alpha-Ketoglutarate (BioDeep_00000840422)
代谢物信息卡片
alpha-Ketoglutarate
化学式: C5H4O5-2 (144.00587339999998)
中文名称:
谱图信息:
最多检出来源 Homo sapiens(blood) 93.33%
分子结构信息
SMILES: C(CC(=O)[O-])C(=O)C(=O)[O-]
InChI: InChI=1S/C5H6O5/c6-3(5(9)10)1-2-4(7)8/h1-2H2,(H,7,8)(H,9,10)/p-2
相关代谢途径
Reactome(81)
- Metabolism
- Metabolism of vitamins and cofactors
- Metabolism of proteins
- Post-translational protein modification
- Gamma carboxylation, hypusinylation, hydroxylation, and arylsulfatase activation
- Disease
- Amino acid and derivative metabolism
- Metabolism of lipids
- Metabolism of cofactors
- Diseases of metabolism
- Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism
- Amino acid metabolism
- Transport of small molecules
- SLC-mediated transmembrane transport
- Transport of bile salts and organic acids, metal ions and amine compounds
- DNA replication and repair
- DNA repair
- Developmental Biology
- DNA Repair
- DNA Damage Reversal
- Reversal of alkylation damage by DNA dioxygenases
- ALKBH2 mediated reversal of alkylation damage
- ALKBH3 mediated reversal of alkylation damage
- Signaling Pathways
- Signaling by Rho GTPases
- RHO GTPase Effectors
- RHO GTPases activate PKNs
- Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3
- Cell Cycle
- Cell Cycle, Mitotic
- M Phase
- Mitotic Prophase
- Condensation of Prophase Chromosomes
- Chromatin organization
- Chromatin modifying enzymes
- HDMs demethylate histones
- Signaling by Rho GTPases, Miro GTPases and RHOBTB3
- Maternal to zygotic transition (MZT)
- Chromatin modifications during the maternal to zygotic transition (MZT)
- Organic cation/anion/zwitterion transport
- Organic anion transport
- Fatty acid metabolism
- Amino acid synthesis and interconversion (transamination)
- Serine biosynthesis
- Tryptophan catabolism
- Cellular responses to stimuli
- Cellular responses to stress
- Gene expression (Transcription)
- Peroxisomal lipid metabolism
- The tricarboxylic acid cycle
- Carbohydrate metabolism
- Glucose metabolism
- The citric acid (TCA) cycle and respiratory electron transport
- Pyruvate metabolism and Citric Acid (TCA) cycle
- Citric acid cycle (TCA cycle)
- Lysine catabolism
- Extracellular matrix organization
- Collagen formation
- Phenylalanine and tyrosine catabolism
- Sulfur amino acid metabolism
- Degradation of cysteine and homocysteine
- Neuronal System
- Transmission across Chemical Synapses
- Neurotransmitter release cycle
- Metabolism of RNA
- tRNA processing
- tRNA modification in the nucleus and cytosol
- Aspartate and asparagine metabolism
- Phenylalanine and tyrosine metabolism
- Signaling by GPCR
- GPCR ligand binding
- Class A/1 (Rhodopsin-like receptors)
- GPCR downstream signalling
- G alpha (i) signalling events
- Gluconeogenesis
- Interconversion of 2-oxoglutarate and 2-hydroxyglutarate
- Branched-chain amino acid catabolism
- Tyrosine catabolism
- Alpha-oxidation of phytanate
- NADPH regeneration
- Glutamate and glutamine metabolism
BioCyc(183)
- superpathway of L-phenylalanine biosynthesis
- L-glutamate degradation II
- superpathway of anaerobic energy metabolism (invertebrates)
- superpathway of demethylmenaquinol-8 biosynthesis I
- superpathway of N-acetylneuraminate degradation
- superpathway of L-methionine biosynthesis (transsulfuration)
- superpathway of hexitol degradation (bacteria)
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis I
- superpathway of L-aspartate and L-asparagine biosynthesis
- superpathway of aromatic amino acid biosynthesis
- 2-carboxy-1,4-naphthoquinol biosynthesis
- superpathway of L-tyrosine biosynthesis
- superpathway of menaquinol-8 biosynthesis I
- superpathway of hyoscyamine and scopolamine biosynthesis
- superpathway of chorismate metabolism
- aspartate superpathway
- superpathway of anaerobic sucrose degradation
- superpathway of UDP-N-acetylglucosamine-derived O-antigen building blocks biosynthesis
- hyoscyamine and scopolamine biosynthesis
- superpathway of cytosolic glycolysis (plants), pyruvate dehydrogenase and TCA cycle
- trans-4-hydroxy-L-proline degradation II
- L-lysine biosynthesis II
- L-lysine biosynthesis I
- superpathway of sterol biosynthesis
- nicotine degradation I (pyridine pathway)
- superpathway of arginine and polyamine biosynthesis
- clavulanate biosynthesis
- superpathway of L-citrulline metabolism
- L-citrulline biosynthesis
- L-Nδ-acetylornithine biosynthesis
- L-arginine degradation VI (arginase 2 pathway)
- superpathway of L-arginine, putrescine, and 4-aminobutanoate degradation
- L-arginine degradation I (arginase pathway)
- L-arginine degradation XI
- superpathway of L-arginine and L-ornithine degradation
- superpathway of citrulline metabolism
- arginine degradation VI (arginase 2 pathway)
- citrulline biosynthesis
- L-Nδ-acetylornithine biosynthesis
- superpathway of arginine and ornithine degradation
- arginine degradation I (arginase pathway)
- superpathway of arginine, putrescine, and 4-aminobutyrate degradation
- arginine degradation VII
- morphine biosynthesis
- 12-epi-hapalindole biosynthesis
- paerucumarin biosynthesis
- superpathway of trimethylamine degradation
- rhabduscin biosynthesis
- hapalindole H biosynthesis
- 12-epi-fischerindole biosynthesis
- ectoine biosynthesis
- nevadensin biosynthesis
- 3-[(E)-2-isocyanoethenyl]-1H-indole biosynthesis
- methylamine degradation II
- superpathway of histidine, purine, and pyrimidine biosynthesis
- polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium)
- polymethylated quercetin glucoside biosynthesis II - quercetagetin series (Chrysosplenium)
- isoflavonoid biosynthesis II
- superpathway of polymethylated quercetin/quercetagetin glucoside biosynthesis (Chrysosplenium)
- superpathway of pentose and pentitol degradation
- superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass
- TCA cycle I (prokaryotic)
- γ-butyrobetaine degradation
- superpathway of microbial D-galacturonate and D-glucuronate degradation
- mixed acid fermentation
- L-valine degradation I
- superpathway of glyoxylate bypass and TCA
- vindoline and vinblastine biosynthesis
- CMP-pseudaminate biosynthesis
- CMP-legionaminate biosynthesis I
- serine biosynthesis
- superpathway of central carbon metabolism
- IAA biosynthesis I
- alanine biosynthesis II
- superpathway of alanine biosynthesis
- alanine biosynthesis I
- superpathway of L-lysine degradation
- L-phenylalanine degradation IV (mammalian, via side chain)
- scopoletin biosynthesis
- coumarins biosynthesis (engineered)
- superpathway of scopolin and esculin biosynthesis
- 2,4-dichlorophenoxyacetate degradation
- superpathway of glycolysis and the Entner-Doudoroff pathway
- NAD/NADP-NADH/NADPH cytosolic interconversion (yeast)
- superpathway NAD/NADP - NADH/NADPH interconversion (yeast)
- gluconeogenesis I
- L-arginine biosynthesis II (acetyl cycle)
- glycolysis II (from fructose 6-phosphate)
- glycolysis I (from glucose 6-phosphate)
- superpathway NAD/NADP - NADH/NADPH interconversion
- NAD/NADP-NADH/NADPH cytosolic interconversion
- L-tyrosine biosynthesis I
- L-phenylalanine biosynthesis I
- validamycin biosynthesis
- glutamate and glutamine biosynthesis
- glutamate biosynthesis II
- glutamate degradation
- proline biosynthesis II (from arginine)
- arginine biosynthesis IV
- L-glutamate degradation X
- glutamate degradation V (via hydroxyglutarate)
- glutamate degradation I
- 4-aminobutyrate degradation V
- alanine degradation II (to D-lactate)
- superpathway of glutamate biosynthesis
- phenylalanine degradation IV (mammalian, via side chain)
- ornithine degradation II (Stickland reaction)
- TCA cycle VI (obligate autotrophs)
- glutamine biosynthesis III
- glutamate degradation IX
- glutamate degradation II
- superpathway of threonine metabolism
- superpathway of aspartate and asparagine biosynthesis; interconversion of aspartate and asparagine
- superpathway of lysine, threonine and methionine biosynthesis II
- isoleucine biosynthesis I
- superpathway of lysine, threonine and methionine biosynthesis I
- isoleucine biosynthesis I (from threonine)
- gluconeogenesis II (Methanobacterium thermoautotrophicum)
- Methanobacterium thermoautotrophicum biosynthetic metabolism
- L-lysine degradation IV
- L-lysine degradation III
- hopanoid biosynthesis (bacteria)
- lysine degradation I (saccharopine pathway)
- procollagen hydroxylation and glycosylation
- ammonia assimilation cycle III
- rosmarinic acid biosynthesis II
- methylaspartate cycle
- L-glutamine degradation II
- TCA cycle V (2-oxoglutarate:ferredoxin oxidoreductase)
- superpathway of rosmarinic acid biosynthesis
- L-lysine degradation V
- L-lysine degradation XI (mammalian)
- L-tyrosine degradation II
- L-glutamate and L-glutamine biosynthesis
- reductive TCA cycle I
- anaerobic energy metabolism (invertebrates, cytosol)
- norspermidine biosynthesis
- superpathway of polyamine biosynthesis III
- L-leucine degradation I
- superpathway of GDP-mannose-derived O-antigen building blocks biosynthesis
- superpathway of penicillin, cephalosporin and cephamycin biosynthesis
- L-valine biosynthesis
- deacetylcephalosporin C biosynthesis
- L-histidine biosynthesis
- L-arginine biosynthesis I (via L-ornithine)
- L-ornithine biosynthesis I
- superpathway of phylloquinol biosynthesis
- superpathway of L-threonine metabolism
- L-carnitine biosynthesis
- trans-4-hydroxy-L-proline degradation I
- (S)-reticuline biosynthesis I
- C4 photosynthetic carbon assimilation cycle, NAD-ME type
- superpathway of L-methionine salvage and degradation
- L-isoleucine biosynthesis IV
- L-isoleucine biosynthesis II
- superpathway of glycolysis, pyruvate dehydrogenase and TCA cycle
- arginine biosynthesis I
- superpathway of fumitremorgin biosynthesis
- superpathway of benzoxazinoid glucosides biosynthesis
- 4'-methoxyviridicatin biosynthesis
- stipitatate biosynthesis
- umbelliferone biosynthesis
- L-valine degradation II
- valine degradation II
- nylon-6 oligomer degradation
- L-methionine salvage cycle I (bacteria and plants)
- L-methionine salvage cycle II (plants)
- superpathway of erythromycin biosynthesis
- superpathway of megalomicin A biosynthesis
- superpathway of L-threonine biosynthesis
- superpathway of L-isoleucine biosynthesis I
- dTDP-L-daunosamine biosynthesis
- isoleucine degradation I
- leucopelargonidin and leucocyanidin biosynthesis
- anthocyanin biosynthesis (pelargonidin 3-O-glucoside)
- superpathway of gibberellin biosynthesis
- respiration (anaerobic)
- superpathway of 4-aminobutyrate degradation
- 4-aminobutyrate degradation II
- threonine biosynthesis
- lysine biosynthesis VI
- lysine biosynthesis I
- ornithine biosynthesis
PlantCyc(53)
- superpathway of hyoscyamine and scopolamine biosynthesis
- hyoscyamine and scopolamine biosynthesis
- superpathway of anaerobic sucrose degradation
- superpathway of isoflavonoids (via naringenin)
- glycolysis IV (plant cytosol)
- superpathway of cytosolic glycolysis (plants), pyruvate dehydrogenase and TCA cycle
- leucodelphinidin biosynthesis
- luteolinidin 5-O-glucoside biosynthesis
- luteolin biosynthesis
- flavonoid biosynthesis (in equisetum)
- leucopelargonidin and leucocyanidin biosynthesis
- superpathway of L-citrulline metabolism
- L-arginine degradation VI (arginase 2 pathway)
- L-citrulline biosynthesis
- L-arginine degradation I (arginase pathway)
- L-Nδ-acetylornithine biosynthesis
- Organic Nitrogen Assimilation
- superpathway of hyoscyamine (atropine) and scopolamine biosynthesis
- nevadensin biosynthesis
- morphine biosynthesis
- polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium)
- polymethylated quercetin glucoside biosynthesis II - quercetagetin series (Chrysosplenium)
- superpathway of polymethylated quercetin/quercetagetin glucoside biosynthesis (Chrysosplenium)
- superpathway of gibberellin biosynthesis
- gibberellin biosynthesis II (early C-3 hydroxylation)
- pinobanksin biosynthesis
- vindoline, vindorosine and vinblastine biosynthesis
- scopoletin biosynthesis
- coumarins biosynthesis (engineered)
- superpathway of scopolin and esculin biosynthesis
- gibberellin inactivation I (2β-hydroxylation)
- tropane alkaloids biosynthesis
- superpathway of flavones and derivatives biosynthesis
- L-lysine degradation I
- L-glutamate biosynthesis I
- Inorganic Nitrogen Assimilation
- flavonol biosynthesis
- syringetin biosynthesis
- C4 photosynthetic carbon assimilation cycle, NAD-ME type
- 1,4-dihydroxy-2-naphthoate biosynthesis II (plants)
- L-histidine biosynthesis
- superpathway of phylloquinol biosynthesis
- (S)-reticuline biosynthesis I
- rosmarinic acid biosynthesis II
- superpathway of rosmarinic acid biosynthesis
- 2-carboxy-1,4-naphthoquinol biosynthesis
- chrysin biosynthesis
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II
- superpathway of benzoxazinoid glucosides biosynthesis
- umbelliferone biosynthesis
- L-methionine salvage cycle II (plants)
- L-methionine salvage cycle I (bacteria and plants)
- proanthocyanidins biosynthesis from flavanols
代谢反应
5161 个相关的代谢反应过程信息。
Reactome(635)
- Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid synthesis and interconversion (transamination):
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid synthesis and interconversion (transamination):
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Amino acid synthesis and interconversion (transamination):
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid synthesis and interconversion (transamination):
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Amino acid synthesis and interconversion (transamination):
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of lipids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Metabolism of lipids:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Fatty acid metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Peroxisomal lipid metabolism:
