Succinate (BioDeep_00000897210)
代谢物信息卡片
Succinate
化学式: C4H4O4-2 (116.01095839999999)
中文名称:
谱图信息:
最多检出来源 Homo sapiens(blood) 56.25%
分子结构信息
SMILES: C(CC(=O)[O-])C(=O)[O-]
InChI: InChI=1S/C4H6O4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6)(H,7,8)/p-2
相关代谢途径
Reactome(57)
- Metabolism
- Metabolism of proteins
- Post-translational protein modification
- Gamma carboxylation, hypusinylation, hydroxylation, and arylsulfatase activation
- Amino acid and derivative metabolism
- Metabolism of lipids
- Transport of small molecules
- SLC-mediated transmembrane transport
- Transport of bile salts and organic acids, metal ions and amine compounds
- DNA replication and repair
- DNA repair
- Developmental Biology
- DNA Repair
- DNA Damage Reversal
- Reversal of alkylation damage by DNA dioxygenases
- ALKBH2 mediated reversal of alkylation damage
- ALKBH3 mediated reversal of alkylation damage
- Signaling Pathways
- Signaling by Rho GTPases
- RHO GTPase Effectors
- RHO GTPases activate PKNs
- Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3
- Cell Cycle
- Cell Cycle, Mitotic
- M Phase
- Mitotic Prophase
- Condensation of Prophase Chromosomes
- Chromatin organization
- Chromatin modifying enzymes
- HDMs demethylate histones
- Signaling by Rho GTPases, Miro GTPases and RHOBTB3
- Maternal to zygotic transition (MZT)
- Chromatin modifications during the maternal to zygotic transition (MZT)
- Fatty acid metabolism
- Cellular responses to stimuli
- Cellular responses to stress
- Gene expression (Transcription)
- Peroxisomal lipid metabolism
- The tricarboxylic acid cycle
- Sodium-coupled sulphate, di- and tri-carboxylate transporters
- The citric acid (TCA) cycle and respiratory electron transport
- Pyruvate metabolism and Citric Acid (TCA) cycle
- Citric acid cycle (TCA cycle)
- Extracellular matrix organization
- Collagen formation
- Neuronal System
- Transmission across Chemical Synapses
- Neurotransmitter release cycle
- Metabolism of RNA
- tRNA processing
- tRNA modification in the nucleus and cytosol
- Signaling by GPCR
- GPCR ligand binding
- Class A/1 (Rhodopsin-like receptors)
- GPCR downstream signalling
- G alpha (i) signalling events
- Alpha-oxidation of phytanate
BioCyc(103)
- superpathway of L-phenylalanine biosynthesis
- anaerobic energy metabolism (invertebrates, mitochondrial)
- superpathway of anaerobic energy metabolism (invertebrates)
- superpathway of L-methionine biosynthesis (transsulfuration)
- superpathway of L-homoserine and L-methionine biosynthesis
- L-methionine biosynthesis I
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis I
- superpathway of aromatic amino acid biosynthesis
- chorismate biosynthesis I
- chorismate biosynthesis from 3-dehydroquinate
- superpathway of L-tyrosine biosynthesis
- superpathway of hyoscyamine and scopolamine biosynthesis
- superpathway of chorismate metabolism
- aspartate superpathway
- superpathway of S-adenosyl-L-methionine biosynthesis
- superpathway of L-tryptophan biosynthesis
- superpathway of anaerobic sucrose degradation
- gallate biosynthesis
- hyoscyamine and scopolamine biosynthesis
- superpathway of cytosolic glycolysis (plants), pyruvate dehydrogenase and TCA cycle
- glycolysis IV (plant cytosol)
- L-lysine biosynthesis I
- nicotine degradation I (pyridine pathway)
- clavulanate biosynthesis
- superpathway of L-arginine, putrescine, and 4-aminobutanoate degradation
- superpathway of L-arginine and L-ornithine degradation
- superpathway of arginine and ornithine degradation
- superpathway of arginine, putrescine, and 4-aminobutyrate degradation
- superpathway of aromatic compound degradation
- morphine biosynthesis
- 12-epi-hapalindole biosynthesis
- paerucumarin biosynthesis
- rhabduscin biosynthesis
- hapalindole H biosynthesis
- 12-epi-fischerindole biosynthesis
- nevadensin biosynthesis
- 3-[(E)-2-isocyanoethenyl]-1H-indole biosynthesis
- polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium)
- polymethylated quercetin glucoside biosynthesis II - quercetagetin series (Chrysosplenium)
- isoflavonoid biosynthesis II
- superpathway of polymethylated quercetin/quercetagetin glucoside biosynthesis (Chrysosplenium)
- respiration (anaerobic)-- electron acceptors reaction list
- superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass
- TCA cycle I (prokaryotic)
- γ-butyrobetaine degradation
- mixed acid fermentation
- nicotine degradation II (pyrrolidine pathway)
- superpathway of glyoxylate bypass and TCA
- vindoline and vinblastine biosynthesis
- superpathway of carotenoid biosynthesis in plants
- trans-lycopene biosynthesis II (oxygenic phototrophs and green sulfur bacteria)
- superpathway of central carbon metabolism
- superpathway of L-lysine degradation
- scopoletin biosynthesis
- coumarins biosynthesis (engineered)
- superpathway of scopolin and esculin biosynthesis
- 2,4-dichlorophenoxyacetate degradation
- superpathway of formononetin derivative biosynthesis
- gluconeogenesis I
- validamycin biosynthesis
- TCA cycle VI (obligate autotrophs)
- superpathway of lysine, threonine and methionine biosynthesis I
- methionine biosynthesis I
- Methanobacterium thermoautotrophicum biosynthetic metabolism
- L-lysine degradation IV
- procollagen hydroxylation and glycosylation
- methylaspartate cycle
- conversion of succinate to propanoate
- TCA cycle V (2-oxoglutarate:ferredoxin oxidoreductase)
- L-lysine degradation V
- reductive TCA cycle I
- 4-hydroxyphenylacetate degradation
- superpathway of aromatic compound degradation via 3-oxoadipate
- 3-phenylpropanoate and 3-(3-hydroxyphenyl)propanoate degradation
- superpathway of penicillin, cephalosporin and cephamycin biosynthesis
- deacetylcephalosporin C biosynthesis
- aromatic compounds degradation via β-ketoadipate
- catechol degradation III (ortho-cleavage pathway)
- mandelate degradation to acetyl-CoA
- L-carnitine biosynthesis
- superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis
- acetyl-CoA degradation to acetate
- superpathway of glycolysis, pyruvate dehydrogenase and TCA cycle
- superpathway of glyoxylate cycle
- NADH to fumarate electron transfer
- succinate to cytochrome bo oxidase electron transfer
- hydrogen to fumarate electron transfer
- glycerol-3-phosphate to fumarate electron transfer
- superpathway of fumitremorgin biosynthesis
- succinate to cytochrome bd oxidase electron transfer
- superpathway of benzoxazinoid glucosides biosynthesis
- 4'-methoxyviridicatin biosynthesis
- stipitatate biosynthesis
- umbelliferone biosynthesis
- L-glutamate degradation VII (to butanoate)
- L-glutamate degradation VI (to pyruvate)
- leucopelargonidin and leucocyanidin biosynthesis
- anthocyanin biosynthesis (pelargonidin 3-O-glucoside)
- superpathway of gibberellin biosynthesis
- respiration (anaerobic)
- superpathway of 4-aminobutyrate degradation
- 4-aminobutyrate degradation II
- lysine biosynthesis I
PlantCyc(37)
- superpathway of hyoscyamine and scopolamine biosynthesis
- hyoscyamine and scopolamine biosynthesis
- superpathway of anaerobic sucrose degradation
- superpathway of isoflavonoids (via naringenin)
- glycolysis IV (plant cytosol)
- superpathway of cytosolic glycolysis (plants), pyruvate dehydrogenase and TCA cycle
- leucodelphinidin biosynthesis
- luteolinidin 5-O-glucoside biosynthesis
- luteolin biosynthesis
- flavonoid biosynthesis (in equisetum)
- leucopelargonidin and leucocyanidin biosynthesis
- superpathway of hyoscyamine (atropine) and scopolamine biosynthesis
- nevadensin biosynthesis
- morphine biosynthesis
- polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium)
- polymethylated quercetin glucoside biosynthesis II - quercetagetin series (Chrysosplenium)
- superpathway of polymethylated quercetin/quercetagetin glucoside biosynthesis (Chrysosplenium)
- superpathway of gibberellin biosynthesis
- gibberellin biosynthesis II (early C-3 hydroxylation)
- pinobanksin biosynthesis
- vindoline, vindorosine and vinblastine biosynthesis
- scopoletin biosynthesis
- coumarins biosynthesis (engineered)
- superpathway of scopolin and esculin biosynthesis
- gibberellin inactivation I (2β-hydroxylation)
- superpathway of formononetin derivative biosynthesis
- tropane alkaloids biosynthesis
- superpathway of flavones and derivatives biosynthesis
- L-lysine degradation I
- superpathway of glyoxylate cycle and fatty acid degradation
- flavonol biosynthesis
- syringetin biosynthesis
- chrysin biosynthesis
- daidzein conjugates interconversion
- superpathway of benzoxazinoid glucosides biosynthesis
- umbelliferone biosynthesis
- proanthocyanidins biosynthesis from flavanols
代谢反应
3373 个相关的代谢反应过程信息。
Reactome(475)
- Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of lipids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Metabolism of lipids:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Fatty acid metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Peroxisomal lipid metabolism:
2OH-PALM + Oxygen ⟶ 2oxo-PALM + H2O2 - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine - Metabolism of lipids:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine - Fatty acid metabolism:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine - Peroxisomal lipid metabolism:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Metabolism of lipids:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Fatty acid metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Peroxisomal lipid metabolism:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Signaling Pathways:
ADORA2A,B + Ade-Rib ⟶ ADORA2A,B:Ade-Rib - Signaling by GPCR:
ADORA2A,B + Ade-Rib ⟶ ADORA2A,B:Ade-Rib - GPCR downstream signalling:
H2O + cAMP ⟶ AMP - G alpha (i) signalling events:
ATP ⟶ PPi + cAMP - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by GPCR:
ADORA1,3 + Ade-Rib ⟶ ADORA1,3:Ade-Rib - GPCR downstream signalling:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - G alpha (i) signalling events:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by GPCR:
ADORA1,3 + Ade-Rib ⟶ ADORA1,3:Ade-Rib - GPCR downstream signalling:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - G alpha (i) signalling events:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by GPCR:
ADORA2A,B + Ade-Rib ⟶ ADORA2A,B:Ade-Rib - GPCR downstream signalling:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - G alpha (i) signalling events:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by GPCR:
ADORA1,3 + Ade-Rib ⟶ ADORA1,3:Ade-Rib - GPCR downstream signalling:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - G alpha (i) signalling events:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - Cell Cycle:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Cell Cycle, Mitotic:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - M Phase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Mitotic Prophase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Condensation of Prophase Chromosomes:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Chromatin organization:
H2O ⟶ ammonia - Chromatin modifying enzymes:
H2O ⟶ ammonia - HDMs demethylate histones:
2OG + MeK37-histone H3 + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - DNA Repair:
MUTYH:(8oxoG:Ade)-dsDNA ⟶ Ade + MUTYH:AP-dsDNA - DNA Damage Reversal:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Reversal of alkylation damage by DNA dioxygenases:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Signaling by Rho GTPases:
TPNH + dioxygen ⟶ H+ + O2.- + TPN - RHO GTPase Effectors:
TPNH + dioxygen ⟶ H+ + O2.- + TPN - RHO GTPases activate PKNs:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - Cell Cycle:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Cell Cycle, Mitotic:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - M Phase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Mitotic Prophase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Condensation of Prophase Chromosomes:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,Me2K-10-H3:KDM1A ⟶ CH2O + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,MeK-10-H3:KDM1A - Chromatin organization:
2OG + MeK37-histone H3 + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - Chromatin modifying enzymes:
2OG + MeK37-histone H3 + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - HDMs demethylate histones:
2OG + MeK37-histone H3 + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - Chromatin organization:
H2O ⟶ ammonia - Chromatin modifying enzymes:
H2O ⟶ ammonia - HDMs demethylate histones:
2OG + MeK37-histone H3 + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - DNA Repair:
MUTYH:(8oxoG:Ade)-dsDNA ⟶ Ade + MUTYH:AP-dsDNA - DNA Damage Reversal:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Reversal of alkylation damage by DNA dioxygenases:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Signaling by Rho GTPases:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPase Effectors:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPases activate PKNs:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - Cell Cycle:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Cell Cycle, Mitotic:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - M Phase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Mitotic Prophase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Condensation of Prophase Chromosomes:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by Rho GTPases:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + Homologues of KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPase Effectors:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + Homologues of KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPases activate PKNs:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + Homologues of KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + Homologues of KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - DNA Repair:
MUTYH:(8oxoG:Ade)-dsDNA ⟶ Ade + MUTYH:AP-dsDNA - DNA Damage Reversal:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Reversal of alkylation damage by DNA dioxygenases:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Chromatin organization:
H2O ⟶ ammonia - Chromatin modifying enzymes:
H2O ⟶ ammonia - HDMs demethylate histones:
2OG + MeK37-histone H3 + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - Cell Cycle:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Cell Cycle, Mitotic:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - M Phase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Mitotic Prophase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Condensation of Prophase Chromosomes:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Chromatin organization:
2OG + Me2K10-histone H3 + Oxygen ⟶ CH2O + MeK10-histone H3 + SUCCA + carbon dioxide - Chromatin modifying enzymes:
2OG + Me2K10-histone H3 + Oxygen ⟶ CH2O + MeK10-histone H3 + SUCCA + carbon dioxide - HDMs demethylate histones:
2OG + Me2K10-histone H3 + Oxygen ⟶ CH2O + MeK10-histone H3 + SUCCA + carbon dioxide - Cell Cycle:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Cell Cycle, Mitotic:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - M Phase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Mitotic Prophase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Condensation of Prophase Chromosomes:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Chromatin organization:
SAM ⟶ SAH - Chromatin modifying enzymes:
SAM ⟶ SAH - HDMs demethylate histones:
2OG + His4:CG33889 + Oxygen ⟶ CH2O + His4:CG33889 + SUCCA + carbon dioxide - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by Rho GTPases:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,Me2K-10-H3:KDM1A ⟶ CH2O + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,MeK-10-H3:KDM1A - RHO GTPase Effectors:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,Me2K-10-H3:KDM1A ⟶ CH2O + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,MeK-10-H3:KDM1A - RHO GTPases activate PKNs:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,Me2K-10-H3:KDM1A ⟶ CH2O + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,MeK-10-H3:KDM1A - Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,Me2K-10-H3:KDM1A ⟶ CH2O + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,MeK-10-H3:KDM1A - Cell Cycle:
H2O + NAD + Q8MQX9 ⟶ 2'-O-acetyl-ADP-ribose + NAM + Q8MQX9 - Cell Cycle, Mitotic:
H2O + NAD + Q8MQX9 ⟶ 2'-O-acetyl-ADP-ribose + NAM + Q8MQX9 - M Phase:
H2O + NAD + Q8MQX9 ⟶ 2'-O-acetyl-ADP-ribose + NAM + Q8MQX9 - Mitotic Prophase:
Ca2+ + DAG ⟶ DAG:active PKC:Ca+2 - DNA replication and repair:
2OG + Oxygen ⟶ CH2O + CH3CHO + SUCCA + carbon dioxide - DNA repair:
2OG + Oxygen ⟶ CH2O + CH3CHO + SUCCA + carbon dioxide - DNA Damage Reversal:
