2-Oxobutanoate (BioDeep_00000897279)
代谢物信息卡片
2-Oxobutanoate
化学式: C4H5O3- (101.02386800000001)
中文名称:
谱图信息:
最多检出来源 Homo sapiens(blood) 84.62%
分子结构信息
SMILES: CCC(=O)C(=O)[O-]
InChI: InChI=1S/C4H6O3/c1-2-3(5)4(6)7/h2H2,1H3,(H,6,7)/p-1
描述信息
A 2-oxo monocarboxylic acid anion that is the conjugate base of 2-oxobutanoic acid, obtained by deprotonation of the carboxy group.
COVID info from COVID-19 Disease Map
Corona-virus
Coronavirus
SARS-CoV-2
COVID-19
SARS-CoV
COVID19
SARS2
SARS
同义名列表
1 个代谢物同义名
相关代谢途径
Reactome(0)
BioCyc(19)
- superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass
- mixed acid fermentation
- photosynthetic 3-hydroxybutanoate biosynthesis (engineered)
- cysteine biosynthesis/homocysteine degradation
- superpathway of threonine degradation
- threonine degradation II
- cysteine biosynthesis II
- cysteine biosynthesis III (mammalia)
- superpathway of threonine metabolism
- isoleucine biosynthesis I
- isoleucine biosynthesis I (from threonine)
- 2-oxobutanoate degradation I
- L-valine biosynthesis
- superpathway of L-threonine metabolism
- superpathway of L-methionine salvage and degradation
- L-isoleucine biosynthesis IV
- L-isoleucine biosynthesis II
- pyruvate fermentation to isobutanol (engineered)
- superpathway of L-isoleucine biosynthesis I
代谢反应
811 个相关的代谢反应过程信息。
Reactome(0)
BioCyc(144)
- homocysteine and cysteine interconversion:
O-acetyl-L-homoserine + cys ⟶ H+ + L-cystathionine + acetate - cysteine biosynthesis/homocysteine degradation:
H2O + L-cystathionine ⟶ 2-oxobutanoate + H+ + ammonia + cys - cysteine biosynthesis/homocysteine degradation:
H2O + L-cystathionine ⟶ 2-oxobutanoate + H+ + ammonia + cys - dimethyl sulfide biosynthesis from methionine:
SAM + methanethiol ⟶ H+ + SAH + dimethyl sulfide - methionine degradation II:
H2O + met ⟶ 2-oxobutanoate + ammonium + methanethiol - superpathway of threonine metabolism:
2-oxobutanoate + coenzyme A ⟶ formate + propanoyl-CoA - isoleucine biosynthesis I:
thr ⟶ 2-oxobutanoate + H+ + ammonia - isoleucine biosynthesis I (from threonine):
thr ⟶ 2-oxobutanoate + H+ + ammonia - threonine degradation I:
2-oxobutanoate + coenzyme A ⟶ formate + propanoyl-CoA - L-isoleucine biosynthesis IV:
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA - superpathway of threonine degradation:
thr ⟶ 2-oxobutanoate + H+ + ammonia - threonine degradation II:
thr ⟶ 2-oxobutanoate + H+ + ammonia - hydrogen sulfide biosynthesis II (mammalian):
H2O + cys ⟶ ammonium + hydrogen sulfide + pyruvate - hydrogen sulfide biosynthesis II (mammalian):
H2O + cys ⟶ ammonium + hydrogen sulfide + pyruvate - threonine degradation:
2-oxobutanoate + NAD+ + coenzyme A ⟶ CO2 + NADH + propanoyl-CoA - cysteine biosynthesis/homocysteine degradation (trans-sulfuration):
L-cystathionine ⟶ (2Z)-2-aminobut-2-enoate + H+ + cys - cysteine biosynthesis:
H2O + SAH ⟶ L-homocysteine + adenosine - superpathway of methionine degradation:
2-oxobutanoate + NAD+ + coenzyme A ⟶ CO2 + NADH + propanoyl-CoA - hypoglycin biosynthesis:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-threonine degradation I:
ATP + propanoate ⟶ ADP + propanoyl phosphate - superpathway of L-cysteine biosynthesis (fungi):
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate - L-threonine degradation V:
thr ⟶ 2-oxobutanoate + ammonium - L-cysteine biosynthesis III (from L-homocysteine):
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - homocysteine and cysteine interconversion:
H2O + L-cystathionine ⟶ 2-oxobutanoate + ammonium + cys - superpathway of L-cysteine biosynthesis (mammalian):
H2O + SAH ⟶ L-homocysteine + adenosine - superpathway of sulfur amino acid biosynthesis (Saccharomyces cerevisiae):
H2O + NADP+ + hydrogen sulfide ⟶ H+ + NADPH + sulfite - superpathway of branched chain amino acid biosynthesis:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of L-threonine metabolism:
NAD+ + thr ⟶ H+ + L-2-amino-3-oxobutanoate + NADH - superpathway of L-methionine salvage and degradation:
L-homocysteine + glycine betaine ⟶ N,N-dimethylglycine + met - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - superpathway of L-isoleucine biosynthesis I:
ATP + L-homoserine ⟶ ADP + H+ + O-phospho-L-homoserine - L-isoleucine biosynthesis I (from threonine):
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of L-threonine metabolism:
2-oxobutanoate + coenzyme A ⟶ formate + propanoyl-CoA - L-threonine degradation I:
2-oxobutanoate + coenzyme A ⟶ formate + propanoyl-CoA - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - superpathway of sulfur amino acid biosynthesis (Saccharomyces cerevisiae):
ATP + H+ + sulfate ⟶ APS + diphosphate - superpathway of leucine, valine, and isoleucine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - homocysteine and cysteine interconversion:
H2O + L-cystathionine ⟶ L-homocysteine + ammonium + pyruvate - cysteine biosynthesis IV (fungi):
O-acetyl-L-homoserine + hydrogen sulfide ⟶ H+ + L-homocysteine + acetate - isoleucine biosynthesis:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - superpathway of L-isoleucine biosynthesis I:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate - L-isoleucine biosynthesis I (from threonine):
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-cysteine biosynthesis III (from L-homocysteine):
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of isoleucine and valine biosynthesis:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-threonine degradation I:
2-oxobutanoate + coenzyme A ⟶ formate + propanoyl-CoA - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + Glu - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + Glu - threonine degradation I:
2-oxobutanoate + coenzyme A ⟶ formate + propanoyl-CoA - superpathway of leucine, valine, and isoleucine biosynthesis:
(R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glt - isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glt - superpathway of branched chain amino acid biosynthesis:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-isoleucine biosynthesis I (from threonine):
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of L-isoleucine biosynthesis I:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glt - superpathway of branched amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glt - superpathway of L-cysteine biosynthesis (mammalian):
H2O + SAH ⟶ L-homocysteine + adenosine - L-cysteine biosynthesis III (from L-homocysteine):
L-cystathionine ⟶ (2Z)-2-aminobut-2-enoate + H+ + cys - isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glt - isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glt - superpathway of leucine, valine, and isoleucine biosynthesis:
(R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - threonine degradation I:
2-oxobutanoate + coenzyme A ⟶ formate + propionyl-CoA - superpathway of leucine, valine, and isoleucine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glt - isoleucine biosynthesis I:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - threonine degradation I:
2-oxobutanoate + coenzyme A ⟶ formate + propionyl-CoA - isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glt - superpathway of leucine, valine, and isoleucine biosynthesis:
2,3-dihydroxy-3-methylbutanoate + NADP+ ⟶ (S)-2-acetolactate + H+ + NADPH - cysteine biosynthesis/homocysteine degradation:
H2O + L-cystathionine ⟶ 2-oxobutanoate + ammonium + cys - isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glt - isoleucine biosynthesis I:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - L-threonine degradation I:
phosphate + propanoyl-CoA ⟶ coenzyme A + propanoyl phosphate - superpathway of branched amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glt - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glt - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - superpathway of L-isoleucine biosynthesis I:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH - L-isoleucine biosynthesis I (from threonine):
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glt - superpathway of leucine, valine, alanine, and isoleucine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glt - superpathway of branched amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glt - L-threonine degradation I:
2-oxobutanoate + coenzyme A ⟶ formate + propanoyl-CoA - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glt - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glt - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - L-cysteine biosynthesis III (from L-homocysteine):
L-cystathionine ⟶ (2Z)-2-aminobut-2-enoate + H+ + cys - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - L-cysteine biosynthesis III (from L-homocysteine):
L-cystathionine ⟶ (2Z)-2-aminobut-2-enoate + H+ + cys - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glt - superpathway of L-cysteine biosynthesis (mammalian):