2OH-PALM + Oxygen ⟶ 2oxo-PALM + H2O2 - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine - Metabolism of lipids:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine - Fatty acid metabolism:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine - Peroxisomal lipid metabolism:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Metabolism of lipids:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Fatty acid metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi - Peroxisomal lipid metabolism:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - Peroxisomal lipid metabolism:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA - Alpha-oxidation of phytanate:
2OG + Oxygen + Phytanoyl-CoA ⟶ 3S2HPhy-CoA + SUCCA + carbon dioxide - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Amino acid and derivative metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Amino acid and derivative metabolism:
GAA + SAM ⟶ CRET + H+ + SAH - Tryptophan catabolism:
L-KYN + PYR ⟶ AP-DOBu + L-Ala - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Signaling Pathways:
ADORA2A,B + Ade-Rib ⟶ ADORA2A,B:Ade-Rib - Signaling by GPCR:
ADORA2A,B + Ade-Rib ⟶ ADORA2A,B:Ade-Rib - GPCR downstream signalling:
H2O + cAMP ⟶ AMP - G alpha (i) signalling events:
ATP ⟶ PPi + cAMP - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by GPCR:
ADORA1,3 + Ade-Rib ⟶ ADORA1,3:Ade-Rib - GPCR downstream signalling:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - G alpha (i) signalling events:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by GPCR:
ADORA1,3 + Ade-Rib ⟶ ADORA1,3:Ade-Rib - GPCR downstream signalling:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - G alpha (i) signalling events:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by GPCR:
ADORA2A,B + Ade-Rib ⟶ ADORA2A,B:Ade-Rib - GPCR downstream signalling:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - G alpha (i) signalling events:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - Cell Cycle:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Cell Cycle, Mitotic:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - M Phase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Mitotic Prophase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Condensation of Prophase Chromosomes:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Chromatin organization:
H2O ⟶ ammonia - Chromatin modifying enzymes:
H2O ⟶ ammonia - HDMs demethylate histones:
2OG + MeK37-histone H3 + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - DNA Repair:
MUTYH:(8oxoG:Ade)-dsDNA ⟶ Ade + MUTYH:AP-dsDNA - DNA Damage Reversal:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Reversal of alkylation damage by DNA dioxygenases:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Signaling by Rho GTPases:
TPNH + dioxygen ⟶ H+ + O2.- + TPN - RHO GTPase Effectors:
TPNH + dioxygen ⟶ H+ + O2.- + TPN - RHO GTPases activate PKNs:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - Cell Cycle:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Cell Cycle, Mitotic:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - M Phase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Mitotic Prophase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Condensation of Prophase Chromosomes:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,Me2K-10-H3:KDM1A ⟶ CH2O + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,MeK-10-H3:KDM1A - Chromatin organization:
2OG + MeK37-histone H3 + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - Chromatin modifying enzymes:
2OG + MeK37-histone H3 + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - HDMs demethylate histones:
2OG + MeK37-histone H3 + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - Chromatin organization:
H2O ⟶ ammonia - Chromatin modifying enzymes:
H2O ⟶ ammonia - HDMs demethylate histones:
2OG + MeK37-histone H3 + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - DNA Repair:
MUTYH:(8oxoG:Ade)-dsDNA ⟶ Ade + MUTYH:AP-dsDNA - DNA Damage Reversal:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Reversal of alkylation damage by DNA dioxygenases:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Signaling by Rho GTPases:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPase Effectors:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPases activate PKNs:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - Cell Cycle:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Cell Cycle, Mitotic:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - M Phase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Mitotic Prophase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Condensation of Prophase Chromosomes:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by Rho GTPases:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + Homologues of KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPase Effectors:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + Homologues of KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPases activate PKNs:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + Homologues of KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + Homologues of KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - DNA Repair:
MUTYH:(8oxoG:Ade)-dsDNA ⟶ Ade + MUTYH:AP-dsDNA - DNA Damage Reversal:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Reversal of alkylation damage by DNA dioxygenases:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Chromatin organization:
H2O ⟶ ammonia - Chromatin modifying enzymes:
H2O ⟶ ammonia - HDMs demethylate histones:
2OG + MeK37-histone H3 + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - Cell Cycle:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Cell Cycle, Mitotic:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - M Phase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Mitotic Prophase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Condensation of Prophase Chromosomes:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Chromatin organization:
2OG + Me2K10-histone H3 + Oxygen ⟶ CH2O + MeK10-histone H3 + SUCCA + carbon dioxide - Chromatin modifying enzymes:
2OG + Me2K10-histone H3 + Oxygen ⟶ CH2O + MeK10-histone H3 + SUCCA + carbon dioxide - HDMs demethylate histones:
2OG + Me2K10-histone H3 + Oxygen ⟶ CH2O + MeK10-histone H3 + SUCCA + carbon dioxide - Cell Cycle:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Cell Cycle, Mitotic:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - M Phase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Mitotic Prophase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Condensation of Prophase Chromosomes:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Chromatin organization:
SAM ⟶ SAH - Chromatin modifying enzymes:
SAM ⟶ SAH - HDMs demethylate histones:
2OG + His4:CG33889 + Oxygen ⟶ CH2O + His4:CG33889 + SUCCA + carbon dioxide - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by Rho GTPases:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,Me2K-10-H3:KDM1A ⟶ CH2O + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,MeK-10-H3:KDM1A - RHO GTPase Effectors:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,Me2K-10-H3:KDM1A ⟶ CH2O + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,MeK-10-H3:KDM1A - RHO GTPases activate PKNs:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,Me2K-10-H3:KDM1A ⟶ CH2O + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,MeK-10-H3:KDM1A - Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,Me2K-10-H3:KDM1A ⟶ CH2O + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,MeK-10-H3:KDM1A - Cell Cycle:
H2O + NAD + Q8MQX9 ⟶ 2'-O-acetyl-ADP-ribose + NAM + Q8MQX9 - Cell Cycle, Mitotic:
H2O + NAD + Q8MQX9 ⟶ 2'-O-acetyl-ADP-ribose + NAM + Q8MQX9 - M Phase:
H2O + NAD + Q8MQX9 ⟶ 2'-O-acetyl-ADP-ribose + NAM + Q8MQX9 - Mitotic Prophase:
Ca2+ + DAG ⟶ DAG:active PKC:Ca+2 - DNA replication and repair:
2OG + Oxygen ⟶ CH2O + CH3CHO + SUCCA + carbon dioxide - DNA repair:
2OG + Oxygen ⟶ CH2O + CH3CHO + SUCCA + carbon dioxide - DNA Damage Reversal:
2OG + Oxygen ⟶ CH2O + CH3CHO + SUCCA + carbon dioxide - Cell Cycle:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Cell Cycle, Mitotic:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - M Phase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Mitotic Prophase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Condensation of Prophase Chromosomes:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by Rho GTPases:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPase Effectors:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPases activate PKNs:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - DNA Repair:
MUTYH:(8oxoG:Ade)-dsDNA ⟶ Ade + MUTYH:AP-dsDNA - DNA Damage Reversal:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Reversal of alkylation damage by DNA dioxygenases:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Chromatin organization:
H2O ⟶ ammonia - Chromatin modifying enzymes:
H2O ⟶ ammonia - HDMs demethylate histones:
2OG + H4-VI + Oxygen ⟶ CH2O + H4-VI + SUCCA + carbon dioxide - Developmental Biology:
Early cornified envelope + Lamellar body ⟶ Cornified envelope - DNA Repair:
MUTYH:(8oxoG:Ade)-dsDNA ⟶ Ade + MUTYH:AP-dsDNA - DNA Damage Reversal:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Reversal of alkylation damage by DNA dioxygenases:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - ALKBH2 mediated reversal of alkylation damage:
2OG + ALKBH2:Fe2+:1-meA-dsDNA + Oxygen ⟶ ALKBH2:Fe2+ + CH2O + SUCCA + carbon dioxide - ALKBH3 mediated reversal of alkylation damage:
2OG + ALKBH3:Fe2+:ASCC1:ASCC2:ASCC3:1-meA-dsDNA + Oxygen ⟶ ALKBH3:Fe2+:ASCC1:ASCC2:ASCC3 + CH2O + SUCCA + carbon dioxide - Signaling by Rho GTPases:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPase Effectors:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPases activate PKNs:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - Cell Cycle:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Cell Cycle, Mitotic:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - M Phase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Mitotic Prophase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Condensation of Prophase Chromosomes:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Chromatin organization:
H2O ⟶ ammonia - Chromatin modifying enzymes:
H2O ⟶ ammonia - HDMs demethylate histones:
2OG + MeK37-histone H3 + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - DNA Repair:
MUTYH:(8oxoG:Ade)-dsDNA ⟶ Ade + MUTYH:AP-dsDNA - DNA Damage Reversal:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Reversal of alkylation damage by DNA dioxygenases:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Chromatin organization:
H2O ⟶ ammonia - Chromatin modifying enzymes:
H2O ⟶ ammonia - HDMs demethylate histones:
2OG + MeK37-histone H3 + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - Cell Cycle:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Cell Cycle, Mitotic:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - M Phase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Mitotic Prophase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Condensation of Prophase Chromosomes:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Chromatin organization:
2OG + H3K4me2 + Oxygen ⟶ CH2O + MeK5-histone H3 + SUCCA + carbon dioxide - Chromatin modifying enzymes:
2OG + H3K4me2 + Oxygen ⟶ CH2O + MeK5-histone H3 + SUCCA + carbon dioxide - HDMs demethylate histones:
2OG + H3K4me2 + Oxygen ⟶ CH2O + MeK5-histone H3 + SUCCA + carbon dioxide - Chromatin organization:
H2O ⟶ ammonia - Chromatin modifying enzymes:
H2O ⟶ ammonia - HDMs demethylate histones:
2OG + MeK37-histone H3 + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - Cell Cycle:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Cell Cycle, Mitotic:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - M Phase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Mitotic Prophase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Condensation of Prophase Chromosomes:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by Rho GTPases:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,Me2K-10-H3:KDM1A ⟶ CH2O + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,MeK-10-H3:KDM1A - RHO GTPase Effectors:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,Me2K-10-H3:KDM1A ⟶ CH2O + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,MeK-10-H3:KDM1A - RHO GTPases activate PKNs:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,Me2K-10-H3:KDM1A ⟶ CH2O + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,MeK-10-H3:KDM1A - Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,Me2K-10-H3:KDM1A ⟶ CH2O + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,MeK-10-H3:KDM1A - DNA Repair:
MUTYH:(8oxoG:Ade)-dsDNA ⟶ Ade + MUTYH:AP-dsDNA - DNA Damage Reversal:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Reversal of alkylation damage by DNA dioxygenases:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Chromatin organization:
2OG + MeK37-histone H3 + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - Chromatin modifying enzymes:
2OG + MeK37-histone H3 + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - HDMs demethylate histones:
2OG + MeK37-histone H3 + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - Signaling Pathways:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Signaling by Rho GTPases:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + Homologues of KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPase Effectors:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + Homologues of KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPases activate PKNs:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + Homologues of KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + Homologues of KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - Cell Cycle:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Cell Cycle, Mitotic:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - M Phase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Mitotic Prophase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Condensation of Prophase Chromosomes:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Cell Cycle:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Cell Cycle, Mitotic:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - M Phase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Mitotic Prophase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Condensation of Prophase Chromosomes:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Chromatin organization:
2OG + MeK-HIST1H4A + Oxygen ⟶ CH2O + HIST1H4 + SUCCA + carbon dioxide - Chromatin modifying enzymes:
2OG + MeK-HIST1H4A + Oxygen ⟶ CH2O + HIST1H4 + SUCCA + carbon dioxide - HDMs demethylate histones:
2OG + MeK-HIST1H4A + Oxygen ⟶ CH2O + HIST1H4 + SUCCA + carbon dioxide - Signaling Pathways:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Signaling by Rho GTPases:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPase Effectors:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPases activate PKNs:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - Chromatin organization:
H2O ⟶ ammonia - Chromatin modifying enzymes:
H2O ⟶ ammonia - HDMs demethylate histones:
2OG + MeK37-histone H3 + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - Cell Cycle:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Cell Cycle, Mitotic:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - M Phase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Mitotic Prophase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Condensation of Prophase Chromosomes:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer - Signaling by Rho GTPases:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPase Effectors:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - RHO GTPases activate PKNs:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - DNA Repair:
MUTYH:(8oxoG:Ade)-dsDNA ⟶ Ade + MUTYH:AP-dsDNA - DNA Damage Reversal:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Reversal of alkylation damage by DNA dioxygenases:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - DNA Repair:
MUTYH:(8oxoG:Ade)-dsDNA ⟶ Ade + MUTYH:AP-dsDNA - DNA Damage Reversal:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Reversal of alkylation damage by DNA dioxygenases:
2OG + Fe2+ + N6-methyladenosine ⟶ CH2O + SUCCA + adenosine + carbon dioxide - Cell Cycle:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Cell Cycle, Mitotic:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - M Phase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Mitotic Prophase:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Condensation of Prophase Chromosomes:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + SUCCA + carbon dioxide + kdm4b + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - HDMs demethylate histones:
2OG + MeK37-histone H3 + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - Condensation of Prophase Chromosomes:
2OG + Oxygen + PHF8:Nucleosome with H3K4me2/3:H4K20me1 ⟶ CH2O + PHF8:Nucleosome with H3K4me2/3 + SUCCA + carbon dioxide - Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - Signaling by Rho GTPases, Miro GTPases and RHOBTB3:
NOX2 complex:RAC2:GTP + S100A8:S100A9:AA:Ca2+ ⟶ NOX2 complex:S100A8:S100A9:Ca2+ - Signaling by Rho GTPases, Miro GTPases and RHOBTB3:
NOX2 complex:RAC2:GTP + S100A8:S100A9:AA:Ca2+ ⟶ NOX2 complex:S100A8:S100A9:Ca2+ - Signaling by Rho GTPases, Miro GTPases and RHOBTB3:
NOX2 complex:RAC2:GTP + S100A8:S100A9:AA:Ca2+ ⟶ NOX2 complex:S100A8:S100A9:Ca2+ - Signaling by Rho GTPases, Miro GTPases and RHOBTB3:
NOX2 complex:RAC2:GTP + S100A8:S100A9:AA:Ca2+ ⟶ NOX2 complex:S100A8:S100A9:Ca2+ - Signaling by Rho GTPases, Miro GTPases and RHOBTB3:
TPNH + dioxygen ⟶ H+ + O2.- + TPN - Signaling by Rho GTPases, Miro GTPases and RHOBTB3:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - Signaling by Rho GTPases, Miro GTPases and RHOBTB3:
TPNH + dioxygen ⟶ H+ + O2.- + TPN - Signaling by Rho GTPases, Miro GTPases and RHOBTB3:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,Me2K-10-H3:KDM1A ⟶ CH2O + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,MeK-10-H3:KDM1A - Signaling by Rho GTPases, Miro GTPases and RHOBTB3:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + Homologues of KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3 - Signaling by Rho GTPases, Miro GTPases and RHOBTB3:
NOX2 complex:RAC2:GTP + S100A8:S100A9:AA:Ca2+ ⟶ NOX2 complex:S100A8:S100A9:Ca2+ - Maternal to zygotic transition (MZT):
2OG + Histone H3 (H3K4me3) + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - Chromatin modifications during the maternal to zygotic transition (MZT):
2OG + Histone H3 (H3K4me3) + Oxygen ⟶ CH2O + Histone H3 + SUCCA + carbon dioxide - Extracellular matrix organization:
2OG + Oxygen + Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides ⟶ Prolyl 3-hydroxylases:Fe2+:3,4-Hyp collagen propeptides + SUCCA + carbon dioxide - Collagen formation:
2OG + Oxygen + Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides ⟶ Prolyl 3-hydroxylases:Fe2+:3,4-Hyp collagen propeptides + SUCCA + carbon dioxide - Collagen biosynthesis and modifying enzymes:
2OG + Oxygen + Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides ⟶ Prolyl 3-hydroxylases:Fe2+:3,4-Hyp collagen propeptides + SUCCA + carbon dioxide - Extracellular matrix organization:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Collagen formation:
2OG + Lysyl hydroxylases:Lysyl hydroxylase procollagen substrates + Oxygen ⟶ Lysyl hydroxylases:Lysyl hydroxylated collagen propeptides + SUCCA + carbon dioxide - Collagen biosynthesis and modifying enzymes:
2OG + Lysyl hydroxylases:Lysyl hydroxylase procollagen substrates + Oxygen ⟶ Lysyl hydroxylases:Lysyl hydroxylated collagen propeptides + SUCCA + carbon dioxide - Extracellular matrix organization:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Collagen formation:
H2O + Oxygen ⟶ H2O2 + ammonia - Collagen biosynthesis and modifying enzymes:
2OG + Lysyl hydroxylases:Lysyl hydroxylase procollagen substrates + Oxygen ⟶ Lysyl hydroxylases:Lysyl hydroxylated collagen propeptides + SUCCA + carbon dioxide - Extracellular matrix organization:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides - Collagen formation:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides - Collagen biosynthesis and modifying enzymes:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides - Extracellular matrix organization:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides - Collagen formation:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides - Collagen biosynthesis and modifying enzymes:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides - Extracellular matrix organization:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides - Collagen formation:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides - Collagen biosynthesis and modifying enzymes:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides - Extracellular matrix organization:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides - Collagen formation:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides - Collagen biosynthesis and modifying enzymes:
4-Hyp collagen propeptides + Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides - Extracellular matrix organization:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Collagen formation:
2OG + Lysyl hydroxylases:Lysyl hydroxylase procollagen substrates + Oxygen ⟶ Lysyl hydroxylases:Lysyl hydroxylated collagen propeptides + SUCCA + carbon dioxide - Collagen biosynthesis and modifying enzymes:
2OG + Lysyl hydroxylases:Lysyl hydroxylase procollagen substrates + Oxygen ⟶ Lysyl hydroxylases:Lysyl hydroxylated collagen propeptides + SUCCA + carbon dioxide - Extracellular matrix organization:
Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides - Collagen formation:
Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides - Collagen biosynthesis and modifying enzymes:
Prolyl 3-hydroxylases:Fe2+ ⟶ Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides - Extracellular matrix organization:
2OG + Oxygen + Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides ⟶ Prolyl 3-hydroxylases:Fe2+:3,4-Hyp collagen propeptides + SUCCA + carbon dioxide - Collagen formation:
2OG + Oxygen + Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides ⟶ Prolyl 3-hydroxylases:Fe2+:3,4-Hyp collagen propeptides + SUCCA + carbon dioxide - Collagen biosynthesis and modifying enzymes:
2OG + Oxygen + Prolyl 3-hydroxylases:Fe2+:4-Hyp collagen propeptides ⟶ Prolyl 3-hydroxylases:Fe2+:3,4-Hyp collagen propeptides + SUCCA + carbon dioxide - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - Amino acid synthesis and interconversion (transamination):
ATP + H2O + L-Asp + L-Gln ⟶ AMP + L-Asn + L-Glu + PPi - Amino acid synthesis and interconversion (transamination):
H2O + NAA ⟶ CH3COO- + L-Asp - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Interconversion of 2-oxoglutarate and 2-hydroxyglutarate:
2HG + FAD ⟶ 2OG + FADH2 - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Interconversion of 2-oxoglutarate and 2-hydroxyglutarate:
2HG + FAD ⟶ 2OG + FADH2 - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Interconversion of 2-oxoglutarate and 2-hydroxyglutarate:
2HG + FAD ⟶ 2OG + FADH2 - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Interconversion of 2-oxoglutarate and 2-hydroxyglutarate:
2HG + FAD ⟶ 2OG + FADH2 - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Interconversion of 2-oxoglutarate and 2-hydroxyglutarate:
2HG + FAD ⟶ 2OG + FADH2 - Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Interconversion of 2-oxoglutarate and 2-hydroxyglutarate:
2HG + FAD ⟶ 2OG + FADH2 - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Interconversion of 2-oxoglutarate and 2-hydroxyglutarate:
2HG + FAD ⟶ 2OG + FADH2 - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Interconversion of 2-oxoglutarate and 2-hydroxyglutarate:
2HG + FAD ⟶ 2OG + FADH2 - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Interconversion of 2-oxoglutarate and 2-hydroxyglutarate:
2HG + FAD ⟶ 2OG + FADH2 - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Interconversion of 2-oxoglutarate and 2-hydroxyglutarate:
2HG + FAD ⟶ 2OG + FADH2 - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Interconversion of 2-oxoglutarate and 2-hydroxyglutarate:
2HG + FAD ⟶ 2OG + FADH2 - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Interconversion of 2-oxoglutarate and 2-hydroxyglutarate:
2HG + FAD ⟶ 2OG + FADH2 - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Interconversion of 2-oxoglutarate and 2-hydroxyglutarate:
2HG + FAD ⟶ 2OG + FADH2 - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Interconversion of 2-oxoglutarate and 2-hydroxyglutarate:
2HG + FAD ⟶ 2OG + FADH2 - Signaling by GPCR:
Ade-Rib ⟶ ADORA1,3:Ade-Rib - Signaling by GPCR:
ADORA1,3 + Ade-Rib ⟶ ADORA1,3:Ade-Rib - GPCR downstream signalling:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - G alpha (i) signalling events:
Heterotrimeric G-protein Gi (inactive) + Ligand:GPCR complexes that activate Gi ⟶ Ligand:GPCR complexes that activate Gi:Heterotrimeric G-protein Gi (inactive) - Signaling by GPCR:
ADORA1,3 + Ade-Rib ⟶ ADORA1,3:Ade-Rib - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Lysine catabolism:
Oxygen + PPCA ⟶ H2O2 + P6C - Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Lysine catabolism:
2OG + H+ + L-Lys + TPNH ⟶ H2O + SACN + TPN - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Lysine catabolism:
5PHL + H2O ⟶ 2AMAS + Pi + ammonia - Lysine catabolism:
Oxygen + PPCA ⟶ H2O2 + P6C - Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia - Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia - Serine biosynthesis:
3POPA + L-Glu ⟶ 2OG + O-P-Ser - Serine biosynthesis:
3POPA + L-Glu ⟶ 2OG + O-P-Ser - Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia - Serine biosynthesis:
3POPA + L-Glu ⟶ 2OG + O-P-Ser - Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia - Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia - Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia - Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia - Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia - Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia - Serine biosynthesis:
3POPA + L-Glu ⟶ 2OG + O-P-Ser - Serine biosynthesis:
Ser ⟶ H2O + PYR + ammonia - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Carnitine synthesis:
2OG + Oxygen + TEABT ⟶ CAR + SUCCA + carbon dioxide - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Carnitine synthesis:
2OG + Oxygen + TMLYS ⟶ HTMLYS + SUCCA + carbon dioxide - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA - The citric acid (TCA) cycle and respiratory electron transport:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Pyruvate metabolism and Citric Acid (TCA) cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Citric acid cycle (TCA cycle):