2OG + Oxygen ⟶ CH2O + CH3CHO + SUCCA + carbon dioxide - Cell Cycle:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Cell Cycle, Mitotic:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - M Phase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Mitotic Prophase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Condensation of Prophase Chromosomes:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by Rho GTPases:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPase Effectors:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPases activate PKNs:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - DNA Repair:
MUTYH:(8oxoG:Ade)-dsDNA ⟶ Ade + MUTYH:AP-dsDNA - DNA Damage Reversal:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Reversal of alkylation damage by DNA dioxygenases:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Chromatin organization:
H2O ⟶ ammonia - Chromatin modifying enzymes:
H2O ⟶ ammonia - HDMs demethylate histones:
2OG + H4-VI + Oxygen ⟶ CH2O + H4-VI + SUCCA + carbon dioxide - Developmental Biology:
Early cornified envelope + Lamellar body ⟶ Cornified envelope - DNA Repair:
MUTYH:(8oxoG:Ade)-dsDNA ⟶ Ade + MUTYH:AP-dsDNA - DNA Damage Reversal:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Reversal of alkylation damage by DNA dioxygenases:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - ALKBH2 mediated reversal of alkylation damage:
2OG + ALKBH2:Fe2+:1-meA-dsDNA + Oxygen ⟶ ALKBH2:Fe2+ + CH2O + SUCCA + carbon dioxide - ALKBH3 mediated reversal of alkylation damage:
2OG + ALKBH3:Fe2+:ASCC1:ASCC2:ASCC3:1-meA-dsDNA + Oxygen ⟶ ALKBH3:Fe2+:ASCC1:ASCC2:ASCC3 + CH2O + SUCCA + carbon dioxide - Signaling by Rho GTPases:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPase Effectors:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPases activate PKNs:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - Cell Cycle:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Cell Cycle, Mitotic:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - M Phase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Mitotic Prophase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Condensation of Prophase Chromosomes:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Chromatin organization:
H2O ⟶ ammonia - Chromatin modifying enzymes:
H2O ⟶ ammonia - HDMs demethylate histones:
2OG + MeK37-histone H3 + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - DNA Repair:
MUTYH:(8oxoG:Ade)-dsDNA ⟶ Ade + MUTYH:AP-dsDNA - DNA Damage Reversal:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Reversal of alkylation damage by DNA dioxygenases:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Chromatin organization:
H2O ⟶ ammonia - Chromatin modifying enzymes:
H2O ⟶ ammonia - HDMs demethylate histones:
2OG + MeK37-histone H3 + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - Cell Cycle:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Cell Cycle, Mitotic:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - M Phase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Mitotic Prophase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Condensation of Prophase Chromosomes:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Chromatin organization:
2OG + H3K4me2 + Oxygen ⟶ CH2O + MeK5-histone H3 + SUCCA + carbon dioxide - Chromatin modifying enzymes:
2OG + H3K4me2 + Oxygen ⟶ CH2O + MeK5-histone H3 + SUCCA + carbon dioxide - HDMs demethylate histones:
2OG + H3K4me2 + Oxygen ⟶ CH2O + MeK5-histone H3 + SUCCA + carbon dioxide - Chromatin organization:
H2O ⟶ ammonia - Chromatin modifying enzymes:
H2O ⟶ ammonia - HDMs demethylate histones:
2OG + MeK37-histone H3 + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - Cell Cycle:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Cell Cycle, Mitotic:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - M Phase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Mitotic Prophase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Condensation of Prophase Chromosomes:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by Rho GTPases:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,Me2K-10-H3:KDM1A ⟶ CH2O + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,MeK-10-H3:KDM1A - RHO GTPase Effectors:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,Me2K-10-H3:KDM1A ⟶ CH2O + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,MeK-10-H3:KDM1A - RHO GTPases activate PKNs:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,Me2K-10-H3:KDM1A ⟶ CH2O + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,MeK-10-H3:KDM1A - Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,Me2K-10-H3:KDM1A ⟶ CH2O + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,MeK-10-H3:KDM1A - DNA Repair:
MUTYH:(8oxoG:Ade)-dsDNA ⟶ Ade + MUTYH:AP-dsDNA - DNA Damage Reversal:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Reversal of alkylation damage by DNA dioxygenases:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Chromatin organization:
2OG + MeK37-histone H3 + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - Chromatin modifying enzymes:
2OG + MeK37-histone H3 + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - HDMs demethylate histones:
2OG + MeK37-histone H3 + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - Signaling Pathways:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Signaling by Rho GTPases:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + Homologues of KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPase Effectors:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + Homologues of KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPases activate PKNs:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + Homologues of KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + Homologues of KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - Cell Cycle:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Cell Cycle, Mitotic:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - M Phase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Mitotic Prophase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Condensation of Prophase Chromosomes:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Cell Cycle:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Cell Cycle, Mitotic:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - M Phase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Mitotic Prophase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Condensation of Prophase Chromosomes:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Chromatin organization:
2OG + MeK-HIST1H4A + Oxygen ⟶ CH2O + HIST1H4 + SUCCA + carbon dioxide - Chromatin modifying enzymes:
2OG + MeK-HIST1H4A + Oxygen ⟶ CH2O + HIST1H4 + SUCCA + carbon dioxide - HDMs demethylate histones:
2OG + MeK-HIST1H4A + Oxygen ⟶ CH2O + HIST1H4 + SUCCA + carbon dioxide - Signaling Pathways:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Signaling by Rho GTPases:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPase Effectors:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPases activate PKNs:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - Chromatin organization:
H2O ⟶ ammonia - Chromatin modifying enzymes:
H2O ⟶ ammonia - HDMs demethylate histones:
2OG + MeK37-histone H3 + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - Cell Cycle:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Cell Cycle, Mitotic:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - M Phase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Mitotic Prophase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Condensation of Prophase Chromosomes:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Signaling by Rho GTPases:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPase Effectors:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPases activate PKNs:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - DNA Repair:
MUTYH:(8oxoG:Ade)-dsDNA ⟶ Ade + MUTYH:AP-dsDNA - DNA Damage Reversal:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Reversal of alkylation damage by DNA dioxygenases:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - DNA Repair:
MUTYH:(8oxoG:Ade)-dsDNA ⟶ Ade + MUTYH:AP-dsDNA - DNA Damage Reversal:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Reversal of alkylation damage by DNA dioxygenases:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Cell Cycle:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Cell Cycle, Mitotic:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - M Phase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Mitotic Prophase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Condensation of Prophase Chromosomes:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + SUCCA + carbon dioxide + kdm4b + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - HDMs demethylate histones:
2OG + MeK37-histone H3 + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - Condensation of Prophase Chromosomes:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - Signaling by Rho GTPases, Miro GTPases and RHOBTB3:
NOX2 complex:RAC2:GTP + S100A8:S100A9:AA:Ca2+ ⟶ NOX2 complex:S100A8:S100A9:Ca2+ - Signaling by Rho GTPases, Miro GTPases and RHOBTB3:
NOX2 complex:RAC2:GTP + S100A8:S100A9:AA:Ca2+ ⟶ NOX2 complex:S100A8:S100A9:Ca2+ - Signaling by Rho GTPases, Miro GTPases and RHOBTB3:
NOX2 complex:RAC2:GTP + S100A8:S100A9:AA:Ca2+ ⟶ NOX2 complex:S100A8:S100A9:Ca2+ - Signaling by Rho GTPases, Miro GTPases and RHOBTB3:
NOX2 complex:RAC2:GTP + S100A8:S100A9:AA:Ca2+ ⟶ NOX2 complex:S100A8:S100A9:Ca2+ - Signaling by Rho GTPases, Miro GTPases and RHOBTB3:
TPNH + dioxygen ⟶ H+ + O2.- + TPN - Signaling by Rho GTPases, Miro GTPases and RHOBTB3:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - Signaling by Rho GTPases, Miro GTPases and RHOBTB3:
TPNH + dioxygen ⟶ H+ + O2.- + TPN - Signaling by Rho GTPases, Miro GTPases and RHOBTB3:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,Me2K-10-H3:KDM1A ⟶ CH2O + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,MeK-10-H3:KDM1A - Signaling by Rho GTPases, Miro GTPases and RHOBTB3:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + Homologues of KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - Signaling by Rho GTPases, Miro GTPases and RHOBTB3:
NOX2 complex:RAC2:GTP + S100A8:S100A9:AA:Ca2+ ⟶ NOX2 complex:S100A8:S100A9:Ca2+ - Maternal to zygotic transition (MZT):
2OG + Histone H3 (H3K4me3) + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - Chromatin modifications during the maternal to zygotic transition (MZT):
2OG + Histone H3 (H3K4me3) + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - Extracellular matrix organization:
2OG + Oxygen + Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides ⟶ Prolyl 3-hydroxylases:Fe2+:3,4-Hyp collagen propeptides + SUCCA + carbon dioxide - Collagen formation:
2OG + Oxygen + Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides ⟶ Prolyl 3-hydroxylases:Fe2+:3,4-Hyp collagen propeptides + SUCCA + carbon dioxide - Collagen biosynthesis and modifying enzymes:
2OG + Oxygen + Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides ⟶ Prolyl 3-hydroxylases:Fe2+:3,4-Hyp collagen propeptides + SUCCA + carbon dioxide - Extracellular matrix organization:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Collagen formation:
2OG + Lysyl hydroxylases:Lysyl hydroxylase procollagen substrates + Oxygen ⟶ Lysyl hydroxylases:Lysyl hydroxylated collagen propeptides + SUCCA + carbon dioxide - Collagen biosynthesis and modifying enzymes:
2OG + Lysyl hydroxylases:Lysyl hydroxylase procollagen substrates + Oxygen ⟶ Lysyl hydroxylases:Lysyl hydroxylated collagen propeptides + SUCCA + carbon dioxide - Extracellular matrix organization:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Collagen formation:
H2O + Oxygen ⟶ H2O2 + ammonia - Collagen biosynthesis and modifying enzymes:
2OG + Lysyl hydroxylases:Lysyl hydroxylase procollagen substrates + Oxygen ⟶ Lysyl hydroxylases:Lysyl hydroxylated collagen propeptides + SUCCA + carbon dioxide - Extracellular matrix organization:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides - Collagen formation:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides - Collagen biosynthesis and modifying enzymes:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides - Extracellular matrix organization:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides - Collagen formation:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides - Collagen biosynthesis and modifying enzymes:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides - Extracellular matrix organization:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides - Collagen formation:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides - Collagen biosynthesis and modifying enzymes:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides - Extracellular matrix organization:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides - Collagen formation:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides - Collagen biosynthesis and modifying enzymes:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides - Extracellular matrix organization:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Collagen formation:
2OG + Lysyl hydroxylases:Lysyl hydroxylase procollagen substrates + Oxygen ⟶ Lysyl hydroxylases:Lysyl hydroxylated collagen propeptides + SUCCA + carbon dioxide - Collagen biosynthesis and modifying enzymes:
2OG + Lysyl hydroxylases:Lysyl hydroxylase procollagen substrates + Oxygen ⟶ Lysyl hydroxylases:Lysyl hydroxylated collagen propeptides + SUCCA + carbon dioxide - Extracellular matrix organization:
Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides - Collagen formation:
Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides - Collagen biosynthesis and modifying enzymes:
Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides - Extracellular matrix organization:
2OG + Oxygen + Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides ⟶ Prolyl 3-hydroxylases:Fe2+:3,4-Hyp collagen propeptides + SUCCA + carbon dioxide - Collagen formation:
2OG + Oxygen + Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides ⟶ Prolyl 3-hydroxylases:Fe2+:3,4-Hyp collagen propeptides + SUCCA + carbon dioxide - Collagen biosynthesis and modifying enzymes:
2OG + Oxygen + Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides ⟶ Prolyl 3-hydroxylases:Fe2+:3,4-Hyp collagen propeptides + SUCCA + carbon dioxide - Signaling by GPCR:
ADORA1,3 + Ade-Rib ⟶ ADORA1,3:Ade-Rib - GPCR downstream signalling:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - G alpha (i) signalling events:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - Signaling by GPCR:
ADORA1,3 + Ade-Rib ⟶ ADORA1,3:Ade-Rib - Ketone body metabolism:
ACA + H+ + NADH ⟶ NAD + bHBA - Ketone body catabolism:
NAD + bHBA ⟶ ACA + H+ + NADH - Ketone body metabolism:
HMG CoA ⟶ ACA + Ac-CoA - Ketone body catabolism:
ACA + SUCC-CoA ⟶ ACA-CoA + SUCCA - Ketone body metabolism:
ACA + H+ + NADH ⟶ NAD + bHBA - Ketone body catabolism:
NAD + bHBA ⟶ ACA + H+ + NADH - Ketone body metabolism:
ACA + H+ + NADH ⟶ NAD + bHBA - Ketone body catabolism:
NAD + bHBA ⟶ ACA + H+ + NADH - Ketone body metabolism:
HMG CoA ⟶ ACA + Ac-CoA - Ketone body catabolism:
ACA + SUCC-CoA ⟶ ACA-CoA + SUCCA - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of lipids:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Ketone body metabolism:
ACA + H+ + NADH ⟶ NAD + bHBA - Ketone body catabolism:
NAD + bHBA ⟶ ACA + H+ + NADH - Ketone body metabolism:
ACA + H+ + NADH ⟶ NAD + bHBA - Ketone body catabolism:
NAD + bHBA ⟶ ACA + H+ + NADH - Ketone body metabolism:
ACA + H+ + NADH ⟶ NAD + bHBA - Ketone body catabolism:
NAD + bHBA ⟶ ACA + H+ + NADH - Ketone body metabolism:
ACA + H+ + NADH ⟶ NAD + bHBA - Ketone body catabolism:
NAD + bHBA ⟶ ACA + H+ + NADH - Ketone body metabolism:
ACA + H+ + NADH ⟶ NAD + bHBA - Ketone body catabolism:
NAD + bHBA ⟶ ACA + H+ + NADH - Ketone body metabolism:
ACA + H+ + NADH ⟶ NAD + bHBA - Ketone body catabolism:
NAD + bHBA ⟶ ACA + H+ + NADH - Ketone body metabolism:
ACA + H+ + NADH ⟶ NAD + bHBA - Ketone body catabolism:
NAD + bHBA ⟶ ACA + H+ + NADH - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Amino acid and derivative metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Carnitine synthesis:
2OG + Oxygen + TEABT ⟶ CAR + SUCCA + carbon dioxide - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - GABA synthesis, release, reuptake and degradation:
H+ + L-Glu ⟶ GABA + carbon dioxide - Degradation of GABA:
H2O + NAD + SUCCSA ⟶ H+ + NADH + SUCCA - Neuronal System:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Transmission across Chemical Synapses:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Neurotransmitter release cycle:
2OG + GABA ⟶ Glu + SUCCSA - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neuronal System:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Transmission across Chemical Synapses:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Neurotransmitter release cycle:
2OG + GABA ⟶ Glu + SUCCSA - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neuronal System:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Transmission across Chemical Synapses:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Neurotransmitter release cycle:
2OG + GABA ⟶ Glu + SUCCSA - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
2OG + GABA ⟶ Glu + SUCCSA - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
Ac-CoA + Cho ⟶ AcCho + CoA-SH - GABA synthesis, release, reuptake and degradation:
H+ + L-Glu ⟶ GABA + carbon dioxide - Degradation of GABA:
H2O + NAD + SUCCSA ⟶ H+ + NADH + SUCCA - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
Ac-CoA + Cho ⟶ AcCho + CoA-SH - GABA synthesis, release, reuptake and degradation:
H+ + L-Glu ⟶ GABA + carbon dioxide - Degradation of GABA:
H2O + NAD + SUCCSA ⟶ H+ + NADH + SUCCA - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Metabolism:
H2O + PBG ⟶ HMBL + ammonia - The tricarboxylic acid cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA
BioCyc(328)
- superpathway of glyoxylate cycle:
ATP + a fatty acid + coenzyme A ⟶ AMP + H+ + a 2,3,4-saturated fatty acyl CoA + diphosphate - glyoxylate cycle:
H2O + acetyl-CoA + glyoxylate ⟶ (S)-malate + H+ + coenzyme A - superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate - superpathway of glyoxylate bypass and TCA:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - fumitremorgin A biosynthesis:
DMAPP + verruculogen ⟶ diphosphate + fumitremorgin A - superpathway of fumitremorgin biosynthesis:
DMAPP + verruculogen ⟶ diphosphate + fumitremorgin A - nevadensin biosynthesis:
2-oxoglutarate + O2 + gardenin B ⟶ CO2 + formaldehyde + nevadensin + succinate - aspartate superpathway:
ATP + ammonia + nicotinate adenine dinucleotide ⟶ AMP + H+ + NAD+ + diphosphate - superpathway of lysine, threonine and methionine biosynthesis I:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate - methionine biosynthesis I:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate - clavulanate biosynthesis:
2-oxoglutarate + O2 + dihydroclavaminate ⟶ CO2 + H2O + clavaminate + succinate - aerobic respiration (cytochrome c):
succinate + ubiquinone-6 ⟶ fumarate + ubiquinol - aerobic respiration (linear view):
succinate + ubiquinone-6 ⟶ fumarate + ubiquinol - respiration (anaerobic):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - respiration (anaerobic):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - pyruvate fermentation to propionate I:
(S)-methylmalonyl-CoA + pyruvate ⟶ oxaloacetate + propanoyl-CoA - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - superpathway of hyoscyamine and scopolamine biosynthesis:
(S)-atropinium + 2-oxoglutarate + O2 ⟶ (6S)-hydroxyhyoscyamine + CO2 + succinate - hyoscyamine and scopolamine biosynthesis:
(S)-atropinium + 2-oxoglutarate + O2 ⟶ (6S)-hydroxyhyoscyamine + CO2 + succinate - 6-methoxypodophyllotoxin biosynthesis:
(-)-yatein + 2-oxoglutarate + O2 ⟶ (-)-deoxypodophyllotoxin + CO2 + H2O + succinate - (-)-4'-demethyl-epipodophyllotoxin biosynthesis:
(-)-deoxypodophyllotoxin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (-)-4'-demethyl-deoxypodophyllotoxin + H2O + MeOH + an oxidized [NADPH-hemoprotein reductase] - morphine biosynthesis:
2-oxoglutarate + O2 + codeine ⟶ CO2 + formaldehyde + morphine + succinate - morphine biosynthesis:
2-oxoglutarate + O2 + codeine ⟶ CO2 + formaldehyde + morphine + succinate - L-lysine biosynthesis I:
N-succinyl-L,L-2,6-diaminopimelate + H2O ⟶ L,L-diaminopimelate + succinate - superpathway of L-lysine, L-threonine and L-methionine biosynthesis I:
ATP + L-homoserine ⟶ ADP + H+ + O-phospho-L-homoserine - aspartate superpathway:
ATP + L-homoserine ⟶ ADP + H+ + O-phospho-L-homoserine - superpathway of L-lysine, L-threonine and L-methionine biosynthesis I:
2-oxoglutarate + asp ⟶ glu + oxaloacetate - L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glu - aspartate superpathway:
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-carnitine biosynthesis:
γ-butyrobetaine + 2-oxoglutarate + O2 ⟶ CO2 + L-carnitine + succinate - γ-butyrobetaine degradation:
L-carnitine + NAD+ ⟶ 3-dehydrocarnitine + H+ + NADH - L-carnitine biosynthesis:
3-hydroxy-N6,N6,N6-trimethyl-L-lysine ⟶ 4-trimethylammoniobutanal + gly - L-carnitine biosynthesis:
γ-butyrobetaine + 2-oxoglutarate + O2 ⟶ CO2 + L-carnitine + succinate - L-carnitine biosynthesis:
γ-butyrobetaine + 2-oxoglutarate + O2 ⟶ CO2 + L-carnitine + succinate - γ-butyrobetaine degradation:
L-carnitine + NAD+ ⟶ 3-dehydrocarnitine + H+ + NADH - validamycin biosynthesis:
GDP-valienol + validamine 7-phosphate ⟶ GDP + H+ + validoxylamine A 7'-phosphate - superpathway of conversion of glucose to acetyl CoA and entry into the TCA cycle:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - TCA cycle:
D-threo-isocitrate + NAD+ ⟶ 2-oxoglutarate + CO2 + NADH - succinate to cytochrome bo oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - TCA cycle III (animals):
UQ + succinate ⟶ UQH2 + fumarate - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration II (cytochrome c) (yeast):
UQH2 + an oxidized c-type cytochrome ⟶ H+ + UQ + a reduced c-type cytochrome - aerobic respiration III (alternative oxidase pathway):
O2 + UQH2 ⟶ H2O + UQ - aerobic respiration I (cytochrome c):
UQH2 + an oxidized c-type cytochrome ⟶ H+ + UQ + a reduced c-type cytochrome - TCA cycle I (prokaryotic):
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - superpathway of glyoxylate bypass and TCA:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - succinate to cytochrome bo oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - TCA cycle variation V (plant):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - TCA cycle I (prokaryotic):
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - superpathway of glyoxylate bypass and TCA:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - succinate to cytochrome bo oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - superpathway of glyoxylate bypass and TCA:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - TCA cycle I (prokaryotic):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - TCA cycle I (prokaryotic):
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - succinate to cytochrome bo oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - superpathway of glyoxylate bypass and TCA:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - TCA cycle I (prokaryotic):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - superpathway of glyoxylate bypass and TCA:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - succinate to cytochrome bo oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - TCA cycle I (prokaryotic):
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - superpathway of glyoxylate bypass and TCA:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - succinate to cytochrome bo oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - succinate to cytochrome bo oxidase electron transfer:
H+ + O2 + UQH2 ⟶ H+ + H2O + UQ - aerobic respiration (cytochrome c):
UQH2 + an oxidized c-type cytochrome ⟶ H+ + UQ + a reduced c-type cytochrome - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration -- electron donors reaction list:
UQ + succinate ⟶ UQH2 + fumarate - TCA cycle variation III (eukaryotic):
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - aerobic respiration -- electron donor II:
UQ + succinate ⟶ UQH2 + fumarate - TCA cycle:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - superpathway of glyoxylate cycle and fatty acid degradation:
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - aerobic respiration -- electron donors reaction list:
UQ + succinate ⟶ UQH2 + fumarate - superpathway of glyoxylate cycle and fatty acid degradation:
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - TCA cycle III (animals):
D-threo-isocitrate + NAD+ ⟶ 2-oxoglutarate + CO2 + NADH - TCA cycle I (prokaryotic):
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - succinate to cytochrome bo oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - superpathway of glyoxylate bypass and TCA:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - TCA cycle I (prokaryotic):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - superpathway of glyoxylate bypass and TCA:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - succinate to cytochrome bo oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - TCA cycle:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - succinate to cytochrome bo oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - TCA cycle I (prokaryotic):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - TCA cycle VI (obligate autotrophs):
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonia - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - TCA cycle I (prokaryotic):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - succinate to cytochrome bo oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - TCA cycle I (prokaryotic):
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - TCA cycle I (prokaryotic):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - superpathway of glyoxylate bypass and TCA:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - TCA cycle I (prokaryotic):
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - pyruvate fermentation to propanoate I:
(S)-methylmalonyl-CoA + pyruvate ⟶ oxaloacetate + propanoyl-CoA - conversion of succinate to propanoate:
propanoyl-CoA + succinate ⟶ propanoate + succinyl-CoA - L-glutamate degradation VIII (to propanoate):
propanoyl-CoA + succinate ⟶ propanoate + succinyl-CoA - anaerobic energy metabolism (invertebrates, mitochondrial):
ATP + hydrogencarbonate + propanoyl-CoA ⟶ (S)-methylmalonyl-CoA + ADP + H+ + phosphate - superpathway of anaerobic energy metabolism (invertebrates):
ATP + hydrogencarbonate + propanoyl-CoA ⟶ (S)-methylmalonyl-CoA + ADP + H+ + phosphate - conversion of succinate to propanoate:
propanoyl-CoA + succinate ⟶ propanoate + succinyl-CoA - conversion of succinate to propionate:
(R)-methylmalonyl-CoA + H+ ⟶ CO2 + propionyl-CoA - conversion of succinate to propionate:
(R)-methylmalonyl-CoA + H+ ⟶ CO2 + propanoyl-CoA - conversion of succinate to propanoate:
propanoyl-CoA + succinate ⟶ propanoate + succinyl-CoA - pyruvate fermentation to propanoate I:
propanoyl-CoA + succinate ⟶ propanoate + succinyl-CoA - pyruvate fermentation to propanoate I:
propanoyl-CoA + succinate ⟶ propanoate + succinyl-CoA - pyruvate fermentation to propanoate I:
(S)-methylmalonyl-CoA + pyruvate ⟶ oxaloacetate + propanoyl-CoA - conversion of succinate to propionate:
(R)-methylmalonyl-CoA + H+ ⟶ CO2 + propanoyl-CoA - conversion of succinate to propionate:
(R)-methylmalonyl-CoA + H+ ⟶ CO2 + propanoyl-CoA - conversion of succinate to propionate:
(R)-methylmalonyl-CoA + H+ ⟶ CO2 + propanoyl-CoA - pyruvate fermentation to propionate I:
(S)-malate ⟶ H2O + fumarate - pyruvate fermentation to propionate I:
MQH2 + fumarate ⟶ MQ + succinate - conversion of succinate to propionate:
(R)-methylmalonyl-CoA + H+ ⟶ CO2 + propanoyl-CoA - pyruvate fermentation to propanoate I:
propanoyl-CoA + succinate ⟶ propanoate + succinyl-CoA - lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt - 2,4-dichlorophenoxyacetate degradation:
2,4-dichlorophenoxyacetate + 2-oxoglutarate + O2 ⟶ 2,4-dichlorophenol + CO2 + glyoxylate + succinate - polymethylated quercetin glucoside biosynthesis II - quercetagetin series (Chrysosplenium):
3,6,7-trimethylquercetagetin + SAM ⟶ 3,6,7,4'-tetramethylquercetagetin + H+ + SAH - superpathway of polymethylated quercetin/quercetagetin glucoside biosynthesis (Chrysosplenium):
3,6,7-trimethylquercetagetin + SAM ⟶ 3,6,7,4'-tetramethylquercetagetin + H+ + SAH - mercaptosuccinate degradation:
H2O + sulfinosuccinate ⟶ H+ + succinate + sulfite - superpathway of taurine degradation:
2-oxoglutarate + O2 + taurine ⟶ 2-aminoacetaldehyde + CO2 + H+ + succinate + sulfite - taurine degradation IV:
2-oxoglutarate + O2 + taurine ⟶ 2-aminoacetaldehyde + CO2 + H+ + succinate + sulfite - taurine degradation IV:
2-oxoglutarate + O2 + taurine ⟶ 2-aminoacetaldehyde + CO2 + H+ + succinate + sulfite - taurine degradation IV:
2-oxoglutarate + O2 + taurine ⟶ CO2 + H+ + aminoacetaldehyde + succinate + sulfite - taurine degradation IV:
2-oxoglutarate + O2 + taurine ⟶ CO2 + H+ + aminoacetaldehyde + succinate + sulfite - taurine degradation IV:
2-oxoglutarate + O2 + taurine ⟶ CO2 + H+ + aminoacetaldehyde + succinate + sulfite - L-cysteine degradation IV:
2-oxoglutarate + O2 + taurine ⟶ 2-aminoacetaldehyde + CO2 + H+ + succinate + sulfite - taurine degradation IV:
2-oxoglutarate + O2 + taurine ⟶ CO2 + H+ + aminoacetaldehyde + succinate + sulfite - taurine degradation IV:
2-oxoglutarate + O2 + taurine ⟶ CO2 + H+ + aminoacetaldehyde + succinate + sulfite - superpathway of central carbon metabolism:
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate - TCA cycle:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - superpathway of glycolysis, pyruvate dehydrogenase and TCA cycle:
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate - aerobic respiration -- electron donor II:
UQ + succinate ⟶ UQH2 + fumarate - TCA cycle:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - 3-oxoadipate degradation:
3-oxoadipate + succinyl-CoA ⟶ 3-oxoadipyl-CoA + succinate - ethylene biosynthesis IV (engineered):
2-oxoglutarate + H+ + O2 ⟶ CO2 + H2O + ethene - acetyl-CoA degradation to acetate:
ATP + acetate + coenzyme A ⟶ AMP + H+ + acetyl-CoA + diphosphate - superpathway of flavones and derivatives biosynthesis:
UDP-β-L-rhamnose + quercetin 3-O-sophoroside ⟶ H+ + UDP + quercetin 3-O-rhamnosyl(1->2)glucoside-7-O-rhamnoside - flavonoid biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ (+)-dihydrokaempferol + CO2 + succinate - flavonoid biosynthesis (in equisetum):
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonoid biosynthesis (in equisetum):
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ (+)-dihydrokaempferol + CO2 + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+ - flavonoid biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ (+)-dihydrokaempferol + CO2 + succinate - superpathway of 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutyrate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation I:
2-oxoglutarate + 4-aminobutyrate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutyrate ⟶ glt + succinate semialdehyde - superpathway of arginine and ornithine degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ γ-glutamyl-γ-aminobutyraldehyde + ammonium + hydrogen peroxide - superpathway of arginine, putrescine, and 4-aminobutyrate degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ γ-glutamyl-γ-aminobutyraldehyde + ammonium + hydrogen peroxide - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - hydroxylated mugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + 2-oxoglutarate + O2 ⟶ 3-epihydroxy-2'-deoxymugineate + CO2 + H+ + succinate - viridicatin biosynthesis:
(-)-cyclopenine ⟶ H+ + methyl isocyanate + viridicatin - polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
2-oxoglutarate + 3,7,4'-trimethylquercetin + O2 ⟶ 3,7,4'-trimethylquercetagetin + CO2 + succinate - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + pelargonidin + succinate - isoflavonoid biosynthesis II:
SAM + genistein ⟶ SAH + prunetin - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - superpathway of isoflavonoids (via naringenin):
SAM + genistein ⟶ SAH + prunetin - 4'-methoxyviridicatin biosynthesis:
(-)-4'-methoxycyclopenine ⟶ 4'-methoxyviridicatin + H+ + methyl isocyanate - TCA cycle V (2-oxoglutarate:ferredoxin oxidoreductase):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - TCA cycle V (2-oxoglutarate:ferredoxin oxidoreductase):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - glyoxylate cycle:
D-threo-isocitrate ⟶ glyoxylate + succinate - luteolinidin 5-O-glucoside biosynthesis:
UDP-α-D-glucose + luteolinidin ⟶ H+ + UDP + luteolinidin 5-O-glucoside - stipitatate biosynthesis:
H2O + stipitatonate ⟶ CO2 + H+ + stipitatate - hyoscyamine and scopolamine biosynthesis:
2-oxoglutarate + L-hyoscyamine + O2 ⟶ (6S)-hydroxyhyoscyamine + CO2 + succinate - 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - GABA shunt:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - TCA cycle IV (2-oxoglutarate decarboxylase):
2-oxoglutarate + H+ ⟶ CO2 + succinate semialdehyde - 4-hydroxyphenylacetate degradation:
(4Z)-2-oxohept-4-enedioate + H2O ⟶ (4S)-4-hydroxy-2-oxoheptanedioate - nicotine degradation II (pyrrolidine pathway):
6-hydroxy-3-succinoyl-pyridine + H+ + NADH + O2 ⟶ 2,5-dihydroxypyridine + H2O + NAD+ + succinate semialdehyde - nicotine degradation I (pyridine pathway):
2,6-dihydroxypyridine + H+ + NADH + O2 ⟶ 2,3,6-trihydroxypyridine + H2O + NAD+ - 4-aminobutanoate degradation III:
H2O + NAD(P)+ + succinate semialdehyde ⟶ H+ + NAD(P)H + succinate - 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - GABA shunt:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - N-methylpyrrolidone degradation:
