Ethanol oxidation:
ATP + CH3COO- + CoA-SH ⟶ AMP + Ac-CoA + PPi - Phase I - Functionalization of compounds:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Biological oxidations:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Phase I - Functionalization of compounds:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Biological oxidations:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Phase I - Functionalization of compounds:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Phase I - Functionalization of compounds:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Phase I - Functionalization of compounds:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Linoleic acid (LA) metabolism:
GLA-CoA + Malonyl-CoA + TPNH ⟶ CoA-SH + DGL-CoA + H2O + TPN + carbon dioxide - Linoleic acid (LA) metabolism:
GLA-CoA + Malonyl-CoA + TPNH ⟶ CoA-SH + DGL-CoA + H2O + TPN + carbon dioxide - Linoleic acid (LA) metabolism:
GLA-CoA + Malonyl-CoA + TPNH ⟶ CoA-SH + DGL-CoA + H2O + TPN + carbon dioxide - Linoleic acid (LA) metabolism:
GLA-CoA + Malonyl-CoA + TPNH ⟶ CoA-SH + DGL-CoA + H2O + TPN + carbon dioxide - Linoleic acid (LA) metabolism:
GLA-CoA + Malonyl-CoA + TPNH ⟶ CoA-SH + DGL-CoA + H2O + TPN + carbon dioxide - Linoleic acid (LA) metabolism:
GLA-CoA + Malonyl-CoA + TPNH ⟶ CoA-SH + DGL-CoA + H2O + TPN + carbon dioxide - Linoleic acid (LA) metabolism:
GLA-CoA + Malonyl-CoA + TPNH ⟶ CoA-SH + DGL-CoA + H2O + TPN + carbon dioxide - Linoleic acid (LA) metabolism:
GLA-CoA + Malonyl-CoA + TPNH ⟶ CoA-SH + DGL-CoA + H2O + TPN + carbon dioxide - Linoleic acid (LA) metabolism:
GLA-CoA + Malonyl-CoA + TPNH ⟶ CoA-SH + DGL-CoA + H2O + TPN + carbon dioxide - Linoleic acid (LA) metabolism:
GLA-CoA + Malonyl-CoA + TPNH ⟶ CoA-SH + DGL-CoA + H2O + TPN + carbon dioxide - Linoleic acid (LA) metabolism:
GLA-CoA + Malonyl-CoA + TPNH ⟶ CoA-SH + DGL-CoA + H2O + TPN + carbon dioxide - Conjugation of benzoate with glycine:
BEZ-CoA + Gly ⟶ CoA + HIPA - Conjugation of benzoate with glycine:
ATP + BENZA + CoA ⟶ AMP + BEZ-CoA + PPi - Conjugation of benzoate with glycine:
BEZ-CoA + Gly ⟶ CoA + HIPA - Conjugation of benzoate with glycine:
BEZ-CoA + Gly ⟶ CoA + HIPA - Conjugation of benzoate with glycine:
BEZ-CoA + Gly ⟶ CoA + HIPA - Conjugation of benzoate with glycine:
BEZ-CoA + Gly ⟶ CoA + HIPA - Conjugation of benzoate with glycine:
ATP + BENZA + CoA ⟶ AMP + BEZ-CoA + PPi - Conjugation of benzoate with glycine:
BEZ-CoA + Gly ⟶ CoA + HIPA - Conjugation of benzoate with glycine:
BEZ-CoA + Gly ⟶ CoA + HIPA - Conjugation of salicylate with glycine:
ATP + CoA + ST ⟶ AMP + PPi + ST-CoA - Conjugation of salicylate with glycine:
ATP + CoA + ST ⟶ AMP + PPi + ST-CoA - Conjugation of salicylate with glycine:
ATP + CoA + ST ⟶ AMP + PPi + ST-CoA - Conjugation of salicylate with glycine:
ATP + CoA + ST ⟶ AMP + PPi + ST-CoA - Conjugation of salicylate with glycine:
ATP + CoA + ST ⟶ AMP + PPi + ST-CoA - Conjugation of salicylate with glycine:
ATP + CoA + ST ⟶ AMP + PPi + ST-CoA - Conjugation of salicylate with glycine:
ATP + CoA + ST ⟶ AMP + PPi + ST-CoA - Conjugation of salicylate with glycine:
ATP + CoA + ST ⟶ AMP + PPi + ST-CoA - Conjugation of salicylate with glycine:
ATP + CoA + ST ⟶ AMP + PPi + ST-CoA - Conjugation of salicylate with glycine:
ATP + CoA + ST ⟶ AMP + PPi + ST-CoA - Glycolysis:
ATP + Fru(6)P ⟶ ADP + F1,6PP - Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Glucose metabolism:
ATP + Fru(6)P ⟶ ADP + F1,6PP - Glycolysis:
ATP + Fru(6)P ⟶ ADP + F1,6PP - Carbohydrate metabolism:
L-gulonate + NAD ⟶ 3-dehydro-L-gulonate + H+ + NADH - Glucose metabolism:
ATP + PYR + carbon dioxide ⟶ ADP + OAA + Pi - Glycolysis:
ATP + Fru(6)P ⟶ ADP + F1,6PP - Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Glucose metabolism:
ATP + PYR + carbon dioxide ⟶ ADP + OAA + Pi - Glycolysis:
ATP + Fru(6)P ⟶ ADP + F1,6PP - Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Glucose metabolism:
ATP + PYR + carbon dioxide ⟶ ADP + OAA + Pi - Glycolysis:
ATP + Fru(6)P ⟶ ADP + F1,6PP - Carbohydrate metabolism:
H2O + Heparan(3)-PGs ⟶ CH3COO- + Heparan(4)-PGs - Glucose metabolism:
ATP + Fru(6)P ⟶ ADP + F1,6PP - Glycolysis:
ATP + Fru(6)P ⟶ ADP + F1,6PP - Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Glucose metabolism:
ATP + Fru(6)P ⟶ ADP + F1,6PP - Glycolysis:
ATP + Fru(6)P ⟶ ADP + F1,6PP - Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Glucose metabolism:
ATP + PYR + carbon dioxide ⟶ ADP + OAA + Pi - Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Glucose metabolism:
ATP + PYR + carbon dioxide ⟶ ADP + OAA + Pi - Glycolysis:
ATP + Fru(6)P ⟶ ADP + F1,6PP - Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Glucose metabolism:
ATP + PYR + carbon dioxide ⟶ ADP + OAA + Pi - Glycolysis:
ATP + Fru(6)P ⟶ ADP + F1,6PP - Carbohydrate metabolism:
ATP + PYR + carbon dioxide ⟶ ADP + OAA + Pi - Glucose metabolism:
ATP + PYR + carbon dioxide ⟶ ADP + OAA + Pi - Glycolysis:
ATP + Fru(6)P ⟶ ADP + F1,6PP - Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Glucose metabolism:
ATP + PYR + carbon dioxide ⟶ ADP + OAA + Pi - Glycolysis:
ATP + Fru(6)P ⟶ ADP + F1,6PP - Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of steroids:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN - Bile acid and bile salt metabolism:
CHOL + H+ + Oxygen + TPNH ⟶ 25OH-CHOL + H2O + TPN - Synthesis of bile acids and bile salts:
CHOL + H+ + Oxygen + TPNH ⟶ 25OH-CHOL + H2O + TPN - Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
H2O + choloyl-CoA ⟶ CoA-SH + cholate - Metabolism of steroids:
17aHPROG + H+ + Oxygen + TPNH ⟶ 11-deoxycortisol + H2O + TPN - Bile acid and bile salt metabolism:
CHOL + H+ + Oxygen + TPNH ⟶ 7alpha-hydroxycholesterol + H2O + TPN - Synthesis of bile acids and bile salts:
CHOL + H+ + Oxygen + TPNH ⟶ 7alpha-hydroxycholesterol + H2O + TPN - Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 7alpha-hydroxycholesterol + H2O + TPN - Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts via 24-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 24OH-CHOL + H2O + TPN - Synthesis of bile acids and bile salts via 24-hydroxycholesterol:
4CHOL7a,12a,24(S)TONE + H+ + TPNH ⟶ 5beta-cholestan-7alpha,12alpha,24(S)-triol-3-one + TPN - Synthesis of bile acids and bile salts via 24-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 24OH-CHOL + H2O + TPN - Synthesis of bile acids and bile salts via 24-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 24OH-CHOL + H2O + TPN - Synthesis of bile acids and bile salts via 24-hydroxycholesterol:
4CHOL7a,12a,24(S)TONE + H+ + TPNH ⟶ 5beta-cholestan-7alpha,12alpha,24(S)-triol-3-one + TPN - Synthesis of bile acids and bile salts via 24-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 24OH-CHOL + H2O + TPN - Synthesis of bile acids and bile salts via 24-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 24OH-CHOL + H2O + TPN - Synthesis of bile acids and bile salts via 24-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 24OH-CHOL + H2O + TPN - Synthesis of bile acids and bile salts via 24-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 24OH-CHOL + H2O + TPN - Synthesis of bile acids and bile salts via 24-hydroxycholesterol:
4CHOL7a,12a,24(S)TONE + H+ + TPNH ⟶ 5beta-cholestan-7alpha,12alpha,24(S)-triol-3-one + TPN - Synthesis of bile acids and bile salts via 24-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 24OH-CHOL + H2O + TPN - Synthesis of bile acids and bile salts via 24-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 24OH-CHOL + H2O + TPN - Nucleotide catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Purine catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Phosphate bond hydrolysis by NUDT proteins:
ADP-D-ribose + H2O ⟶ AMP + R5P - Nucleotide catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Purine catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Phosphate bond hydrolysis by NUDT proteins:
ADP-D-ribose + H2O ⟶ AMP + R5P - Nucleotide catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Purine catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Phosphate bond hydrolysis by NUDT proteins:
ADP-D-ribose + H2O ⟶ AMP + R5P - Nucleotide catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Purine catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Phosphate bond hydrolysis by NUDT proteins:
ADP-D-ribose + H2O ⟶ AMP + R5P - Nucleotide catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Purine catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Phosphate bond hydrolysis by NUDT proteins:
ADP-D-ribose + H2O ⟶ AMP + R5P - Nucleotide catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Purine catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Phosphate bond hydrolysis by NUDT proteins:
ADP-D-ribose + H2O ⟶ AMP + R5P - Nucleotide catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Purine catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Phosphate bond hydrolysis by NUDT proteins:
ADP-D-ribose + H2O ⟶ AMP + R5P - Nucleotide catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Purine catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Phosphate bond hydrolysis by NUDT proteins:
ADP-D-ribose + H2O ⟶ AMP + R5P - Nucleotide catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Purine catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Phosphate bond hydrolysis by NUDT proteins:
ADP-D-ribose + H2O ⟶ AMP + R5P - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins.:
CoQ + ETF:FADH2 ⟶ ETF:FAD + ubiquinol - Respiratory electron transport:
CoQ + ETF:FADH2 ⟶ ETF:FAD + ubiquinol - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins.:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Respiratory electron transport:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins.:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Respiratory electron transport:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins.:
H2O + oleoyl-Phe ⟶ L-Phe + oleate - Respiratory electron transport:
CoQ + Cytochrome c (oxidised) + H+ + ubiquinol ⟶ CoQ + Cytochrome c (reduced) + H+ + ubiquinol - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins.:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Respiratory electron transport:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins.:
Cytochrome c-Fe2+ + H+ + Oxygen ⟶ Cytochrome c-Fe3+ + H+ + H2O - Respiratory electron transport:
Cytochrome c-Fe2+ + H+ + Oxygen ⟶ Cytochrome c-Fe3+ + H+ + H2O - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins.:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Respiratory electron transport:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins.:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Respiratory electron transport:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins.:
H2O + oleoyl-Phe ⟶ L-Phe + oleate - Respiratory electron transport:
CoQ + Cytochrome c (oxidised) + H+ + ubiquinol ⟶ CoQ + Cytochrome c (reduced) + H+ + ubiquinol - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins.:
H2O + oleoyl-Phe ⟶ L-Phe + oleate - Respiratory electron transport:
CoQ + Cytochrome c (oxidised) + H+ + ubiquinol ⟶ CoQ + Cytochrome c (reduced) + H+ + ubiquinol - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins.:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Respiratory electron transport:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins.:
CoQ + H+ + NADH ⟶ H+ + NAD + ubiquinol - Respiratory electron transport:
CoQ + H+ + NADH ⟶ H+ + NAD + ubiquinol - Abacavir ADME:
AMP + abacavir ⟶ Ade-Rib + xenobiotic - Abacavir metabolism:
AMP + abacavir ⟶ Ade-Rib + xenobiotic - Vitamin B1 (thiamin) metabolism:
ATP + THMN ⟶ AMP + TPP - Vitamin B1 (thiamin) metabolism:
ATP + THMN ⟶ AMP + TPP - Vitamin B1 (thiamin) metabolism:
ATP + THMN ⟶ AMP + TPP - Vitamin B1 (thiamin) metabolism:
ATP + THMN ⟶ AMP + TPP - Vitamin B1 (thiamin) metabolism:
ATP + THMN ⟶ AMP + TPP - Vitamin B1 (thiamin) metabolism:
ATP + THMN ⟶ AMP + TPP - Vitamin B1 (thiamin) metabolism:
ATP + THMN ⟶ AMP + TPP - Vitamin B1 (thiamin) metabolism:
ATP + THMN ⟶ AMP + TPP - Vitamin B1 (thiamin) metabolism:
ATP + THMN ⟶ AMP + TPP - Vitamin B1 (thiamin) metabolism:
ATP + THMN ⟶ AMP + TPP - Vitamin B1 (thiamin) metabolism:
ATP + THMN ⟶ AMP + TPP - Vitamin B1 (thiamin) metabolism:
ATP + THMN ⟶ AMP + TPP - Vitamin B1 (thiamin) metabolism:
ATP + THMN ⟶ AMP + TPP - Vitamin B1 (thiamin) metabolism:
ATP + THMN ⟶ AMP + TPP - Vitamin B1 (thiamin) metabolism:
ATP + THMN ⟶ AMP + TPP - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Gamma carboxylation, hypusine formation and arylsulfatase activation:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Synthesis of diphthamide-EEF2:
Q3SYU2 + SAM ⟶ Q3SYU2 + SAH - Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Gamma carboxylation, hypusine formation and arylsulfatase activation:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Synthesis of diphthamide-EEF2:
SAM + nascent EEF2 ⟶ MTAD + aminocarboxypropyl EEF2 - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Gamma carboxylation, hypusine formation and arylsulfatase activation:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Synthesis of diphthamide-EEF2:
F6XRY2 + SAM ⟶ F6XRY2 + MTAD - Metabolism of proteins:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a - Post-translational protein modification:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a - Gamma carboxylation, hypusine formation and arylsulfatase activation:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a - Synthesis of diphthamide-EEF2:
SAM + efbA ⟶ MTAD + efbA - Nucleotide metabolism:
ATP + Thy-dRib ⟶ ADP + TMP - Nucleotide salvage:
ATP + Thy-dRib ⟶ ADP + TMP - Purine salvage:
AMP + H2O ⟶ IMP + NH4+ - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH + Q9GU68 - Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH + Q9GU68 - Gamma carboxylation, hypusine formation and arylsulfatase activation:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH + Q9GU68 - Synthesis of diphthamide-EEF2:
SAM + nascent EEF2 ⟶ MTAD + aminocarboxypropyl EEF2 - Metabolism of proteins:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Post-translational protein modification:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Gamma carboxylation, hypusine formation and arylsulfatase activation:
A0A1D5NW08 + PAPS ⟶ A0A1D5NW08 + PAP - Synthesis of diphthamide-EEF2:
A0A1D5PS29 + SAM ⟶ A0A1D5PS29 + MTAD - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Gamma carboxylation, hypusine formation and arylsulfatase activation:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Synthesis of diphthamide-EEF2:
SAM + nascent EEF2 ⟶ MTAD + aminocarboxypropyl EEF2 - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Gamma carboxylation, hypusine formation and arylsulfatase activation:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Synthesis of diphthamide-EEF2:
SAM + nascent EEF2 ⟶ MTAD + aminocarboxypropyl EEF2 - Nucleotide metabolism:
GTP + IMP + L-Asp ⟶ ADS + GDP + H+ + Pi - Nucleotide salvage:
R1P, dRibP + Ura ⟶ (d)Ura + Pi - Purine salvage:
GMP + H+ + TPNH ⟶ IMP + NH4+ + TPN - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Gamma carboxylation, hypusine formation and arylsulfatase activation:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Synthesis of diphthamide-EEF2:
SAM + nascent EEF2 ⟶ MTAD + aminocarboxypropyl EEF2 - Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Gamma carboxylation, hypusine formation and arylsulfatase activation:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Synthesis of diphthamide-EEF2:
SAM + nascent EEF2 ⟶ MTAD + aminocarboxypropyl EEF2 - Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Gamma carboxylation, hypusine formation and arylsulfatase activation:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Synthesis of diphthamide-EEF2:
SAM + nascent EEF2 ⟶ MTAD + aminocarboxypropyl EEF2 - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Gamma carboxylation, hypusine formation and arylsulfatase activation:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Synthesis of diphthamide-EEF2:
I3LII3 + SAM ⟶ I3LII3 + SAH - Metabolism of proteins:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a - Post-translational protein modification:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a - Gamma carboxylation, hypusine formation and arylsulfatase activation:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a - Synthesis of diphthamide-EEF2:
A0A6I8QPT9 + SAM ⟶ A0A6I8QPT9 + SAH - Fatty acyl-CoA biosynthesis:
Mal-CoA + PALM-CoA ⟶ 3OOD-CoA + CoA-SH + carbon dioxide - Synthesis of very long-chain fatty acyl-CoAs:
Mal-CoA + PALM-CoA ⟶ 3OOD-CoA + CoA-SH + carbon dioxide - Integration of energy metabolism:
A0A3Q1LHN3 + cAMP ⟶ RAPGEF3:cAMP complex - Regulation of insulin secretion:
A0A3Q1LHN3 + cAMP ⟶ RAPGEF3:cAMP complex - Free fatty acids regulate insulin secretion:
ATP + CoA-SH + PALM ⟶ AMP + PALM-CoA + PPi - Fatty acyl-CoA biosynthesis:
ATP + CIT + CoA-SH ⟶ ADP + Ac-CoA + OA + Pi - Synthesis of very long-chain fatty acyl-CoAs:
Mal-CoA + PALM-CoA ⟶ 3OOD-CoA + CoA-SH + carbon dioxide - Integration of energy metabolism:
cAMP + epac-1 ⟶ RAPGEF3:cAMP complex - Regulation of insulin secretion:
cAMP + epac-1 ⟶ RAPGEF3:cAMP complex - Fatty acyl-CoA biosynthesis:
ATP + CIT + CoA-SH ⟶ ADP + Ac-CoA + OA + Pi - Synthesis of very long-chain fatty acyl-CoAs:
Mal-CoA + PALM-CoA ⟶ 3OOD-CoA + CoA-SH + carbon dioxide - Integration of energy metabolism:
F1PW07 + cAMP ⟶ RAPGEF3:cAMP complex - Regulation of insulin secretion:
F1PW07 + cAMP ⟶ RAPGEF3:cAMP complex - Free fatty acids regulate insulin secretion:
ATP + CoA-SH + PALM ⟶ AMP + PALM-CoA + PPi - Fatty acyl-CoA biosynthesis:
ATP + CIT + CoA-SH ⟶ ADP + Ac-CoA + OA + Pi - Synthesis of very long-chain fatty acyl-CoAs:
Mal-CoA + PALM-CoA ⟶ 3OOD-CoA + CoA-SH + carbon dioxide - Integration of energy metabolism:
E7FDC9 + cAMP ⟶ RAPGEF3:cAMP complex - Regulation of insulin secretion:
E7FDC9 + cAMP ⟶ RAPGEF3:cAMP complex - Free fatty acids regulate insulin secretion:
ATP + CoA-SH + PALM ⟶ AMP + PALM-CoA + PPi - Fatty acyl-CoA biosynthesis:
ATP + CIT + CoA-SH ⟶ ADP + Ac-CoA + OA + Pi - Synthesis of very long-chain fatty acyl-CoAs:
Mal-CoA + PALM-CoA ⟶ 3OOD-CoA + CoA-SH + carbon dioxide - Fatty acyl-CoA biosynthesis:
ATP + CIT + CoA-SH ⟶ ADP + Ac-CoA + OA + Pi - Synthesis of very long-chain fatty acyl-CoAs:
Mal-CoA + PALM-CoA ⟶ 3OOD-CoA + CoA-SH + carbon dioxide - Integration of energy metabolism:
Epac + cAMP ⟶ RAPGEF3:cAMP complex - Regulation of insulin secretion:
Epac + cAMP ⟶ RAPGEF3:cAMP complex - Fatty acyl-CoA biosynthesis:
ATP + CIT + CoA-SH ⟶ ADP + Ac-CoA + OA + Pi - Synthesis of very long-chain fatty acyl-CoAs:
Mal-CoA + PALM-CoA ⟶ 3OOD-CoA + CoA-SH + carbon dioxide - Integration of energy metabolism:
A0A3Q2UAA9 + cAMP ⟶ RAPGEF3:cAMP complex - Regulation of insulin secretion:
A0A3Q2UAA9 + cAMP ⟶ RAPGEF3:cAMP complex - Fatty acyl-CoA biosynthesis:
ATP + CIT + CoA-SH ⟶ ADP + Ac-CoA + OA + Pi - Synthesis of very long-chain fatty acyl-CoAs:
Mal-CoA + PALM-CoA ⟶ 3OOD-CoA + CoA-SH + carbon dioxide - Integration of energy metabolism:
PKA:AKAP79:IQGAP1 Complex + cAMP ⟶ PRKACA,PRKACB,PRKACG + cAMP:PKA:AKAP79:IQGAP1 Complex - Regulation of insulin secretion:
PKA:AKAP79:IQGAP1 Complex + cAMP ⟶ PRKACA,PRKACB,PRKACG + cAMP:PKA:AKAP79:IQGAP1 Complex - Free fatty acids regulate insulin secretion:
ATP + CoA-SH + PALM ⟶ AMP + PALM-CoA + PPi - Fatty acyl-CoA biosynthesis:
ATP + CIT + CoA-SH ⟶ ADP + Ac-CoA + OA + Pi - Synthesis of very long-chain fatty acyl-CoAs:
Mal-CoA + PALM-CoA ⟶ 3OOD-CoA + CoA-SH + carbon dioxide - Integration of energy metabolism:
Q8VCC8 + cAMP ⟶ RAPGEF3:cAMP complex - Regulation of insulin secretion:
Q8VCC8 + cAMP ⟶ RAPGEF3:cAMP complex - Free fatty acids regulate insulin secretion:
ATP + CoA-SH + PALM ⟶ AMP + PALM-CoA + PPi - Fatty acyl-CoA biosynthesis:
Mal-CoA + PALM-CoA ⟶ 3OOD-CoA + CoA-SH + carbon dioxide - Synthesis of very long-chain fatty acyl-CoAs:
Mal-CoA + PALM-CoA ⟶ 3OOD-CoA + CoA-SH + carbon dioxide - Fatty acyl-CoA biosynthesis:
ATP + CIT + CoA-SH ⟶ ADP + Ac-CoA + OA + Pi - Synthesis of very long-chain fatty acyl-CoAs:
Mal-CoA + PALM-CoA ⟶ 3OOD-CoA + CoA-SH + carbon dioxide - Integration of energy metabolism:
Q9Z1C8 + cAMP ⟶ RAPGEF3:cAMP complex - Regulation of insulin secretion:
Q9Z1C8 + cAMP ⟶ RAPGEF3:cAMP complex - Free fatty acids regulate insulin secretion:
ATP + CoA-SH + PALM ⟶ AMP + PALM-CoA + PPi - Fatty acyl-CoA biosynthesis:
ATP + Ac-CoA + HCO3- ⟶ ADP + Mal-CoA + Pi - Synthesis of very long-chain fatty acyl-CoAs:
AA + ATP + CoA-SH ⟶ AA-CoA + AMP + H2O + PPi - Integration of energy metabolism:
PKA tetramer:4xcAMP ⟶ cAMP:PKA regulatory subunit - Regulation of insulin secretion:
ATP + CoA-SH + PALM ⟶ AMP + PALM-CoA + PPi - Free fatty acids regulate insulin secretion:
ATP + CoA-SH + PALM ⟶ AMP + PALM-CoA + PPi - Metabolism of lipids:
ACA + H+ + NADH ⟶ NAD + bHBA - Fatty acid metabolism:
ATP + CIT + CoA-SH ⟶ ADP + Ac-CoA + OA + Pi - Fatty acyl-CoA biosynthesis:
ATP + CIT + CoA-SH ⟶ ADP + Ac-CoA + OA + Pi - Synthesis of very long-chain fatty acyl-CoAs:
AA + ATP + CoA-SH ⟶ AA-CoA + AMP + H2O + PPi - Integration of energy metabolism:
PKA tetramer:4xcAMP ⟶ PRKACA + cAMP:PKA regulatory subunit - Regulation of insulin secretion:
ATP + CoA-SH + PALM ⟶ AMP + PALM-CoA + PPi - Fatty acyl-CoA biosynthesis:
ATP + CIT + CoA-SH ⟶ ADP + Ac-CoA + OA + Pi - Synthesis of very long-chain fatty acyl-CoAs:
Mal-CoA + PALM-CoA ⟶ 3OOD-CoA + CoA-SH + carbon dioxide - Integration of energy metabolism:
I3L7Z0 + cAMP ⟶ RAPGEF3:cAMP complex - Regulation of insulin secretion:
I3L7Z0 + cAMP ⟶ RAPGEF3:cAMP complex - Free fatty acids regulate insulin secretion:
ATP + CoA-SH + PALM ⟶ AMP + PALM-CoA + PPi - Fatty acyl-CoA biosynthesis:
ATP + CIT + CoA-SH ⟶ ADP + Ac-CoA + OA + Pi - Synthesis of very long-chain fatty acyl-CoAs:
Mal-CoA + PALM-CoA ⟶ 3OOD-CoA + CoA-SH + carbon dioxide - Integration of energy metabolism:
F6PS10 + cAMP ⟶ RAPGEF3:cAMP complex - Regulation of insulin secretion:
F6PS10 + cAMP ⟶ RAPGEF3:cAMP complex - Free fatty acids regulate insulin secretion:
ATP + CoA-SH + PALM ⟶ AMP + PALM-CoA + PPi - Free fatty acids regulate insulin secretion:
ATP + CoA-SH + PALM ⟶ AMP + PALM-CoA + PPi - Intracellular metabolism of fatty acids regulates insulin secretion:
ATP + CoA-SH + PALM ⟶ AMP + PALM-CoA + PPi - Intracellular metabolism of fatty acids regulates insulin secretion:
ATP + CoA-SH + PALM ⟶ AMP + PALM-CoA + PPi - Intracellular metabolism of fatty acids regulates insulin secretion:
ATP + CoA-SH + PALM ⟶ AMP + PALM-CoA + PPi - Intracellular metabolism of fatty acids regulates insulin secretion:
ATP + CoA-SH + PALM ⟶ AMP + PALM-CoA + PPi - Free fatty acids regulate insulin secretion:
ATP + CoA-SH + PALM ⟶ AMP + PALM-CoA + PPi - Intracellular metabolism of fatty acids regulates insulin secretion:
ATP + CoA-SH + PALM ⟶ AMP + PALM-CoA + PPi - Intracellular metabolism of fatty acids regulates insulin secretion:
ATP + CoA-SH + PALM ⟶ AMP + PALM-CoA + PPi - Intracellular metabolism of fatty acids regulates insulin secretion:
ATP + CoA-SH + PALM ⟶ AMP + PALM-CoA + PPi - Free fatty acids regulate insulin secretion:
ATP + CoA-SH + PALM ⟶ AMP + PALM-CoA + PPi - Intracellular metabolism of fatty acids regulates insulin secretion:
ATP + CoA-SH + PALM ⟶ AMP + PALM-CoA + PPi - Intracellular metabolism of fatty acids regulates insulin secretion:
ATP + CoA-SH + PALM ⟶ AMP + PALM-CoA + PPi - Free fatty acids regulate insulin secretion:
H2O + PI(4,5)P2 ⟶ DAG + I(1,4,5)P3 - Intracellular metabolism of fatty acids regulates insulin secretion:
ATP + CoA-SH + PALM ⟶ AMP + PALM-CoA + PPi - Intracellular metabolism of fatty acids regulates insulin secretion:
ATP + CoA-SH + PALM ⟶ AMP + PALM-CoA + PPi - Intracellular metabolism of fatty acids regulates insulin secretion:
ATP + CoA-SH + PALM ⟶ AMP + PALM-CoA + PPi - Intracellular metabolism of fatty acids regulates insulin secretion:
ATP + CoA-SH + PALM ⟶ AMP + PALM-CoA + PPi
BioCyc(530)
- acetone degradation II (to acetoacetate):
NADP+ + propan-2-ol ⟶ H+ + NADPH + acetone - citronellol degradation:
ATP + citronellate + coenzyme A ⟶ AMP + citronellyll-CoA + diphosphate - fumiquinazoline D biosynthesis:
ATP + ala + fumiquinazoline F-indoline-2',3'-diol ⟶ AMP + H+ + H2O + diphosphate + fumiquinazoline A - phenolphthiocerol biosynthesis:
19-(4-hydroxyphenyl)nonadecanoyl adenylate + holo-(phenol)carboxyphthiodiolenone synthase ⟶ AMP + H+ + a 19-(4-hydroxyphenyl)-nonadecanoyl-[(phenol)carboxyphthiodiolenone synthase] - phenolphthiocerol biosynthesis:
19-(4-hydroxyphenyl)nonadecanoyl adenylate + holo-(phenol)carboxyphthiodiolenone synthase ⟶ AMP + H+ + a 19-(4-hydroxyphenyl)-nonadecanoyl-[(phenol)carboxyphthiodiolenone synthase] - selenocysteine biosynthesis:
ATP + ser ⟶ AMP + diphosphate - L-selenocysteine biosynthesis II (archaea and eukaryotes):
ATP + H2O + selenide ⟶ AMP + phosphate + selenophosphate - L-selenocysteine biosynthesis I (bacteria):
ATP + H2O + selenide ⟶ AMP + phosphate + selenophosphate - L-selenocysteine biosynthesis I (bacteria):
ATP + H2O + selenide ⟶ AMP + phosphate + selenophosphate - selenocysteine biosynthesis I (bacteria):
ATP + H+ + ser ⟶ AMP + diphosphate - selenocysteine biosynthesis I (bacteria):
ATP + ser ⟶ AMP + diphosphate - selenocysteine biosynthesis I (bacteria):
ATP + H+ + ser ⟶ AMP + diphosphate - selenocysteine biosynthesis I (bacteria):
ATP + H+ + ser ⟶ AMP + diphosphate - L-selenocysteine biosynthesis I (bacteria):
ATP + H2O + selenide ⟶ AMP + phosphate + selenophosphate - L-selenocysteine biosynthesis I (bacteria):
ATP + H+ + ser ⟶ AMP + diphosphate - L-selenocysteine biosynthesis II (archaea and eukaryotes):
ATP + H+ + ser ⟶ AMP + diphosphate - selenocysteine biosynthesis I (bacteria):
ATP + H+ + ser ⟶ AMP + diphosphate - selenocysteine biosynthesis I (bacteria):
ATP + H+ + ser ⟶ AMP + diphosphate - selenocysteine biosynthesis II (archaea and eukaryotes):
ATP ⟶ ADP - L-selenocysteine biosynthesis I (bacteria):
ATP + ser ⟶ AMP + diphosphate - L-selenocysteine biosynthesis I (bacteria):
ATP + ser ⟶ AMP + diphosphate - L-selenocysteine biosynthesis I (bacteria):
ATP + ser ⟶ AMP + diphosphate - L-selenocysteine biosynthesis II (archaea and eukaryotes):
ATP + H+ + ser ⟶ AMP + diphosphate - L-selenocysteine biosynthesis I (bacteria):
ATP + ser ⟶ AMP + diphosphate - selenate reduction:
H+ + NADPH + glutathioselenol ⟶ NADP+ + glutathione + hydrogen selenide - selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol - phosphopantothenate biosynthesis I:
β-alanine + (R)-pantoate + ATP ⟶ (R)-pantothenate + AMP + H+ + diphosphate - superpathway of coenzyme A biosynthesis I (bacteria):
β-alanine + (R)-pantoate + ATP ⟶ (R)-pantothenate + AMP + H+ + diphosphate - superpathway of coenzyme A biosynthesis I (bacteria):
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate - phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate - superpathway of chorismate metabolism:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - enterobactin biosynthesis:
H2O + isochorismate ⟶ (2S,3S)-2,3-dihydroxy-2,3-dihydrobenzoate + pyruvate - enterobactin biosynthesis:
H2O + isochorismate ⟶ (2S,3S)-2,3-dihydroxy-2,3-dihydrobenzoate + pyruvate - enterobactin biosynthesis:
H2O + isochorismate ⟶ (2S,3S)-2,3-dihydroxy-2,3-dihydrobenzoate + pyruvate - superpathway of chorismate metabolism:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - enterobactin biosynthesis:
H2O + isochorismate ⟶ (2S,3S)-2,3-dihydroxy-2,3-dihydrobenzoate + pyruvate - superpathway of chorismate metabolism:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - chitin degradation I (archaea):