H2O + SAH ⟶ L-homocysteine + adenosine - L-cysteine biosynthesis III (from L-homocysteine):
L-cystathionine ⟶ (2Z)-2-aminobut-2-enoate + H+ + cys - superpathway of L-cysteine biosynthesis (mammalian):
H2O + SAH ⟶ L-homocysteine + adenosine - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glt - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glt - superpathway of branched amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glt - isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glt - superpathway of leucine, valine, and isoleucine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glt - threonine degradation I:
2-oxobutanoate + coenzyme A ⟶ formate + propanoyl-CoA - superpathway of threonine metabolism:
H2O + O2 + aminoacetone ⟶ ammonium + hydrogen peroxide + methylglyoxal - superpathway of threonine metabolism:
H2O + O2 + aminoacetone ⟶ ammonium + hydrogen peroxide + methylglyoxal - superpathway of leucine, valine, and isoleucine biosynthesis:
(R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glt - threonine degradation I:
2-oxobutanoate + coenzyme A ⟶ formate + propanoyl-CoA - isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glt - cysteine biosynthesis/homocysteine degradation:
L-cystathionine ⟶ (2Z)-2-aminobut-2-enoate + H+ + cys - superpathway of leucine, valine, and isoleucine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glt - superpathway of leucine, valine, and isoleucine biosynthesis:
(R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glt - L-threonine degradation I:
phosphate + propanoyl-CoA ⟶ coenzyme A + propanoyl phosphate - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + Glu - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + asp ⟶ Glu + oxaloacetate - isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glt - superpathway of leucine, valine, and isoleucine biosynthesis:
(R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - isoleucine biosynthesis I:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glt - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glt - superpathway of branched amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glt - L-cysteine biosynthesis III (from L-homocysteine):
L-cystathionine ⟶ (2Z)-2-aminobut-2-enoate + H+ + cys - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + Glu - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + Glu - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + Glu - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + Glu - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + Glu - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + Glu - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + asp ⟶ Glu + oxaloacetate - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + Glu - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + Glu - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + Glu - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + Glu - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + Glu - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + Glu
WikiPathways(3)
- One-carbon metabolism and related pathways:
5-oxoproline ⟶ Glutamate - Trans-sulfuration and one-carbon metabolism:
Methionine ⟶ Decarboxylated SAM - One-carbon metabolism and related pathways:
L-Cystathionine ⟶ 2-oxobutanoate
Plant Reactome(0)
INOH(0)
PlantCyc(664)
- L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - L-cysteine biosynthesis III (from L-homocysteine):
L-cystathionine ⟶ (2Z)-2-aminobut-2-enoate + H+ + cys - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + asp ⟶ glu + oxaloacetate - homocysteine and cysteine interconversion:
O-succinyl-L-homoserine + cys ⟶ H+ + L-cystathionine + succinate - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - L-cysteine biosynthesis III (from L-homocysteine):
L-cystathionine ⟶ (2Z)-2-aminobut-2-enoate + H+ + cys - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - homocysteine and cysteine interconversion:
O-succinyl-L-homoserine + cys ⟶ H+ + L-cystathionine + succinate - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + asp ⟶ glu + oxaloacetate - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - superpathway of L-isoleucine biosynthesis I:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH - superpathway of branched chain amino acid biosynthesis:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-isoleucine biosynthesis I (from threonine):