4-methylaminobutanoate + H2O + O2 ⟶ hydrogen peroxide + methylamine + succinate semialdehyde - superpathway of L-arginine, putrescine, and 4-aminobutanoate degradation:
H2O + agmatine ⟶ putrescine + urea - superpathway of L-arginine and L-ornithine degradation:
4-aminobutanal ⟶ 1-pyrroline + H2O - L-glutamate degradation IV:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - superpathway of L-arginine, putrescine, and 4-aminobutanoate degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ 4-(γ-L-glutamylamino)butanal + ammonium + hydrogen peroxide - superpathway of L-arginine and L-ornithine degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ 4-(γ-L-glutamylamino)butanal + ammonium + hydrogen peroxide - 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - glutamate degradation to succinate:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - L-glutamate degradation IV:
4-hydroxybutanoate + NAD(P)+ ⟶ H+ + NAD(P)H + succinate semialdehyde - 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - superpathway of 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - glutamate degradation IX (via 4-aminobutyrate):
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - TCA cycle IV (2-oxoglutarate decarboxylase):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - GABA shunt:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - glutamate degradation IX (via 4-aminobutyrate):
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-hydroxyphenylacetate degradation:
4-hydroxyphenylacetate + FADH2 + O2 ⟶ 3,4-dihydroxyphenylacetate + FAD + H+ + H2O - 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - superpathway of 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - glutamate degradation IX (via 4-aminobutyrate):
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - TCA cycle IV (2-oxoglutarate decarboxylase):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - 4-aminobutyrate degradation I:
2-oxoglutarate + 4-aminobutyrate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation IV:
4-aminobutyrate + pyruvate ⟶ ala + succinate semialdehyde - glutamate degradation IV:
4-aminobutyrate + pyruvate ⟶ ala + succinate semialdehyde - glutamate degradation III (via 4-aminobutyrate):
2-oxoglutarate + 4-aminobutyrate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - superpathway of glycolysis and TCA variant VIII:
2-oxoglutarate + H+ ⟶ CO2 + succinate semialdehyde - superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - TCA cycle IV (2-oxoglutarate decarboxylase):
2-oxoglutarate + H+ ⟶ CO2 + succinate semialdehyde - 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - TCA cycle IV (2-oxoglutarate decarboxylase):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - superpathway of arginine, putrescine, and 4-aminobutyrate degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ 4-(γ-glutamylamino)butanal + ammonium + hydrogen peroxide - superpathway of arginine and ornithine degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ 4-(γ-glutamylamino)butanal + ammonium + hydrogen peroxide - 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - superpathway of 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-hydroxyphenylacetate degradation:
4-hydroxyphenylacetate + FADH2 + O2 ⟶ 3,4-dihydroxyphenylacetate + FAD + H+ + H2O - 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - superpathway of 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - superpathway of arginine, putrescine, and 4-aminobutyrate degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ 4-(γ-glutamylamino)butanal + ammonium + hydrogen peroxide - superpathway of arginine and ornithine degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ 4-(γ-glutamylamino)butanal + ammonium + hydrogen peroxide - 4-hydroxyphenylacetate degradation:
4-hydroxyphenylacetate + FADH2 + O2 ⟶ 3,4-dihydroxyphenylacetate + FAD + H+ + H2O - TCA cycle variation I:
2-oxoglutarate + H+ ⟶ CO2 + succinate semialdehyde - 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutyrate ⟶ glt + succinate semialdehyde - 4-hydroxyphenylacetate degradation:
4-hydroxyphenylacetate + FADH2 + O2 ⟶ 3,4-dihydroxyphenylacetate + FAD + H2O - 4-aminobutyrate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - glutamate degradation IX (via 4-aminobutyrate):
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - superpathway of 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - 4-aminobutanoate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - 4-aminobutanoate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - 4-aminobutanoate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - 4,4'-disulfanediyldibutanoate degradation:
4-oxo-4-sulfanylbutanoate + H2O ⟶ H+ + hydrogen sulfide + succinate - homoserine and methionine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH - vindoline and vinblastine biosynthesis:
O2 + vinblastine ⟶ H+ + H2O + vincristine - kanamycin biosynthesis:
2-deoxy-L-scyllo-inosose + gln ⟶ 2-deoxy-scyllo-inosamine + 2-oxoglutaramate - succinic fermentation pathway:
(S)-malate ⟶ H2O + fumarate - glutamate degradation VII:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - superpathway of L-lysine, L-threonine and L-methionine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + Glu - aspartate superpathway:
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + Glu - L-lysine biosynthesis I:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate - L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt - L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glu - superpathway of L-lysine, L-threonine and L-methionine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt - L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt - aspartate superpathway:
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-lysine biosynthesis I:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH - L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glu - aspartate superpathway:
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-lysine, L-threonine and L-methionine biosynthesis I:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt - aspartate threonine lysine biosynthesis superpathway:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - superpathway of L-lysine, L-threonine and L-methionine biosynthesis I:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - aspartate superpathway:
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt - L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + Glu - 12-epi-fischerindole biosynthesis:
D-ribulose 5-phosphate + trp ⟶ (2S)-3-(1H-indol-3-yl)-2-isocyanopropanoate + H+ + H2O + acetol + formaldehyde + phosphate - 4-chloro-2-methylphenoxyacetate degradation:
2-methyl-4-chlorophenol + H+ + NADPH + O2 ⟶ 5-chloro-3-methylcatechol + H2O + NADP+
WikiPathways(3)
- Thiamine metabolic pathways:
alpha-ketoglutarate ⟶ succinate - GABA metabolism (aka GHB):
beta-alanine ⟶ malonic semialdehyde - Krebs cycle disorders:
alpha-ketoglutarate ⟶ Succinyl coenzyme A
Plant Reactome(663)
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
H2O + indole-3-acetyl-ala ⟶ IAA + L-Ala - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Hormone signaling, transport, and metabolism:
H2O + indole-3-acetyl-ala ⟶ IAA + L-Ala - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA - Hormone signaling, transport, and metabolism:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate + Oxygen ⟶ CH3COO- + jasmonic acid - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A14 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Secondary metabolism:
GPP + H2O ⟶ PPi + geraniol - Leucodelphinidin biosynthesis:
2OG + Oxygen + eriodictyol ⟶ (+)-taxifolin + SUCCA + carbon dioxide - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Leucopelargonidin and leucocyanidin biosynthesis:
2OG + Oxygen + eriodictyol ⟶ (+)-taxifolin + SUCCA + carbon dioxide - Amino acid metabolism:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA - Amino acid biosynthesis:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA - Lysine biosynthesis I:
L-Glu + N-succinyl-2-amino-6-ketopimelate ⟶ 2OG + N-succinyl-L,L-2,6-diaminopimelate - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
L-Phe ⟶ ammonia + trans-cinnamate - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
UDP-Glc + pelargonidin ⟶ UDP + pelargonidin-3-O-beta-D-glucoside - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
2OG + Oxygen + naringenin ⟶ H2O + SUCCA + apigenin + carbon dioxide - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
2OG + Oxygen + naringenin ⟶ H2O + SUCCA + apigenin + carbon dioxide - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
2OG + Oxygen + naringenin ⟶ H2O + SUCCA + apigenin + carbon dioxide - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
2OG + Oxygen + naringenin ⟶ SUCCA + carbon dioxide + dihydrokaempferol - Flavonoid biosynthesis:
4-coumarate + ATP + CoA-SH ⟶ 4-coumaroyl-CoA + AMP + PPi - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Generation of precursor metabolites and energy:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - TCA cycle (plant):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - GABA shunt:
GABA + PYR ⟶ L-Ala + SUCCSA
INOH(0)
PlantCyc(1904)
- chrysin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + chrysin + succinate - pinobanksin biosynthesis:
(2S)-pinocembrin + SAM ⟶ SAH + pinostrobin - pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate - pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate - nevadensin biosynthesis:
2-oxoglutarate + O2 + gardenin B ⟶ CO2 + formaldehyde + nevadensin + succinate - apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A53 ⟶ CO2 + gibberellin44 (open lactone form) + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin44 (open lactone form) ⟶ CO2 + H2O + gibberellin A19 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin44 (open lactone form) ⟶ CO2 + H2O + gibberellin A19 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin44 (open lactone form) ⟶ CO2 + H2O + gibberellin A19 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - superpathway of gibberellin biosynthesis:
2-oxoglutarate + O2 + gibberellin A5 ⟶ CO2 + gibberellin A6 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin44 (open lactone form) ⟶ CO2 + H2O + gibberellin A19 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin44 (open lactone form) ⟶ CO2 + H2O + gibberellin A19 + succinate - superpathway of gibberellin biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin44 (open lactone form) ⟶ CO2 + H2O + gibberellin A19 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + H+ + O2 + gibberellin44 (open lactone form) ⟶ CO2 + H2O + gibberellin A38 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A53 ⟶ CO2 + gibberellin44 (open lactone form) + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin44 (open lactone form) ⟶ CO2 + H2O + gibberellin A19 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin44 (open lactone form) ⟶ CO2 + H2O + gibberellin A19 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin44 (open lactone form) ⟶ CO2 + H2O + gibberellin A19 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - superpathway of gibberellin biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + H+ + O2 + gibberellin44 (open lactone form) ⟶ CO2 + H2O + gibberellin A38 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - superpathway of gibberellin biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + O2 + gibberellin A15 (open lactone form) ⟶ CO2 + gibberellin A37 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A15 (open lactone form) ⟶ CO2 + H2O + gibberellin A24 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A12 ⟶ CO2 + gibberellin A15 (open lactone form) + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A15 (open lactone form) ⟶ CO2 + H2O + gibberellin A24 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A9 ⟶ CO2 + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A15 (open lactone form) ⟶ CO2 + H2O + gibberellin A24 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A15 (open lactone form) ⟶ CO2 + H2O + gibberellin A24 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A25 ⟶ CO2 + gibberellin A13 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A15 (open lactone form) ⟶ CO2 + H2O + gibberellin A24 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A9 ⟶ CO2 + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + O2 + gibberellin A15 (open lactone form) ⟶ CO2 + gibberellin A37 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A12 ⟶ CO2 + gibberellin A15 (open lactone form) + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A9 ⟶ CO2 + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A9 ⟶ CO2 + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + O2 + gibberellin A37 ⟶ CO2 + H2O + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A25 ⟶ CO2 + gibberellin A13 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + O2 + gibberellin A12 ⟶ CO2 + gibberellin A14 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + O2 + gibberellin A12 ⟶ CO2 + gibberellin A14 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A15 (open lactone form) ⟶ CO2 + H2O + gibberellin A24 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A12 ⟶ CO2 + gibberellin A15 (open lactone form) + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A15 (open lactone form) ⟶ CO2 + H2O + gibberellin A24 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A9 ⟶ CO2 + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A12 ⟶ CO2 + gibberellin A15 (open lactone form) + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A12 ⟶ CO2 + gibberellin A15 (open lactone form) + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + O2 + gibberellin A15 (open lactone form) ⟶ CO2 + gibberellin A37 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A9 ⟶ CO2 + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin inactivation I (2β-hydroxylation):
2-oxoglutarate + O2 + gibberellin A51 ⟶ CO2 + H+ + H2O + gibberellin A51-catabolite + succinate - gibberellin inactivation I (2β-hydroxylation):
2-oxoglutarate + H+ + O2 + gibberellin A44 (closed lactone form) ⟶ CO2 + gibberellin A98 + succinate - gibberellin inactivation I (2β-hydroxylation):
2-oxoglutarate + O2 + gibberellin A51 ⟶ CO2 + H+ + H2O + gibberellin A51-catabolite + succinate - gibberellin inactivation I (2β-hydroxylation):
2-oxoglutarate + O2 + gibberellin A53 ⟶ CO2 + gibberellin A97 + succinate - gibberellin inactivation I (2β-hydroxylation):
2-oxoglutarate + O2 + gibberellin A12 ⟶ CO2 + gibberellin A110 + succinate - gibberellin inactivation I (2β-hydroxylation):
2-oxoglutarate + O2 + gibberellin A34 ⟶ CO2 + H+ + H2O + gibberellin A34-catabolite + succinate - gibberellin inactivation I (2β-hydroxylation):
2-oxoglutarate + O2 + gibberellin A51 ⟶ CO2 + H+ + H2O + gibberellin A51-catabolite + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A15 (open lactone form) ⟶ CO2 + H2O + gibberellin A24 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A15 (open lactone form) ⟶ CO2 + H2O + gibberellin A24 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A9 ⟶ CO2 + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A9 ⟶ CO2 + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A9 ⟶ CO2 + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A15 (open lactone form) ⟶ CO2 + H2O + gibberellin A24 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A15 (open lactone form) ⟶ CO2 + H2O + gibberellin A24 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A9 ⟶ CO2 + gibberellin A4 + succinate - morphine biosynthesis:
2-oxoglutarate + O2 + oripavine ⟶ CO2 + formaldehyde + morphinone + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate - luteolin biosynthesis:
(2S)-eriodictyol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + luteolin - flavonoid biosynthesis (in equisetum):
(2S)-eriodictyol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (2S)-dihydrotricetin + H2O + an oxidized [NADPH-hemoprotein reductase] - leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - luteolin biosynthesis:
(2S)-eriodictyol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + luteolin - flavonoid biosynthesis (in equisetum):
(2S)-naringenin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (2S)-eriodictyol + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - flavonoid biosynthesis (in equisetum):
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - luteolin biosynthesis:
(2S)-naringenin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (2S)-eriodictyol + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - luteolin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ CO2 + H2O + luteolin + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - flavonoid biosynthesis (in equisetum):
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - luteolin biosynthesis:
(2S)-eriodictyol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + luteolin - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - flavonol biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - flavonol biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - syringetin biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - superpathway of flavones and derivatives biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin - leucodelphinidin biosynthesis:
(2S)-eriodictyol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (2S)-dihydrotricetin + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - flavonol biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-taxifolin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + quercetin + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-taxifolin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + quercetin + succinate - flavonol biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - syringetin biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - flavonol biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - flavonol biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - flavonol biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - flavonol biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - flavonol biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - leucodelphinidin biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - syringetin biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - syringetin biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - syringetin biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - syringetin biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - syringetin biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - leucodelphinidin biosynthesis:
(2S)-eriodictyol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (2S)-dihydrotricetin + H2O + an oxidized [NADPH-hemoprotein reductase] - syringetin biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - superpathway of flavones and derivatives biosynthesis:
PAPS + isorhamnetin ⟶ 3',5'-ADP + H+ + isorhamnetin 3-sulfate - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - syringetin biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - syringetin biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - syringetin biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - superpathway of flavones and derivatives biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin - syringetin biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - leucodelphinidin biosynthesis:
(2S)-eriodictyol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (2S)-dihydrotricetin + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - 6-methoxypodophyllotoxin biosynthesis:
(-)-yatein + 2-oxoglutarate + O2 ⟶ (-)-deoxypodophyllotoxin + CO2 + H2O + succinate - (-)-4'-demethyl-epipodophyllotoxin biosynthesis:
(-)-deoxypodophyllotoxin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (-)-4'-demethyl-deoxypodophyllotoxin + H2O + MeOH + an oxidized [NADPH-hemoprotein reductase] - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate - apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate - apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate - apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate - apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - gibberellin biosynthesis V:
2-oxoglutarate + O2 + gibberellin A5 ⟶ CO2 + gibberellin A6 + succinate - gibberellin biosynthesis V:
2-oxoglutarate + O2 + gibberellin A5 ⟶ CO2 + gibberellin A6 + succinate - gibberellin biosynthesis V:
2-oxoglutarate + O2 + gibberellin A5 ⟶ CO2 + gibberellin A3 + succinate - gibberellin biosynthesis V:
2-oxoglutarate + O2 + gibberellin A5 ⟶ CO2 + gibberellin A3 + succinate - gibberellin biosynthesis V:
2-oxoglutarate + O2 + gibberellin A5 ⟶ CO2 + gibberellin A3 + succinate - L-carnitine biosynthesis:
γ-butyrobetaine + 2-oxoglutarate + O2 ⟶ CO2 + L-carnitine + succinate - L-carnitine biosynthesis:
γ-butyrobetaine + 2-oxoglutarate + O2 ⟶ CO2 + L-carnitine + succinate - L-carnitine biosynthesis:
γ-butyrobetaine + 2-oxoglutarate + O2 ⟶ CO2 + L-carnitine + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + O2 + gibberellin A12 ⟶ CO2 + gibberellin A14 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + O2 + gibberellin A12 ⟶ CO2 + gibberellin A14 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - TCA cycle variation V (plant):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - TCA cycle III (animals):
2-oxoglutarate + H+ + a [2-oxoglutarate dehydrogenase E2 protein] N6-lipoyl-L-lysine ⟶ CO2 + a [2-oxoglutarate dehydrogenase E2 protein] N6-S-succinyldihydrolipoyl-L-lysine - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - TCA cycle III (animals):
citrate ⟶ cis-aconitate + H2O - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - TCA cycle variation V (plant):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
UQH2 + an oxidized c-type cytochrome ⟶ H+ + UQ + a reduced c-type cytochrome - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration II (cytochrome c) (yeast):
H+ + NADH + UQ ⟶ NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - polymethylated quercetin glucoside biosynthesis II - quercetagetin series (Chrysosplenium):
3,6,7-trimethylquercetagetin + SAM ⟶ 3,6,7,4'-tetramethylquercetagetin + H+ + SAH - superpathway of polymethylated quercetin/quercetagetin glucoside biosynthesis (Chrysosplenium):
3,6,7-trimethylquercetagetin + SAM ⟶ 3,6,7,4'-tetramethylquercetagetin + H+ + SAH - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - superpathway of benzoxazinoid glucosides biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH - superpathway of benzoxazinoid glucosides biosynthesis:
DIBOA + UDP-α-D-glucose ⟶ DIBOA-Glc + UDP - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH - DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH - superpathway of benzoxazinoid glucosides biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH - DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH - superpathway of benzoxazinoid glucosides biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - superpathway of benzoxazinoid glucosides biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH - DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH - superpathway of benzoxazinoid glucosides biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH - DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH - reductive TCA cycle I:
ATP + hydrogencarbonate + pyruvate ⟶ ADP + H+ + oxaloacetate + phosphate - superpathway of glyoxylate cycle and fatty acid degradation:
an electron-transfer quinone + succinate ⟶ an electron-transfer quinol + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQH2 + an oxidized c-type cytochrome ⟶ H+ + UQ + a reduced c-type cytochrome - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonol biosynthesis:
(+)-taxifolin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + quercetin + succinate - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonol biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonol biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonol biosynthesis:
(+)-taxifolin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + quercetin + succinate - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - superpathway of flavones and derivatives biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+ - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ (+)-dihydrokaempferol + CO2 + succinate - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + NADPH + malonyl-CoA ⟶ CO2 + H2O + NADP+ + coenzyme A + isoliquiritigenin - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + NADPH + malonyl-CoA ⟶ CO2 + H2O + NADP+ + coenzyme A + isoliquiritigenin - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - hydroxylated mugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + 2-oxoglutarate + O2 ⟶ CO2 + H+ + mugineate + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
3,7,4'-trimethylquercetin + H+ + NADPH + O2 ⟶ 2'-hydroxy 3,7,4'-trimethylquercetin + H2O + NADP+ - polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
3,7,4'-trimethylquercetin + H+ + NADPH + O2 ⟶ 2'-hydroxy 3,7,4'-trimethylquercetin + H2O + NADP+ - polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
3,7,4'-trimethylquercetin + H+ + NADPH + O2 ⟶ 2'-hydroxy 3,7,4'-trimethylquercetin + H2O + NADP+ - polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
2'-hydroxy 3,7,4'-trimethylquercetin + SAM ⟶ 2'-hydroxy 3,7,3',4'-tetramethylquercetin + H+ + SAH - polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
3,7,4'-trimethylquercetin + H+ + NADPH + O2 ⟶ 2'-hydroxy 3,7,4'-trimethylquercetin + H2O + NADP+ - polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
2'-hydroxy 3,7,4'-trimethylquercetin + SAM ⟶ 2'-hydroxy 3,7,3',4'-tetramethylquercetin + H+ + SAH - polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
2'-hydroxy 3,7,4'-trimethylquercetin + UDP-α-D-glucose ⟶ 3,7,4'-trimethylquercetin 2'-O-β-D-glucoside + H+ + UDP - polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
2'-hydroxy 3,7,4'-trimethylquercetin + SAM ⟶ 2'-hydroxy 3,7,3',4'-tetramethylquercetin + H+ + SAH - polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
2'-hydroxy 3,7,4'-trimethylquercetin + SAM ⟶ 2'-hydroxy 3,7,3',4'-tetramethylquercetin + H+ + SAH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - proanthocyanidins biosynthesis from flavanols:
UDP-α-D-glucose + a (2R,3R)-flavan-3-ol ⟶ H+ + UDP + a (2R,3R)-flavan-3-ol-3'-O-glucoside - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - proanthocyanidins biosynthesis from flavanols:
UDP-α-D-glucose + a (2R,3R)-flavan-3-ol ⟶ H+ + UDP + a (2R,3R)-flavan-3-ol-3'-O-glucoside - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
UDP-α-D-glucose + a (2R,3R)-flavan-3-ol ⟶ H+ + UDP + a (2R,3R)-flavan-3-ol-3'-O-glucoside - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ CO2 + H2O + luteolin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - superpathway of isoflavonoids (via naringenin):
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H+ + H2O + an oxidized [NADPH-hemoprotein reductase] + apigenin - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - isoflavonoid biosynthesis II:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - isoflavonoid biosynthesis II:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - superpathway of isoflavonoids (via naringenin):
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - isoflavonoid biosynthesis II:
(2S)-naringenin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + an oxidized [NADPH-hemoprotein reductase] - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H+ + H2O + an oxidized [NADPH-hemoprotein reductase] + apigenin - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - isoflavonoid biosynthesis II:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - isoflavonoid biosynthesis II:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H+ + H2O + an oxidized [NADPH-hemoprotein reductase] + apigenin - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+ - isoflavonoid biosynthesis II:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H+ + H2O + an oxidized [NADPH-hemoprotein reductase] + apigenin - superpathway of isoflavonoids (via naringenin):
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - isoflavonoid biosynthesis II:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - isoflavonoid biosynthesis II:
(2S)-naringenin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + an oxidized [NADPH-hemoprotein reductase] - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
2,4',5,7-tetrahydroxyisoflavanone + SAM ⟶ 2,5,7-trihydroxy-4'-methoxyisoflavanone + H+ + SAH - isoflavonoid biosynthesis II:
SAM + genistein ⟶ SAH + prunetin - proanthocyanidins biosynthesis from flavanols:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
NAD(P)+ + a (2R,3R)-flavan-3-ol ⟶ H+ + NAD(P)H + an anthocyanidin with a 3-hydroxy group - anthocyanin biosynthesis:
UDP-α-D-glucose + an anthocyanidin with a 3-hydroxy group ⟶ H+ + UDP + an anthocyanidin-3-O-β-D-glucoside - hyoscyamine and scopolamine biosynthesis:
(6S)-hydroxyhyoscyamine + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + scopolamine + succinate - superpathway of hyoscyamine and scopolamine biosynthesis:
N-methylputrescine + H2O + O2 ⟶ N-methylaminobutanal + ammonium + hydrogen peroxide - hyoscyamine and scopolamine biosynthesis:
NADP+ + tropine ⟶ H+ + NADPH + tropinone - superpathway of hyoscyamine and scopolamine biosynthesis:
N-methylputrescine + H2O + O2 ⟶ N-methylaminobutanal + ammonium + hydrogen peroxide - hyoscyamine and scopolamine biosynthesis:
NADP+ + tropine ⟶ H+ + NADPH + tropinone - superpathway of hyoscyamine and scopolamine biosynthesis:
N-methylputrescine + H2O + O2 ⟶ N-methylaminobutanal + ammonium + hydrogen peroxide - hyoscyamine and scopolamine biosynthesis:
(S)-atropine + 2-oxoglutarate + O2 ⟶ (6S)-hydroxyhyoscyamine + CO2 + succinate - superpathway of hyoscyamine and scopolamine biosynthesis:
N-methylputrescine + H2O + O2 ⟶ N-methylaminobutanal + ammonium + hydrogen peroxide - superpathway of hyoscyamine and scopolamine biosynthesis:
NADP+ + tropine ⟶ H+ + NADPH + tropinone - hyoscyamine and scopolamine biosynthesis:
NADP+ + tropine ⟶ H+ + NADPH + tropinone - hyoscyamine and scopolamine biosynthesis:
(S)-atropine + 2-oxoglutarate + O2 ⟶ (6S)-hydroxyhyoscyamine + CO2 + succinate - superpathway of hyoscyamine and scopolamine biosynthesis:
N-methylputrescine + H2O + O2 ⟶ N-methylaminobutanal + ammonium + hydrogen peroxide - hyoscyamine and scopolamine biosynthesis:
(S)-atropine + 2-oxoglutarate + O2 ⟶ (6S)-hydroxyhyoscyamine + CO2 + succinate - superpathway of hyoscyamine and scopolamine biosynthesis:
N-methylputrescine + H2O + O2 ⟶ N-methylaminobutanal + ammonium + hydrogen peroxide - hyoscyamine and scopolamine biosynthesis:
(S)-atropine + 2-oxoglutarate + O2 ⟶ (6S)-hydroxyhyoscyamine + CO2 + succinate - superpathway of hyoscyamine and scopolamine biosynthesis:
N-methylputrescine + H2O + O2 ⟶ N-methylaminobutanal + ammonium + hydrogen peroxide - hyoscyamine and scopolamine biosynthesis:
NADP+ + tropine ⟶ H+ + NADPH + tropinone - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - syringetin biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - syringetin biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
UDP-α-D-glucose + pelargonidin ⟶ H+ + UDP + pelargonidin-3-O-β-D-glucoside - proanthocyanidins biosynthesis from flavanols:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
UDP-α-D-glucose + pelargonidin ⟶ H+ + UDP + pelargonidin-3-O-β-D-glucoside - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
UDP-α-D-glucose + pelargonidin ⟶ H+ + UDP + pelargonidin-3-O-β-D-glucoside - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - GABA shunt II:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - GABA shunt II:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - GABA shunt II:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - GABA shunt II:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - GABA shunt II:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - vindoline, vindorosine and vinblastine biosynthesis:
catharanthine + hydrogen peroxide + vindoline ⟶ α-3',4'-anhydrovinblastine radical + H2O - vindoline, vindorosine and vinblastine biosynthesis:
catharanthine + hydrogen peroxide + vindoline ⟶ α-3',4'-anhydrovinblastine radical + H2O - L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glu - aerobic respiration I (cytochrome c):
UQH2 + an oxidized c-type cytochrome ⟶ H+ + UQ + a reduced c-type cytochrome - aerobic respiration III (alternative oxidase pathway):
O2 + UQH2 ⟶ H2O + UQ - superpathway of glyoxylate cycle and fatty acid degradation:
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a (2E)-2-enoyl-CoA + hydrogen peroxide - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - superpathway of glyoxylate cycle and fatty acid degradation:
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate
COVID-19 Disease Map(0)
PathBank(0)
PharmGKB(0)
0 个相关的物种来源信息
在这里通过桑基图来展示出与当前的这个代谢物在我们的BioDeep知识库中具有相关联信息的其他代谢物。在这里进行关联的信息来源主要有：
- PubMed: 来源于PubMed文献库中的文献信息，我们通过自然语言数据挖掘得到的在同一篇文献中被同时提及的相关代谢物列表，这个列表按照代谢物同时出现的文献数量降序排序，取前10个代谢物作为相关研究中关联性很高的代谢物集合展示在桑基图中。
- NCBI Taxonomy: 通过文献数据挖掘，得到的代谢物物种来源信息关联。这个关联信息同样按照出现的次数降序排序，取前10个代谢物作为高关联度的代谢物集合展示在桑吉图上。
- Chemical Taxonomy: 在物质分类上处于同一个分类集合中的其他代谢物
- Chemical Reaction: 在化学反应过程中，存在为当前代谢物相关联的生化反应过程中的反应底物或者反应产物的关联代谢物信息。
点击图上的相关代谢物的名称，可以跳转到相关代谢物的信息页面。
文献列表
- Nikhil Dnyaneshwar Patil, Aarti Bains, Sawinder Kaur, Rahul Yadav, Gulden Goksen, Nemat Ali, Abdullah F AlAsmari, Prince Chawla. Effect of dual modifications with ultrasonication and succinylation on Cicer arietinum protein-iron complexes: Characterization, digestibility, in-vitro cellular mineral uptake and preparation of fortified smoothie.