β-D-glucosaminyl-(1→4)-N-acetyl-D-glucosamine + H2O ⟶ N-acetyl-D-glucosamine + D-glucosamine - superpathay of heme b biosynthesis from glutamate:
ATP + glu ⟶ AMP + diphosphate - tRNA charging:
ATP + thr ⟶ AMP + diphosphate - tetrapyrrole biosynthesis I (from glutamate):
ATP + glu ⟶ AMP + diphosphate - tetrapyrrole biosynthesis I (from glutamate):
(S)-4-amino-5-oxopentanoate + NADP+ ⟶ H+ + NADPH - tRNA charging:
ATP + ala ⟶ AMP + diphosphate - phosalacine biosynthesis:
N-acetylphosphinothricyl-L-alanyl-L-leucine + H2O ⟶ acetate + phosalacine - phosphinothricin tripeptide biosynthesis:
2-hydroxyethylphosphonate + NAD+ ⟶ H+ + NADH + phosphonoacetaldehyde - nickel cofactor biosynthesis:
hydrogencarbonate + nicotinate adenine dinucleotide ⟶ AMP + H+ + pyridin-1-ium-3,5-dicarboxylate mononucleotide - novobiocin biosynthesis:
3-amino-4,7-dihydroxy-coumarin + 3-dimethylallyl-4-hydroxybenzoate + ATP ⟶ 8-demethylnovobiocic acid + AMP + H+ + diphosphate - glycolysis V (Pyrococcus):
D-glyceraldehyde 3-phosphate + H2O + an oxidized ferredoxin [iron-sulfur] cluster ⟶ 3-phospho-D-glycerate + H+ + a reduced ferredoxin [iron-sulfur] cluster - L-carnitine degradation I:
ATP + L-carnitine + coenzyme A ⟶ AMP + L-carnitinyl-CoA + diphosphate - L-carnitine degradation I:
γ-butyrobetainyl-CoA + L-carnitine ⟶ γ-butyrobetaine + L-carnitinyl-CoA - L-carnitine degradation I:
ATP + L-carnitine + coenzyme A ⟶ AMP + L-carnitinyl-CoA + diphosphate - carnitine degradation I:
γ-butyrobetainyl-CoA + L-carnitine ⟶ γ-butyrobetaine + L-carnitinyl-CoA - carnitine degradation I:
γ-butyrobetainyl-CoA + L-carnitine ⟶ γ-butyrobetaine + L-carnitinyl-CoA - L-carnitine degradation I:
γ-butyrobetainyl-CoA + L-carnitine ⟶ γ-butyrobetaine + L-carnitinyl-CoA - L-carnitine degradation I:
ATP + L-carnitine + coenzyme A ⟶ AMP + L-carnitinyl-CoA + diphosphate - L-carnitine degradation I:
ATP + L-carnitine + coenzyme A ⟶ AMP + L-carnitinyl-CoA + diphosphate - echinomycin and triostin A biosynthesis:
ATP + SAM + a quinoxaline-2-carboxyl-D-seryl-L-alanyl-[non-ribosomal peptide synthase] + cys + val ⟶ AMP + H+ + SAH + diphosphate + non-ribosomal peptide synthase + triostin A dithiol - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - 2-methylcitrate cycle II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - 2-methylcitrate cycle I:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - superpathway of coenzyme A biosynthesis II (plants):
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - L-isoleucine biosynthesis IV:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - 2-methylcitrate cycle I:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ala + malonate semialdehyde ⟶ β-alanine + pyruvate - 2-methylcitrate cycle I:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - 2-methylcitrate cycle I:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - 2-methylcitrate cycle I:
(2R,3S)-2-methylisocitrate ⟶ pyruvate + succinate - 2-methylcitrate cycle II:
(2R,3S)-2-methylisocitrate ⟶ pyruvate + succinate - 2-methylcitrate cycle I:
(2R,3S)-2-methylisocitrate ⟶ pyruvate + succinate - β-alanine biosynthesis II:
ala + malonate semialdehyde ⟶ β-alanine + pyruvate - pantothenate and coenzyme A biosynthesis II:
3-methyl-2-oxobutanoate + 5,10-methylenetetrahydrofolate + H2O ⟶ 2-dehydropantoate + tetrahydrofolate - isoleucine biosynthesis IV:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glt - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - 2-methylcitrate cycle I:
H2O + oxaloacetate + propanoyl-CoA ⟶ (2S,3S)-2-methylcitrate + H+ + coenzyme A - 2-methylcitrate cycle I:
ATP + coenzyme A + propionate ⟶ AMP + H+ + diphosphate + propanoyl-CoA - isoleucine biosynthesis IV:
2-oxoglutarate + ile ⟶ 2-keto-3-methyl-valerate + glt - 2-methylcitrate cycle I:
(2R,3S)-2-methylisocitrate ⟶ pyruvate + succinate - 2-methylcitrate cycle I:
(2R,3S)-2-methylisocitrate ⟶ pyruvate + succinate - L-isoleucine biosynthesis IV:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - L-isoleucine biosynthesis IV:
2-oxobutanoate + an oxidized ferredoxin [iron-sulfur] cluster + coenzyme A ⟶ CO2 + H+ + a reduced ferredoxin [iron-sulfur] cluster + propanoyl-CoA - nocardicin A biosynthesis:
H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster + nocardicin C ⟶ H2O + an oxidized ferredoxin [iron-sulfur] cluster + nocardicin A - dissimilatory sulfate reduction I (to hydrogen sufide)):
ATP + H+ + sulfate ⟶ APS + diphosphate - superpathway of thiosulfate metabolism (Desulfovibrio sulfodismutans):
A + AMP + H+ + sulfite ⟶ A(H2) + APS - assimilatory sulfate reduction II:
H2O + an oxidized ferredoxin [iron-sulfur] cluster + hydrogen sulfide ⟶ H+ + a reduced ferredoxin [iron-sulfur] cluster + sulfite - assimilatory sulfate reduction III:
H2O + NADP+ + hydrogen sulfide ⟶ H+ + NADPH + sulfite - superpathway of sulfur metabolism (Desulfocapsa sulfoexigens):
A + AMP + H+ + sulfite ⟶ A(H2) + APS - sulfite oxidation III:
A + AMP + H+ + sulfite ⟶ A(H2) + APS - sulfite oxidation II:
A + AMP + H+ + sulfite ⟶ A(H2) + APS - superpathway of sulfur oxidation (Acidianus ambivalens):
A + AMP + H+ + sulfite ⟶ A(H2) + APS - superpathway of sulfide oxidation (phototrophic sulfur bacteria):
A + AMP + H+ + sulfite ⟶ A(H2) + APS - dissimilatory sulfate reduction II (to thiosulfate):
ATP + H+ + sulfate ⟶ APS + diphosphate - sulfate reduction II (assimilatory):
AMP + GSSG + H+ + sulfite ⟶ APS + glutathione - sulfate reduction III (assimilatory):
ATP + H+ + sulfate ⟶ adenosine 5'-phosphosulfate + diphosphate - sulfite oxidation III:
ATP + H+ + sulfate ⟶ APS + diphosphate - sulfate reduction II (assimilatory):
ATP + H+ + sulfate ⟶ adenosine 5'-phosphosulfate + diphosphate - sulfate reduction III (assimilatory):
ATP + H+ + sulfate ⟶ adenosine 5'-phosphosulfate + diphosphate - sulfate reduction II (assimilatory):
ATP + H+ + sulfate ⟶ adenosine 5'-phosphosulfate + diphosphate - sulfite oxidation III:
ATP + H+ + sulfate ⟶ APS + diphosphate - sulfate reduction V (dissimilatory, to thiosulfate):
ATP + H+ + sulfate ⟶ APS + diphosphate - sulfate reduction IV (dissimilatory, to hydrogen sufide)):
ATP + H+ + sulfate ⟶ APS + diphosphate - phthiocerol biosynthesis:
(behenoyl)adenylate + holo-(phenol)carboxyphthiodiolenone synthase ⟶ AMP + H+ + a behenoyl-[(phenol)carboxyphthiodiolenone synthase] - phthiocerol biosynthesis:
(behenoyl)adenylate + holo-(phenol)carboxyphthiodiolenone synthase ⟶ AMP + H+ + a behenoyl-[(phenol)carboxyphthiodiolenone synthase] - adenine and adenosine salvage I:
adenosine + phosphate ⟶ α-D-ribose-1-phosphate + adenine - superpathway of purine nucleotide salvage:
adenosine + phosphate ⟶ α-D-ribose-1-phosphate + adenine - (aminomethyl)phosphonate degradation:
AMP + diphosphate ⟶ PRPP + adenine - adenosine nucleotides degradation III:
AMP + H2O ⟶ D-ribofuranose 5-phosphate + adenine - nucleoside and nucleotide degradation (archaea):
UMP + phosphate ⟶ α-D-ribose 1,5-bisphosphate + uracil - superpathway of purine nucleotide salvage:
inosine + phosphate ⟶ α-D-ribose-1-phosphate + hypoxanthine - adenine salvage:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage I:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - glyphosate degradation III:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - (aminomethyl)phosphonate degradation:
(acetamidomethyl)phosphonate + ATP ⟶ α-D-ribose 1-(acetamidomethylphosphonate) 5-triphosphate + adenine - adenosine nucleotides degradation III:
AMP + H2O ⟶ D-ribofuranose 5-phosphate + adenine - adenine and adenosine salvage IV:
AMP + diphosphate ⟶ PRPP + adenine - salvage pathways of adenine, hypoxanthine and their nucleosides:
AMP + diphosphate ⟶ PRPP + adenine - superpathway of purine nucleosides salvage:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - purine nucleosides salvage II (plant):
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage I:
adenosine + phosphate ⟶ α-D-ribose-1-phosphate + adenine - adenosine nucleotides degradation III:
AMP + H2O ⟶ D-ribofuranose 5-phosphate + adenine - adenine and adenosine salvage IV:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - adenine and adenosine salvage I:
adenosine + phosphate ⟶ α-D-ribose-1-phosphate + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage I:
AMP + diphosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + adenine - purine and pyrimidine metabolism:
AMP + diphosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + adenine - purine nucleosides salvage II (plant):
AMP + diphosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + adenine - adenine and adenosine salvage I:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage I:
AMP + diphosphate ⟶ PRPP + adenine - adenosine nucleotides degradation III:
AMP + H2O ⟶ D-ribose 5-phosphate + adenine - adenine and adenosine salvage I:
adenosine + phosphate ⟶ α-D-ribose-1-phosphate + adenine - adenine and adenosine salvage IV:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - adenine and adenosine salvage I:
adenosine + phosphate ⟶ α-D-ribose-1-phosphate + adenine - adenosine nucleotides degradation III:
AMP + H2O ⟶ D-ribose 5-phosphate + adenine - adenine and adenosine salvage IV:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - adenosine nucleotides degradation III:
AMP + H2O ⟶ D-ribose 5-phosphate + adenine - adenine salvage:
AMP + diphosphate ⟶ PRPP + adenine - adenosine nucleotides degradation III:
AMP + H2O ⟶ D-ribofuranose 5-phosphate + adenine - adenine and adenosine salvage I:
AMP + diphosphate ⟶ PRPP + adenine - adenine salvage:
AMP + diphosphate ⟶ PRPP + adenine - adenine salvage:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - adenosine nucleotides degradation III:
AMP + H2O ⟶ D-ribofuranose 5-phosphate + adenine - adenine and adenosine salvage I:
AMP + diphosphate ⟶ PRPP + adenine - purine and pyrimidine metabolism:
adenosine + phosphate ⟶ α-D-ribose-1-phosphate + adenine - adenine and adenosine salvage I:
adenosine + phosphate ⟶ α-D-ribose-1-phosphate + adenine - salvage pathways of adenine, hypoxanthine, and their nucleosides:
adenosine + phosphate ⟶ α-D-ribose-1-phosphate + adenine - salvage pathways of purine and pyrimidine nucleotides:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage I:
AMP + diphosphate ⟶ PRPP + adenine - adenine salvage:
AMP + diphosphate ⟶ PRPP + adenine - purine and pyrimidine metabolism:
AMP + diphosphate ⟶ PRPP + adenine - salvage pathways of adenine, hypoxanthine, and their nucleosides:
adenosine + phosphate ⟶ α-D-ribose-1-phosphate + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenosine nucleotides degradation III:
AMP + H2O ⟶ D-ribofuranose 5-phosphate + adenine - adenosine nucleotides degradation III:
AMP + H2O ⟶ D-ribofuranose 5-phosphate + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - purine and pyrimidine metabolism:
adenosine + phosphate ⟶ α-D-ribose-1-phosphate + adenine - purine and pyrimidine metabolism:
adenosine + phosphate ⟶ α-D-ribose-1-phosphate + adenine - adenine and adenosine salvage IV:
AMP + diphosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + adenine - purine and pyrimidine metabolism:
AMP + diphosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + adenine - adenine and adenosine salvage I:
AMP + diphosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribose + adenine - purine nucleosides salvage II (plant):
H2O + adenosine ⟶ D-ribose + adenine - adenine and adenosine salvage I:
adenosine + phosphate ⟶ α-D-ribose-1-phosphate + adenine - adenine and adenosine salvage IV:
AMP + diphosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + adenine - adenine and adenosine salvage I:
adenosine + phosphate ⟶ α-D-ribose-1-phosphate + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage I:
adenosine + phosphate ⟶ α-D-ribose-1-phosphate + adenine - adenosine nucleotides degradation III:
AMP + H2O ⟶ D-ribofuranose 5-phosphate + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenosine nucleotides degradation III:
AMP + H2O ⟶ D-ribofuranose 5-phosphate + adenine - adenine and adenosine salvage I:
adenosine + phosphate ⟶ α-D-ribose-1-phosphate + adenine - adenine and adenosine salvage I:
adenosine + phosphate ⟶ α-D-ribose-1-phosphate + adenine - adenine and adenosine salvage I:
adenosine + phosphate ⟶ α-D-ribose-1-phosphate + adenine - adenine salvage:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - adenine and adenosine salvage I:
AMP + diphosphate ⟶ PRPP + adenine - aminomethylphosphonate degradation:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage I:
AMP + diphosphate ⟶ PRPP + adenine - adenine salvage:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage I:
AMP + diphosphate ⟶ PRPP + adenine - adenine salvage:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - adenine and adenosine salvage I:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage I:
AMP + diphosphate ⟶ PRPP + adenine - peramine biosynthesis:
(S)-1-pyrroline-5-carboxylate + ATP + SAM + arg ⟶ AMP + H+ + H2O + SAH + diphosphate + peramine - pseudomonine biosynthesis:
pre-pseudomonine ⟶ pseudomonine - pyochelin biosynthesis:
(L-cysteinyl)adenylate + a [PchE non-ribosomal peptide synthase] ⟶ AMP + H+ + an L-cysteinyl-[PchE non-ribosomal peptide synthase] - 2-methylpropene degradation:
2-methylpropane-1,2-diol + NAD+ ⟶ 2-hydroxy-2-methylpropanal + H+ + NADH - methyl tert-butyl ether degradation:
H+ + NADH + O2 + methyl tert-butyl ether ⟶ tert-butoxymethanol + H2O + NAD+ - superpathway of roquefortine, meleagrin and neoxaline biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + roquefortine D ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + roquefortine C - roquefortine C biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + roquefortine D ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + roquefortine C - 5-N-acetylardeemin biosynthesis:
DMAPP + ardeemin FQ ⟶ ardeemin + diphosphate - shinorine biosynthesis:
(R)-4-deoxygadusol ⟶ (S)-4-deoxygadusol - viridicatin biosynthesis:
(-)-cyclopenine ⟶ H+ + methyl isocyanate + viridicatin - thiocoraline biosynthesis:
3-hydroxyquinaldate adenylate + aryl-carrier protein ⟶ AMP + H+ + a 3-hydroxyquinaldyl-[aryl-carrier protein] - sitosterol degradation to androstenedione:
17-hydroxy-3-oxo-4-pregnane-20-carboxyl-CoA ⟶ androst-4-ene-3,17-dione + propanoyl-CoA - (-)-microperfuranone biosynthesis:
3-phenyl-2-oxopropanoate + ATP + H2O ⟶ (-)-microperfuranone + AMP + CO2 + diphosphate - 6-gingerol analog biosynthesis (engineered):
(E)-4-coumaroyl-CoA + 3-oxooctanoyl-CoA + H2O ⟶ 4-coumaroylhexanoylmethane + CO2 + coenzyme A - lipoate biosynthesis and incorporation II:
ATP + a [lipoyl-carrier protein]-L-lysine + octanoate ⟶ AMP + H+ + a [lipoyl-carrier protein] N6-octanoyl-L-lysine + diphosphate - lipoate biosynthesis and incorporation II:
H+ + SAM + a [lipoyl-carrier protein] N6-octanoyl-L-lysine + a reduced ferredoxin [iron-sulfur] cluster + an [Fe-S] cluster scaffold protein carrying a [4Fe-4S]+2 cluster ⟶ 5'-deoxyadenosine + Fe2+ + a [lipoyl-carrier protein] N6-[(R)-dihydrolipoyl]-L-lysine + an [Fe-S] cluster scaffold protein + an oxidized ferredoxin [iron-sulfur] cluster + met + sulfide(2-) - lipoate biosynthesis and incorporation II:
ATP + a [lipoyl-carrier protein] + octanoate ⟶ AMP + H+ + a [lipoyl-carrier protein] N6-octanoyl-L-lysine + diphosphate - lipoate biosynthesis and incorporation II:
ATP + a [lipoyl-carrier protein] + octanoate ⟶ AMP + H+ + a [lipoyl-carrier protein] N6-octanoyl-L-lysine + diphosphate - lipoate biosynthesis and incorporation II:
ATP + a [lipoyl-carrier protein] + octanoate ⟶ AMP + H+ + a [lipoyl-carrier protein] N6-octanoyl-L-lysine + diphosphate - indolmycin biosynthesis:
(S)-1-pyrroline-5-carboxylate + H+ + H2O ⟶ L-glutamate-5-semialdehyde - actinomycin D biosynthesis:
3-hydroxy-4-methyl-anthranilate pentapeptide lactone + O2 ⟶ H2O + actinomycin D - superpathway of seleno-compound metabolism:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol - selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol - selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol - selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol - selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol - selenate reduction:
H+ + NADPH + selenodiglutathione ⟶ NADP+ + glutathione + glutathioselenol - selenate reduction:
H+ + NADPH + selenodiglutathione ⟶ NADP+ + glutathione + glutathioselenol - selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol - tetrahydroxyxanthone biosynthesis (from benzoate):
2,3',4,6-tetrahydroxybenzophenone + NADPH + O2 ⟶ 1,3,7-trihydroxyxanthone + H2O + NADP+ - tetrahydroxyxanthone biosynthesis (from 3-hydroxybenzoate):
2,3',4,6-tetrahydroxybenzophenone + NADPH + O2 ⟶ 1,3,5-trihydroxyxanthone + H2O + NADP+ - superpathway of tetrahydroxyxanthone biosynthesis:
2,3',4,6-tetrahydroxybenzophenone + NADPH + O2 ⟶ 1,3,5-trihydroxyxanthone + H2O + NADP+ - selenocysteine biosynthesis I (bacteria):
ATP + H2O + hydrogen selenide ⟶ AMP + phosphate + selenophosphate - selenocysteine biosynthesis II (archaea and eukaryotes):
ATP + H2O + hydrogen selenide ⟶ AMP + phosphate + selenophosphate - selenocysteine biosynthesis I (bacteria):
ATP + H2O + hydrogen selenide ⟶ AMP + H+ + phosphate + selenophosphate - selenocysteine biosynthesis II (archaea and eukaryotes):
ATP + H2O + hydrogen selenide ⟶ AMP + H+ + phosphate + selenophosphate - superpathway of cholesterol degradation II (cholesterol dehydrogenase):
3-hydroxy-9,10-secoandrosta-1,3,5(10)-triene-9,17-dione + FMNH2 + O2 ⟶ 3,4-dihydroxy-9,10-secoandrosta-1,3,5(10)-triene-9,17-dione + FMN + H+ + H2O - cholesterol degradation to androstenedione II (cholesterol dehydrogenase):
17-hydroxy-3-oxo-4-pregnane-20-carboxyl-CoA ⟶ androst-4-ene-3,17-dione + propanoyl-CoA - superpathway of cholesterol degradation II (cholesterol dehydrogenase):
3,4-dihydroxy-9,10-secoandrosta-1,3,5(10)-triene-9,17-dione + O2 ⟶ (1E,2Z)-3-hydroxy-5,9,17-trioxo-4,5:9,10-disecoandrosta-1 (10),2-dien-4-oate + H+ - cholesterol degradation to androstenedione II (cholesterol dehydrogenase):
17-hydroxy-3-oxo-4-pregnane-20-carboxyl-CoA ⟶ androst-4-ene-3,17-dione + propanoyl-CoA - grixazone biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate - clavulanate biosynthesis:
2-oxoglutarate + O2 + dihydroclavaminate ⟶ CO2 + H2O + clavaminate + succinate - thiamin salvage III:
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine salvage IV (yeast):
H2O + thiamine ⟶ 4-amino-2-methyl-5-pyrimidinemethanol + 5-(2-hydroxyethyl)-4-methylthiazole + H+ - thiamine salvage III:
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis III (Staphylococcus):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamin diphosphate biosynthesis III (eukaryotes):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide - thiamin salvage III:
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamin salvage IV:
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - thiamin diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine salvage IV (yeast):
4-amino-2-methyl-5-pyrimidinemethanol + ATP ⟶ ADP + H+ + HMP-P - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - thiamine salvage III:
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine diphosphate biosynthesis III (Staphylococcus):
2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate + H+ + HMP-PP ⟶ CO2 + diphosphate + thiamine phosphate - thiamine diphosphate biosynthesis III (Staphylococcus):
2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate + H+ + HMP-PP ⟶ CO2 + diphosphate + thiamine phosphate - thiamine salvage III:
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine salvage III:
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamin salvage III:
ATP + thiamin ⟶ AMP + H+ + thiamin diphosphate - thiamin diphosphate biosynthesis IV (eukaryotes):
ATP + thiamin ⟶ AMP + H+ + thiamin diphosphate - thiamin diphosphate biosynthesis III (Staphylococcus):
2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate + 4-amino-2-methyl-5-diphosphomethylpyrimidine + H+ ⟶ CO2 + diphosphate + thiamin phosphate - thiamin salvage III:
ATP + thiamin ⟶ AMP + H+ + thiamin diphosphate - thiamin salvage III:
ATP + thiamin ⟶ AMP + H+ + thiamin diphosphate - thiamin diphosphate biosynthesis III (Staphylococcus):
2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate + 4-amino-2-methyl-5-diphosphomethylpyrimidine + H+ ⟶ CO2 + diphosphate + thiamin phosphate - thiamine salvage III:
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine diphosphate biosynthesis III (Staphylococcus):
2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate + H+ + HMP-PP ⟶ CO2 + diphosphate + thiamine phosphate - thiamin diphosphate biosynthesis III (Staphylococcus):
2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate + H+ + HMP-PP ⟶ CO2 + diphosphate + thiamin phosphate - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - thiamine salvage III:
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine salvage III:
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine salvage III:
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine salvage III:
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine diphosphate biosynthesis III (Staphylococcus):
2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate + H+ + HMP-PP ⟶ CO2 + diphosphate + thiamine phosphate - thiamine salvage III:
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine salvage III:
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine diphosphate biosynthesis III (Staphylococcus):
2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate + H+ + HMP-PP ⟶ CO2 + diphosphate + thiamine phosphate - 4'-methoxyviridicatin biosynthesis:
(-)-4'-methoxycyclopenine ⟶ 4'-methoxyviridicatin + H+ + methyl isocyanate - acinetoferrin biosynthesis:
N1-citryl-N3-oct-2-enoyl-N3-hydroxy-1,3-diaminopropane + N3-oct-2-enoyl-N3-hydroxy-1,3-diaminopropane + ATP ⟶ AMP + H+ + acinetoferrin + diphosphate - glycolysis V (Pyrococcus):
β-D-glucose + ADP ⟶ β-D-glucose-6-phosphate + AMP + H+ - hentriaconta-3,6,9,12,15,19,22,25,28-nonaene biosynthesis:
(6Z,9Z,12Z,15Z)-3-hydroxy-2-[(2Z,5Z,8Z,11Z)-tetradeca-2,5,8,11-tetraen-1-yl]octadeca-6,9,12,15-tetraenoate + ATP ⟶ 3-[(3Z,6Z,9Z,12Z)-pentadeca-3,6,9,12-tetraen-1-yl]-4-[(2Z,5Z,8Z,11Z)-tetradeca-2,5,8,11-tetraen-1-yl]oxetan-2-one + AMP + diphosphate - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3R-hydroxyoctanoyl)-CoA + NAD+ ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxooctanoyl)-CoA + H+ + NADH - squid bioluminescence:
H2O + O2 + adenylylcoelenterazine disulfonate ⟶ AMP + H+ + coelenterazine disulfonate dioxetanone - adenosine nucleotides degradation:
AMP + H2O ⟶ adenosine + phosphate - purine nucleotides degradation:
AMP + H2O ⟶ adenosine + phosphate - adenine and adenosine salvage II:
ATP + adenosine ⟶ ADP + AMP + H+ - adenosine nucleotides degradation II:
inosine + phosphate ⟶ α-D-ribose-1-phosphate + hypoxanthine - purine nucleotides degradation II (aerobic):
inosine + phosphate ⟶ α-D-ribose-1-phosphate + hypoxanthine - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenosine nucleotides degradation II:
AMP + H2O ⟶ adenosine + phosphate - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - periplasmic NAD degradation:
AMP + H2O ⟶ adenosine + phosphate - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenosine nucleotides degradation II:
AMP + H2O ⟶ adenosine + phosphate - adenosine nucleotides degradation II:
H+ + H2O + adenosine ⟶ ammonium + inosine - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenosine nucleotides degradation II:
H+ + H2O + adenosine ⟶ ammonium + inosine - adenosine nucleotides degradation II:
H+ + H2O + adenosine ⟶ ammonium + inosine - purine nucleotides degradation II (aerobic):
H+ + H2O + adenosine ⟶ ammonium + inosine - adenosine nucleotides degradation II:
H+ + H2O + adenosine ⟶ ammonium + inosine - adenosine nucleotides degradation II:
H+ + H2O + adenosine ⟶ ammonium + inosine - purine nucleotides degradation II (aerobic):
H+ + H2O + adenosine ⟶ ammonium + inosine - adenosine nucleotides degradation II:
H+ + H2O + adenosine ⟶ ammonium + inosine - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenosine nucleotides degradation II:
AMP + H2O ⟶ adenosine + phosphate - purine nucleotides degradation II (aerobic):
AMP + H2O ⟶ adenosine + phosphate - adenosine nucleotides degradation II:
AMP + H2O ⟶ adenosine + phosphate - adenosine nucleotides degradation II:
AMP + H2O ⟶ adenosine + phosphate - purine nucleotides degradation II (aerobic):
AMP + H2O ⟶ adenosine + phosphate - adenosine nucleotides degradation II:
AMP + H2O ⟶ adenosine + phosphate - adenosine nucleotides degradation II:
AMP + H2O ⟶ adenosine + phosphate - adenosine nucleotides degradation II:
H+ + H2O + adenosine ⟶ ammonium + inosine - adenosine nucleotides degradation II:
AMP + H2O ⟶ adenosine + phosphate - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenosine nucleotides degradation II:
H2O + adenosine ⟶ ammonia + inosine - purine nucleotides degradation II (aerobic):
H2O + adenosine ⟶ ammonia + inosine - adenosine nucleotides degradation II:
H2O + adenosine ⟶ ammonia + inosine - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - purine nucleotides degradation II (aerobic):
H2O + adenosine ⟶ ammonia + inosine - adenosine nucleotides degradation II:
H+ + H2O + adenosine ⟶ ammonium + inosine - purine nucleotides degradation II (aerobic):
H+ + H2O + adenosine ⟶ ammonium + inosine - adenosine nucleotides degradation II:
H+ + H2O + adenosine ⟶ ammonium + inosine - purine nucleotides degradation II (aerobic):
H+ + H2O + adenosine ⟶ ammonium + inosine - adenosine nucleotides degradation II:
H+ + H2O + adenosine ⟶ ammonium + inosine - diphthamide biosynthesis:
SAM + an L-histidine-[translation elongation factor 2] ⟶ S-methyl-5'-thioadenosine + H+ + a 2-[(3S)-3-amino-3-carboxypropyl]-L-histidine-[translation elongation factor 2] - peptidoglycan biosynthesis IV (Enterococcus faecium):
ditrans,octacis-undecaprenyldiphospho-N-acetyl-(N-acetyl-β-D-glucosaminyl)muramoyl-L-alanyl-γ-D-glutamyl-L-lysyl-D-alanyl-D-alanine + ammonium ⟶ ditrans,octacis-undecaprenyldiphospho-N-acetyl-(N-acetylglucosaminyl)muramoyl-L-alanyl-γ-D-isoglutaminyl-L-lysyl-D-alanyl-D-alanine + H2O - peptidoglycan cross-bridge biosynthesis II (E. faecium):
ditrans,octacis-undecaprenyldiphospho-N-acetyl-(N-acetylglucosaminyl)muramoyl-L-alanyl-γ-D-isoglutaminyl-N-(β-D-asparatyl)-L-lysyl-D-alanyl-D-alanine + ATP + ammonium ⟶ ditrans,octacis-undecaprenyldiphospho-N-acetyl-(N-acetylglucosaminyl)muramoyl-L-alanyl-γ-D-isoglutaminyl-N-(β-D-asparaginyl)-L-lysyl-D-alanyl-D-alanine + AMP + H+ + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis I (archaea):
SAM + an L-histidine-[translation elongation factor 2] ⟶ S-methyl-5'-thioadenosine + H+ + a 2-[(3S)-3-amino-3-carboxypropyl]-L-histidine-[translation elongation factor 2] - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - superpathway of L-aspartate and L-asparagine biosynthesis:
asp ⟶ ammonium + fumarate - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - aspartate superpathway:
ATP + L-homoserine ⟶ ADP + H+ + O-phospho-L-homoserine - superpathway of purines degradation in plants:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-aspartate and L-asparagine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - aspartate superpathway:
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis:
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-aspartate and L-asparagine biosynthesis:
2-oxoglutarate + asp ⟶ Glu + oxaloacetate - NAD biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - aspartate superpathway:
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of aspartate and asparagine biosynthesis; interconversion of aspartate and asparagine:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - NAD biosynthesis I (from aspartate):
O2 + asp ⟶ α-iminosuccinate + H+ + hydrogen peroxide - aspartate superpathway:
O2 + asp ⟶ α-iminosuccinate + H+ + hydrogen peroxide - asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of asparagine biosynthesis:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - NAD biosynthesis I (from aspartate):
O2 + asp ⟶ α-iminosuccinate + H+ + hydrogen peroxide - asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of asparagine biosynthesis:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of aspartate and asparagine biosynthesis; interconversion of aspartate and asparagine:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - aspartate superpathway:
O2 + asp ⟶ α-iminosuccinate + H+ + hydrogen peroxide - aspartate superpathway:
O2 + asp ⟶ α-iminosuccinate + H+ + hydrogen peroxide - superpathway of aspartate and asparagine biosynthesis; interconversion of aspartate and asparagine:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - NAD biosynthesis I (from aspartate):
O2 + asp ⟶ α-iminosuccinate + H+ + hydrogen peroxide - asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD biosynthesis I (from aspartate):
O2 + asp ⟶ α-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glt - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-aspartate and L-asparagine biosynthesis:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - NAD biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - aspartate superpathway:
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - aspartate superpathway:
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - NAD biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of purines degradation in plants:
H2O + O2 + urate ⟶ 5-hydroxyisourate + hydrogen peroxide - adenosine nucleotides degradation I:
H2O + xanthosine ⟶ D-ribofuranose + xanthine - pyridine nucleotide cycling:
H2O + NAD+ ⟶ ADP-D-ribose + H+ + nicotinamide - purine nucleotides degradation I (plants):
H2O + xanthosine ⟶ D-ribofuranose + xanthine - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-aspartate and L-asparagine biosynthesis:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - NAD biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of asparagine biosynthesis:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of aspartate and asparagine biosynthesis; interconversion of aspartate and asparagine:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - NAD biosynthesis I (from aspartate):
O2 + asp ⟶ α-iminosuccinate + H+ + hydrogen peroxide - aspartate superpathway:
O2 + asp ⟶ α-iminosuccinate + H+ + hydrogen peroxide - aspartate superpathway:
O2 + asp ⟶ α-iminosuccinate + H+ + hydrogen peroxide - superpathway of aspartate and asparagine biosynthesis; interconversion of aspartate and asparagine:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - NAD biosynthesis I (from aspartate):
O2 + asp ⟶ α-iminosuccinate + H+ + hydrogen peroxide - asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glt - peptidoglycan cross-bridge biosynthesis II (E. faecium):
N-acetylmuramoyl-L-alanyl-D-isoglutaminyl-L-lysyl-D-alanyl-D-alanine-diphospho-ditrans,octacis-undecaprenyl-N-acetylglucosamine + ATP + D-aspartate ⟶ N-acetylmuramoyl-L-alanyl-D-isoglutaminyl-N-(β-D-asparatyl)-L-lysyl-D-alanyl-D-alanine-diphosphoundecaprenyl-N-acetylglucosamine + ADP + H+ + phosphate - NAD biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + Glu + H+ + asn + diphosphate - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of asparagine biosynthesis:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD biosynthesis I (from aspartate):
O2 + asp ⟶ α-iminosuccinate + H+ + hydrogen peroxide - superpathway of aspartate and asparagine biosynthesis; interconversion of aspartate and asparagine:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - superpathway of L-aspartate and L-asparagine biosynthesis:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - aspartate superpathway:
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - NAD biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glt - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - peptidoglycan cross-bridge biosynthesis II (E. faecium):
ditrans,octacis-undecaprenyldiphospho-N-acetyl-(N-acetylglucosaminyl)muramoyl-L-alanyl-γ-D-isoglutaminyl-N-(β-D-asparatyl)-L-lysyl-D-alanyl-D-alanine + ATP + ammonium ⟶ ditrans,octacis-undecaprenyldiphospho-N-acetyl-(N-acetylglucosaminyl)muramoyl-L-alanyl-γ-D-isoglutaminyl-N-(β-D-asparaginyl)-L-lysyl-D-alanyl-D-alanine + AMP + H+ + diphosphate - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glt - peptidoglycan biosynthesis IV (Enterococcus faecium):
ATP + UDP-N-acetyl-α-D-muramate + ala ⟶ ADP + H+ + UDP-N-acetyl-α-D-muramoyl-L-alanine + phosphate - NAD biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + Glu + H+ + asn + diphosphate - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-aspartate and L-asparagine biosynthesis:
2-oxoglutarate + asp ⟶ Glu + oxaloacetate - NAD biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - NAD biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + Glu + H+ + asn + diphosphate - NAD biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis (archaea):
SAM + an L-histidine-[translation elongation factor 2] ⟶ S-methyl-5'-thioadenosine + H+ + a 2-[(3S)-3-amino-3-carboxypropyl]-L-histidine-[translation elongation factor 2] - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glt - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - peptidoglycan cross-bridge biosynthesis II (E. faecium):
ditrans,octacis-undecaprenyldiphospho-N-acetyl-(N-acetylglucosaminyl)muramoyl-L-alanyl-γ-D-isoglutaminyl-N-(β-D-asparatyl)-L-lysyl-D-alanyl-D-alanine + ATP + ammonium ⟶ ditrans,octacis-undecaprenyldiphospho-N-acetyl-(N-acetylglucosaminyl)muramoyl-L-alanyl-γ-D-isoglutaminyl-N-(β-D-asparaginyl)-L-lysyl-D-alanyl-D-alanine + AMP + H+ + diphosphate - NAD biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - peptidoglycan biosynthesis IV (Enterococcus faecium):
ATP + UDP-N-acetyl-α-D-muramate + ala ⟶ ADP + H+ + UDP-N-acetyl-α-D-muramoyl-L-alanine + phosphate - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - glycolysis I:
ATP + D-fructose-6-phosphate ⟶ ADP + H+ + fructose-1,6-bisphosphate - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis:
6-hydroxymethyl-7,8-dihydropterin + ATP ⟶ 6-hydroxymethyl-dihydropterin diphosphate + AMP + H+ - fatty acid activation:
ATP + a fatty acid + coenzyme A ⟶ AMP + a long-chain acyl-CoA + diphosphate - superpathway of citrulline metabolism:
ATP + CO2 + H2O + ammonia ⟶ ADP + H+ + carbamoyl-phosphate + phosphate - tetrahydrofolate biosynthesis II:
ADP + a 10-formyltetrahydrofolate + phosphate ⟶ ATP + a tetrahydrofolate + formate - glycolysis II:
ATP + D-fructose-6-phosphate ⟶ ADP + H+ + fructose-1,6-bisphosphate - gluconeogenesis I:
(S)-malate + NAD+ ⟶ CO2 + NADH + pyruvate - ethanol degradation IV (peroxisomal):
ethanol + hydrogen peroxide ⟶ H2O + acetaldehyde - purine nucleotides de novo biosynthesis II:
5'-phosphoribosyl-4-(N-succinocarboxamide)-5-aminoimidazole ⟶ aminoimidazole carboxamide ribonucleotide + fumarate - urea cycle:
ATP + CO2 + H2O + ammonia ⟶ ADP + H+ + carbamoyl-phosphate + phosphate - oxidative ethanol degradation III (microsomal):
H+ + NADPH + O2 + ethanol ⟶ H2O + NADP+ + acetaldehyde - fatty acid β-oxidation II (core pathway):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
O2 + OPC6-CoA ⟶ OPC6-trans-2-enoyl-CoA + hydrogen peroxide - 1,4-dihydroxy-2-naphthoate biosynthesis I:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - NAD biosynthesis I (from aspartate):
ATP + ammonia + nicotinate adenine dinucleotide ⟶ AMP + NAD+ + diphosphate - superpathway of acetate utilization and formation:
ATP + acetate ⟶ ADP + acetylphosphate - acetate conversion to acetyl-CoA:
ATP + acetate + coenzyme A ⟶ AMP + acetyl-CoA + diphosphate - superpathway of arginine and polyamine biosynthesis:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - aspartate superpathway:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate - PRPP biosynthesis I:
ATP + D-ribose 5-phosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + AMP + H+ - citrulline-nitric oxide cycle:
L-arginino-succinate ⟶ arg + fumarate - arginine biosynthesis III:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - glutamate degradation VII (to butanoate):
(2S, 3S)-3-methylaspartate ⟶ ammonia + mesaconate - ethanol degradation II (cytosol):
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - arginine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - tRNA charging pathway:
ATP + H+ + ala ⟶ AMP + diphosphate - fatty acid β-oxidation I:
ATP + a fatty acid + coenzyme A ⟶ AMP + a 2,3,4-saturated fatty acyl CoA + diphosphate - arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - NAD salvage pathway I:
H2O + nicotinamide ⟶ H+ + ammonia + nicotinate - superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - superpathway of glycolysis and Entner-Doudoroff:
ATP + D-fructose-6-phosphate ⟶ ADP + H+ + fructose-1,6-bisphosphate - asparagine biosynthesis I:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glt - reductive TCA cycle I:
2-oxoglutarate + an oxidized ferredoxin [iron-sulfur] cluster + coenzyme A ⟶ CO2 + a reduced ferredoxin [iron-sulfur] cluster + succinyl-CoA - superpathway of tetrahydrofolate biosynthesis:
7,8-dihydropteroate + ATP + glt ⟶ 7,8-dihydrofolate monoglutamate + ADP + H+ + phosphate - superpathway of chorismate:
glt + phenylpyruvate ⟶ 2-oxoglutarate + phe - superpathway of glyoxylate cycle:
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - tetrapyrrole biosynthesis I:
H2O + porphobilinogen ⟶ H+ + ammonia + hydroxymethylbilane - superpathway of tetrahydrofolate biosynthesis and salvage:
7,8-dihydropteroate + ATP + glt ⟶ 7,8-dihydrofolate monoglutamate + ADP + H+ + phosphate - fatty acid β-oxidation I:
ATP + a fatty acid + coenzyme A ⟶ AMP + a 2,3,4-saturated fatty acyl CoA + diphosphate - citrulline-nitric oxide cycle:
L-arginino-succinate ⟶ arg + fumarate - γ-linolenate biosynthesis II (animals):
ATP + coenzyme A + linoleate ⟶ AMP + diphosphate + linoleoyl-CoA - tRNA splicing:
ATP ⟶ AMP + diphosphate - superpathway of citrulline metabolism:
H2O + gln ⟶ H+ + ammonia + glt - tRNA charging pathway:
ATP + H+ + ala ⟶ AMP + diphosphate - urea cycle:
ATP + CO2 + H2O + ammonia ⟶ ADP + H+ + carbamoyl-phosphate + phosphate - NAD biosynthesis from 2-amino-3-carboxymuconate semialdehyde:
ATP + H2O + gln + nicotinate adenine dinucleotide ⟶ AMP + H+ + NAD+ + diphosphate + glt - glycolysis I:
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate - L-glutamine biosynthesis II (tRNA-dependent):
ATP + gln ⟶ ADP + glt + phosphate - PRPP biosynthesis I:
ATP + D-ribose 5-phosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + AMP + H+ - fatty acid activation:
ATP + a fatty acid + coenzyme A ⟶ AMP + a long-chain acyl-CoA + diphosphate - NAD biosynthesis II (from tryptophan):
3-hydroxy-L-kynurenine + H2O ⟶ 3-hydroxyanthranilate + H+ + ala - ethanol degradation II (cytosol):
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetate conversion to acetyl-CoA:
ATP + acetate + coenzyme A ⟶ AMP + acetyl-CoA + diphosphate - fatty acid β-oxidation II (core pathway):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - arginine biosynthesis IV:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + NAD(P)H + ammonia - gluconeogenesis I:
ATP + oxaloacetate ⟶ ADP + CO2 + phosphoenolpyruvate - asparagine biosynthesis I:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glt - bile acid biosynthesis, neutral pathway:
(25R)-3α,7α-dihydroxy-5-β-cholestanate + ATP + coenzyme A ⟶ (25R)-3α,7α-dihydroxy-5β-cholestanoyl-CoA + AMP + diphosphate - pyridine nucleotide cycling:
ATP + ammonia + nicotinate adenine dinucleotide ⟶ AMP + NAD+ + diphosphate - asparagine biosynthesis II:
ATP + ammonia + asp ⟶ AMP + H+ + asn + diphosphate - glycolysis I:
3-phospho-D-glycerate + ATP ⟶ 1,3-diphosphateglycerate + ADP + H+ - acetate conversion to acetyl-CoA:
ATP + acetate + coenzyme A ⟶ AMP + H+ + acetyl-CoA + diphosphate - superpathway of aspartate and asparagine biosynthesis; interconversion of aspartate and asparagine:
ATP + ammonia + asp ⟶ AMP + H+ + asn + diphosphate - purine nucleotides de novo biosynthesis II:
5'-phosphoribosyl-4-(N-succinocarboxamide)-5-aminoimidazole ⟶ aminoimidazole carboxamide ribonucleotide + fumarate - fatty acid β-oxidation I:
ATP + a fatty acid + coenzyme A ⟶ AMP + H+ + a 2,3,4-saturated fatty acyl CoA + diphosphate - oxidative ethanol degradation III (microsomal):
H+ + NADPH + O2 + ethanol ⟶ H2O + NADP+ + acetaldehyde - citrulline-nitric oxide cycle:
L-arginino-succinate ⟶ arg + fumarate - tRNA charging pathway:
ATP + ala ⟶ AMP + diphosphate - arginine biosynthesis IV:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + NAD(P)H + ammonia - purine nucleotides de novo biosynthesis II:
5'-phosphoribosyl-4-(N-succinocarboxamide)-5-aminoimidazole ⟶ aminoimidazole carboxamide ribonucleotide + fumarate - citrulline-nitric oxide cycle:
L-arginino-succinate ⟶ arg + fumarate - arginine biosynthesis I:
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - ethanol degradation IV (peroxisomal):
ethanol + hydrogen peroxide ⟶ H2O + acetaldehyde - ethanol degradation II (cytosol):
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - fatty acid β-oxidation II (core pathway):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - glycolysis I:
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate - arginine biosynthesis II (acetyl cycle):