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Phenylalanine and tyrosine catabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Phenylalanine and tyrosine catabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Phenylalanine and tyrosine catabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Phenylalanine and tyrosine catabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Phenylalanine and tyrosine catabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Phenylalanine and tyrosine catabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Phenylalanine and tyrosine catabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Phenylalanine and tyrosine catabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Phenylalanine and tyrosine catabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Phenylalanine and tyrosine catabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Histidine, lysine, phenylalanine, tyrosine, proline and tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK - Phenylalanine and tyrosine catabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Phenylalanine and tyrosine metabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Tyrosine catabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Phenylalanine and tyrosine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Tyrosine catabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Phenylalanine and tyrosine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Tyrosine catabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Phenylalanine and tyrosine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Tyrosine catabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Phenylalanine and tyrosine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Tyrosine catabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Phenylalanine and tyrosine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Tyrosine catabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Phenylalanine and tyrosine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Tyrosine catabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Phenylalanine and tyrosine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Tyrosine catabolism:
HGTA + Oxygen ⟶ 4MAA - Phenylalanine and tyrosine metabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Tyrosine catabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Phenylalanine and tyrosine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Tyrosine catabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Phenylalanine and tyrosine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Tyrosine catabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Phenylalanine and tyrosine metabolism:
H2O + L-Phe + Oxygen ⟶ H2O2 + ammonia + kPPV - Tyrosine catabolism:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - GABA synthesis, release, reuptake and degradation:
H+ + L-Glu ⟶ GABA + carbon dioxide - Degradation of GABA:
H2O + NAD + SUCCSA ⟶ H+ + NADH + SUCCA - Neuronal System:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Transmission across Chemical Synapses:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Neurotransmitter release cycle:
2OG + GABA ⟶ Glu + SUCCSA - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
2OG + GABA ⟶ Glu + SUCCSA - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neuronal System:
3MT + H2O + Oxygen ⟶ H2O2 + HVA + ammonia - Transmission across Chemical Synapses:
3MT + H2O + Oxygen ⟶ H2O2 + HVA + ammonia - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neuronal System:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Transmission across Chemical Synapses:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Neurotransmitter release cycle:
2OG + GABA ⟶ Glu + SUCCSA - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
H2O + NAd + Oxygen ⟶ 3,4-dihydroxymandelaldehyde + H2O2 + ammonia - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neuronal System:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Transmission across Chemical Synapses:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP - Neurotransmitter release cycle:
2OG + GABA ⟶ Glu + SUCCSA - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
2OG + GABA ⟶ Glu + SUCCSA - GABA synthesis, release, reuptake and degradation:
2OG + GABA ⟶ Glu + SUCCSA - Degradation of GABA:
2OG + GABA ⟶ Glu + SUCCSA - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
Ac-CoA + Cho ⟶ AcCho + CoA-SH - GABA synthesis, release, reuptake and degradation:
H+ + L-Glu ⟶ GABA + carbon dioxide - Degradation of GABA:
H2O + NAD + SUCCSA ⟶ H+ + NADH + SUCCA - Neuronal System:
DA + SAM ⟶ 3MT + SAH - Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH - Neurotransmitter release cycle:
Ac-CoA + Cho ⟶ AcCho + CoA-SH - GABA synthesis, release, reuptake and degradation:
H+ + L-Glu ⟶ GABA + carbon dioxide - Degradation of GABA:
H2O + NAD + SUCCSA ⟶ H+ + NADH + SUCCA - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of cofactors:
ISCIT + TPN ⟶ 2OG + H+ + TPNH + carbon dioxide - NADPH regeneration:
ISCIT + TPN ⟶ 2OG + H+ + TPNH + carbon dioxide - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - NADPH regeneration:
ISCIT + TPN ⟶ 2OG + H+ + TPNH + carbon dioxide - Metabolism of vitamins and cofactors:
6x(PCCA:PCCB) + ATP + Btn ⟶ 6x(Btn-PCCA:PCCB) + AMP + PPi - Metabolism of cofactors:
H+ + TPNH + sepiapterin ⟶ TPN + dihydrobiopterin - NADPH regeneration:
ISCIT + TPN ⟶ 2OG + H+ + TPNH + carbon dioxide - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - NADPH regeneration:
ISCIT + TPN ⟶ 2OG + H+ + TPNH + carbon dioxide - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - NADPH regeneration:
ISCIT + TPN ⟶ 2OG + H+ + TPNH + carbon dioxide - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - NADPH regeneration:
ISCIT + TPN ⟶ 2OG + H+ + TPNH + carbon dioxide - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - NADPH regeneration:
ISCIT + TPN ⟶ 2OG + H+ + TPNH + carbon dioxide - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - NADPH regeneration:
ISCIT + TPN ⟶ 2OG + H+ + TPNH + carbon dioxide - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - NADPH regeneration:
ISCIT + TPN ⟶ 2OG + H+ + TPNH + carbon dioxide - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - NADPH regeneration:
ISCIT + TPN ⟶ 2OG + H+ + TPNH + carbon dioxide - Metabolism of vitamins and cofactors:
4x(PC:Mn2+) + ATP + Btn ⟶ 4x(Btn-PC:Mn2+) + AMP + PPi - Metabolism of cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - NADPH regeneration:
ISCIT + TPN ⟶ 2OG + H+ + TPNH + carbon dioxide - Metabolism of vitamins and cofactors:
4x(PC:Mn2+) + ATP + Btn ⟶ 4x(Btn-PC:Mn2+) + AMP + PPi - Metabolism of cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - NADPH regeneration:
ISCIT + TPN ⟶ 2OG + H+ + TPNH + carbon dioxide - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of cofactors:
H+ + TPNH + sepiapterin ⟶ TPN + dihydrobiopterin - NADPH regeneration:
ISCIT + TPN ⟶ 2OG + H+ + TPNH + carbon dioxide - Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate - Metabolism of cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2 - NADPH regeneration:
ISCIT + TPN ⟶ 2OG + H+ + TPNH + carbon dioxide - Disease:
ADORA2B + Ade-Rib ⟶ ADORA2B:Ade-Rib - Diseases of metabolism:
2OG + H+ + TPNH ⟶ 2HG + TPN - Abnormal conversion of 2-oxoglutarate to 2-hydroxyglutarate:
2OG + H+ + TPNH ⟶ 2HG + TPN - Sulfur amino acid metabolism:
H2O + L-Cystathionine ⟶ 2OBUTA + L-Cys + ammonia - Degradation of cysteine and homocysteine:
H2O + HCYS ⟶ 2OBUTA + H2S + ammonia
BioCyc(379)
- fumitremorgin A biosynthesis:
DMAPP + verruculogen ⟶ diphosphate + fumitremorgin A - superpathway of fumitremorgin biosynthesis:
DMAPP + verruculogen ⟶ diphosphate + fumitremorgin A - ethylene biosynthesis IV (engineered):
2-oxoglutarate + H+ + O2 ⟶ CO2 + H2O + ethene - ethylene biosynthesis II (microbes):
2-oxoglutarate + H+ + O2 ⟶ CO2 + H2O + ethene - ethylene biosynthesis V (engineered):
2-oxoglutarate + H+ + O2 ⟶ CO2 + H2O + ethene - dTDP-L-daunosamine biosynthesis:
2-oxoglutarate + dTDP-3-amino-4-dehydro-2,3,6-trideoxy-β-L-glucose ⟶ dTDP-3,4-didehydro-2,6-dideoxy-β-L-glucose + glu - nevadensin biosynthesis:
2-oxoglutarate + O2 + gardenin B ⟶ CO2 + formaldehyde + nevadensin + succinate - clavulanate biosynthesis:
2-oxoglutarate + O2 + dihydroclavaminate ⟶ CO2 + H2O + clavaminate + succinate - validamycin biosynthesis:
GDP-valienol + validamine 7-phosphate ⟶ GDP + H+ + validoxylamine A 7'-phosphate - valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + bicarbonate + propanoyl-CoA - valine degradation I:
(S)-methylmalonate-semialdehyde + H2O + NAD+ + coenzyme A ⟶ H+ + NADH + bicarbonate + propanoyl-CoA - isoflavonoid biosynthesis II:
2-oxoglutarate + O2 + naringenin ⟶ CO2 + H2O + apigenin + succinate - superpathway of isoflavonoids (via naringenin):
2-oxoglutarate + O2 + naringenin ⟶ CO2 + H2O + apigenin + succinate - L-cysteine degradation I:
2-oxoglutarate + 3-sulfinoalanine ⟶ 3-sulfinyl-pyruvate + glt - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - superpathway of hyoscyamine and scopolamine biosynthesis:
(S)-atropinium + 2-oxoglutarate + O2 ⟶ (6S)-hydroxyhyoscyamine + CO2 + succinate - hyoscyamine and scopolamine biosynthesis:
(S)-atropinium + 2-oxoglutarate + O2 ⟶ (6S)-hydroxyhyoscyamine + CO2 + succinate - 6-methoxypodophyllotoxin biosynthesis:
(-)-yatein + 2-oxoglutarate + O2 ⟶ (-)-deoxypodophyllotoxin + CO2 + H2O + succinate - (-)-4'-demethyl-epipodophyllotoxin biosynthesis:
(-)-deoxypodophyllotoxin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (-)-4'-demethyl-deoxypodophyllotoxin + H2O + MeOH + an oxidized [NADPH-hemoprotein reductase] - morphine biosynthesis:
2-oxoglutarate + O2 + codeine ⟶ CO2 + formaldehyde + morphine + succinate - morphine biosynthesis:
2-oxoglutarate + O2 + codeine ⟶ CO2 + formaldehyde + morphine + succinate - TCA cycle V (2-oxoglutarate:ferredoxin oxidoreductase):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - mixed acid fermentation:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - TCA cycle V (2-oxoglutarate:ferredoxin oxidoreductase):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - isoleucine degradation I:
2-methylacetoacetyl-CoA + coenzyme A ⟶ acetyl-CoA + propanoyl-CoA - superpathway of threonine metabolism:
2-oxobutanoate + coenzyme A ⟶ formate + propanoyl-CoA - isoleucine biosynthesis I:
thr ⟶ 2-oxobutanoate + H+ + ammonia - isoleucine biosynthesis I (from threonine):
thr ⟶ 2-oxobutanoate + H+ + ammonia - superpathway of ornithine degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ γ-glutamyl-γ-aminobutyraldehyde + ammonium + hydrogen peroxide - putrescine degradation I:
2-oxoglutarate + putrescine ⟶ 4-aminobutanal + glt - superpathway of arginine and ornithine degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ γ-glutamyl-γ-aminobutyraldehyde + ammonium + hydrogen peroxide - superpathway of arginine, putrescine, and 4-aminobutyrate degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ γ-glutamyl-γ-aminobutyraldehyde + ammonium + hydrogen peroxide - phenylalanine degradation II (anaerobic):
glt + phenylpyruvate ⟶ 2-oxoglutarate + phe - L-carnitine biosynthesis:
γ-butyrobetaine + 2-oxoglutarate + O2 ⟶ CO2 + L-carnitine + succinate - γ-butyrobetaine degradation:
L-carnitine + NAD+ ⟶ 3-dehydrocarnitine + H+ + NADH - L-carnitine biosynthesis:
3-hydroxy-N6,N6,N6-trimethyl-L-lysine ⟶ 4-trimethylammoniobutanal + gly - L-carnitine biosynthesis:
γ-butyrobetaine + 2-oxoglutarate + O2 ⟶ CO2 + L-carnitine + succinate - L-carnitine biosynthesis:
γ-butyrobetaine + 2-oxoglutarate + O2 ⟶ CO2 + L-carnitine + succinate - γ-butyrobetaine degradation:
L-carnitine + NAD+ ⟶ 3-dehydrocarnitine + H+ + NADH - alanine biosynthesis II:
2-oxoglutarate + ala ⟶ glt + pyruvate - alanine degradation III:
2-oxoglutarate + ala ⟶ glt + pyruvate - alanine degradation III:
2-oxoglutarate + ala ⟶ glt + pyruvate - superpathway of alanine biosynthesis:
pyruvate + val ⟶ 2-oxoisovalerate + ala - alanine biosynthesis II:
2-oxoglutarate + ala ⟶ glt + pyruvate - superpathway of histidine, purine, and pyrimidine biosynthesis:
glt + imidazole acetol-phosphate ⟶ 2-oxoglutarate + L-histidinol-phosphate - histidine biosynthesis:
glt + imidazole acetol-phosphate ⟶ 2-oxoglutarate + L-histidinol-phosphate - aspartate superpathway:
ATP + ammonia + nicotinate adenine dinucleotide ⟶ AMP + H+ + NAD+ + diphosphate - superpathway of lysine, threonine and methionine biosynthesis I:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate - lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt - superpathway of sterol biosynthesis:
4-methyl-2-oxopentanoate + NAD+ + coenzyme A ⟶ CO2 + NADH + isovaleryl-CoA - leucine degradation I:
4-methyl-2-oxopentanoate + NAD+ + coenzyme A ⟶ CO2 + NADH + isovaleryl-CoA - leucine degradation I:
2-oxoglutarate + leu ⟶ 4-methyl-2-oxopentanoate + glt - 2,4-dichlorophenoxyacetate degradation:
2,4-dichlorophenoxyacetate + 2-oxoglutarate + O2 ⟶ 2,4-dichlorophenol + CO2 + glyoxylate + succinate - polymethylated quercetin glucoside biosynthesis II - quercetagetin series (Chrysosplenium):
3,6,7-trimethylquercetagetin + SAM ⟶ 3,6,7,4'-tetramethylquercetagetin + H+ + SAH - superpathway of polymethylated quercetin/quercetagetin glucoside biosynthesis (Chrysosplenium):
3,6,7-trimethylquercetagetin + SAM ⟶ 3,6,7,4'-tetramethylquercetagetin + H+ + SAH - superpathway of taurine degradation:
2-oxoglutarate + O2 + taurine ⟶ 2-aminoacetaldehyde + CO2 + H+ + succinate + sulfite - taurine degradation IV:
2-oxoglutarate + O2 + taurine ⟶ 2-aminoacetaldehyde + CO2 + H+ + succinate + sulfite - taurine degradation IV:
2-oxoglutarate + O2 + taurine ⟶ 2-aminoacetaldehyde + CO2 + H+ + succinate + sulfite - taurine degradation IV:
2-oxoglutarate + O2 + taurine ⟶ CO2 + H+ + aminoacetaldehyde + succinate + sulfite - taurine degradation IV:
2-oxoglutarate + O2 + taurine ⟶ CO2 + H+ + aminoacetaldehyde + succinate + sulfite - taurine degradation IV:
2-oxoglutarate + O2 + taurine ⟶ CO2 + H+ + aminoacetaldehyde + succinate + sulfite - L-cysteine degradation IV:
2-oxoglutarate + O2 + taurine ⟶ 2-aminoacetaldehyde + CO2 + H+ + succinate + sulfite - taurine degradation IV:
2-oxoglutarate + O2 + taurine ⟶ CO2 + H+ + aminoacetaldehyde + succinate + sulfite - taurine degradation IV:
2-oxoglutarate + O2 + taurine ⟶ CO2 + H+ + aminoacetaldehyde + succinate + sulfite - CMP-diacetamido-8-epilegionaminic acid biosynthesis:
5,7-diacetamido-3,5,7,9-tetradeoxy-L-glycero-D-galacto-non-2-ulosonate + CTP ⟶ CMP-5,7-diacetamido-3,5,7,9-tetradeoxy-L-glycero-D-galacto-non-2-ulosonate + diphosphate - arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate γ-semialdehyde + glt - arginine degradation I (arginase pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate γ-semialdehyde + glt - arginine degradation VII:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + NAD(P)H + ammonia - superpathway of serine and glycine biosynthesis I:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phospho-hydroxypyruvate + glt - serine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phospho-hydroxypyruvate + glt - tyrosine degradation II:
4-hydroxyphenylpyruvate + H+ + O2 ⟶ 4-hydroxyphenylacetate + CO2 + H2O - tyrosine degradation I:
2-oxoglutarate + tyr ⟶ 4-hydroxyphenylpyruvate + glt - superpathway of lysine, threonine and methionine biosynthesis II:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate - lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ H2O + H+ + glt + tetrahydrodipicolinate - arginine biosynthesis I:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - superpathway of arginine and polyamine biosynthesis:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - ornithine biosynthesis:
N-acetyl-L-ornithine + H2O ⟶ L-ornithine + acetate - superpathway of flavones and derivatives biosynthesis:
UDP-β-L-rhamnose + quercetin 3-O-sophoroside ⟶ H+ + UDP + quercetin 3-O-rhamnosyl(1->2)glucoside-7-O-rhamnoside - flavonoid biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ (+)-dihydrokaempferol + CO2 + succinate - flavonoid biosynthesis (in equisetum):
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonoid biosynthesis (in equisetum):
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ (+)-dihydrokaempferol + CO2 + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+ - flavonoid biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ (+)-dihydrokaempferol + CO2 + succinate - superpathway of 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutyrate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation I:
2-oxoglutarate + 4-aminobutyrate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutyrate ⟶ glt + succinate semialdehyde - 2-oxoglutarate decarboxylation to succinyl-CoA:
2-oxoglutarate + H+ + a [2-oxoglutarate dehydrogenase E2 protein] N6-lipoyl-L-lysine ⟶ CO2 + a [2-oxoglutarate dehydrogenase E2 protein] N6-S-succinyldihydrolipoyl-L-lysine - IAA biosynthesis I:
acetate + indole ⟶ H+ + indole-3-acetate - tryptophan degradation:
2-oxoglutarate + trp ⟶ glt + indole-3-pyruvate - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - hydroxylated mugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + 2-oxoglutarate + O2 ⟶ 3-epihydroxy-2'-deoxymugineate + CO2 + H+ + succinate - viridicatin biosynthesis:
(-)-cyclopenine ⟶ H+ + methyl isocyanate + viridicatin - polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
2-oxoglutarate + 3,7,4'-trimethylquercetin + O2 ⟶ 3,7,4'-trimethylquercetagetin + CO2 + succinate - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + pelargonidin + succinate - isoflavonoid biosynthesis II:
SAM + genistein ⟶ SAH + prunetin - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - superpathway of isoflavonoids (via naringenin):
SAM + genistein ⟶ SAH + prunetin - L-lysine biosynthesis II:
L-2-acetamido-6-oxoheptanedioate + glu ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate - L-lysine biosynthesis II:
L-2-acetamido-6-oxoheptanedioate + glu ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate - lysine biosynthesis II:
L-2-acetamido-6-oxoheptanedioate + glt ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate - lysine biosynthesis II:
L-2-acetamido-6-oxoheptanedioate + glt ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate - L-lysine biosynthesis II:
Glu + L-2-acetamido-6-oxoheptanedioate ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate - L-lysine biosynthesis II:
L-2-acetamido-6-oxoheptanedioate + glt ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate - L-lysine biosynthesis II:
Glu + L-2-acetamido-6-oxoheptanedioate ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate - L-lysine biosynthesis II:
Glu + L-2-acetamido-6-oxoheptanedioate ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate - 4'-methoxyviridicatin biosynthesis:
(-)-4'-methoxycyclopenine ⟶ 4'-methoxyviridicatin + H+ + methyl isocyanate - superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate - TCA cycle I (prokaryotic):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - mixed acid fermentation:
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate - superpathway of demethylmenaquinol-8 biosynthesis I:
4-(2'-carboxyphenyl)-4-oxobutyryl-CoA + H+ ⟶ 1,4-dihydroxy-2-naphthoyl-CoA + H2O - 2-carboxy-1,4-naphthoquinol biosynthesis:
4-(2'-carboxyphenyl)-4-oxobutyryl-CoA + H+ ⟶ 1,4-dihydroxy-2-naphthoyl-CoA + H2O - superpathway of menaquinol-8 biosynthesis I:
4-(2'-carboxyphenyl)-4-oxobutyryl-CoA + H+ ⟶ 1,4-dihydroxy-2-naphthoyl-CoA + H2O - superpathway of chorismate metabolism:
3-octaprenyl-4-hydroxybenzoate + H+ ⟶ 2-octaprenylphenol + CO2 - superpathway of phylloquinol biosynthesis:
SAM + demethylphylloquinol ⟶ H+ + SAH + phylloquinol - trans-4-hydroxy-L-proline degradation I:
Hyp + an electron-transfer quinone ⟶ (3R,5S)-3-hydroxy-1-pyrroline-5-carboxylate + H+ + an electron-transfer quinol - superpathway of glyoxylate bypass and TCA:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - 2-carboxy-1,4-naphthoquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - TCA cycle I (prokaryotic):
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - mixed acid fermentation:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde - superpathway of menaquinol-8 biosynthesis I:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2 - superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - superpathway of chorismate metabolism:
2-oxoglutarate + phe ⟶ 3-phenyl-2-oxopropanoate + glu - superpathway of glyoxylate bypass and TCA:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - luteolinidin 5-O-glucoside biosynthesis:
UDP-α-D-glucose + luteolinidin ⟶ H+ + UDP + luteolinidin 5-O-glucoside - stipitatate biosynthesis:
H2O + stipitatonate ⟶ CO2 + H+ + stipitatate - hyoscyamine and scopolamine biosynthesis:
2-oxoglutarate + L-hyoscyamine + O2 ⟶ (6S)-hydroxyhyoscyamine + CO2 + succinate - 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - GABA shunt:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - TCA cycle IV (2-oxoglutarate decarboxylase):
2-oxoglutarate + H+ ⟶ CO2 + succinate semialdehyde - nicotine degradation I (pyridine pathway):
2,6-dihydroxypyridine + H+ + NADH + O2 ⟶ 2,3,6-trihydroxypyridine + H2O + NAD+ - 4-aminobutanoate degradation III:
H2O + NAD(P)+ + succinate semialdehyde ⟶ H+ + NAD(P)H + succinate - 4-aminobutanoate degradation V:
acetate + butanoyl-CoA ⟶ acetyl-CoA + butanoate - 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - GABA shunt:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - superpathway of L-arginine, putrescine, and 4-aminobutanoate degradation:
H2O + agmatine ⟶ putrescine + urea - superpathway of L-arginine and L-ornithine degradation:
4-aminobutanal ⟶ 1-pyrroline + H2O - L-glutamate degradation IV:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - superpathway of L-arginine, putrescine, and 4-aminobutanoate degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ 4-(γ-L-glutamylamino)butanal + ammonium + hydrogen peroxide - superpathway of L-arginine and L-ornithine degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ 4-(γ-L-glutamylamino)butanal + ammonium + hydrogen peroxide - 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - glutamate degradation to succinate:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - L-glutamate degradation IV:
4-hydroxybutanoate + NAD(P)+ ⟶ H+ + NAD(P)H + succinate semialdehyde - 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - superpathway of 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - glutamate degradation IX (via 4-aminobutyrate):
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - TCA cycle variation I:
2-oxoglutarate + H+ ⟶ CO2 + succinate semialdehyde - 4-aminobutyrate degradation V:
H2O + NAD+ + glt ⟶ 2-oxoglutarate + H+ + NADH + ammonia - 4-aminobutanoate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - TCA cycle IV (2-oxoglutarate decarboxylase):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - GABA shunt:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - glutamate degradation IX (via 4-aminobutyrate):
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - superpathway of 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - glutamate degradation IX (via 4-aminobutyrate):
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - TCA cycle IV (2-oxoglutarate decarboxylase):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - 4-aminobutyrate degradation I:
2-oxoglutarate + 4-aminobutyrate ⟶ glt + succinate semialdehyde - glutamate degradation IV:
4-aminobutyrate + pyruvate ⟶ ala + succinate semialdehyde - glutamate degradation III (via 4-aminobutyrate):
2-oxoglutarate + 4-aminobutyrate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - superpathway of glycolysis and TCA variant VIII:
2-oxoglutarate + H+ ⟶ CO2 + succinate semialdehyde - superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - TCA cycle IV (2-oxoglutarate decarboxylase):
2-oxoglutarate + H+ ⟶ CO2 + succinate semialdehyde - 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutyrate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation I:
2-oxoglutarate + 4-aminobutyrate ⟶ glt + succinate semialdehyde - superpathway of 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutyrate ⟶ glt + succinate semialdehyde - glutamate degradation IV:
4-aminobutyrate + pyruvate ⟶ ala + succinate semialdehyde - TCA cycle IV (2-oxoglutarate decarboxylase):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - superpathway of arginine, putrescine, and 4-aminobutyrate degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ 4-(γ-glutamylamino)butanal + ammonium + hydrogen peroxide - superpathway of arginine and ornithine degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ 4-(γ-glutamylamino)butanal + ammonium + hydrogen peroxide - 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - superpathway of 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - superpathway of 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - superpathway of arginine, putrescine, and 4-aminobutyrate degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ 4-(γ-glutamylamino)butanal + ammonium + hydrogen peroxide - superpathway of arginine and ornithine degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ 4-(γ-glutamylamino)butanal + ammonium + hydrogen peroxide - TCA cycle variation I:
2-oxoglutarate + H+ ⟶ CO2 + succinate semialdehyde - 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutyrate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - glutamate degradation IX (via 4-aminobutyrate):
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation V:
H2O + NAD+ + glt ⟶ 2-oxoglutarate + H+ + NADH + ammonia - superpathway of 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutyrate degradation V:
H2O + NAD+ + glt ⟶ 2-oxoglutarate + H+ + NADH + ammonia - 4-aminobutanoate degradation V:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - 4-aminobutanoate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - 4-aminobutanoate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde - 4-aminobutanoate degradation V:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - 4-aminobutanoate degradation III:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde - UDP-yelosamine biosynthesis:
2-oxoglutarate + ATP + UDP-2-acetamido-4-amino-2,4,6-trideoxy-α-D-galactose ⟶ ADP + H+ + UDP-yelosamine + phosphate - glutamate degradation IX:
H2O + NAD+ + glt ⟶ 2-oxoglutarate + H+ + NADH + ammonia - superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate - TCA cycle:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - superpathway of glyoxylate bypass and TCA:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - alanine biosynthesis I:
pyruvate + val ⟶ 2-oxoisovalerate + ala - superpathway of central carbon metabolism:
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate - TCA cycle:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - superpathway of glycolysis, pyruvate dehydrogenase and TCA cycle:
ATP + H2O + pyruvate ⟶ AMP + H+ + phosphate + phosphoenolpyruvate - roseoflavin biosynthesis:
8-amino-8-demethylriboflavin + SAM ⟶ 8-demethyl-8-(methylamino)riboflavin + H+ + SAH - gentamicin biosynthesis:
O2 + geneticin + glu ⟶ 2-oxoglutarate + JI-20B + hydrogen peroxide - vindoline and vinblastine biosynthesis:
O2 + vinblastine ⟶ H+ + H2O + vincristine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation:
2-oxoglutaramate + H2O ⟶ 2-oxoglutarate + ammonium - methionine salvage cycle III:
S-methyl-5'-thioadenosine + phosphate ⟶ 5-MTR-1-P + adenine - ornithine de novo biosynthesis:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - glutamate biosynthesis/degradation:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - nitrate reduction VI (assimilatory):
H2O + an oxidized ferredoxin [iron-sulfur] cluster + nitrite ⟶ H+ + a reduced ferredoxin [iron-sulfur] cluster + nitrate - nitrate reduction V (assimilatory):
H2O + NADP+ + nitrite ⟶ H+ + NADPH + nitrate - methylaspartate cycle:
ATP + hydrogencarbonate + propanoyl-CoA ⟶ (S)-methylmalonyl-CoA + ADP + H+ + phosphate - partial TCA cycle (obligate autotrophs):
oxaloacetate + phosphate ⟶ hydrogencarbonate + phosphoenolpyruvate - L-glutamate and L-glutamine biosynthesis:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate - L-alanine degradation II (to D-lactate):
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine fermentation to propanoate and acetate:
(R)-lactate + propanoyl-CoA ⟶ (R)-lactoyl-CoA + propanoate - L-glutamate degradation V (via hydroxyglutarate):
acetate + butanoyl-CoA ⟶ acetyl-CoA + butanoate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
2-oxoglutaramate + H2O ⟶ 2-oxoglutarate + ammonium - kanamycin biosynthesis:
2-deoxy-L-scyllo-inosose + gln ⟶ 2-deoxy-scyllo-inosamine + 2-oxoglutaramate - L-histidine degradation VI:
4-imidazolone-5-propanoate + H2O + O2 ⟶ hydantoin-5-propanoate + hydrogen peroxide - L-methionine salvage cycle I (bacteria and plants):
dAdoMet + putrescine ⟶ S-methyl-5'-thioadenosine + H+ + spermidine - L-methionine salvage cycle III:
S-methyl-5'-thioadenosine + phosphate ⟶ 5-MTR-1-P + adenine - L-methionine salvage cycle II (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+ - L-glutamate biosynthesis III:
H2O + NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamate biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation X:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate biosynthesis III:
H2O + NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - glutamate biosynthesis from ammonia:
H2O + NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - glutamate degradation to 2-oxoglutarate:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate biosynthesis II:
Glu + H2O + NAD(P)+ ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-alanine degradation II (to D-lactate):
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate degradation I:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-ornithine biosynthesis II:
Glu + H2O + NAD(P)+ ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate biosynthesis III:
Glu + H2O + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation:
2-oxoglutaramate + H2O ⟶ 2-oxoglutarate + ammonium - L-glutamate biosynthesis III:
Glu + H2O + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - glutamate degradation X:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate biosynthesis III:
H2O + NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - glutamate degradation X:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - glutamate biosynthesis II:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamate biosynthesis II:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation X:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation I:
H2O + NAD+ + glt ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate and L-glutamine biosynthesis:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamate biosynthesis III:
H2O + NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate biosynthesis III:
H2O + NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation X:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-ornithine biosynthesis II:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glt - aspartate degradation:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - glutamate degradation:
H2O + NAD+ + glt ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
2-oxoglutaramate + H2O ⟶ 2-oxoglutarate + ammonium - L-glutamate biosynthesis II:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - proline biosynthesis II:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-ornithine biosynthesis II:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glt - L-glutamate degradation X:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate and L-glutamine biosynthesis:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation:
2-oxoglutaramate + H2O ⟶ 2-oxoglutarate + ammonium - nitrate reduction VI (assimilatory):
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamate biosynthesis III:
Glu + H2O + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamate degradation I:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ Glu + pyruvate - glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamate degradation I:
H2O + NAD+ + glt ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate degradation X:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate biosynthesis II:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamate degradation X:
Glu + H2O + NAD(P)+ ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation I:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate degradation V (via hydroxyglutarate):
(R)-2-hydroxyglutarate + NAD+ ⟶ 2-oxoglutarate + H+ + NADH - L-glutamate biosynthesis III:
Glu + H2O + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamate biosynthesis II:
Glu + H2O + NAD(P)+ ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation X:
Glu + H2O + NAD(P)+ ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation I:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate biosynthesis III:
Glu + H2O + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamate biosynthesis II:
Glu + H2O + NAD(P)+ ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation I:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate degradation X:
Glu + H2O + NAD(P)+ ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate biosynthesis II:
Glu + H2O + NAD(P)+ ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate biosynthesis III:
Glu + H2O + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamate biosynthesis III:
Glu + H2O + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamate biosynthesis II:
Glu + H2O + NAD(P)+ ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation I:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate degradation X:
Glu + H2O + NAD(P)+ ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamate biosynthesis III:
Glu + H2O + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - nitrate reduction V (assimilatory):
Glu + H2O + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ Glu + pyruvate - L-glutamate degradation I:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate degradation X:
Glu + H2O + NAD(P)+ ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation I:
Glu + H2O + NAD+ ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate biosynthesis II:
Glu + H2O + NAD(P)+ ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate biosynthesis III:
Glu + H2O + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - respiration (anaerobic):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - glutamate degradation:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + NAD(P)H + ammonia - respiration (anaerobic):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - staphyloferrin B biosynthesis:
3-phospho-L-serine + glu ⟶ N-[(2S)-2-amino-2-carboxyethyl]-L-glutamate + phosphate - dapdiamides biosynthesis:
N-3-fumaramoyl-L-2,3-diaminopropanoate + ATP + val ⟶ ADP + H+ + dapdiamide A + phosphate - staphyloferrin B biosynthesis:
2-[(L-alanin-3-ylcarbamoyl)methyl]-3-(2-aminoethylcarbamoyl)-2-hydroxypropanoate + 2-oxoglutarate + ATP ⟶ AMP + H+ + diphosphate + staphyloferrin B - L-lysine biosynthesis I:
N-succinyl-L,L-2,6-diaminopimelate + H2O ⟶ L,L-diaminopimelate + succinate - superpathway of L-lysine, L-threonine and L-methionine biosynthesis I:
ATP + L-homoserine ⟶ ADP + H+ + O-phospho-L-homoserine - aspartate superpathway:
ATP + L-homoserine ⟶ ADP + H+ + O-phospho-L-homoserine - superpathway of L-lysine, L-threonine and L-methionine biosynthesis I:
2-oxoglutarate + asp ⟶ glu + oxaloacetate - L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glu - aspartate superpathway:
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-lysine, L-threonine and L-methionine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + Glu - aspartate superpathway:
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + Glu - L-lysine biosynthesis I:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate - L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt - L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glu - superpathway of L-lysine, L-threonine and L-methionine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt - L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt - aspartate superpathway:
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-lysine biosynthesis I:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH - L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glu - aspartate superpathway:
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - superpathway of L-lysine, L-threonine and L-methionine biosynthesis I:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt - aspartate threonine lysine biosynthesis superpathway:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - superpathway of L-lysine, L-threonine and L-methionine biosynthesis I:
2-oxoglutarate + asp ⟶ glt + oxaloacetate - aspartate superpathway:
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide - L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt - L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + Glu - 12-epi-fischerindole biosynthesis:
D-ribulose 5-phosphate + trp ⟶ (2S)-3-(1H-indol-3-yl)-2-isocyanopropanoate + H+ + H2O + acetol + formaldehyde + phosphate - 4-chloro-2-methylphenoxyacetate degradation:
2-methyl-4-chlorophenol + H+ + NADPH + O2 ⟶ 5-chloro-3-methylcatechol + H2O + NADP+
WikiPathways(2)
- Krebs cycle disorders:
alpha-ketoglutarate ⟶ Succinyl coenzyme A - Metabolic reprogramming in colon cancer:
KG ⟶ S-CoA
Plant Reactome(1935)
- Metabolism and regulation:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA - PCO cycle:
Gly + NAD + THF ⟶ 5,10-methylene-THF + NADH + ammonia + carbon dioxide - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
H2O + indole-3-acetyl-ala ⟶ IAA + L-Ala - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Hormone signaling, transport, and metabolism:
H2O + indole-3-acetyl-ala ⟶ IAA + L-Ala - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Hormone signaling, transport, and metabolism:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate + Oxygen ⟶ CH3COO- + jasmonic acid - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - gibberellin biosynthesis I (late C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A15 - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pyridoxal 5'-phosphate biosynthesis:
Oxygen + PDXP ⟶ H2O2 + PXLP - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A12 ⟶ SUCCA + carbon dioxide + gibberellin A14 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Gibberellin biosynthesis II (early C-3 hydroxylation):
2OG + Oxygen + gibberellin A14 ⟶ SUCCA + carbon dioxide + gibberellin A37 - Secondary metabolism:
GPP + H2O ⟶ PPi + geraniol - Leucodelphinidin biosynthesis:
2OG + Oxygen + eriodictyol ⟶ (+)-taxifolin + SUCCA + carbon dioxide - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Gibberellin biosynthesis III (early C-13 hydroxylation):
2OG + Oxygen + gibberellin A53 ⟶ SUCCA + carbon dioxide + gibberellin A44 - Leucopelargonidin and leucocyanidin biosynthesis:
2OG + Oxygen + eriodictyol ⟶ (+)-taxifolin + SUCCA + carbon dioxide - Amino acid metabolism:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA - Amino acid biosynthesis:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA - Lysine biosynthesis I:
L-Glu + N-succinyl-2-amino-6-ketopimelate ⟶ 2OG + N-succinyl-L,L-2,6-diaminopimelate - IAA biosynthesis I:
H2O + indole-3-acetonitrile ⟶ IAA + ammonia - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + indole-3-acetonitrile ⟶ IAA + ammonia - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + indole-3-acetonitrile ⟶ IAA + ammonia - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + indole-3-acetonitrile ⟶ IAA + ammonia - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Hormone signaling, transport, and metabolism:
(-)-jasmonate + ATP + L-Ile ⟶ AMP + Jasmonyl-isoleucine + PPi(3-) - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + indole-3-acetonitrile ⟶ IAA + ammonia - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + indole-3-acetonitrile ⟶ IAA + ammonia - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + indole-3-acetonitrile ⟶ IAA + ammonia - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + indole-3-acetonitrile ⟶ IAA + ammonia - IAA biosynthesis I:
CH3COO- + indole ⟶ IAA - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + indole-3-acetonitrile ⟶ IAA + ammonia - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - IAA biosynthesis I:
H2O + Oxygen + tryptamine ⟶ H2O2 + ammonia + indole acetaldehyde - Inorganic nutrients metabolism:
Nitrite ⟶ H2O + ammonia - Response to iron deficiency:
2OG + nicotianamine ⟶ 3''-deamino-3''-oxonicotianamine + L-Glu - Mugineic acid biosynthesis:
2OG + nicotianamine ⟶ 3''-deamino-3''-oxonicotianamine + L-Glu - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
2OG + L-Asp ⟶ L-Glu + OA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
2OG + L-Asp ⟶ L-Glu + OA - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
2OG + L-Val ⟶ Glu + KIV - Asparagine degradation I:
2OG + L-Asp ⟶ L-Glu + OA - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
H2O + L-Asn ⟶ L-Asp + ammonia - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
2OG + L-Asp ⟶ L-Glu + OA - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
2OG + L-Asp ⟶ L-Glu + OA - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
2OG + L-Val ⟶ Glu + KIV - Asparagine degradation I:
2OG + L-Asp ⟶ L-Glu + OA - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
2OG + L-Val ⟶ Glu + KIV - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + KIV + NAD ⟶ ISB-CoA + NADH + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Aspartate biosynthesis I:
L-Glu + OA ⟶ 2OG + L-Asp - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Asparagine degradation I:
H2O + L-Asn ⟶ L-Asp + ammonia - Amino acid catabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Lysine degradation II:
H2O + NAD + allysine ⟶ NADH + alpha-aminoadipate - Histidine biosynthesis I:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
2OBUTA + PYR ⟶ 2-aceto-2-hydroxy-butyrate + carbon dioxide - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