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - homocysteine and cysteine interconversion:
H2O + L-cystathionine ⟶ L-homocysteine + ammonium + pyruvate - L-cysteine biosynthesis III (from L-homocysteine):
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + asp ⟶ glu + oxaloacetate - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - L-cysteine biosynthesis III (from L-homocysteine):
L-cystathionine ⟶ (2Z)-2-aminobut-2-enoate + H+ + cys - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - homocysteine and cysteine interconversion:
O-succinyl-L-homoserine + cys ⟶ H+ + L-cystathionine + succinate - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - homocysteine and cysteine interconversion:
O-succinyl-L-homoserine + cys ⟶ H+ + L-cystathionine + succinate - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - L-cysteine biosynthesis III (from L-homocysteine):
L-cystathionine ⟶ (2Z)-2-aminobut-2-enoate + H+ + cys - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + asp ⟶ glu + oxaloacetate - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + asp ⟶ glu + oxaloacetate - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-cysteine biosynthesis III (from L-homocysteine):
L-cystathionine ⟶ (2Z)-2-aminobut-2-enoate + H+ + cys - homocysteine and cysteine interconversion:
O-succinyl-L-homoserine + cys ⟶ H+ + L-cystathionine + succinate - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + asp ⟶ glu + oxaloacetate - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + asp ⟶ glu + oxaloacetate - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - homocysteine and cysteine interconversion:
H2O + L-cystathionine ⟶ L-homocysteine + ammonium + pyruvate - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - L-cysteine biosynthesis III (from L-homocysteine):
L-cystathionine ⟶ (2Z)-2-aminobut-2-enoate + H+ + cys - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-isoleucine biosynthesis I (from threonine):
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-cysteine biosynthesis III (from L-homocysteine):
L-cystathionine ⟶ (2Z)-2-aminobut-2-enoate + H+ + cys - homocysteine and cysteine interconversion:
O-succinyl-L-homoserine + cys ⟶ H+ + L-cystathionine + succinate - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-cysteine biosynthesis III (from L-homocysteine):
L-cystathionine ⟶ (2Z)-2-aminobut-2-enoate + H+ + cys - homocysteine and cysteine interconversion:
O-succinyl-L-homoserine + cys ⟶ H+ + L-cystathionine + succinate - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - homocysteine and cysteine interconversion:
O-succinyl-L-homoserine + cys ⟶ H+ + L-cystathionine + succinate - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - hypoglycin biosynthesis:
β-methylenecyclopropyl pyruvate + ala ⟶ hypoglycin A + pyruvate - homocysteine and cysteine interconversion:
O-succinyl-L-homoserine + cys ⟶ H+ + L-cystathionine + succinate - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-cysteine biosynthesis III (from L-homocysteine):
L-cystathionine ⟶ (2Z)-2-aminobut-2-enoate + H+ + cys - homocysteine and cysteine interconversion:
O-succinyl-L-homoserine + cys ⟶ H+ + L-cystathionine + succinate - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-cysteine biosynthesis III (from L-homocysteine):
L-cystathionine ⟶ (2Z)-2-aminobut-2-enoate + H+ + cys - homocysteine and cysteine interconversion:
O-succinyl-L-homoserine + cys ⟶ H+ + L-cystathionine + succinate - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-cysteine biosynthesis III (from L-homocysteine):
L-cystathionine ⟶ (2Z)-2-aminobut-2-enoate + H+ + cys - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - homocysteine and cysteine interconversion:
O-succinyl-L-homoserine + cys ⟶ H+ + L-cystathionine + succinate - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-cysteine biosynthesis III (from L-homocysteine):
L-cystathionine ⟶ (2Z)-2-aminobut-2-enoate + H+ + cys - homocysteine and cysteine interconversion:
O-succinyl-L-homoserine + cys ⟶ H+ + L-cystathionine + succinate - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-cysteine biosynthesis III (from L-homocysteine):
L-cystathionine ⟶ (2Z)-2-aminobut-2-enoate + H+ + cys - homocysteine and cysteine interconversion:
O-succinyl-L-homoserine + cys ⟶ H+ + L-cystathionine + succinate - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - homocysteine and cysteine interconversion:
H2O + L-cystathionine ⟶ L-homocysteine + ammonium + pyruvate - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-isoleucine biosynthesis I (from threonine):
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - hypoglycin biosynthesis:
glutathione + hypoglycin A ⟶ L-cysteinylglycine + hypoglycin B - superpathway of isoleucine and valine biosynthesis:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of L-isoleucine biosynthesis I:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - homocysteine and cysteine interconversion:
O-succinyl-L-homoserine + cys ⟶ H+ + L-cystathionine + succinate - L-methionine degradation II:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-cysteine biosynthesis III (from L-homocysteine):
L-cystathionine ⟶ (2Z)-2-aminobut-2-enoate + H+ + cys - homocysteine and cysteine interconversion:
O-succinyl-L-homoserine + cys ⟶ H+ + L-cystathionine + succinate - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - homocysteine and cysteine interconversion:
H2O + L-cystathionine ⟶ 2-oxobutanoate + ammonium + cys - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-cysteine biosynthesis III (from L-homocysteine):
(2Z)-2-aminobut-2-enoate ⟶ 2-iminobutanoate - homocysteine and cysteine interconversion:
H2O + L-cystathionine ⟶ L-homocysteine + ammonium + pyruvate - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - L-cysteine biosynthesis III (from L-homocysteine):
L-cystathionine ⟶ (2Z)-2-aminobut-2-enoate + H+ + cys - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - homocysteine and cysteine interconversion:
H2O + L-cystathionine ⟶ L-homocysteine + ammonium + pyruvate - L-cysteine biosynthesis III (from L-homocysteine):
(2Z)-2-aminobut-2-enoate ⟶ 2-iminobutanoate - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - homocysteine and cysteine interconversion:
H2O + L-cystathionine ⟶ 2-oxobutanoate + ammonium + cys - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - superpathway of branched chain amino acid biosynthesis:
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - L-isoleucine biosynthesis I (from threonine):
2-iminobutanoate + H+ + H2O ⟶ 2-oxobutanoate + ammonium - superpathway of L-isoleucine biosynthesis I:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - superpathway of branched chain amino acid biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of branched chain amino acid biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - superpathway of isoleucine and valine biosynthesis:
(2R)-2,3-dihydroxy-3-methylbutanoate ⟶ 3-methyl-2-oxobutanoate + H2O - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
3-methyl-2-oxobutanoate + H2O + acetyl-CoA ⟶ (2S)-2-isopropylmalate + H+ + coenzyme A - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - superpathway of isoleucine and valine biosynthesis:
2-oxoglutarate + val ⟶ 3-methyl-2-oxobutanoate + glu - L-isoleucine biosynthesis I (from threonine):
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of isoleucine and valine biosynthesis:
H+ + pyruvate ⟶ (S)-2-acetolactate + CO2 - homocysteine and cysteine interconversion:
H2O + L-cystathionine ⟶ L-homocysteine + ammonium + pyruvate - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2 - superpathway of branched chain amino acid biosynthesis:
H+ + pyruvate ⟶ (S)-2-acetolactate + CO2 - L-methionine degradation II:
met ⟶ (2Z)-2-aminobut-2-enoate + H+ + methanethiol - superpathway of isoleucine and valine biosynthesis:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
COVID-19 Disease Map(0)
PathBank(0)
PharmGKB(0)
0 个相关的物种来源信息
在这里通过桑基图来展示出与当前的这个代谢物在我们的BioDeep知识库中具有相关联信息的其他代谢物。在这里进行关联的信息来源主要有：
- PubMed: 来源于PubMed文献库中的文献信息，我们通过自然语言数据挖掘得到的在同一篇文献中被同时提及的相关代谢物列表，这个列表按照代谢物同时出现的文献数量降序排序，取前10个代谢物作为相关研究中关联性很高的代谢物集合展示在桑基图中。
- NCBI Taxonomy: 通过文献数据挖掘，得到的代谢物物种来源信息关联。这个关联信息同样按照出现的次数降序排序，取前10个代谢物作为高关联度的代谢物集合展示在桑吉图上。
- Chemical Taxonomy: 在物质分类上处于同一个分类集合中的其他代谢物
- Chemical Reaction: 在化学反应过程中，存在为当前代谢物相关联的生化反应过程中的反应底物或者反应产物的关联代谢物信息。
点击图上的相关代谢物的名称，可以跳转到相关代谢物的信息页面。
文献列表
- Fangfang Chen, Yu-Pei Chen, Hongtan Wu, Ya Li, Shudi Zhang, Jincheng Ke, Jeng-Yuan Yao. Characterization of tea (Camellia sinensis L.) flower extract and insights into its antifungal susceptibilities of Aspergillus flavus.
BMC complementary medicine and therapies.
