beta-NADH (BioDeep_00000897421)
代谢物信息卡片
beta-NADH
化学式: C21H27N7O14P2-2 (663.1091182000001)
中文名称:
谱图信息:
最多检出来源 () 0%
分子结构信息
SMILES: C1C=CN(C=C1C(=O)N)C2C(C(C(O2)COP(=O)([O-])OP(=O)([O-])OCC3C(C(C(O3)N4C=NC5=C(N=CN=C54)N)O)O)O)O
InChI: InChI=1S/C21H29N7O14P2/c22-17-12-19(25-7-24-17)28(8-26-12)21-16(32)14(30)11(41-21)6-39-44(36,37)42-43(34,35)38-5-10-13(29)15(31)20(40-10)27-3-1-2-9(4-27)18(23)33/h1,3-4,7-8,10-11,13-16,20-21,29-32H,2,5-6H2,(H2,23,33)(H,34,35)(H,36,37)(H2,22,24,25)/p-2/t10-,11-,13-,14-,15-,16-,20-,21-/m1/s1
描述信息
COVID info from COVID-19 Disease Map
Corona-virus
Coronavirus
SARS-CoV-2
COVID-19
SARS-CoV
COVID19
SARS2
SARS
同义名列表
1 个代谢物同义名
相关代谢途径
Reactome(96)
- Metabolism
- Biological oxidations
- Phase I - Functionalization of compounds
- Metabolism of vitamins and cofactors
- Metabolism of fat-soluble vitamins
- Retinoid metabolism and transport
- Visual phototransduction
- Sensory Perception
- Metabolism of proteins
- Post-translational protein modification
- Gamma carboxylation, hypusinylation, hydroxylation, and arylsulfatase activation
- Disease
- Phase II - Conjugation of compounds
- Amino acid and derivative metabolism
- Glyoxylate metabolism and glycine degradation
- Drug ADME
- Metabolism of lipids
- Metabolism of steroids
- Cholesterol biosynthesis
- Transport of small molecules
- Choline catabolism
- Signaling Pathways
- Purine metabolism
- Urate synthesis
- Nucleotide metabolism
- Nucleotide catabolism
- Purine catabolism
- Biosynthesis of specialized proresolving mediators (SPMs)
- Biosynthesis of EPA-derived SPMs
- Fatty acid metabolism
- Mitochondrial Fatty Acid Beta-Oxidation
- mitochondrial fatty acid beta-oxidation of saturated fatty acids
- Beta oxidation of myristoyl-CoA to lauroyl-CoA
- Serine biosynthesis
- Metabolism of water-soluble vitamins and cofactors
- Azathioprine ADME
- Tryptophan catabolism
- Beta oxidation of hexanoyl-CoA to butanoyl-CoA
- Bile acid and bile salt metabolism
- Synthesis of bile acids and bile salts
- Synthesis of bile acids and bile salts via 27-hydroxycholesterol
- Infectious disease
- Latent infection - Other responses of Mtb to phagocytosis
- Infection with Mycobacterium tuberculosis
- Bacterial Infection Pathways
- Arachidonic acid metabolism
- Synthesis of Prostaglandins (PG) and Thromboxanes (TX)
- Peroxisomal lipid metabolism
- Beta-oxidation of pristanoyl-CoA
- The tricarboxylic acid cycle
- Glycolysis
- Carbohydrate metabolism
- Glucose metabolism
- The citric acid (TCA) cycle and respiratory electron transport
- Pyruvate metabolism and Citric Acid (TCA) cycle
- Citric acid cycle (TCA cycle)
- Lysine catabolism
- Phospholipid metabolism
- Glycerophospholipid biosynthesis
- Glycine degradation
- Threonine catabolism
- Neuronal System
- Transmission across Chemical Synapses
- Neurotransmitter release cycle
- Neurotransmitter clearance
- Tolerance by Mtb to nitric oxide produced by macrophages
- Phenylalanine and tyrosine metabolism
- Phenylalanine metabolism
- Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol
- Clearance of seratonin
- Metabolism of serotonin
- Gluconeogenesis
- Sphingolipid metabolism
- Glycosphingolipid metabolism
- Branched-chain amino acid catabolism
- Nicotinate metabolism
- Lipid metabolism
- Sphingolipid catabolism
- Signaling by Nuclear Receptors
- Beta oxidation of palmitoyl-CoA to myristoyl-CoA
- Glycosphingolipid catabolism
- alpha-linolenic (omega3) and linoleic (omega6) acid metabolism
- alpha-linolenic acid (ALA) metabolism
- Linoleic acid (LA) metabolism
- Beta oxidation of decanoyl-CoA to octanoyl-CoA-CoA
- Alpha-oxidation of phytanate
- Beta-oxidation of very long chain fatty acids
- Synthesis of bile acids and bile salts via 24-hydroxycholesterol
- Metabolism of steroid hormones
- Glucocorticoid biosynthesis
- Mineralocorticoid biosynthesis
- Nicotinamide salvaging
- Metabolism of folate and pterines
- Signaling by Retinoic Acid
- RA biosynthesis pathway
- Glutamate and glutamine metabolism
BioCyc(332)
- superpathway of pyrimidine ribonucleosides salvage
- diphenylamine degradation
- echinenone and zeaxanthin biosynthesis (Synechocystis)
- staphyloxanthin biosynthesis
- 4-hydroxyacetophenone degradation
- 4-nitrophenol degradation I
- alkylnitronates degradation
- acetate and ATP formation from acetyl-CoA I
- anaerobic energy metabolism (invertebrates, mitochondrial)
- superpathway of anaerobic energy metabolism (invertebrates)
- superpathway of N-acetylneuraminate degradation
- superpathway of hexitol degradation (bacteria)
- mannitol cycle
- D-sorbitol degradation II
- superpathway of aromatic amino acid biosynthesis
- chorismate biosynthesis I
- superpathway of bacteriochlorophyll a biosynthesis
- superpathway of L-tyrosine biosynthesis
- superpathway of chorismate metabolism
- superpathway of anaerobic sucrose degradation
- superpathway of UDP-N-acetylglucosamine-derived O-antigen building blocks biosynthesis
- p-cymene degradation
- p-cymene degradation to p-cumate
- plant sterol biosynthesis
- aliphatic glucosinolate biosynthesis, side chain elongation cycle
- superpathway of tryptophan utilization
- abietic acid biosynthesis
- superpathway of diterpene resin acids biosynthesis
- superpathway of C28 brassinosteroid biosynthesis
- brassinosteroid biosynthesis I
- superpathway of glycol metabolism and degradation
- superpathway of cytosolic glycolysis (plants), pyruvate dehydrogenase and TCA cycle
- glycolate and glyoxylate degradation I
- glycolysis IV (plant cytosol)
- indolmycin biosynthesis
- theophylline degradation
- superpathway of fucose and rhamnose degradation
- 2-methylpropene degradation
- nicotine degradation I (pyridine pathway)
- L-arginine degradation VIII (arginine oxidase pathway)
- superpathway of L-arginine, putrescine, and 4-aminobutanoate degradation
- L-arginine degradation I (arginase pathway)
- L-arginine degradation IX (arginine:pyruvate transaminase pathway)
- superpathway of L-arginine and L-ornithine degradation
- superpathway of purines degradation in plants
- superpathway of aromatic compound degradation
- methanol oxidation to carbon dioxide
- vanillin and vanillate degradation II
- formaldehyde oxidation I
- methanol oxidation to formaldehyde II
- superpathway of C1 compounds oxidation to CO2
- superpathway of dimethylsulfone degradation
- methanesulfonate degradation
- propane degradation II
- 5,5'-dehydrodivanillate degradation
- formaldehyde assimilation III (dihydroxyacetone cycle)
- formaldehyde assimilation I (serine pathway)
- caffeine degradation IV (bacteria, via demethylation and oxidation)
- caffeine degradation III (bacteria, via demethylation)
- dimethyl sulfide degradation I
- formaldehyde oxidation III (mycothiol-dependent)
- formaldehyde oxidation V (bacillithiol-dependent)
- formaldehyde oxidation IV (thiol-independent)
- matairesinol biosynthesis
- justicidin B biosynthesis
- L-arabinose degradation II
- D-arabinose degradation I
- superpathway of pentose and pentitol degradation
- pentachlorophenol degradation
- dimethyl sulfoxide degradation
- dimethyl sulfone degradation
- NADH to dimethyl sulfoxide electron transfer
- respiration (anaerobic)-- electron acceptors reaction list
- 2-heptyl-3-hydroxy-4(1H)-quinolone biosynthesis
- superpathway of quinolone and alkylquinolone biosynthesis
- chitin degradation to ethanol
- choline degradation IV
- glycine betaine biosynthesis III (plants)
- 2,6-dinitrotoluene degradation
- superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass
- TCA cycle I (prokaryotic)
- formate oxidation to CO2
- γ-butyrobetaine degradation
- aromatic biogenic amine degradation (bacteria)
- 4-deoxy-L-threo-hex-4-enopyranuronate degradation
- superpathway of microbial D-galacturonate and D-glucuronate degradation
- choline-O-sulfate degradation
- choline degradation I
- D-carnitine degradation I
- L-carnitine degradation II
- mixed acid fermentation
- 2-aminophenol degradation
- 2-hydroxybiphenyl degradation
- nicotine degradation II (pyrrolidine pathway)
- glycerol degradation III
- nicotinate degradation I
- 1,3-propanediol biosynthesis (engineered)
- streptomycin biosynthesis
- L-valine degradation I
- glycocholate metabolism (bacteria)
- superpathway of glycerol degradation to 1,3-propanediol
- superpathway of glyoxylate bypass and TCA
- superpathway of proto- and siroheme biosynthesis
- (-)-dehydrodiconiferyl alcohol degradation
- bacteriochlorophyll a biosynthesis
- superpathway of testosterone and androsterone degradation
- dibenzo-p-dioxin degradation
- plant sterol biosynthesis II
- bacteriochlorophyll b biosynthesis
- abscisic acid biosynthesis
- diadinoxanthin and fucoxanthin biosynthesis
- superpathway of carotenoid biosynthesis in plants
- trans-lycopene biosynthesis II (oxygenic phototrophs and green sulfur bacteria)
- superpathway of carotenoid biosynthesis
- gadusol biosynthesis
- jasmonic acid biosynthesis
- γ-hexachlorocyclohexane degradation
- 1,2,4-trichlorobenzene degradation
- superpathway of L-lysine degradation
- purine nucleotides degradation II (aerobic)
- inosine 5'-phosphate degradation
- superpathway of guanosine nucleotides de novo biosynthesis I
- L-lysine fermentation to acetate and butanoate
- N10-formyl-tetrahydrofolate biosynthesis
- guanosine ribonucleotides de novo biosynthesis
- L-phenylalanine degradation IV (mammalian, via side chain)
- superpathway of ergotamine biosynthesis
- NADH to cytochrome bo oxidase electron transfer I
- NADH to cytochrome bd oxidase electron transfer I
- acetone degradation III (to propane-1,2-diol)
- superpathway of Clostridium acetobutylicum acidogenic and solventogenic fermentation
- superpathway of Clostridium acetobutylicum solventogenic fermentation
- propane degradation I
- ketogenesis
- bile acids degradation
- caffeine degradation V (bacteria, via trimethylurate)
- 1,2-dichloroethane degradation
- D-altritol and galactitol degradation
- galactitol degradation
- D-galactose degradation IV
- galactose degradation IV
- protein S-nitrosylation and denitrosylation
- superpathway of glycolysis and the Entner-Doudoroff pathway
- photosynthetic 3-hydroxybutanoate biosynthesis (engineered)
- Entner-Doudoroff pathway I
- ethylene biosynthesis III (microbes)
- ethylene biosynthesis
- NAD/NADP-NADH/NADPH cytosolic interconversion (yeast)
- superpathway NAD/NADP - NADH/NADPH interconversion (yeast)
- flavin biosynthesis II (archaea)
- gluconeogenesis I
- glycolysis II (from fructose 6-phosphate)
- glycolysis I (from glucose 6-phosphate)
- superpathway NAD/NADP - NADH/NADPH interconversion
- NAD/NADP-NADH/NADPH cytosolic interconversion
- 1,8-cineole degradation
- D-galactose degradation I (Leloir pathway)
- menthol biosynthesis
- L-tyrosine biosynthesis I
- validamycin biosynthesis
- diphenyl ethers degradation
- juvenile hormone III biosynthesis I
- juvenile hormone III biosynthesis II
- brassinosteroid biosynthesis II
- zerumbone biosynthesis
- styrene degradation
- lysine degradation VIII
- glutamate and glutamine biosynthesis
- 2-amino-3-carboxymuconate semialdehyde degradation to 2-oxopentenoate
- leucine degradation IV
- isoleucine degradation III
- dimethylsulfoniopropionate biosynthesis II (Spartina)
- phenylalanine degradation IV (mammalian, via side chain)
- ornithine degradation II (Stickland reaction)
- TCA cycle VI (obligate autotrophs)
- tryptophan degradation X (mammalian, via tryptamine)
- glutamine biosynthesis III
- lactate biosynthesis (archaea)
- Methanobacterium thermoautotrophicum biosynthetic metabolism
- superpathway of cholesterol degradation II (cholesterol dehydrogenase)
- superpathway of cholesterol degradation I (cholesterol oxidase)
- cholesterol degradation to androstenedione I (cholesterol oxidase)
- cholesterol degradation to androstenedione II (cholesterol dehydrogenase)
- limonene degradation II (L-limonene)
- terrequinone A biosynthesis
- L-lysine degradation III
- Spodoptera littoralis pheromone biosynthesis
- ephedrine biosynthesis
- guanosine nucleotides degradation
- purine nucleotides degradation
- lysine degradation I (saccharopine pathway)
- fumigaclavine biosynthesis
- (S,S)-butanediol degradation
- L-homomethionine biosynthesis
- allantoin degradation IV (anaerobic)
- 2-nitrobenzoate degradation I
- ethylene glycol biosynthesis (engineered)
- methylaspartate cycle
- colanic acid building blocks biosynthesis
- pyruvate fermentation to acetate and lactate II
- vitamin B6 degradation
- superpathway of pyrimidine deoxyribonucleosides degradation
- TCA cycle V (2-oxoglutarate:ferredoxin oxidoreductase)
- (4S)-carvone biosynthesis
- L-lysine degradation V
- L-lysine degradation XI (mammalian)
- superpathway of Clostridium acetobutylicum acidogenic fermentation
- grixazone biosynthesis
- 3,3'-disulfanediyldipropannoate degradation
- L-glutamate and L-glutamine biosynthesis
- 2-oxobutanoate degradation I
- superpathway of purine deoxyribonucleosides degradation
- L-carnitine degradation III
- D-galactose detoxification
- superpathway of purine nucleotides de novo biosynthesis I
- reductive TCA cycle I
- 4-hydroxymandelate degradation
- hexitol fermentation to lactate, formate, ethanol and acetate
- 4-amino-3-hydroxybenzoate degradation
- orcinol degradation
- superpathway of aromatic compound degradation via 2-hydroxypentadienoate
- 4-hydroxyphenylacetate degradation
- purine nucleobases degradation I (anaerobic)
- purine nucleobases degradation II (anaerobic)
- superpathway of aromatic compound degradation via 3-oxoadipate
- anaerobic energy metabolism (invertebrates, cytosol)
- 3-phenylpropanoate and 3-(3-hydroxyphenyl)propanoate degradation
- 2-hydroxypenta-2,4-dienoate degradation
- UDP-sugars interconversion
- mevalonate degradation
- (S,S)-butanediol biosynthesis
- L-leucine degradation I
- superpathway of (R,R)-butanediol biosynthesis
- superpathway of 2,3-butanediol biosynthesis
- superpathway of rifamycin B biosynthesis
- novobiocin biosynthesis
- myo-, chiro- and scyllo-inositol degradation
- myo-inositol degradation I
- L-histidine biosynthesis
- phosphinothricin tripeptide biosynthesis
- puromycin biosynthesis
- L-threonine degradation II
- L-threonine degradation III (to methylglyoxal)
- meta cleavage pathway of aromatic compounds
- superpathway of β-D-glucuronosides degradation
- flaviolin dimer and mompain biosynthesis
- glycolysis III (from glucose)
- L-rhamnose degradation II
- catechol degradation II (meta-cleavage pathway)
- catechol degradation I (meta-cleavage pathway)
- guanosine nucleotides degradation III
- pyruvate fermentation to lactate
- androstenedione degradation
- UDP-α-D-xylose biosynthesis
- Entner-Doudoroff pathway III (semi-phosphorylative)
- mandelate degradation to acetyl-CoA
- L-malate degradation II
- glycerol degradation II
- superpathway of UDP-glucose-derived O-antigen building blocks biosynthesis
- aminopropanol phosphate biosynthesis II
- D-galacturonate degradation I
- D-fructuronate degradation
- superpathway of hexuronide and hexuronate degradation
- superpathway of L-threonine metabolism
- L-carnitine biosynthesis
- trans-4-hydroxy-L-proline degradation I
- superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis
- 2'-deoxy-α-D-ribose 1-phosphate degradation
- C4 photosynthetic carbon assimilation cycle, NAD-ME type
- superpathway of L-methionine salvage and degradation
- 3-dehydroquinate biosynthesis I
- L-isoleucine biosynthesis II
- limonene degradation III (to perillate)
- isoprene degradation
- pyrrolnitrin biosynthesis
- nitrate reduction VIII (dissimilatory)
- NADH to fumarate electron transfer
- NADH to cytochrome bo oxidase electron transfer II
- ethanol degradation I
- ethanolamine utilization
- guaiacylglycerol-β-guaiacyl ether degradation
- L-threonine degradation IV
- pyruvate fermentation to ethanol I
- methylglyoxal degradation VI
- 1,2-propanediol biosynthesis from lactate (engineered)
- 2,2'-dihydroxybiphenyl degradation
- superpathway of pyrimidine nucleobases salvage
- 2,4-xylenol degradation to protocatechuate
- sitosterol degradation to androstenedione
- superpathway of mycolyl-arabinogalactan-peptidoglycan complex biosynthesis
- mAGP
- mycolyl-arabinogalactan-peptidoglycan complex biosynthesis
- γ-resorcylate degradation II
- 4-nitrophenol degradation II
- 2,4,5-trichlorophenoxyacetate degradation
- NADH to cytochrome bd oxidase electron transfer II
- nitrate reduction VIIIb (dissimilatory)
- coenzyme M biosynthesis I
- coelimycin P1 biosynthesis
- benzene degradation
- histamine degradation
- fluorene degradation I
- salicortin biosynthesis
- indole-3-acetate degradation
- nostoxanthin biosynthesis
- myo-, chiro- and scillo-inositol degradation
- myo-inositol degradation
- pinitol biosynthesis II
- myo-inositol degradation II
- bisphenol A degradation
- glycine betaine biosynthesis I (Gram-negative bacteria)
- pyruvate fermentation to isobutanol (engineered)
- butanol and isobutanol biosynthesis (engineered)
- L-valine degradation II
- (+)-camphor biosynthesis
- rebeccamycin biosynthesis
- L-glutamate degradation VII (to butanoate)
- L-ascorbate degradation II (bacterial, aerobic)
- L-ascorbate degradation IV
- salicin biosynthesis
- neurosporaxanthin biosynthesis
- bixin biosynthesis
- teichuronic acid biosynthesis (B. subtilis 168)
- (R,R)-butanediol degradation
- (R,R)-butanediol biosynthesis
- superpathway of acetoin and butanediol biosynthesis
- butanediol biosynthesis
- carbon disulfide oxidation II (aerobic)
- androgen biosynthesis
- L-threonate degradation
- D-threonate degradation
- D-carnitine degradation II
PlantCyc(69)
- superpathway of anaerobic sucrose degradation
- abietic acid biosynthesis
- superpathway of diterpene resin acids biosynthesis
- brassinolide biosynthesis II
- brassinolide biosynthesis I
- brassinosteroid biosynthesis I
- superpathway of C28 brassinosteroid biosynthesis
- glycolysis IV (plant cytosol)
- superpathway of cytosolic glycolysis (plants), pyruvate dehydrogenase and TCA cycle
- L-arginine degradation VI (arginase 2 pathway)
- L-arginine degradation I (arginase pathway)
- superpathway of purines degradation in plants
- Organic Nitrogen Assimilation
- superpathway of hyoscyamine (atropine) and scopolamine biosynthesis
- formaldehyde oxidation II (glutathione-dependent)
- morphine biosynthesis
- inosine 5'-phosphate degradation
- guanosine ribonucleotides de novo biosynthesis
- adenosine nucleotides degradation I
- ureide biosynthesis
- purine nucleotides degradation I (plants)
- phytosterol biosynthesis (plants)
- NAD/NADH phosphorylation and dephosphorylation
- guanosine nucleotides degradation II
- nucleobase ascorbate transport I
- superpathway of guanosine nucleotides degradation (plants)
- guanosine nucleotides degradation I
- glycine betaine biosynthesis III (plants)
- superpathway of proto- and siroheme biosynthesis
- ketogenesis
- tropane alkaloids biosynthesis
- menthol biosynthesis
- aliphatic glucosinolate biosynthesis, side chain elongation cycle
- juvenile hormone III biosynthesis I
- glycerol-3-phosphate shuttle
- L-lysine degradation I
- L-proline degradation
- superpathway of glyoxylate cycle and fatty acid degradation
- superpathway of photosynthetic hydrogen production
- brassinosteroid biosynthesis II
- zerumbone biosynthesis
- ephedrine biosynthesis
- Inorganic Nitrogen Assimilation
- matairesinol biosynthesis
- C4 photosynthetic carbon assimilation cycle, NAD-ME type
- L-histidine biosynthesis
- (4S)-carvone biosynthesis
- D-galactose detoxification
- rosmarinic acid biosynthesis II
- superpathway of rosmarinic acid biosynthesis
- sanguinarine and macarpine biosynthesis
- phosphatidylglycerol biosynthesis II (non-plastidic)
- UDP-galactose biosynthesis (salvage pathway from galactose using UDP-glucose)
- cholesterol biosynthesis I
- zymosterol biosynthesis
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II
- L-ascorbate biosynthesis II (plants, L-gulose pathway)
- jasmonic acid biosynthesis
- nostoxanthin biosynthesis
- pinitol biosynthesis II
- cholesterol biosynthesis (plants)
- cholesterol biosynthesis (plants, early side-chain reductase)
- abscisic acid biosynthesis
- (+)-camphor biosynthesis
- L-ascorbate degradation IV
- salicin biosynthesis
- bixin biosynthesis
- justicidin B biosynthesis
- proanthocyanidins biosynthesis from flavanols
代谢反应
7149 个相关的代谢反应过程信息。
Reactome(1063)
- Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of lipids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of steroid hormones:
17aHPROG + H+ + Oxygen + TPNH ⟶ 11-deoxycortisol + H2O + TPN - Glucocorticoid biosynthesis:
17aHPROG + H+ + Oxygen + TPNH ⟶ 11-deoxycortisol + H2O + TPN - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of steroid hormones:
17aHPROG + H+ + Oxygen + TPNH ⟶ 11-deoxycortisol + H2O + TPN - Glucocorticoid biosynthesis:
17aHPROG + H+ + Oxygen + TPNH ⟶ 11-deoxycortisol + H2O + TPN - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of steroid hormones:
17aHPROG + H+ + Oxygen + TPNH ⟶ 11-deoxycortisol + H2O + TPN - Glucocorticoid biosynthesis:
17aHPROG + H+ + Oxygen + TPNH ⟶ 11-deoxycortisol + H2O + TPN - Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of steroid hormones:
17aHPROG + H+ + Oxygen + TPNH ⟶ 11-deoxycortisol + H2O + TPN - Glucocorticoid biosynthesis:
17aHPROG + H+ + Oxygen + TPNH ⟶ 11-deoxycortisol + H2O + TPN - Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of steroid hormones:
11-deoxycortisol ⟶ 11DCORT - Glucocorticoid biosynthesis:
11-deoxycortisol ⟶ 11DCORT - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of steroid hormones:
17aHPROG + H+ + Oxygen + TPNH ⟶ 11-deoxycortisol + H2O + TPN - Glucocorticoid biosynthesis:
17aHPROG + H+ + Oxygen + TPNH ⟶ 11-deoxycortisol + H2O + TPN - Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of steroid hormones:
17aHPROG + H+ + Oxygen + TPNH ⟶ 11-deoxycortisol + H2O + TPN - Glucocorticoid biosynthesis:
17aHPROG + H+ + Oxygen + TPNH ⟶ 11-deoxycortisol + H2O + TPN - Glucocorticoid biosynthesis:
17aHPREG + NAD ⟶ H+ + NADH + pregn-5-ene-3,20-dione-17-ol - Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Metabolism of lipids:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Metabolism of steroids:
17aHPROG + H+ + Oxygen + TPNH ⟶ 11-deoxycortisol + H2O + TPN - Metabolism of steroid hormones:
17aHPROG + H+ + Oxygen + TPNH ⟶ 11-deoxycortisol + H2O + TPN - Glucocorticoid biosynthesis:
17aHPROG + H+ + Oxygen + TPNH ⟶ 11-deoxycortisol + H2O + TPN - Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Bile acid and bile salt metabolism:
CHOL + H+ + Oxygen + TPNH ⟶ 7alpha-hydroxycholesterol + H2O + TPN - Synthesis of bile acids and bile salts:
CHOL + H+ + Oxygen + TPNH ⟶ 7alpha-hydroxycholesterol + H2O + TPN - Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 7alpha-hydroxycholesterol + H2O + TPN - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Mitochondrial Fatty Acid Beta-Oxidation:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - mitochondrial fatty acid beta-oxidation of saturated fatty acids:
(S)-3-hydroxypalmitoyl-CoA + NAD ⟶ 3-Oxopalmitoyl-CoA + H+ + NADH - Beta oxidation of octanoyl-CoA to hexanoyl-CoA:
(S)-Hydroxyoctanoyl-CoA + NAD ⟶ 3-Oxooctanoyl-CoA + H+ + NADH - Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Mitochondrial Fatty Acid Beta-Oxidation:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - mitochondrial fatty acid beta-oxidation of saturated fatty acids:
H+ + TPNH + tdec2-CoA ⟶ DEC-CoA + TPN - Beta oxidation of octanoyl-CoA to hexanoyl-CoA:
(S)-Hydroxyoctanoyl-CoA + NAD ⟶ 3-Oxooctanoyl-CoA + H+ + NADH - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Mitochondrial Fatty Acid Beta-Oxidation:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - mitochondrial fatty acid beta-oxidation of saturated fatty acids:
H+ + TPNH + tdec2-CoA ⟶ DEC-CoA + TPN - Beta oxidation of octanoyl-CoA to hexanoyl-CoA:
(S)-Hydroxyoctanoyl-CoA + NAD ⟶ 3-Oxooctanoyl-CoA + H+ + NADH - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Mitochondrial Fatty Acid Beta-Oxidation:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - mitochondrial fatty acid beta-oxidation of saturated fatty acids:
H+ + TPNH + tdec2-CoA ⟶ DEC-CoA + TPN - Beta oxidation of octanoyl-CoA to hexanoyl-CoA:
(S)-Hydroxyoctanoyl-CoA + NAD ⟶ 3-Oxooctanoyl-CoA + H+ + NADH - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Mitochondrial Fatty Acid Beta-Oxidation:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - mitochondrial fatty acid beta-oxidation of saturated fatty acids:
H+ + TPNH + tdec2-CoA ⟶ DEC-CoA + TPN - Beta oxidation of octanoyl-CoA to hexanoyl-CoA:
(S)-Hydroxyoctanoyl-CoA + NAD ⟶ 3-Oxooctanoyl-CoA + H+ + NADH - Fatty acid metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Mitochondrial Fatty Acid Beta-Oxidation:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - mitochondrial fatty acid beta-oxidation of saturated fatty acids:
ATP + BUT ⟶ AMP + BT-CoA + PPi - Beta oxidation of octanoyl-CoA to hexanoyl-CoA:
(S)-Hydroxyoctanoyl-CoA + NAD ⟶ 3-Oxooctanoyl-CoA + H+ + NADH - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Mitochondrial Fatty Acid Beta-Oxidation:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - mitochondrial fatty acid beta-oxidation of saturated fatty acids:
H+ + TPNH + tdec2-CoA ⟶ DEC-CoA + TPN - Beta oxidation of octanoyl-CoA to hexanoyl-CoA:
(S)-Hydroxyoctanoyl-CoA + NAD ⟶ 3-Oxooctanoyl-CoA + H+ + NADH - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Mitochondrial Fatty Acid Beta-Oxidation:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - mitochondrial fatty acid beta-oxidation of saturated fatty acids:
H+ + TPNH + tdec2-CoA ⟶ DEC-CoA + TPN - Beta oxidation of octanoyl-CoA to hexanoyl-CoA:
(S)-Hydroxyoctanoyl-CoA + NAD ⟶ 3-Oxooctanoyl-CoA + H+ + NADH - Fatty acid metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Mitochondrial Fatty Acid Beta-Oxidation:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - mitochondrial fatty acid beta-oxidation of saturated fatty acids:
(S)-3-hydroxypalmitoyl-CoA + NAD ⟶ 3-Oxopalmitoyl-CoA + H+ + NADH - Beta oxidation of octanoyl-CoA to hexanoyl-CoA:
(S)-Hydroxyoctanoyl-CoA + NAD ⟶ 3-Oxooctanoyl-CoA + H+ + NADH - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Mitochondrial Fatty Acid Beta-Oxidation:
H+ + TPNH + tdec2-CoA ⟶ DEC-CoA + TPN - mitochondrial fatty acid beta-oxidation of saturated fatty acids:
H+ + TPNH + tdec2-CoA ⟶ DEC-CoA + TPN - Beta oxidation of octanoyl-CoA to hexanoyl-CoA:
(S)-Hydroxyoctanoyl-CoA + NAD ⟶ 3-Oxooctanoyl-CoA + H+ + NADH - Beta oxidation of hexanoyl-CoA to butanoyl-CoA:
(S)-Hydroxyhexanoyl-CoA + NAD ⟶ 3-Oxohexanoyl-CoA + H+ + NADH - Beta oxidation of hexanoyl-CoA to butanoyl-CoA:
(S)-Hydroxyhexanoyl-CoA + NAD ⟶ 3-Oxohexanoyl-CoA + H+ + NADH - Beta oxidation of hexanoyl-CoA to butanoyl-CoA:
(S)-Hydroxyhexanoyl-CoA + NAD ⟶ 3-Oxohexanoyl-CoA + H+ + NADH - Beta oxidation of hexanoyl-CoA to butanoyl-CoA:
(S)-Hydroxyhexanoyl-CoA + NAD ⟶ 3-Oxohexanoyl-CoA + H+ + NADH - Beta oxidation of hexanoyl-CoA to butanoyl-CoA:
(S)-Hydroxyhexanoyl-CoA + NAD ⟶ 3-Oxohexanoyl-CoA + H+ + NADH - Beta oxidation of hexanoyl-CoA to butanoyl-CoA:
(S)-Hydroxyhexanoyl-CoA + NAD ⟶ 3-Oxohexanoyl-CoA + H+ + NADH - Beta oxidation of hexanoyl-CoA to butanoyl-CoA:
(S)-Hydroxyhexanoyl-CoA + NAD ⟶ 3-Oxohexanoyl-CoA + H+ + NADH - Beta oxidation of hexanoyl-CoA to butanoyl-CoA:
(S)-Hydroxyhexanoyl-CoA + NAD ⟶ 3-Oxohexanoyl-CoA + H+ + NADH - Beta oxidation of hexanoyl-CoA to butanoyl-CoA:
(S)-Hydroxyhexanoyl-CoA + NAD ⟶ 3-Oxohexanoyl-CoA + H+ + NADH - Beta oxidation of hexanoyl-CoA to butanoyl-CoA:
(S)-Hydroxyhexanoyl-CoA + NAD ⟶ 3-Oxohexanoyl-CoA + H+ + NADH - Signaling Pathways:
ADORA2A,B + Ade-Rib ⟶ ADORA2A,B:Ade-Rib - Signaling by Nuclear Receptors:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN - Signaling by Retinoic Acid:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN - RA biosynthesis pathway:
H+ + TPNH + atRAL ⟶ TPN + atROL - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by Nuclear Receptors:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN - Signaling by Retinoic Acid:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN - RA biosynthesis pathway:
H+ + TPNH + atRAL ⟶ TPN + atROL - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by Nuclear Receptors:
E2QW22 + E2RPT1 + ESR1:ER:PGR:P4 + F6UTY3 + J9P0C0 ⟶ ESR1:ESTG:PGR:P4:FOXA1:GATA3:TLE3:NRIP:EP300 - Signaling by Retinoic Acid:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN - RA biosynthesis pathway:
H+ + TPNH + atRAL ⟶ TPN + atROL - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by Nuclear Receptors:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + F8W2D1 + HSP90:HSP90 + Pi + Q7SZQ8 - Signaling by Retinoic Acid:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN - RA biosynthesis pathway:
E9QD41 + atRA ⟶ SUMO-CRABP1:atRA - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by Nuclear Receptors:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Signaling by Retinoic Acid:
H+ + TPNH + atRAL ⟶ TPN + atROL - RA biosynthesis pathway:
H+ + TPNH + atRAL ⟶ TPN + atROL - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by Nuclear Receptors:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + HSP90:HSP90 + Pi + Q9VH95 + Q9VL78 - Signaling by Retinoic Acid:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN - RA biosynthesis pathway:
atRA + fabp ⟶ SUMO-CRABP1:atRA - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by Nuclear Receptors:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN - Signaling by Retinoic Acid:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN - RA biosynthesis pathway:
CRABP1 + atRA ⟶ SUMO-CRABP1:atRA - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of fat-soluble vitamins:
atREs + nascent CM ⟶ nascent CM:atREs - Retinoid metabolism and transport:
atREs + nascent CM ⟶ nascent CM:atREs - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Visual phototransduction:
atREs + nascent CM ⟶ nascent CM:atREs - Signaling by Nuclear Receptors:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + HSP90:HSP90 + Immunophilin FKBP52 + Pi + cPGES - Signaling by Retinoic Acid:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN - RA biosynthesis pathway:
H+ + TPNH + atRAL ⟶ TPN + atROL - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by Nuclear Receptors:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + Fkbp4 + HSP90:HSP90 + Pi + Q9R0Q7 - Signaling by Retinoic Acid:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN - RA biosynthesis pathway:
H+ + TPNH + atRAL ⟶ TPN + atROL - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by Nuclear Receptors:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + HSP90:HSP90 + Pi + Ptges3 + Q9QVC8 - Signaling by Retinoic Acid:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN - RA biosynthesis pathway:
H+ + TPNH + atRAL ⟶ TPN + atROL - Signaling Pathways:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Signaling by Nuclear Receptors:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Signaling by Retinoic Acid:
H2O + NAD + atRAL ⟶ H+ + NADH + atRA - RA biosynthesis pathway:
H2O + NAD + atRAL ⟶ H+ + NADH + atRA - Signaling Pathways:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Signaling by Nuclear Receptors:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Signaling by Retinoic Acid:
H2O + NAD + atRAL ⟶ H+ + NADH + atRA - RA biosynthesis pathway:
H2O + NAD + atRAL ⟶ H+ + NADH + atRA - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by Nuclear Receptors:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN - Signaling by Retinoic Acid:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN - RA biosynthesis pathway:
H+ + TPNH + atRAL ⟶ TPN + atROL - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by Nuclear Receptors:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ A0A310SUH5 + ADP + ESR1:ER:PGR:P4 + HSP90:HSP90 + Pi + Q5U4Z0 - Signaling by Retinoic Acid:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN - RA biosynthesis pathway:
H+ + TPNH + atRAL ⟶ TPN + atROL - Sensory Perception:
GTP + odorant:Olfactory Receptor:GNAL:GDP:GNB1:GNG13 ⟶ GDP + odorant:Olfactory Receptor:GNAL:GTP:GNB1:GNG13 - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Purine catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide catabolism:
H+ + TPNH + Ura ⟶ Hydrouracil + TPN - Purine catabolism:
H2O + Hyp + Oxygen ⟶ H2O2 + XAN - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Purine catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Nucleotide metabolism:
ATP + Thy-dRib ⟶ ADP + TMP - Nucleotide catabolism:
H+ + TPNH + Ura ⟶ Hydrouracil + TPN - Purine catabolism:
H2O + Hyp + Oxygen ⟶ H2O2 + XAN - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide catabolism:
H+ + TPNH + Ura ⟶ Hydrouracil + TPN - Purine catabolism:
H2O + Hyp + Oxygen ⟶ H2O2 + XAN - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Purine catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Metabolism:
H2O + PBG ⟶ HMBL + ammonia - Nucleotide metabolism:
CAP + L-Asp ⟶ N-carb-L-Asp + Pi - Purine metabolism:
ATP + CAIR + L-Asp ⟶ ADP + Pi + SAICAR - Urate synthesis:
Ino + Pi ⟶ Hyp + R1P - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Purine catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Purine catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Purine catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi - Nucleotide catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Purine catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Nucleotide metabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Nucleotide catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Purine catabolism:
AMP + H2O ⟶ Ade-Rib + Pi - Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of lipids:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Metabolism of steroids:
H+ + TPNH + estrone ⟶ EST17b + TPN - Bile acid and bile salt metabolism:
CHOL + H+ + Oxygen + TPNH ⟶ 25OH-CHOL + H2O + TPN - Synthesis of bile acids and bile salts:
CHOL + H+ + Oxygen + TPNH ⟶ 25OH-CHOL + H2O + TPN - Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
25(S) THCA-CoA + Oxygen ⟶ H2O2 + THCA-CoA - Metabolism of lipids:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Phase I - Functionalization of compounds:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Biological oxidations:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN - Phase I - Functionalization of compounds:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Phase I - Functionalization of compounds:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Phase I - Functionalization of compounds:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Ethanol oxidation:
ATP + CH3COO- + CoA-SH ⟶ AMP + Ac-CoA + PPi - Biological oxidations:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN - Phase I - Functionalization of compounds:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Biological oxidations:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Phase I - Functionalization of compounds:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Biological oxidations:
H+ + Oxygen + TPNH + progesterone ⟶ 11DCORST + H2O + TPN - Phase I - Functionalization of compounds:
H+ + Oxygen + TPNH + progesterone ⟶ 11DCORST + H2O + TPN - Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Phase I - Functionalization of compounds:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Phase I - Functionalization of compounds:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Phase I - Functionalization of compounds:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Metabolism:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine - Biological oxidations:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Phase I - Functionalization of compounds:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Biological oxidations:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Phase I - Functionalization of compounds:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Phase I - Functionalization of compounds:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Phase I - Functionalization of compounds:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN - Ethanol oxidation:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH - alpha-linolenic (omega3) and linoleic (omega6) acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Linoleic acid (LA) metabolism:
GLA-CoA + Malonyl-CoA + TPNH ⟶ CoA-SH + DGL-CoA + H2O + TPN + carbon dioxide - alpha-linolenic (omega3) and linoleic (omega6) acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Linoleic acid (LA) metabolism:
GLA-CoA + Malonyl-CoA + TPNH ⟶ CoA-SH + DGL-CoA + H2O + TPN + carbon dioxide - alpha-linolenic (omega3) and linoleic (omega6) acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Linoleic acid (LA) metabolism:
GLA-CoA + Malonyl-CoA + TPNH ⟶ CoA-SH + DGL-CoA + H2O + TPN + carbon dioxide - alpha-linolenic (omega3) and linoleic (omega6) acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Linoleic acid (LA) metabolism:
GLA-CoA + Malonyl-CoA + TPNH ⟶ CoA-SH + DGL-CoA + H2O + TPN + carbon dioxide - alpha-linolenic (omega3) and linoleic (omega6) acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Linoleic acid (LA) metabolism:
GLA-CoA + Malonyl-CoA + TPNH ⟶ CoA-SH + DGL-CoA + H2O + TPN + carbon dioxide - alpha-linolenic (omega3) and linoleic (omega6) acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Linoleic acid (LA) metabolism:
GLA-CoA + Malonyl-CoA + TPNH ⟶ CoA-SH + DGL-CoA + H2O + TPN + carbon dioxide - alpha-linolenic (omega3) and linoleic (omega6) acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Linoleic acid (LA) metabolism:
GLA-CoA + Malonyl-CoA + TPNH ⟶ CoA-SH + DGL-CoA + H2O + TPN + carbon dioxide - alpha-linolenic (omega3) and linoleic (omega6) acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Linoleic acid (LA) metabolism:
GLA-CoA + Malonyl-CoA + TPNH ⟶ CoA-SH + DGL-CoA + H2O + TPN + carbon dioxide - alpha-linolenic (omega3) and linoleic (omega6) acid metabolism:
Oxygen + THA-CoA ⟶ H2O2 + delta2-THA-CoA - Linoleic acid (LA) metabolism:
GLA-CoA + Malonyl-CoA + TPNH ⟶ CoA-SH + DGL-CoA + H2O + TPN + carbon dioxide - Androgen biosynthesis:
DHEA + NAD ⟶ ANDST + H+ + NADH - Androgen biosynthesis:
DHEA + NAD ⟶ ANDST + H+ + NADH - Androgen biosynthesis:
DHEA + NAD ⟶ ANDST + H+ + NADH - Androgen biosynthesis:
DHEA + NAD ⟶ ANDST + H+ + NADH - Androgen biosynthesis:
DHEA + NAD ⟶ ANDST + H+ + NADH - Androgen biosynthesis:
DHEA + NAD ⟶ ANDST + H+ + NADH - Androgen biosynthesis:
H+ + Oxygen + TPNH + progesterone ⟶ 17aHPROG + H2O + TPN - Androgen biosynthesis:
H+ + Oxygen + TPNH + progesterone ⟶ 17aHPROG + H2O + TPN - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Choline catabolism:
BET + HCYS ⟶ DMGLY + L-Met - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Choline catabolism:
DMGLY + H2O ⟶ CH2O + SARC - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Choline catabolism:
BET + HCYS ⟶ DMGLY + L-Met - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Choline catabolism:
BET + HCYS ⟶ DMGLY + L-Met - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Choline catabolism:
Cho + hydrogen acceptor ⟶ BETALD + hydrogen donor - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Choline catabolism:
BETALD + H2O + NAD ⟶ BET + NADH - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Choline catabolism:
BET + HCYS ⟶ DMGLY + L-Met - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Choline catabolism:
BET + HCYS ⟶ DMGLY + L-Met - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Choline catabolism:
BET + HCYS ⟶ DMGLY + L-Met - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Choline catabolism:
BET + HCYS ⟶ DMGLY + L-Met - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Choline catabolism:
DMGLY + H2O ⟶ CH2O + SARC - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Choline catabolism:
BET + HCYS ⟶ DMGLY + L-Met - mitochondrial fatty acid beta-oxidation of unsaturated fatty acids:
CoA + FAD + H2O + LIN-CoA + NAD ⟶ (3Z,6Z)-dodecadienoyl-CoA + Ac-CoA + FADH2(2-) + H+ + NADH - Cholesterol biosynthesis:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN - Cholesterol biosynthesis:
7-dehydroCHOL + H+ + TPNH ⟶ CHOL + TPN - Cholesterol biosynthesis:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN - Cholesterol biosynthesis:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN - Cholesterol biosynthesis:
H+ + LAN + Oxygen + TPNH ⟶ 4,4DMCHtOL + H2O + HCOOH + TPN - Cholesterol biosynthesis:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN - Cholesterol biosynthesis:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN - Cholesterol biosynthesis:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN - Cholesterol biosynthesis:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN - Metabolism of lipids:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine - Metabolism of steroids:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN - Cholesterol biosynthesis:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN - Metabolism of lipids:
ACA + H+ + NADH ⟶ NAD + bHBA - Metabolism of steroids:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN - Cholesterol biosynthesis:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN - Cholesterol biosynthesis:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN - Disease:
ADORA2B + Ade-Rib ⟶ ADORA2B:Ade-Rib - Infectious disease:
ADORA2B + Ade-Rib ⟶ ADORA2B:Ade-Rib - Latent infection - Other responses of Mtb to phagocytosis:
H+ + MSH + NADH + nitrosomycothiol ⟶ H2O + MSSM + NAD + ammonia - Tolerance by Mtb to nitric oxide produced by macrophages:
H+ + MSH + NADH + nitrosomycothiol ⟶ H2O + MSSM + NAD + ammonia - Infection with Mycobacterium tuberculosis:
H+ + MSH + NADH + nitrosomycothiol ⟶ H2O + MSSM + NAD + ammonia - Bacterial Infection Pathways:
H+ + NADH + dlaT(ox.) ⟶ NAD + dlaT - Arachidonic acid metabolism:
H+ + e- + prostaglandin G2 ⟶ H2O + prostaglandin H2 - Synthesis of Prostaglandins (PG) and Thromboxanes (TX):
H+ + e- + prostaglandin G2 ⟶ H2O + prostaglandin H2 - Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Formation of xylulose-5-phosphate:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Carbohydrate metabolism:
L-gulonate + NAD ⟶ 3-dehydro-L-gulonate + H+ + NADH - Formation of xylulose-5-phosphate:
L-gulonate + NAD ⟶ 3-dehydro-L-gulonate + H+ + NADH - Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Formation of xylulose-5-phosphate:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Carbohydrate metabolism:
L-gulonate + NAD ⟶ 3-dehydro-L-gulonate + H+ + NADH - Formation of xylulose-5-phosphate:
L-gulonate + NAD ⟶ 3-dehydro-L-gulonate + H+ + NADH - Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Formation of xylulose-5-phosphate:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Formation of xylulose-5-phosphate:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Formation of xylulose-5-phosphate:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Formation of xylulose-5-phosphate:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Carbohydrate metabolism:
ATP + PYR + carbon dioxide ⟶ ADP + OAA + Pi - Formation of xylulose-5-phosphate:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Carbohydrate metabolism:
ATP + PYR + carbon dioxide ⟶ ADP + OAA + Pi - Formation of xylulose-5-phosphate:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Carbohydrate metabolism:
ATP + PYR + carbon dioxide ⟶ ADP + OAA + Pi - Formation of xylulose-5-phosphate:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Formation of xylulose-5-phosphate:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN - Beta oxidation of butanoyl-CoA to acetyl-CoA:
3HB-CoA + NAD ⟶ ACA-CoA + H+ + NADH - Beta oxidation of butanoyl-CoA to acetyl-CoA:
3HB-CoA + NAD ⟶ ACA-CoA + H+ + NADH - Beta oxidation of butanoyl-CoA to acetyl-CoA:
3HB-CoA + NAD ⟶ ACA-CoA + H+ + NADH - Beta oxidation of butanoyl-CoA to acetyl-CoA:
3HB-CoA + NAD ⟶ ACA-CoA + H+ + NADH - Beta oxidation of butanoyl-CoA to acetyl-CoA:
3HB-CoA + NAD ⟶ ACA-CoA + H+ + NADH - Beta oxidation of butanoyl-CoA to acetyl-CoA:
ATP + BUT ⟶ AMP + BT-CoA + PPi - Beta oxidation of butanoyl-CoA to acetyl-CoA:
3HB-CoA + NAD ⟶ ACA-CoA + H+ + NADH - Beta oxidation of butanoyl-CoA to acetyl-CoA:
3HB-CoA + NAD ⟶ ACA-CoA + H+ + NADH - Beta oxidation of butanoyl-CoA to acetyl-CoA:
3HB-CoA + NAD ⟶ ACA-CoA + H+ + NADH - Beta oxidation of butanoyl-CoA to acetyl-CoA:
3HB-CoA + NAD ⟶ ACA-CoA + H+ + NADH - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Beta-oxidation of pristanoyl-CoA:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Beta-oxidation of pristanoyl-CoA:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Beta-oxidation of pristanoyl-CoA:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Fatty acid metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Peroxisomal lipid metabolism:
2OH-PALM + Oxygen ⟶ 2oxo-PALM + H2O2 - Beta-oxidation of pristanoyl-CoA:
(2S) Pristanoyl-CoA + Oxygen ⟶ H2O2 + trans-2,3-dehydropristanoyl-CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Beta-oxidation of pristanoyl-CoA:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Beta-oxidation of pristanoyl-CoA:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Beta-oxidation of pristanoyl-CoA:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Beta-oxidation of pristanoyl-CoA:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Beta-oxidation of pristanoyl-CoA:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Fructose metabolism:
GA + H2O + NAD ⟶ DGA + H+ + NADH - Fructose biosynthesis:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN - Abacavir ADME:
NAD + abacavir ⟶ H+ + NADH + xenobiotic - Abacavir metabolism:
NAD + abacavir ⟶ H+ + NADH + xenobiotic - Fructose metabolism:
GA + H2O + NAD ⟶ DGA + H+ + NADH - Fructose biosynthesis:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN - Abacavir ADME:
IMP + carbovir ⟶ Ino + xenobiotic - Abacavir metabolism:
IMP + carbovir ⟶ Ino + xenobiotic - Fructose metabolism:
GA + H2O + NAD ⟶ DGA + H+ + NADH - Fructose biosynthesis:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN - Abacavir ADME:
IMP + carbovir ⟶ Ino + xenobiotic - Abacavir metabolism:
IMP + carbovir ⟶ Ino + xenobiotic - Abacavir ADME:
IMP + carbovir ⟶ Ino + xenobiotic - Abacavir metabolism:
IMP + carbovir ⟶ Ino + xenobiotic - Abacavir ADME:
IMP + carbovir ⟶ Ino + xenobiotic - Abacavir metabolism:
IMP + carbovir ⟶ Ino + xenobiotic - Fructose metabolism:
GA + H2O + NAD ⟶ DGA + H+ + NADH - Fructose biosynthesis:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN - Abacavir ADME:
IMP + carbovir ⟶ Ino + xenobiotic - Abacavir metabolism:
IMP + carbovir ⟶ Ino + xenobiotic - Fructose metabolism:
GA + H2O + NAD ⟶ DGA + H+ + NADH - Fructose biosynthesis:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN - Abacavir ADME:
IMP + carbovir ⟶ Ino + xenobiotic - Abacavir metabolism:
IMP + carbovir ⟶ Ino + xenobiotic - Fructose metabolism:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN - Fructose biosynthesis:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN - Abacavir ADME:
AMP + abacavir ⟶ Ade-Rib + xenobiotic - Abacavir metabolism:
AMP + abacavir ⟶ Ade-Rib + xenobiotic - Fructose metabolism:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN - Fructose biosynthesis:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN - Abacavir ADME:
IMP + carbovir ⟶ Ino + xenobiotic - Abacavir metabolism:
IMP + carbovir ⟶ Ino + xenobiotic - Fructose metabolism:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN - Fructose biosynthesis:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN - Abacavir ADME:
IMP + carbovir ⟶ Ino + xenobiotic - Abacavir metabolism:
IMP + carbovir ⟶ Ino + xenobiotic - Fructose metabolism:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN - Fructose biosynthesis:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN - Abacavir ADME:
NAD + abacavir ⟶ H+ + NADH + xenobiotic - Abacavir metabolism:
NAD + abacavir ⟶ H+ + NADH + xenobiotic - Fructose metabolism:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN - Fructose biosynthesis:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN - Abacavir ADME:
NAD + abacavir ⟶ H+ + NADH + xenobiotic - Abacavir metabolism:
NAD + abacavir ⟶ H+ + NADH + xenobiotic - Fructose metabolism:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN - Fructose biosynthesis:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN - Abacavir ADME:
IMP + carbovir ⟶ Ino + xenobiotic - Abacavir metabolism:
IMP + carbovir ⟶ Ino + xenobiotic - Fructose metabolism:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN - Fructose biosynthesis:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN - Abacavir ADME:
IMP + carbovir ⟶ Ino + xenobiotic - Abacavir metabolism:
IMP + carbovir ⟶ Ino + xenobiotic - Drug ADME:
APAP + UDP-GlcA ⟶ APAP-GlcA + UDP - Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic - Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic - Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic - Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic - Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic - Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic - Drug ADME:
AMP + abacavir ⟶ Ade-Rib + xenobiotic - Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic - Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic - Drug ADME:
APAP + UDP-GlcA ⟶ APAP-GlcA + UDP - Drug ADME:
6TIMP + H2O + NAD ⟶ 6TXMP + H+ + NADH - Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic - Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter clearance:
DA + SAM ⟶ 3MT + SAH - Clearance of seratonin:
5HT + H2O + Oxygen ⟶ 5HIALD + H2O2 + ammonia - Metabolism of serotonin:
5HT + H2O + Oxygen ⟶ 5HIALD + H2O2 + ammonia - Neuronal System:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Transmission across Chemical Synapses:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Neurotransmitter clearance:
AcCho + H2O ⟶ Cho + acetate - Clearance of seratonin:
HIALD + NAD ⟶ H+ + HIAA + NADH - Metabolism of serotonin:
HIALD + NAD ⟶ H+ + HIAA + NADH - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter clearance:
DA + SAM ⟶ 3MT + SAH - Clearance of seratonin:
5HT + H2O + Oxygen ⟶ 5HIALD + H2O2 + ammonia - Metabolism of serotonin:
5HT + H2O + Oxygen ⟶ 5HIALD + H2O2 + ammonia - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter clearance:
DA + SAM ⟶ 3MT + SAH - Clearance of seratonin:
HIALD + NAD ⟶ H+ + HIAA + NADH - Metabolism of serotonin:
HIALD + NAD ⟶ H+ + HIAA + NADH - Neuronal System:
3MT + H2O + Oxygen ⟶ H2O2 + HVA + ammonia - Transmission across Chemical Synapses:
3MT + H2O + Oxygen ⟶ H2O2 + HVA + ammonia - Neurotransmitter clearance:
3MT + H2O + Oxygen ⟶ H2O2 + HVA + ammonia - Clearance of seratonin:
5HT + H2O + Oxygen ⟶ 5HIALD + H2O2 + ammonia - Metabolism of serotonin:
5HT + H2O + Oxygen ⟶ 5HIALD + H2O2 + ammonia - Neuronal System:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Transmission across Chemical Synapses:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Neurotransmitter clearance:
AcCho + H2O ⟶ Cho + acetate - Clearance of seratonin:
HIALD + NAD ⟶ H+ + HIAA + NADH - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter clearance:
DA + SAM ⟶ 3MT + SAH - Clearance of seratonin:
5HT + H2O + Oxygen ⟶ 5HIALD + H2O2 + ammonia - Metabolism of serotonin:
5HT + H2O + Oxygen ⟶ 5HIALD + H2O2 + ammonia - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter clearance:
DA + SAM ⟶ 3MT + SAH - Clearance of seratonin:
5HT + H2O + Oxygen ⟶ 5HIALD + H2O2 + ammonia - Metabolism of serotonin:
5HT + H2O + Oxygen ⟶ 5HIALD + H2O2 + ammonia - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter clearance:
DA + SAM ⟶ 3MT + SAH - Clearance of seratonin:
5HT + H2O + Oxygen ⟶ 5HIALD + H2O2 + ammonia - Metabolism of serotonin:
5HT + H2O + Oxygen ⟶ 5HIALD + H2O2 + ammonia - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter clearance:
DA + SAM ⟶ 3MT + SAH - Clearance of seratonin:
5HT + H2O + Oxygen ⟶ 5HIALD + H2O2 + ammonia - Metabolism of serotonin:
5HT + H2O + Oxygen ⟶ 5HIALD + H2O2 + ammonia - Neuronal System:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Transmission across Chemical Synapses:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Neurotransmitter clearance:
HIALD + NAD ⟶ H+ + HIAA + NADH - Clearance of seratonin:
HIALD + NAD ⟶ H+ + HIAA + NADH - Metabolism of serotonin:
HIALD + NAD ⟶ H+ + HIAA + NADH - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter clearance:
DA + SAM ⟶ 3MT + SAH - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter clearance:
DA + SAM ⟶ 3MT + SAH - Clearance of seratonin:
HIALD + NAD ⟶ H+ + HIAA + NADH - Metabolism of serotonin:
HIALD + NAD ⟶ H+ + HIAA + NADH - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter clearance:
DA + SAM ⟶ 3MT + SAH - Clearance of seratonin:
HIALD + NAD ⟶ H+ + HIAA + NADH - Metabolism of serotonin:
HIALD + NAD ⟶ H+ + HIAA + NADH - Clearance of seratonin:
HIALD + NAD ⟶ H+ + HIAA + NADH - Metabolism of serotonin:
HIALD + NAD ⟶ H+ + HIAA + NADH - Metabolism of serotonin:
HIALD + NAD ⟶ H+ + HIAA + NADH - Azathioprine ADME:
6MP + H2O + NAD ⟶ 6TU + H+ + NADH - Azathioprine ADME:
6MP + H2O + NAD ⟶ 6TU + H+ + NADH - Azathioprine ADME:
6MP + H2O + NAD ⟶ 6TU + H+ + NADH - Azathioprine ADME:
6MP + H2O + NAD ⟶ 6TU + H+ + NADH - Azathioprine ADME:
6MP + H2O + NAD ⟶ 6TU + H+ + NADH - Azathioprine ADME:
6MP + H2O + NAD ⟶ 6TU + H+ + NADH - Azathioprine ADME:
6MP + H2O + NAD ⟶ 6TU + H+ + NADH - Azathioprine ADME:
6MP + H2O + NAD ⟶ 6TU + H+ + NADH - Azathioprine ADME:
6MP + H2O + NAD ⟶ 6TU + H+ + NADH - Azathioprine ADME:
6MP + H2O + NAD ⟶ 6TU + H+ + NADH - Azathioprine ADME:
6MP + H2O + NAD ⟶ 6TU + H+ + NADH - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Branched-chain amino acid catabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Branched-chain amino acid catabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Branched-chain amino acid catabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Branched-chain amino acid catabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Branched-chain amino acid catabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Branched-chain amino acid catabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Branched-chain amino acid catabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Branched-chain amino acid catabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Branched-chain amino acid catabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Branched-chain amino acid catabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Branched-chain amino acid catabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Branched-chain amino acid catabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - alpha-linolenic acid (ALA) metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - alpha-linolenic acid (ALA) metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - alpha-linolenic acid (ALA) metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - alpha-linolenic acid (ALA) metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - alpha-linolenic acid (ALA) metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - alpha-linolenic acid (ALA) metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - alpha-linolenic acid (ALA) metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - alpha-linolenic acid (ALA) metabolism:
Oxygen + THA-CoA ⟶ H2O2 + delta2-THA-CoA - alpha-linolenic (omega3) and linoleic (omega6) acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - alpha-linolenic acid (ALA) metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Lysine catabolism:
Oxygen + PPCA ⟶ H2O2 + P6C - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Amino acid and derivative metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Lysine catabolism:
2OG + H+ + L-Lys + TPNH ⟶ H2O + SACN + TPN - Amino acid and derivative metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Lysine catabolism:
Oxygen + PPCA ⟶ H2O2 + P6C - Beta oxidation of decanoyl-CoA to octanoyl-CoA-CoA:
(S)-Hydroxydecanoyl-CoA + NAD ⟶ 3-Oxodecanoyl-CoA + H+ + NADH - Beta oxidation of decanoyl-CoA to octanoyl-CoA-CoA:
H+ + TPNH + tdec2-CoA ⟶ DEC-CoA + TPN - Beta oxidation of decanoyl-CoA to octanoyl-CoA-CoA:
H+ + TPNH + tdec2-CoA ⟶ DEC-CoA + TPN - Beta oxidation of decanoyl-CoA to octanoyl-CoA-CoA:
H+ + TPNH + tdec2-CoA ⟶ DEC-CoA + TPN - Beta oxidation of decanoyl-CoA to octanoyl-CoA-CoA:
H+ + TPNH + tdec2-CoA ⟶ DEC-CoA + TPN - Beta oxidation of decanoyl-CoA to octanoyl-CoA-CoA:
H+ + TPNH + tdec2-CoA ⟶ DEC-CoA + TPN - Beta oxidation of decanoyl-CoA to octanoyl-CoA-CoA:
H+ + TPNH + tdec2-CoA ⟶ DEC-CoA + TPN - Beta oxidation of decanoyl-CoA to octanoyl-CoA-CoA:
H+ + TPNH + tdec2-CoA ⟶ DEC-CoA + TPN - Beta oxidation of decanoyl-CoA to octanoyl-CoA-CoA:
(S)-Hydroxydecanoyl-CoA + NAD ⟶ 3-Oxodecanoyl-CoA + H+ + NADH - Beta oxidation of decanoyl-CoA to octanoyl-CoA-CoA:
H+ + TPNH + tdec2-CoA ⟶ DEC-CoA + TPN - Linoleic acid (LA) metabolism:
GLA-CoA + Malonyl-CoA + TPNH ⟶ CoA-SH + DGL-CoA + H2O + TPN + carbon dioxide - Beta oxidation of palmitoyl-CoA to myristoyl-CoA:
(S)-3-hydroxypalmitoyl-CoA + NAD ⟶ 3-Oxopalmitoyl-CoA + H+ + NADH - Beta oxidation of palmitoyl-CoA to myristoyl-CoA:
(S)-3-hydroxypalmitoyl-CoA + NAD ⟶ 3-Oxopalmitoyl-CoA + H+ + NADH - Beta oxidation of palmitoyl-CoA to myristoyl-CoA:
(S)-3-hydroxypalmitoyl-CoA + NAD ⟶ 3-Oxopalmitoyl-CoA + H+ + NADH - Beta oxidation of palmitoyl-CoA to myristoyl-CoA:
(S)-3-hydroxypalmitoyl-CoA + NAD ⟶ 3-Oxopalmitoyl-CoA + H+ + NADH - Mitochondrial Fatty Acid Beta-Oxidation:
H+ + TPNH + tdec2-CoA ⟶ DEC-CoA + TPN - mitochondrial fatty acid beta-oxidation of saturated fatty acids:
H+ + TPNH + tdec2-CoA ⟶ DEC-CoA + TPN - Beta oxidation of palmitoyl-CoA to myristoyl-CoA:
(S)-3-hydroxypalmitoyl-CoA + NAD ⟶ 3-Oxopalmitoyl-CoA + H+ + NADH - Beta oxidation of palmitoyl-CoA to myristoyl-CoA:
(S)-3-hydroxypalmitoyl-CoA + NAD ⟶ 3-Oxopalmitoyl-CoA + H+ + NADH - Beta oxidation of palmitoyl-CoA to myristoyl-CoA:
(S)-3-hydroxypalmitoyl-CoA + NAD ⟶ 3-Oxopalmitoyl-CoA + H+ + NADH - Beta oxidation of palmitoyl-CoA to myristoyl-CoA:
(S)-3-hydroxypalmitoyl-CoA + NAD ⟶ 3-Oxopalmitoyl-CoA + H+ + NADH - Beta oxidation of palmitoyl-CoA to myristoyl-CoA:
(S)-3-hydroxypalmitoyl-CoA + NAD ⟶ 3-Oxopalmitoyl-CoA + H+ + NADH - Beta oxidation of palmitoyl-CoA to myristoyl-CoA:
(S)-3-hydroxypalmitoyl-CoA + NAD ⟶ 3-Oxopalmitoyl-CoA + H+ + NADH - Beta oxidation of palmitoyl-CoA to myristoyl-CoA:
(S)-3-hydroxypalmitoyl-CoA + NAD ⟶ 3-Oxopalmitoyl-CoA + H+ + NADH - alpha-linolenic acid (ALA) metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Synthesis of bile acids and bile salts via 24-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 24OH-CHOL + H2O + TPN - Synthesis of bile acids and bile salts via 24-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 24OH-CHOL + H2O + TPN - Synthesis of bile acids and bile salts via 24-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 24OH-CHOL + H2O + TPN - Synthesis of bile acids and bile salts via 24-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 24OH-CHOL + H2O + TPN - Synthesis of bile acids and bile salts via 24-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 24OH-CHOL + H2O + TPN - Synthesis of bile acids and bile salts via 24-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 24OH-CHOL + H2O + TPN - Synthesis of bile acids and bile salts via 24-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 24OH-CHOL + H2O + TPN - Synthesis of bile acids and bile salts via 24-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 24OH-CHOL + H2O + TPN - Visual phototransduction:
H+ + RBP2:atRAL + TPNH ⟶ RBP2:atROL + TPN - The canonical retinoid cycle in rods (twilight vision):
DHA + H+ + Oxygen + TPNH ⟶ H2O + HDoHE + TPN - Visual phototransduction:
atREs + nascent CM ⟶ nascent CM:atREs - The canonical retinoid cycle in rods (twilight vision):
RLBP1:11cROL + TPN ⟶ H+ + RLBP1:11cRAL + TPNH - Visual phototransduction:
atREs + nascent CM ⟶ nascent CM:atREs - The canonical retinoid cycle in rods (twilight vision):
RLBP1:11cROL + TPN ⟶ H+ + RLBP1:11cRAL + TPNH - Visual phototransduction:
H+ + RBP2:atRAL + TPNH ⟶ RBP2:atROL + TPN - The canonical retinoid cycle in rods (twilight vision):
DHA + H+ + Oxygen + TPNH ⟶ H2O + HDoHE + TPN - The canonical retinoid cycle in rods (twilight vision):
RLBP1:11cROL + TPN ⟶ H+ + RLBP1:11cRAL + TPNH - Visual phototransduction:
atREs + nascent CM ⟶ nascent CM:atREs - The canonical retinoid cycle in rods (twilight vision):
RLBP1:11cROL + TPN ⟶ H+ + RLBP1:11cRAL + TPNH - Visual phototransduction:
atREs + nascent CM ⟶ nascent CM:atREs - The canonical retinoid cycle in rods (twilight vision):
RLBP1:11cROL + TPN ⟶ H+ + RLBP1:11cRAL + TPNH - Visual phototransduction:
atREs + nascent CM ⟶ nascent CM:atREs - The canonical retinoid cycle in rods (twilight vision):
DHA + H+ + Oxygen + TPNH ⟶ H2O + HDoHE + TPN - Sensory Perception:
atREs + nascent CM ⟶ nascent CM:atREs - Sensory Perception:
atREs + nascent CM ⟶ nascent CM:atREs - Sensory Perception:
atREs + nascent CM ⟶ nascent CM:atREs - Sensory Perception:
H2O + RPALM ⟶ PALM + atROL - Sensory Perception:
atREs + nascent CM ⟶ nascent CM:atREs - Sensory Perception:
H2O + RPALM ⟶ PALM + atROL - Sensory Perception:
atREs + nascent CM ⟶ nascent CM:atREs - mitochondrial fatty acid beta-oxidation of unsaturated fatty acids:
(2E,4Z)-deca-2,4-dienoyl-CoA + H+ + NADH ⟶ 3-trans-decenoyl-CoA + NAD - mitochondrial fatty acid beta-oxidation of unsaturated fatty acids:
(2E,4Z)-deca-2,4-dienoyl-CoA + H+ + NADH ⟶ 3-trans-decenoyl-CoA + NAD - mitochondrial fatty acid beta-oxidation of unsaturated fatty acids:
(2E,4Z)-deca-2,4-dienoyl-CoA + H+ + NADH ⟶ 3-trans-decenoyl-CoA + NAD - mitochondrial fatty acid beta-oxidation of unsaturated fatty acids:
(2E,4Z)-deca-2,4-dienoyl-CoA + H+ + NADH ⟶ 3-trans-decenoyl-CoA + NAD - mitochondrial fatty acid beta-oxidation of unsaturated fatty acids:
(2E,4Z)-deca-2,4-dienoyl-CoA + H+ + NADH ⟶ 3-trans-decenoyl-CoA + NAD - mitochondrial fatty acid beta-oxidation of unsaturated fatty acids:
(2E,4Z)-deca-2,4-dienoyl-CoA + H+ + NADH ⟶ 3-trans-decenoyl-CoA + NAD - mitochondrial fatty acid beta-oxidation of unsaturated fatty acids:
(2E,4Z)-deca-2,4-dienoyl-CoA + H+ + NADH ⟶ 3-trans-decenoyl-CoA + NAD - mitochondrial fatty acid beta-oxidation of unsaturated fatty acids:
(2E,4Z)-deca-2,4-dienoyl-CoA + H+ + NADH ⟶ 3-trans-decenoyl-CoA + NAD - mitochondrial fatty acid beta-oxidation of unsaturated fatty acids:
(2E,4Z)-deca-2,4-dienoyl-CoA + H+ + NADH ⟶ 3-trans-decenoyl-CoA + NAD - Mineralocorticoid biosynthesis:
H+ + Oxygen + TPNH + progesterone ⟶ 11DCORST + H2O + TPN - Mineralocorticoid biosynthesis:
pregn-5-ene-3,20-dione ⟶ progesterone - Mineralocorticoid biosynthesis:
H+ + Oxygen + TPNH + progesterone ⟶ 11DCORST + H2O + TPN - Mineralocorticoid biosynthesis:
H+ + Oxygen + TPNH + progesterone ⟶ 11DCORST + H2O + TPN - Mineralocorticoid biosynthesis:
pregn-5-ene-3,20-dione ⟶ progesterone - Mineralocorticoid biosynthesis:
H+ + Oxygen + TPNH + progesterone ⟶ 11DCORST + H2O + TPN - Mineralocorticoid biosynthesis:
H+ + Oxygen + TPNH + progesterone ⟶ 11DCORST + H2O + TPN - Mineralocorticoid biosynthesis:
H+ + Oxygen + TPNH + progesterone ⟶ 11DCORST + H2O + TPN - Mineralocorticoid biosynthesis:
H+ + Oxygen + TPNH + progesterone ⟶ 11DCORST + H2O + TPN - Mineralocorticoid biosynthesis:
pregn-5-ene-3,20-dione ⟶ progesterone - Mineralocorticoid biosynthesis:
H+ + Oxygen + TPNH + progesterone ⟶ 11DCORST + H2O + TPN - Mineralocorticoid biosynthesis:
pregn-5-ene-3,20-dione ⟶ progesterone - Beta oxidation of lauroyl-CoA to decanoyl-CoA-CoA:
(S)-3-hydroxylauroyl-CoA + NAD ⟶ 3-oxolauroyl-CoA + H+ + NADH - Beta oxidation of lauroyl-CoA to decanoyl-CoA-CoA:
(S)-3-hydroxylauroyl-CoA + NAD ⟶ 3-oxolauroyl-CoA + H+ + NADH - Beta oxidation of lauroyl-CoA to decanoyl-CoA-CoA:
(S)-3-hydroxylauroyl-CoA + NAD ⟶ 3-oxolauroyl-CoA + H+ + NADH - Beta oxidation of lauroyl-CoA to decanoyl-CoA-CoA:
(S)-3-hydroxylauroyl-CoA + NAD ⟶ 3-oxolauroyl-CoA + H+ + NADH - Beta oxidation of lauroyl-CoA to decanoyl-CoA-CoA:
(S)-3-hydroxylauroyl-CoA + NAD ⟶ 3-oxolauroyl-CoA + H+ + NADH - Beta oxidation of lauroyl-CoA to decanoyl-CoA-CoA:
(S)-3-hydroxylauroyl-CoA + NAD ⟶ 3-oxolauroyl-CoA + H+ + NADH - Beta oxidation of lauroyl-CoA to decanoyl-CoA-CoA:
(S)-3-hydroxylauroyl-CoA + NAD ⟶ 3-oxolauroyl-CoA + H+ + NADH - Beta oxidation of lauroyl-CoA to decanoyl-CoA-CoA:
(S)-3-hydroxylauroyl-CoA + NAD ⟶ 3-oxolauroyl-CoA + H+ + NADH - Beta oxidation of lauroyl-CoA to decanoyl-CoA-CoA:
(S)-3-hydroxylauroyl-CoA + NAD ⟶ 3-oxolauroyl-CoA + H+ + NADH - Beta oxidation of lauroyl-CoA to decanoyl-CoA-CoA:
(S)-3-hydroxylauroyl-CoA + NAD ⟶ 3-oxolauroyl-CoA + H+ + NADH - Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
Glu + L-Glu5S ⟶ 2OG + L-Orn - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Sphingolipid metabolism:
H2O + dehydroepiandrosterone sulfate ⟶ DHEA + SO4(2-) - Sphingolipid metabolism:
3-ketosphinganine + H+ + TPNH ⟶ SPA + TPN - Sphingolipid metabolism:
H2O + dehydroepiandrosterone sulfate ⟶ DHEA + SO4(2-) - Sphingolipid metabolism:
H2O + dehydroepiandrosterone sulfate ⟶ DHEA + SO4(2-) - Sphingolipid metabolism:
3-ketosphinganine + H+ + TPNH ⟶ SPA + TPN - Sphingolipid metabolism:
3-ketosphinganine + H+ + TPNH ⟶ SPA + TPN - Sphingolipid metabolism:
H2O + dehydroepiandrosterone sulfate ⟶ DHEA + SO4(2-) - Sphingolipid metabolism:
H2O + dehydroepiandrosterone sulfate ⟶ DHEA + SO4(2-) - Sphingolipid metabolism:
H2O + dehydroepiandrosterone sulfate ⟶ DHEA + SO4(2-) - Sphingolipid metabolism:
H2O + dehydroepiandrosterone sulfate ⟶ DHEA + SO4(2-) - Sphingolipid metabolism:
3-ketosphinganine + H+ + TPNH ⟶ SPA + TPN - Sphingolipid metabolism:
H2O + dehydroepiandrosterone sulfate ⟶ DHEA + SO4(2-) - Sphingolipid catabolism:
H2O + Plant-Ceramides-II ⟶ RCOO- + phytosphingosine - Sphingolipid catabolism:
H2O + HD2NAL + NAD ⟶ H+ + NADH + PALM - Sphingolipid catabolism:
H2O + Plant-Ceramides-II ⟶ RCOO- + phytosphingosine - Sphingolipid catabolism:
H2O + HD2NAL + NAD ⟶ H+ + NADH + PALM - Sphingolipid catabolism:
H2O + Plant-Ceramides-II ⟶ RCOO- + phytosphingosine - Sphingolipid catabolism:
H2O + HD2NAL + NAD ⟶ H+ + NADH + PALM - Sphingolipid catabolism:
H2O + Plant-Ceramides-II ⟶ RCOO- + phytosphingosine - Sphingolipid catabolism:
H2O + Plant-Ceramides-II ⟶ RCOO- + phytosphingosine - Sphingolipid catabolism:
H2O + Plant-Ceramides-II ⟶ RCOO- + phytosphingosine - Sphingolipid catabolism:
H2O + Plant-Ceramides-II ⟶ RCOO- + phytosphingosine - Sphingolipid catabolism:
H2O + Plant-Ceramides-II ⟶ RCOO- + phytosphingosine - Sphingolipid catabolism:
H2O + Plant-Ceramides-II ⟶ RCOO- + phytosphingosine - Phenylalanine and tyrosine metabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Phenylalanine metabolism:
L-Phe + PYR ⟶ 3IN-PYRA + L-Ala - Phenylalanine and tyrosine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Phenylalanine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Phenylalanine and tyrosine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Phenylalanine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Phenylalanine and tyrosine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Phenylalanine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Phenylalanine and tyrosine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Phenylalanine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Phenylalanine and tyrosine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Phenylalanine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Phenylalanine and tyrosine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Phenylalanine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Phenylalanine and tyrosine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Phenylalanine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Phenylalanine and tyrosine metabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Phenylalanine metabolism:
L-Phe + PYR ⟶ 3IN-PYRA + L-Ala - Phenylalanine and tyrosine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Phenylalanine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Phenylalanine and tyrosine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Phenylalanine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Phenylalanine and tyrosine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Phenylalanine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Beta oxidation of myristoyl-CoA to lauroyl-CoA:
(S)-3-Hydroxytetradecanoyl-CoA + NAD ⟶ 3-Oxotetradecanoyl-CoA + H+ + NADH - Beta oxidation of myristoyl-CoA to lauroyl-CoA:
(S)-3-Hydroxytetradecanoyl-CoA + NAD ⟶ 3-Oxotetradecanoyl-CoA + H+ + NADH - Beta oxidation of myristoyl-CoA to lauroyl-CoA:
(S)-3-Hydroxytetradecanoyl-CoA + NAD ⟶ 3-Oxotetradecanoyl-CoA + H+ + NADH - Beta oxidation of myristoyl-CoA to lauroyl-CoA:
(S)-3-Hydroxytetradecanoyl-CoA + NAD ⟶ 3-Oxotetradecanoyl-CoA + H+ + NADH - Beta oxidation of myristoyl-CoA to lauroyl-CoA:
(S)-3-Hydroxytetradecanoyl-CoA + NAD ⟶ 3-Oxotetradecanoyl-CoA + H+ + NADH - Beta oxidation of myristoyl-CoA to lauroyl-CoA:
(S)-3-Hydroxytetradecanoyl-CoA + NAD ⟶ 3-Oxotetradecanoyl-CoA + H+ + NADH - Beta oxidation of myristoyl-CoA to lauroyl-CoA:
(S)-3-Hydroxytetradecanoyl-CoA + NAD ⟶ 3-Oxotetradecanoyl-CoA + H+ + NADH - Beta oxidation of myristoyl-CoA to lauroyl-CoA:
(S)-3-Hydroxytetradecanoyl-CoA + NAD ⟶ 3-Oxotetradecanoyl-CoA + H+ + NADH - Beta oxidation of myristoyl-CoA to lauroyl-CoA:
(S)-3-Hydroxytetradecanoyl-CoA + NAD ⟶ 3-Oxotetradecanoyl-CoA + H+ + NADH - Beta oxidation of myristoyl-CoA to lauroyl-CoA:
(S)-3-Hydroxytetradecanoyl-CoA + NAD ⟶ 3-Oxotetradecanoyl-CoA + H+ + NADH - Beta oxidation of myristoyl-CoA to lauroyl-CoA:
(S)-3-Hydroxytetradecanoyl-CoA + NAD ⟶ 3-Oxotetradecanoyl-CoA + H+ + NADH - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism:
DCA + H2O ⟶ HCl + glyoxylate - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism:
DCA + H2O ⟶ HCl + glyoxylate - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism:
DCA + H2O ⟶ HCl + glyoxylate - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism:
DCA + H2O ⟶ HCl + glyoxylate - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism:
DCA + H2O ⟶ HCl + glyoxylate - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism:
DCA + H2O ⟶ HCl + glyoxylate - Pyruvate metabolism:
CoA + NAD + PYR ⟶ Ac-CoA + H+ + NADH + carbon dioxide - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism:
DCA + H2O ⟶ HCl + glyoxylate - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism:
DCA + H2O ⟶ HCl + glyoxylate - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism:
DCA + H2O ⟶ HCl + glyoxylate - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism:
DCA + H2O ⟶ HCl + glyoxylate - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism:
DCA + H2O ⟶ HCl + glyoxylate - Synthesis of bile acids and bile salts via 27-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 27OH-CHOL + H2O + TPN - Synthesis of bile acids and bile salts via 27-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 27OH-CHOL + H2O + TPN - Synthesis of bile acids and bile salts via 27-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 27OH-CHOL + H2O + TPN - Synthesis of bile acids and bile salts via 27-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 27OH-CHOL + H2O + TPN - Synthesis of bile acids and bile salts via 27-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 27OH-CHOL + H2O + TPN - Synthesis of bile acids and bile salts via 27-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 27OH-CHOL + H2O + TPN - Synthesis of bile acids and bile salts via 27-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 27OH-CHOL + H2O + TPN - Synthesis of bile acids and bile salts via 27-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 27OH-CHOL + H2O + TPN - Ketone body metabolism:
ACA + H+ + NADH ⟶ NAD + bHBA - Synthesis of Ketone Bodies:
ACA + H+ + NADH ⟶ NAD + bHBA - Ketone body catabolism:
NAD + bHBA ⟶ ACA + H+ + NADH - Ketone body metabolism:
ACA + H+ + NADH ⟶ NAD + bHBA - Synthesis of Ketone Bodies:
ACA + H+ + NADH ⟶ NAD + bHBA - Ketone body catabolism:
NAD + bHBA ⟶ ACA + H+ + NADH - Ketone body metabolism:
ACA + H+ + NADH ⟶ NAD + bHBA - Synthesis of Ketone Bodies:
ACA + H+ + NADH ⟶ NAD + bHBA - Ketone body catabolism:
NAD + bHBA ⟶ ACA + H+ + NADH - Ketone body metabolism:
ACA + H+ + NADH ⟶ NAD + bHBA - Synthesis of Ketone Bodies:
ACA + H+ + NADH ⟶ NAD + bHBA - Ketone body catabolism:
NAD + bHBA ⟶ ACA + H+ + NADH - Ketone body metabolism:
ACA + H+ + NADH ⟶ NAD + bHBA - Synthesis of Ketone Bodies:
ACA + H+ + NADH ⟶ NAD + bHBA - Ketone body catabolism:
NAD + bHBA ⟶ ACA + H+ + NADH - Ketone body metabolism:
ACA + H+ + NADH ⟶ NAD + bHBA - Synthesis of Ketone Bodies:
ACA + H+ + NADH ⟶ NAD + bHBA - Ketone body catabolism:
NAD + bHBA ⟶ ACA + H+ + NADH - Ketone body metabolism:
ACA + H+ + NADH ⟶ NAD + bHBA - Synthesis of Ketone Bodies:
ACA + H+ + NADH ⟶ NAD + bHBA - Ketone body catabolism:
NAD + bHBA ⟶ ACA + H+ + NADH - Ketone body metabolism:
ACA + H+ + NADH ⟶ NAD + bHBA - Synthesis of Ketone Bodies:
ACA + H+ + NADH ⟶ NAD + bHBA - Ketone body catabolism:
NAD + bHBA ⟶ ACA + H+ + NADH - Ketone body metabolism:
ACA + H+ + NADH ⟶ NAD + bHBA - Synthesis of Ketone Bodies:
ACA + H+ + NADH ⟶ NAD + bHBA - Ketone body catabolism:
NAD + bHBA ⟶ ACA + H+ + NADH - Ketone body metabolism:
ACA + H+ + NADH ⟶ NAD + bHBA - Synthesis of Ketone Bodies:
ACA + H+ + NADH ⟶ NAD + bHBA - Ketone body catabolism:
NAD + bHBA ⟶ ACA + H+ + NADH - Ketone body metabolism:
ACA + H+ + NADH ⟶ NAD + bHBA - Synthesis of Ketone Bodies:
ACA + H+ + NADH ⟶ NAD + bHBA - Ketone body catabolism:
NAD + bHBA ⟶ ACA + H+ + NADH - Beta-oxidation of very long chain fatty acids:
C26:0 CoA + Oxygen ⟶ H2O2 + trans-2-hexacosenoyl-CoA - Lysine catabolism:
CoA + NAD + aKADA ⟶ GL-CoA + NADH + carbon dioxide - Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia - Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia - Serine biosynthesis:
3POPA + L-Glu ⟶ 2OG + O-P-Ser - Serine biosynthesis:
3POPA + L-Glu ⟶ 2OG + O-P-Ser - Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia - Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia - Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia - Serine biosynthesis:
3POPA + L-Glu ⟶ 2OG + O-P-Ser - Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Gamma carboxylation, hypusine formation and arylsulfatase activation:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Hypusinylation:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Gamma carboxylation, hypusine formation and arylsulfatase activation:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Hypusinylation:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Gamma carboxylation, hypusine formation and arylsulfatase activation:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Hypusinylation:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Gamma carboxylation, hypusine formation and arylsulfatase activation:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Hypusinylation:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Metabolism of proteins:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a - Post-translational protein modification:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a - Gamma carboxylation, hypusine formation and arylsulfatase activation:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a - Hypusinylation:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH + Q9GU68 - Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH + Q9GU68 - Gamma carboxylation, hypusine formation and arylsulfatase activation:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH + Q9GU68 - Hypusinylation:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH + Q9GU68 - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Gamma carboxylation, hypusine formation and arylsulfatase activation:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Hypusinylation:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Gamma carboxylation, hypusine formation and arylsulfatase activation:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Hypusinylation:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Gamma carboxylation, hypusine formation and arylsulfatase activation:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Hypusinylation:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Gamma carboxylation, hypusine formation and arylsulfatase activation:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Hypusinylation:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Gamma carboxylation, hypusine formation and arylsulfatase activation:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Hypusinylation:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Gamma carboxylation, hypusine formation and arylsulfatase activation:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Hypusinylation:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Gamma carboxylation, hypusine formation and arylsulfatase activation:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Hypusinylation:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Metabolism of proteins:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a - Post-translational protein modification:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a - Gamma carboxylation, hypusine formation and arylsulfatase activation:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a - Hypusinylation:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins.:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Respiratory electron transport:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins.:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Respiratory electron transport:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins.:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Respiratory electron transport:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins.:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Respiratory electron transport:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins.:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Respiratory electron transport:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins.:
Cytochrome c-Fe2+ + H+ + Oxygen ⟶ Cytochrome c-Fe3+ + H+ + H2O - Respiratory electron transport:
Cytochrome c-Fe2+ + H+ + Oxygen ⟶ Cytochrome c-Fe3+ + H+ + H2O - Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins.:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Respiratory electron transport:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins.:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Respiratory electron transport:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins.:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Respiratory electron transport:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O - Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins.:
CoQ + H+ + NADH ⟶ H+ + NAD + ubiquinol - Respiratory electron transport:
CoQ + H+ + NADH ⟶ H+ + NAD + ubiquinol - Fructose catabolism:
GA + H2O + NAD ⟶ DGA + H+ + NADH - Fructose catabolism:
GA + H2O + NAD ⟶ DGA + H+ + NADH - Fructose catabolism:
GA + H2O + NAD ⟶ DGA + H+ + NADH - Carbohydrate metabolism:
H2O + Heparan(3)-PGs ⟶ CH3COO- + Heparan(4)-PGs - Fructose metabolism:
GA + H2O + NAD ⟶ DGA + H+ + NADH - Fructose catabolism:
GA + H2O + NAD ⟶ DGA + H+ + NADH - Fructose catabolism:
GA + H2O + NAD ⟶ DGA + H+ + NADH - Fructose catabolism:
GA + H2O + NAD ⟶ DGA + H+ + NADH - Fructose catabolism:
GA + H2O + NAD ⟶ DGA + H+ + NADH - Fructose catabolism:
GA + H2O + NAD ⟶ DGA + H+ + NADH - Fructose catabolism:
GA + H2O + NAD ⟶ DGA + H+ + NADH - Fructose catabolism:
GA + H2O + NAD ⟶ DGA + H+ + NADH - Fructose catabolism:
GA + H2O + NAD ⟶ DGA + H+ + NADH - Fructose catabolism:
GA + H2O + NAD ⟶ DGA + H+ + NADH - Fructose catabolism:
GA + H2O + NAD ⟶ DGA + H+ + NADH - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - GABA synthesis, release, reuptake and degradation:
H+ + L-Glu ⟶ GABA + carbon dioxide - Degradation of GABA:
H2O + NAD + SUCCSA ⟶ H+ + NADH + SUCCA - Neurotransmitter release cycle:
2OG + GABA ⟶ Glu + SUCCSA - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neurotransmitter release cycle:
2OG + GABA ⟶ Glu + SUCCSA - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neurotransmitter release cycle:
2OG + GABA ⟶ Glu + SUCCSA - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neurotransmitter release cycle:
2OG + GABA ⟶ Glu + SUCCSA - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neurotransmitter release cycle:
Ac-CoA + Cho ⟶ AcCho + CoA-SH - GABA synthesis, release, reuptake and degradation:
H+ + L-Glu ⟶ GABA + carbon dioxide - Degradation of GABA:
H2O + NAD + SUCCSA ⟶ H+ + NADH + SUCCA - Neurotransmitter release cycle:
Ac-CoA + Cho ⟶ AcCho + CoA-SH - GABA synthesis, release, reuptake and degradation:
H+ + L-Glu ⟶ GABA + carbon dioxide - Degradation of GABA:
H2O + NAD + SUCCSA ⟶ H+ + NADH + SUCCA - The activation of arylsulfatases:
NAD ⟶ H2S + NADH - Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide - Sphingolipid catabolism:
H2O + Plant-Ceramides-II ⟶ RCOO- + phytosphingosine - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Biosynthesis of specialized proresolving mediators (SPMs):
DHA + Oxygen ⟶ 17-HDHA - Biosynthesis of DHA-derived SPMs:
17(S)-Hp-DHA + TPN ⟶ 16S,17S-epoxy-DHA + TPNH - Biosynthesis of D-series resolvins:
7(S)-Hp-17(S)-HDHA + TPN ⟶ 7S(8)-epoxy-17(S)-HDHA + TPNH - Biosynthesis of specialized proresolving mediators (SPMs):
DHA + Oxygen ⟶ 17-HDHA - Biosynthesis of DHA-derived SPMs:
17(S)-Hp-DHA + TPN ⟶ 16S,17S-epoxy-DHA + TPNH - Biosynthesis of D-series resolvins:
7(S)-Hp-17(S)-HDHA + TPN ⟶ 7S(8)-epoxy-17(S)-HDHA + TPNH - Biosynthesis of specialized proresolving mediators (SPMs):
DHA + Oxygen ⟶ 17-HDHA - Biosynthesis of DHA-derived SPMs:
17(S)-Hp-DHA + TPN ⟶ 16S,17S-epoxy-DHA + TPNH - Biosynthesis of D-series resolvins:
7(S)-Hp-17(S)-HDHA + TPN ⟶ 7S(8)-epoxy-17(S)-HDHA + TPNH - Biosynthesis of specialized proresolving mediators (SPMs):
NAD + lipoxin A4 ⟶ 15k-LXA4 + H+ + NADH - Biosynthesis of DHA-derived SPMs:
NAD + resolvin D1 ⟶ 17(S)-oxo-RvD1, 8-oxo-17(S)-RvD1 + NADH - Biosynthesis of D-series resolvins:
NAD + resolvin D1 ⟶ 17(S)-oxo-RvD1, 8-oxo-17(S)-RvD1 + NADH - Biosynthesis of specialized proresolving mediators (SPMs):
18(R)-HpEPE + GSH ⟶ 18(R)-HEPE + GSSG + H2O - Biosynthesis of DHA-derived SPMs:
7(S)-Hp-17(S)-HDHA + TPN ⟶ 7S(8)-epoxy-17(S)-HDHA + TPNH - Biosynthesis of D-series resolvins:
7(S)-Hp-17(S)-HDHA + TPN ⟶ 7S(8)-epoxy-17(S)-HDHA + TPNH - Biosynthesis of specialized proresolving mediators (SPMs):
DHA + Oxygen ⟶ 17-HDHA - Biosynthesis of DHA-derived SPMs:
17(S)-Hp-DHA + TPN ⟶ 16S,17S-epoxy-DHA + TPNH - Biosynthesis of D-series resolvins:
7(S)-Hp-17(S)-HDHA + TPN ⟶ 7S(8)-epoxy-17(S)-HDHA + TPNH - Biosynthesis of specialized proresolving mediators (SPMs):
DHA + Oxygen ⟶ 17-HDHA - Biosynthesis of DHA-derived SPMs:
17(S)-Hp-DHA + TPN ⟶ 16S,17S-epoxy-DHA + TPNH - Biosynthesis of D-series resolvins:
7(S)-Hp-17(S)-HDHA + TPN ⟶ 7S(8)-epoxy-17(S)-HDHA + TPNH - Biosynthesis of specialized proresolving mediators (SPMs):
DHA + Oxygen ⟶ 17-HDHA - Biosynthesis of DHA-derived SPMs:
17(S)-Hp-DHA + TPN ⟶ 16S,17S-epoxy-DHA + TPNH - Biosynthesis of D-series resolvins:
7(S)-Hp-17(S)-HDHA + TPN ⟶ 7S(8)-epoxy-17(S)-HDHA + TPNH - Biosynthesis of specialized proresolving mediators (SPMs):
DHA + Oxygen ⟶ 17-HDHA - Biosynthesis of DHA-derived SPMs:
17(S)-Hp-DHA + TPN ⟶ 16S,17S-epoxy-DHA + TPNH - Biosynthesis of D-series resolvins:
7(S)-Hp-17(S)-HDHA + TPN ⟶ 7S(8)-epoxy-17(S)-HDHA + TPNH - Biosynthesis of specialized proresolving mediators (SPMs):
DHA + Oxygen ⟶ 17-HDHA - Biosynthesis of DHA-derived SPMs:
7(S)-Hp-17(S)-HDHA + TPN ⟶ 7S(8)-epoxy-17(S)-HDHA + TPNH - Biosynthesis of D-series resolvins:
7(S)-Hp-17(S)-HDHA + TPN ⟶ 7S(8)-epoxy-17(S)-HDHA + TPNH - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Alpha-oxidation of phytanate:
ATP + CoA-SH + Phytanate ⟶ AMP + PPi + Phytanoyl-CoA - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Fatty acid metabolism:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine - Peroxisomal lipid metabolism:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Peroxisomal lipid metabolism:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Synthesis of Lipoxins (LX):
NAD + lipoxin A4 ⟶ 15k-LXA4 + H+ + NADH - Synthesis of Lipoxins (LX):
NAD + lipoxin A4 ⟶ 15k-LXA4 + H+ + NADH - Synthesis of Lipoxins (LX):
NAD + lipoxin A4 ⟶ 15k-LXA4 + H+ + NADH - Synthesis of Lipoxins (LX):
NAD + lipoxin A4 ⟶ 15k-LXA4 + H+ + NADH - Synthesis of Lipoxins (LX):
NAD + lipoxin A4 ⟶ 15k-LXA4 + H+ + NADH - Synthesis of Lipoxins (LX):
NAD + lipoxin A4 ⟶ 15k-LXA4 + H+ + NADH - Synthesis of Lipoxins (LX):
NAD + lipoxin A4 ⟶ 15k-LXA4 + H+ + NADH - Synthesis of Lipoxins (LX):
NAD + lipoxin A4 ⟶ 15k-LXA4 + H+ + NADH - Synthesis of Lipoxins (LX):
NAD + lipoxin A4 ⟶ 15k-LXA4 + H+ + NADH - Synthesis of Lipoxins (LX):
NAD + lipoxin A4 ⟶ 15k-LXA4 + H+ + NADH
BioCyc(1328)
- toluene degradation to 4-methylphenol:
H+ + NADH + O2 + toluene ⟶ 4-methylphenol + H2O + NAD+ - toluene degradation III (aerobic) (via p-cresol):
4-methylphenol + H2O + an oxidized azurin ⟶ 4-hydroxybenzyl alcohol + H+ + a reduced azurin - toluene degradation to 2-hydroxypentadienoate (via 4-methylcatechol):
H+ + NADH + O2 + toluene ⟶ 4-methylphenol + H2O + NAD+ - toluene degradation II (aerobic) (via 4-methylcatechol):
H+ + NADH + O2 + toluene ⟶ 4-methylphenol + H2O + NAD+ - superpathway of aerobic toluene degradation:
4-methylphenol + H2O + an oxidized azurin ⟶ 4-hydroxybenzyl alcohol + H+ + a reduced azurin - propane degradation I:
NAD+ + propan-2-ol ⟶ H+ + NADH + acetone - propane degradation II:
NAD+ + propan-2-ol ⟶ H+ + NADH + acetone - nicotine degradation I (pyridine pathway):
2,6-dihydroxypyridine + H+ + NADH + O2 ⟶ 2,3,6-trihydroxypyridine + H2O + NAD+ - (R,R)-butanediol degradation:
(R,R)-2,3-butanediol + NAD+ ⟶ (R)-acetoin + H+ + NADH - pyruvate fermentation to (R)-acetoin I:
(R)-acetoin + NAD+ ⟶ H+ + NADH + diacetyl - meso-butanediol biosynthesis I:
(R,S)-2,3-butanediol + NAD+ ⟶ (R)-acetoin + H+ + NADH - superpathway of (R,R)-butanediol biosynthesis:
(S)-2-acetolactate + H+ ⟶ (R)-acetoin + CO2 - (R,R)-butanediol biosynthesis:
(R,R)-2,3-butanediol + NAD+ ⟶ (R)-acetoin + H+ + NADH - superpathway of 2,3-butanediol biosynthesis:
(S)-2-acetolactate + H+ ⟶ (R)-acetoin + CO2 - (R)-acetoin biosynthesis I:
H+ + pyruvate ⟶ (S)-2-acetolactate + CO2 - (R,R)-butanediol biosynthesis:
(R,R)-2,3-butanediol + NAD+ ⟶ (R)-acetoin + H+ + NADH - superpathway of acetoin and butanediol biosynthesis:
H+ + acetaldehyde + pyruvate ⟶ CO2 + acetoin - butanediol biosynthesis:
(R,R)-2,3-butanediol + NAD+ ⟶ (R)-acetoin + H+ + NADH - (R,R)-butanediol degradation:
(R,R)-2,3-butanediol + NAD+ ⟶ (R)-acetoin + H+ + NADH - (R,R)-butanediol biosynthesis:
(R,R)-2,3-butanediol + NAD+ ⟶ (R)-acetoin + H+ + NADH - (R,R)-butanediol degradation:
(R,R)-2,3-butanediol + NAD+ ⟶ (R)-acetoin + H+ + NADH - (R)-acetoin biosynthesis I:
H+ + pyruvate ⟶ (S)-2-acetolactate + CO2 - (R)-acetoin biosynthesis I:
H+ + pyruvate ⟶ (S)-2-acetolactate + CO2 - pyruvate fermentation to (R)-acetoin I:
(R)-acetoin + NAD+ ⟶ H+ + NADH + diacetyl - (R,R)-butanediol degradation:
(R,R)-2,3-butanediol + NAD+ ⟶ (R)-acetoin + H+ + NADH - superpathway of (R,R)-butanediol biosynthesis:
H+ + pyruvate ⟶ (S)-2-acetolactate + CO2 - (R,R)-butanediol biosynthesis:
(R,R)-2,3-butanediol + NAD+ ⟶ (R)-acetoin + H+ + NADH - pyruvate fermentation to (R)-acetoin I:
H+ + pyruvate ⟶ (S)-2-acetolactate + CO2 - (R)-acetoin biosynthesis I:
H+ + pyruvate ⟶ (S)-2-acetolactate + CO2 - (R)-acetoin biosynthesis I:
H+ + pyruvate ⟶ (S)-2-acetolactate + CO2 - D-carnitine degradation I:
D-carnitine + NAD+ ⟶ 3-dehydrocarnitine + H+ + NADH - ethene and chloroethene degradation:
H+ + NADH + O2 + ethene ⟶ H2O + NAD+ + ethylene oxide - 1,2,4-trichlorobenzene degradation:
1,2,4-trichlorobenzene + H+ + NADH + O2 ⟶ (1R,2S)-3,4,6-trichlorocyclohexa-3,5-diene-1,2-diol + NAD+ - dibenzo-p-dioxin degradation:
H+ + NADH + O2 + dibenzo-p-dioxin ⟶ 4,4a-dihydroxy-dihydro-dibenzo-p-dioxin + NAD+ - (4S)-carveol and (4S)-dihydrocarveol degradation:
(4S,6S)-cis-carveol + oxidized DCPIP ⟶ (+)-carvone + H+ + reduced DCPIP - plant sterol biosynthesis:
4α-hydroxymethyl-ergosta-7,24(241)-dien-3β-ol + H+ + NADH + O2 ⟶ 4α-formyl-ergosta-7,24(241)-dien-3β-ol + H2O + NAD+ - justicidin B biosynthesis:
NAD+ + collinusin ⟶ H+ + NADH + justicidin B - nitrobenzene degradation II:
NADH + O2 + nitrobenzene ⟶ NAD+ + catechol + nitrite - superpathway of aromatic compound degradation via 2-hydroxypentadienoate:
O2 + catechol ⟶ H+ + HMS - diphenylamine degradation:
H+ + NADH + O2 + diphenylamine ⟶ NAD+ + aniline + catechol - superpathway of aromatic compound degradation via 3-oxoadipate:
O2 + catechol ⟶ H+ + HMS - superpathway of salicylate degradation:
O2 + catechol ⟶ H+ + cis,cis-muconate - naphthalene degradation to acetyl-CoA:
O2 + catechol ⟶ H+ + HMS - benzene degradation:
(1R,2S)-cyclohexa-3,5-diene-1,2-diol + NAD+ ⟶ H+ + NADH + catechol - salicylate degradation I:
H+ + NADH + O2 + salicylate ⟶ CO2 + H2O + NAD+ + catechol - benzoate degradation I (aerobic):
3,5-cyclohexadiene-1,2-diol-1-carboxylate + NAD+ ⟶ CO2 + NADH + catechol - meta cleavage pathway of aromatic compounds:
O2 + catechol ⟶ H+ + HMS - toluene degradation IV (aerobic) (via catechol):
O2 + catechol ⟶ H+ + HMS - mandelate degradation to acetyl-CoA:
O2 + catechol ⟶ H+ + HMS - 2-chlorobenzoate degradation:
2-chlorobenzoate + H+ + NADH + O2 ⟶ CO2 + NAD+ + catechol + chloride - benzenesulfonate degradation:
NADH + O2 + benzenesulfonate ⟶ NAD+ + catechol + sulfite - nitrobenzene degradation II:
NADH + O2 + nitrobenzene ⟶ NAD+ + catechol + nitrite - salicylate degradation I:
H+ + NADH + O2 + salicylate ⟶ CO2 + H2O + NAD+ + catechol - salicylate degradation I:
H+ + NADH + O2 + salicylate ⟶ CO2 + H2O + NAD+ + catechol - superpathway of aromatic compound degradation via 3-oxoadipate:
O2 + trp ⟶ N-formylkynurenine - benzoate degradation I (aerobic):
3,5-cyclohexadiene-1,2-diol-1-carboxylate + NAD+ ⟶ CO2 + NADH + catechol - salicylate degradation I:
H+ + NADH + O2 + salicylate ⟶ CO2 + H2O + NAD+ + catechol - superpathway of aromatic compound degradation:
O2 + protocatechuate ⟶ 3-carboxy-cis,cis-muconate + H+ - benzoate degradation I (aerobic):
3,5-cyclohexadiene-1,2-diol-1-carboxylate + NAD+ ⟶ CO2 + NADH + catechol - bisphenol A degradation:
NAD+ + S-1-(4-hydroxyphenyl)-ethanol ⟶ 4-hydroxyacetophenone + H+ + NADH - mannitol cycle:
D-mannitol + NAD+ ⟶ keto-D-fructose + H+ + NADH - mannitol degradation II:
D-mannitol + NAD+ ⟶ aldehydo-D-mannose + H+ + NADH - matairesinol biosynthesis:
(-)-secoisolariciresinol + NAD+ ⟶ (3R,4R)-3,4-bis(4-hydroxy-3-methoxybenzyl)tetrahydro-2-furanol + H+ + NADH - matairesinol biosynthesis:
(+)-lariciresinol + H+ + NADPH ⟶ (-)-secoisolariciresinol + NADP+ - superpathway of Clostridium acetobutylicum acidogenic and solventogenic fermentation:
H+ + acetoacetate ⟶ CO2 + acetone - superpathway of Clostridium acetobutylicum solventogenic fermentation:
H+ + acetoacetate ⟶ CO2 + acetone - butanol and isobutanol biosynthesis (engineered):
NAD+ + butan-1-ol ⟶ H+ + NADH + butan-1-al - glycerol degradation to butanol:
NAD+ + butan-1-ol ⟶ H+ + NADH + butan-1-al - pyruvate fermentation to butanol II (engineered):
NAD+ + butan-1-ol ⟶ H+ + NADH + butan-1-al - 1-butanol autotrophic biosynthesis (engineered):
NAD+ + butan-1-ol ⟶ H+ + NADH + butan-1-al - pyruvate fermentation to butanol I:
NAD+ + butan-1-ol ⟶ H+ + NADH + butan-1-al - butane degradation:
NADH + O2 + butan-1-al ⟶ H2O + NAD+ + butanoate - isoprene degradation:
2-(glutathion-S-yl)-2-methylbut-3-en-1-ol + NAD+ ⟶ 2-(glutathion-S-yl)-2-methylbut-3-enal + H+ + NADH - dimethyl sulfoxide degradation:
H+ + NADH + dimethyl sulfoxide ⟶ H2O + NAD+ + dimethyl sulfide - superpathway of dimethylsulfone degradation:
H+ + NADH + O2 + dimethyl sulfide ⟶ H2O + NAD+ + formaldehyde + methanethiol - dimethyl sulfide degradation I:
H+ + NADH + O2 + dimethyl sulfide ⟶ H2O + NAD+ + formaldehyde + methanethiol - dimethyl sulfoxide degradation:
H+ + NADH + dimethyl sulfoxide ⟶ H2O + NAD+ + dimethyl sulfide - dimethyl sulfoxide degradation:
H+ + NADH + dimethyl sulfoxide ⟶ H2O + NAD+ + dimethyl sulfide - myo-inositol degradation II:
3-dehydro scyllo-inosose + H2O ⟶ 5-dehydro-L-gluconate + H+ - 1,4-dichlorobenzene degradation:
1,4-dichlorobenzene + H+ + NADH + O2 ⟶ (1R,2S)-3,6-dichlorocyclohexa-3,5-diene-1,2-diol + NAD+ - 2-propylphenol degradation:
2-propylphenol + H+ + NADH + O2 ⟶ 3-propylcatechol + H2O + NAD+ - pyruvate fermentation to isobutanol (engineered):
NAD+ + isobutanol ⟶ H+ + NADH + isobutanal - L-valine degradation II:
NAD+ + isobutanol ⟶ H+ + NADH + isobutanal - valine degradation:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - L-valine degradation II:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glt - valine degradation II:
3-methyl-2-oxobutanoate + H+ ⟶ CO2 + isobutanal - valine degradation II:
2-oxoisovalerate + H+ ⟶ CO2 + isobutanal - valine degradation II:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glt - L-valine degradation II:
3-methyl-2-oxobutanoate + H+ ⟶ CO2 + isobutanal - valine degradation II:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glt - L-valine degradation II:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glt - superpathway of lipoxygenase:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(Z)-hex-3-en-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - zeaxanthin biosynthesis:
all-trans-β-carotene + H+ + NADH + O2 ⟶ β-cryptoxanthin + H2O + NAD+ - zeaxanthin biosynthesis:
all-trans-β-carotene + H+ + NADH + O2 ⟶ β-cryptoxanthin + H2O + NAD+ - superpathway of carotenoid biosynthesis:
all-trans-β-carotene + H+ + NADH + O2 ⟶ β-cryptoxanthin + H2O + NAD+ - zeaxanthin biosynthesis:
all-trans-β-carotene + H+ + NADH + O2 ⟶ β-cryptoxanthin + H2O + NAD+ - pyruvate fermentation to hexanol (engineered):
1-hexanol + NAD+ ⟶ 1-hexanal + H+ + NADH - 10-cis-heptadecenoyl-CoA degradation (yeast):
(3R)-hydroxy, 6-cis-tridecenoyl-CoA + NAD+ ⟶ 6-cis, 3-oxo-tridecenoyl-CoA + H+ + NADH - 10-cis-heptadecenoyl-CoA degradation:
3-hydroxy-heptanoyl-CoA + H2O + NAD+ + O2 + coenzyme A ⟶ 3-hydroxypentanoyl-CoA + H+ + NADH + acetyl-CoA + hydrogen peroxide - NAD/NADP-NADH/NADPH mitochondrial interconversion:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration (cytochrome c):
succinate + ubiquinone-6 ⟶ fumarate + ubiquinol - aerobic respiration (linear view):
succinate + ubiquinone-6 ⟶ fumarate + ubiquinol - phytol degradation:
H+ + NADPH + phytenoyl-CoA ⟶ NADP+ + phytanoyl-CoA - phytol degradation:
NAD+ + phytol ⟶ H+ + NADH + phytenal - p-cymene degradation to p-cumate:
p-cymene + H+ + NADH + O2 ⟶ p-cumic alcohol + H2O + NAD+ - glycerol degradation V:
NAD+ + glycerol ⟶ H+ + NADH + dihydroxyacetone - glycerol degradation II:
ATP + dihydroxyacetone ⟶ ADP + DHAP + H+ - superpathway of glycerol degradation to 1,3-propanediol:
ATP + dihydroxyacetone ⟶ ADP + DHAP + H+ - glycerol degradation V:
NAD+ + glycerol ⟶ H+ + NADH + dihydroxyacetone - glycerol degradation V:
NAD+ + glycerol ⟶ H+ + NADH + dihydroxyacetone - glycerol degradation to butanol:
NAD+ + glycerol ⟶ H+ + NADH + dihydroxyacetone - glycerol degradation II:
NAD+ + glycerol ⟶ H+ + NADH + dihydroxyacetone - glycerol degradation V:
NAD+ + glycerol ⟶ H+ + NADH + dihydroxyacetone - glycerol degradation V:
NAD+ + glycerol ⟶ H+ + NADH + dihydroxyacetone - glycerol degradation V:
NAD+ + glycerol ⟶ H+ + NADH + dihydroxyacetone - glycerol degradation V:
NAD+ + glycerol ⟶ H+ + NADH + dihydroxyacetone - glycerol degradation V:
NAD+ + glycerol ⟶ H+ + NADH + dihydroxyacetone - glycerol degradation V:
NAD+ + glycerol ⟶ H+ + NADH + dihydroxyacetone - glycerol degradation to butanol:
NAD+ + glycerol ⟶ H+ + NADH + dihydroxyacetone - glycerol degradation II:
NAD+ + glycerol ⟶ H+ + NADH + dihydroxyacetone - glycerol degradation V:
NAD+ + glycerol ⟶ H+ + NADH + dihydroxyacetone - glycerol degradation to butanol:
NAD+ + glycerol ⟶ H+ + NADH + dihydroxyacetone - glycerol degradation II:
NAD+ + glycerol ⟶ H+ + NADH + dihydroxyacetone - glycerol degradation V:
NAD+ + glycerol ⟶ H+ + NADH + dihydroxyacetone - L-methionine degradation III:
NAD+ + methionol ⟶ 3-(methylsulfanyl)propanal + H+ + NADH - L-methionine degradation III:
4-(methylsulfanyl)-2-oxobutanoate + H+ ⟶ 3-methylthiopropanal + CO2 - methionine degradation III:
keto-phenylpyruvate + met ⟶ 2-oxo-4-methylthiobutanoate + phe - methanol oxidation to carbon dioxide:
MeOH + NAD+ ⟶ H+ + NADH + formaldehyde - methanol oxidation to formaldehyde II:
MeOH + NAD+ ⟶ H+ + NADH + formaldehyde - methanol oxidation to formaldehyde II:
NAD+ + methanol ⟶ H+ + NADH + formaldehyde - methanol oxidation to carbon dioxide:
H2O + NAD+ + formaldehyde ⟶ H+ + NADH + formate - methanol oxidation to formaldehyde II:
NAD+ + methanol ⟶ H+ + NADH + formaldehyde - urate conversion to allantoin II:
(S)-5-hydroxyisourate + H2O ⟶ (S)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline + H+ - 1,2-dichlorobenzene degradation:
1,2-dichlorobenzene + H+ + NADH + O2 ⟶ (1R,2S)-3,4-dichlorocyclohexa-3,5-diene-1,2-diol + NAD+ - (4S)-carvone biosynthesis:
(+)-trans-carveol + NAD+ ⟶ (+)-carvone + H+ + NADH - menaquinol-4 biosynthesis II:
H+ + NADH + menadione ⟶ NAD+ + menadiol - menaquinol-4 biosynthesis II:
H2O + phylloquinone ⟶ menadione + phytol - cyclohexanol degradation:
H+ + NADPH + O2 + cyclohexanone ⟶ ε-caprolactone + H2O + NADP+ - methyl tert-butyl ether degradation:
H+ + NADH + O2 + methyl tert-butyl ether ⟶ tert-butoxymethanol + H2O + NAD+ - superpathway of cholesterol degradation II (cholesterol dehydrogenase):
NAD+ + coenzyme A + propanal ⟶ H+ + NADH + propanoyl-CoA - superpathway of testosterone and androsterone degradation:
NAD+ + coenzyme A + propanal ⟶ H+ + NADH + propanoyl-CoA - androstenedione degradation:
NAD+ + coenzyme A + propanal ⟶ H+ + NADH + propanoyl-CoA - superpathway of microbial D-galacturonate and D-glucuronate degradation:
aldehydo-D-glucuronate ⟶ D-fructuronate - superpathway of β-D-glucuronosides degradation:
aldehydo-D-glucuronate ⟶ D-fructuronate - D-fructuronate degradation:
D-mannonate + NAD+ ⟶ D-fructuronate + H+ + NADH - L-gulonate degradation:
L-gulonate + NAD+ ⟶ D-fructuronate + H+ + NADH - superpathway of hexuronide and hexuronate degradation:
aldehydo-D-glucuronate ⟶ D-fructuronate - D-fructuronate degradation:
KDGP ⟶ D-glyceraldehyde 3-phosphate + pyruvate - superpathway of β-D-glucuronosides degradation:
H2O + a β-D-glucuronoside ⟶ D-glucopyranuronate + an alcohol - superpathway of hexuronide and hexuronate degradation:
H2O + a β-D-glucuronoside ⟶ D-glucopyranuronate + an alcohol - superpathway of β-D-glucuronide and D-glucuronate degradation:
D-glucopyranuronate ⟶ aldehydo-D-glucuronate - D-fructuronate degradation:
KDGP ⟶ D-glyceraldehyde 3-phosphate + pyruvate - superpathway of hexuronide and hexuronate degradation:
D-glucopyranuronate ⟶ aldehydo-D-glucuronate - superpathway of β-D-glucuronide and D-glucuronate degradation:
H2O + a β-D-glucuronoside ⟶ D-glucopyranuronate + an alcohol - D-fructuronate degradation:
KDGP ⟶ D-glyceraldehyde 3-phosphate + pyruvate - superpathway of hexuronide and hexuronate degradation:
H2O + a β-D-glucuronoside ⟶ D-glucopyranuronate + an alcohol - superpathway of hexuronide and hexuronate degradation:
D-glucopyranuronate ⟶ aldehydo-D-glucuronate - superpathway of β-D-glucuronide and D-glucuronate degradation:
D-glucopyranuronate ⟶ aldehydo-D-glucuronate - D-fructuronate degradation:
KDGP ⟶ D-glyceraldehyde 3-phosphate + pyruvate - D-fructuronate degradation:
D-mannonate + NAD+ ⟶ D-fructuronate + H+ + NADH - superpathway of hexuronide and hexuronate degradation:
H2O + a β-D-glucuronoside ⟶ D-glucopyranuronate + an alcohol - superpathway of β-D-glucuronosides degradation:
H2O + a β-D-glucuronoside ⟶ D-glucopyranuronate + an alcohol - D-fructuronate degradation:
KDGP ⟶ D-glyceraldehyde 3-phosphate + pyruvate - superpathway of hexuronide and hexuronate degradation:
H2O + a β-D-glucuronoside ⟶ D-glucopyranuronate + an alcohol - superpathway of β-D-glucuronosides degradation:
H2O + a β-D-glucuronoside ⟶ D-glucopyranuronate + an alcohol - D-fructuronate degradation:
KDGP ⟶ D-glyceraldehyde 3-phosphate + pyruvate - superpathway of β-D-glucuronide and D-glucuronate degradation:
H2O + a β-D-glucuronoside ⟶ D-glucopyranuronate + an alcohol - D-fructuronate degradation:
KDGP ⟶ D-glyceraldehyde 3-phosphate + pyruvate - superpathway of hexuronide and hexuronate degradation:
H2O + a β-D-glucuronoside ⟶ D-glucopyranuronate + an alcohol - superpathway of hexuronide and hexuronate degradation:
D-glucopyranuronate ⟶ aldehydo-D-glucuronate - superpathway of β-D-glucuronide and D-glucuronate degradation:
D-glucopyranuronate ⟶ aldehydo-D-glucuronate - D-fructuronate degradation:
KDGP ⟶ D-glyceraldehyde 3-phosphate + pyruvate - superpathway of hexuronide and hexuronate degradation:
D-mannonate + NAD+ ⟶ D-fructuronate + H+ + NADH - β-D-glucuronide and D-glucuronate degradation:
D-mannonate + NAD+ ⟶ D-fructuronate + H+ + NADH - D-fructuronate degradation:
KDGP ⟶ D-glyceraldehyde 3-phosphate + pyruvate - D-fructuronate degradation:
KDGP ⟶ D-glyceraldehyde 3-phosphate + pyruvate - superpathway of β-D-glucuronide and D-glucuronate degradation:
D-glucopyranuronate ⟶ aldehydo-D-glucuronate - D-fructuronate degradation:
KDGP ⟶ D-glyceraldehyde 3-phosphate + pyruvate - superpathway of β-D-glucuronide and D-glucuronate degradation:
H2O + a β-D-glucuronoside ⟶ D-glucopyranuronate + an alcohol - superpathway of β-D-glucuronide and D-glucuronate degradation:
D-glucopyranuronate ⟶ aldehydo-D-glucuronate - superpathway of hexuronide and hexuronate degradation:
D-glucopyranuronate ⟶ aldehydo-D-glucuronate - D-fructuronate degradation:
KDGP ⟶ D-glyceraldehyde 3-phosphate + pyruvate - superpathway of β-D-glucuronide and D-glucuronate degradation:
H2O + a β-D-glucuronoside ⟶ D-glucopyranuronate + an alcohol - D-fructuronate degradation:
KDGP ⟶ D-glyceraldehyde 3-phosphate + pyruvate - superpathway of hexuronide and hexuronate degradation:
H2O + a β-D-glucuronoside ⟶ D-glucopyranuronate + an alcohol - superpathway of choline degradation to L-serine:
A + choline ⟶ A(H2) + betaine aldehyde - choline degradation:
A + choline ⟶ A(H2) + betaine aldehyde - choline degradation IV:
betaine aldehyde hydrate ⟶ H2O + betaine aldehyde - choline-O-sulfate degradation:
A + choline ⟶ A(H2) + betaine aldehyde - choline degradation I:
A + choline ⟶ A(H2) + betaine aldehyde - glycine betaine biosynthesis III (plants):
H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster + choline ⟶ H2O + an oxidized ferredoxin [iron-sulfur] cluster + betaine aldehyde hydrate - glycine betaine biosynthesis II (Gram-positive bacteria):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis I (Gram-negative bacteria):
A + choline ⟶ A(H2) + betaine aldehyde - glycine betaine biosynthesis I (Gram-negative bacteria):
A + choline ⟶ A(H2) + betaine aldehyde - glycine betaine biosynthesis III (plants):
H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster + choline ⟶ H2O + an oxidized ferredoxin [iron-sulfur] cluster + betaine aldehyde hydrate - glycine betaine biosynthesis I (Gram-negative bacteria):
A + choline ⟶ A(H2) + betaine aldehyde - choline degradation I:
A + choline ⟶ A(H2) + betaine aldehyde - glycine betaine biosynthesis I (Gram-negative bacteria):
A + choline ⟶ A(H2) + betaine aldehyde - choline degradation I:
A + choline ⟶ A(H2) + betaine aldehyde - glycine betaine biosynthesis II (Gram-positive bacteria):
NAD+ + choline ⟶ H+ + NADH + betaine aldehyde - glycine betaine biosynthesis I (Gram-negative bacteria):
A + choline ⟶ A(H2) + betaine aldehyde - choline degradation I:
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - choline-O-sulfate degradation:
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis I (Gram-negative bacteria):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis I (Gram-negative bacteria):
A + choline ⟶ A(H2) + betaine aldehyde - choline degradation I:
A + choline ⟶ A(H2) + betaine aldehyde - choline degradation I:
A + choline ⟶ A(H2) + betaine aldehyde - glycine betaine biosynthesis II (Gram-positive bacteria):
NAD+ + choline ⟶ H+ + NADH + betaine aldehyde - glycine betaine biosynthesis III (plants):
H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster + choline ⟶ H2O + an oxidized ferredoxin [iron-sulfur] cluster + betaine aldehyde hydrate - glycine betaine biosynthesis I (Gram-negative bacteria):
A + choline ⟶ A(H2) + betaine aldehyde - glycine betaine biosynthesis II (Gram-positive bacteria):
NAD+ + choline ⟶ H+ + NADH + betaine aldehyde - glycine betaine biosynthesis I (Gram-negative bacteria):
A + choline ⟶ A(H2) + betaine aldehyde - glycine betaine biosynthesis I (Gram-negative bacteria):
A + choline ⟶ A(H2) + betaine aldehyde - glycine betaine biosynthesis II (Gram-positive bacteria):
NAD+ + choline ⟶ H+ + NADH + betaine aldehyde - glycine betaine biosynthesis I (Gram-negative bacteria):
A + choline ⟶ A(H2) + betaine aldehyde - glycine betaine biosynthesis II (Gram-positive bacteria):
NAD+ + choline ⟶ H+ + NADH + betaine aldehyde - choline degradation I:
A + choline ⟶ A(H2) + betaine aldehyde - glycine betaine biosynthesis II (Gram-positive bacteria):
NAD+ + choline ⟶ H+ + NADH + betaine aldehyde - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - pentachlorophenol degradation:
2,3,5,6-tetrachlorohydroquinone + H+ + NAD+ ⟶ 2,3,5,6-tetrachloro-1,4-benzoquinone + NADH - (4R)-carveol and (4R)-dihydrocarveol degradation:
(-)-cis-carveol + oxidized DCPIP ⟶ (-)-carvone + H+ + reduced DCPIP - (S,S)-butanediol degradation:
(S,S)-2,3-butanediol + NAD+ ⟶ (S)-acetoin + H+ + NADH - pyruvate fermentation to (S)-acetoin:
(S)-acetoin + NAD+ ⟶ H+ + NADH + diacetyl - (S,S)-butanediol biosynthesis:
(S,S)-2,3-butanediol + NAD+ ⟶ (S)-acetoin + H+ + NADH - meso-butanediol biosynthesis II:
(R,S)-2,3-butanediol + NAD+ ⟶ (S)-acetoin + H+ + NADH - meso-butanediol biosynthesis II:
(R,S)-2,3-butanediol + NAD+ ⟶ (S)-acetoin + H+ + NADH - (S,S)-butanediol degradation:
(S,S)-2,3-butanediol + NAD+ ⟶ (S)-acetoin + H+ + NADH - (S)-acetoin biosynthesis:
H+ + pyruvate ⟶ (S)-2-acetolactate + CO2 - (S,S)-butanediol degradation:
(S,S)-2,3-butanediol + NAD+ ⟶ (S)-acetoin + H+ + NADH - (S,S)-butanediol biosynthesis:
(S,S)-2,3-butanediol + NAD+ ⟶ (S)-acetoin + H+ + NADH - (S)-acetoin biosynthesis:
H+ + pyruvate ⟶ (S)-2-acetolactate + CO2 - (S,S)-butanediol biosynthesis:
(S,S)-2,3-butanediol + NAD+ ⟶ (S)-acetoin + H+ + NADH - (S,S)-butanediol degradation:
(S,S)-2,3-butanediol + NAD+ ⟶ (S)-acetoin + H+ + NADH - L-isoleucine degradation II:
2-methylbutanol + NAD+ ⟶ 2-methylbutanal + H+ + NADH - isoleucine degradation:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - isoleucine degradation II:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - isoleucine degradation II:
2-oxoglutarate + ile ⟶ 2-keto-3-methyl-valerate + glt - juvenile hormone III biosynthesis I:
(2E,6E)-farnesol + NADP+ ⟶ (2E,6E)-farnesal + H+ + NADPH - juvenile hormone III biosynthesis II:
(2E,6E)-farnesol + NADP+ ⟶ (2E,6E)-farnesal + H+ + NADPH - juvenile hormone III biosynthesis I:
(2E,6E)-farnesol + NADP+ ⟶ (2E,6E)-farnesal + H+ + NADPH - juvenile hormone III biosynthesis II:
(2E,6E)-farnesol + NADP+ ⟶ (2E,6E)-farnesal + H+ + NADPH - D-arabitol degradation:
D-arabinitol + NAD+ ⟶ D-xylulose + H+ + NADH - superpathway of pentose and pentitol degradation:
H2O + L-arabinono-1,4-lactone ⟶ H+ + L-arabinonate - D-arabitol degradation:
D-arabitol + NAD+ ⟶ D-xylulose + H+ + NADH - androgen biosynthesis:
17-α-hydroxypregnenolone + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-β-hydroxyandrost-5-en-17-one + H+ + H2O + acetate + an oxidized [NADPH-hemoprotein reductase] - androgen biosynthesis:
NADP+ + testosterone ⟶ H+ + NADPH + androst-4-ene-3,17-dione - 3-methylquinoline degradation:
3-methylquinoline + A + H2O ⟶ 3-methyl-2-oxo-1,2-dihydroquinoline + A(H2) - chlorobenzene degradation:
H+ + NADH + O2 + chlorobenzene ⟶ (1R,2R)-3-chlorocyclohexa-3,5-diene-1,2-diol + NAD+ - 2-methylpropene degradation:
2-methylpropane-1,2-diol + NAD+ ⟶ 2-hydroxy-2-methylpropanal + H+ + NADH - naphthalene degradation (aerobic):
H2O + trans-O-hydroxybenzylidenepyruvate ⟶ pyruvate + salicylaldehyde - naphthalene degradation (aerobic):
H2O + NAD+ + salicylaldehyde ⟶ H+ + NADH + salicylate - naphthalene degradation (aerobic):
H2O + trans-O-hydroxybenzylidenepyruvate ⟶ pyruvate + salicylaldehyde - staphyloxanthin biosynthesis:
all-trans-4,4'-diapo-ζ-carotene + FAD + H+ ⟶ all-trans-4,4'-diaponeurosporene + FADH2 - staphyloxanthin biosynthesis:
4,4'-diaponeurosporenal + H2O + NAD+ ⟶ 4,4'-diaponeurosporenoate + H+ + NADH - D-malate degradation:
(R)-malate + NAD+ ⟶ CO2 + NADH + pyruvate - D-malate degradation:
(R)-malate + NAD+ ⟶ CO2 + NADH + pyruvate - fatty acid β-oxidation II (peroxisome):
NAD+ + a (3S)-3-hydroxyacyl-CoA ⟶ H+ + NADH + a 3-oxoacyl-CoA - fatty acid β-oxidation I:
NAD+ + a (3S)-3-hydroxyacyl-CoA ⟶ H+ + NADH + a 3-oxoacyl-CoA - fatty acid β-oxidation I:
NAD+ + a (3S)-3-hydroxyacyl-CoA ⟶ H+ + NADH + a 3-oxoacyl-CoA - fatty acid β-oxidation I:
NAD+ + a (3S)-3-hydroxyacyl-CoA ⟶ H+ + NADH + a 3-oxoacyl-CoA - fatty acid β-oxidation I:
NAD+ + a (3S)-3-hydroxyacyl-CoA ⟶ H+ + NADH + a 3-oxoacyl-CoA - fatty acid β-oxidation I:
NAD+ + a (3S)-3-hydroxyacyl-CoA ⟶ H+ + NADH + a 3-oxoacyl-CoA - fatty acid β-oxidation I:
NAD+ + a (3S)-3-hydroxyacyl-CoA ⟶ H+ + NADH + a 3-oxoacyl-CoA - fatty acid β-oxidation I:
NAD+ + a (3S)-3-hydroxyacyl-CoA ⟶ H+ + NADH + a 3-oxoacyl-CoA - fatty acid β-oxidation I:
NAD+ + a (3S)-3-hydroxyacyl-CoA ⟶ H+ + NADH + a 3-oxoacyl-CoA - fatty acid β-oxidation II (core pathway):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - fatty acid β-oxidation I:
NAD+ + a (3S)-3-hydroxyacyl-CoA ⟶ H+ + NADH + a 3-oxoacyl-CoA - fatty acid β-oxidation I:
NAD+ + a (3S)-3-hydroxyacyl-CoA ⟶ H+ + NADH + a 3-oxoacyl-CoA - fatty acid β-oxidation I:
NAD+ + a (3S)-3-hydroxyacyl-CoA ⟶ H+ + NADH + a 3-oxoacyl-CoA - methylglyoxal degradation III:
NADP+ + acetol ⟶ H+ + NADPH + methylglyoxal - acetone degradation III (to propane-1,2-diol):
NADP+ + propan-2-ol ⟶ H+ + NADPH + acetone - superpathway of methylglyoxal degradation:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + acetol - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + acetol - L-lactaldehyde degradation (anaerobic):
(S)-propane-1,2-diol + NAD+ ⟶ (S)-lactaldehyde + H+ + NADH - superpathway of fucose and rhamnose degradation:
ATP + L-fuculose ⟶ ADP + H+ + L-fuculose 1-phosphate - L-lactaldehyde degradation (anaerobic):
(S)-propane-1,2-diol + NAD+ ⟶ (S)-lactaldehyde + H+ + NADH - methylglyoxal degradation III:
NADP+ + acetol ⟶ H+ + NADPH + methylglyoxal - superpathway of fucose and rhamnose degradation:
α-L-fucopyranose ⟶ β-L-fucopyranose - superpathway of methylglyoxal degradation:
NADP+ + acetol ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + acetol - L-lactaldehyde degradation (anaerobic):
(S)-propane-1,2-diol + NAD+ ⟶ (S)-lactaldehyde + H+ + NADH - methylglyoxal degradation III:
NADP+ + acetol ⟶ H+ + NADPH + methylglyoxal - superpathway of fucose and rhamnose degradation:
α-L-fucopyranose ⟶ β-L-fucopyranose - L-lactaldehyde degradation (anaerobic):
(S)-propane-1,2-diol + NAD+ ⟶ H+ + L-lactaldehyde + NADH - methylglyoxal degradation III:
NADP+ + acetol ⟶ H+ + NADPH + methylglyoxal - superpathway of fucose and rhamnose degradation:
(S)-lactate + A ⟶ A(H2) + pyruvate - methylglyoxal degradation III:
NADP+ + acetol ⟶ H+ + NADPH + methylglyoxal - superpathway of fucose and rhamnose degradation:
(S)-lactate + A ⟶ A(H2) + pyruvate - L-lactaldehyde degradation (anaerobic):
(S)-propane-1,2-diol + NAD+ ⟶ H+ + L-lactaldehyde + NADH - L-lactaldehyde degradation (anaerobic):
(S)-propane-1,2-diol + NAD+ ⟶ (S)-lactaldehyde + H+ + NADH - superpathway of fucose and rhamnose degradation:
α-L-fucopyranose ⟶ L-fuculose - L-lactaldehyde degradation (anaerobic):
(S)-propane-1,2-diol + NAD+ ⟶ (S)-lactaldehyde + H+ + NADH - methylglyoxal degradation III:
NADP+ + acetol ⟶ H+ + NADPH + methylglyoxal - L-lactaldehyde degradation (anaerobic):
(S)-propane-1,2-diol + NAD+ ⟶ H+ + L-lactaldehyde + NADH - methylglyoxal degradation III:
NADP+ + acetol ⟶ H+ + NADPH + methylglyoxal - superpathway of methylglyoxal degradation:
NADP+ + acetol ⟶ H+ + NADPH + methylglyoxal - superpathway of fucose and rhamnose degradation:
α-L-fucopyranose ⟶ L-fuculose - L-lactaldehyde degradation (anaerobic):
(S)-propane-1,2-diol + NAD+ ⟶ H+ + L-lactaldehyde + NADH - superpathway of fucose and rhamnose degradation:
α-L-fucopyranose ⟶ L-fuculose - superpathway of methylglyoxal degradation:
NADP+ + acetol ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + acetol ⟶ H+ + NADPH + methylglyoxal - L-lactaldehyde degradation (anaerobic):
(S)-propane-1,2-diol + NAD+ ⟶ H+ + L-lactaldehyde + NADH - superpathway of methylglyoxal degradation:
NADP+ + acetol ⟶ H+ + NADPH + methylglyoxal - superpathway of fucose and rhamnose degradation:
(S)-lactate + A ⟶ A(H2) + pyruvate - methylglyoxal degradation III:
NADP+ + acetol ⟶ H+ + NADPH + methylglyoxal - L-lactaldehyde degradation (anaerobic):
(S)-propane-1,2-diol + NAD+ ⟶ (S)-lactaldehyde + H+ + NADH - L-lactaldehyde degradation (anaerobic):
(S)-propane-1,2-diol + NAD+ ⟶ (S)-lactaldehyde + H+ + NADH - L-lactaldehyde degradation (anaerobic):
(S)-propane-1,2-diol + NAD+ ⟶ (S)-lactaldehyde + H+ + NADH - xylitol degradation:
NAD+ + xylitol ⟶ D-xylulose + H+ + NADH - ribitol degradation:
D-ribitol + NAD+ ⟶ D-ribulose + H+ + NADH - xylitol degradation:
NAD+ + xylitol ⟶ D-xylulose + H+ + NADH - xylitol degradation:
NAD+ + xylitol ⟶ D-xylulose + H+ + NADH - ribitol degradation:
D-ribitol + NAD+ ⟶ D-ribulose + H+ + NADH - 9-cis, 11-trans-octadecadienoyl-CoA degradation (isomerase-dependent, yeast):
(3R)-hydroxy- 5-cis, 7-trans-tetradecadienoyl-CoA + NAD+ ⟶ 5-cis, 7-trans-3-oxo-tetradecadienoyl-CoA + H+ + NADH - 9-cis, 11-trans-octadecadienoyl-CoA degradation (isomerase-dependent):
5-cis, 7-trans-tetradecadienoyl-CoA + O2 ⟶ 2-trans, 5-cis, 7-trans-tetradecatrienoyl-CoA + hydrogen peroxide - vanillin and vanillate degradation II:
H+ + NADH + O2 + vanillate ⟶ H2O + NAD+ + formaldehyde + protocatechuate - superpathway of C1 compounds oxidation to CO2:
MeOH + an oxidized cytochrome cL ⟶ H+ + a reduced cytochrome cL + formaldehyde - methanesulfonate degradation:
NADH + O2 + methanesulfonate ⟶ H2O + NAD+ + formaldehyde + sulfite - 5,5'-dehydrodivanillate degradation:
5,5'-dehydrodivanillate + H+ + NADH + O2 ⟶ 2,2',3-trihydroxy-3'-methoxy-5,5'-dicarboxybiphenyl + H2O + NAD+ + formaldehyde - formaldehyde oxidation IV (thiol-independent):
H2O + NAD+ + formaldehyde ⟶ H+ + NADH + formate - vanillin and vanillate degradation II:
H+ + NADH + O2 + vanillate ⟶ H2O + NAD+ + formaldehyde + protocatechuate - methanesulfonate degradation:
NADH + O2 + methanesulfonate ⟶ H2O + NAD+ + formaldehyde + sulfite - formaldehyde oxidation IV (thiol-independent):
H2O + NAD+ + formaldehyde ⟶ H+ + NADH + formate - methanesulfonate degradation:
NADH + O2 + methanesulfonate ⟶ H2O + NAD+ + formaldehyde + sulfite - superpathway of C1 compounds oxidation to CO2:
S-formylglutathione + H2O ⟶ H+ + formate + glutathione - formaldehyde oxidation IV (thiol-independent):
H2O + NAD+ + formaldehyde ⟶ H+ + NADH + formate - formaldehyde oxidation IV (thiol-independent):
H2O + NAD+ + formaldehyde ⟶ H+ + NADH + formate - superpathway of C1 compounds oxidation to CO2:
H2O + an oxidized amicyanin + methylamine ⟶ a reduced amicyanin + ammonia + formaldehyde - vanillin and vanillate degradation II:
H+ + NADH + O2 + vanillate ⟶ H2O + NAD+ + formaldehyde + protocatechuate - p-cymene degradation:
p-cymene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ 4-isopropylbenzyl alcohol + H2O + an oxidized ferredoxin [iron-sulfur] cluster - p-cymene degradation to p-cumate:
p-cymene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ 4-isopropylbenzyl alcohol + H2O + an oxidized ferredoxin [iron-sulfur] cluster - superpathway of nicotinate degradation:
6-hydroxynicotinate + H+ + NADH + O2 ⟶ 2,5-dihydroxypyridine + CO2 + H2O + NAD+ - nicotine degradation II (pyrrolidine pathway):
6-hydroxy-3-succinoyl-pyridine + H+ + NADH + O2 ⟶ 2,5-dihydroxypyridine + H2O + NAD+ + succinate semialdehyde - nicotine degradation III (VPP pathway):
6-hydroxy-3-succinoyl-pyridine + H+ + NADH + O2 ⟶ 2,5-dihydroxypyridine + H2O + NAD+ + succinate semialdehyde - nicotinate degradation I:
6-hydroxynicotinate + H+ + NADH + O2 ⟶ 2,5-dihydroxypyridine + CO2 + H2O + NAD+ - L-lysine degradation X:
1-piperideine + H2O + NAD+ ⟶ 5-aminopentanoate + H+ + NADH - plant sterol biosynthesis II:
4α-methyl-zymosterol ⟶ 4α-methyl-5α-cholesta-7,24-dien-3β-ol - dopamine degradation:
H2O + O2 + dopamine ⟶ 3,4-dihydroxyphenylacetaldehyde + ammonium + hydrogen peroxide - dopamine degradation:
3,4-dihydroxyphenylacetaldehyde + H2O + NAD+ ⟶ 3,4-dihydroxyphenylacetate + H+ + NADH - aromatic biogenic amine degradation (bacteria):
3,4-dihydroxyphenylacetaldehyde + H2O + NAD+ ⟶ 3,4-dihydroxyphenylacetate + H+ + NADH - aromatic biogenic amine degradation (bacteria):
(4-hydroxyphenyl)acetaldehyde + H2O + NAD+ ⟶ 4-hydroxyphenylacetate + H+ + NADH - dopamine degradation:
H2O + O2 + dopamine ⟶ 3,4-dihydroxyphenylacetaldehyde + ammonium + hydrogen peroxide - dopamine degradation:
H2O + O2 + dopamine ⟶ 3,4-dihydroxyphenylacetaldehyde + H+ + ammonia + hydrogen peroxide - abscisic acid biosynthesis:
9'-cis-neoxanthin + O2 ⟶ (3S,5R,6R)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al + 2-cis,4-trans-xanthoxin - abscisic acid biosynthesis:
9'-cis-neoxanthin + O2 ⟶ (3S,5R,6R)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al + 2-cis,4-trans-xanthoxin - plant sterol biosynthesis:
4α-formyl-ergosta-7,24(241)-dien-3β-ol + H+ + O2 + a ferrocytochrome b5 ⟶ 4α-carboxy-ergosta-7,24(241)-dien-3β-ol + H2O + a ferricytochrome b5 - 2-isopropylphenol degradation:
3-isopropylcatechol + O2 ⟶ 2-hydroxy-7-methyl-6-oxo-2,4-octadienoate + H+ - glycerol degradation III:
1,3-propanediol + NAD+ ⟶ 3-hydroxypropionaldehyde + H+ + NADH - 2,4-dinitrotoluene degradation:
2,4-dinitrotoluene + NADH + O2 ⟶ 4-methyl-5-nitrocatechol + NAD+ + nitrite - limonene degradation III (to perillate):
(4R)-perillyl alcohol + NAD+ ⟶ (4R)-perillyl aldehyde + H+ + NADH - androgen biosynthesis:
NAD+ + dehydroepiandrosterone ⟶ 5-androstene-3,17-dione + H+ + NADH - benzoyl-CoA degradation II (anaerobic):
6-hydroxycyclohex-1-ene-1-carbonyl-CoA + NAD+ ⟶ 6-oxocyclohex-1-ene-1-carbonyl-CoA + H+ + NADH - D-sorbitol degradation I:
D-sorbitol + NAD+ ⟶ keto-D-fructose + H+ + NADH - superpathway of hexitol degradation (bacteria):
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate - galactitol degradation:
NAD+ + galactitol 1-phosphate ⟶ keto-D-tagatose 6-phosphate + H+ + NADH - phosphinothricin tripeptide biosynthesis:
2-hydroxyethylphosphonate + NAD+ ⟶ H+ + NADH + phosphonoacetaldehyde - L-threonine degradation II:
NAD+ + thr ⟶ H+ + L-2-amino-3-oxobutanoate + NADH - L-threonine degradation III (to methylglyoxal):
NAD+ + thr ⟶ H+ + L-2-amino-3-oxobutanoate + NADH - toluene degradation VI (anaerobic):
6-hydroxycyclohex-1-ene-1-carbonyl-CoA + NAD+ ⟶ 6-oxocyclohex-1-ene-1-carbonyl-CoA + H+ + NADH - toluene degradation to benzoate:
NAD+ + benzyl alcohol ⟶ H+ + NADH + benzaldehyde - aminopropanol phosphate biosynthesis II:
NAD+ + thr ⟶ H+ + L-2-amino-3-oxobutanoate + NADH - L-galactonate degradation:
aldehydo-L-galactonate + NAD+ ⟶ D-tagaturonate + H+ + NADH - pyridoxal 5'-phosphate biosynthesis I:
4-phosphooxy-L-threonine + NAD+ ⟶ 3-amino-1-hydroxyacetone 1-phosphate + CO2 + NADH - superpathway of L-threonine metabolism:
NAD+ + thr ⟶ H+ + L-2-amino-3-oxobutanoate + NADH - superpathway of pyridoxal 5'-phosphate biosynthesis and salvage:
ATP + pyridoxal ⟶ ADP + H+ + PLP - galactitol degradation:
an [HPr protein]-Nπ-phospho-L-histidine + galactitol ⟶ an [HPr]-L-histidine + galactitol 1-phosphate - superpathway of hexitol degradation (bacteria):
an [HPr protein]-Nπ-phospho-L-histidine + galactitol ⟶ an [HPr]-L-histidine + galactitol 1-phosphate - superpathway of pyridoxal 5'-phosphate biosynthesis and salvage:
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide - superpathway of L-threonine metabolism:
2-oxobutanoate + coenzyme A ⟶ formate + propanoyl-CoA - L-threonine degradation III (to methylglyoxal):
H2O + O2 + aminoacetone ⟶ ammonium + hydrogen peroxide + methylglyoxal - L-threonine degradation II:
NAD+ + thr ⟶ H+ + L-2-amino-3-oxobutanoate + NADH - L-galactonate degradation:
aldehydo-L-galactonate + NAD+ ⟶ D-tagaturonate + H+ + NADH - pyridoxal 5'-phosphate biosynthesis I:
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide - superpathway of tryptophan utilization:
N-formylkynurenine + H2O ⟶ H+ + L-kynurenine + formate - serotonin degradation:
H2O + O2 + serotonin ⟶ 5-hydroxyindole acetaldehyde + ammonium + hydrogen peroxide - serotonin degradation:
5-hydroxytryptophol + NAD+ ⟶ 5-hydroxyindole acetaldehyde + H+ + NADH - serotonin degradation:
H2O + O2 + serotonin ⟶ 5-hydroxyindole acetaldehyde + H+ + ammonia + hydrogen peroxide - L-tryptophan degradation VIII (to tryptophol):
NAD+ + indole-3-ethanol ⟶ (indol-3-yl)acetaldehyde + H+ + NADH - tryptophan degradation VIII (to tryptophol):
2-oxoglutarate + trp ⟶ (indol-3-yl)pyruvate + glu - L-carnitine biosynthesis:
γ-butyrobetaine + 2-oxoglutarate + O2 ⟶ CO2 + L-carnitine + succinate - L-carnitine biosynthesis:
3-hydroxy-N6,N6,N6-trimethyl-L-lysine ⟶ 4-trimethylammoniobutanal + gly - L-carnitine biosynthesis:
γ-butyrobetaine + 2-oxoglutarate + O2 ⟶ CO2 + L-carnitine + succinate - aliphatic glucosinolate biosynthesis, side chain elongation cycle:
2-[(2'-methylsulfanyl)propyl]maleate + H2O ⟶ 3-[(3'-methylsulfanyl)propyl]malate - methylsalicylate degradation:
5-methylsalicylate + H+ + NADH + O2 ⟶ 4-methylcatechol + CO2 + H2O + NAD+ - 4-toluenesulfonate degradation II:
4-toluenesulfonate + NADH + O2 ⟶ 4-methylcatechol + NAD+ + sulfite - methylsalicylate degradation:
4-methylsalicylate + H+ + NADH + O2 ⟶ 4-methylcatechol + CO2 + H2O + NAD+ - methylsalicylate degradation:
5-methylsalicylate + H+ + NADH + O2 ⟶ 4-methylcatechol + CO2 + H2O + NAD+ - valine degradation:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - valine degradation I:
3-methyl-2-oxobutanoate + NAD+ + coenzyme A ⟶ CO2 + NADH + isobutanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogen carbonate + propanoyl-CoA - valine degradation I:
3-methyl-2-oxobutanoate + NAD+ + coenzyme A ⟶ CO2 + NADH + isobutanoyl-CoA - valine degradation I:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glt - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogen carbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - valine degradation III:
H2O + NAD+ + coenzyme A + methylmalonate semialdehyde ⟶ H+ + NADH + hydrogen carbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogen carbonate + propanoyl-CoA - valine degradation I:
2-oxoglutarate + val ⟶ 2-oxoisovalerate + glt - valine degradation I:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glt - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogen carbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - orcinol degradation:
2,3,5-trihydroxytoluene + O2 ⟶ 2,4,6-trioxoheptanoate + H+ - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + ammonia + an oxidized ferredoxin [iron-sulfur] cluster ⟶ H+ + a reduced ferredoxin [iron-sulfur] cluster + nitrite - vitamin B6 degradation:
4-pyridoxolactone + H2O ⟶ 4-pyridoxate + H+ - vitamin B6 degradation:
pyridoxamine + pyruvate ⟶ ala + pyridoxal - vitamin B6 degradation:
2-(acetamidomethylene)succinate + H2O ⟶ CO2 + acetate + ammonia + succinate semialdehyde - vitamin B6 degradation:
2-(acetamidomethylene)succinate + H2O ⟶ CO2 + acetate + ammonia + succinate semialdehyde - biphenyl degradation:
H+ + NADH + O2 + biphenyl ⟶ NAD+ + cis-3-phenylcyclohexa-3,5-diene-1,2-diol - K-252 biosynthesis:
K-252c + dTDP-2-deoxy-5-keto-dihydrostreptose ⟶ 2-deoxy-5-keto-dihydrostreptosyl-K252c + dTDP - staurosporine biosynthesis:
K-252c + dTDP-L-ristosamine ⟶ H+ + dTDP + holyrine A - hydrogen oxidation II (aerobic, NAD):
H2 + NAD+ ⟶ H+ + NADH - hydrogen production II:
H2 + NAD+ ⟶ H+ + NADH - hydrogen production I:
H2 + NAD+ + an oxidized ferredoxin [iron-sulfur] cluster ⟶ H+ + NADH + a reduced ferredoxin [iron-sulfur] cluster - superpathway of hydrogen production:
H2 + NAD+ ⟶ H+ + NADH - hydrogen oxidation II (aerobic, NAD):
H2 + NAD+ ⟶ H+ + NADH - hydrogen production II:
H2 + NAD+ ⟶ H+ + NADH - hydrogen production I:
H2 + NAD+ + an oxidized ferredoxin [iron-sulfur] cluster ⟶ H+ + NADH + a reduced ferredoxin [iron-sulfur] cluster - hydrogen production II:
H2 + NAD+ ⟶ H+ + NADH - superpathway of hydrogen production:
H2 + NAD+ ⟶ H+ + NADH - hydrogen oxidation II (aerobic, NAD):
H2 + NAD+ ⟶ H+ + NADH - hydrogen production I:
H2 + NAD+ + an oxidized ferredoxin [iron-sulfur] cluster ⟶ H+ + NADH + a reduced ferredoxin [iron-sulfur] cluster - methylglyoxal degradation VI:
(R)-lactate + an oxidized c-type cytochrome ⟶ H+ + a reduced c-type cytochrome + pyruvate - methylglyoxal degradation VI:
(R)-lactaldehyde + H2O + NAD+ ⟶ (R)-lactate + H+ + NADH - 1,2-propanediol biosynthesis from lactate (engineered):
(S)-propane-1,2-diol + NADP+ ⟶ (S)-lactaldehyde + H+ + NADPH - methylglyoxal degradation VI:
(R)-lactate + an oxidized c-type cytochrome ⟶ a reduced c-type cytochrome + pyruvate - kanosamine biosynthesis II:
D-glucopyranose 6-phosphate + NAD+ ⟶ 3-dehydro-D-glucose 6-phosphate + H+ + NADH - kanosamine biosynthesis II:
2-oxoglutarate + D-kanosamine 6-phosphate ⟶ 3-dehydro-D-glucose 6-phosphate + glu - γ-butyrobetaine degradation:
L-carnitine + NAD+ ⟶ 3-dehydrocarnitine + H+ + NADH - D-carnitine degradation II:
D-carnitine ⟶ L-carnitine - L-carnitine degradation II:
L-carnitine + NAD+ ⟶ 3-dehydrocarnitine + H+ + NADH - L-carnitine degradation II:
L-carnitine + NAD+ ⟶ 3-dehydrocarnitine + H+ + NADH - γ-butyrobetaine degradation:
L-carnitine + NAD+ ⟶ 3-dehydrocarnitine + H+ + NADH - L-carnitine degradation II:
L-carnitine + NAD+ ⟶ 3-dehydrocarnitine + H+ + NADH - 2,2'-dihydroxybiphenyl degradation:
2,2',3-trihydroxybiphenyl + H+ + NADH + O2 ⟶ 2,2',3,3'-tetrahydroxybiphenyl + H2O + NAD+ - dibenzofuran degradation:
2,2',3-trihydroxybiphenyl + O2 ⟶ (2Z,2E)-2-hydroxy-6-oxo-6-(2-hydroxyphenyl)-hexa-2,4-dienoate + H+ - 1-chloro-2-nitrobenzene degradation:
1-chloro-2-nitrobenzene + NADH + O2 ⟶ 3-chlorocatechol + NAD+ + nitrite - 3-chlorobenzoate degradation I (via chlorocatechol):
3-chloro-3,5-cyclohexadiene-l,2-diol-1-carboxylate + NAD+ ⟶ 3-chlorocatechol + CO2 + NADH - NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast):
H+ + NADH + UQ ⟶ NAD+ + UQH2 - superpathway NAD/NADP - NADH/NADPH interconversion (yeast):
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH - nitrate reduction VIIIb (dissimilatory):
H+ + UQH2 + nitrate ⟶ H+ + H2O + UQ + nitrite - NAD/NADH phosphorylation and dephosphorylation:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NADH to cytochrome bd oxidase electron transfer II:
H+ + NADH + UQ ⟶ NAD+ + UQH2 - NADH to cytochrome bo oxidase electron transfer II:
H+ + NADH + UQ ⟶ NAD+ + UQH2 - NADH to cytochrome bo oxidase electron transfer I:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NADH to cytochrome bd oxidase electron transfer I:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration II (cytochrome c) (yeast):
UQH2 + an oxidized c-type cytochrome ⟶ H+ + UQ + a reduced c-type cytochrome - aerobic respiration III (alternative oxidase pathway):
O2 + UQH2 ⟶ H2O + UQ - aerobic respiration I (cytochrome c):
UQH2 + an oxidized c-type cytochrome ⟶ H+ + UQ + a reduced c-type cytochrome - Fe(II) oxidation:
UQH2 + an oxidized CycA1 cytochrome ⟶ H+ + UQ + a reduced CycA1 cytochrome - nitrate reduction VIIIb (dissimilatory):
H+ + UQH2 + nitrate ⟶ H+ + H2O + UQ + nitrite - NADH to cytochrome bd oxidase electron transfer II:
H+ + O2 + UQH2 ⟶ H+ + H2O + UQ - NADH to cytochrome bo oxidase electron transfer II:
H+ + O2 + UQH2 ⟶ H+ + H2O + UQ - NADH to cytochrome bo oxidase electron transfer I:
H+ + O2 + UQH2 ⟶ H+ + H2O + UQ - NADH to cytochrome bd oxidase electron transfer I:
H+ + O2 + UQH2 ⟶ H+ + H2O + UQ - superpathway NAD/NADP - NADH/NADPH interconversion:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast):
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NADH to cytochrome bd oxidase electron transfer I:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NADH to cytochrome bd oxidase electron transfer I:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NADH to cytochrome bo oxidase electron transfer I:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NADH to cytochrome bd oxidase electron transfer II:
H+ + NADH + UQ ⟶ NAD+ + UQH2 - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NADH to cytochrome bd oxidase electron transfer I:
H+ + O2 + UQH2 ⟶ H+ + H2O + UQ - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NADH to cytochrome bd oxidase electron transfer I:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NADH to cytochrome bo oxidase electron transfer:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NADH to cytochrome bd oxidase electron transfer:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NADH to cytochrome bd oxidase electron transfer:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NADH to cytochrome bo oxidase electron transfer:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NADH to cytochrome bo oxidase electron transfer I:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NADH to cytochrome bd oxidase electron transfer:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration (cytochrome c):
UQH2 + an oxidized c-type cytochrome ⟶ H+ + UQ + a reduced c-type cytochrome - NADH to cytochrome bo oxidase electron transfer II:
H+ + NADH + UQ ⟶ NAD+ + UQH2 - NADH to cytochrome bd oxidase electron transfer I:
H+ + O2 + UQH2 ⟶ H+ + H2O + UQ - NADH to cytochrome bd oxidase electron transfer II:
H+ + NADH + UQ ⟶ NAD+ + UQH2 - NADH to cytochrome bo oxidase electron transfer I:
H+ + O2 + UQH2 ⟶ H+ + H2O + UQ - NADH to cytochrome bd oxidase electron transfer II:
H+ + NADH + UQ ⟶ NAD+ + UQH2 - NADH to cytochrome bd oxidase electron transfer I:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - respiration (anaerobic)-- electron donors reaction list:
H+ + MQ + formate ⟶ CO2 + H+ + MQH2 - aerobic respiration -- electron donors reaction list:
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NADH to cytochrome bd oxidase electron transfer:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NADH to cytochrome bo oxidase electron transfer:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NADH to cytochrome bo oxidase electron transfer:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NADH to cytochrome bd oxidase electron transfer:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NADH to cytochrome bd oxidase electron transfer:
H+ + NADH + UQ ⟶ NAD+ + UQH2 - NADH to cytochrome bo oxidase electron transfer:
H+ + NADH + UQ ⟶ NAD+ + UQH2 - NADH to cytochrome bd oxidase electron transfer:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NADH to cytochrome bd oxidase electron transfer:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NADH to cytochrome bo oxidase electron transfer:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NADH to cytochrome bd oxidase electron transfer:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NADH to cytochrome bd oxidase electron transfer:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NADH to cytochrome bo oxidase electron transfer:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NADH to cytochrome bd oxidase electron transport II:
H+ + NADH + UQ ⟶ NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NADH to cytochrome bd oxidase electron transfer I:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NADH to cytochrome bd oxidase electron transfer I:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - neurosporaxanthin biosynthesis:
O2 + torulene ⟶ 3-methyl-2-butenal + 4'-apo-β-carotenal - neurosporaxanthin biosynthesis:
4'-apo-β,ψ-caroten-4'-al + H2O + NAD+ ⟶ H+ + NADH + neurosporaxanthin - nostoxanthin biosynthesis:
H+ + NADH + O2 + caloxanthin ⟶ H2O + NAD+ + nostoxanthin - carbon disulfide oxidation II (aerobic):
H+ + NADH + O2 + carbon disulfide ⟶ H2O + NAD+ + carbonyl sulfide + hydrogen sulfide - myo-, chiro- and scyllo-inositol degradation:
scyllo-inosose ⟶ 1-keto-D-chiro-inositol - myo-, chiro- and scillo-inositol degradation:
scyllo-inositol + NAD+ ⟶ scyllo-inosose + H+ + NADH - myo-, chiro- and scyllo-inositol degradation:
1D-chiro-inositol + NAD+ ⟶ 1-keto-D-chiro-inositol + H+ + NADH - myo-, chiro- and scyllo-inositol degradation:
scyllo-inositol + NAD+ ⟶ scyllo-inosose + H+ + NADH - myo-, chiro- and scyllo-inositol degradation:
scyllo-inositol + NAD+ ⟶ scyllo-inosose + H+ + NADH - myo-inositol degradation:
myo-inositol + NAD+ ⟶ 2-keto-myo-inositol + H+ + NADH - streptomycin biosynthesis:
D-1-guanidino-3-amino-1,3-dideoxy-scyllo-inositol + pyruvate ⟶ D-1-guanidino-1-deoxy-3-dehydro-scyllo-inositol + ala - myo-, chiro- and scillo-inositol degradation:
scyllo-inositol + NAD+ ⟶ scyllo-inosose + H+ + NADH - 2'-deoxy-α-D-ribose 1-phosphate degradation:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - oxidative ethanol degradation III:
O2 + a reduced [NADPH-hemoprotein reductase] + ethanol ⟶ H2O + acetaldehyde + an oxidized [NADPH-hemoprotein reductase] - ethanol degradation IV:
ethanol + hydrogen peroxide ⟶ H2O + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - hypotaurine degradation:
2-sulfinoacetaldehyde + H2O ⟶ H+ + acetaldehyde + sulfite - chitin degradation to ethanol:
H2O + chitin ⟶ acetate + chitosan - 2-aminoethylphosphonate degradation I:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - superpathway of pyrimidine deoxyribonucleosides degradation:
2'-deoxycytidine + H+ + H2O ⟶ 2'-deoxyuridine + ammonium - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation III:
O2 + a reduced [NADPH-hemoprotein reductase] + ethanol ⟶ H2O + acetaldehyde + an oxidized [NADPH-hemoprotein reductase] - ethanol degradation IV:
ethanol + hydrogen peroxide ⟶ H2O + acetaldehyde - ethanolamine utilization:
ethanolamine ⟶ acetaldehyde + ammonium - triethylamine degradation:
H+ + diethylamine N-oxide ⟶ acetaldehyde + ethylamine - superpathway of fermentation (Chlamydomonas reinhardtii):
H2 + an oxidized ferredoxin [iron-sulfur] cluster ⟶ H+ + a reduced ferredoxin [iron-sulfur] cluster - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - superpathway of purine deoxyribonucleosides degradation:
2'-deoxyadenosine + phosphate ⟶ 2-deoxy-α-D-ribose 1-phosphate + adenine - hexitol fermentation to lactate, formate, ethanol and acetate:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetylene degradation:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - p-cumate degradation:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - mixed acid fermentation:
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate - 3-phenylpropanoate and 3-(3-hydroxyphenyl)propanoate degradation:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - 2-hydroxypenta-2,4-dienoate degradation:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - superpathway of N-acetylneuraminate degradation:
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate - L-threonine degradation IV:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - catechol degradation II (meta-cleavage pathway):
O2 + catechol ⟶ H+ + HMS - catechol degradation I (meta-cleavage pathway):
O2 + catechol ⟶ H+ + HMS - toluene degradation I (aerobic) (via o-cresol):
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - L-tryptophan degradation IX:
N-Formyl-L-kynurenine + H2O ⟶ H+ + L-kynurenine + formate - L-tryptophan degradation XII (Geobacillus):
N-Formyl-L-kynurenine + H2O ⟶ H+ + L-kynurenine + formate - heterolactic fermentation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - toluene degradation V (aerobic) (via toluene-cis-diol):
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - superpathway of anaerobic sucrose degradation:
β-D-fructofuranose + ATP ⟶ ADP + F6P + H+ - acetoin degradation:
NAD+ + acetoin + coenzyme A ⟶ H+ + NADH + acetaldehyde + acetyl-CoA - 2'-deoxy-α-D-ribose 1-phosphate degradation:
2-deoxy-D-ribose 5-phosphate ⟶ D-glyceraldehyde 3-phosphate + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol III:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanolamine utilization:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - 2'-deoxy-α-D-ribose 1-phosphate degradation:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - mixed acid fermentation:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - 3-phenylpropanoate and 3-(3-hydroxyphenyl)propanoate degradation:
3-(3-hydroxyphenyl)propanoate + H+ + NADH + O2 ⟶ 2,3-DHP + H2O + NAD+ - ethanol degradation I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - L-threonine degradation IV:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - 2-hydroxypenta-2,4-dienoate degradation:
(S)-4-hydroxy-2-oxopentanoate ⟶ acetaldehyde + pyruvate - superpathway of pyrimidine deoxyribonucleosides degradation:
2'-deoxyuridine + phosphate ⟶ 2-deoxy-α-D-ribose 1-phosphate + uracil - superpathway of purine deoxyribonucleosides degradation:
2'-deoxyadenosine + phosphate ⟶ 2-deoxy-α-D-ribose 1-phosphate + adenine - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - threonine degradation:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - chitin degradation to ethanol:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
H+ + pyruvate ⟶ CO2 + acetaldehyde - ethanol degradation I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - superpathway of pyrimidine deoxyribonucleosides degradation:
2'-deoxycytidine + H+ + H2O ⟶ 2'-deoxyuridine + ammonium - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - 2'-deoxy-α-D-ribose 1-phosphate degradation:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - superpathway of purine deoxyribonucleosides degradation:
2'-deoxyadenosine + phosphate ⟶ 2-deoxy-α-D-ribose 1-phosphate + adenine - 2-aminoethylphosphonate degradation I:
(2-aminoethyl)phosphonate + pyruvate ⟶ ala + phosphonoacetaldehyde - superpathway of N-acetylneuraminate degradation:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - superpathway of purine deoxyribonucleosides degradation:
2'-deoxyadenosine + phosphate ⟶ 2-deoxy-α-D-ribose 1-phosphate + adenine - 2'-deoxy-α-D-ribose 1-phosphate degradation:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - pyruvate fermentation to ethanol I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - superpathway of pyrimidine deoxyribonucleosides degradation:
2'-deoxycytidine + H+ + H2O ⟶ 2'-deoxyuridine + ammonium - hexitol fermentation to lactate, formate, ethanol and acetate:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - mixed acid fermentation:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - ethanol degradation I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - superpathway of N-acetylneuraminate degradation:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - mixed acid fermentation:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - ethanol degradation I:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - ethanol degradation II:
H2O + NAD+ + acetaldehyde ⟶ H+ + NADH + acetate - pyruvate fermentation to ethanol II:
H+ + pyruvate ⟶ CO2 + acetaldehyde - superpathway of purine deoxyribonucleosides degradation:
2'-deoxyadenosine + phosphate ⟶ 2-deoxy-α-D-ribose 1-phosphate + adenine - superpathway of pyrimidine deoxyribonucleosides degradation:
2'-deoxyuridine + phosphate ⟶ 2-deoxy-α-D-ribose 1-phosphate + uracil - 2'-deoxy-α-D-ribose 1-phosphate degradation:
2-deoxy-D-ribose 5-phosphate ⟶ D-glyceraldehyde 3-phosphate + acetaldehyde - mixed acid fermentation:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - ethanol degradation I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - superpathway of purine deoxyribonucleosides degradation:
2'-deoxyadenosine + phosphate ⟶ 2-deoxy-α-D-ribose 1-phosphate + adenine - superpathway of pyrimidine deoxyribonucleosides degradation:
2'-deoxyuridine + phosphate ⟶ 2-deoxy-α-D-ribose 1-phosphate + uracil - 2-oxopentenoate degradation:
4-hydroxy-2-oxopentanoate ⟶ acetaldehyde + pyruvate - 2'-deoxy-α-D-ribose 1-phosphate degradation:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - ethanol degradation IV:
ethanol + hydrogen peroxide ⟶ H2O + acetaldehyde - 2'-deoxy-α-D-ribose 1-phosphate degradation:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - 2'-deoxy-α-D-ribose 1-phosphate degradation:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - ethanol degradation I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - superpathway of purine deoxyribonucleosides degradation:
2'-deoxyadenosine + phosphate ⟶ 2-deoxy-α-D-ribose 1-phosphate + adenine - pyruvate fermentation to ethanol I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - superpathway of pyrimidine deoxyribonucleosides degradation:
2'-deoxycytidine + H+ + H2O ⟶ 2'-deoxyuridine + ammonium - hexitol fermentation to lactate, formate, ethanol and acetate:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - mixed acid fermentation:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - 2-oxopentenoate degradation:
4-hydroxy-2-oxopentanoate ⟶ acetaldehyde + pyruvate - superpathway of N-acetylneuraminate degradation:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - 3-phenylpropionate and 3-(3-hydroxyphenyl)propionate degradation:
3-(3-hydroxyphenyl)propionate + H+ + NADH + O2 ⟶ 2,3-DHP + H2O + NAD+ - threonine degradation IV:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - pyruvate fermentation to ethanol I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - 2'-deoxy-α-D-ribose 1-phosphate degradation:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - ethanol degradation I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - mixed acid fermentation:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - superpathway of pyrimidine deoxyribonucleosides degradation:
2'-deoxycytidine + H+ + H2O ⟶ 2'-deoxyuridine + ammonium - superpathway of purine deoxyribonucleosides degradation:
2'-deoxyadenosine + phosphate ⟶ 2-deoxy-α-D-ribose 1-phosphate + adenine - threonine degradation IV:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - 2-oxopentenoate degradation:
4-hydroxy-2-oxopentanoate ⟶ acetaldehyde + pyruvate - mixed acid fermentation:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - acetoin degradation:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - 2'-deoxy-α-D-ribose 1-phosphate degradation:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - pyruvate fermentation to ethanol III:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - superpathway of pyrimidine deoxyribonucleosides degradation:
2'-deoxycytidine + H+ + H2O ⟶ 2'-deoxyuridine + ammonium - superpathway of purine deoxyribonucleosides degradation:
2'-deoxyadenosine + phosphate ⟶ 2-deoxy-α-D-ribose 1-phosphate + adenine - mixed acid fermentation:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - acetoin degradation:
NAD+ + acetoin + coenzyme A ⟶ H+ + NADH + acetaldehyde + acetyl-CoA - superpathway of purine deoxyribonucleosides degradation:
2'-deoxyadenosine + H+ + H2O ⟶ 2'-deoxyinosine + ammonium - 2'-deoxy-α-D-ribose 1-phosphate degradation:
2-deoxy-D-ribose 5-phosphate ⟶ D-glyceraldehyde 3-phosphate + acetaldehyde - ethanol degradation I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - mixed acid fermentation:
oxaloacetate + phosphate ⟶ hydrogencarbonate + phosphoenolpyruvate - L-threonine degradation IV:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - superpathway of pyrimidine deoxyribonucleosides degradation:
2'-deoxyuridine + phosphate ⟶ 2-deoxy-α-D-ribose 1-phosphate + uracil - 2'-deoxy-α-D-ribose 1-phosphate degradation:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - superpathway of pyrimidine deoxyribonucleosides degradation:
2'-deoxycytidine + H+ + H2O ⟶ 2'-deoxyuridine + ammonium - superpathway of purine deoxyribonucleosides degradation:
2'-deoxyadenosine + phosphate ⟶ 2-deoxy-α-D-ribose 1-phosphate + adenine - heterolactic fermentation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - 2-oxopentenoate degradation:
4-hydroxy-2-oxopentanoate ⟶ acetaldehyde + pyruvate - hexitol fermentation to lactate, formate, ethanol and acetate:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol fermentation to acetate:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - mixed acid fermentation:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - mixed acid fermentation:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - 2'-deoxy-α-D-ribose 1-phosphate degradation:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - acetoin degradation:
NAD+ + acetoin + coenzyme A ⟶ H+ + NADH + acetaldehyde + acetyl-CoA - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation IV:
ethanol + hydrogen peroxide ⟶ H2O + acetaldehyde - superpathway of purine deoxyribonucleosides degradation:
2'-deoxyadenosine + phosphate ⟶ 2-deoxy-α-D-ribose 1-phosphate + adenine - superpathway of pyrimidine deoxyribonucleosides degradation:
2'-deoxycytidine + H+ + H2O ⟶ 2'-deoxyuridine + ammonium - pyruvate fermentation to ethanol I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - 2'-deoxy-α-D-ribose 1-phosphate degradation:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - superpathway of N-acetylneuraminate degradation:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - 2'-deoxy-α-D-ribose 1-phosphate degradation:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - mixed acid fermentation:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - superpathway of pyrimidine deoxyribonucleosides degradation:
2'-deoxycytidine + H+ + H2O ⟶ 2'-deoxyuridine + ammonium - ethanol degradation I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - 2-oxopentenoate degradation:
4-hydroxy-2-oxopentanoate ⟶ acetaldehyde + pyruvate - threonine degradation IV:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - 2'-deoxy-α-D-ribose 1-phosphate degradation:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - superpathway of threonine metabolism:
H2O + O2 + aminoacetone ⟶ ammonium + hydrogen peroxide + methylglyoxal - 3-phenylpropionate and 3-(3-hydroxyphenyl)propionate degradation:
3-(3-hydroxyphenyl)propionate + H+ + NADH + O2 ⟶ 2,3-DHP + H2O + NAD+ - superpathway of threonine metabolism:
H2O + O2 + aminoacetone ⟶ ammonium + hydrogen peroxide + methylglyoxal - pyruvate fermentation to ethanol I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - superpathway of purine deoxyribonucleosides degradation:
2'-deoxyadenosine + phosphate ⟶ 2-deoxy-α-D-ribose 1-phosphate + adenine - superpathway of pyrimidine deoxyribonucleosides degradation:
2'-deoxycytidine + H+ + H2O ⟶ 2'-deoxyuridine + ammonium - ethanol degradation I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - 2'-deoxy-α-D-ribose 1-phosphate degradation:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - mixed acid fermentation:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - acetoin degradation:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - 2-oxopentenoate degradation:
4-hydroxy-2-oxopentanoate ⟶ acetaldehyde + pyruvate - threonine degradation IV:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - 3-phenylpropionate and 3-(3-hydroxyphenyl)propionate degradation:
3-(3-hydroxyphenyl)propionate + H+ + NADH + O2 ⟶ 2,3-DHP + H2O + NAD+ - mixed acid fermentation:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - purine deoxyribonucleosides degradation:
deoxyadenosine + phosphate ⟶ adenine + deoxyribose 1-phosphate - mixed acid fermentation:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - threonine degradation IV:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - superpathway of N-acetylneuraminate degradation:
D-glucosamine 6-phosphate + H2O ⟶ D-fructose 6-phosphate + H+ + ammonia - pyruvate fermentation to ethanol I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - heterolactic fermentation:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyrimidine deoxyribonucleosides degradation:
deoxyuridine + phosphate ⟶ deoxyribose 1-phosphate + uracil - ethanol degradation I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - purine deoxyribonucleosides degradation:
deoxyadenosine + phosphate ⟶ adenine + deoxyribose 1-phosphate - ethanol degradation IV:
ethanol + hydrogen peroxide ⟶ H2O + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - heterolactic fermentation:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - threonine degradation IV:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - mixed acid fermentation:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - pyruvate fermentation to ethanol I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - superpathway of purine deoxyribonucleosides degradation:
2'-deoxyadenosine + phosphate ⟶ 2'-deoxy-α-D-ribose 1-phosphate + adenine - superpathway of N-acetylneuraminate degradation:
D-glucosamine 6-phosphate + H2O ⟶ D-fructose 6-phosphate + H+ + ammonia - hexitol fermentation to lactate, formate, ethanol and acetate:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - mixed acid fermentation:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - heterolactic fermentation:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - superpathway of pyrimidine deoxyribonucleosides degradation:
2'-deoxycytidine + H2O ⟶ 2'-deoxyuridine + ammonia - threonine degradation IV:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - 2'-deoxy-α-D-ribose 1-phosphate degradation:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - ethanol degradation I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - 2-aminoethylphosphonate degradation I:
2-aminoethylphosphonate + pyruvate ⟶ ala + phosphonoacetaldehyde - L-threonine degradation IV:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - 2-aminoethylphosphonate degradation I:
(2-aminoethyl)phosphonate + pyruvate ⟶ ala + phosphonoacetaldehyde - 2'-deoxy-α-D-ribose 1-phosphate degradation:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - superpathway of pyrimidine deoxyribonucleosides degradation:
2'-deoxyuridine + phosphate ⟶ 2-deoxy-α-D-ribose 1-phosphate + uracil - superpathway of purine deoxyribonucleosides degradation:
2'-deoxyadenosine + phosphate ⟶ 2-deoxy-α-D-ribose 1-phosphate + adenine - pyruvate fermentation to ethanol III:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - 2'-deoxy-α-D-ribose 1-phosphate degradation:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - superpathway of purine deoxyribonucleosides degradation:
2'-deoxyadenosine + phosphate ⟶ 2-deoxy-α-D-ribose 1-phosphate + adenine - mixed acid fermentation:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - 2'-deoxy-α-D-ribose 1-phosphate degradation:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - mixed acid fermentation:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - superpathway of pyrimidine deoxyribonucleosides degradation:
2'-deoxyuridine + phosphate ⟶ 2-deoxy-α-D-ribose 1-phosphate + uracil - ethanol degradation I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - 2'-deoxy-α-D-ribose 1-phosphate degradation:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - heterolactic fermentation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - superpathway of purine deoxyribonucleosides degradation:
2'-deoxyadenosine + phosphate ⟶ 2-deoxy-α-D-ribose 1-phosphate + adenine - pyruvate fermentation to ethanol I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - L-threonine degradation IV:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - heterolactic fermentation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - pyruvate fermentation to ethanol I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - 2'-deoxy-α-D-ribose 1-phosphate degradation:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - superpathway of pyrimidine deoxyribonucleosides degradation:
2'-deoxyuridine + phosphate ⟶ 2-deoxy-α-D-ribose 1-phosphate + uracil - 2'-deoxy-α-D-ribose 1-phosphate degradation:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - superpathway of pyrimidine deoxyribonucleosides degradation:
2'-deoxyuridine + phosphate ⟶ 2-deoxy-α-D-ribose 1-phosphate + uracil - superpathway of purine deoxyribonucleosides degradation:
2'-deoxyadenosine + phosphate ⟶ 2-deoxy-α-D-ribose 1-phosphate + adenine - 2'-deoxy-α-D-ribose 1-phosphate degradation:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - mixed acid fermentation:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - 2'-deoxy-α-D-ribose 1-phosphate degradation:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - heterolactic fermentation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - pyruvate fermentation to ethanol I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - mixed acid fermentation:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - superpathway of pyrimidine deoxyribonucleosides degradation:
2'-deoxycytidine + H+ + H2O ⟶ 2'-deoxyuridine + ammonium - ethanolamine utilization:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - superpathway of purine deoxyribonucleosides degradation:
2'-deoxyadenosine + phosphate ⟶ 2-deoxy-α-D-ribose 1-phosphate + adenine - pyruvate fermentation to ethanol I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - mixed acid fermentation:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - 2'-deoxy-α-D-ribose 1-phosphate degradation:
NAD+ + acetaldehyde + coenzyme A ⟶ H+ + NADH + acetyl-CoA - ethylene glycol degradation:
NAD+ + ethylene glycol ⟶ H+ + NADH + glycolaldehyde - superpathway of glycol metabolism and degradation:
NAD+ + ethylene glycol ⟶ H+ + NADH + glycolaldehyde - superpathway of glycol metabolism and degradation:
H+ + glyoxylate ⟶ CO2 + tartronate semialdehyde - ethylene glycol degradation:
NAD+ + ethylene glycol ⟶ H+ + NADH + glycolaldehyde - ethylene glycol degradation:
H2O + NAD+ + glycolaldehyde ⟶ H+ + NADH + glycolate - ethylene glycol degradation:
H2O + NAD+ + glycolaldehyde ⟶ H+ + NADH + glycolate - ethylene glycol degradation:
H2O + NAD+ + glycolaldehyde ⟶ H+ + NADH + glycolate - superpathway of glycol metabolism and degradation:
H+ + glyoxylate ⟶ CO2 + tartronate semialdehyde - ethylene glycol degradation:
NAD+ + ethylene glycol ⟶ H+ + NADH + glycolaldehyde - ethylene glycol degradation:
H2O + NAD+ + glycolaldehyde ⟶ H+ + NADH + glycolate - superpathway of glycol metabolism and degradation:
H+ + glyoxylate ⟶ CO2 + tartronate semialdehyde - ethylene glycol degradation:
NAD+ + ethylene glycol ⟶ H+ + NADH + glycolaldehyde - superpathway of glycol metabolism and degradation:
H+ + glyoxylate ⟶ CO2 + tartronate semialdehyde - noradrenaline and adrenaline degradation:
H2O + O2 + noradrenaline ⟶ 3,4-dihydroxyphenylglycolaldehyde + H+ + ammonia + hydrogen peroxide - dimethyl sulfone degradation:
H2O + NAD+ + dimethyl sulfoxide ⟶ H+ + NADH + dimethyl sulfone - propene degradation:
2-(R)-hydroxypropyl-CoM ⟶ (R)-1,2-epoxypropane + coenzyme M - D-altritol and galactitol degradation:
D-altritol + NAD+ ⟶ keto-D-tagatose + H+ + NADH - 2,5-xylenol and 3,5-xylenol degradation:
(2E)-3-methyl-4,6-dioxohept-2-enedioate + H2O ⟶ H+ + citraconate + pyruvate - fluorene degradation II:
H+ + NADH + O2 + fluorene ⟶ 9-fluorenol + H2O + NAD+ - fluorene degradation I:
H+ + NADH + O2 + fluorene ⟶ 9-fluorenol + H2O + NAD+ - sorbitol degradation I:
keto-D-fructose ⟶ β-D-fructofuranose - sorbitol degradation:
D-sorbitol + NAD+ ⟶ keto-D-fructose + H+ + NADH - D-sorbitol degradation I:
D-sorbitol + NAD+ ⟶ keto-D-fructose + H+ + NADH - D-sorbitol degradation I:
D-sorbitol + NAD+ ⟶ keto-D-fructose + H+ + NADH - D-sorbitol degradation I:
keto-D-fructose ⟶ β-D-fructofuranose - D-sorbitol degradation I:
keto-D-fructose ⟶ β-D-fructofuranose - galactose degradation IV:
D-galactitol + NAD+ ⟶ H+ + L-xylo-3-hexulose + NADH - sorbitol degradation I:
D-sorbitol + NAD+ ⟶ D-fructose + H+ + NADH - D-sorbitol degradation I:
keto-D-fructose ⟶ β-D-fructofuranose - D-sorbitol degradation I:
D-sorbitol + NAD+ ⟶ keto-D-fructose + H+ + NADH - D-sorbitol degradation I:
keto-D-fructose ⟶ β-D-fructofuranose - dehydro-D-arabinono-1,4-lactone biosynthesis:
D-arabinono-1,4-lactone + O2 ⟶ dehydro-D-arabinono-1,4-lactone + hydrogen peroxide - dehydro-D-arabinono-1,4-lactone biosynthesis:
D-arabinono-1,4-lactone + O2 ⟶ dehydro-D-arabinono-1,4-lactone + hydrogen peroxide - γ-hexachlorocyclohexane degradation:
(3R,6R)-1,3,4,6-tetrachlorocyclohexa-1,4-diene ⟶ 1,2,4-trichlorobenzene + H+ + chloride - caffeine degradation V (bacteria, via trimethylurate):
1,6,8-trimethylallantoate + H2O ⟶ N,N'-dimethylurea + N-methylurea + glyoxylate - bile acids degradation:
7α-hydroxy-3-oxochol-4-en-24-oyl-CoA ⟶ 3-oxochol-4,6-dien-24-oyl-CoA + H2O - 4-hydroxybenzoate biosynthesis IV (plants):
4-hydroxybenzaldehyde + H2O + NAD+ ⟶ 4-hydroxybenzoate + H+ + NADH - 4-hydroxybenzoate biosynthesis I (eukaryotes):
4-hydroxybenzaldehyde + H2O + NAD+ ⟶ 4-hydroxybenzoate + H+ + NADH - 4-hydroxymandelate degradation:
2-(4-hydroxyphenyl)-2-oxoacetate + H+ ⟶ 4-hydroxybenzaldehyde + CO2 - 4-hydroxymandelate degradation:
4-hydroxybenzoate + H+ + NADPH + O2 ⟶ H2O + NADP+ + protocatechuate - 4-hydroxymandelate degradation:
4-hydroxybenzoate + H+ + NADPH + O2 ⟶ H2O + NADP+ + protocatechuate - 4-hydroxymandelate degradation:
4-hydroxybenzoate + H+ + NADPH + O2 ⟶ H2O + NADP+ + protocatechuate - zerumbone biosynthesis:
10-hydroxy-α-humulene + NAD+ ⟶ H+ + NADH + zerumbone - γ-resorcylate degradation II:
O2 + hydroxyquinol ⟶ 2-maleylacetate + H+ - 4-nitrophenol degradation II:
2-hydroxy-1,4-benzoquinone + H+ + NADH ⟶ NAD+ + hydroxyquinol - 2,4,5-trichlorophenoxyacetate degradation:
5-chlorohydroxyquinol + FAD ⟶ 5-chlorohydroxyquinone + FADH2 - salicortin biosynthesis:
benzylbenzoate ⟶ benzyl-6-hydroxy-2-cyclohexene-on-oyl - salicin biosynthesis:
benzaldehyde ⟶ salicylaldehyde - toluene degradation to benzoate:
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - (-)-camphor biosynthesis:
(-)-bornyl-diphosphate + H2O ⟶ (-)-borneol + diphosphate - D-galactose degradation IV:
H+ + L-xylo-3-hexulose + NADPH ⟶ D-sorbitol + NADP+ - streptomycin biosynthesis:
α-D-glucopyranose 1-phosphate ⟶ D-glucopyranose 6-phosphate - myo-inositol degradation I:
myo-inositol + NAD+ ⟶ scyllo-inosose + H+ + NADH - myo-inositol degradation I:
myo-inositol + NAD+ ⟶ scyllo-inosose + H+ + NADH - myo-inositol degradation I:
myo-inositol + NAD+ ⟶ scyllo-inosose + H+ + NADH - myo-inositol degradation I:
myo-inositol + NAD+ ⟶ scyllo-inosose + H+ + NADH - myo-inositol degradation I:
myo-inositol + NAD+ ⟶ scyllo-inosose + H+ + NADH - myo-inositol degradation I:
myo-inositol + NAD+ ⟶ scyllo-inosose + H+ + NADH - myo-inositol degradation I:
myo-inositol + NAD+ ⟶ scyllo-inosose + H+ + NADH - myo-inositol degradation I:
myo-inositol + NAD+ ⟶ scyllo-inosose + H+ + NADH - ethanedisulfonate degradation:
NADH + O2 + ethanedisulfonate ⟶ H2O + NAD+ + sulfite + sulfoacetaldehyde - 4-toluenesulfonate degradation I:
4-sulfobenzoate + NADH + O2 ⟶ NAD+ + protocatechuate + sulfite - adenosylcobalamin biosynthesis II (late cobalt incorporation):
(R)-1-amino-2-propanol O-2-phosphate + ATP + adenosyl-cobyrate ⟶ ADP + H+ + adenosyl-cobinamide phosphate + phosphate - adenosylcobalamin biosynthesis from cobyrinate a,c-diamide II:
(R)-1-amino-2-propanol O-2-phosphate + ATP + adenosyl-cobyrate ⟶ ADP + H+ + adenosyl-cobinamide phosphate + phosphate - adenosylcobalamin biosynthesis from cobyrinate a,c-diamide II:
β-nicotinate D-ribonucleotide + 5,6-dimethylbenzimidazole ⟶ α-ribazole-5'-phosphate + H+ + nicotinate - adenosylcobalamin biosynthesis II (late cobalt incorporation):
β-nicotinate D-ribonucleotide + 5,6-dimethylbenzimidazole ⟶ α-ribazole-5'-phosphate + H+ + nicotinate - adenosylcobalamin biosynthesis from cobyrinate a,c-diamide II:
β-nicotinate D-ribonucleotide + 5,6-dimethylbenzimidazole ⟶ α-ribazole-5'-phosphate + H+ + nicotinate - adenosylcobalamin biosynthesis II (late cobalt incorporation):
β-nicotinate D-ribonucleotide + 5,6-dimethylbenzimidazole ⟶ α-ribazole-5'-phosphate + H+ + nicotinate - phenylethylamine degradation I:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethylamine degradation I:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethylamine degradation II:
2-phenylethylamine + A + H2O ⟶ A(H2) + ammonium + phenylacetaldehyde - styrene degradation:
(S)-2-phenyloxirane ⟶ phenylacetaldehyde - L-phenylalanine degradation III:
2-phenylethanol + NAD+ ⟶ H+ + NADH + phenylacetaldehyde - L-phenylalanine degradation IV (mammalian, via side chain):
H2O + NAD+ + phenylacetaldehyde ⟶ H+ + NADH + phenylacetate - L-phenylalanine degradation II (anaerobic):
3-phenyl-2-oxopropanoate + H+ ⟶ CO2 + phenylacetaldehyde - superpathway of phenylethylamine degradation:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - superpathway of phenylethylamine degradation:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethylamine degradation I:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - L-phenylalanine degradation II (anaerobic):
keto-phenylpyruvate + glu ⟶ 2-oxoglutarate + phe - phenylalanine degradation:
phe + pyruvate ⟶ keto-phenylpyruvate + ala - L-phenylalanine degradation III:
2-phenylethanol + NAD+ ⟶ H+ + NADH + phenylacetaldehyde - L-phenylalanine degradation II (anaerobic):
H2O + NAD+ + phenylacetaldehyde ⟶ H+ + NADH + phenylacetate - L-phenylalanine degradation II (anaerobic):
2-oxo-3-phenylpropanoate + glt ⟶ 2-oxoglutarate + phe - phenylethylamine degradation I:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethylamine degradation I:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - superpathway of phenylethylamine degradation:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethylamine degradation I:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
H2O + O2 + phe ⟶ CO2 + ammonia + hydrogen peroxide + phenylacetaldehyde - phenylalanine degradation III:
phe + pyruvate ⟶ ala + keto-phenylpyruvate - phenylalanine degradation IV (mammalian, via side chain):
2-phenylethylamine + H2O + O2 ⟶ H+ + ammonia + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
H2O + O2 + phe ⟶ CO2 + ammonia + hydrogen peroxide + phenylacetaldehyde - L-tryptophan degradation V (side chain pathway):
NAD(P)+ + indole-3-ethanol ⟶ (indol-3-yl)acetaldehyde + H+ + NAD(P)H - progesterone biosynthesis:
pregn-5-ene-3,20-dione ⟶ progesterone - progesterone biosynthesis:
NAD+ + pregnenolone ⟶ H+ + NADH + pregn-5-ene-3,20-dione - protein S-nitrosylation and denitrosylation:
O2 + a [protein]-L-cysteine + nitric oxide ⟶ H+ + a [protein] 3-nitrosothio-L-alanine + superoxide - protein S-nitrosylation and denitrosylation:
H2O + NAD+ + ammonium ⟶ H+ + NADH + hydroxylamine - protein S-nitrosylation and denitrosylation:
O2 + a [protein]-L-cysteine + nitric oxide ⟶ H+ + a [protein] 3-nitrosothio-L-alanine + superoxide - protein S-nitrosylation and denitrosylation:
O2 + a [protein]-L-cysteine + nitric oxide ⟶ H+ + a [protein] 3-nitrosothio-L-alanine + superoxide - L-threitol degradation:
L-erythrulose 1-phosphate ⟶ D-erythrulose 4-phosphate - isoniazid activation:
NAD+ + NADH + isonicotinate acyl radical ⟶ H+ + isonicotinate acyl-NADH adduct - isoniazid activation:
NAD+ + NADH + isonicotinate acyl radical ⟶ H+ + isonicotinate acyl-NADH adduct - fumigaclavine biosynthesis:
NAD+ + festuclavine ⟶ 6,8-dimethyl-6,7-didehydroergoline + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate γ-semialdehyde + glt - proline degradation:
(S)-1-pyrroline-5-carboxylate + H2O + NAD+ ⟶ H+ + NADH + glt - sphingosine and sphingosine-1-phosphate metabolism:
sphingosine 1-phosphate ⟶ (2E)-hexadecenal + O-phosphoethanolamine - 3-chlorotoluene degradation II:
3-chlorobenzaldehyde + H2O + NAD+ ⟶ 3-chlorobenzoate + H+ + NADH - L-ascorbate biosynthesis II (L-gulose pathway):
β-L-gulose 1-phosphate + H2O ⟶ L-gulopyranose + phosphate - L-ascorbate biosynthesis II (L-gulose pathway):
β-L-gulose 1-phosphate + H2O ⟶ L-gulopyranose + phosphate - ethylbenzene degradation (anaerobic):
ATP + H2O + acetophenone + hydrogencarbonate ⟶ 3-oxo-3-phenylpropanoate + ADP + H+ + phosphate - ethylbenzene degradation (anaerobic):
ATP + H2O + acetophenone + bicarbonate ⟶ 3-oxo-3-phenylpropanoate + ADP + H+ + phosphate - putrescine degradation III:
4-acetamidobutanoate + H2O ⟶ 4-aminobutanoate + acetate - putrescine degradation III:
4-acetamidobutanal + H2O + NAD+ ⟶ 4-acetamidobutanoate + H+ + NADH - putrescine degradation III:
N-acetylputrescine + H2O + O2 ⟶ 4-acetamidobutanal + ammonia + hydrogen peroxide - limonene degradation II (L-limonene):
(1R,2R,4S)-limonene-1,2-diol + oxidized DCPIP ⟶ (1R,4S)-1-hydroxymenth-8-en-2-one + H+ + reduced DCPIP - geraniol and nerol degradation:
H2O + neral ⟶ acetaldehyde + sulcatone - lactate biosynthesis (archaea):
(S)-lactaldehyde + an oxidized coenzyme F420 ⟶ a reduced coenzyme F420 + methylglyoxal - methylglyoxal degradation V:
(S)-lactaldehyde + H2O + NAD+ ⟶ (S)-lactate + H+ + NADH - methylglyoxal degradation IV:
(S)-lactaldehyde + H2O + NAD+ ⟶ (S)-lactate + H+ + NADH - L-lactaldehyde degradation (aerobic):
(S)-lactaldehyde + H2O + NAD+ ⟶ (S)-lactate + H+ + NADH - L-rhamnose degradation II:
2-dehydro-3-deoxy-L-rhamnonate ⟶ (S)-lactaldehyde + pyruvate - L-lactaldehyde degradation (aerobic):
(S)-lactate + an electron-transfer quinone ⟶ an electron-transfer quinol + pyruvate - methylglyoxal degradation IV:
(S)-lactaldehyde + NADP+ ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation V:
(S)-lactaldehyde + NADP+ ⟶ H+ + NADPH + methylglyoxal - L-lactaldehyde degradation (aerobic):
(S)-lactate + an electron-transfer quinone ⟶ an electron-transfer quinol + pyruvate - L-lactaldehyde degradation (aerobic):
(S)-lactate + A ⟶ A(H2) + pyruvate - L-lactaldehyde degradation (aerobic):
(S)-lactate + A ⟶ A(H2) + pyruvate - L-lactaldehyde degradation (aerobic):
(S)-lactate + A ⟶ A(H2) + pyruvate - L-lactaldehyde degradation (aerobic):
(S)-lactate + A ⟶ A(H2) + pyruvate - L-lactaldehyde degradation (aerobic):
(S)-lactate + an electron-transfer quinone ⟶ an electron-transfer quinol + pyruvate - L-lactaldehyde degradation (aerobic):
(S)-lactaldehyde + H2O + NAD+ ⟶ (S)-lactate + H+ + NADH - L-lactaldehyde degradation (aerobic):
(S)-lactate + A ⟶ A(H2) + pyruvate - L-lactaldehyde degradation (aerobic):
(S)-lactate + A ⟶ A(H2) + pyruvate - L-lactaldehyde degradation (aerobic):
(S)-lactate + A ⟶ A(H2) + pyruvate - L-lactaldehyde degradation (aerobic):
(S)-lactate + A ⟶ A(H2) + pyruvate - L-rhamnose degradation II:
H2O + L-lactaldehyde + NADP+ ⟶ (S)-lactate + H+ + NADPH - methylglyoxal degradation V:
L-lactaldehyde + NADP+ ⟶ H+ + NADPH + methylglyoxal - L-lactaldehyde degradation (aerobic):
(S)-lactate + A ⟶ A(H2) + pyruvate - L-lactaldehyde degradation (aerobic):
(S)-lactate + an electron-transfer quinone ⟶ an electron-transfer quinol + pyruvate - L-lactaldehyde degradation (aerobic):
(S)-lactate + A ⟶ A(H2) + pyruvate - erythritol degradation II:
D-erythrulose 4-phosphate ⟶ D-erythrose 4-phosphate - D-threitol degradation:
D-erythrulose 4-phosphate ⟶ D-erythrose 4-phosphate - bacteriochlorophyll b biosynthesis:
ADP + an oxidized ferredoxin [iron-sulfur] cluster + bacteriochlorophyllide g + phosphate ⟶ 3,8-divinyl chlorophyllide a + ATP + H+ + H2O + a reduced ferredoxin [iron-sulfur] cluster - brassinosteroid biosynthesis III:
NAD+ + campesterol ⟶ NADH + campest-5-en-3-one - echinenone and zeaxanthin biosynthesis (Synechocystis):
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster - L-rhamnose degradation III:
L-rhamnofuranose + NAD+ ⟶ H+ + L-rhamnono-1,4-lactone + NADH - L-rhamnose degradation III:
L-rhamnofuranose + NADP+ ⟶ H+ + L-rhamnono-1,4-lactone + NADPH - dimethylsulfoniopropanoate biosynthesis II (Spartina):
3-dimethylsulfoniopropionaldehyde + H2O + NAD+ ⟶ DMSP + H+ + NADH - dimethylsulfoniopropanoate biosynthesis I (Wollastonia):
3-dimethylsulfoniopropionaldehyde + H2O + NAD+ ⟶ DMSP + H+ + NADH - dimethylsulfoniopropionate biosynthesis II (Spartina):
DMSP-amine + H2O + O2 ⟶ 3-dimethylsulfoniopropionaldehyde + H+ + ammonia + hydrogen peroxide - dimethylsulfoniopropionate biosynthesis I (Wollastonia):
H+ + S-methyl-L-methionine + a 2-oxo carboxylate ⟶ 3-dimethylsulfoniopropionaldehyde + CO2 + a proteinogenic amino acid - menthol biosynthesis:
(-)-menthone + NADP+ ⟶ (+)-pulegone + H+ + NADPH - L-arabinose degradation II:
NADP+ + xylitol ⟶ H+ + L-xylulose + NADPH - L-arabinose degradation II:
L-arabitol + NADP+ ⟶ H+ + L-arabinose + NADPH - chlorosalicylate degradation:
(2R)-2-chloro-2,5-dihydro-5-oxofuran-2-acetate + H2O ⟶ 2-maleylacetate + H+ + chloride - chlorosalicylate degradation:
(2R)-2-chloro-2,5-dihydro-5-oxofuran-2-acetate ⟶ CO2 + chloride + protoanemonin - limonene degradation I (D-limonene):
(1S,2S,4R)-limonene-1,2-diol + oxidized DCPIP ⟶ (1S,4R)-1-hydroxymenth-8-en-2-one + H+ + reduced DCPIP - superpathway of bacteriochlorophyll a biosynthesis:
131-oxo-magnesium-protoporphyrin IX 13-monomethyl ester + SAM ⟶ 3,8-divinyl protochlorophyllide a + 5'-deoxyadenosine + H+ + met - bacteriochlorophyll a biosynthesis:
an oxidized ferredoxin [iron-sulfur] cluster + chlorophyllide a ⟶ 3,8-divinyl chlorophyllide a + H+ + a reduced ferredoxin [iron-sulfur] cluster - gadusol biosynthesis:
SAM + desmethyl gadusol ⟶ H+ + SAH + gadusol - superpathway of C28 brassinosteroid biosynthesis:
6-deoxotyphasterol + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxotyphasterol + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxotyphasterol + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - D-xylose degradation V:
D-xylopyranose + NAD+ ⟶ D-xylono-1,5-lactone + H+ + NADH - 3-methylbutanol biosynthesis (engineered):
3-methylbutanol + NAD+ ⟶ 3-methylbutanal + H+ + NADH - L-leucine degradation III:
3-methylbutanol + NAD+ ⟶ 3-methylbutanal + H+ + NADH - leucine degradation III:
2-oxoglutarate + leu ⟶ 4-methyl-2-oxopentanoate + glu - leucine degradation:
2-oxoglutarate + leu ⟶ 4-methyl-2-oxopentanoate + glu - leucine degradation III:
4-methyl-2-oxopentanoate + H+ ⟶ 3-methylbutanal + CO2 - respiration (anaerobic)-- electron acceptors reaction list:
nitrite ⟶ ammonia - formaldehyde oxidation III (mycothiol-dependent):
S-formylmycothiol + H2O ⟶ H+ + formate + mycothiol - formaldehyde oxidation III (mycothiol-dependent):
S-formylmycothiol + H2O ⟶ H+ + formate + mycothiol - formaldehyde oxidation III (mycothiol-dependent):
S-formylmycothiol + H2O ⟶ H+ + formate + mycothiol - methylglyoxal degradation VII:
H2O + NAD+ + methylglyoxal ⟶ H+ + NADH + pyruvate - 2,2'-dihydroxyketocarotenoids biosynthesis:
H+ + NADH + O2 + adonixanthin ⟶ 2-hydroxyadonixanthin + H2O + NAD+ - 1,3-dichlorobenzene degradation:
(1R,2S)-3,5-dichlorocyclohexa-3,5-diene-1,2-diol + NAD+ ⟶ 3,5-dichlorocatechol + H+ + NADH - pinitol biosynthesis II:
myo-inositol + SAM ⟶ H+ + SAH + sequoyitol - toluene degradation to 2-hydroxypentadienoate (via toluene-cis-diol):
H+ + NADH + O2 + toluene ⟶ (1S,2R)-3-methylcyclohexa-3,5-diene-1,2-diol + NAD+ - 2,4-dichlorotoluene degradation:
2-(2,4-dichloro-5-oxofuran-2-yl)propanoate ⟶ 3,5-dichloro-2-methyl-muconate + H+ - 2,4-dichlorotoluene degradation:
2,4-dichlorotoluene + H+ + NADH + O2 ⟶ 4,6-dichloro-3-methyl-cis-1,2-dihydro-1,2-dihydroxycyclohexa-3,5-diene + NAD+ - β myrcene degradation:
(3S)-linalool ⟶ β-myrcene + H2O - phenylacetate degradation I (aerobic):
(3S)-hydroxyadipyl-CoA + NAD+ ⟶ 3-oxoadipyl-CoA + H+ + NADH - benzoyl-CoA degradation I (aerobic):
(3S)-hydroxyadipyl-CoA + NAD+ ⟶ 3-oxoadipyl-CoA + H+ + NADH - phenylacetate degradation I (aerobic):
ATP + coenzyme A + phenylacetate ⟶ AMP + diphosphate + phenylacetyl-CoA - 10-trans-heptadecenoyl-CoA degradation (reductase-dependent, yeast):
(3R)-hydroxy-undecanoyl-CoA + H2O + NAD+ + O2 + coenzyme A ⟶ (3R)-hydroxy-nonanoyl-CoA + H+ + NADH + acetyl-CoA + hydrogen peroxide - 10-trans-heptadecenoyl-CoA degradation (reductase-dependent):
4-trans-undecenoyl-CoA + O2 ⟶ 2-trans, 4-trans-undecadienoyl-CoA + hydrogen peroxide - tryptophan degradation via tryptamine:
H2O + O2 + tryptamine ⟶ (indol-3-yl)acetaldehyde + ammonium + hydrogen peroxide - L-tryptophan degradation X (mammalian, via tryptamine):
(indol-3-yl)acetaldehyde + H+ + NADPH ⟶ NADP+ + indole-3-ethanol - tryptophan degradation X (mammalian, via tryptamine):
H2O + O2 + tryptamine ⟶ H+ + ammonia + hydrogen peroxide + indole acetaldehyde - 4-nitrotoluene degradation II:
(S)-4-hydroxy-2-oxohexanoate + A ⟶ (3Z)-4-hydroxy-2-oxohexenoate + A(H2) - L-tyrosine degradation III:
4-tyrosol + NAD+ ⟶ (4-hydroxyphenyl)acetaldehyde + H+ + NADH - salidroside biosynthesis:
4-tyrosol + UDP-α-D-glucose ⟶ H+ + UDP + salidroside - tyrosine degradation:
pyruvate + tyr ⟶ 4-hydroxyphenylpyruvate + ala - salidroside biosynthesis:
4-tyrosol + UDP-α-D-glucose ⟶ H+ + UDP + salidroside - tyrosine degradation III:
pyruvate + tyr ⟶ 4-hydroxyphenylpyruvate + ala - D-galactose degradation II:
D-galactono-1,4-lactone + H2O ⟶ D-galactonate + H+ - D-galactose degradation II:
D-galactopyranose + NAD+ ⟶ D-galactono-1,4-lactone + H+ + NADH - 10-trans-heptadecenoyl-CoA degradation (MFE-dependent, yeast):
(3R)-hydroxy-nonanoyl-CoA ⟶ 2-trans-nonenoyl-CoA + H2O - 10-trans-heptadecenoyl-CoA degradation (MFE-dependent):
3-hydroxy-heptanoyl-CoA + H2O + NAD+ + O2 + coenzyme A ⟶ 3-hydroxypentanoyl-CoA + H+ + NADH + acetyl-CoA + hydrogen peroxide - superpathway of hexitol degradation (bacteria):
D-sorbitol 6-phosphate + NAD+ ⟶ keto-D-fructose 6-phosphate + H+ + NADH - D-sorbitol degradation II:
D-sorbitol 6-phosphate + NAD+ ⟶ keto-D-fructose 6-phosphate + H+ + NADH - D-sorbitol degradation II:
keto-D-fructose 6-phosphate ⟶ F6P - superpathway of hexitol degradation (bacteria):
keto-D-fructose 6-phosphate ⟶ F6P - 1,8-cineole degradation:
1,6,6-trimethyl-2,7-dioxobicyclo-(3,2,2)nonan-3-one ⟶ 4,5-dihydro-5,5-dimethyl-4-(3-oxobutyl)furan-2(3H)-one - 2-heptyl-3-hydroxy-4(1H)-quinolone biosynthesis:
(2-aminobenzoyl)acetate + H+ + a [PqsC protein]-S-octanoyl-L-cysteine ⟶ 1-(2-aminophenyl)decane-1,3-dione + CO2 + a [PqsC protein]-L-cysteine - superpathway of quinolone and alkylquinolone biosynthesis:
(2-aminobenzoyl)acetyl-CoA ⟶ 4-hydroxy-2(1H)-quinolone + coenzyme A - adenosine nucleotides degradation:
AMP + H2O ⟶ adenosine + phosphate - purine nucleotides degradation:
AMP + H2O ⟶ adenosine + phosphate - adenosine nucleotides degradation II:
inosine + phosphate ⟶ α-D-ribose-1-phosphate + hypoxanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation II (aerobic):
inosine + phosphate ⟶ α-D-ribose-1-phosphate + hypoxanthine - purine nucleobases degradation I (anaerobic):
3,5-dihydro-4H-imidazol-4-one + H2O ⟶ N-formimino-glycine - superpathway of purines degradation in plants:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - adenosine nucleotides degradation II:
AMP + H2O ⟶ adenosine + phosphate - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - adenosine nucleotides degradation II:
AMP + H2O ⟶ adenosine + phosphate - adenosine nucleotides degradation II:
H+ + H2O + adenosine ⟶ ammonium + inosine - adenosine nucleotides degradation II:
H+ + H2O + adenosine ⟶ ammonium + inosine - adenosine nucleotides degradation II:
H+ + H2O + adenosine ⟶ ammonium + inosine - purine nucleotides degradation II (aerobic):
H+ + H2O + adenosine ⟶ ammonium + inosine - adenosine nucleotides degradation II:
H+ + H2O + adenosine ⟶ ammonium + inosine - adenosine nucleotides degradation II:
H+ + H2O + adenosine ⟶ ammonium + inosine - purine nucleotides degradation II (aerobic):
H+ + H2O + adenosine ⟶ ammonium + inosine - adenosine nucleotides degradation II:
H+ + H2O + adenosine ⟶ ammonium + inosine - superpathway of purines degradation in plants:
H2O + O2 + urate ⟶ 5-hydroxyisourate + hydrogen peroxide - adenosine nucleotides degradation I:
H2O + xanthosine ⟶ D-ribofuranose + xanthine - adenosine nucleotides degradation II:
AMP + H2O ⟶ adenosine + phosphate - purine nucleotides degradation I (plants):
H2O + xanthosine ⟶ D-ribofuranose + xanthine - purine nucleobases degradation I (anaerobic):
ATP + acetate ⟶ ADP + acetyl phosphate - adenosine nucleotides degradation II:
AMP + H2O ⟶ adenosine + phosphate - purine nucleotides degradation II (aerobic):
AMP + H2O ⟶ adenosine + phosphate - adenosine nucleotides degradation II:
AMP + H2O ⟶ adenosine + phosphate - adenosine nucleotides degradation II:
AMP + H2O ⟶ adenosine + phosphate - adenosine nucleotides degradation II:
H+ + H2O + adenosine ⟶ ammonium + inosine - adenosine nucleotides degradation II:
AMP + H2O ⟶ adenosine + phosphate - adenosine nucleotides degradation I:
AMP + H2O ⟶ IMP + ammonia - purine nucleotides degradation III (anaerobic):
acetylphosphate + ammonia + an oxidized thioredoxin ⟶ a reduced thioredoxin + gly + phosphate - adenosine nucleotides degradation II:
H2O + adenosine ⟶ ammonia + inosine - purine nucleotides degradation II (aerobic):
H2O + adenosine ⟶ ammonia + inosine - adenosine nucleotides degradation II:
H2O + adenosine ⟶ ammonia + inosine - purine nucleobases degradation I (anaerobic):
4-ureido-5-imidazole carboxylate + H2O + H+ ⟶ 4-amino-5-imidazole carboxylate + CO2 + ammonia - purine nucleotides degradation II (aerobic):
H2O + adenosine ⟶ ammonia + inosine - adenosine nucleotides degradation II:
H+ + H2O + adenosine ⟶ ammonium + inosine - purine nucleotides degradation II (aerobic):
H+ + H2O + adenosine ⟶ ammonium + inosine - purine nucleobases degradation I (anaerobic):
ATP + acetate ⟶ ADP + acetyl phosphate - adenosine nucleotides degradation II:
H+ + H2O + adenosine ⟶ ammonium + inosine - purine nucleotides degradation II (aerobic):
H+ + H2O + adenosine ⟶ ammonium + inosine - adenosine nucleotides degradation II:
H+ + H2O + adenosine ⟶ ammonium + inosine - coelimycin P1 biosynthesis:
(2E,5S,6E,8E,10E)-1-aminododeca-2,6,8,10-tetraen-5-ol + pyruvate ⟶ (2E,5S,6E,8E,10E)-5-hydroxydodeca-2,6,8,10-tetraenal + ala - superpathway of cholesterol degradation II (cholesterol dehydrogenase):
3-hydroxy-9,10-secoandrosta-1,3,5(10)-triene-9,17-dione + FMNH2 + O2 ⟶ 3,4-dihydroxy-9,10-secoandrosta-1,3,5(10)-triene-9,17-dione + FMN + H+ + H2O - cholesterol degradation to androstenedione II (cholesterol dehydrogenase):
17-hydroxy-3-oxo-4-pregnane-20-carboxyl-CoA ⟶ androst-4-ene-3,17-dione + propanoyl-CoA - superpathway of cholesterol degradation II (cholesterol dehydrogenase):
3,4-dihydroxy-9,10-secoandrosta-1,3,5(10)-triene-9,17-dione + O2 ⟶ (1E,2Z)-3-hydroxy-5,9,17-trioxo-4,5:9,10-disecoandrosta-1 (10),2-dien-4-oate + H+ - cholesterol degradation to androstenedione II (cholesterol dehydrogenase):
17-hydroxy-3-oxo-4-pregnane-20-carboxyl-CoA ⟶ androst-4-ene-3,17-dione + propanoyl-CoA - cholesterol degradation to androstenedione II (cholesterol dehydrogenase):
17-hydroxy-3-oxo-4-pregnane-20-carboxyl-CoA ⟶ androst-4-ene-3,17-dione + propanoyl-CoA - cholesterol degradation to androstenedione II (cholesterol dehydrogenase):
NAD+ + cholesterol ⟶ H+ + NADH + cholest-5-en-3-one - superpathway of cholesterol degradation II (cholesterol dehydrogenase):
NAD+ + cholesterol ⟶ H+ + NADH + cholest-5-en-3-one - ascorbate recycling (cytosolic):
H+ + NADPH + monodehydroascorbate radical ⟶ H+ + L-ascorbate + NADP+ - ascorbate recycling (cytosolic):
monodehydroascorbate radical ⟶ H+ + L-ascorbate + L-dehydro-ascorbate - 1,2-dichloroethane degradation:
1,2-dichloroethane + H2O ⟶ 2-chloroethanol + H+ + chloride - 1,2-dichloroethane degradation:
H2O + chloroacetate ⟶ H+ + chloride + glycolate - 1,2-dichloroethane degradation:
H2O + chloroacetate ⟶ H+ + chloride + glycolate - 1,2-dichloroethane degradation:
1,2-dichloroethane + H2O ⟶ 2-chloroethanol + H+ + chloride - 1,2-dichloroethane degradation:
1,2-dichloroethane + H2O ⟶ 2-chloroethanol + H+ + chloride - 1,2-dichloroethane degradation:
H2O + chloroacetate ⟶ H+ + chloride + glycolate - indolmycin biosynthesis:
(S)-1-pyrroline-5-carboxylate + H+ + H2O ⟶ L-glutamate-5-semialdehyde - ethylene glycol biosynthesis (engineered):
H+ + NADPH + glycolaldehyde ⟶ NADP+ + ethylene glycol - cholesterol degradation to androstenedione I (cholesterol oxidase):
17-hydroxy-3-oxo-4-pregnane-20-carboxyl-CoA ⟶ androst-4-ene-3,17-dione + propanoyl-CoA - superpathway of cholesterol degradation I (cholesterol oxidase):
O2 + cholesterol ⟶ cholest-5-en-3-one + hydrogen peroxide - cholesterol degradation to androstenedione I (cholesterol oxidase):
O2 + cholesterol ⟶ cholest-5-en-3-one + hydrogen peroxide - (S)-propane-1,2-diol degradation:
(S)-propane-1,2-diol ⟶ 1-propanal + H2O - L-1,2-propanediol degradation:
NAD+ + coenzyme A + propanal ⟶ H+ + NADH + propanoyl-CoA - L-1,2-propanediol degradation:
phosphate + propanoyl-CoA ⟶ coenzyme A + propanoyl phosphate - L-carnitine degradation III:
H+ + L-carnitine + NAD(P)H + O2 ⟶ H2O + L-malic semialdehyde + NAD(P)+ + trimethylamine - anaerobic energy metabolism (invertebrates, mitochondrial):
ATP + hydrogencarbonate + propanoyl-CoA ⟶ (S)-methylmalonyl-CoA + ADP + H+ + phosphate - superpathway of anaerobic energy metabolism (invertebrates):
ATP + hydrogencarbonate + propanoyl-CoA ⟶ (S)-methylmalonyl-CoA + ADP + H+ + phosphate - gluconeogenesis I:
β-D-fructose 1,6-bisphosphate ⟶ D-glyceraldehyde 3-phosphate + DHAP - L-histidine biosynthesis:
H2O + L-histidinol phosphate ⟶ histidinol + phosphate - puromycin biosynthesis:
3'-amino-3'-deoxyadenosine + tyr ⟶ N6,N6,O-tridemethylpuromycin + H2O - L-malate degradation II:
(S)-malate + NAD+ ⟶ CO2 + NADH + pyruvate - C4 photosynthetic carbon assimilation cycle, NAD-ME type:
H+ + hydrogencarbonate ⟶ CO2 + H2O - gluconeogenesis I:
(S)-malate + NADP+ ⟶ CO2 + NADPH + pyruvate - L-histidine biosynthesis:
2-oxoglutarate + L-histidinol phosphate ⟶ glu + imidazole acetol-phosphate - rebeccamycin biosynthesis:
4'-O-demethylrebeccamycin + SAM ⟶ H+ + SAH + rebeccamycin - toluene degradation to 2-hydroxypentadienoate I (via o-cresol):
H+ + NADH + O2 + toluene ⟶ 2-methylphenol + H2O + NAD+ - phenylalanine degradation/tyrosine biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + NAD+ ⟶ H+ + L-erythro-7,8-dihydrobiopterin + NADH - L-phenylalanine degradation I (aerobic):
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + NAD+ ⟶ H+ + L-erythro-7,8-dihydrobiopterin + NADH - L-phenylalanine degradation I (aerobic):
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + NAD+ ⟶ H+ + L-erythro-7,8-dihydrobiopterin + NADH - L-phenylalanine degradation I (aerobic):
(6R)-4a-hydroxy-tetrahydrobiopterin ⟶ H2O + L-erythro-7,8-dihydrobiopterin - 2,6-dinitrotoluene degradation:
2,6-dinitrotoluene + NADH + O2 ⟶ 3-methyl-4-nitrocatechol + NAD+ + nitrite - 1,4-dimethylbenzene degradation to 4-methylbenzoate:
1,4-dimethylbenzene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ 4-methylbenzyl alcohol + H2O + an oxidized ferredoxin [iron-sulfur] cluster - 1,3-dimethylbenzene degradation to 3-methylbenzoate:
1,3-dimethylbenzene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ 3-methylbenzyl alcohol + H2O + an oxidized ferredoxin [iron-sulfur] cluster - 4-hydroxybenzoate biosynthesis III (plants):
3S-(4-hydroxyphenyl)-3-hydroxy-propanoyl-CoA + NAD+ ⟶ 4-hydroxybenzoyl-acetyl-CoA + H+ + NADH - purine nucleobases degradation II (anaerobic):
3,5-dihydro-4H-imidazol-4-one + H2O ⟶ N-formimino-glycine - Entner-Doudoroff pathway II (non-phosphorylative):
α-D-glucose ⟶ β-D-glucose - superpathway of cholesterol degradation I (cholesterol oxidase):
3-hydroxy-9,10-secoandrosta-1,3,5(10)-triene-9,17-dione + FMNH2 + O2 ⟶ 3,4-dihydroxy-9,10-secoandrosta-1,3,5(10)-triene-9,17-dione + FMN + H+ + H2O - androstenedione degradation:
3-hydroxy-9,10-secoandrosta-1,3,5(10)-triene-9,17-dione + FMNH2 + O2 ⟶ 3,4-dihydroxy-9,10-secoandrosta-1,3,5(10)-triene-9,17-dione + FMN + H+ + H2O - superpathway of testosterone and androsterone degradation:
3-hydroxy-9,10-secoandrosta-1,3,5(10)-triene-9,17-dione + FMNH2 + O2 ⟶ 3,4-dihydroxy-9,10-secoandrosta-1,3,5(10)-triene-9,17-dione + FMN + H+ + H2O - androstenedione degradation:
3,4-dihydroxy-9,10-secoandrosta-1,3,5(10)-triene-9,17-dione + O2 ⟶ (1E,2Z)-3-hydroxy-5,9,17-trioxo-4,5:9,10-disecoandrosta-1 (10),2-dien-4-oate + H+ - androstenedione degradation:
5-hydroxy-3-[(3aS,4S,5R,7aS)-7a-methyl-1,5-dioxo-octahydro-1H-inden-4-yl]propanoyl-CoA + NADP+ ⟶ 3-[(3aS,4S,7aS)-7a-methyl-1,5-dioxo-octahydro-1H-inden-4-yl]propanoyl-CoA + H+ + NADPH - androstenedione degradation:
5-hydroxy-3-[(3aS,4S,5R,7aS)-7a-methyl-1,5-dioxo-octahydro-1H-inden-4-yl]propanoyl-CoA + NADP+ ⟶ 3-[(3aS,4S,7aS)-7a-methyl-1,5-dioxo-octahydro-1H-inden-4-yl]propanoyl-CoA + H+ + NADPH - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis II (CoA-independent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - mandelate degradation I:
H+ + phenylglyoxylate ⟶ CO2 + benzaldehyde - benzoate biosynthesis II (CoA-independent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - mandelate degradation I:
H2O + NADP+ + benzaldehyde ⟶ H+ + NADPH + benzoate - m-cresol degradation:
3-hydroxybenzyl alcohol + NAD+ ⟶ 3-hydroxybenzaldehyde + H+ + NADH - 2-hydroxybiphenyl degradation:
O2 + biphenyl-2,3-diol ⟶ 2-hydroxy-6-oxo-6-phenylhexa-2,4-dienoate + H+ - L-homomethionine biosynthesis:
4-(methylsulfanyl)-2-oxobutanoate + H2O + acetyl-CoA ⟶ 2-[(2'-methylsulfanyl)ethyl]malate + H+ + coenzyme A - bixin biosynthesis:
SAM + bixin ⟶ SAH + bixin dimethyl ester - noscapine biosynthesis:
(S)-canadine + SAM ⟶ (S)-N-methylcanadine + SAH - juglone degradation:
3,5-dihydroxy-1,4-naphthoquinol + H2O + O2 ⟶ 2,3-dihydroxybenzoate + H+ + pyruvate - folate transformations I:
NAD+ + gly + tetrahydrofolate ⟶ 5,10-methylenetetrahydrofolate + CO2 + H+ + NADH + ammonia - formylTHF biosynthesis I:
NAD+ + gly + tetrahydrofolate ⟶ 5,10-methylenetetrahydrofolate + CO2 + H+ + NADH + ammonia - diadinoxanthin and fucoxanthin biosynthesis:
acetyl-CoA + fucoxanthinol ⟶ coenzyme A + fucoxanthin - (-)-dehydrodiconiferyl alcohol degradation:
(-)-dehydrodiconiferyl acid aldehyde gem-diol + an electron-transfer quinone ⟶ (-)-dehydrodiconiferyl acid carboxylate + H+ + an electron-transfer quinol - histamine degradation:
H2O + O2 + histamine ⟶ ammonium + hydrogen peroxide + imidazole acetaldehyde - histamine degradation:
SAM + histamine ⟶ Nτ-methylhistamine + H+ + SAH - 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - GABA shunt:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - succinate fermentation to butanoate:
acetate + butanoyl-CoA ⟶ acetyl-CoA + butanoate - 4-aminobutanoate degradation V:
acetate + butanoyl-CoA ⟶ acetyl-CoA + butanoate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - GABA shunt:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - N-methylpyrrolidone degradation:
4-methylaminobutanoate + H2O + O2 ⟶ hydrogen peroxide + methylamine + succinate semialdehyde - superpathway of L-arginine, putrescine, and 4-aminobutanoate degradation:
H2O + agmatine ⟶ putrescine + urea - superpathway of L-arginine and L-ornithine degradation:
4-aminobutanal ⟶ 1-pyrroline + H2O - L-glutamate degradation IV:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - superpathway of L-arginine, putrescine, and 4-aminobutanoate degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ 4-(γ-L-glutamylamino)butanal + ammonium + hydrogen peroxide - superpathway of L-arginine and L-ornithine degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ 4-(γ-L-glutamylamino)butanal + ammonium + hydrogen peroxide - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - L-glutamate degradation IV:
4-hydroxybutanoate + NAD(P)+ ⟶ H+ + NAD(P)H + succinate semialdehyde - 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - superpathway of 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - GABA shunt:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - superpathway of 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - superpathway of arginine, putrescine, and 4-aminobutyrate degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ 4-(γ-glutamylamino)butanal + ammonium + hydrogen peroxide - superpathway of arginine and ornithine degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ 4-(γ-glutamylamino)butanal + ammonium + hydrogen peroxide - superpathway of 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - superpathway of 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - superpathway of arginine, putrescine, and 4-aminobutyrate degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ 4-(γ-glutamylamino)butanal + ammonium + hydrogen peroxide - superpathway of arginine and ornithine degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ 4-(γ-glutamylamino)butanal + ammonium + hydrogen peroxide - 4-aminobutyrate degradation V:
H2O + NAD+ + glt ⟶ 2-oxoglutarate + H+ + NADH + ammonia - superpathway of 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation V:
H2O + NAD+ + glt ⟶ 2-oxoglutarate + H+ + NADH + ammonia - 4-aminobutanoate degradation V:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - succinate fermentation to butanoate:
acetate + butanoyl-CoA ⟶ acetyl-CoA + butanoate - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - succinate fermentation to butanoate:
acetate + succinyl-CoA ⟶ acetyl-CoA + succinate - 4-aminobutanoate degradation V:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - abietic acid biosynthesis:
(+)-copalyl diphosphate ⟶ abieta-7,13-diene + diphosphate - superpathway of diterpene resin acids biosynthesis:
(+)-copalyl diphosphate ⟶ abieta-7,13-diene + diphosphate - guaiacylglycerol-β-guaiacyl ether degradation:
(2R)-3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-2-(2-methoxyphenoxy)propan-1-one + glutathione ⟶ (2R)-2-(glutathion-S-yl)-3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)propan-1-one + guaiacol - 3-chlorotoluene degradation I:
(1R,2S)-5-chloro-3-methylcyclohexa-3,5-diene-1,2-diol + NAD+ ⟶ 5-chloro-3-methylcatechol + H+ + NADH - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3R-hydroxyoctanoyl)-CoA + NAD+ ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxooctanoyl)-CoA + H+ + NADH - formaldehyde oxidation V (bacillithiol-dependent):
bacillithiol + formaldehyde ⟶ S-(hydroxymethyl)bacillithiol - formaldehyde oxidation V (bacillithiol-dependent):
S-formylbacillithiol + H2O ⟶ H+ + bacillithiol + formate - D-erythronate degradation I:
4-phospho-D-erythronate + NAD+ ⟶ 3-dehydro-4-phospho-D-erythronate + H+ + NADH - diphenyl ethers degradation:
O2 + diphenyl ether 2,3-diol ⟶ (2Z,4E)-2-hydroxy-6-oxo-6-phenoxyhexa-2,4-dienoate + H+ - D-threonate degradation:
4-phospho-D-threonate + NAD+ ⟶ 3-dehydro-4-phospho-L-erythronate + H+ + NADH - 4-chloronitrobenzene degradation:
2-amino-5-chlorophenol + O2 ⟶ (2Z,4Z)-2-amino-5-chloro-6-oxohexa-2,4-dienoate + H+ - oleate β-oxidation (isomerase-dependent, yeast):
(2E,5Z)-tetradecenoyl-CoA + H2O + O2 + coenzyme A ⟶ (3Z)-dodec-3-enoyl-CoA + acetyl-CoA + hydrogen peroxide - oleate β-oxidation (isomerase-dependent):
(2E,5Z)-tetradecenoyl-CoA + H2O + O2 + coenzyme A ⟶ (3Z)-dodec-3-enoyl-CoA + acetyl-CoA + hydrogen peroxide - folate transformations I:
NAD+ + a tetrahydrofolate + gly ⟶ CO2 + NADH + a 5,10-methylenetetrahydrofolate + ammonium - ethylene biosynthesis IV (engineered):
2-oxoglutarate + H+ + O2 ⟶ CO2 + H2O + ethene - methylaspartate cycle:
ATP + hydrogencarbonate + propanoyl-CoA ⟶ (S)-methylmalonyl-CoA + ADP + H+ + phosphate - superpathway of L-lysine degradation:
acetoacetate + butanoyl-CoA ⟶ acetoacetyl-CoA + butanoate - L-lysine degradation VIII:
H2O + NAD+ + lys ⟶ H+ + NADH + allysine + ammonium - L-alanine degradation IV:
H2O + NAD+ + ala ⟶ H+ + NADH + ammonium + pyruvate - L-alanine degradation II (to D-lactate):
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - orthanilate degradation:
(2Z,4E)-2-hydroxy-6-oxo-6-sulfonatohexa-2,4-dienoate + H2O ⟶ (2Z,4E)-2-hydroxyhexa-2,4-dienedioate + H+ + sulfite - L-alanine fermentation to propanoate and acetate:
(R)-lactate + propanoyl-CoA ⟶ (R)-lactoyl-CoA + propanoate - L-glutamate degradation V (via hydroxyglutarate):
acetate + butanoyl-CoA ⟶ acetyl-CoA + butanoate - L-lysine fermentation to acetate and butanoate:
acetoacetate + butanoyl-CoA ⟶ acetoacetyl-CoA + butanoate - N10-formyl-tetrahydrofolate biosynthesis:
L-homocysteine + a 5-methyltetrahydrofolate ⟶ a tetrahydrofolate + met - folate transformations II:
NAD+ + a tetrahydrofolate + gly ⟶ CO2 + NADH + a 5,10-methylenetetrahydrofolate + ammonium - folate transformations I:
a tetrahydrofolate + trimethyl sulfonium ⟶ H+ + a 5-methyltetrahydrofolate + dimethyl sulfide - L-pyrrolysine biosynthesis:
(2R,3R)-3-methylornithinyl-N6-lysine + NAD+ ⟶ H+ + L-pyrrolysine + NADH + ammonium - chorismate biosynthesis II (archaea):
NADP+ + shikimate ⟶ 3-dehydroshikimate + H+ + NADPH - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - 3-dehydroquinate biosynthesis II (archaea):
enolaldehyde ⟶ methylglyoxal - N10-formyl-tetrahydrofolate biosynthesis:
NAD+ + a tetrahydrofolate + gly ⟶ CO2 + NADH + a 5,10-methylenetetrahydrofolate + ammonium - folate transformations:
NAD+ + a tetrahydrofolate + gly ⟶ CO2 + NADH + a 5,10-methylenetetrahydrofolate + ammonium - folate interconversions:
NAD+ + a tetrahydrofolate + gly ⟶ CO2 + NADH + a 5,10-methylenetetrahydrofolate + ammonium - glutamate degradation to 2-oxoglutarate:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
NAD+ + a tetrahydrofolate + gly ⟶ CO2 + NADH + a 5,10-methylenetetrahydrofolate + ammonium - L-alanine degradation IV:
H2O + NAD+ + ala ⟶ H+ + NADH + ammonium + pyruvate - folate transformations I:
NAD+ + a tetrahydrofolate + gly ⟶ CO2 + NADH + a 5,10-methylenetetrahydrofolate + ammonium - folate transformations II:
NAD+ + a tetrahydrofolate + gly ⟶ CO2 + NADH + a 5,10-methylenetetrahydrofolate + ammonium - N10-formyl-tetrahydrofolate biosynthesis:
NAD+ + a tetrahydrofolate + gly ⟶ CO2 + NADH + a 5,10-methylenetetrahydrofolate + ammonium - N10-formyl-tetrahydrofolate biosynthesis:
NAD+ + a tetrahydrofolate + gly ⟶ CO2 + NADH + a 5,10-methylenetetrahydrofolate + ammonium - folate transformations I:
NAD+ + a tetrahydrofolate + gly ⟶ CO2 + NADH + a 5,10-methylenetetrahydrofolate + ammonium - L-alanine degradation IV:
H2O + NAD+ + ala ⟶ H+ + NADH + ammonium + pyruvate - N10-formyl-tetrahydrofolate biosynthesis:
NAD+ + a tetrahydrofolate + gly ⟶ CO2 + NADH + a 5,10-methylenetetrahydrofolate + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - N10-formyl-tetrahydrofolate biosynthesis:
NAD+ + a tetrahydrofolate + gly ⟶ CO2 + NADH + a 5,10-methylenetetrahydrofolate + ammonium - L-alanine degradation IV:
H2O + NAD+ + ala ⟶ H+ + NADH + ammonium + pyruvate - folate transformations I:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - formylTHF biosynthesis I:
NADP+ + a 5,10-methylenetetrahydrofolate ⟶ NADPH + a 5,10-methenyltetrahydrofolate - glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - alanine degradation IV:
H2O + NAD+ + ala ⟶ H+ + NADH + ammonium + pyruvate - folate transformations I:
10-formyl-tetrahydrofolate + H2O ⟶ H+ + formate + tetrahydrofolate - formylTHF biosynthesis:
10-formyl-tetrahydrofolate + H2O ⟶ H+ + formate + tetrahydrofolate - formylTHF biosynthesis:
10-formyl-tetrahydrofolate + H2O ⟶ H+ + formate + tetrahydrofolate - folate transformations I:
10-formyl-tetrahydrofolate + H2O ⟶ H+ + formate + tetrahydrofolate - formylTHF biosynthesis I:
10-formyl-tetrahydrofolate + H2O ⟶ H+ + formate + tetrahydrofolate - folate transformations II:
ATP + formate + tetrahydrofolate ⟶ 10-formyl-tetrahydrofolate + ADP + phosphate - folate transformations I:
10-formyl-tetrahydrofolate + H2O ⟶ H+ + formate + tetrahydrofolate - alanine degradation IV:
H2O + NAD+ + ala ⟶ H+ + NADH + ammonium + pyruvate - lysine fermentation to acetate and butyrate:
ATP + acetate ⟶ ADP + acetyl phosphate - N10-formyl-tetrahydrofolate biosynthesis:
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate - folate transformations I:
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate - L-glutamate degradation I:
H2O + NAD+ + glt ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation IV:
H2O + NAD+ + ala ⟶ H+ + NADH + ammonium + pyruvate - L-lysine fermentation to acetate and butanoate:
ATP + acetate ⟶ ADP + acetyl phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations I:
a tetrahydrofolate + trimethyl sulfonium ⟶ H+ + a 5-methyltetrahydrofolate + dimethyl sulfide - N10-formyl-tetrahydrofolate biosynthesis:
NAD+ + a tetrahydrofolate + gly ⟶ CO2 + NADH + a 5,10-methylenetetrahydrofolate + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - N10-formyl-tetrahydrofolate biosynthesis:
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate - folate transformations I:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation IV:
H2O + NAD+ + ala ⟶ H+ + NADH + ammonium + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - aspartate degradation:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - glutamate degradation:
H2O + NAD+ + glt ⟶ 2-oxoglutarate + H+ + NADH + ammonium - N10-formyl-tetrahydrofolate biosynthesis:
NADP+ + a 5,10-methylenetetrahydrofolate ⟶ NADPH + a 5,10-methenyltetrahydrofolate - folate transformations I:
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate - L-alanine degradation IV:
H2O + NAD+ + ala ⟶ H+ + NADH + ammonium + pyruvate - folate transformations I:
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate - N10-formyl-tetrahydrofolate biosynthesis:
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate - L-alanine degradation IV:
H2O + NAD+ + ala ⟶ H+ + NADH + ammonium + pyruvate - L-tryptophan degradation XI (mammalian, via kynurenine):
O2 + trp ⟶ N-formylkynurenine - N10-formyl-tetrahydrofolate biosynthesis:
NADP+ + a 5,10-methylenetetrahydrofolate ⟶ NADPH + a 5,10-methenyltetrahydrofolate - folate transformations I:
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate - 2-amino-3-carboxymuconate semialdehyde degradation to glutaryl-CoA:
H+ + aminocarboxymuconate semialdehyde ⟶ 2-aminomuconate 6-semialdehyde + CO2 - L-tryptophan degradation III (eukaryotic):
O2 + trp ⟶ N-formylkynurenine - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-alanine degradation IV:
H2O + NAD+ + ala ⟶ H+ + NADH + ammonium + pyruvate - N10-formyl-tetrahydrofolate biosynthesis:
NADP+ + a 5,10-methylenetetrahydrofolate ⟶ NADPH + a 5,10-methenyltetrahydrofolate - folate transformations I:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - formylTHF biosynthesis:
10-formyl-tetrahydrofolate + H2O ⟶ H+ + formate + tetrahydrofolate - formylTHF biosynthesis:
10-formyl-tetrahydrofolate + H2O ⟶ H+ + formate + tetrahydrofolate - formylTHF biosynthesis:
10-formyl-tetrahydrofolate + H2O ⟶ H+ + formate + tetrahydrofolate - folate transformations I:
ATP + formate + tetrahydrofolate ⟶ 10-formyl-tetrahydrofolate + ADP + phosphate - formylTHF biosynthesis:
10-formyl-tetrahydrofolate + H2O ⟶ H+ + formate + tetrahydrofolate - folate transformations I:
ATP + formate + tetrahydrofolate ⟶ 10-formyl-tetrahydrofolate + ADP + phosphate - formylTHF biosynthesis:
10-formyl-tetrahydrofolate + H2O ⟶ H+ + formate + tetrahydrofolate - L-glutamate degradation I:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ Glu + pyruvate - folate transformations I:
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate - N10-formyl-tetrahydrofolate biosynthesis:
NADP+ + a 5,10-methylenetetrahydrofolate ⟶ NADPH + a 5,10-methenyltetrahydrofolate - folate transformations I:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - N10-formyl-tetrahydrofolate biosynthesis:
NADP+ + a 5,10-methylenetetrahydrofolate ⟶ NADPH + a 5,10-methenyltetrahydrofolate - alanine degradation IV:
H2O + NAD+ + ala ⟶ H+ + NADH + ammonium + pyruvate - N10-formyl-tetrahydrofolate biosynthesis:
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate - folate transformations I:
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate - L-glutamate degradation I:
H2O + NAD+ + glt ⟶ 2-oxoglutarate + H+ + NADH + ammonium - N10-formyl-tetrahydrofolate biosynthesis:
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate - L-glutamate degradation I:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation IV:
H2O + NAD+ + ala ⟶ H+ + NADH + ammonium + pyruvate - L-glutamate degradation V (via hydroxyglutarate):
(R)-2-hydroxyglutarate + NAD+ ⟶ 2-oxoglutarate + H+ + NADH - N10-formyl-tetrahydrofolate biosynthesis:
NADP+ + a 5,10-methylenetetrahydrofolate ⟶ NADPH + a 5,10-methenyltetrahydrofolate - L-glutamate degradation I:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate degradation I:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate degradation I:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation IV:
H2O + NAD+ + ala ⟶ H+ + NADH + ammonium + pyruvate - folate transformations I:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - N10-formyl-tetrahydrofolate biosynthesis:
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate - 3-dehydroquinate biosynthesis II (archaea):
2-amino-3,7-dideoxy-D-threo-hept-6-ulosonate + H2O + NAD+ ⟶ 3-dehydroquinate + H+ + NADH + ammonium - chorismate biosynthesis II (archaea):
NADP+ + shikimate ⟶ 3-dehydroshikimate + H+ + NADPH - N10-formyl-tetrahydrofolate biosynthesis:
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ Glu + pyruvate - L-alanine degradation IV:
H2O + NAD+ + ala ⟶ H+ + NADH + ammonium + pyruvate - L-glutamate degradation I:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations I:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - N10-formyl-tetrahydrofolate biosynthesis:
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate - L-threonate degradation:
3-dehydro-L-erythronate + ATP ⟶ 3-dehydro-4-phospho-L-erythronate + ADP + H+ - D-erythronate degradation II:
3-dehydro-D-erythronate + ATP ⟶ 3-dehydro-4-phospho-D-erythronate + ADP + H+ - staphyloferrin B biosynthesis:
3-phospho-L-serine + glu ⟶ N-[(2S)-2-amino-2-carboxyethyl]-L-glutamate + phosphate - dapdiamides biosynthesis:
N-3-fumaramoyl-L-2,3-diaminopropanoate + ATP + val ⟶ ADP + H+ + dapdiamide A + phosphate - staphyloferrin B biosynthesis:
2-[(L-alanin-3-ylcarbamoyl)methyl]-3-(2-aminoethylcarbamoyl)-2-hydroxypropanoate + 2-oxoglutarate + ATP ⟶ AMP + H+ + diphosphate + staphyloferrin B - D-arabinose degradation I:
D-ribulose 1-phosphate ⟶ DHAP + glycolaldehyde - D-arabinose degradation I:
H2O + NAD+ + glycolaldehyde ⟶ H+ + NADH + glycolate - D-arabinose degradation I:
H2O + NAD+ + glycolaldehyde ⟶ H+ + NADH + glycolate - D-arabinose degradation I:
H2O + NAD+ + glycolaldehyde ⟶ H+ + NADH + glycolate - D-arabinose degradation I:
H2O + NAD+ + glycolaldehyde ⟶ H+ + NADH + glycolate - L-arabinose degradation IIIb:
2-dehydro-3-deoxy-L-arabinonate ⟶ glycolaldehyde + pyruvate - D-arabinose degradation I:
H2O + NAD+ + glycolaldehyde ⟶ H+ + NADH + glycolate - 4,5-dichlorocatechol degradation:
2-chloro-2-(2-chloro-5-oxofuran-2-yl)acetate ⟶ 5-chloro-trans-dienelactone + H+ + chloride - cholesterol degradation to androstenedione I (cholesterol oxidase):
17-hydroxy-3-oxo-4-pregnane-20-carboxyl-CoA ⟶ androst-4-ene-3,17-dione + propanoyl-CoA - cholesterol degradation to androstenedione I (cholesterol oxidase):
17-hydroxy-3-oxo-4-pregnane-20-carboxyl-CoA ⟶ androst-4-ene-3,17-dione + propanoyl-CoA - D-glucuronate degradation II:
β-D-glucuronate + NAD+ ⟶ D-glucaro-1,5-lactone + H+ + NADH - vanillin and vanillate degradation I:
H2O + NAD+ + vanillin ⟶ H+ + NADH + vanillate - pinoresinol degradation:
(+)-pinoresinol + A + H2O ⟶ (+)-6-hydroxypinoresinol + A(H2) - superpathway of vanillin and vanillate degradation:
H2O + NAD+ + vanillin ⟶ H+ + NADH + vanillate - vanillin and vanillate degradation I:
tetrahydrofolate + vanillate ⟶ 5-methyl-tetrahydrofolate + protocatechuate - fluoroacetate and fluorothreonine biosynthesis:
SAM + fluoride ⟶ 5'-deoxy-5'-fluoroadenosine + met - fluoroacetate and fluorothreonine biosynthesis:
5'-deoxy-5'-fluoroadenosine + phosphate ⟶ 5-fluoro-5-deoxy-D-ribose-1-phosphate + adenine - fluoroacetate and fluorothreonine biosynthesis:
5'-deoxy-5'-fluoroadenosine + phosphate ⟶ 5-fluoro-5-deoxy-D-ribose-1-phosphate + adenine - toluene degradation to benzoyl-CoA (anaerobic):
(R)-2-benzylsuccinate ⟶ fumarate + toluene - 2-nitrotoluene degradation:
2-nitrotoluene + NADH + O2 ⟶ 3-methylcatechol + NAD+ + nitrite - 4-hydroxyacetophenone degradation:
(4-hydroxyphenyl)acetate + H2O ⟶ acetate + hydroquinone - 4-nitrophenol degradation I:
4-nitrophenol + H+ + NAD(P)H + O2 ⟶ 1,4-benzoquinone + H2O + NAD(P)+ + nitrite - sitosterol degradation to androstenedione:
17-hydroxy-3-oxo-4-pregnane-20-carboxyl-CoA ⟶ androst-4-ene-3,17-dione + propanoyl-CoA - sitosterol degradation to androstenedione:
17-hydroxy-3-oxo-4-pregnane-20-carboxyl-CoA ⟶ androst-4-ene-3,17-dione + propanoyl-CoA - sitosterol degradation to androstenedione:
NAD+ + sitosterol ⟶ 3-oxo-24-ethyl-cholest-5-ene + H+ + NADH - indican biosynthesis:
cis-indole-2,3-dihydrodiol ⟶ H2O + indoxyl - indigo biosynthesis:
O2 + indoxyl ⟶ H2O + indigo
WikiPathways(0)
Plant Reactome(26)
- Metabolism and regulation:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pyridoxal 5'-phosphate biosynthesis:
Oxygen + PDXP ⟶ H2O2 + PXLP - Nucleotide metabolism:
ATP + R5P ⟶ AMP + PRPP - ureide biogenesis:
5-hydroxy-2-oxo-4-ureido-2,5-dihydro-1H imidazole-5-carboxylate ⟶ allantoin + carbon dioxide - Amino acid metabolism:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA - Amino acid biosynthesis:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Glycine betaine biosynthesis:
Cho + H+ + dioxygen ⟶ H2O + betaine aldehyde hydrate - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Hormone signaling, transport, and metabolism:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate + Oxygen ⟶ CH3COO- + jasmonic acid - ABA biosynthesis and mediated signaling:
H2O + Oxygen + abscisic aldehyde ⟶ ABA + H2O2 - ABA synthesis:
H2O + Oxygen + abscisic aldehyde ⟶ ABA + H2O2 - Abscisic acid homeostasis:
H2O + beta-D-glucopyranosyl abscisate ⟶ ABA + beta-D-glucose - Ascorbate biosynthesis:
L-galactono-1,4-lactone + an oxidized cytochrome c ⟶ VitC + a reduced cytochrome c - Inorganic nutrients metabolism:
Nitrite ⟶ H2O + ammonia - Nitrate assimilation:
Nitrite ⟶ H2O + ammonia - Beta-alanine biosynthesis II:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Ehrlich pathway:
L-Phe + PYR ⟶ L-Ala + phenylpyruvate - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Proline degradation:
FAD + L-Pro ⟶ 1PYR-5COOH + FADH2 - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Lysine biosynthesis II:
H2O + N-acetyl-L,L-2,6-diaminopimelate ⟶ CH3COO- + L,L-diaminopimelate - GABA shunt:
GABA + PYR ⟶ L-Ala + SUCCSA
INOH(0)
PlantCyc(4731)
- secologanin and strictosidine biosynthesis:
(6E)-8-oxogeranial + H+ + NAD(P)H ⟶ (+)-cis,trans-nepetalactol + NAD(P)+ - L-proline biosynthesis IV:
NAD(P)+ + pro ⟶ 1-pyrroline-2-carboxylate + H+ + NAD(P)H - justicidin B biosynthesis:
NAD+ + collinusin ⟶ H+ + NADH + justicidin B - nitrobenzene degradation II:
NADH + O2 + nitrobenzene ⟶ NAD+ + catechol + nitrite - nitrobenzene degradation II:
NADH + O2 + nitrobenzene ⟶ NAD+ + catechol + nitrite - mannitol degradation II:
D-mannitol + NAD+ ⟶ aldehydo-D-mannose + H+ + NADH - mannitol degradation II:
D-mannitol + NAD+ ⟶ aldehydo-D-mannose + H+ + NADH - mannitol degradation II:
aldehydo-D-mannose ⟶ D-mannopyranose - mannitol degradation II:
D-mannitol + NAD+ ⟶ aldehydo-D-mannose + H+ + NADH - mannitol degradation II:
aldehydo-D-mannose ⟶ D-mannopyranose - mannitol degradation II:
D-mannitol + NAD+ ⟶ aldehydo-D-mannose + H+ + NADH - mannitol degradation II:
aldehydo-D-mannose ⟶ D-mannopyranose - mannitol degradation II:
D-mannitol + NAD+ ⟶ aldehydo-D-mannose + H+ + NADH - mannitol degradation II:
D-mannitol + NAD+ ⟶ aldehydo-D-mannose + H+ + NADH - mannitol degradation II:
aldehydo-D-mannose ⟶ D-mannopyranose - mannitol degradation II:
aldehydo-D-mannose ⟶ D-mannopyranose - mannitol degradation II:
D-mannitol + NAD+ ⟶ aldehydo-D-mannose + H+ + NADH - mannitol degradation II:
D-mannitol + NAD+ ⟶ aldehydo-D-mannose + H+ + NADH - mannitol degradation II:
aldehydo-D-mannose ⟶ D-mannopyranose - mannitol degradation II:
aldehydo-D-mannose ⟶ D-mannopyranose - mannitol degradation II:
aldehydo-D-mannose ⟶ D-mannopyranose - mannitol degradation II:
D-mannitol + NAD+ ⟶ aldehydo-D-mannose + H+ + NADH - mannitol degradation II:
aldehydo-D-mannose ⟶ D-mannopyranose - mannitol degradation II:
D-mannitol + NAD+ ⟶ aldehydo-D-mannose + H+ + NADH - mannitol degradation II:
D-mannitol + NAD+ ⟶ aldehydo-D-mannose + H+ + NADH - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
(-)-secoisolariciresinol + NADP+ ⟶ (+)-lariciresinol + H+ + NADPH - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
(-)-secoisolariciresinol + NADP+ ⟶ (+)-lariciresinol + H+ + NADPH - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical - matairesinol biosynthesis:
(-)-secoisolariciresinol + NAD+ ⟶ (3R,4R)-3,4-bis(4-hydroxy-3-methoxybenzyl)tetrahydro-2-furanol + H+ + NADH - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I (plants):
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I (plants):
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I (plants):
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I (plants):
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I (plants):
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I (plants):
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I (plants):
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - alkane oxidation:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I (plants):
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I (plants):
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I (plants):
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - alkane oxidation:
O2 + an ω-hydroxy fatty acid ⟶ an ω-oxo fatty acid + hydrogen peroxide - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I (plants):
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H+ + a (2R)-2-hydroperoxyfatty acid ⟶ CO2 + H2O + a fatty aldehyde - alkane oxidation:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - alkane oxidation:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I (plants):
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - superpathway of ergosterol biosynthesis II:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - cholesterol biosynthesis I:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase] - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + acetyl-CoA ⟶ (3Z)-hex-3-en-1-yl acetate + coenzyme A - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - superpathway of lipoxygenase:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - superpathway of lipoxygenase:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - superpathway of lipoxygenase:
(Z)-hex-3-en-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - superpathway of lipoxygenase:
9(S)-HPOTE ⟶ (2E,6Z)-non-2,6-dienal + 9-oxononanoate - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (3Z)-hexenal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - superpathway of lipoxygenase:
(3Z)-hex-3-en-1-ol + acetyl-CoA ⟶ (3Z)-hex-3-en-1-yl acetate + coenzyme A - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + acetyl-CoA ⟶ (3Z)-hex-3-en-1-yl acetate + coenzyme A - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (3Z)-hexenal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (3Z)-hexenal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (3Z)-hexenal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (3Z)-hexenal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (3Z)-hexenal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (3Z)-hexenal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
O2 + linoleate ⟶ (13S)-HPODE - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
O2 + linoleate ⟶ (13S)-HPODE - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
O2 + linoleate ⟶ (13S)-HPODE - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
O2 + linoleate ⟶ (13S)-HPODE - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
O2 + linoleate ⟶ (13S)-HPODE - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
O2 + linoleate ⟶ (13S)-HPODE - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
O2 + linoleate ⟶ (13S)-HPODE - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
O2 + linoleate ⟶ (13S)-HPODE - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
O2 + linoleate ⟶ (13S)-HPODE - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + acetyl-CoA ⟶ (3Z)-hex-3-en-1-yl acetate + coenzyme A - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
O2 + linoleate ⟶ (13S)-HPODE - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
O2 + linoleate ⟶ (13S)-HPODE - superpathway of lipoxygenase:
(3Z)-hex-3-en-1-ol + acetyl-CoA ⟶ (3Z)-hex-3-en-1-yl acetate + coenzyme A - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
O2 + linoleate ⟶ (13S)-HPODE - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
O2 + linoleate ⟶ (13S)-HPODE - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
O2 + linoleate ⟶ (13S)-HPODE - superpathway of lipoxygenase:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH - traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (3Z)-hexenal + H+ + NADH - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - adenosine nucleotides degradation I:
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - purine nucleotides degradation I (plants):
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - guanosine nucleotides degradation II:
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - superpathway of guanosine nucleotides degradation (plants):
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - superpathway of purines degradation in plants:
H2O + O2 + urate ⟶ (S)-5-hydroxyisourate + hydrogen peroxide - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - urate conversion to allantoin II:
H+ + NADH + O2 + urate ⟶ (S)-5-hydroxyisourate + H2O + NAD+ - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - inosine 5'-phosphate degradation:
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - guanosine nucleotides degradation II:
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - adenosine nucleotides degradation I:
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - superpathway of purines degradation in plants:
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - nucleobase ascorbate transport I:
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - ureide biosynthesis:
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - superpathway of guanosine nucleotides degradation (plants):
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - guanosine nucleotides degradation I:
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - purine nucleotides degradation I (plants):
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - superpathway of guanosine nucleotides degradation (plants):
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - urate conversion to allantoin II:
H+ + NADH + O2 + urate ⟶ (S)-5-hydroxyisourate + H2O + NAD+ - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - superpathway of purines degradation in plants:
H2O + O2 + urate ⟶ (S)-5-hydroxyisourate + hydrogen peroxide - inosine 5'-phosphate degradation:
phosphate + xanthosine ⟶ α-D-ribose-1-phosphate + xanthine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - ureide biosynthesis:
H2O + O2 + urate ⟶ (S)-5-hydroxyisourate + hydrogen peroxide - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - Organic Nitrogen Assimilation:
H2O + O2 + urate ⟶ CO2 + allantoin + hydrogen peroxide - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - guanosine nucleotides degradation II:
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - guanosine nucleotides degradation I:
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - adenosine nucleotides degradation I:
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - superpathway of purines degradation in plants:
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - guanosine nucleotides degradation I:
GMP + H2O ⟶ guanosine + phosphate - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - guanosine nucleotides degradation II:
H2O + guanosine ⟶ D-ribofuranose + guanine - purine nucleotides degradation I (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - superpathway of guanosine nucleotides degradation (plants):
H2O + guanosine ⟶ D-ribofuranose + guanine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - guanosine nucleotides degradation I:
H+ + H2O + guanosine ⟶ ammonium + xanthosine - superpathway of guanosine nucleotides degradation (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - guanosine nucleotides degradation II:
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + IMP ⟶ inosine + phosphate - adenosine nucleotides degradation II:
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - adenosine nucleotides degradation I:
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - inosine 5'-phosphate degradation:
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - ureide biosynthesis:
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - guanosine nucleotides degradation II:
H2O + NAD+ + xanthine ⟶ H+ + NADH + urate - Organic Nitrogen Assimilation:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln - glycerol degradation V:
NAD+ + glycerol ⟶ H+ + NADH + dihydroxyacetone - glycerol degradation V:
NAD+ + glycerol ⟶ H+ + NADH + dihydroxyacetone - glycerol degradation V:
NAD+ + glycerol ⟶ H+ + NADH + dihydroxyacetone - glycerol degradation V:
NAD+ + glycerol ⟶ H+ + NADH + dihydroxyacetone - glycerol degradation V:
NAD+ + glycerol ⟶ H+ + NADH + dihydroxyacetone - glycerol degradation V:
NAD+ + glycerol ⟶ H+ + NADH + dihydroxyacetone - glycerol degradation V:
NAD+ + glycerol ⟶ H+ + NADH + dihydroxyacetone - urate conversion to allantoin II:
(S)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline + H+ ⟶ (S)-(+)-allantoin + CO2 - urate conversion to allantoin II:
(S)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline + H+ ⟶ (S)-(+)-allantoin + CO2 - (4S)-carvone biosynthesis:
(4R)-limonene + H+ + NADPH + O2 ⟶ (+)-trans-carveol + H2O + NADP+ - (4S)-carvone biosynthesis:
(4R)-limonene + H+ + NADPH + O2 ⟶ (+)-trans-carveol + H2O + NADP+ - (4S)-carvone biosynthesis:
(+)-trans-carveol + NAD+ ⟶ (+)-carvone + H+ + NADH - (4S)-carvone biosynthesis:
(+)-trans-carveol + NAD+ ⟶ (+)-carvone + H+ + NADH - choline degradation I:
A + choline ⟶ A(H2) + betaine aldehyde - choline degradation I:
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster + choline ⟶ H2O + an oxidized ferredoxin [iron-sulfur] cluster + betaine aldehyde hydrate - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
betaine aldehyde hydrate ⟶ H2O + betaine aldehyde - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
betaine aldehyde hydrate ⟶ H2O + betaine aldehyde - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - glycine betaine biosynthesis III (plants):
H2O + NAD+ + betaine aldehyde ⟶ H+ + NADH + glycine betaine - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (plants, L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
α-D-mannose 1-phosphate + GTP + H+ ⟶ GDP-α-D-mannose + diphosphate - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (plants, L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (plants, L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (plants, L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (plants, L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (plants, L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (plants, L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (plants, L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (plants, L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (plants, L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (plants, L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (plants, L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (plants, L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
GDP-α-D-mannose ⟶ GDP-β-L-galactose - L-ascorbate biosynthesis I (plants, L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (plants, L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (plants, L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (plants, L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (plants, L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (plants, L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (plants, L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (plants, L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (plants, L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (plants, L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (plants, L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
GDP-α-D-mannose ⟶ GDP-β-L-galactose - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - L-ascorbate biosynthesis I (L-galactose pathway):
L-galactopyranose + NAD+ ⟶ H+ + L-galactono-1,4-lactone + NADH - juvenile hormone III biosynthesis I:
(2E,6E)-farnesol + NADP+ ⟶ (2E,6E)-farnesal + H+ + NADPH - sanguinarine and macarpine biosynthesis:
(S)-reticuline + O2 ⟶ (S)-scoulerine + H+ + hydrogen peroxide - sanguinarine and macarpine biosynthesis:
(S)-cis-N-methylstylopine + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H+ + H2O + an oxidized [NADPH-hemoprotein reductase] + protopine - superpathway of glyoxylate cycle and fatty acid degradation:
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - superpathway of glyoxylate cycle and fatty acid degradation:
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - superpathway of glyoxylate cycle and fatty acid degradation:
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a (2E)-alkan-2-enoyl-CoA + hydrogen peroxide - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + acetol ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + acetol - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal - methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone - xylitol degradation:
NAD+ + xylitol ⟶ D-xylulose + H+ + NADH - 6-gingerol analog biosynthesis (engineered):
O2 + octanoyl-CoA ⟶ (2E)-oct-2-enoyl-CoA + hydrogen peroxide - arsenate detoxification V:
D-glyceraldehyde 3-phosphate + NAD+ + arsenate ⟶ 1-arsono-3-phospho-D-glycerate + H+ + NADH - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
9'-cis-neoxanthin + O2 ⟶ (3S,5R,6R)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al + 2-cis,4-trans-xanthoxin - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
9'-cis-neoxanthin + O2 ⟶ (3S,5R,6R)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al + 2-cis,4-trans-xanthoxin - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
2-cis,4-trans-xanthoxin + NAD+ ⟶ (+)-cis-abscisic aldehyde + H+ + NADH - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
(+)-cis-abscisic aldehyde + H2O + O2 ⟶ 2-cis-abscisate + H+ + hydrogen peroxide - abscisic acid biosynthesis:
2-cis,4-trans-xanthoxin + NAD+ ⟶ (+)-cis-abscisic aldehyde + H+ + NADH - phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol - L-carnitine biosynthesis:
γ-butyrobetaine + 2-oxoglutarate + O2 ⟶ CO2 + L-carnitine + succinate - L-carnitine biosynthesis:
γ-butyrobetaine + 2-oxoglutarate + O2 ⟶ CO2 + L-carnitine + succinate - L-carnitine biosynthesis:
γ-butyrobetaine + 2-oxoglutarate + O2 ⟶ CO2 + L-carnitine + succinate - aliphatic glucosinolate biosynthesis, side chain elongation cycle:
3-isopropyl-8-(methylthio)-2-oxooctanoate + H+ ⟶ 8-(methylthio)-2-oxooctanoate + CO2 - aliphatic glucosinolate biosynthesis, side chain elongation cycle:
3-isopropyl-7-(methylthio)-2-oxoheptanoate + H+ ⟶ 7-(methylthio)-2-oxoheptanoate + CO2 - aliphatic glucosinolate biosynthesis, side chain elongation cycle:
3-isopropyl-6-(methylthio)-2-oxohexanoate + H+ ⟶ 6-(methylthio)-2-oxohexanoate + CO2 - aliphatic glucosinolate biosynthesis, side chain elongation cycle:
3-isopropyl-8-(methylthio)-2-oxooctanoate + H+ ⟶ 8-(methylthio)-2-oxooctanoate + CO2 - aliphatic glucosinolate biosynthesis, side chain elongation cycle:
3-isopropyl-8-(methylthio)-2-oxooctanoate + H+ ⟶ 8-(methylthio)-2-oxooctanoate + CO2 - aliphatic glucosinolate biosynthesis, side chain elongation cycle:
3-isopropyl-8-(methylthio)-2-oxooctanoate + H+ ⟶ 8-(methylthio)-2-oxooctanoate + CO2 - aliphatic glucosinolate biosynthesis, side chain elongation cycle:
3-isopropyl-8-(methylthio)-2-oxooctanoate + H+ ⟶ 8-(methylthio)-2-oxooctanoate + CO2 - aliphatic glucosinolate biosynthesis, side chain elongation cycle:
3-isopropyl-8-(methylthio)-2-oxooctanoate + H+ ⟶ 8-(methylthio)-2-oxooctanoate + CO2 - aliphatic glucosinolate biosynthesis, side chain elongation cycle:
3-isopropyl-7-(methylthio)-2-oxoheptanoate + H+ ⟶ 7-(methylthio)-2-oxoheptanoate + CO2 - aliphatic glucosinolate biosynthesis, side chain elongation cycle:
3-isopropyl-8-(methylthio)-2-oxooctanoate + H+ ⟶ 8-(methylthio)-2-oxooctanoate + CO2 - aliphatic glucosinolate biosynthesis, side chain elongation cycle:
3-[(5'-methylthio)pentyl]malate + NAD+ ⟶ 3-isopropyl-8-(methylthio)-2-oxooctanoate + H+ + NADH - aliphatic glucosinolate biosynthesis, side chain elongation cycle:
3-[(3'-methylthio)propyl]malate + NAD+ ⟶ 3-isopropyl-6-(methylthio)-2-oxohexanoate + H+ + NADH - aliphatic glucosinolate biosynthesis, side chain elongation cycle:
3-[(5'-methylthio)pentyl]malate + NAD+ ⟶ 3-isopropyl-8-(methylthio)-2-oxooctanoate + H+ + NADH - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
3-methyl-2-oxobutanoate + NAD+ + coenzyme A ⟶ CO2 + NADH + isobutanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
3-methyl-2-oxobutanoate + NAD+ + coenzyme A ⟶ CO2 + NADH + isobutanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
3-methyl-2-oxobutanoate + NAD+ + coenzyme A ⟶ CO2 + NADH + isobutanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - L-valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + hydrogencarbonate + propanoyl-CoA - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - Inorganic Nitrogen Assimilation:
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - nitrate reduction II (assimilatory):
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - Inorganic Nitrogen Assimilation:
H2O + NAD+ + nitrite ⟶ H+ + NADH + nitrate - hydrogen production II:
H2 + NAD+ ⟶ H+ + NADH - hydrogen oxidation II (aerobic, NAD):
H2 + NAD+ ⟶ H+ + NADH - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD(P)/NADPH interconversion:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD(P)/NADPH interconversion:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast):
H2O + NADP+ + an aldehyde ⟶ H+ + NADPH + a carboxylate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast):
H2O + NADP+ + an aldehyde ⟶ H+ + NADPH + a carboxylate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD(P)/NADPH interconversion:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD(P)/NADPH interconversion:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD(P)/NADPH interconversion:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD(P)/NADPH interconversion:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD(P)/NADPH interconversion:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD(P)/NADPH interconversion:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD(P)/NADPH interconversion:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD(P)/NADPH interconversion:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - NAD(P)/NADPH interconversion:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast):
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD(P)/NADPH interconversion:
NAD+ + NADPH ⟶ NADH + NADP+ - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast):
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD(P)/NADPH interconversion:
H2O + NADP+ ⟶ NAD+ + phosphate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD(P)/NADPH interconversion:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD(P)/NADPH interconversion:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD(P)/NADPH interconversion:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD(P)/NADPH interconversion:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - NAD(P)/NADPH interconversion:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - NAD(P)/NADPH interconversion:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD(P)/NADPH interconversion:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD(P)/NADPH interconversion:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD(P)/NADPH interconversion:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD(P)/NADPH interconversion:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD(P)/NADPH interconversion:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
UQH2 + an oxidized c-type cytochrome ⟶ H+ + UQ + a reduced c-type cytochrome - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration II (cytochrome c) (yeast):
H+ + NADH + UQ ⟶ NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - α-solanine/α-chaconine biosynthesis:
NAD+ + demissidine ⟶ H+ + NADH + solanid-3-one - α-solanine/α-chaconine biosynthesis:
NAD+ + demissidine ⟶ H+ + NADH + solanid-3-one - nostoxanthin biosynthesis:
H+ + NADH + O2 + zeaxanthin ⟶ H2O + NAD+ + caloxanthin - momilactone A biosynthesis:
3β-hydroxy-9β-pimara-7,15-diene-19,6β-olide + NAD(P)+ ⟶ H+ + NAD(P)H + momilactone A - momilactone A biosynthesis:
3β-hydroxy-9β-pimara-7,15-diene-19,6β-olide + NAD(P)+ ⟶ H+ + NAD(P)H + momilactone A - momilactone A biosynthesis:
(-)-9β-pimara-7,15-dien-19-ol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (-)-9β-pimara-7,15-dien-19-al + H2O + an oxidized [NADPH-hemoprotein reductase] - momilactone A biosynthesis:
3β-hydroxy-9β-pimara-7,15-diene-19,6β-olide + NAD(P)+ ⟶ H+ + NAD(P)H + momilactone A - momilactone A biosynthesis:
3β-hydroxy-9β-pimara-7,15-diene-19,6β-olide + NAD(P)+ ⟶ H+ + NAD(P)H + momilactone A - superpathway of photosynthetic hydrogen production:
H2 + an oxidized ferredoxin [iron-sulfur] cluster ⟶ H+ + a reduced ferredoxin [iron-sulfur] cluster - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - superpathway of anaerobic sucrose degradation:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - superpathway of anaerobic sucrose degradation:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - superpathway of anaerobic sucrose degradation:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - superpathway of anaerobic sucrose degradation:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation IV:
ethanol + hydrogen peroxide ⟶ H2O + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
H+ + pyruvate ⟶ CO2 + acetaldehyde - superpathway of anaerobic sucrose degradation:
β-D-fructofuranose + ATP ⟶ ADP + F6P + H+ - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation IV:
ethanol + hydrogen peroxide ⟶ H2O + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - superpathway of anaerobic sucrose degradation:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - superpathway of anaerobic sucrose degradation:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - superpathway of fermentation (Chlamydomonas reinhardtii):
H2 + an oxidized ferredoxin [iron-sulfur] cluster ⟶ H+ + a reduced ferredoxin [iron-sulfur] cluster - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - superpathway of anaerobic sucrose degradation:
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - superpathway of fermentation (Chlamydomonas reinhardtii):