Food research international (Ottawa, Ont.).
2024 Jun; 186(?):114344. doi:
10.1016/j.foodres.2024.114344. [PMID: 38729696] - Yiwen Li, Tan Dai, Yidong Tang, Yan Wang, Xixi Wang, Zhongqiao Huang, Feng Li, Liang Lu, Jianqiang Miao, Xili Liu. Inhibitory activity to Fusarium spp. and control potential for wheat Fusarium crown rot of a novel succinate dehydrogenase inhibitor cyclobutrifluram.
Pest management science.
2024 Apr; 80(4):2001-2010. doi:
10.1002/ps.7935. [PMID: 38096203] - Jing Wu, Yilian Li, Jinbao Yin, Chen Wang, Xuejin Qi, Yujie Zhou, Hongjuan Liu, Pengfei Wu, Jianan Zhang. Mutation breeding of high-stress resistant strains for succinic acid production from corn straw.
Applied microbiology and biotechnology.
2024 Apr; 108(1):278. doi:
10.1007/s00253-024-13112-7. [PMID: 38558151] - Ningbo Wang, Zeming Zhang, Yinan Wang, Liuquan Zhang, Aili Sun, Hua Liu, Xizhi Shi. Comparative antioxidant and metabolomic analysis for the identification of differential response of mussel (Mytilus coruscus) to four succinate dehydrogenase inhibitor fungicides.
Environmental science and pollution research international.
2024 Mar; 31(11):16819-16831. doi:
10.1007/s11356-024-32309-x. [PMID: 38324158] - Mei-Yu Zhang, Xin-Ru Xu, Ru-Ping Zhao, Chao Huang, Yuan-Da Song, Zi-Tong Zhao, Yu-Bin Zhao, Xiao-Jie Ren, Xin-He Zhao. Mechanism of enhanced microalgal biomass and lipid accumulation through symbiosis between a highly succinic acid-producing strain of Escherichia coli SUC and Aurantiochytrium sp. SW1.
Bioresource technology.
2024 Feb; 394(?):130232. doi:
10.1016/j.biortech.2023.130232. [PMID: 38141881] - Shuying Gu, Taju Wu, Junqi Zhao, Tao Sun, Zhen Zhao, Lu Zhang, Jingen Li, Chaoguang Tian. Rewiring metabolic flux to simultaneously improve malate production and eliminate by-product succinate accumulation by Myceliophthora thermophila.
Microbial biotechnology.
2024 Jan; ?(?):e14410. doi:
10.1111/1751-7915.14410. [PMID: 38298109] - Keke Luo, Haiyu Zhao, Mengxiao Wang, Mengyao Tian, Nan Si, Wen Xia, Jianfang Song, Yunqin Chen, Linna Wang, Yan Zhang, Xiaolu Wei, Xing Li, Guangyuan Qin, Jiaying Yang, Hongjie Wang, Baolin Bian, Yanyan Zhou. Huanglian Jiedu Wan intervened with 'Shi-Re Shanghuo' syndrome through regulating immune balance mediated by biomarker succinate.
Clinical immunology (Orlando, Fla.).
2024 01; 258(?):109861. doi:
10.1016/j.clim.2023.109861. [PMID: 38065370] - Monique Marcondes Krauskopf, Chimenes Darlan Leal de Araújo, Priscila R Dos Santos-Donado, Mariana Damiames Baccarin Dargelio, João Antônio Santos Manzi, Anna Cecilia Venturini, Júlio César de Carvalho Balieiro, Eduardo Francisquine Delgado, Carmen Josefina Contreras Castillo. The effect of succinate on color stability of Bos indicus bull meat: pH-dependent effects during the 14-day aging period.
Food research international (Ottawa, Ont.).
2024 Jan; 175(?):113688. doi:
10.1016/j.foodres.2023.113688. [PMID: 38129031] - Xin Jin, Hangyi Wu, Jie Yu, Yanni Cao, Lanyi Zhang, Zhenhai Zhang, Huixia Lv. Glutamate affects self-assembly, protein corona, and anti-4 T1 tumor effects of melittin/vitamin E-succinic acid-(glutamate)n nanoparticles.
Journal of controlled release : official journal of the Controlled Release Society.
2024 Jan; 365(?):802-817. doi:
10.1016/j.jconrel.2023.12.013. [PMID: 38092255] - Haiyan Sun, Shiyan Cai, Yuanyu Deng, Shulin Cao, Xiaoyue Yang, Yanteng Lu, Wei Li, Huaigu Chen. Efficacy of cyclobutrifluram in controlling Fusarium crown rot of wheat and resistance risk of three Fusarium species to cyclobutrifluram.
Pesticide biochemistry and physiology.
2024 Jan; 198(?):105723. doi:
10.1016/j.pestbp.2023.105723. [PMID: 38225078] - Chao Ma, Chunran Zhu, Yajun Zhang, Mei Yu, Yizhi Song, Yulong Chong, Yan Yang, Chan Zhu, Yucui Jiang, Changming Wang, Shuo Cheng, Keke Jia, Guang Yu, Jia Li, Zongxiang Tang. Gastrodin alleviates NTG-induced migraine-like pain via inhibiting succinate/HIF-1α/TRPM2 signaling pathway in trigeminal ganglion.
Phytomedicine : international journal of phytotherapy and phytopharmacology.
2023 Dec; 125(?):155266. doi:
10.1016/j.phymed.2023.155266. [PMID: 38241917] - Shiyong Li, Chaodong Song, Hongyan Zhang, Yan Qin, Mingguo Jiang, Naikun Shen. Comparative Transcriptome Analysis Reveals the Molecular Mechanisms of Acetic Acid Reduction by Adding NaHSO3 in Actinobacillus succinogenes GXAS137.
Polish journal of microbiology.
2023 Dec; 72(4):399-411. doi:
10.33073/pjm-2023-036. [PMID: 38000010] - Yurong Qiu, Yaling Meng, Wenxu Lian, Shasha Jian, Yannan Du, Meng Wang, Ye Yang, Xiaoyu Liang, Yu Zhang. Polymorphisms at amino acid positions 85 and 86 in succinate dehydrogenase subunit C of Colletotrichum siamense: Implications for fitness and intrinsic sensitivity to SDHI fungicides.
Fungal genetics and biology : FG & B.
2023 Dec; 169(?):103844. doi:
10.1016/j.fgb.2023.103844. [PMID: 37989450] - Seo Hyun Hwang, Chaw Ei Htwe Maung, Jun Su Noh, Jeong-Yong Cho, Kil Yong Kim. Butyl succinate-mediated control of Bacillus velezensis ce 100 for apple anthracnose caused by Colletotrichum gloeosporioides.
Journal of applied microbiology.
2023 Nov; 134(11):. doi:
10.1093/jambio/lxad247. [PMID: 37903743] - Yan-Ming Yin, Zong-Yue Sun, Da-Wei Wang, Zhen Xi. Discovery of Benzothiazolylpyrazole-4-Carboxamides as Potent Succinate Dehydrogenase Inhibitors through Active Fragment Exchange and Link Approach.
Journal of agricultural and food chemistry.
2023 Oct; 71(40):14471-14482. doi:
10.1021/acs.jafc.3c03646. [PMID: 37775473] - Bingxue Sun, Rongjia Zhou, Guangxue Zhu, Xuewen Xie, Ali Chai, Lei Li, Tengfei Fan, Jingjing Shi, Baoju Li, Yanxia Shi. A Rapid Molecular Detection System for Sdh Mutations Conferring Differential Succinate Dehydrogenase Inhibitor Resistance in Corynespora cassiicola.
Plant disease.
2023 Jul; 107(7):2153-2159. doi:
10.1094/pdis-11-22-2626-re. [PMID: 36548917] - Jun Liu, Jiaxuan Wu, Peiyuan Jin, Jian Hu, Kurt Lamour, Zhimin Yang. Activity of a succinate dehydrogenase inhibitor fungicide benzovindiflupyr against Clarireedia spp.
Plant disease.
2023 Jun; ?(?):. doi:
10.1094/pdis-02-23-0201-re. [PMID: 37340553] - Sarah Abdullah, Michael Ghio, Aaron Cotton-Betteridge, Aditya Vinjamuri, Robert Drury, Jacob Packer, Oguz Aras, Jessica Friedman, Mardeen Karim, David Engelhardt, Emma Kosowski, Kelby Duong, Farhana Shaheen, Patrick R McGrew, Charles T Harris, Robert Reily, Mimi Sammarco, Partha K Chandra, Derek Pociask, Jay Kolls, Prasad V Katakam, Alison Smith, Sharven Taghavi, Juan Duchesne, Olan Jackson-Weaver. Succinate metabolism and membrane reorganization drives the endotheliopathy and coagulopathy of traumatic hemorrhage.
Science advances.
2023 06; 9(24):eadf6600. doi:
10.1126/sciadv.adf6600. [PMID: 37315138] - Shengfang Zhou, Yingli Zhang, Zhiwen Wei, Sunghoon Park. Recent advances in metabolic engineering of microorganisms for the production of monomeric C3 and C4 chemical compounds.
Bioresource technology.
2023 Jun; 377(?):128973. doi:
10.1016/j.biortech.2023.128973. [PMID: 36972803] - Jingwen Xu, Zhenhua Tian, Zhe Li, Xiaoshi Du, Yansong Cui, Jiangrong Wang, Mei Gao, Yinglong Hou. Puerarin-Tanshinone IIA Suppresses atherosclerosis inflammatory plaque via targeting succinate/HIF-1α/IL-1β axis.
Journal of ethnopharmacology.
2023 May; ?(?):116675. doi:
10.1016/j.jep.2023.116675. [PMID: 37257708] - Tamieka Pearce, Jason Scott, Calum R Wilson, David H Gent. Evolution of the genetic structure of the Didymella tanaceti population during development of succinate dehydrogenase inhibitor resistance.
Phytopathology.
2023 May; ?(?):. doi:
10.1094/phyto-10-22-0385-r. [PMID: 37129263] - Salvatore Nesci, Cristina Algieri, Fabiana Trombetti, Micaela Fabbri, Giorgio Lenaz. Two separate pathways underlie NADH and succinate oxidation in swine heart mitochondria: Kinetic evidence on the mobile electron carriers.
Biochimica et biophysica acta. Bioenergetics.
2023 Apr; 1864(3):148977. doi:
10.1016/j.bbabio.2023.148977. [PMID: 37059413] - Mathias Brouillard, Rémi Kinet, Marie Joyeux, Benjamin Dehay, Sylvie Crauste-Manciet, Valérie Desvergnes. Modulating Lysosomal pH through Innovative Multimerized Succinic Acid-Based Nucleolipid Derivatives.
Bioconjugate chemistry.
2023 03; 34(3):572-580. doi:
10.1021/acs.bioconjchem.3c00041. [PMID: 36853958] - Zhaolin Xue, Shan Zhong, Jinghuan Shen, Ye Sun, Xuheng Gao, Xiangyang Wang, Feng Li, Liang Lu, Xili Liu. Multiple Mutations in SDHB and SDHC2 Subunits Confer Resistance to the Succinate Dehydrogenase Inhibitor Cyclobutrifluram in Fusarium fujikuroi.
Journal of agricultural and food chemistry.
2023 Mar; 71(8):3694-3704. doi:
10.1021/acs.jafc.2c08023. [PMID: 36802617] - Naikun Shen, Shiyong Li, Shuyan Li, Yibing Wang, Hongyan Zhang, Mingguo Jiang. Reduced acetic acid formation using NaHSO3 as a steering agent by Actinobacillus succinogenes GXAS137.
Journal of bioscience and bioengineering.
2023 Mar; 135(3):203-209. doi:
10.1016/j.jbiosc.2022.12.007. [PMID: 36628842] - Chang-Shun Liu, Yin-Xia Hu, Zhen-Ye Luo, Chuan-Wei Qiu, Xiang-Hua Deng, Fei-Long Chen. Xianglian pill modulates gut microbial production of succinate and induces regulatory T cells to alleviate ulcerative colitis in rats.
Journal of ethnopharmacology.
2023 Mar; 303(?):116007. doi:
10.1016/j.jep.2022.116007. [PMID: 36473618] - Jinhang Li, Peng Wei, Juan Qin, Kaiyang Feng, Guangmao Shen, Wei Dou, Youjun Zhang, Peng Cao, Zhiguang Yuchi, Thomas Van Leeuwen, Lin He. Molecular Basis for the Selectivity of the Succinate Dehydrogenase Inhibitor Cyflumetofen between Pest and Predatory Mites.
Journal of agricultural and food chemistry.
2023 Mar; 71(8):3658-3669. doi:
10.1021/acs.jafc.2c06149. [PMID: 36787109] - Yu-Hao Zhang, Shan-Shan Yang, Qi Zhang, Tian-Tian Zhang, Tian-Yi Zhang, Bo-Hang Zhou, Le Zhou. Discovery of N-Phenylpropiolamide as a Novel Succinate Dehydrogenase Inhibitor Scaffold with Broad-Spectrum Antifungal Activity on Phytopathogenic Fungi.
Journal of agricultural and food chemistry.
2023 Feb; ?(?):. doi:
10.1021/acs.jafc.2c07712. [PMID: 36790098] - Trinita K Barboza, Leonardo Susta, Alex Zur Linden, Sara Gardhouse, Hugues Beaufrère. Association of plasma metabolites and diagnostic imaging findings with hepatic lipidosis in bearded dragons (Pogona vitticeps) and effects of gemfibrozil therapy.
PloS one.
2023; 18(2):e0274060. doi:
10.1371/journal.pone.0274060. [PMID: 36735707] - Haoran Zhao, Minmin Li, Xiaowei Liu, Jiajie Yang, Xueyao Li, Jieyin Chen, Xiaofeng Dai, Jesus Simal-Gandara, Zhiqiang Kong, Zhizhong Li. Simultaneous determination of succinate-dehydrogenase-inhibitor fungicide traces in cereals by QuEChERS preparation and UPLC-MS/MS analysis.
Food chemistry.
2022 Dec; 396(?):133708. doi:
10.1016/j.foodchem.2022.133708. [PMID: 35878445] - Xuan Li, Yuting Ren, Guowen Huang, Ruofan Zhang, Yanan Zhang, Weiyun Zhu, Kaifan Yu. Succinate communicates pro-inflammatory signals to the host and regulates bile acid enterohepatic metabolism in a pig model.
Food & function.
2022 Oct; 13(21):11070-11082. doi:
10.1039/d2fo01958b. [PMID: 36197400] - Hao Liu, Hairong Zhang, Xiaoyu Zhang, Qian Chen, Lei Xia. Role of succinic acid in the regulation of sepsis.
