L-argininium(1+) (BioDeep_00000896190)
human metabolite
代谢物信息卡片
[amino({[(4S)-4-amino-4-carboxybutyl]amino})methylidene]azanium
化学式: C6H15N4O2+ (175.119495)
中文名称:
谱图信息:
最多检出来源 Homo sapiens(natural_products) 0.53%
分子结构信息
SMILES: C(CC(C(=O)[O-])[NH3+])C[NH+]=C(N)N
InChI: InChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/p+1/t4-/m0/s1
描述信息
L-argininium(1+), also known as L-Arginine or DL Arginine acetate, monohydrate, is classified as a member of the L-alpha-amino acids. L-alpha-amino acids are alpha amino acids which have the L-configuration of the alpha-carbon atom. L-argininium(1+) is considered to be soluble (in water) and acidic
COVID info from WikiPathways, PDB, Protein Data Bank
Corona-virus
Coronavirus
SARS-CoV-2
COVID-19
SARS-CoV
COVID19
SARS2
SARS
同义名列表
23 个代谢物同义名
[amino({[(4S)-4-amino-4-carboxybutyl]amino})methylidene]azanium; (2S)-2-Amino-5-(carbamimidamido)pentanoic acid; (2S)-2-Amino-5-(carbamimidamido)pentanoate; (2S)-2-Ammonio-5-guanidiniopentanoic acid; (2S)-2-Amino-5-guanidinopentanoic acid; (2S)-2-Ammonio-5-guanidiniopentanoate; (2S)-2-Amino-5-guanidinopentanoate; DL-Arginine acetate, monohydrate; DL Arginine acetate, monohydrate; Monohydrate DL-arginine acetate; 2-Amino-5-guanidinovaleric acid; Hydrochloride, arginine; Arginine hydrochloride; L-Arginine monocation; Arginine, L isomer; Arginine, L-isomer; L-Isomer arginine; L-Arginine cation; L-argininium(1+); Arginine(1+); D-Arginine; L-Arginine; L Arginine
相关代谢途径
Reactome(35)
- Metabolism
- Biological oxidations
- Phase I - Functionalization of compounds
- Metabolism of proteins
- Disease
- Amino acid and derivative metabolism
- Amino acid metabolism
- Arginine metabolism
- Transport of small molecules
- SLC-mediated transmembrane transport
- Metabolism of polyamines
- Agmatine biosynthesis
- Urea cycle
- Signaling Pathways
- Immune System
- Innate Immune System
- ROS and RNS production in phagocytes
- Disorders of transmembrane transporters
- SLC transporter disorders
- Transport of inorganic cations/anions and amino acids/oligopeptides
- Metabolism of nitric oxide: NOS3 activation and regulation
- eNOS activation and regulation
- eNOS activation
- Signaling by Receptor Tyrosine Kinases
- Signaling by VEGF
- VEGFA-VEGFR2 Pathway
- Cellular responses to stimuli
- Cellular responses to stress
- Hemostasis
- Platelet homeostasis
- Nitric oxide stimulates guanylate cyclase
- VEGFR2 mediated vascular permeability
- Signaling by Nuclear Receptors
- ESR-mediated signaling
- Extra-nuclear estrogen signaling
BioCyc(49)
- indolmycin biosynthesis
- ornithine biosynthesis (arginine degradation)
- putrescine biosynthesis IV
- putrescine biosynthesis I
- urea cycle
- spermidine biosynthesis III
- superpathway of polyamine biosynthesis I
- superpathway of arginine and polyamine biosynthesis
- clavulanate biosynthesis
- superpathway of L-citrulline metabolism
- L-citrulline biosynthesis
- L-Nδ-acetylornithine biosynthesis
- L-arginine degradation VIII (arginine oxidase pathway)
- L-arginine degradation VI (arginase 2 pathway)
- L-arginine degradation XII
- superpathway of L-arginine, putrescine, and 4-aminobutanoate degradation
- L-arginine degradation I (arginase pathway)
- L-arginine degradation III (arginine decarboxylase/agmatinase pathway)
- L-arginine degradation XI
- L-arginine degradation X (arginine monooxygenase pathway)
- L-arginine degradation VII (arginase 3 pathway)
- L-arginine degradation IX (arginine:pyruvate transaminase pathway)
- superpathway of L-arginine and L-ornithine degradation
- arginine degradation VI (arginase 2 pathway)
- citrulline biosynthesis
- L-Nδ-acetylornithine biosynthesis
- arginine degradation III (arginine decarboxylase/agmatinase pathway)
- superpathway of arginine and ornithine degradation
- arginine degradation VII (arginase 3 pathway)
- arginine degradation I (arginase pathway)
- superpathway of arginine, putrescine, and 4-aminobutyrate degradation
- arginine degradation X (arginine monooxygenase pathway)
- arginine degradation VII
- streptomycin biosynthesis
- L-arginine degradation V (arginine deiminase pathway)
- tRNA charging pathway
- L-arginine biosynthesis II (acetyl cycle)
- rhizocticin A and B biosynthesis
- L-arginine biosynthesis I (via L-ornithine)
- L-ornithine biosynthesis I
- arginine biosynthesis I
- citrulline-nitric oxide cycle
- nitric oxide biosynthesis
- nitric oxide biosynthesis II (mammals)
- nitric oxide biosynthesis I (plants)
- nitric oxide biosynthesis III (bacteria)
- L-citrulline-nitric oxide cycle
- nitric oxide biosynthesis (plants)
- tRNA charging
PlantCyc(11)
- L-arginine degradation X (arginine monooxygenase pathway)
- superpathway of L-citrulline metabolism
- L-arginine degradation VI (arginase 2 pathway)
- putrescine biosynthesis I
- L-citrulline biosynthesis
- L-arginine degradation I (arginase pathway)
- L-Nδ-acetylornithine biosynthesis
- urea cycle
- putrescine biosynthesis IV
- Organic Nitrogen Assimilation
- superpathway of hyoscyamine (atropine) and scopolamine biosynthesis
代谢反应
1821 个相关的代谢反应过程信息。
Reactome(319)
- Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Creatine metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Creatine metabolism:
ATP + CRET ⟶ ADP + Pcr - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Creatine metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Creatine metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Creatine metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Creatine metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Creatine metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Creatine metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of polyamines:
GAA + SAM ⟶ CRET + H+ + SAH - Creatine metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Creatine metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Peptide hormone metabolism:
GHRL + octanoic acid ⟶ GHRL - Metabolism of Angiotensinogen to Angiotensins:
AGT + H2O ⟶ AGT - Metabolism of nitric oxide: NOS3 activation and regulation:
ADMA + H2O ⟶ DMA + L-Cit - eNOS activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - eNOS activation:
ADMA + H2O ⟶ DMA + L-Cit - Signaling Pathways:
ADORA2A,B + Ade-Rib ⟶ ADORA2A,B:Ade-Rib - Signaling by Receptor Tyrosine Kinases:
H2O + cAMP ⟶ AMP - Signaling by VEGF:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - VEGFA-VEGFR2 Pathway:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - VEGFR2 mediated vascular permeability:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Signaling by Nuclear Receptors:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by Receptor Tyrosine Kinases:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by VEGF:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - VEGFA-VEGFR2 Pathway:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - VEGFR2 mediated vascular permeability:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Signaling by Nuclear Receptors:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN - Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Peptide hormone metabolism:
AGT + H2O ⟶ AGT - Metabolism of Angiotensinogen to Angiotensins:
AGT + H2O ⟶ AGT - eNOS activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH - Peptide hormone metabolism:
H2O + agt ⟶ agt - Metabolism of Angiotensinogen to Angiotensins:
H2O + agt ⟶ agt - Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Metabolism of nitric oxide: NOS3 activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - eNOS activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - eNOS activation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by Receptor Tyrosine Kinases:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by VEGF:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - VEGFA-VEGFR2 Pathway:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - VEGFR2 mediated vascular permeability:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Signaling by Nuclear Receptors:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by Receptor Tyrosine Kinases:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by VEGF:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - VEGFA-VEGFR2 Pathway:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - VEGFR2 mediated vascular permeability:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Signaling by Nuclear Receptors:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + HSP90:HSP90 + Pi + Q9VH95 + Q9VL78 - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of nitric oxide: NOS3 activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - eNOS activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - eNOS activation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - Metabolism of nitric oxide: NOS3 activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - eNOS activation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by Receptor Tyrosine Kinases:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by VEGF:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - VEGFA-VEGFR2 Pathway:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - VEGFR2 mediated vascular permeability:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Signaling by Nuclear Receptors:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN - Metabolism of proteins:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP - Peptide hormone metabolism:
ghr + octanoic acid ⟶ ghr - Metabolism of Angiotensinogen to Angiotensins:
AGT + H2O ⟶ AGT - Metabolism of nitric oxide: NOS3 activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - eNOS activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - eNOS activation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by Receptor Tyrosine Kinases:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by VEGF:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - VEGFA-VEGFR2 Pathway:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - VEGFR2 mediated vascular permeability:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Signaling by Nuclear Receptors:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + HSP90:HSP90 + Immunophilin FKBP52 + Pi + cPGES - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Peptide hormone metabolism:
AGT + H2O ⟶ AGT - Insulin processing:
6xHC-INS(25-110) + Ca2+ + Zn2+ ⟶ 6xProinsulin:2xZn2+:1xCa2+ - Metabolism of Angiotensinogen to Angiotensins:
AGT + H2O ⟶ AGT - Metabolism of nitric oxide: NOS3 activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - eNOS activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - eNOS activation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by Receptor Tyrosine Kinases:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by VEGF:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - VEGFA-VEGFR2 Pathway:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - VEGFR2 mediated vascular permeability:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Signaling by Nuclear Receptors:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + Fkbp4 + HSP90:HSP90 + Pi + Q9R0Q7 - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Peptide hormone metabolism:
Agt + H2O ⟶ Agt - Metabolism of Angiotensinogen to Angiotensins:
Agt + H2O ⟶ Agt - Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Signaling Pathways:
H2O + cAMP ⟶ AMP - Signaling by Receptor Tyrosine Kinases:
H2O + cAMP ⟶ AMP - Signaling by VEGF:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - VEGFA-VEGFR2 Pathway:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - VEGFR2 mediated vascular permeability:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Metabolism of nitric oxide: NOS3 activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - eNOS activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - eNOS activation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH - Peptide hormone metabolism:
Agt + H2O ⟶ Agt - Metabolism of Angiotensinogen to Angiotensins:
Agt + H2O ⟶ Agt - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by Receptor Tyrosine Kinases:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by VEGF:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - VEGFA-VEGFR2 Pathway:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - VEGFR2 mediated vascular permeability:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Signaling by Nuclear Receptors:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + HSP90:HSP90 + Pi + Ptges3 + Q9QVC8 - Signaling Pathways:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Signaling by Receptor Tyrosine Kinases:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Signaling by VEGF:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - VEGFA-VEGFR2 Pathway:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - VEGFR2 mediated vascular permeability:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Signaling by Nuclear Receptors:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Metabolism:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine - Metabolism of nitric oxide: NOS3 activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - eNOS activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - eNOS activation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - Metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Signaling Pathways:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Signaling by Receptor Tyrosine Kinases:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Signaling by VEGF:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - VEGFA-VEGFR2 Pathway:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - VEGFR2 mediated vascular permeability:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Signaling by Nuclear Receptors:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Metabolism of nitric oxide: NOS3 activation and regulation:
H+ + TPNH + sepiapterin ⟶ TPN + dihydrobiopterin - eNOS activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - eNOS activation:
H+ + TPNH + sepiapterin ⟶ TPN + dihydrobiopterin - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by Receptor Tyrosine Kinases:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by VEGF:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - VEGFA-VEGFR2 Pathway:
Oxygen + TPNH ⟶ H+ + O2.- + TPN - VEGFR2 mediated vascular permeability:
PAK1,2,3 dimer + p-VAV family:PIP3:RAC1:GTP ⟶ 2 x p-VAV family:PIP3:RAC1:GTP:PAK 1-3 - Signaling by Nuclear Receptors:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN - Metabolism of proteins:
EIF5A2 + NAD + SPM ⟶ 1,3-diaminopropane + H+ + H0ZKZ7 + NADH - Peptide hormone metabolism:
H0ZI58 + H2O ⟶ H0ZI58 - Metabolism of Angiotensinogen to Angiotensins:
H0ZI58 + H2O ⟶ H0ZI58 - Metabolism of proteins:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a - Peptide hormone metabolism:
H2O + agt ⟶ agt - Metabolism of Angiotensinogen to Angiotensins:
H2O + agt ⟶ agt - Metabolism of nitric oxide: NOS3 activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - eNOS activation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - Metabolism of nitric oxide: NOS3 activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - eNOS activation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - Metabolism of nitric oxide: NOS3 activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - eNOS activation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of polyamines:
GAA + SAM ⟶ CRET + H+ + SAH - Agmatine biosynthesis:
L-Arg ⟶ AGM + carbon dioxide - Agmatine biosynthesis:
L-Arg ⟶ AGM + carbon dioxide - ESR-mediated signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - ESR-mediated signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - ESR-mediated signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - ESR-mediated signaling:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + HSP90:HSP90 + Pi + Q9VH95 + Q9VL78 - ESR-mediated signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - ESR-mediated signaling:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + HSP90:HSP90 + Immunophilin FKBP52 + Pi + cPGES - ESR-mediated signaling:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + Fkbp4 + HSP90:HSP90 + Pi + Q9R0Q7 - Signaling by Nuclear Receptors:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - ESR-mediated signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - ESR-mediated signaling:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + HSP90:HSP90 + Pi + Ptges3 + Q9QVC8 - ESR-mediated signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - ESR-mediated signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - ESR-mediated signaling:
SPG ⟶ S1P - Extra-nuclear estrogen signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Extra-nuclear estrogen signaling:
SPG ⟶ S1P - Extra-nuclear estrogen signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Extra-nuclear estrogen signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Extra-nuclear estrogen signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Extra-nuclear estrogen signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Extra-nuclear estrogen signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Extra-nuclear estrogen signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Extra-nuclear estrogen signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Extra-nuclear estrogen signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Extra-nuclear estrogen signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Extra-nuclear estrogen signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of polyamines:
GAA + SAM ⟶ CRET + H+ + SAH - Urea cycle:
CAP + L-Orn ⟶ L-Cit + Pi - Urea cycle:
CAP + L-Orn ⟶ L-Cit + Pi - Urea cycle:
ATP + L-Asp + L-Cit ⟶ AMP + ARSUA + PPi - Urea cycle:
H2O + L-Arg ⟶ L-Orn + Urea - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Urea cycle:
H2O + L-Arg ⟶ L-Orn + Urea - Urea cycle:
ATP + L-Asp + L-Cit ⟶ AMP + ARSUA + PPi - Urea cycle:
CAP + L-Orn ⟶ L-Cit + Pi - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Urea cycle:
H2O + L-Arg ⟶ L-Orn + Urea - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Urea cycle:
H2O + L-Arg ⟶ L-Orn + Urea - Urea cycle:
ATP + L-Asp + L-Cit ⟶ AMP + ARSUA + PPi - Metabolism:
H2O + PBG ⟶ HMBL + ammonia - Amino acid metabolism:
Glu + OAA ⟶ 2OG + L-Asp - Arginine metabolism:
ATP + L-Asp + L-Cit ⟶ ARSUA + PPi - Urea cycle:
ATP + L-Asp + L-Cit ⟶ AMP + ARSUA + PPi - Urea cycle:
ATP + L-Asp + L-Cit ⟶ AMP + ARSUA + PPi - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Urea cycle:
H2O + L-Arg ⟶ L-Orn + Urea - Urea cycle:
CAP + L-Orn ⟶ L-Cit + Pi - Amino acid and derivative metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Urea cycle:
CAP + L-Orn ⟶ L-Cit + Pi - Amino acid and derivative metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Urea cycle:
CAP + L-Orn ⟶ L-Cit + Pi - Urea cycle:
ATP + L-Asp + L-Cit ⟶ AMP + ARSUA + PPi - Urea cycle:
H2O + L-Arg ⟶ L-Orn + Urea - Hemostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF - Platelet homeostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF - Nitric oxide stimulates guanylate cyclase:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Immune System:
Rap1 cAMP-GEFs + cAMP ⟶ Rap1 cAMP-GEFs:cAMP - Innate Immune System:
Cl- + H+ + H2O2 ⟶ H2O + HOCl - ROS and RNS production in phagocytes:
Cl- + H+ + H2O2 ⟶ H2O + HOCl - Immune System:
Rap1 cAMP-GEFs + cAMP ⟶ Rap1 cAMP-GEFs:cAMP - Innate Immune System:
TLR4:TLR6 + oxLDL:CD36 ⟶ TLR4:TLR6:CD36:oxLDL - ROS and RNS production in phagocytes:
Cl- + H+ + H2O2 ⟶ H2O + HOCl - Hemostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF - Platelet homeostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF - Nitric oxide stimulates guanylate cyclase:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Hemostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF - Platelet homeostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF - Nitric oxide stimulates guanylate cyclase:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Immune System:
Rap1 cAMP-GEFs + cAMP ⟶ Rap1 cAMP-GEFs:cAMP - Innate Immune System:
TLR4:TLR6 + oxLDL:CD36 ⟶ TLR4:TLR6:CD36:oxLDL - ROS and RNS production in phagocytes:
Cl- + H+ + H2O2 ⟶ H2O + HOCl - Hemostasis:
2AG + H2O ⟶ AA + Glycerol + H+ - Platelet homeostasis:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Nitric oxide stimulates guanylate cyclase:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Immune System:
cAMP ⟶ Rap1 cAMP-GEFs:cAMP - Innate Immune System:
Cl- + H+ + H2O2 ⟶ H2O + HOCl - ROS and RNS production in phagocytes:
Cl- + H+ + H2O2 ⟶ H2O + HOCl - Immune System:
Epac + cAMP ⟶ RAPGEF3:cAMP complex - Innate Immune System:
Cl- + H+ + H2O2 ⟶ H2O + HOCl - ROS and RNS production in phagocytes:
Cl- + H+ + H2O2 ⟶ H2O + HOCl - Hemostasis:
3AG + H2O ⟶ AA + Glycerol + H+ - Platelet homeostasis:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Nitric oxide stimulates guanylate cyclase:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Hemostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF - Platelet homeostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF - Nitric oxide stimulates guanylate cyclase:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Immune System:
Rap1 cAMP-GEFs + cAMP ⟶ Rap1 cAMP-GEFs:cAMP - Innate Immune System:
Cl- + H+ + H2O2 ⟶ H2O + HOCl - ROS and RNS production in phagocytes:
Cl- + H+ + H2O2 ⟶ H2O + HOCl - Hemostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF - Platelet homeostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF - Nitric oxide stimulates guanylate cyclase:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Immune System:
Rap1 cAMP-GEFs + cAMP ⟶ Rap1 cAMP-GEFs:cAMP - Innate Immune System:
TLR4:TLR6 + oxLDL:CD36 ⟶ TLR4:TLR6:CD36:oxLDL - ROS and RNS production in phagocytes:
H+ + O2.- ⟶ H2O2 - Immune System:
Rap1 cAMP-GEFs + cAMP ⟶ Rap1 cAMP-GEFs:cAMP - Innate Immune System:
TLR4:TLR6 + oxLDL:CD36 ⟶ TLR4:TLR6:CD36:oxLDL - ROS and RNS production in phagocytes:
Cl- + H+ + H2O2 ⟶ H2O + HOCl - Hemostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF - Platelet homeostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF - Nitric oxide stimulates guanylate cyclase:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Hemostasis:
3AG + H2O ⟶ AA + Glycerol + H+ - Platelet homeostasis:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Nitric oxide stimulates guanylate cyclase:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Immune System:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Innate Immune System:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - ROS and RNS production in phagocytes:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Hemostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF - Platelet homeostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF - Nitric oxide stimulates guanylate cyclase:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Immune System:
Rap1 cAMP-GEFs + cAMP ⟶ Rap1 cAMP-GEFs:cAMP - Innate Immune System:
TLR4:TLR6 + oxLDL:CD36 ⟶ TLR4:TLR6:CD36:oxLDL - ROS and RNS production in phagocytes:
Cl- + H+ + H2O2 ⟶ H2O + HOCl - Hemostasis:
2AG + H2O ⟶ AA + Glycerol + H+ - Platelet homeostasis:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Nitric oxide stimulates guanylate cyclase:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Immune System:
H2O + PC ⟶ Cho + PA - Innate Immune System:
H2O + PC ⟶ Cho + PA - ROS and RNS production in phagocytes:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Hemostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF - Platelet homeostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF - Immune System:
H2O + PC ⟶ Cho + PA - Innate Immune System:
H2O + PC ⟶ Cho + PA - ROS and RNS production in phagocytes:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Hemostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF - Platelet homeostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF - Nitric oxide stimulates guanylate cyclase:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Immune System:
Rap1 cAMP-GEFs + cAMP ⟶ Rap1 cAMP-GEFs:cAMP - Innate Immune System:
TLR4:TLR6 + oxLDL:CD36 ⟶ TLR4:TLR6:CD36:oxLDL - ROS and RNS production in phagocytes:
Cl- + H+ + H2O2 ⟶ H2O + HOCl - Immune System:
ATP + Ag-substrate:E3:E2:Ub ⟶ AMP + E3:Ub:substrate + PPi - Innate Immune System:
ATP + DAG:p-5Y-PKC-theta:CBM oligomer:TRAF6 oligomer + UBE2N:UBE2V1 ⟶ AMP + DAG:p-5Y-PKC-theta:CBM oligomer:oligo-K63-poly Ub-TRAF6 + PPi + UBE2N:UBE2V1 - ROS, RNS production in phagocytes:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Hemostasis:
AMP + GTP ⟶ ADP + GDP - Platelet homeostasis:
H0ZG60 + LDL ⟶ LDL:LRP8 - Nitric oxide stimulates guanylate cyclase:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Nitric oxide stimulates guanylate cyclase:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN - Biological oxidations:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN - Phase I - Functionalization of compounds:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN - Biological oxidations:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN - Phase I - Functionalization of compounds:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN - Biological oxidations:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN - Phase I - Functionalization of compounds:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN
BioCyc(84)
- arginine degradation X (arginine monooxygenase pathway):
4-guanidinobutyramide + H2O ⟶ 4-guanidinobutyrate + H+ + ammonia - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
ATP + L-citrulline + asp ⟶ AMP + H+ + L-arginino-succinate + diphosphate - arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - citrulline biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - rhizocticin A and B biosynthesis:
ATP + rhizocticin A + val ⟶ ADP + H+ + phosphate + rhizocticin B - superpathway of polyamine biosynthesis I:
H2O + agmatine ⟶ putrescine + urea - putrescine biosynthesis I:
H2O + agmatine ⟶ putrescine + urea - arginine degradation III (arginine decarboxylase/agmatinase pathway):
H2O + agmatine ⟶ putrescine + urea - superpathway of arginine and ornithine degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ γ-glutamyl-γ-aminobutyraldehyde + ammonium + hydrogen peroxide - superpathway of arginine, putrescine, and 4-aminobutyrate degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ γ-glutamyl-γ-aminobutyraldehyde + ammonium + hydrogen peroxide - superpathway of polyamine biosynthesis II:
N-carbamoylputrescine + H2O + H+ ⟶ CO2 + ammonia + putrescine - superpathway of polyamine biosynthesis I:
H2O + agmatine ⟶ putrescine + urea - superpathway of arginine and polyamine biosynthesis:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - putrescine biosynthesis I:
H2O + agmatine ⟶ putrescine + urea - putrescine biosynthesis II:
N-carbamoylputrescine + H2O + H+ ⟶ CO2 + ammonia + putrescine - nocardicin A biosynthesis:
H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster + nocardicin C ⟶ H2O + an oxidized ferredoxin [iron-sulfur] cluster + nocardicin A - urea cycle:
ATP + L-citrulline + asp ⟶ AMP + H+ + L-arginino-succinate + diphosphate - arginine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - ethylene biosynthesis IV (engineered):
2-oxoglutarate + H+ + O2 ⟶ CO2 + H2O + ethene - peramine biosynthesis:
(S)-1-pyrroline-5-carboxylate + ATP + SAM + arg ⟶ AMP + H+ + H2O + SAH + diphosphate + peramine - urea cycle:
ATP + L-citrulline + asp ⟶ AMP + H+ + L-arginino-succinate + diphosphate - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + phosphate - superpathway of L-citrulline metabolism:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + phosphate - L-citrulline biosynthesis:
an electron-transfer quinone + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + an electron-transfer quinol - L-Nδ-acetylornithine biosynthesis:
an electron-transfer quinone + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + an electron-transfer quinol - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VII (arginase 3 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + phosphate - putrescine biosynthesis IV:
H2O + agmatine ⟶ putrescine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
(S)-1-pyrroline-5-carboxylate + H+ + H2O ⟶ L-glutamate-5-semialdehyde - L-Nδ-acetylornithine biosynthesis:
(S)-1-pyrroline-5-carboxylate + H+ + H2O ⟶ L-glutamate-5-semialdehyde - L-arginine degradation VI (arginase 2 pathway):
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H - ornithine biosynthesis (arginine degradation):
H2O + arg ⟶ L-ornithine + urea - arginine degradation VII (arginase 3 pathway):
H2O + arg ⟶ L-ornithine + urea - arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate γ-semialdehyde + glt - arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate γ-semialdehyde + glt - arginine degradation VII:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + NAD(P)H + ammonia - urea cycle:
ATP + L-citrulline + asp ⟶ AMP + H+ + L-arginino-succinate + diphosphate - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glt - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glt - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VII (arginase 3 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + phosphate - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glt - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glt - urea cycle:
H2O + arg ⟶ L-ornithine + urea - arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate γ-semialdehyde + glt - arginine degradation VII (arginase 3 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
ATP + CO2 + H2O + ammonia ⟶ ADP + H+ + carbamoyl-phosphate + phosphate - citrulline biosynthesis:
H2O + gln ⟶ H+ + ammonia + glt - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate γ-semialdehyde + glt - putrescine biosynthesis IV:
H2O + agmatine ⟶ putrescine + urea - arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate γ-semialdehyde + glt - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ Glu + L-glutamate-5-semialdehyde - indolmycin biosynthesis:
(S)-1-pyrroline-5-carboxylate + H+ + H2O ⟶ L-glutamate-5-semialdehyde - L-arginine degradation X (arginine monooxygenase pathway):
4-guanidinobutanoate + H2O ⟶ 4-aminobutanoate + urea - citrulline-nitric oxide cycle:
ATP + L-citrulline + asp ⟶ AMP + H+ + L-arginino-succinate + diphosphate - nitric oxide biosynthesis II (mammals):
H+ + NADPH + O2 + arg ⟶ H2O + L-citrulline + NADP+ + nitric oxide - L-citrulline-nitric oxide cycle:
H+ + NADPH + O2 + arg ⟶ H2O + L-citrulline + NADP+ + nitric oxide - nitric oxide biosynthesis (plants):
H+ + NADPH + O2 + arg ⟶ H2O + L-citrulline + NADP+ + nitric oxide - nitric oxide biosynthesis:
NADPH + O2 + arg ⟶ L-citrulline + NADP+ + nitric oxide - L-citrulline-nitric oxide cycle:
L-arginino-succinate ⟶ arg + fumarate - L-arginine degradation VIII (arginine oxidase pathway):
4-guanidinobutanoate + H2O ⟶ 4-aminobutanoate + urea - D-arginine degradation:
H2O + iminoarginine ⟶ 5-guanidino-2-oxopentanoate + ammonium - L-arginine degradation V (arginine deiminase pathway):
H+ + carbamate ⟶ CO2 + ammonium - L-arginine degradation (Stickland reaction):
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H - L-proline biosynthesis II (from arginine):
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H - L-arginine degradation V (arginine deiminase pathway):
H2O + arg ⟶ L-citrulline + ammonium - L-arginine degradation V (arginine deiminase pathway):
ATP + CO2 + ammonium ⟶ ADP + H+ + carbamoyl phosphate - L-arginine degradation V (arginine deiminase pathway):
H+ + carbamate ⟶ CO2 + ammonium - L-arginine degradation V (arginine deiminase pathway):
ATP + CO2 + ammonium ⟶ ADP + H+ + carbamoyl phosphate - arginine degradation V (arginine deiminase pathway):
ATP + CO2 + ammonium ⟶ ADP + H+ + carbamoyl-phosphate - D-arginine degradation:
H2O + iminoarginine ⟶ 5-guanidino-2-oxo-pentanoate + ammonium - L-arginine degradation V (arginine deiminase pathway):
ATP + CO2 + ammonium ⟶ ADP + H+ + carbamoyl phosphate - L-arginine degradation V (arginine deiminase pathway):
ATP + CO2 + ammonium ⟶ ADP + H+ + carbamoyl phosphate - tRNA charging pathway:
ATP + arg ⟶ AMP + diphosphate
WikiPathways(2)
- Creatine pathway:
Proline ⟶ Pyrroline-5-carboxylate - Regucalcin in proximal tubule epithelial kidney cells:
AMP ⟶ cAMP
Plant Reactome(739)
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
H2O + N-Carbamoylputrescine ⟶ Putrescine + ammonia + carbon dioxide - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
H2O + N-Carbamoylputrescine ⟶ Putrescine + ammonia + carbon dioxide - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amine and polyamine biosynthesis:
H2O + N-Carbamoylputrescine ⟶ Putrescine + ammonia + carbon dioxide - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
H2O + N-Carbamoylputrescine ⟶ Putrescine + ammonia + carbon dioxide - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amine and polyamine biosynthesis:
H2O + N-Carbamoylputrescine ⟶ Putrescine + ammonia + carbon dioxide - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
H2O + N-Carbamoylputrescine ⟶ Putrescine + ammonia + carbon dioxide - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amine and polyamine biosynthesis:
H2O + N-Carbamoylputrescine ⟶ Putrescine + ammonia + carbon dioxide - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
H2O + N-Carbamoylputrescine ⟶ Putrescine + ammonia + carbon dioxide - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amine and polyamine biosynthesis:
H2O + N-Carbamoylputrescine ⟶ Putrescine + ammonia + carbon dioxide - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
H2O + N-Carbamoylputrescine ⟶ Putrescine + ammonia + carbon dioxide - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amine and polyamine biosynthesis:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Putrescine biosynthesis I:
L-Arg ⟶ AGM + carbon dioxide - Putrescine biosynthesis II:
AGM + H2O ⟶ N-Carbamoylputrescine + ammonia - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine biosynthesis I:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
H2O + L-Arg ⟶ L-Orn + Urea - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
H2O + L-Arg ⟶ L-Orn + Urea - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Arginine degradation:
H2O + L-Arg ⟶ L-Orn + Urea - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
H2O + L-Arg ⟶ L-Orn + Urea - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
H2O + L-Arg ⟶ L-Orn + Urea - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Metabolism and regulation:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA - Amino acid metabolism:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA - Amino acid biosynthesis:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Arginine degradation:
2OG + L-Orn ⟶ Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
H+ + L-Arg + Oxygen + TPNH ⟶ H2O + L-Cit + NO + TPN - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
H+ + L-Arg + Oxygen + TPNH ⟶ H2O + L-Cit + NO + TPN - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
H+ + L-Arg + Oxygen + TPNH ⟶ H2O + L-Cit + NO + TPN - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
H+ + L-Arg + Oxygen + TPNH ⟶ H2O + L-Cit + NO + TPN - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
H+ + L-Arg + Oxygen + TPNH ⟶ H2O + L-Cit + NO + TPN - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Citrulline-nitric oxide cycle:
H+ + L-Arg + Oxygen + TPNH ⟶ H2O + L-Cit + NO + TPN - Citrulline-nitric oxide cycle:
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia
INOH(0)
PlantCyc(677)
- L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
(S)-1-pyrroline-5-carboxylate + H+ + H2O ⟶ L-glutamate-5-semialdehyde - urea cycle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + phosphate - L-citrulline biosynthesis:
(S)-1-pyrroline-5-carboxylate + H+ + H2O ⟶ L-glutamate-5-semialdehyde - L-arginine degradation VI (arginase 2 pathway):
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + agmatine ⟶ putrescine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - superpathway of polyamine biosynthesis II:
H+ + arg ⟶ CO2 + agmatine - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - superpathway of polyamine biosynthesis II:
N-carbamoylputrescine + H+ + H2O ⟶ CO2 + ammonium + putrescine - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - superpathway of polyamine biosynthesis II:
H+ + L-ornithine ⟶ CO2 + putrescine - urea cycle:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - putrescine biosynthesis IV:
H2O + agmatine ⟶ putrescine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - putrescine biosynthesis IV:
H2O + agmatine ⟶ putrescine + urea - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - superpathway of polyamine biosynthesis II:
H+ + SAM ⟶ CO2 + dAdoMet - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - L-arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - urea cycle:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - superpathway of polyamine biosynthesis II:
H+ + SAM ⟶ CO2 + dAdoMet - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - superpathway of polyamine biosynthesis II:
H+ + arg ⟶ CO2 + agmatine - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + agmatine ⟶ putrescine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of polyamine biosynthesis II:
H+ + arg ⟶ CO2 + agmatine - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - superpathway of polyamine biosynthesis II:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + agmatine ⟶ putrescine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of polyamine biosynthesis II:
N-carbamoylputrescine + H+ + H2O ⟶ CO2 + ammonium + putrescine - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - superpathway of L-citrulline metabolism:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + phosphate - L-arginine degradation VI (arginase 2 pathway):
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H - L-citrulline biosynthesis:
an electron-transfer quinone + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + an electron-transfer quinol - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
an electron-transfer quinone + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + an electron-transfer quinol - urea cycle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + phosphate - putrescine biosynthesis IV:
H2O + agmatine ⟶ putrescine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - superpathway of polyamine biosynthesis II:
dAdoMet + putrescine ⟶ S-methyl-5'-thioadenosine + H+ + spermidine - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - superpathway of hyoscyamine and scopolamine biosynthesis:
N-methylputrescine + H2O + O2 ⟶ N-methylaminobutanal + ammonium + hydrogen peroxide - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - superpathway of polyamine biosynthesis II:
dAdoMet + putrescine ⟶ S-methyl-5'-thioadenosine + H+ + spermidine - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - superpathway of polyamine biosynthesis II:
dAdoMet + spermidine ⟶ S-methyl-5'-thioadenosine + H+ + spermine - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + agmatine ⟶ putrescine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of polyamine biosynthesis II:
dAdoMet + putrescine ⟶ S-methyl-5'-thioadenosine + H+ + spermidine - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - superpathway of hyoscyamine and scopolamine biosynthesis:
N-methylputrescine + H2O + O2 ⟶ N-methylaminobutanal + ammonium + hydrogen peroxide - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - superpathway of polyamine biosynthesis II:
dAdoMet + spermidine ⟶ S-methyl-5'-thioadenosine + H+ + spermine - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + agmatine ⟶ putrescine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - superpathway of polyamine biosynthesis II:
dAdoMet + spermidine ⟶ S-methyl-5'-thioadenosine + H+ + spermine - putrescine biosynthesis IV:
H2O + agmatine ⟶ putrescine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - superpathway of polyamine biosynthesis II:
dAdoMet + spermidine ⟶ S-methyl-5'-thioadenosine + H+ + spermine - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - superpathway of polyamine biosynthesis II:
dAdoMet + putrescine ⟶ S-methyl-5'-thioadenosine + H+ + spermidine - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of polyamine biosynthesis II:
dAdoMet + spermidine ⟶ S-methyl-5'-thioadenosine + H+ + spermine - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
an electron-transfer quinone + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + an electron-transfer quinol - urea cycle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + phosphate - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H - L-Nδ-acetylornithine biosynthesis:
an electron-transfer quinone + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + an electron-transfer quinol - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - superpathway of polyamine biosynthesis II:
dAdoMet + spermidine ⟶ S-methyl-5'-thioadenosine + H+ + spermine - putrescine biosynthesis IV:
H2O + agmatine ⟶ putrescine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - superpathway of L-citrulline metabolism:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + phosphate - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - putrescine biosynthesis IV:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - urea cycle:
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea - L-arginine degradation I (arginase pathway):
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + gln ⟶ H+ + ammonia + glu - L-citrulline biosynthesis:
H2O + gln ⟶ H+ + ammonia + glu - L-arginine degradation VI (arginase 2 pathway):
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H - L-citrulline biosynthesis:
H2O + gln ⟶ ammonium + glu - L-arginine degradation VI (arginase 2 pathway):
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H - L-Nδ-acetylornithine biosynthesis:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-arginine degradation I (arginase pathway):
H2O + L-glutamate-5-semialdehyde + NAD+ ⟶ H+ + NADH + glu - urea cycle:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + phosphate - L-arginine degradation VI (arginase 2 pathway):
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H - L-citrulline biosynthesis:
H2O + gln ⟶ H+ + ammonia + glu - L-citrulline biosynthesis:
H2O + gln ⟶ H+ + ammonia + glu - L-citrulline biosynthesis:
H2O + gln ⟶ H+ + ammonia + glu - L-citrulline biosynthesis:
H2O + gln ⟶ H+ + ammonia + glu - L-Nδ-acetylornithine biosynthesis:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-citrulline biosynthesis:
H2O + gln ⟶ H+ + ammonia + glu - superpathway of polyamine biosynthesis II:
N-carbamoylputrescine + H+ + H2O ⟶ CO2 + ammonium + putrescine - putrescine biosynthesis III:
H+ + L-ornithine ⟶ CO2 + putrescine - L-citrulline biosynthesis:
H2O + gln ⟶ H+ + ammonia + glu - L-citrulline biosynthesis:
H2O + gln ⟶ H+ + ammonia + glu - L-citrulline biosynthesis:
H2O + gln ⟶ H+ + ammonia + glu - nitric oxide biosynthesis II (mammals):
L-arginino-succinate ⟶ arg + fumarate - nitric oxide biosynthesis II (mammals):
L-arginino-succinate ⟶ arg + fumarate - L-arginine degradation V (arginine deiminase pathway):
H+ + carbamate ⟶ CO2 + ammonium - L-arginine degradation V (arginine deiminase pathway):
H+ + carbamate ⟶ CO2 + ammonium - L-arginine degradation V (arginine deiminase pathway):
H+ + carbamate ⟶ CO2 + ammonium - L-arginine degradation V (arginine deiminase pathway):
H+ + carbamate ⟶ CO2 + ammonium - L-arginine degradation V (arginine deiminase pathway):
H+ + carbamate ⟶ CO2 + ammonium - Organic Nitrogen Assimilation:
H2O + O2 + urate ⟶ CO2 + allantoin + hydrogen peroxide - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - L-arginine degradation V (arginine deiminase pathway):
H+ + carbamate ⟶ CO2 + ammonium - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - L-arginine degradation V (arginine deiminase pathway):
H+ + carbamate ⟶ CO2 + ammonium - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
H+ + H2O + adenine ⟶ ammonium + hypoxanthine - Organic Nitrogen Assimilation:
NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + gln
COVID-19 Disease Map(0)
PathBank(0)
PharmGKB(0)
1 个相关的物种来源信息
在这里通过桑基图来展示出与当前的这个代谢物在我们的BioDeep知识库中具有相关联信息的其他代谢物。在这里进行关联的信息来源主要有：
- PubMed: 来源于PubMed文献库中的文献信息，我们通过自然语言数据挖掘得到的在同一篇文献中被同时提及的相关代谢物列表，这个列表按照代谢物同时出现的文献数量降序排序，取前10个代谢物作为相关研究中关联性很高的代谢物集合展示在桑基图中。
- NCBI Taxonomy: 通过文献数据挖掘，得到的代谢物物种来源信息关联。这个关联信息同样按照出现的次数降序排序，取前10个代谢物作为高关联度的代谢物集合展示在桑吉图上。
- Chemical Taxonomy: 在物质分类上处于同一个分类集合中的其他代谢物
- Chemical Reaction: 在化学反应过程中，存在为当前代谢物相关联的生化反应过程中的反应底物或者反应产物的关联代谢物信息。
点击图上的相关代谢物的名称，可以跳转到相关代谢物的信息页面。