2023 Aug; 23(1):286. doi:
10.1186/s12906-023-04122-5. [PMID: 37580785] - Charles Ar Cotton, Iria Bernhardsgrütter, Hai He, Simon Burgener, Luca Schulz, Nicole Paczia, Beau Dronsella, Alexander Erban, Stepan Toman, Marian Dempfle, Alberto De Maria, Joachim Kopka, Steffen N Lindner, Tobias J Erb, Arren Bar-Even. Underground isoleucine biosynthesis pathways in E. coli.
eLife.
2020 08; 9(?):. doi:
10.7554/elife.54207. [PMID: 32831171] - Cornelius von Morze, Robert A Bok, Michael A Ohliger, Zihan Zhu, Daniel B Vigneron, John Kurhanewicz. Hyperpolarized [(13)C]ketobutyrate, a molecular analog of pyruvate with modified specificity for LDH isoforms.
Magnetic resonance in medicine.
2016 May; 75(5):1894-900. doi:
10.1002/mrm.25716. [PMID: 26059096] - Muhammad Zafar-Ul-Hye, Hafiz Muhammad Farooq, Mubshar Hussain. Bacteria in combination with fertilizers promote root and shoot growth of maize in saline-sodic soil.
Brazilian journal of microbiology : [publication of the Brazilian Society for Microbiology].
2015 Mar; 46(1):97-102. doi:
10.1590/s1517-838220131135. [PMID: 26221093] - Thomas D Niehaus, Thuy N D Nguyen, Satinder K Gidda, Mona ElBadawi-Sidhu, Jennifer A Lambrecht, Donald R McCarty, Diana M Downs, Arthur J L Cooper, Oliver Fiehn, Robert T Mullen, Andrew D Hanson. Arabidopsis and maize RidA proteins preempt reactive enamine/imine damage to branched-chain amino acid biosynthesis in plastids.
The Plant cell.
2014 Jul; 26(7):3010-22. doi:
10.1105/tpc.114.126854. [PMID: 25070638] - Chaitanya Kumar Jha, Kannepalli Annapurna, Meenu Saraf. Isolation of Rhizobacteria from Jatropha curcas and characterization of produced ACC deaminase.
Journal of basic microbiology.
2012 Jun; 52(3):285-95. doi:
10.1002/jobm.201100113. [PMID: 21953604] - Seralathan Kamala-Kannan, Kui-Jae Lee, Seung-Moon Park, Jong-Chan Chae, Bong-Sik Yun, Yong Hoon Lee, Yool-Jin Park, Byung-Taek Oh. Characterization of ACC deaminase gene in Pseudomonas entomophila strain PS-PJH isolated from the rhizosphere soil.
Journal of basic microbiology.
2010 Apr; 50(2):200-5. doi:
10.1002/jobm.200900171. [PMID: 20082369] - Jin-Ho Kang, Lei Wang, Ashok Giri, Ian T Baldwin. Silencing threonine deaminase and JAR4 in Nicotiana attenuata impairs jasmonic acid-isoleucine-mediated defenses against Manduca sexta.
The Plant cell.
2006 Nov; 18(11):3303-20. doi:
10.1105/tpc.106.041103. [PMID: 17085687] - Joachim Schuster, Stefan Binder. The mitochondrial branched-chain aminotransferase (AtBCAT-1) is capable to initiate degradation of leucine, isoleucine and valine in almost all tissues in Arabidopsis thaliana.
Plant molecular biology.
2005 Jan; 57(2):241-54. doi:
10.1007/s11103-004-7533-1. [PMID: 15821880] - R Hirota, Y Kusumi, H Takahashi, S Nakagawa. Effect of alpha-ketobutyrate on microvascular thickness in the diabetic rat kidney.
Experimental and clinical endocrinology & diabetes : official journal, German Society of Endocrinology [and] German Diabetes Association.
2003 Dec; 111(8):499-504. doi:
10.1055/s-2003-44710. [PMID: 14714272] - Christopher L Sprague, Adnan A Elfarra. Detection of carboxylic acids and inhibition of hippuric acid formation in rats treated with 3-butene-1,2-diol, a major metabolite of 1,3-butadiene.
Drug metabolism and disposition: the biological fate of chemicals.