International immunopharmacology.
2022 Sep; 110(?):109065. doi:
10.1016/j.intimp.2022.109065. [PMID: 35853278] - Jing Li, Huyi Zhou, Wei Zuo, Wenjin An, Yaohai Zhang, Qiyang Zhao. Simultaneous enantioselective determination of two succinate- dehydrogenase-inhibitor fungicides in plant-origin foods by ultra-high performance liquid chromatography-tandem mass spectrometry.
Journal of chromatography. A.
2022 Aug; 1677(?):463325. doi:
10.1016/j.chroma.2022.463325. [PMID: 35853420] - Nadezhda Fedotcheva, Natalia Beloborodova. Influence of Microbial Metabolites and Itaconic Acid Involved in Bacterial Inflammation on the Activity of Mitochondrial Enzymes and the Protective Role of Alkalization.
International journal of molecular sciences.
2022 Aug; 23(16):. doi:
10.3390/ijms23169069. [PMID: 36012366] - Xiang-Lin Kong, Qin Lyu, Ya-Qi Zhang, Dong-Fang Kang, Chao Li, Lei Zhang, Zi-Chen Gao, Xin-Xin Liu, Ji-Biao Wu, Yun-Lun Li. Effect of astragaloside IV and salvianolic acid B on antioxidant stress and vascular endothelial protection in the treatment of atherosclerosis based on metabonomics.
Chinese journal of natural medicines.
2022 Aug; 20(8):601-613. doi:
10.1016/s1875-5364(22)60186-9. [PMID: 36031232] - Chunli Yu, Hui-Ping Wang, Xuya Yu. The associative induction of succinic acid and hydrogen sulfide for high-producing biomass, astaxanthin and lipids in Haematococcus pluvialis.
Bioresource technology.
2022 Aug; 358(?):127397. doi:
10.1016/j.biortech.2022.127397. [PMID: 35636672] - Sarah Budde-Rodriguez, Julie S Pasche, Fereshteh Shahoveisi, Ipsita Mallik, Neil C Gudmestad. Aggressiveness of Small-Spored Alternaria spp. and Their Sensitivity to Succinate Dehydrogenase Inhibitor Fungicides.
Plant disease.
2022 Jul; 106(7):1919-1928. doi:
10.1094/pdis-10-21-2292-re. [PMID: 34978878] - Eduardo Henrique Goulin, Thiago Antônio de Lima, Paulo José Camargo Dos Santos, Marcos Antonio Machado. RNAi-induced silencing of the succinate dehydrogenase subunits gene in Colletotrichum abscissum, the causal agent of postbloom fruit drop (PFD) in citrus.
Microbiological research.
2022 Jul; 260(?):126938. doi:
10.1016/j.micres.2021.126938. [PMID: 35500454] - Qiao Wang, Yushuai Mao, Shengxue Li, Tao Li, Jianxin Wang, Mingguo Zhou, Yabing Duan. Molecular Mechanism of Sclerotinia sclerotiorum Resistance to Succinate Dehydrogenase Inhibitor Fungicides.
Journal of agricultural and food chemistry.
2022 Jun; 70(23):7039-7048. doi:
10.1021/acs.jafc.2c02056. [PMID: 35666187] - Yang Lin, Zi-Yuan Wang, Ma-Jie Wang, Zheng-Meng Jiang, Ya-Qiu Qin, Tian-Qing Huang, Yu Song, Hui-Ting Liang, E-Hu Liu. Baicalin attenuate diet-induced metabolic syndrome by improving abnormal metabolism and gut microbiota.
European journal of pharmacology.
2022 Jun; 925(?):174996. doi:
10.1016/j.ejphar.2022.174996. [PMID: 35513018] - Xiaoyu Liang, Lijun Zou, Wenxu Lian, Meng Wang, Ye Yang, Yu Zhang. Comparative Transcriptome Analyses Reveal Conserved and Distinct Mechanisms of the SDHI Fungicide Benzovindiflupyr Inhibiting Colletotrichum.
Phytopathology.
2022 Jun; 112(6):1255-1263. doi:
10.1094/phyto-10-21-0420-r. [PMID: 34879716] - Xiao Liu, Dong-He Liu, Tao Chen, Jing Zhang, Chun-Lei Wang. Watercore Pear Fruit Respiration Changed and Accumulated γ-Aminobutyric Acid (GABA) in Response to Inner Hypoxia Stress.
Genes.
2022 05; 13(6):. doi:
10.3390/genes13060977. [PMID: 35741739] - Artem P Gureev, Vadim V Sitnikov, Daniil I Pogorelov, Inna Yu Vitkalova, Abir U Igamberdiev, Vasily N Popov. The effect of pesticides on the NADH-supported mitochondrial respiration of permeabilized potato mitochondria.
Pesticide biochemistry and physiology.
2022 May; 183(?):105056. doi:
10.1016/j.pestbp.2022.105056. [PMID: 35430060] - Wenyong Shao, Jingrui Wang, Huiyuan Wang, Ziyue Wen, Chao Liu, Yu Zhang, Youfu Zhao, Zhonghua Ma. Fusarium graminearum FgSdhC1 point mutation A78V confers resistance to the succinate dehydrogenase inhibitor pydiflumetofen.
Pest management science.
2022 May; 78(5):1780-1788. doi:
10.1002/ps.6795. [PMID: 35014167] - Shirong Huang, Xiaojie Chen, Rui Yan, Meng Huang, Dongfang Chen. Isolation, Identification and Antibacterial Mechanism of the Main Antibacterial Component from Pickled and Dried Mustard (Brassica juncea Coss. var. foliosa Bailey).
Molecules (Basel, Switzerland).
2022 Apr; 27(8):. doi:
10.3390/molecules27082418. [PMID: 35458613] - Celia M Bisbach, Daniel T Hass, Eric D Thomas, Timothy J Cherry, James B Hurley. Monocarboxylate Transporter 1 (MCT1) Mediates Succinate Export in the Retina.
Investigative ophthalmology & visual science.
2022 04; 63(4):1. doi:
10.1167/iovs.63.4.1. [PMID: 35363247] - Alex Gomez-Gomez, Paula Aguilera, Klaus Langohr, Gregori Casals, Cristina Pavon, Josep Marcos, Jordi To-Figueras, Oscar J Pozo. Evaluation of Metabolic Changes in Acute Intermittent Porphyria Patients by Targeted Metabolomics.
International journal of molecular sciences.
2022 Mar; 23(6):. doi:
10.3390/ijms23063219. [PMID: 35328641] - Can Zhao, Yuting Li, Zhijian Liang, Lihong Gao, Chenggui Han, Xuehong Wu. Molecular Mechanisms Associated with the Resistance of Rhizoctonia solani AG-4 Isolates to the Succinate Dehydrogenase Inhibitor Thifluzamide.
Phytopathology.
2022 Mar; 112(3):567-578. doi:
10.1094/phyto-06-21-0266-r. [PMID: 34615378] - Shulei Zhang, Yamin Liang, Lu Li, Yanmei Chen, Peng Wu, Dangheng Wei. Succinate: A Novel Mediator to Promote Atherosclerotic Lesion Progression.
DNA and cell biology.
2022 Mar; 41(3):285-291. doi:
10.1089/dna.2021.0345. [PMID: 35138943] - Yasser Nehela, Nabil Killiny. Not Just a Cycle: Three gab Genes Enable the Non-Cyclic Flux Toward Succinate via GABA Shunt in 'Candidatus Liberibacter asiaticus'-Infected Citrus.
Molecular plant-microbe interactions : MPMI.
2022 Mar; 35(3):200-214. doi:
10.1094/mpmi-09-21-0241-r. [PMID: 34775834] - Yaoqing Wang, Xiao Zhang, Haoya Yao, Xiaocui Chen, Lin Shang, Ping Li, Xiaojuan Cui, Jia Zeng. Peroxisome-generated succinate induces lipid accumulation and oxidative stress in the kidneys of diabetic mice.
The Journal of biological chemistry.
2022 03; 298(3):101660. doi:
10.1016/j.jbc.2022.101660. [PMID: 35124006] - Hyunkyu Sang, Hao-Xun Chang, Sungyu Choi, Doeun Son, Gahee Lee, Martin I Chilvers. Genome-wide transcriptional response of the causal soybean sudden death syndrome pathogen Fusarium virguliforme to a succinate dehydrogenase inhibitor fluopyram.
Pest management science.
2022 Feb; 78(2):530-540. doi:
10.1002/ps.6657. [PMID: 34561937] - Constance Lamy, Clémence Mansard, Louis Blondel, Lionel Mercier, Angelo Paci, Sophie Broutin. Quantification of succinic acid levels, linked to succinate dehydrogenase (SDH) dysfunctions, by an automated and fully validated liquid chromatography tandem mass spectrometry method suitable for multi-matrix applications.
Journal of chromatography. B, Analytical technologies in the biomedical and life sciences.
2022 Jan; 1189(?):123085. doi:
10.1016/j.jchromb.2021.123085. [PMID: 34974318] - Kunzhe Lin, Jianping Zhang, Yinghong Lin, Zhijie Pei, Shousen Wang. Metabolic Characteristics and M2 Macrophage Infiltrates in Invasive Nonfunctioning Pituitary Adenomas.
Frontiers in endocrinology.
2022; 13(?):901884. doi:
10.3389/fendo.2022.901884. [PMID: 35898456] - Ke Feng, Wenjie Dai, Ling Liu, Shengming Li, Yi Gou, Zhongwei Chen, Guodong Chen, Xufeng Fu. Identification of biomarkers and the mechanisms of multiple trauma complicated with sepsis using metabolomics.
Frontiers in public health.
2022; 10(?):923170. doi:
10.3389/fpubh.2022.923170. [PMID: 35991069] - Jingwen Xu, Yabing Zheng, Yaqing Zhao, Yujiao Zhang, Huilin Li, An Zhang, Xuehan Wang, Weizong Wang, Yinglong Hou, Jiangrong Wang. Succinate/IL-1β Signaling Axis Promotes the Inflammatory Progression of Endothelial and Exacerbates Atherosclerosis.
Frontiers in immunology.
2022; 13(?):817572. doi:
10.3389/fimmu.2022.817572. [PMID: 35273600] - Eduardo Sommella, Giulio Verna, Marina Liso, Emanuela Salviati, Tiziana Esposito, Daniela Carbone, Camilla Pecoraro, Marcello Chieppa, Pietro Campiglia. Hop-derived fraction rich in beta acids and prenylflavonoids regulates the inflammatory response in dendritic cells differently from quercetin: unveiling metabolic changes by mass spectrometry-based metabolomics.
Food & function.
2021 Dec; 12(24):12800-12811. doi:
10.1039/d1fo02361f. [PMID: 34859812] - Chengyuan Liang, Juan Li, Bin Tian, Lei Tian, Yuzhi Liu, Jingyi Li, Liang Xin, Jun Wang, Chao Fu, Zhenfeng Shi, Juan Xia, Yiting Liang, Kun Wang. Foresight regarding drug candidates acting on the succinate-GPR91 signalling pathway for non-alcoholic steatohepatitis (NASH) treatment.
Biomedicine & pharmacotherapy = Biomedecine & pharmacotherapie.
2021 Dec; 144(?):112298. doi:
10.1016/j.biopha.2021.112298. [PMID: 34649219] - Pierre Hellin, Maxime Duvivier, Thies M Heick, Bart A Fraaije, Charlotte Bataille, Aurélie Clinckemaillie, Anne Legrève, Lise N Jørgensen, Björn Andersson, Berit Samils, Bernd Rodemann, Gunilla Berg, Fiona Hutton, Maxime Garnault, Moussa El Jarroudi, Gilles Couleaud, Steven Kildea. Spatio-temporal distribution of DMI and SDHI fungicide resistance of Zymoseptoria tritici throughout Europe based on frequencies of key target-site alterations.
Pest management science.
2021 Dec; 77(12):5576-5588. doi:
10.1002/ps.6601. [PMID: 34392616] - Lizhan Su, Yarou Gao, Mingxin Zhang, Zexin Liu, Qisheng Lin, Lang Gong, Jianying Guo, Lixia Chen, Tongqing An, Jianxin Chen. Andrographolide and Its Derivative Potassium Dehydrographolide Succinate Suppress PRRSV Replication in Primary and Established Cells via Differential Mechanisms of Action.
Virologica Sinica.
2021 Dec; 36(6):1626-1643. doi:
10.1007/s12250-021-00455-y. [PMID: 34704222] - Yonglan Ruan, Jinying Ling, Fan Ye, Nuo Cheng, Fei Wu, Zongxiang Tang, Xiaolan Cheng, Hongquan Liu. Paeoniflorin alleviates CFA-induced inflammatory pain by inhibiting TRPV1 and succinate/SUCNR1-HIF-1α/NLPR3 pathway.
International immunopharmacology.
2021 Dec; 101(Pt B):108364. doi:
10.1016/j.intimp.2021.108364. [PMID: 34844873] - Mònica Bulló, Christopher Papandreou, Jesus García-Gavilán, Miguel Ruiz-Canela, Jun Li, Marta Guasch-Ferré, Estefanía Toledo, Clary Clish, Dolores Corella, Ramon Estruch, Emilio Ros, Montserrat Fitó, Chih-Hao Lee, Kerry Pierce, Cristina Razquin, Fernando Arós, Lluís Serra-Majem, Liming Liang, Miguel A Martínez-González, Frank B Hu, Jordi Salas-Salvadó. Tricarboxylic acid cycle related-metabolites and risk of atrial fibrillation and heart failure.
Metabolism: clinical and experimental.
2021 12; 125(?):154915. doi:
10.1016/j.metabol.2021.154915. [PMID: 34678258] - Wenchan Chen, Lingling Wei, Xiujuan Li, Hongyu Ma, Tiancheng Lou, Pengcheng Zhang, Huanhuan Zheng, Xiaolei Zhu, Yu Zhang, Fengquan Liu, Changjun Chen, Guangfu Yang. Point Mutations in FgSdhC2 or in the 5' Untranslated Region of FgSdhC1 Confer Resistance to a Novel Succinate Dehydrogenase Inhibitor Flubeneteram in Fusarium graminearum.
Journal of agricultural and food chemistry.
2021 Nov; 69(44):13006-13019. doi:
10.1021/acs.jafc.1c04363. [PMID: 34723519] - Hongtu Cui, Yanghui Chen, Ke Li, Rui Zhan, Mingming Zhao, Yangkai Xu, Zhiyong Lin, Yi Fu, Qihua He, Paul C Tang, Ienglam Lei, Jifeng Zhang, Chenze Li, Yang Sun, Xinhua Zhang, Tiffany Horng, Hong S Lu, Y Eugene Chen, Alan Daugherty, Daowen Wang, Lemin Zheng. Untargeted metabolomics identifies succinate as a biomarker and therapeutic target in aortic aneurysm and dissection.
European heart journal.
2021 11; 42(42):4373-4385. doi:
10.1093/eurheartj/ehab605. [PMID: 34534287] - Pratibha Sharma, Dean K Malvick, Ashok K Chanda. Sensitivity of Rhizoctonia solani Anastomosis Group 2-2 Isolates from Soybean and Sugar Beet to Selected SDHI and QoI Fungicides.
Plant disease.