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - acetaldehyde biosynthesis I:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
H2O + NAD+ + acetaldehyde ⟶ H+ + NADH + acetate - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - pyruvate fermentation to ethanol II:
H+ + pyruvate ⟶ CO2 + acetaldehyde - ethanol degradation II:
H2O + NAD+ + acetaldehyde ⟶ H+ + NADH + acetate - ethanol degradation II:
H2O + NAD+ + acetaldehyde ⟶ H+ + NADH + acetate - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
H2O + NAD+ + acetaldehyde ⟶ H+ + NADH + acetate - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
H2O + NAD+ + acetaldehyde ⟶ H+ + NADH + acetate - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
H2O + NAD+ + acetaldehyde ⟶ H+ + NADH + acetate - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
H2O + NAD+ + acetaldehyde ⟶ H+ + NADH + acetate - ethanol degradation II:
H2O + NAD+ + acetaldehyde ⟶ H+ + NADH + acetate - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ethanol degradation II:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - ferulate and sinapate biosynthesis:
5-hydroxy-coniferaldehyde + SAM ⟶ H+ + SAH + sinapaldehyde - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
ATP + H2O + XMP + gln ⟶ AMP + GMP + H+ + diphosphate + glu - superpathway of purine nucleotides de novo biosynthesis I:
ATP + H2O + XMP + gln ⟶ AMP + GMP + H+ + diphosphate + glu - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
SAICAR ⟶ AICAR + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2 - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
ATP + GMP ⟶ ADP + GDP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
ATP + GMP ⟶ ADP + GDP - superpathway of guanosine nucleotides de novo biosynthesis I:
ATP + GMP ⟶ ADP + GDP - guanosine ribonucleotides de novo biosynthesis:
ATP + GMP ⟶ ADP + GDP - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - superpathway of guanosine nucleotides de novo biosynthesis I:
ATP + H2O + XMP + gln ⟶ AMP + GMP + H+ + diphosphate + glu - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - guanosine ribonucleotides de novo biosynthesis:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I (plants):
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - fatty acid α-oxidation I:
H2O + NAD+ + a fatty aldehyde ⟶ H+ + NADH + a fatty acid - D-sorbitol degradation I:
D-sorbitol + NAD+ ⟶ keto-D-fructose + H+ + NADH - D-sorbitol degradation I:
keto-D-fructose ⟶ β-D-fructofuranose - D-sorbitol degradation I:
D-sorbitol + NAD+ ⟶ keto-D-fructose + H+ + NADH - D-sorbitol degradation I:
D-sorbitol + NAD+ ⟶ keto-D-fructose + H+ + NADH - D-sorbitol degradation I:
D-sorbitol + NAD+ ⟶ keto-D-fructose + H+ + NADH - D-sorbitol degradation I:
keto-D-fructose ⟶ β-D-fructofuranose - D-sorbitol degradation I:
D-sorbitol + NAD+ ⟶ keto-D-fructose + H+ + NADH - D-sorbitol degradation I:
D-sorbitol + NAD+ ⟶ keto-D-fructose + H+ + NADH - D-sorbitol degradation I:
D-sorbitol + NAD+ ⟶ keto-D-fructose + H+ + NADH - D-sorbitol degradation I:
D-sorbitol + NAD+ ⟶ keto-D-fructose + H+ + NADH - D-sorbitol degradation I:
D-sorbitol + NAD+ ⟶ keto-D-fructose + H+ + NADH - D-sorbitol degradation I:
keto-D-fructose ⟶ β-D-fructofuranose - D-sorbitol degradation I:
D-sorbitol + NAD+ ⟶ keto-D-fructose + H+ + NADH - D-sorbitol degradation I:
keto-D-fructose ⟶ β-D-fructofuranose - D-sorbitol degradation I:
keto-D-fructose ⟶ β-D-fructofuranose - D-sorbitol degradation I:
D-sorbitol + NAD+ ⟶ keto-D-fructose + H+ + NADH - D-sorbitol degradation I:
D-sorbitol + NAD+ ⟶ keto-D-fructose + H+ + NADH - D-sorbitol degradation I:
keto-D-fructose ⟶ β-D-fructofuranose - D-sorbitol degradation I:
D-sorbitol + NAD+ ⟶ keto-D-fructose + H+ + NADH - D-sorbitol degradation I:
D-sorbitol + NAD+ ⟶ keto-D-fructose + H+ + NADH - L-lysine degradation I:
5-aminopentanal + H2O + NAD+ ⟶ 5-aminopentanoate + H+ + NADH - L-lysine degradation I:
2-oxoglutarate + cadaverine ⟶ 5-aminopentanal + D-or-L-glutamate - 4-hydroxybenzoate biosynthesis I (eukaryotes):
4-coumarate + H2O ⟶ 4-hydroxybenzaldehyde + acetate - 4-hydroxybenzoate biosynthesis IV (plants):
4-coumarate + H2O ⟶ 4-hydroxybenzaldehyde + acetate - 4-hydroxybenzoate biosynthesis IV (plants):
4-coumarate + H2O ⟶ 4-hydroxybenzaldehyde + acetate - proanthocyanidins biosynthesis from flavanols:
UDP-α-D-glucose + a (2R,3R)-flavan-3-ol ⟶ H+ + UDP + a (2R,3R)-flavan-3-ol-3'-O-glucoside - zerumbone biosynthesis:
α-humulene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 10-hydroxy-α-humulene + H2O + an oxidized [NADPH-hemoprotein reductase] - salicin biosynthesis:
benzaldehyde ⟶ salicylaldehyde - salicortin biosynthesis:
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol - salicortin biosynthesis:
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - salicin biosynthesis:
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - (-)-camphor biosynthesis:
(-)-bornyl-diphosphate + H2O ⟶ (-)-borneol + diphosphate - superpathway of glandular trichomes produced diterpenoids (tobacco):
(13E)-8α-hydroxylabd-13-en-15-yl diphosphate ⟶ cis-abienol + diphosphate - cembratrienediol biosynthesis:
α-cembratriene-ol + H+ + NAD(P)H + O2 ⟶ α-cembratriene-4,6-diol + H2O + NAD(P)+ - phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - L-phenylalanine degradation III:
3-phenyl-2-oxopropanoate + H+ ⟶ CO2 + phenylacetaldehyde - phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - L-phenylalanine degradation III:
2-phenylethanol + NAD+ ⟶ H+ + NADH + phenylacetaldehyde - phenylethanol biosynthesis:
2-phenylethanol + NAD+ ⟶ H+ + NADH + phenylacetaldehyde - phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde - NAD/NADH phosphorylation and dephosphorylation:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQH2 + an oxidized c-type cytochrome ⟶ H+ + UQ + a reduced c-type cytochrome - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - (+)-camphor biosynthesis:
(+)-borneol + NAD+ ⟶ (+)-camphor + H+ + NADH - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-proline biosynthesis I:
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H - L-proline biosynthesis III:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-proline biosynthesis III:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-proline biosynthesis I:
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H - L-proline biosynthesis III (from L-ornithine):
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H - L-proline biosynthesis I (from L-glutamate):
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-proline biosynthesis III:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-proline biosynthesis I:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-proline biosynthesis I:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-proline biosynthesis III:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-proline biosynthesis I:
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H - L-proline biosynthesis III:
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-proline biosynthesis III:
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H - L-proline biosynthesis I:
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H - L-proline biosynthesis III:
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H - L-arginine degradation VI (arginase 2 pathway):
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-proline biosynthesis III:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-proline biosynthesis I:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-proline biosynthesis III:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-proline biosynthesis I:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - oryzalexin A, B, and C biosynthesis:
NAD(P)+ + oryzalexin A ⟶ H+ + NAD(P)H + oryzalexin C - oryzalexin A, B, and C biosynthesis:
NAD(P)+ + oryzalexin A ⟶ H+ + NAD(P)H + oryzalexin C - oryzalexin A, B, and C biosynthesis:
NAD(P)+ + oryzalexin D ⟶ H+ + NAD(P)H + oryzalexin A - oryzalexin A, B, and C biosynthesis:
NAD(P)+ + oryzalexin D ⟶ H+ + NAD(P)H + oryzalexin B - oryzalexin A, B, and C biosynthesis:
NAD(P)+ + oryzalexin D ⟶ H+ + NAD(P)H + oryzalexin B - L-ascorbate biosynthesis II (L-gulose pathway):
GDP-α-D-mannose ⟶ GDP-β-L-gulose - L-ascorbate biosynthesis II (L-gulose pathway):
L-gulopyranose + NAD+ ⟶ H+ + L-gulono-1,4-lactone + NADH - L-ascorbate biosynthesis II (L-gulose pathway):
L-gulopyranose + NAD+ ⟶ H+ + L-gulono-1,4-lactone + NADH - L-ascorbate biosynthesis II (L-gulose pathway):
GDP-α-D-mannose ⟶ GDP-β-L-gulose - L-ascorbate biosynthesis II (plants, L-gulose pathway):
L-gulopyranose + NAD+ ⟶ H+ + L-gulono-1,4-lactone + NADH - L-ascorbate biosynthesis II (L-gulose pathway):
L-gulopyranose + NAD+ ⟶ H+ + L-gulono-1,4-lactone + NADH - L-ascorbate biosynthesis II (L-gulose pathway):
L-gulopyranose + NAD+ ⟶ H+ + L-gulono-1,4-lactone + NADH - L-ascorbate biosynthesis II (L-gulose pathway):
GDP-α-D-mannose ⟶ GDP-β-L-gulose - L-ascorbate biosynthesis II (plants, L-gulose pathway):
L-gulopyranose + NAD+ ⟶ H+ + L-gulono-1,4-lactone + NADH - L-ascorbate biosynthesis II (plants, L-gulose pathway):
L-gulopyranose + NAD+ ⟶ H+ + L-gulono-1,4-lactone + NADH - L-ascorbate biosynthesis II (plants, L-gulose pathway):
L-gulopyranose + NAD+ ⟶ H+ + L-gulono-1,4-lactone + NADH - L-ascorbate biosynthesis II (L-gulose pathway):
L-gulopyranose + NAD+ ⟶ H+ + L-gulono-1,4-lactone + NADH - L-ascorbate biosynthesis II (plants, L-gulose pathway):
L-gulopyranose + NAD+ ⟶ H+ + L-gulono-1,4-lactone + NADH - L-ascorbate biosynthesis II (plants, L-gulose pathway):
L-gulopyranose + NAD+ ⟶ H+ + L-gulono-1,4-lactone + NADH - L-ascorbate biosynthesis II (plants, L-gulose pathway):
L-gulopyranose + NAD+ ⟶ H+ + L-gulono-1,4-lactone + NADH - L-ascorbate biosynthesis II (plants, L-gulose pathway):
L-gulopyranose + NAD+ ⟶ H+ + L-gulono-1,4-lactone + NADH - L-ascorbate biosynthesis II (plants, L-gulose pathway):
L-gulopyranose + NAD+ ⟶ H+ + L-gulono-1,4-lactone + NADH - L-ascorbate biosynthesis II (plants, L-gulose pathway):
L-gulopyranose + NAD+ ⟶ H+ + L-gulono-1,4-lactone + NADH - L-ascorbate biosynthesis II (plants, L-gulose pathway):
L-gulopyranose + NAD+ ⟶ H+ + L-gulono-1,4-lactone + NADH - ephedrine biosynthesis:
(+)-norpseudoephedrine + SAM ⟶ H+ + SAH + pseudoephedrine - dimethylsulfoniopropanoate biosynthesis I (Wollastonia):
3-dimethylsulfoniopropionaldehyde + H2O + NAD+ ⟶ DMSP + H+ + NADH - dimethylsulfoniopropanoate biosynthesis II (Spartina):
3-dimethylsulfoniopropionaldehyde + H2O + NAD+ ⟶ DMSP + H+ + NADH - menthol biosynthesis:
(-)-menthol + NADP+ ⟶ (-)-menthone + H+ + NADPH - menthol biosynthesis:
(-)-menthol + NADP+ ⟶ (-)-menthone + H+ + NADPH - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis I:
3-dehydro-6-deoxoteasterone + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-hydroxyteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis III:
NAD(P)+ + campesterol ⟶ NAD(P)H + campest-4-en-3-one - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxotyphasterol + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxotyphasterol + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxotyphasterol + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis III:
campest-5-en-3-one ⟶ campest-4-en-3-one - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
3-dehydro-6-deoxoteasterone + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-hydroxyteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-hydroxyteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxotyphasterol + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-hydroxyteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
3-dehydro-6-deoxoteasterone + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-hydroxyteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-hydroxyteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis I:
3-dehydro-6-deoxoteasterone + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-hydroxyteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase] - brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2) - brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2) - brassinolide biosynthesis II:
NAD+ + campest-4-en-3β-ol ⟶ H+ + NADH + campest-4-en-3-one - brassinosteroid biosynthesis II:
NAD+ + campest-4-en-3β-ol ⟶ H+ + NADH + campest-4-en-3-one - brassinosteroid biosynthesis I:
NAD+ + campest-4-en-3β-ol ⟶ H+ + NADH + campest-4-en-3-one - zymosterol biosynthesis:
14-demethyllanosterol + H+ + O2 + a ferrocytochrome b5 ⟶ 4α-hydroxymethyl-4β-methyl-5α-cholesta-8,24-dien-3β-ol + H2O + a ferricytochrome b5 - furaneol and mesifurane biosynthesis:
furaneol ⟶ furaneol (enol form) - furaneol and mesifurane biosynthesis:
SAM + furaneol (enol form) ⟶ H+ + SAH + mesifurane (enol form) - benzoate biosynthesis II (CoA-independent, non-β-oxidative):
3-hydroxy-3-phenylpropanoate ⟶ acetate + benzaldehyde - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis II (CoA-independent, non-β-oxidative):
3-hydroxy-3-phenylpropanoate ⟶ acetate + benzaldehyde - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis II (CoA-independent, non-β-oxidative):
3-hydroxy-3-phenylpropanoate ⟶ acetate + benzaldehyde - phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol - phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol - phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol - phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol - phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol - phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol - phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol - phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol - phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol - phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol - phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol - phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol - phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol - phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol - phytosterol biosynthesis (plants):
O2 + a reduced [NADPH-hemoprotein reductase] + sitosterol ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + stigmasterol - phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol - phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol - phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol - phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol - phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol - phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol - phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol - phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol - phytosterol biosynthesis (plants):
4α-carboxy-4β,14α-dimethyl-9β,19-cyclo-5α-ergost-24(241)-en-3β-ol + NAD+ ⟶ CO2 + NADH + cycloeucalenone - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - methyl ketone biosynthesis (engineered):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - fatty acid β-oxidation II (peroxisome):
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - pinitol biosynthesis II:
myo-inositol + SAM ⟶ H+ + SAH + sequoyitol - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
4-tyrosol + NAD+ ⟶ (4-hydroxyphenyl)acetaldehyde + H+ + NADH - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
H2O + O2 + tyramine ⟶ (4-hydroxyphenyl)acetaldehyde + ammonium + hydrogen peroxide - salidroside biosynthesis:
4-tyrosol + NAD+ ⟶ (4-hydroxyphenyl)acetaldehyde + H+ + NADH - salidroside biosynthesis:
4-tyrosol + NAD+ ⟶ (4-hydroxyphenyl)acetaldehyde + H+ + NADH - salidroside biosynthesis:
4-tyrosol + NAD+ ⟶ (4-hydroxyphenyl)acetaldehyde + H+ + NADH - β-alanine biosynthesis I:
H2O + O2 + propane-1,3-diamine ⟶ 3-aminopropanal + ammonium + hydrogen peroxide - β-alanine biosynthesis I:
H2O + O2 + propane-1,3-diamine ⟶ 3-aminopropanal + ammonium + hydrogen peroxide - β-alanine biosynthesis I:
H2O + O2 + propane-1,3-diamine ⟶ 3-aminopropanal + ammonium + hydrogen peroxide - β-alanine biosynthesis I:
H2O + O2 + propane-1,3-diamine ⟶ 3-aminopropanal + ammonium + hydrogen peroxide - β-alanine biosynthesis I:
H2O + O2 + propane-1,3-diamine ⟶ 3-aminopropanal + ammonium + hydrogen peroxide - β-alanine biosynthesis I:
H2O + O2 + propane-1,3-diamine ⟶ 3-aminopropanal + ammonium + hydrogen peroxide - β-alanine biosynthesis I:
H2O + O2 + propane-1,3-diamine ⟶ 3-aminopropanal + ammonium + hydrogen peroxide - β-alanine biosynthesis I:
3-aminopropanal + H2O + NAD(P)+ ⟶ β-alanine + H+ + NAD(P)H - β-alanine biosynthesis I:
H2O + O2 + propane-1,3-diamine ⟶ 3-aminopropanal + ammonium + hydrogen peroxide - β-alanine biosynthesis I:
H2O + O2 + propane-1,3-diamine ⟶ 3-aminopropanal + ammonium + hydrogen peroxide - superpathway of purines degradation in plants:
H2O + O2 + urate ⟶ (S)-5-hydroxyisourate + hydrogen peroxide - adenosine nucleotides degradation II:
AMP + H2O ⟶ adenosine + phosphate - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - adenosine nucleotides degradation I:
H2O + inosine ⟶ D-ribofuranose + hypoxanthine - superpathway of purines degradation in plants:
H2O + O2 + urate ⟶ (S)-5-hydroxyisourate + hydrogen peroxide - purine nucleotides degradation I (plants):
H+ + H2O + guanine ⟶ ammonium + xanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical - ascorbate recycling (cytosolic):
NADH + monodehydroascorbate radical ⟶ H+ + L-ascorbate + NAD+ - formate oxidation to CO2:
NAD+ + formate ⟶ CO2 + NADH - formate oxidation to CO2:
NAD+ + formate ⟶ CO2 + NADH - formate oxidation to CO2:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
H2O + formyl-CoA ⟶ H+ + coenzyme A + formate - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - oxalate degradation VI:
NAD+ + formate ⟶ CO2 + NADH - C4 photosynthetic carbon assimilation cycle, NAD-ME type:
H+ + hydrogencarbonate ⟶ CO2 + H2O - fatty acid α-oxidation I:
H+ + a 2(R)-hydroperoxy fatty acid ⟶ CO2 + H2O + a fatty aldehyde - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - benzoate biosynthesis III (CoA-dependent, non-β-oxidative):
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate - pinitol biosynthesis I:
D-ononitol + NAD+ ⟶ 4-O-methyl-D-myo-inosose + H+ + NADH - 2-hydroxybiphenyl degradation:
2,6-dioxo-6-phenylhexa-3-enoate + H2O ⟶ (2Z)-2-hydroxypenta-2,4-dienoate + H+ + benzoate - 2-hydroxybiphenyl degradation:
2,6-dioxo-6-phenylhexa-3-enoate + H2O ⟶ (2Z)-2-hydroxypenta-2,4-dienoate + H+ + benzoate - 2-hydroxybiphenyl degradation:
2,6-dioxo-6-phenylhexa-3-enoate + H2O ⟶ (2Z)-2-hydroxypenta-2,4-dienoate + H+ + benzoate - 2-hydroxybiphenyl degradation:
2,6-dioxo-6-phenylhexa-3-enoate + H2O ⟶ (2Z)-2-hydroxypenta-2,4-dienoate + H+ + benzoate - L-homomethionine biosynthesis:
2-[2-(methylthio)ethyl]-3-oxobutanedioate + H+ ⟶ 5-(methylthio)-2-oxopentanoate + CO2 - L-homomethionine biosynthesis:
2-[2-(methylthio)ethyl]-3-oxobutanedioate + H+ ⟶ 5-(methylthio)-2-oxopentanoate + CO2 - L-homomethionine biosynthesis:
2-[2-(methylthio)ethyl]-3-oxobutanedioate + H+ ⟶ 5-(methylthio)-2-oxopentanoate + CO2 - L-homomethionine biosynthesis:
2-[2-(methylthio)ethyl]-3-oxobutanedioate + H+ ⟶ 5-(methylthio)-2-oxopentanoate + CO2 - L-homomethionine biosynthesis:
2-[2-(methylthio)ethyl]-3-oxobutanedioate + H+ ⟶ 5-(methylthio)-2-oxopentanoate + CO2 - L-homomethionine biosynthesis:
2-[2-(methylthio)ethyl]-3-oxobutanedioate + H+ ⟶ 5-(methylthio)-2-oxopentanoate + CO2 - L-homomethionine biosynthesis:
2-[2-(methylthio)ethyl]-3-oxobutanedioate + H+ ⟶ 5-(methylthio)-2-oxopentanoate + CO2 - L-homomethionine biosynthesis:
2-[2-(methylthio)ethyl]-3-oxobutanedioate + H+ ⟶ 5-(methylthio)-2-oxopentanoate + CO2 - L-homomethionine biosynthesis:
2-[2-(methylthio)ethyl]-3-oxobutanedioate + H+ ⟶ 5-(methylthio)-2-oxopentanoate + CO2 - L-homomethionine biosynthesis:
2-[2-(methylthio)ethyl]-3-oxobutanedioate + H+ ⟶ 5-(methylthio)-2-oxopentanoate + CO2 - L-homomethionine biosynthesis:
3-[(2'-methylthio)ethyl]malate + NAD+ ⟶ 2-[2-(methylthio)ethyl]-3-oxobutanedioate + H+ + NADH - L-homomethionine biosynthesis:
3-[(2'-methylthio)ethyl]malate + NAD+ ⟶ 2-[2-(methylthio)ethyl]-3-oxobutanedioate + H+ + NADH - L-homomethionine biosynthesis:
3-[(2'-methylthio)ethyl]malate + NAD+ ⟶ 2-[2-(methylthio)ethyl]-3-oxobutanedioate + H+ + NADH - bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin - bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin - bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin - bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin - bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin - bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin - bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin - bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin - bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin - bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin - bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin - bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin - bixin biosynthesis:
SAM + bixin ⟶ SAH + bixin dimethyl ester - bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin - bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin - bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin - bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin - bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin - bixin biosynthesis:
all-trans-lycopene + O2 ⟶ bixin aldehyde + sulcatone - noscapine biosynthesis:
(S)-reticuline + O2 ⟶ (S)-scoulerine + H+ + hydrogen peroxide - noscapine biosynthesis:
(S)-reticuline + O2 ⟶ (S)-scoulerine + H+ + hydrogen peroxide - noscapine biosynthesis:
(S)-reticuline + O2 ⟶ (S)-scoulerine + H+ + hydrogen peroxide - noscapine biosynthesis:
(S)-reticuline + O2 ⟶ (S)-scoulerine + H+ + hydrogen peroxide - noscapine biosynthesis:
(13S,14R)-13-O-acetyl-1-hydroxy-N-methylcanadine + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (13S,14R)-13-O-acetyl-1,8-dihydroxy-N-methylcanadine + H2O + an oxidized [NADPH-hemoprotein reductase] - noscapine biosynthesis:
(S)-reticuline + O2 ⟶ (S)-scoulerine + H+ + hydrogen peroxide - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - GABA shunt II:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - GABA shunt II:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - GABA shunt II:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - GABA shunt II:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - GABA shunt II:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - abietic acid biosynthesis:
(+)-copalyl diphosphate ⟶ abieta-7,13-diene + diphosphate - superpathway of diterpene resin acids biosynthesis:
A + abieta-7,13-diene ⟶ A(H2) + abietatriene - jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-octa-2-enoyl)-CoA + hydrogen peroxide - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
NAD+ + a tetrahydrofolate + gly ⟶ CO2 + NADH + a 5,10-methylenetetrahydrofolate + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - folate transformations II:
NAD+ + a tetrahydrofolate + gly ⟶ CO2 + NADH + a 5,10-methylenetetrahydrofolate + ammonium - L-alanine degradation II (to D-lactate):
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
(R)-lactate + NAD+ ⟶ H+ + NADH + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
(R)-lactate + NAD+ ⟶ H+ + NADH + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
(R)-lactate + NAD+ ⟶ H+ + NADH + pyruvate - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
(R)-lactate + NAD+ ⟶ H+ + NADH + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-alanine degradation II (to D-lactate):
(R)-lactate + NAD+ ⟶ H+ + NADH + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
(R)-lactate + NAD+ ⟶ H+ + NADH + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
(R)-lactate + NAD+ ⟶ H+ + NADH + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
NAD+ + a tetrahydrofolate + gly ⟶ CO2 + NADH + a 5,10-methylenetetrahydrofolate + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-alanine degradation II (to D-lactate):
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - photorespiration:
O2 + glycolate ⟶ glyoxylate + hydrogen peroxide - folate transformations II:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-alanine degradation II (to D-lactate):
(R)-lactate + NAD+ ⟶ H+ + NADH + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - iron reduction and absorption:
H+ + NAD+ + a siderophore-bound Fe(II) ⟶ NADH + a siderophore-bound Fe(III) - iron reduction and absorption:
H+ + NAD+ + a siderophore-bound Fe(II) ⟶ NADH + a siderophore-bound Fe(III) - iron reduction and absorption:
H+ + NAD+ + a siderophore-bound Fe(II) ⟶ NADH + a siderophore-bound Fe(III) - iron reduction and absorption:
H+ + NAD+ + a siderophore-bound Fe(II) ⟶ NADH + a siderophore-bound Fe(III) - iron reduction and absorption:
H+ + NAD+ + a siderophore-bound Fe(II) ⟶ NADH + a siderophore-bound Fe(III) - iron reduction and absorption:
H+ + NAD+ + a siderophore-bound Fe(II) ⟶ NADH + a siderophore-bound Fe(III) - iron reduction and absorption:
H+ + NAD+ + a siderophore-bound Fe(II) ⟶ NADH + a siderophore-bound Fe(III) - iron reduction and absorption:
H+ + NAD+ + a siderophore-bound Fe(II) ⟶ NADH + a siderophore-bound Fe(III) - iron reduction and absorption:
H+ + NAD+ + a siderophore-bound Fe(II) ⟶ NADH + a siderophore-bound Fe(III) - iron reduction and absorption:
H+ + NAD+ + a siderophore-bound Fe(II) ⟶ NADH + a siderophore-bound Fe(III) - iron reduction and absorption:
H+ + NAD+ + a siderophore-bound Fe(II) ⟶ NADH + a siderophore-bound Fe(III) - iron reduction and absorption:
H+ + NAD+ + a siderophore-bound Fe(II) ⟶ NADH + a siderophore-bound Fe(III) - iron reduction and absorption:
H+ + NAD+ + a siderophore-bound Fe(II) ⟶ NADH + a siderophore-bound Fe(III) - iron reduction and absorption:
H+ + NAD+ + a siderophore-bound Fe(II) ⟶ NADH + a siderophore-bound Fe(III) - iron reduction and absorption:
H+ + NAD+ + a siderophore-bound Fe(II) ⟶ NADH + a siderophore-bound Fe(III) - iron reduction and absorption:
H+ + NAD+ + a siderophore-bound Fe(II) ⟶ NADH + a siderophore-bound Fe(III) - iron reduction and absorption:
H+ + NAD+ + a siderophore-bound Fe(II) ⟶ NADH + a siderophore-bound Fe(III) - iron reduction and absorption:
H+ + NAD+ + a siderophore-bound Fe(II) ⟶ NADH + a siderophore-bound Fe(III) - iron reduction and absorption:
H+ + NAD+ + a siderophore-bound Fe(II) ⟶ NADH + a siderophore-bound Fe(III) - iron reduction and absorption:
H+ + NAD+ + a siderophore-bound Fe(II) ⟶ NADH + a siderophore-bound Fe(III) - iron reduction and absorption:
H+ + NAD+ + a siderophore-bound Fe(II) ⟶ NADH + a siderophore-bound Fe(III) - iron reduction and absorption:
H+ + NAD+ + a siderophore-bound Fe(II) ⟶ NADH + a siderophore-bound Fe(III) - iron reduction and absorption:
H+ + NAD+ + a siderophore-bound Fe(II) ⟶ NADH + a siderophore-bound Fe(III) - iron reduction and absorption:
H+ + NAD+ + a siderophore-bound Fe(II) ⟶ NADH + a siderophore-bound Fe(III) - iron reduction and absorption:
H+ + NAD+ + a siderophore-bound Fe(II) ⟶ NADH + a siderophore-bound Fe(III) - iron reduction and absorption:
H+ + an Fe(II)-siderophore ⟶ Fe2+ + a siderophore - iron reduction and absorption:
H+ + an Fe(II)-siderophore ⟶ Fe2+ + a siderophore - iron reduction and absorption:
H+ + an Fe(II)-siderophore ⟶ Fe2+ + a siderophore - iron reduction and absorption:
H+ + an Fe(II)-siderophore ⟶ Fe2+ + a siderophore - iron reduction and absorption:
H+ + an Fe(II)-siderophore ⟶ Fe2+ + a siderophore - iron reduction and absorption:
H+ + an Fe(II)-siderophore ⟶ Fe2+ + a siderophore - iron reduction and absorption:
H+ + an Fe(II)-siderophore ⟶ Fe2+ + a siderophore - iron reduction and absorption:
H+ + NAD+ + a siderophore-bound Fe(II) ⟶ NADH + a siderophore-bound Fe(III) - iron reduction and absorption:
H+ + an Fe(II)-siderophore ⟶ Fe2+ + a siderophore - iron reduction and absorption:
H+ + an Fe(II)-siderophore ⟶ Fe2+ + a siderophore - iron reduction and absorption:
H+ + NAD+ + a siderophore-bound Fe(II) ⟶ NADH + a siderophore-bound Fe(III) - iron reduction and absorption:
H+ + NAD+ + a siderophore-bound Fe(II) ⟶ NADH + a siderophore-bound Fe(III) - NAD/NADH phosphorylation and dephosphorylation:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
UQH2 + an oxidized c-type cytochrome ⟶ H+ + UQ + a reduced c-type cytochrome - aerobic respiration III (alternative oxidase pathway):
O2 + UQH2 ⟶ H2O + UQ - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - chelerythrine biosynthesis:
(S)-canadine + SAM ⟶ (S)-N-methylcanadine + SAH - fluoroacetate and fluorothreonine biosynthesis:
5'-deoxy-5'-fluoroadenosine + phosphate ⟶ 5-fluoro-5-deoxy-D-ribose 1-phosphate + adenine - indigo biosynthesis:
cis-indole-2,3-dihydrodiol ⟶ H2O + indoxyl - indican biosynthesis:
cis-indole-2,3-dihydrodiol ⟶ H2O + indoxyl - indican biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indigo biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indican biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indigo biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indican biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indigo biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indican biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indigo biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indican biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indigo biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indican biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indigo biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indican biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indigo biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indican biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indigo biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indican biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indigo biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indican biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indigo biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indican biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indigo biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indican biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indigo biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indican biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indigo biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indican biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indigo biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indican biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indigo biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indican biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indigo biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indigo biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indican biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indican biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indigo biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indican biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indigo biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indigo biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indican biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indican biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indigo biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indican biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indigo biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indican biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indigo biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indigo biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indican biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indican biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indigo biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indican biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indigo biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indican biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indigo biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indican biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indigo biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indican biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indigo biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indican biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+ - indigo biosynthesis:
H+ + NADH + O2 + indole ⟶ cis-indole-2,3-dihydrodiol + NAD+
COVID-19 Disease Map(1)
- @COVID-19 Disease
Map["name"]:
2-Methyl-3-acetoacetyl-CoA + Coenzyme A ⟶ Acetyl-CoA + Propanoyl-CoA
PathBank(0)
PharmGKB(0)
0 个相关的物种来源信息
在这里通过桑基图来展示出与当前的这个代谢物在我们的BioDeep知识库中具有相关联信息的其他代谢物。在这里进行关联的信息来源主要有：
- PubMed: 来源于PubMed文献库中的文献信息，我们通过自然语言数据挖掘得到的在同一篇文献中被同时提及的相关代谢物列表，这个列表按照代谢物同时出现的文献数量降序排序，取前10个代谢物作为相关研究中关联性很高的代谢物集合展示在桑基图中。
- NCBI Taxonomy: 通过文献数据挖掘，得到的代谢物物种来源信息关联。这个关联信息同样按照出现的次数降序排序，取前10个代谢物作为高关联度的代谢物集合展示在桑吉图上。
- Chemical Taxonomy: 在物质分类上处于同一个分类集合中的其他代谢物
- Chemical Reaction: 在化学反应过程中，存在为当前代谢物相关联的生化反应过程中的反应底物或者反应产物的关联代谢物信息。
点击图上的相关代谢物的名称，可以跳转到相关代谢物的信息页面。