2-oxoglutarate + N-acetyl-L-ornithine ⟶ N-acetyl-L-glutamate 5-semialdehyde + glt - PRPP biosynthesis I:
ATP + D-ribose 5-phosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + AMP + H+ - tRNA charging pathway:
ATP + ala ⟶ AMP + diphosphate - fatty acid β-oxidation I:
ATP + a fatty acid + coenzyme A ⟶ AMP + H+ + a 2,3,4-saturated fatty acyl CoA + diphosphate - NAD biosynthesis from 2-amino-3-carboxymuconate semialdehyde:
ATP + H2O + gln + nicotinate adenine dinucleotide ⟶ AMP + H+ + NAD+ + diphosphate + glt - tetrahydrofolate biosynthesis:
7,8-dihydropteroate + ATP + glt ⟶ 7,8-dihydrofolate + ADP + H+ + phosphate - NAD biosynthesis I (from aspartate):
ATP + ammonia + nicotinate adenine dinucleotide ⟶ AMP + H+ + NAD+ + diphosphate - fatty acid activation:
ATP + a fatty acid + coenzyme A ⟶ AMP + a long-chain acyl-CoA + diphosphate - urea cycle:
ATP + CO2 + H2O + ammonia ⟶ ADP + H+ + carbamoyl-phosphate + phosphate - γ-linolenate biosynthesis II (animals):
ATP + coenzyme A + linoleate ⟶ AMP + H+ + diphosphate + linoleoyl-CoA - phenylacetate degradation I (aerobic):
ATP + coenzyme A + phenylacetate ⟶ AMP + H+ + diphosphate + phenylacetyl-CoA - NAD biosynthesis II (from tryptophan):
3-hydroxy-L-kynurenine + H2O ⟶ 3-hydroxyanthranilate + H+ + ala - isopenicillin N biosynthesis:
2-aminoadipate + ATP + H2O + cys + val ⟶ N-[(5S)-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine + AMP + H+ + diphosphate - 4-hydroxybenzoate biosynthesis I (animals):
4-coumarate + ATP + coenzyme A ⟶ 4-coumaroyl-CoA + AMP + H+ + diphosphate - NAD salvage pathway I:
H2O + nicotinamide ⟶ H+ + ammonia + nicotinate - glycolysis II:
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate - canavanine biosynthesis:
L-homoserine + ammonia ⟶ H+ + L-canaline - pantothenate biosynthesis I:
2-oxoisovalerate + 5,10-methylenetetrahydrofolate + H2O ⟶ 2-dehydropantoate + H+ + tetrahydrofolate - gluconeogenesis I:
3-phospho-D-glycerate + ATP ⟶ 1,3-diphosphateglycerate + ADP + H+ - acetate conversion to acetyl-CoA:
ATP + acetate + coenzyme A ⟶ AMP + H+ + acetyl-CoA + diphosphate - tetrahydrofolate biosynthesis II:
ATP + glt + tetrahydrofolate ⟶ ADP + H+ + phosphate + tetrahydrofolate-L-glutamate - superpathway of NAD biosynthesis in eukaryotes:
H2O + nicotinamide ⟶ H+ + ammonia + nicotinate - asparagine biosynthesis I:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glt - asperlicin E biosynthesis:
H+ + NAD(P)H + O2 + asperlicin C ⟶ H2O + NAD(P)+ + asperlicin E
WikiPathways(2)
- Purine metabolism and related disorders:
Adenine ⟶ AMP - Purine metabolism:
Adenine ⟶ AMP
Plant Reactome(20)
- Metabolism and regulation:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA - Secondary metabolism:
GPP + H2O ⟶ PPi + geraniol - Flavonoid biosynthesis:
4-coumarate + ATP + CoA-SH ⟶ 4-coumaroyl-CoA + AMP + PPi - Lignin biosynthesis:
4-coumarate + ATP + CoA-SH ⟶ 4-coumaroyl-CoA + AMP + PPi - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - NAD biosynthesis I (from aspartate):
ATP + H2O + L-Gln + NAAD ⟶ AMP + L-Glu + NAD + PPi - Hormone signaling, transport, and metabolism:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate + Oxygen ⟶ CH3COO- + jasmonic acid - Trans-zeatin biosynthesis:
AMP + DMAPP ⟶ PPi + isopentenyladenosine-5'-monophosphate - Growth and developmental processes:
AMP + DMAPP ⟶ PPi + isopentenyladenosine-5'-monophosphate - Vegetative structure development:
AMP + DMAPP ⟶ PPi + isopentenyladenosine-5'-monophosphate - Regulation of leaf development:
AMP + DMAPP ⟶ PPi + isopentenyladenosine-5'-monophosphate - Amino acid metabolism:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA - Amino acid biosynthesis:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA - Beta-alanine biosynthesis II:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA - Jasmonic acid signaling:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - Folate biosynthesis:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP - Tetrahydrofolate biosynthesis II:
6-hydroxymethyl-dihydropterin + ATP ⟶ 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + AMP
INOH(0)
PlantCyc(2915)
- ppGpp biosynthesis:
ATP + GTP ⟶ AMP + pppGpp - L-selenocysteine biosynthesis II (archaea and eukaryotes):
ATP + ser ⟶ AMP + diphosphate - L-selenocysteine biosynthesis II (archaea and eukaryotes):
ATP + ser ⟶ AMP + diphosphate - L-selenocysteine biosynthesis II (archaea and eukaryotes):
ATP + ser ⟶ AMP + diphosphate - L-selenocysteine biosynthesis II (archaea and eukaryotes):
ATP + ser ⟶ AMP + diphosphate - L-selenocysteine biosynthesis II (archaea and eukaryotes):
ATP + ser ⟶ AMP + diphosphate - L-selenocysteine biosynthesis II (archaea and eukaryotes):
ATP + ser ⟶ AMP + diphosphate - L-selenocysteine biosynthesis II (archaea and eukaryotes):
ATP + ser ⟶ AMP + diphosphate - L-selenocysteine biosynthesis II (archaea and eukaryotes):
ATP + ser ⟶ AMP + diphosphate - L-selenocysteine biosynthesis II (archaea and eukaryotes):
ATP + ser ⟶ AMP + diphosphate - L-selenocysteine biosynthesis II (archaea and eukaryotes):
ATP + ser ⟶ AMP + diphosphate - L-selenocysteine biosynthesis II (archaea and eukaryotes):
ATP + H2O + selenide ⟶ AMP + phosphate + selenophosphate - L-selenocysteine biosynthesis II (archaea and eukaryotes):
ATP + ser ⟶ AMP + diphosphate - L-selenocysteine biosynthesis II (archaea and eukaryotes):
ATP + ser ⟶ AMP + diphosphate - L-selenocysteine biosynthesis II (archaea and eukaryotes):
ATP + ser ⟶ AMP + diphosphate - L-selenocysteine biosynthesis II (archaea and eukaryotes):
ATP + ser ⟶ AMP + diphosphate - L-selenocysteine biosynthesis II (archaea and eukaryotes):
ATP + ser ⟶ AMP + diphosphate - L-selenocysteine biosynthesis II (archaea and eukaryotes):
ATP + ser ⟶ AMP + diphosphate - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - selenate reduction:
H+ + glutathione + selenite ⟶ GSSG + H2O + selenodiglutathione - superpathway of seleno-compound metabolism:
H+ + glutathione + selenite ⟶ GSSG + H2O + selenodiglutathione - selenate reduction:
H+ + glutathione + selenite ⟶ GSSG + H2O + selenodiglutathione - selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol - superpathway of seleno-compound metabolism:
H+ + glutathione + selenite ⟶ GSSG + H2O + selenodiglutathione - selenate reduction:
H+ + glutathione + selenite ⟶ GSSG + H2O + selenodiglutathione - superpathway of seleno-compound metabolism:
H+ + glutathione + selenite ⟶ GSSG + H2O + selenodiglutathione - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
ATP + H2O + XMP + gln ⟶ AMP + GMP + H+ + diphosphate + glu - superpathway of purine nucleotides de novo biosynthesis I:
ATP + H2O + XMP + gln ⟶ AMP + GMP + H+ + diphosphate + glu - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
SAICAR ⟶ AICAR + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
ATP + GMP ⟶ ADP + GDP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
ATP + GMP ⟶ ADP + GDP - superpathway of guanosine nucleotides de novo biosynthesis I:
ATP + GMP ⟶ ADP + GDP - guanosine ribonucleotides de novo biosynthesis:
ATP + GMP ⟶ ADP + GDP - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - superpathway of guanosine nucleotides de novo biosynthesis I:
ATP + H2O + XMP + gln ⟶ AMP + GMP + H+ + diphosphate + glu - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - adlupulone and adhumulone biosynthesis:
2-methylbutanoate + ATP + coenzyme A ⟶ 2-methylbutanoyl-CoA + AMP + diphosphate - superpathway of bitter acids biosynthesis:
A(H2) + O2 + deoxyhumulone ⟶ A + H2O + humulone - adlupulone and adhumulone biosynthesis:
A(H2) + O2 + deoxyadlupulone ⟶ A + H2O + adhumulone - superpathway of bitter acids biosynthesis:
ATP + coenzyme A + isobutanoate ⟶ AMP + diphosphate + isobutanoyl-CoA - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - starch degradation II:
a glucan + maltotriose ⟶ D-glucopyranose + a glucan - starch degradation II:
a glucan + maltotriose ⟶ D-glucopyranose + a glucan - starch degradation II:
a glucan + maltotriose ⟶ D-glucopyranose + a glucan - starch degradation II:
a glucan + maltotriose ⟶ D-glucopyranose + a glucan - starch degradation II:
H2O + an exposed unphosphorylated, unbranched malto-oligosaccharide tail on amylopectin ⟶ amylopectin + maltose - starch degradation II:
H2O + an exposed unphosphorylated, unbranched malto-oligosaccharide tail on amylopectin ⟶ amylopectin + maltose - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - superpathway of coenzyme A biosynthesis II (plants):
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
3-oxopropanoate + ala ⟶ β-alanine + pyruvate - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
3-oxopropanoate + ala ⟶ β-alanine + pyruvate - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - superpathway of coenzyme A biosynthesis II (plants):
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
3-oxopropanoate + ala ⟶ β-alanine + pyruvate - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - superpathway of coenzyme A biosynthesis II (plants):
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
3-oxopropanoate + ala ⟶ β-alanine + pyruvate - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - superpathway of coenzyme A biosynthesis II (plants):
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - superpathway of coenzyme A biosynthesis II (plants):
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - superpathway of coenzyme A biosynthesis II (plants):
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - superpathway of coenzyme A biosynthesis II (plants):
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate - superpathway of coenzyme A biosynthesis II (plants):
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - superpathway of coenzyme A biosynthesis II (plants):
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - β-alanine biosynthesis II:
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA - superpathway of coenzyme A biosynthesis II (plants):
3-oxopropanoate + ala ⟶ β-alanine + pyruvate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - purine nucleotides degradation I (plants):
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - superpathway of purines degradation in plants:
H2O + O2 + urate ⟶ (S)-5-hydroxyisourate + hydrogen peroxide - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - adenosine nucleotides degradation I:
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - superpathway of purines degradation in plants:
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - purine nucleotides degradation I (plants):
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - superpathway of purines degradation in plants:
H2O + O2 + urate ⟶ (S)-5-hydroxyisourate + hydrogen peroxide - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - superpathway of purines degradation in plants:
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - adenosine nucleotides degradation I:
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - jasmonoyl-amino acid conjugates biosynthesis II:
ATP + a jasmonate + ile ⟶ AMP + H+ + a jasmonoyl-L-isoleucine + diphosphate - superpathway of jasmonoyl-amino acid conjugates biosynthesis:
ATP + a jasmonate + ile ⟶ AMP + H+ + a jasmonoyl-L-isoleucine + diphosphate - jasmonoyl-amino acid conjugates biosynthesis I:
ATP + a jasmonate + ile ⟶ AMP + H+ + a jasmonoyl-L-isoleucine + diphosphate - jasmonoyl-amino acid conjugates biosynthesis II:
ATP + a jasmonate + gln ⟶ AMP + H+ + a jasmonoyl-glutamine + diphosphate - jasmonoyl-amino acid conjugates biosynthesis II:
ATP + a jasmonate + gln ⟶ AMP + H+ + a jasmonoyl-glutamine + diphosphate - jasmonoyl-amino acid conjugates biosynthesis II:
ATP + a jasmonate + gln ⟶ AMP + H+ + a jasmonoyl-glutamine + diphosphate - jasmonoyl-amino acid conjugates biosynthesis II:
ATP + a jasmonate + gln ⟶ AMP + H+ + a jasmonoyl-glutamine + diphosphate - jasmonoyl-amino acid conjugates biosynthesis II:
ATP + a jasmonate + gln ⟶ AMP + H+ + a jasmonoyl-glutamine + diphosphate - jasmonoyl-amino acid conjugates biosynthesis II:
ATP + a jasmonate + gln ⟶ AMP + H+ + a jasmonoyl-glutamine + diphosphate - jasmonoyl-amino acid conjugates biosynthesis II:
ATP + a jasmonate + gln ⟶ AMP + H+ + a jasmonoyl-glutamine + diphosphate - jasmonoyl-amino acid conjugates biosynthesis II:
ATP + a jasmonate + gln ⟶ AMP + H+ + a jasmonoyl-glutamine + diphosphate - jasmonoyl-amino acid conjugates biosynthesis II:
ATP + a jasmonate + gln ⟶ AMP + H+ + a jasmonoyl-glutamine + diphosphate - jasmonoyl-amino acid conjugates biosynthesis II:
ATP + a jasmonate + gln ⟶ AMP + H+ + a jasmonoyl-glutamine + diphosphate - jasmonoyl-amino acid conjugates biosynthesis II:
ATP + a jasmonate + gln ⟶ AMP + H+ + a jasmonoyl-glutamine + diphosphate - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - ppGpp biosynthesis:
H2O + pppGpp ⟶ GTP + H+ + diphosphate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinylbenzoate + ATP + coenzyme A ⟶ 4-(2'-carboxyphenyl)-4-oxobutyryl-CoA + AMP + diphosphate - superpathway of phylloquinol biosynthesis:
SAM + demethylphylloquinol ⟶ H+ + SAH + phylloquinol - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
SAM + demethylphylloquinol ⟶ H+ + SAH + phylloquinol - 2-carboxy-1,4-naphthoquinol biosynthesis:
4-(2'-carboxyphenyl)-4-oxobutyryl-CoA + H+ ⟶ 1,4-dihydroxy-2-naphthoyl-CoA + H2O - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
SAM + demethylphylloquinol ⟶ H+ + SAH + phylloquinol - 2-carboxy-1,4-naphthoquinol biosynthesis:
4-(2'-carboxyphenyl)-4-oxobutyryl-CoA + H+ ⟶ 1,4-dihydroxy-2-naphthoyl-CoA + H2O - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - purine nucleosides salvage II (plant):
ATP + guanosine ⟶ ADP + GMP + H+ - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine salvage:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - purine nucleosides salvage II (plant):