2021 Nov; 105(11):3573-3579. doi:
10.1094/pdis-12-20-2680-re. [PMID: 33835827] - Chunli Yu, Hui-Ping Wang, Tengsheng Qiao, Yongteng Zhao, Xuya Yu. A fed-batch feeding with succinic acid strategy for astaxanthin and lipid hyper-production in Haematococcus pluviualis.
Bioresource technology.
2021 Nov; 340(?):125648. doi:
10.1016/j.biortech.2021.125648. [PMID: 34332443] - Selçuk Varol, Faruk Öktem, Abdurrahim Koçyiğit, Ayşegül Doğan Demir, Ersin Karataş, Mehmet Aydın, Nilüfer Göknar, Tümay İpekçi. The impact of Technetium-99m dimercapto-succinic acid scintigraphy on DNA damage and oxidative stress in children.
International journal of clinical practice.
2021 Nov; 75(11):e14810. doi:
10.1111/ijcp.14810. [PMID: 34487588] - Falin He, Jingqiang Wan, Xiangxiang Li, Shanshan Chu, Ning Sun, Rutao Liu. Toxic effects of benzovindiflupyr, a new SDHI-type fungicide on earthworms (Eisenia fetida).
Environmental science and pollution research international.
2021 Nov; 28(44):62782-62795. doi:
10.1007/s11356-021-15207-4. [PMID: 34215985] - Yanan Sun, Haiping Shi, Chenxin Mao, Jianyan Wu, Chuanqing Zhang. Activity of a SDHI fungicide penflufen and the characterization of natural-resistance in Fusarium fujikuroi.
Pesticide biochemistry and physiology.
2021 Nov; 179(?):104960. doi:
10.1016/j.pestbp.2021.104960. [PMID: 34802512] - Goksu Kasarci, Baris Ertugrul, Elif Sinem Iplik, Bedia Cakmakoglu. The apoptotic efficacy of succinic acid on renal cancer cell lines.
Medical oncology (Northwood, London, England).
2021 Oct; 38(12):144. doi:
10.1007/s12032-021-01577-9. [PMID: 34687367] - Panagiota Ntasiou, Anastasios Samaras, George Karaoglanidis. Apple Fruit Core Rot Agents in Greece and Control with Succinate Dehydrogenase Inhibitor Fungicides.
Plant disease.
2021 Oct; 105(10):3072-3081. doi:
10.1094/pdis-11-20-2422-re. [PMID: 33673771] - Yang Bai, Chun-Yan Gu, Rui Pan, Muhammad Abid, Hao-Yu Zang, Xue Yang, Gen-Jia Tan, Yu Chen. Activity of A Novel Succinate Dehydrogenase Inhibitor Fungicide Pydiflumetofen Against Fusarium fujikuroi causing Rice Bakanae Disease.
Plant disease.
2021 Oct; 105(10):3208-3217. doi:
10.1094/pdis-10-20-2274-re. [PMID: 33560887] - Moran Fremder, Seung Won Kim, Ahlam Khamaysi, Liana Shimshilashvili, Hadar Eini-Rider, I Seul Park, Uzi Hadad, Jae Hee Cheon, Ehud Ohana. A transepithelial pathway delivers succinate to macrophages, thus perpetuating their pro-inflammatory metabolic state.
Cell reports.
2021 08; 36(6):109521. doi:
10.1016/j.celrep.2021.109521. [PMID: 34380041] - Corrilynn O Hileman, Robert C Kalayjian, Sausan Azzam, Daniela Schlatzer, Kunling Wu, Katherine Tassiopoulos, Roger Bedimo, Ronald J Ellis, Kristine M Erlandson, Asha Kallianpur, Susan L Koletar, Alan L Landay, Frank J Palella, Babafemi Taiwo, Muralidhar Pallaki, Charles L Hoppel. Plasma Citrate and Succinate Are Associated With Neurocognitive Impairment in Older People With HIV.
Clinical infectious diseases : an official publication of the Infectious Diseases Society of America.
2021 08; 73(3):e765-e772. doi:
10.1093/cid/ciab107. [PMID: 33564870] - Francisco J Osuna-Prieto, Borja Martinez-Tellez, Lourdes Ortiz-Alvarez, Xinyu Di, Lucas Jurado-Fasoli, Huiwen Xu, Victoria Ceperuelo-Mallafré, Catalina Núñez-Roa, Isabelle Kohler, Antonio Segura-Carretero, José V García-Lario, Angel Gil, Concepción M Aguilera, Jose M Llamas-Elvira, Patrick C N Rensen, Joan Vendrell, Jonatan R Ruiz, Sonia Fernández-Veledo. Elevated plasma succinate levels are linked to higher cardiovascular disease risk factors in young adults.
Cardiovascular diabetology.
2021 07; 20(1):151. doi:
10.1186/s12933-021-01333-3. [PMID: 34315463] - Pouria Jarsiah, Joerg Roehrich, Theresa Kueting, Walter Martz, Cornelius Hess. GHB related acids are useful in routine casework of suspected GHB intoxication cases.
Forensic science international.
2021 Jul; 324(?):110833. doi:
10.1016/j.forsciint.2021.110833. [PMID: 34020075] - Xinyao Su, Qiang Xue, Mengchu Sun, Jiarou Liu, Ming Hung Wong, Caixia Wang, Shilin Chen. Co-production of polysaccharides, ginsenosides and succinic acid from Panax ginseng residue: A typical industrial herbal waste.
Bioresource technology.
2021 Jul; 331(?):125073. doi:
10.1016/j.biortech.2021.125073. [PMID: 33819907] - M A González Hernández, E E Canfora, E E Blaak. Faecal microbial metabolites of proteolytic and saccharolytic fermentation in relation to degree of insulin resistance in adult individuals.
Beneficial microbes.
2021 Jun; 12(3):259-266. doi:
10.3920/bm2020.0179. [PMID: 33880973] - N Mota-Martorell, M Jové, R Berdún, R Pamplona. Plasma methionine metabolic profile is associated with longevity in mammals.
Communications biology.
2021 06; 4(1):725. doi:
10.1038/s42003-021-02254-3. [PMID: 34117367] - Yingying Tong, Dong Guo, Shu-Hai Lin, Jiazhen Liang, Dianqiang Yang, Chunmin Ma, Fei Shao, Min Li, Qiujing Yu, Yuhui Jiang, Lei Li, Jing Fang, Rilei Yu, Zhimin Lu. SUCLA2-coupled regulation of GLS succinylation and activity counteracts oxidative stress in tumor cells.
Molecular cell.
2021 06; 81(11):2303-2316.e8. doi:
10.1016/j.molcel.2021.04.002. [PMID: 33991485] - Zhichao Wang, Qiong A Wang, Yong Liu, Lei Jiang. Energy metabolism in brown adipose tissue.
The FEBS journal.
2021 06; 288(12):3647-3662. doi:
10.1111/febs.16015. [PMID: 34028971] - Hiroyo Shinno-Hashimoto, Yaeko Hashimoto, Yan Wei, Lijia Chang, Yuko Fujita, Tamaki Ishima, Hiroyuki Matsue, Kenji Hashimoto. Abnormal composition of microbiota in the gut and skin of imiquimod-treated mice.
Scientific reports.
2021 05; 11(1):11265. doi:
10.1038/s41598-021-90480-4. [PMID: 34050205] - Yibo Dong, Ping Li, Ping Li, Chao Chen. First comprehensive analysis of lysine succinylation in paper mulberry (Broussonetia papyrifera).
BMC genomics.
2021 Apr; 22(1):255. doi:
10.1186/s12864-021-07567-5. [PMID: 33838656] - Sengnolotha Marak, Elena Shumilina, Nutan Kaushik, Eva Falch, Alexander Dikiy. Effect of Different Drying Methods on the Nutritional Value of Hibiscus sabdariffa Calyces as Revealed by NMR Metabolomics.
Molecules (Basel, Switzerland).
2021 Mar; 26(6):. doi:
10.3390/molecules26061675. [PMID: 33802805] - Jaemin Lee, Michaela R Elliott, Minsoo Kim, Toshihiko Yamada, Geunhwa Jung. A Rapid Molecular Detection System for SdhB and SdhC Point Mutations Conferring Differential Succinate Dehydrogenase Inhibitor Resistance in Clarireedia Populations.
Plant disease.
2021 Mar; 105(3):660-666. doi:
10.1094/pdis-04-20-0724-re. [PMID: 32757732] - Alena A Semenova, Victor N Samartsev, Mikhail V Dubinin. The stimulation of succinate-fueled respiration of rat liver mitochondria in state 4 by α,ω-hexadecanedioic acid without induction of proton conductivity of the inner membrane. Intrinsic uncoupling of the bc1 complex.
Biochimie.
2021 Feb; 181(?):215-225. doi:
10.1016/j.biochi.2020.12.021. [PMID: 33400934] - Yaling Lu, Xiangping Wu, Lei Yuan, Yingdi Li, Penghui Wang, Jianna Yu, Pingfang Tian, Wenjie Liu. A rapid liquid chromatography-electrospray ionization-ion mobility spectrometry method for monitoring nine representative metabolites in the seedlings of cucumber and wheat.
Journal of separation science.
2021 Feb; 44(3):709-716. doi:
10.1002/jssc.202000811. [PMID: 33245598] - Vlad F Avram, Imen Chamkha, Eleonor Åsander-Frostner, Johannes K Ehinger, Romulus Z Timar, Magnus J Hansson, Danina M Muntean, Eskil Elmér. Cell-Permeable Succinate Rescues Mitochondrial Respiration in Cellular Models of Statin Toxicity.
International journal of molecular sciences.
2021 Jan; 22(1):. doi:
10.3390/ijms22010424. [PMID: 33401621] - Isabelle Laforest-Lapointe, Allan B Becker, Piushkumar J Mandhane, Stuart E Turvey, Theo J Moraes, Malcolm R Sears, Padmaja Subbarao, Laura K Sycuro, Meghan B Azad, Marie-Claire Arrieta. Maternal consumption of artificially sweetened beverages during pregnancy is associated with infant gut microbiota and metabolic modifications and increased infant body mass index.
Gut microbes.
2021 Jan; 13(1):1-15. doi:
10.1080/19490976.2020.1857513. [PMID: 33382954] - Christina H Hagerty, Ann M Klein, Catherine L Reardon, Duncan R Kroese, Caroline J Melle, Kaci R Graber, Christopher C Mundt. Baseline and Temporal Changes in Sensitivity of Zymoseptoria tritici Isolates to Benzovindiflupyr in Oregon, U.S.A., and Cross-Sensitivity to Other SDHI Fungicides.
Plant disease.
2021 Jan; 105(1):169-174. doi:
10.1094/pdis-10-19-2125-re. [PMID: 33170771] - Liat Oren-Young, Eugenio Llorens, Kai Bi, Mingzhe Zhang, Amir Sharon. Botrytis cinerea methyl isocitrate lyase mediates oxidative stress tolerance and programmed cell death by modulating cellular succinate levels.
Fungal genetics and biology : FG & B.
2021 01; 146(?):103484. doi:
10.1016/j.fgb.2020.103484. [PMID: 33220429] - Yujiao Yang, Hong Zhang, Zhenyang Guo, Siwei Zou, Fei Long, Jiacheng Wu, Peng Li, Guo-Ping Zhao, Wei Zhao. Global Insights Into Lysine Acylomes Reveal Crosstalk Between Lysine Acetylation and Succinylation in Streptomyces coelicolor Metabolic Pathways.
Molecular & cellular proteomics : MCP.
2021; 20(?):100148. doi:
10.1016/j.mcpro.2021.100148. [PMID: 34530157] - Wenchan Chen, Lingling Wei, Weicheng Zhao, Bingran Wang, Huanhuan Zheng, Pengcheng Zhang, Tiancheng Lou, Yabing Duan, Yiping Hou, Mingguo Zhou, Changjun Chen. Resistance risk assessment for a novel succinate dehydrogenase inhibitor pydiflumetofen in Fusarium asiaticum.
Pest management science.
2021 Jan; 77(1):538-547. doi:
10.1002/ps.6053. [PMID: 32816384] - Dieter M Matlac, Katerina Hadrava Vanova, Nicole Bechmann, Susan Richter, Julica Folberth, Hans K Ghayee, Guang-Bo Ge, Luma Abunimer, Robert Wesley, Redouane Aherrahrou, Margo Dona, Ángel M Martínez-Montes, Bruna Calsina, Maria J Merino, Markus Schwaninger, Peter M T Deen, Zhengping Zhuang, Jiri Neuzil, Karel Pacak, Hendrik Lehnert, Stephanie M J Fliedner. Succinate Mediates Tumorigenic Effects via Succinate Receptor 1: Potential for New Targeted Treatment Strategies in Succinate Dehydrogenase Deficient Paragangliomas.
Frontiers in endocrinology.
2021; 12(?):589451. doi:
10.3389/fendo.2021.589451. [PMID: 33776908] - Ruixue Wang, Lianyun Lin, Yiqiang Zheng, Peng Cao, Zhiguang Yuchi, Hui-Yuan Wu. Identification of 2-PMPA as a novel inhibitor of cytosolic carboxypeptidases.
Biochemical and biophysical research communications.
2020 12; 533(4):1393-1399. doi:
10.1016/j.bbrc.2020.10.029. [PMID: 33092792] - Ksenia N Sorokina, Yuliya V Samoylova, Nikolay V Gromov, Olga L Ogorodnikova, Valentin N Parmon. Production of biodiesel and succinic acid from the biomass of the microalga Micractinium sp. IC-44.
Bioresource technology.
2020 Dec; 317(?):124026. doi:
10.1016/j.biortech.2020.124026. [PMID: 32866839] - Francesca Cateni, Marina Zacchigna, Giuseppe Procida. Synthesis and controlled drug delivery studies of a novel Ubiquinol-Polyethylene glycol-Vitamin E adduct.
Bioorganic chemistry.
2020 12; 105(?):104329. doi:
10.1016/j.bioorg.2020.104329. [PMID: 33068813] - Amrita Banerjee, Charles A Herring, Bob Chen, Hyeyon Kim, Alan J Simmons, Austin N Southard-Smith, Margaret M Allaman, James R White, Mary C Macedonia, Eliot T Mckinley, Marisol A Ramirez-Solano, Elizabeth A Scoville, Qi Liu, Keith T Wilson, Robert J Coffey, M Kay Washington, Jeremy A Goettel, Ken S Lau. Succinate Produced by Intestinal Microbes Promotes Specification of Tuft Cells to Suppress Ileal Inflammation.
Gastroenterology.
2020 12; 159(6):2101-2115.e5. doi:
10.1053/j.gastro.2020.08.029. [PMID: 32828819] - Garrett Brinkley, Hyeyoung Nam, Eunhee Shim, Richard Kirkman, Anirban Kundu, Suman Karki, Yasaman Heidarian, Jason M Tennessen, Juan Liu, Jason W Locasale, Tao Guo, Shi Wei, Jennifer Gordetsky, Teresa L Johnson-Pais, Devin Absher, Dinesh Rakheja, Anil K Challa, Sunil Sudarshan. Teleological role of L-2-hydroxyglutarate dehydrogenase in the kidney.
Disease models & mechanisms.
2020 11; 13(11):. doi:
10.1242/dmm.045898. [PMID: 32928875]