2003 Aug; 31(8):986-92. doi:
10.1124/dmd.31.8.986. [PMID: 12867486] - F K Tavaria, S Dahl, F J Carballo, F X Malcata. Amino acid catabolism and generation of volatiles by lactic acid bacteria.
Journal of dairy science.
2002 Oct; 85(10):2462-70. doi:
10.3168/jds.s0022-0302(02)74328-2. [PMID: 12416797] - Y Y Chang, J E Cronan. Conversion of Escherichia coli pyruvate oxidase to an 'alpha-ketobutyrate oxidase'.
The Biochemical journal.
2000 Dec; 352 Pt 3(?):717-24. doi:
. [PMID: 11104678] - L Feng, J F Kirsch. L-Vinylglycine is an alternative substrate as well as a mechanism-based inhibitor of 1-aminocyclopropane-1-carboxylate synthase.
Biochemistry.
2000 Mar; 39(10):2436-44. doi:
10.1021/bi9922704. [PMID: 10704193] - S Slater, T A Mitsky, K L Houmiel, M Hao, S E Reiser, N B Taylor, M Tran, H E Valentin, D J Rodriguez, D A Stone, S R Padgette, G Kishore, K J Gruys. Metabolic engineering of Arabidopsis and Brassica for poly(3-hydroxybutyrate-co-3-hydroxyvalerate) copolymer production.
Nature biotechnology.
1999 Oct; 17(10):1011-6. doi:
10.1038/13711. [PMID: 10504704] - A C Eschenlauer, S K Stoup, F Srienc, D A Somers. Production of heteropolymeric polyhydroxyalkanoate in Escherichia coli from a single carbon source.
International journal of biological macromolecules.
1996 Aug; 19(2):121-30. doi:
10.1016/0141-8130(96)01114-2. [PMID: 8842775] - S Peldszus, P M Huck, S A Andrews. Determination of short-chain aliphatic, oxo- and hydroxy-acids in drinking water at low microgram per liter concentrations.
Journal of chromatography. A.
1996 Feb; 723(1):27-34. doi:
10.1016/0021-9673(95)00838-1. [PMID: 8819819] - N Le Floc'h, C Obled, B Sève. In vivo threonine oxidation rate is dependent on threonine dietary supply in growing pigs fed low to adequate levels.
The Journal of nutrition.
1995 Oct; 125(10):2550-62. doi:
10.1093/jn/125.10.2550. [PMID: 7562090] - S Chakrabarti, M A Malick. In vivo nephrotoxic action of an isomeric mixture of S-(1-phenyl-2-hydroxyethyl)glutathione and S-(2-phenyl-2-hydroxyethyl)glutathione in Fischer-344 rats.
Toxicology.
1991 Mar; 67(1):15-27. doi:
10.1016/0300-483x(91)90160-3. [PMID: 1673268] - M I Gomes, W J Kim, M K Lively, H Amos. Heat-shock treatment lethal for mammalian cells deprived of glucose and glutamine: protection by alpha-keto acids.
Biochemical and biophysical research communications.
1985 Sep; 131(2):1013-9. doi:
10.1016/0006-291x(85)91340-3. [PMID: 4052064] - W Yang, K S Roth. Defect in alpha-ketobutyrate metabolism: a new inborn error.
Clinica chimica acta; international journal of clinical chemistry.
1985 Jan; 145(2):173-82. doi:
10.1016/0009-8981(85)90284-0. [PMID: 3918815] - R D Steele, H Weber, J I Patterson. Characterization of alpha-ketobutyrate metabolism in rat tissues: effects of dietary protein and fasting.
The Journal of nutrition.
1984 Apr; 114(4):701-10. doi:
10.1093/jn/114.4.701. [PMID: 6716171] - M R Dessì, G Floris. [Oxidative deamination of beta-methylaspartic acid].
Bollettino della Societa italiana di biologia sperimentale.
1979 Jul; 55(12):1189-95. doi:
NULL. [PMID: 553534] - S EICH, L R CERECEDO. Effects of certain thiamine analogs on the enzymatic decarboxylation of alpha-ketobutyric acid.
Archives of biochemistry and biophysics.
1955 Aug; 57(2):285-7. doi:
10.1016/0003-9861(55)90290-3. [PMID: 13259644]