GMP + diphosphate ⟶ PRPP + guanine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - purine nucleosides salvage II (plant):
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - purine nucleosides salvage II (plant):
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
H2O + adenosine ⟶ D-ribofuranose + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - adenine and adenosine salvage II:
AMP + diphosphate ⟶ PRPP + adenine - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - superpathway of indole-3-acetate conjugate biosynthesis:
(indol-3-yl)acetate + ATP + gln ⟶ AMP + H+ + IAA-Gln + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + gln ⟶ AMP + H+ + IAA-Gln + diphosphate - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-octa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - acetate conversion to acetyl-CoA:
ATP + acetate + coenzyme A ⟶ AMP + acetyl-CoA + diphosphate - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetate conversion to acetyl-CoA:
ATP + acetate + coenzyme A ⟶ AMP + acetyl-CoA + diphosphate - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation IV:
ethanol + hydrogen peroxide ⟶ H2O + acetaldehyde - ethanol degradation IV:
ethanol + hydrogen peroxide ⟶ H2O + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetate conversion to acetyl-CoA:
ATP + acetate + coenzyme A ⟶ AMP + acetyl-CoA + diphosphate - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
H2O + NAD+ + acetaldehyde ⟶ H+ + NADH + acetate - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
H2O + NAD+ + acetaldehyde ⟶ H+ + NADH + acetate - ethanol degradation II:
H2O + NAD+ + acetaldehyde ⟶ H+ + NADH + acetate - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
H2O + NAD+ + acetaldehyde ⟶ H+ + NADH + acetate - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
H2O + NAD+ + acetaldehyde ⟶ H+ + NADH + acetate - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
H2O + NAD+ + acetaldehyde ⟶ H+ + NADH + acetate - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
H2O + NAD+ + acetaldehyde ⟶ H+ + NADH + acetate - ethanol degradation II:
H2O + NAD+ + acetaldehyde ⟶ H+ + NADH + acetate - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - long-chain fatty acid activation:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain acyl-CoA + diphosphate - phosphatidylcholine acyl editing:
a 1-acyl-sn-glycero-3-phosphocholine + an acyl-CoA ⟶ a phosphatidylcholine + coenzyme A - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - long-chain fatty acid activation:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain acyl-CoA + diphosphate - phosphatidylcholine acyl editing:
a 1-acyl-sn-glycero-3-phosphocholine + an acyl-CoA ⟶ a phosphatidylcholine + coenzyme A - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - phosphatidylcholine acyl editing:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain acyl-CoA + diphosphate - long-chain fatty acid activation:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain acyl-CoA + diphosphate - long-chain fatty acid activation:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain acyl-CoA + diphosphate - phosphatidylcholine acyl editing:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain acyl-CoA + diphosphate - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - long-chain fatty acid activation:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain acyl-CoA + diphosphate - phosphatidylcholine acyl editing:
a 1-acyl-sn-glycero-3-phosphocholine + an acyl-CoA ⟶ a phosphatidylcholine + coenzyme A - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - phosphatidylcholine acyl editing:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain acyl-CoA + diphosphate - long-chain fatty acid activation:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain acyl-CoA + diphosphate - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - long-chain fatty acid activation:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain acyl-CoA + diphosphate - phosphatidylcholine acyl editing:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain acyl-CoA + diphosphate - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - long-chain fatty acid activation:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain acyl-CoA + diphosphate - phosphatidylcholine acyl editing:
a 1-acyl-sn-glycero-3-phosphocholine + an acyl-CoA ⟶ a phosphatidylcholine + coenzyme A - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - long-chain fatty acid activation:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain acyl-CoA + diphosphate - phosphatidylcholine acyl editing:
a 1-acyl-sn-glycero-3-phosphocholine + an acyl-CoA ⟶ a phosphatidylcholine + coenzyme A - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - long-chain fatty acid activation:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain acyl-CoA + diphosphate - phosphatidylcholine acyl editing:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain acyl-CoA + diphosphate - phosphatidylcholine acyl editing:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain acyl-CoA + diphosphate - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - long-chain fatty acid activation:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain acyl-CoA + diphosphate - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - phosphatidylcholine acyl editing:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain acyl-CoA + diphosphate - long-chain fatty acid activation:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain acyl-CoA + diphosphate - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - phosphatidylcholine acyl editing:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain acyl-CoA + diphosphate - long-chain fatty acid activation:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain acyl-CoA + diphosphate - long-chain fatty acid activation:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain acyl-CoA + diphosphate - phosphatidylcholine acyl editing:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain acyl-CoA + diphosphate - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - long-chain fatty acid activation:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain acyl-CoA + diphosphate - phosphatidylcholine acyl editing:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain acyl-CoA + diphosphate - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - long-chain fatty acid activation:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain acyl-CoA + diphosphate - phosphatidylcholine acyl editing:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain acyl-CoA + diphosphate - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - long-chain fatty acid activation:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain fatty acyl-CoA + diphosphate - phosphatidylcholine acyl editing:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain fatty acyl-CoA + diphosphate - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - phosphatidylcholine acyl editing:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain fatty acyl-CoA + diphosphate - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - long-chain fatty acid activation:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain fatty acyl-CoA + diphosphate - phosphatidylcholine acyl editing:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain fatty acyl-CoA + diphosphate - long-chain fatty acid activation:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain fatty acyl-CoA + diphosphate - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - phosphatidylcholine acyl editing:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain fatty acyl-CoA + diphosphate - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - long-chain fatty acid activation:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain fatty acyl-CoA + diphosphate - long-chain fatty acid activation:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain fatty acyl-CoA + diphosphate - phosphatidylcholine acyl editing:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain fatty acyl-CoA + diphosphate - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - phosphatidylcholine acyl editing:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain fatty acyl-CoA + diphosphate - wax esters biosynthesis II:
NAD+ + a long-chain fatty aldehyde + coenzyme A ⟶ H+ + NADH + a long-chain fatty acyl-CoA - long-chain fatty acid activation:
ATP + a long-chain fatty acid + coenzyme A ⟶ AMP + a long-chain fatty acyl-CoA + diphosphate - benzoate biosynthesis I (CoA-dependent, β-oxidative):
ATP + benzoate + coenzyme A ⟶ AMP + benzoyl-CoA + diphosphate - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
3-hydroxy-3-phenylpropanoyl-CoA + NADP+ ⟶ 3-oxo-3-phenylpropanoyl-CoA + H+ + NADPH - benzoate degradation II (aerobic and anaerobic):
ATP + benzoate + coenzyme A ⟶ AMP + benzoyl-CoA + diphosphate - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
ATP + benzoate + coenzyme A ⟶ AMP + benzoyl-CoA + diphosphate - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
ATP + benzoate + coenzyme A ⟶ AMP + benzoyl-CoA + diphosphate - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzoyl-CoA ⟶ H+ + benzoate + coenzyme A - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - superpathway of tetrahydroxyxanthone biosynthesis:
2,3',4,6-tetrahydroxybenzophenone + NADPH + O2 ⟶ 1,3,7-trihydroxyxanthone + H2O + NADP+ - salicortin biosynthesis:
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
3-hydroxy-3-phenylpropanoyl-CoA + NADP+ ⟶ 3-oxo-3-phenylpropanoyl-CoA + H+ + NADPH - tetrahydroxyxanthone biosynthesis (from benzoate):
2,3',4,6-tetrahydroxybenzophenone + NADPH + O2 ⟶ 1,3,7-trihydroxyxanthone + H2O + NADP+ - salicortin biosynthesis:
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
ATP + benzoate + coenzyme A ⟶ AMP + benzoyl-CoA + diphosphate - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - superpathway of tetrahydroxyxanthone biosynthesis:
ATP + benzoate + coenzyme A ⟶ AMP + benzoyl-CoA + diphosphate - tetrahydroxyxanthone biosynthesis (from benzoate):
ATP + benzoate + coenzyme A ⟶ AMP + benzoyl-CoA + diphosphate - benzoate biosynthesis I (CoA-dependent, β-oxidative):
ATP + benzoate + coenzyme A ⟶ AMP + benzoyl-CoA + diphosphate - benzoate biosynthesis I (CoA-dependent, β-oxidative):
ATP + benzoate + coenzyme A ⟶ AMP + benzoyl-CoA + diphosphate - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - benzoate biosynthesis I (CoA-dependent, β-oxidative):
ATP + benzoate + coenzyme A ⟶ AMP + benzoyl-CoA + diphosphate - benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin 3'-phosphate + H2O ⟶ 7,8-dihydroneopterin + phosphate - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin 3'-phosphate + H2O ⟶ 7,8-dihydroneopterin + phosphate - superpathway of tetrahydrofolate biosynthesis:
7,8-dihydroneopterin 3'-phosphate + H2O ⟶ 7,8-dihydroneopterin + phosphate - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - superpathway of tetrahydrofolate biosynthesis:
7,8-dihydroneopterin 3'-phosphate + H2O ⟶ 7,8-dihydroneopterin + phosphate - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin 3'-phosphate + H2O ⟶ 7,8-dihydroneopterin + phosphate - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin 3'-phosphate + H2O ⟶ 7,8-dihydroneopterin + phosphate - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - superpathway of tetrahydrofolate biosynthesis:
GTP + H2O ⟶ 7,8-dihydroneopterin 3'-triphosphate + H+ + formate - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin 3'-phosphate + H2O ⟶ 7,8-dihydroneopterin + phosphate - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+ - tetrahydrofolate biosynthesis II:
4-amino-4-deoxychorismate ⟶ 4-aminobenzoate + H+ + pyruvate - 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I:
7,8-dihydroneopterin 3'-phosphate + H2O ⟶ D-erythro-7,8-dihydroneopterin + phosphate - superpathway of tetrahydrofolate biosynthesis:
4-amino-4-deoxychorismate ⟶ 4-aminobenzoate + H+ + pyruvate - methyl ketone biosynthesis (engineered):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - molybdenum cofactor biosynthesis:
ATP + H2O + molybdate ⟶ ADP + H+ + molybdate + phosphate - molybdenum cofactor biosynthesis:
ATP + H2O + molybdate ⟶ ADP + H+ + molybdate + phosphate - molybdenum cofactor biosynthesis:
ATP + H2O + molybdate ⟶ ADP + H+ + molybdate + phosphate - molybdenum cofactor biosynthesis:
ATP + H2O + molybdate ⟶ ADP + H+ + molybdate + phosphate - molybdenum cofactor biosynthesis:
ATP + H2O + molybdate ⟶ ADP + H+ + molybdate + phosphate - molybdenum cofactor biosynthesis:
ATP + H2O + molybdate ⟶ ADP + H+ + molybdate + phosphate - molybdenum cofactor biosynthesis:
ATP + H2O + molybdate ⟶ ADP + H+ + molybdate + phosphate - molybdenum cofactor biosynthesis:
ATP + H2O + molybdate ⟶ ADP + H+ + molybdate + phosphate - molybdenum cofactor biosynthesis:
ATP + H2O + molybdate ⟶ ADP + H+ + molybdate + phosphate - molybdenum cofactor biosynthesis:
ATP + H2O + molybdate ⟶ ADP + H+ + molybdate + phosphate - molybdenum cofactor biosynthesis:
ATP + H2O + molybdate ⟶ ADP + H+ + molybdate + phosphate - molybdenum cofactor biosynthesis:
ATP + H2O + molybdate ⟶ ADP + H+ + molybdate + phosphate - molybdenum cofactor biosynthesis:
ATP + H2O + molybdate ⟶ ADP + H+ + molybdate + phosphate - molybdenum cofactor biosynthesis:
ATP + H2O + molybdate ⟶ ADP + H+ + molybdate + phosphate - molybdenum cofactor biosynthesis:
ATP + H2O + molybdate ⟶ ADP + H+ + molybdate + phosphate - molybdenum cofactor biosynthesis:
ATP + H2O + molybdate ⟶ ADP + H+ + molybdate + phosphate - molybdenum cofactor biosynthesis:
ATP + H2O + molybdate ⟶ ADP + H+ + molybdate + phosphate - molybdenum cofactor biosynthesis:
ATP + H2O + molybdate ⟶ ADP + H+ + molybdate + phosphate - molybdenum cofactor biosynthesis:
ATP + H2O + molybdate ⟶ ADP + H+ + molybdate + phosphate - molybdenum cofactor biosynthesis:
ATP + H2O + molybdate ⟶ ADP + H+ + molybdate + phosphate - molybdenum cofactor biosynthesis:
ATP + H2O + molybdate ⟶ ADP + H+ + molybdate + phosphate - molybdenum cofactor biosynthesis:
ATP + H2O + molybdate ⟶ ADP + H+ + molybdate + phosphate - molybdenum cofactor biosynthesis:
ATP + H2O + molybdate ⟶ ADP + H+ + molybdate + phosphate - molybdenum cofactor biosynthesis:
ATP + H2O + molybdate ⟶ ADP + H+ + molybdate + phosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + asp ⟶ AMP + H+ + IAA-Asp + diphosphate - superpathway of indole-3-acetate conjugate biosynthesis:
1-O-(indol-3-ylacetyl)-β-D-glucose + myo-inositol ⟶ 1D-1-O-(indol-3-yl)acetyl-myo-inositol + D-glucopyranose - indole-3-acetate inactivation IV:
(indol-3-yl)acetate + ATP + asp ⟶ AMP + H+ + IAA-Asp + diphosphate - indole-3-acetate inactivation V:
(indol-3-yl)acetate + ATP + val ⟶ AMP + H+ + IAA-Val + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + asp ⟶ AMP + H+ + IAA-Asp + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + val ⟶ AMP + H+ + IAA-Val + diphosphate - indole-3-acetate inactivation III:
(indol-3-yl)acetate + ATP + asp ⟶ AMP + H+ + IAA-Asp + diphosphate - indole-3-acetate inactivation II:
(indol-3-yl)acetate + ATP + asp ⟶ AMP + H+ + IAA-Asp + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + asp ⟶ AMP + H+ + IAA-Asp + diphosphate - superpathway of indole-3-acetate conjugate biosynthesis:
1-O-(indol-3-ylacetyl)-β-D-glucose + myo-inositol ⟶ 1D-1-O-(indol-3-yl)acetyl-myo-inositol + D-glucopyranose - indole-3-acetate inactivation V:
(indol-3-yl)acetate + ATP + val ⟶ AMP + H+ + IAA-Val + diphosphate - indole-3-acetate inactivation VII:
(indol-3-yl)acetate + ATP + asp ⟶ AMP + H+ + IAA-Asp + diphosphate - indole-3-acetate inactivation IV:
(indol-3-yl)acetate + ATP + asp ⟶ AMP + H+ + IAA-Asp + diphosphate - indole-3-acetate inactivation VI:
(indol-3-yl)acetate + ATP + asp ⟶ AMP + H+ + IAA-Asp + diphosphate - indole-3-acetate inactivation II:
(indol-3-yl)acetate + A + H2O ⟶ 2-oxo-indole-3-acetate + A(H2) - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VII:
(indol-3-yl)acetate + A + H2O ⟶ 2-oxoindole-3-acetate + A(H2) - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VI:
(indol-3-yl)acetate + ATP + asp ⟶ AMP + H+ + IAA-Asp + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + phe ⟶ AMP + H+ + IAA-Phe + diphosphate - indole-3-acetate inactivation IV:
(indol-3-yl)acetate + A + H2O ⟶ 2-oxoindole-3-acetate + A(H2) - superpathway of indole-3-acetate conjugate biosynthesis:
1-O-(indol-3-ylacetyl)-β-D-glucose + myo-inositol ⟶ 1D-1-O-(indol-3-yl)acetyl-myo-inositol + D-glucopyranose - indole-3-acetate inactivation V:
(indol-3-yl)acetate + ATP + phe ⟶ AMP + H+ + IAA-Phe + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation VIII:
(indol-3-yl)acetate + ATP + ala ⟶ AMP + H+ + IAA-Ala + diphosphate - indole-3-acetate inactivation V:
(indol-3-yl)acetate + ATP + val ⟶ AMP + H+ + IAA-Val + diphosphate - 6-gingerol analog biosynthesis (engineered):
O2 + octanoyl-CoA ⟶ (2E)-oct-2-enoyl-CoA + hydrogen peroxide - 6-gingerol analog biosynthesis (engineered):
(E)-4-coumaroyl-CoA + 3-oxooctanoyl-CoA + H2O ⟶ 4-coumaroylhexanoylmethane + CO2 + coenzyme A - tetrahydroxyxanthone biosynthesis (from 3-hydroxybenzoate):
2,3',4,6-tetrahydroxybenzophenone + NADPH + O2 ⟶ 1,3,5-trihydroxyxanthone + H2O + NADP+ - tetrahydroxyxanthone biosynthesis (from 3-hydroxybenzoate):
2,3',4,6-tetrahydroxybenzophenone + NADPH + O2 ⟶ 1,3,5-trihydroxyxanthone + H2O + NADP+ - tetrahydroxyxanthone biosynthesis (from 3-hydroxybenzoate):
2,3',4,6-tetrahydroxybenzophenone + NADPH + O2 ⟶ 1,3,5-trihydroxyxanthone + H2O + NADP+ - selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol - selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol - superpathway of seleno-compound metabolism:
H2O + O2 + dimethylselenopropanoate-amine ⟶ 3-dimethylselenopropionaldehyde + ammonium + hydrogen peroxide - selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol - selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol - selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol - selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol - selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol - selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol - selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol - selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol - selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol - selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol - selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol - selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol - selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol - selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol - selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol - selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol - superpathway of seleno-compound metabolism:
H2O + O2 + dimethylselenopropanoate-amine ⟶ 3-dimethylselenopropionaldehyde + ammonium + hydrogen peroxide - selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol - selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol - selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - assimilatory sulfate reduction II:
ATP + H+ + sulfate ⟶ APS + diphosphate - canavanine biosynthesis:
L-canaline + carbamoyl phosphate ⟶ O-ureido-L-homoserine + phosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - thiamine salvage IV (yeast):
4-amino-2-methyl-5-pyrimidinemethanol + ATP ⟶ ADP + H+ + HMP-P - thiamine salvage III:
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - thiamine salvage III:
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - thiamine salvage III:
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine salvage III:
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - thiamine salvage IV (yeast):
H2O + thiamine ⟶ 4-amino-2-methyl-5-pyrimidinemethanol + 5-(2-hydroxyethyl)-4-methylthiazole + H+ - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine salvage III:
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine salvage IV (yeast):
H2O + thiamine ⟶ 4-amino-2-methyl-5-pyrimidinemethanol + 5-(2-hydroxyethyl)-4-methylthiazole + H+ - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - thiamine salvage IV (yeast):
H2O + thiamine ⟶ 4-amino-2-methyl-5-pyrimidinemethanol + 5-(2-hydroxyethyl)-4-methylthiazole + H+ - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - thiamine salvage IV (yeast):
H2O + thiamine ⟶ 4-amino-2-methyl-5-pyrimidinemethanol + 5-(2-hydroxyethyl)-4-methylthiazole + H+ - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - thiamine salvage IV (yeast):
H2O + thiamine ⟶ 4-amino-2-methyl-5-pyrimidinemethanol + 5-(2-hydroxyethyl)-4-methylthiazole + H+ - thiamine salvage IV (yeast):
H2O + thiamine ⟶ 4-amino-2-methyl-5-pyrimidinemethanol + 5-(2-hydroxyethyl)-4-methylthiazole + H+ - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - thiamine salvage IV (yeast):
H2O + thiamine ⟶ 4-amino-2-methyl-5-pyrimidinemethanol + 5-(2-hydroxyethyl)-4-methylthiazole + H+ - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine salvage IV (yeast):
H2O + thiamine ⟶ 4-amino-2-methyl-5-pyrimidinemethanol + 5-(2-hydroxyethyl)-4-methylthiazole + H+ - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine salvage IV (yeast):
H2O + thiamine ⟶ 4-amino-2-methyl-5-pyrimidinemethanol + 5-(2-hydroxyethyl)-4-methylthiazole + H+ - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - thiamine salvage IV (yeast):
H2O + thiamine ⟶ 4-amino-2-methyl-5-pyrimidinemethanol + 5-(2-hydroxyethyl)-4-methylthiazole + H+ - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - thiamine salvage IV (yeast):
H2O + thiamine ⟶ 4-amino-2-methyl-5-pyrimidinemethanol + 5-(2-hydroxyethyl)-4-methylthiazole + H+ - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine salvage IV (yeast):
H2O + thiamine ⟶ 4-amino-2-methyl-5-pyrimidinemethanol + 5-(2-hydroxyethyl)-4-methylthiazole + H+ - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine salvage IV (yeast):
4-amino-2-methyl-5-pyrimidinemethanol + ATP ⟶ ADP + H+ + HMP-P - thiamine salvage IV (yeast):
H2O + thiamine ⟶ 4-amino-2-methyl-5-pyrimidinemethanol + 5-(2-hydroxyethyl)-4-methylthiazole + H+ - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - thiamine salvage IV (yeast):
H2O + thiamine ⟶ 4-amino-2-methyl-5-pyrimidinemethanol + 5-(2-hydroxyethyl)-4-methylthiazole + H+ - thiamine salvage IV (yeast):
H2O + thiamine ⟶ 4-amino-2-methyl-5-pyrimidinemethanol + 5-(2-hydroxyethyl)-4-methylthiazole + H+ - thiamine salvage IV (yeast):
H2O + thiamine ⟶ 4-amino-2-methyl-5-pyrimidinemethanol + 5-(2-hydroxyethyl)-4-methylthiazole + H+ - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - thiamine salvage IV (yeast):
H2O + thiamine ⟶ 4-amino-2-methyl-5-pyrimidinemethanol + 5-(2-hydroxyethyl)-4-methylthiazole + H+ - thiamine salvage IV (yeast):
H2O + thiamine ⟶ 4-amino-2-methyl-5-pyrimidinemethanol + 5-(2-hydroxyethyl)-4-methylthiazole + H+ - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - thiamine salvage IV (yeast):
H2O + thiamine ⟶ 4-amino-2-methyl-5-pyrimidinemethanol + 5-(2-hydroxyethyl)-4-methylthiazole + H+ - thiamine salvage IV (yeast):
H2O + thiamine ⟶ 4-amino-2-methyl-5-pyrimidinemethanol + 5-(2-hydroxyethyl)-4-methylthiazole + H+ - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine salvage IV (yeast):
5-(2-hydroxyethyl)-4-methylthiazole + ATP ⟶ 4-methyl-5-(2-phosphooxyethyl)thiazole + ADP + H+ - superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met - thiamine diphosphate biosynthesis IV (eukaryotes):
ATP + thiamine ⟶ AMP + H+ + thiamine diphosphate - thiamine diphosphate biosynthesis IV (eukaryotes):
H2O + thiamine phosphate ⟶ phosphate + thiamine - thiamine diphosphate salvage IV (yeast):
H2O + thiamine phosphate ⟶ phosphate + thiamine - thiamine diphosphate salvage IV (yeast):
H2O + thiamine phosphate ⟶ phosphate + thiamine - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-octa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoate + ATP + coenzyme A ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA + AMP + diphosphate - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoate + NADP+ ⟶ H+ + NADPH + dinor-12-oxo-phytodienoate - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-octa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoate + ATP + coenzyme A ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA + AMP + diphosphate - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-octa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3R-hydroxyhexanoyl)-CoA + NAD+ ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxohexanoyl)-CoA + H+ + NADH - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-octa-2-enoyl)-CoA + hydrogen peroxide - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenosine nucleotides degradation II:
AMP + H2O ⟶ adenosine + phosphate - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenine and adenosine salvage VI:
ATP + adenosine ⟶ ADP + AMP + H+ - adenosine nucleotides degradation II:
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of purines degradation in plants:
H2O + O2 + urate ⟶ (S)-5-hydroxyisourate + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - diphthamide biosynthesis I (archaea):
SAM + an L-histidine-[translation elongation factor 2] ⟶ S-methyl-5'-thioadenosine + H+ + a 2-[(3S)-3-amino-3-carboxypropyl]-L-histidine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - superpathway of L-asparagine biosynthesis:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - diphthamide biosynthesis I (archaea):
SAM + an L-histidine-[translation elongation factor 2] ⟶ S-methyl-5'-thioadenosine + H+ + a 2-[(3S)-3-amino-3-carboxypropyl]-L-histidine-[translation elongation factor 2] - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of purines degradation in plants:
H2O + O2 + urate ⟶ (S)-5-hydroxyisourate + hydrogen peroxide - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - diphthamide biosynthesis I (archaea):
SAM + an L-histidine-[translation elongation factor 2] ⟶ S-methyl-5'-thioadenosine + H+ + a 2-[(3S)-3-amino-3-carboxypropyl]-L-histidine-[translation elongation factor 2] - superpathway of L-asparagine biosynthesis:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - superpathway of L-asparagine biosynthesis:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - superpathway of L-asparagine biosynthesis:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - superpathway of L-asparagine biosynthesis:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - superpathway of L-asparagine biosynthesis:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2] - NAD de novo biosynthesis I (from aspartate):
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - superpathway of L-asparagine biosynthesis:
ATP + H2O + asp + gln ⟶ AMP + H+ + asn + diphosphate + glu - L-asparagine biosynthesis II:
ATP + ammonium + asp ⟶ AMP + H+ + asn + diphosphate - NAD de novo biosynthesis I (from aspartate):
ATP + H2O + gln + nicotinate adenine dinucleotide ⟶ AMP + H+ + NAD+ + diphosphate + glu - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide
COVID-19 Disease Map(0)
PathBank(0)
PharmGKB(0)
0 个相关的物种来源信息
在这里通过桑基图来展示出与当前的这个代谢物在我们的BioDeep知识库中具有相关联信息的其他代谢物。在这里进行关联的信息来源主要有：
- PubMed: 来源于PubMed文献库中的文献信息，我们通过自然语言数据挖掘得到的在同一篇文献中被同时提及的相关代谢物列表，这个列表按照代谢物同时出现的文献数量降序排序，取前10个代谢物作为相关研究中关联性很高的代谢物集合展示在桑基图中。
- NCBI Taxonomy: 通过文献数据挖掘，得到的代谢物物种来源信息关联。这个关联信息同样按照出现的次数降序排序，取前10个代谢物作为高关联度的代谢物集合展示在桑吉图上。
- Chemical Taxonomy: 在物质分类上处于同一个分类集合中的其他代谢物
- Chemical Reaction: 在化学反应过程中，存在为当前代谢物相关联的生化反应过程中的反应底物或者反应产物的关联代谢物信息。
点击图上的相关代谢物的名称，可以跳转到相关代谢物的信息页面。
| 亚细胞结构定位 | 关联基因列表 |
|---|