2OBUTA + PYR ⟶ 2-aceto-2-hydroxy-butyrate + carbon dioxide - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia - Lysine biosynthesis II:
H2O + N-acetyl-L,L-2,6-diaminopimelate ⟶ CH3COO- + L,L-diaminopimelate - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
H2O + L-Arg ⟶ L-Cit + ammonia - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia - Proline biosynthesis V (from arginine):
2OG + L-Orn ⟶ L-Glu + L-Glu5S - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
L-Phe ⟶ ammonia + trans-cinnamate - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
UDP-Glc + pelargonidin ⟶ UDP + pelargonidin-3-O-beta-D-glucoside - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Anthocyanin biosynthesis (pelargonidin 3-O-glucoside, cyanidin 3-O-glucoside):
2OG + Oxygen + leucopelargonidin ⟶ H2O + SUCCA + carbon dioxide + pelargonidin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
2OG + Oxygen + naringenin ⟶ H2O + SUCCA + apigenin + carbon dioxide - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
2OG + Oxygen + naringenin ⟶ H2O + SUCCA + apigenin + carbon dioxide - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
2OG + Oxygen + naringenin ⟶ H2O + SUCCA + apigenin + carbon dioxide - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Secondary metabolism:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin - Lysine biosynthesis VI:
H2O + L-2,3,4,5-Tetrahydrodipicolinate + L-Glu ⟶ 2OG + LL-2,6-Diaminopimelate - Arginine biosynthesis I:
H2O + N-acetyl-L-ornithine ⟶ CH3COO- + L-Orn - Arginine biosynthesis II (acetyl cycle):
ATP + L-Asp + L-Cit ⟶ AMP + L-Argininosuccinate + PPi - Ornithine biosynthesis:
H2O + N-acetyl-L-ornithine ⟶ CH3COO- + L-Orn - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
2OG + Oxygen + naringenin ⟶ SUCCA + carbon dioxide + dihydrokaempferol - Flavonoid biosynthesis:
4-coumarate + ATP + CoA-SH ⟶ 4-coumaroyl-CoA + AMP + PPi - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Flavonoid biosynthesis:
4-coumaroyl-CoA + Mal-CoA + coumaroyl-CoA ⟶ CoA-SH + apigenin + carbon dioxide - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Anthocyanin biosynthesis (delphinidin 3-O-glucoside):
2OG + Oxygen + leucodelphinidin ⟶ H2O + SUCCA + carbon dioxide + delphinidin - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
L-Phe + PYR ⟶ L-Ala + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - Phenylalanine biosynthesis I:
L-Glu + phenylpyruvate ⟶ 2OG + L-Phe - Ehrlich pathway:
2OG + L-Phe ⟶ L-Glu + phenylpyruvate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - tyrosine degradation I:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
2OG + L-Tyr ⟶ HPPYRA + L-Glu - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - tyrosine degradation I:
4FAA + H2O ⟶ ACA + fumarate - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
KIV + L-Glu ⟶ 2OG + L-Val - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
KIV + L-Glu ⟶ 2OG + L-Val - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
KIV + L-Glu ⟶ 2OG + L-Val - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Valine degradation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Valine biosynthesis:
KIV + L-Glu ⟶ 2OG + L-Val - Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu - Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Glutamate synthase cycle:
Ac-CoA + H2O + OAA ⟶ CIT + CoA - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Inorganic nutrients metabolism:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate synthase cycle:
ATP + L-Glu + ammonia ⟶ ADP + L-Gln + Pi - Glutamate biosynthesis I:
2OG + H+ + L-Gln + TPNH ⟶ L-Glu + TPN - Cysteine degradation:
H2O + L-Cys ⟶ PYR + S(2-) + ammonia
INOH(0)
PlantCyc(2210)
- ethylene biosynthesis II (microbes):
2-oxoglutarate + O2 + arg ⟶ (3S)-3-hydroxy-L-arginine + CO2 + succinate - ethylene biosynthesis II (microbes):
2-oxoglutarate + O2 + arg ⟶ (3S)-3-hydroxy-L-arginine + CO2 + succinate - chrysin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + chrysin + succinate - pinobanksin biosynthesis:
(2S)-pinocembrin + SAM ⟶ SAH + pinostrobin - pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate - pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate - nevadensin biosynthesis:
2-oxoglutarate + O2 + gardenin B ⟶ CO2 + formaldehyde + nevadensin + succinate - apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A53 ⟶ CO2 + gibberellin44 (open lactone form) + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin44 (open lactone form) ⟶ CO2 + H2O + gibberellin A19 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin44 (open lactone form) ⟶ CO2 + H2O + gibberellin A19 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin44 (open lactone form) ⟶ CO2 + H2O + gibberellin A19 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - superpathway of gibberellin biosynthesis:
2-oxoglutarate + O2 + gibberellin A5 ⟶ CO2 + gibberellin A6 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin44 (open lactone form) ⟶ CO2 + H2O + gibberellin A19 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin44 (open lactone form) ⟶ CO2 + H2O + gibberellin A19 + succinate - superpathway of gibberellin biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin44 (open lactone form) ⟶ CO2 + H2O + gibberellin A19 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + H+ + O2 + gibberellin44 (open lactone form) ⟶ CO2 + H2O + gibberellin A38 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A53 ⟶ CO2 + gibberellin44 (open lactone form) + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin44 (open lactone form) ⟶ CO2 + H2O + gibberellin A19 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin44 (open lactone form) ⟶ CO2 + H2O + gibberellin A19 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin44 (open lactone form) ⟶ CO2 + H2O + gibberellin A19 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - superpathway of gibberellin biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + H+ + O2 + gibberellin44 (open lactone form) ⟶ CO2 + H2O + gibberellin A38 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - superpathway of gibberellin biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + O2 + gibberellin A15 (open lactone form) ⟶ CO2 + gibberellin A37 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A15 (open lactone form) ⟶ CO2 + H2O + gibberellin A24 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A12 ⟶ CO2 + gibberellin A15 (open lactone form) + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A15 (open lactone form) ⟶ CO2 + H2O + gibberellin A24 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A9 ⟶ CO2 + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A15 (open lactone form) ⟶ CO2 + H2O + gibberellin A24 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A15 (open lactone form) ⟶ CO2 + H2O + gibberellin A24 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A25 ⟶ CO2 + gibberellin A13 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A15 (open lactone form) ⟶ CO2 + H2O + gibberellin A24 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A9 ⟶ CO2 + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + O2 + gibberellin A15 (open lactone form) ⟶ CO2 + gibberellin A37 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A12 ⟶ CO2 + gibberellin A15 (open lactone form) + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A9 ⟶ CO2 + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A9 ⟶ CO2 + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + O2 + gibberellin A37 ⟶ CO2 + H2O + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A25 ⟶ CO2 + gibberellin A13 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + O2 + gibberellin A12 ⟶ CO2 + gibberellin A14 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + O2 + gibberellin A12 ⟶ CO2 + gibberellin A14 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A15 (open lactone form) ⟶ CO2 + H2O + gibberellin A24 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A12 ⟶ CO2 + gibberellin A15 (open lactone form) + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A15 (open lactone form) ⟶ CO2 + H2O + gibberellin A24 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A9 ⟶ CO2 + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A12 ⟶ CO2 + gibberellin A15 (open lactone form) + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A12 ⟶ CO2 + gibberellin A15 (open lactone form) + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + O2 + gibberellin A15 (open lactone form) ⟶ CO2 + gibberellin A37 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A9 ⟶ CO2 + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin inactivation I (2β-hydroxylation):
2-oxoglutarate + O2 + gibberellin A51 ⟶ CO2 + H+ + H2O + gibberellin A51-catabolite + succinate - gibberellin inactivation I (2β-hydroxylation):
2-oxoglutarate + H+ + O2 + gibberellin A44 (closed lactone form) ⟶ CO2 + gibberellin A98 + succinate - gibberellin inactivation I (2β-hydroxylation):
2-oxoglutarate + O2 + gibberellin A51 ⟶ CO2 + H+ + H2O + gibberellin A51-catabolite + succinate - gibberellin inactivation I (2β-hydroxylation):
2-oxoglutarate + O2 + gibberellin A53 ⟶ CO2 + gibberellin A97 + succinate - gibberellin inactivation I (2β-hydroxylation):
2-oxoglutarate + O2 + gibberellin A12 ⟶ CO2 + gibberellin A110 + succinate - gibberellin inactivation I (2β-hydroxylation):
2-oxoglutarate + O2 + gibberellin A34 ⟶ CO2 + H+ + H2O + gibberellin A34-catabolite + succinate - gibberellin inactivation I (2β-hydroxylation):
2-oxoglutarate + O2 + gibberellin A51 ⟶ CO2 + H+ + H2O + gibberellin A51-catabolite + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A15 (open lactone form) ⟶ CO2 + H2O + gibberellin A24 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A15 (open lactone form) ⟶ CO2 + H2O + gibberellin A24 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A9 ⟶ CO2 + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A9 ⟶ CO2 + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A9 ⟶ CO2 + gibberellin A4 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A25 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + H+ + gibberellin A9 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A24 ⟶ CO2 + gibberellin A36 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A15 (open lactone form) ⟶ CO2 + H2O + gibberellin A24 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A15 (open lactone form) ⟶ CO2 + H2O + gibberellin A24 + succinate - gibberellin biosynthesis I (non C-3, non C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A9 ⟶ CO2 + gibberellin A4 + succinate - morphine biosynthesis:
2-oxoglutarate + O2 + oripavine ⟶ CO2 + formaldehyde + morphinone + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate - luteolin biosynthesis:
(2S)-eriodictyol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + luteolin - flavonoid biosynthesis (in equisetum):
(2S)-eriodictyol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (2S)-dihydrotricetin + H2O + an oxidized [NADPH-hemoprotein reductase] - leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - luteolin biosynthesis:
(2S)-eriodictyol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + luteolin - flavonoid biosynthesis (in equisetum):
(2S)-naringenin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (2S)-eriodictyol + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - flavonoid biosynthesis (in equisetum):
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - luteolin biosynthesis:
(2S)-naringenin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (2S)-eriodictyol + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - luteolin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ CO2 + H2O + luteolin + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - flavonoid biosynthesis (in equisetum):
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - luteolin biosynthesis:
(2S)-eriodictyol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + luteolin - leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH - flavonol biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - flavonol biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - syringetin biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - superpathway of flavones and derivatives biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin - leucodelphinidin biosynthesis:
(2S)-eriodictyol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (2S)-dihydrotricetin + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - flavonol biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-taxifolin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + quercetin + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-taxifolin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + quercetin + succinate - flavonol biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - syringetin biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - flavonol biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - flavonol biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - flavonol biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - flavonol biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - flavonol biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - leucodelphinidin biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - syringetin biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - syringetin biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - syringetin biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - syringetin biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - syringetin biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - leucodelphinidin biosynthesis:
(2S)-eriodictyol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (2S)-dihydrotricetin + H2O + an oxidized [NADPH-hemoprotein reductase] - syringetin biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - superpathway of flavones and derivatives biosynthesis:
PAPS + isorhamnetin ⟶ 3',5'-ADP + H+ + isorhamnetin 3-sulfate - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - syringetin biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - syringetin biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - syringetin biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - superpathway of flavones and derivatives biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin - syringetin biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - leucodelphinidin biosynthesis:
(2S)-eriodictyol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (2S)-dihydrotricetin + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - 6-methoxypodophyllotoxin biosynthesis:
(-)-yatein + 2-oxoglutarate + O2 ⟶ (-)-deoxypodophyllotoxin + CO2 + H2O + succinate - (-)-4'-demethyl-epipodophyllotoxin biosynthesis:
(-)-deoxypodophyllotoxin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (-)-4'-demethyl-deoxypodophyllotoxin + H2O + MeOH + an oxidized [NADPH-hemoprotein reductase] - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate - apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate - apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate - apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate - apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH - gibberellin biosynthesis V:
2-oxoglutarate + O2 + gibberellin A5 ⟶ CO2 + gibberellin A6 + succinate - gibberellin biosynthesis V:
2-oxoglutarate + O2 + gibberellin A5 ⟶ CO2 + gibberellin A6 + succinate - gibberellin biosynthesis V:
2-oxoglutarate + O2 + gibberellin A5 ⟶ CO2 + gibberellin A3 + succinate - gibberellin biosynthesis V:
2-oxoglutarate + O2 + gibberellin A5 ⟶ CO2 + gibberellin A3 + succinate - gibberellin biosynthesis V:
2-oxoglutarate + O2 + gibberellin A5 ⟶ CO2 + gibberellin A3 + succinate - L-carnitine biosynthesis:
γ-butyrobetaine + 2-oxoglutarate + O2 ⟶ CO2 + L-carnitine + succinate - L-carnitine biosynthesis:
γ-butyrobetaine + 2-oxoglutarate + O2 ⟶ CO2 + L-carnitine + succinate - L-carnitine biosynthesis:
γ-butyrobetaine + 2-oxoglutarate + O2 ⟶ CO2 + L-carnitine + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + O2 + gibberellin A12 ⟶ CO2 + gibberellin A14 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + O2 + gibberellin A12 ⟶ CO2 + gibberellin A14 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate - L-lysine degradation I:
5-aminopentanal + H2O + NAD+ ⟶ 5-aminopentanoate + H+ + NADH - L-lysine degradation I:
2-oxoglutarate + cadaverine ⟶ 5-aminopentanal + D-or-L-glutamate - polymethylated quercetin glucoside biosynthesis II - quercetagetin series (Chrysosplenium):
3,6,7-trimethylquercetagetin + SAM ⟶ 3,6,7,4'-tetramethylquercetagetin + H+ + SAH - superpathway of polymethylated quercetin/quercetagetin glucoside biosynthesis (Chrysosplenium):
3,6,7-trimethylquercetagetin + SAM ⟶ 3,6,7,4'-tetramethylquercetagetin + H+ + SAH - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - superpathway of benzoxazinoid glucosides biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH - superpathway of benzoxazinoid glucosides biosynthesis:
DIBOA + UDP-α-D-glucose ⟶ DIBOA-Glc + UDP - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH - DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH - superpathway of benzoxazinoid glucosides biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH - DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH - superpathway of benzoxazinoid glucosides biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - superpathway of benzoxazinoid glucosides biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH - DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH - superpathway of benzoxazinoid glucosides biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole - DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate - superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one - DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH - DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonol biosynthesis:
(+)-taxifolin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + quercetin + succinate - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonol biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonol biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonol biosynthesis:
(+)-taxifolin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + quercetin + succinate - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - superpathway of flavones and derivatives biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+ - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-dihydromyricetin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ (+)-dihydrokaempferol + CO2 + succinate - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + NADPH + malonyl-CoA ⟶ CO2 + H2O + NADP+ + coenzyme A + isoliquiritigenin - flavonol biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + NADPH + malonyl-CoA ⟶ CO2 + H2O + NADP+ + coenzyme A + isoliquiritigenin - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - hydroxylated mugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + 2-oxoglutarate + O2 ⟶ CO2 + H+ + mugineate + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A17 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A20 ⟶ CO2 + gibberellin A1 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - gibberellin biosynthesis III (early C-13 hydroxylation):
2-oxoglutarate + O2 + gibberellin A19 ⟶ CO2 + H+ + gibberellin A20 + succinate - polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
3,7,4'-trimethylquercetin + H+ + NADPH + O2 ⟶ 2'-hydroxy 3,7,4'-trimethylquercetin + H2O + NADP+ - polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
3,7,4'-trimethylquercetin + H+ + NADPH + O2 ⟶ 2'-hydroxy 3,7,4'-trimethylquercetin + H2O + NADP+ - polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
3,7,4'-trimethylquercetin + H+ + NADPH + O2 ⟶ 2'-hydroxy 3,7,4'-trimethylquercetin + H2O + NADP+ - polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
2'-hydroxy 3,7,4'-trimethylquercetin + SAM ⟶ 2'-hydroxy 3,7,3',4'-tetramethylquercetin + H+ + SAH - polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
3,7,4'-trimethylquercetin + H+ + NADPH + O2 ⟶ 2'-hydroxy 3,7,4'-trimethylquercetin + H2O + NADP+ - polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
2'-hydroxy 3,7,4'-trimethylquercetin + SAM ⟶ 2'-hydroxy 3,7,3',4'-tetramethylquercetin + H+ + SAH - polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
2'-hydroxy 3,7,4'-trimethylquercetin + UDP-α-D-glucose ⟶ 3,7,4'-trimethylquercetin 2'-O-β-D-glucoside + H+ + UDP - polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
2'-hydroxy 3,7,4'-trimethylquercetin + SAM ⟶ 2'-hydroxy 3,7,3',4'-tetramethylquercetin + H+ + SAH - polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
2'-hydroxy 3,7,4'-trimethylquercetin + SAM ⟶ 2'-hydroxy 3,7,3',4'-tetramethylquercetin + H+ + SAH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - proanthocyanidins biosynthesis from flavanols:
UDP-α-D-glucose + a (2R,3R)-flavan-3-ol ⟶ H+ + UDP + a (2R,3R)-flavan-3-ol-3'-O-glucoside - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - anthocyanin biosynthesis (delphinidin 3-O-glucoside):
(2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + delphinidin + succinate - proanthocyanidins biosynthesis from flavanols:
UDP-α-D-glucose + a (2R,3R)-flavan-3-ol ⟶ H+ + UDP + a (2R,3R)-flavan-3-ol-3'-O-glucoside - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
UDP-α-D-glucose + a (2R,3R)-flavan-3-ol ⟶ H+ + UDP + a (2R,3R)-flavan-3-ol-3'-O-glucoside - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ CO2 + H2O + luteolin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - superpathway of isoflavonoids (via naringenin):
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H+ + H2O + an oxidized [NADPH-hemoprotein reductase] + apigenin - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - isoflavonoid biosynthesis II:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - isoflavonoid biosynthesis II:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - superpathway of isoflavonoids (via naringenin):
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - isoflavonoid biosynthesis II:
(2S)-naringenin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + an oxidized [NADPH-hemoprotein reductase] - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H+ + H2O + an oxidized [NADPH-hemoprotein reductase] + apigenin - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - isoflavonoid biosynthesis II:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - isoflavonoid biosynthesis II:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H+ + H2O + an oxidized [NADPH-hemoprotein reductase] + apigenin - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+ - isoflavonoid biosynthesis II:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H+ + H2O + an oxidized [NADPH-hemoprotein reductase] + apigenin - superpathway of isoflavonoids (via naringenin):
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - isoflavonoid biosynthesis II:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+ - luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin - isoflavonoid biosynthesis II:
(2S)-naringenin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + an oxidized [NADPH-hemoprotein reductase] - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate - isoflavonoid biosynthesis II:
2,4',5,7-tetrahydroxyisoflavanone + SAM ⟶ 2,5,7-trihydroxy-4'-methoxyisoflavanone + H+ + SAH - isoflavonoid biosynthesis II:
SAM + genistein ⟶ SAH + prunetin - proanthocyanidins biosynthesis from flavanols:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
NAD(P)+ + a (2R,3R)-flavan-3-ol ⟶ H+ + NAD(P)H + an anthocyanidin with a 3-hydroxy group - anthocyanin biosynthesis:
UDP-α-D-glucose + an anthocyanidin with a 3-hydroxy group ⟶ H+ + UDP + an anthocyanidin-3-O-β-D-glucoside - 1,4-dihydroxy-2-naphthoate biosynthesis II (plants):
2-succinylbenzoate + ATP + coenzyme A ⟶ 4-(2'-carboxyphenyl)-4-oxobutyryl-CoA + ADP + phosphate - superpathway of phylloquinol biosynthesis:
SAM + demethylphylloquinol ⟶ H+ + SAH + phylloquinol - 2-carboxy-1,4-naphthoquinol biosynthesis:
4-(2'-carboxyphenyl)-4-oxobutyryl-CoA + H+ ⟶ 1,4-dihydroxy-2-naphthoyl-CoA + H2O - hyoscyamine and scopolamine biosynthesis:
(6S)-hydroxyhyoscyamine + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + scopolamine + succinate - superpathway of hyoscyamine and scopolamine biosynthesis:
N-methylputrescine + H2O + O2 ⟶ N-methylaminobutanal + ammonium + hydrogen peroxide - hyoscyamine and scopolamine biosynthesis:
NADP+ + tropine ⟶ H+ + NADPH + tropinone - superpathway of hyoscyamine and scopolamine biosynthesis:
N-methylputrescine + H2O + O2 ⟶ N-methylaminobutanal + ammonium + hydrogen peroxide - hyoscyamine and scopolamine biosynthesis:
NADP+ + tropine ⟶ H+ + NADPH + tropinone - superpathway of hyoscyamine and scopolamine biosynthesis:
N-methylputrescine + H2O + O2 ⟶ N-methylaminobutanal + ammonium + hydrogen peroxide - hyoscyamine and scopolamine biosynthesis:
(S)-atropine + 2-oxoglutarate + O2 ⟶ (6S)-hydroxyhyoscyamine + CO2 + succinate - superpathway of hyoscyamine and scopolamine biosynthesis:
N-methylputrescine + H2O + O2 ⟶ N-methylaminobutanal + ammonium + hydrogen peroxide - superpathway of hyoscyamine and scopolamine biosynthesis:
NADP+ + tropine ⟶ H+ + NADPH + tropinone - hyoscyamine and scopolamine biosynthesis:
NADP+ + tropine ⟶ H+ + NADPH + tropinone - hyoscyamine and scopolamine biosynthesis:
(S)-atropine + 2-oxoglutarate + O2 ⟶ (6S)-hydroxyhyoscyamine + CO2 + succinate - superpathway of hyoscyamine and scopolamine biosynthesis:
N-methylputrescine + H2O + O2 ⟶ N-methylaminobutanal + ammonium + hydrogen peroxide - hyoscyamine and scopolamine biosynthesis:
(S)-atropine + 2-oxoglutarate + O2 ⟶ (6S)-hydroxyhyoscyamine + CO2 + succinate - superpathway of hyoscyamine and scopolamine biosynthesis:
N-methylputrescine + H2O + O2 ⟶ N-methylaminobutanal + ammonium + hydrogen peroxide - hyoscyamine and scopolamine biosynthesis:
(S)-atropine + 2-oxoglutarate + O2 ⟶ (6S)-hydroxyhyoscyamine + CO2 + succinate - superpathway of hyoscyamine and scopolamine biosynthesis:
N-methylputrescine + H2O + O2 ⟶ N-methylaminobutanal + ammonium + hydrogen peroxide - hyoscyamine and scopolamine biosynthesis:
NADP+ + tropine ⟶ H+ + NADPH + tropinone - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH - syringetin biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - syringetin biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
UDP-α-D-glucose + pelargonidin ⟶ H+ + UDP + pelargonidin-3-O-β-D-glucoside - proanthocyanidins biosynthesis from flavanols:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
UDP-α-D-glucose + pelargonidin ⟶ H+ + UDP + pelargonidin-3-O-β-D-glucoside - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
(2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + O2 ⟶ (4S)-2,3-dehydroleucopelargonidin + CO2 + H+ + H2O + succinate - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - anthocyanin biosynthesis (pelargonidin 3-O-glucoside):
UDP-α-D-glucose + pelargonidin ⟶ H+ + UDP + pelargonidin-3-O-β-D-glucoside - proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - GABA shunt II:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - GABA shunt II:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - GABA shunt II:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - GABA shunt II:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - GABA shunt II:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - 4-aminobutanoate degradation I:
H2O + NAD+ + succinate semialdehyde ⟶ H+ + NADH + succinate - vindoline, vindorosine and vinblastine biosynthesis:
catharanthine + hydrogen peroxide + vindoline ⟶ α-3',4'-anhydrovinblastine radical + H2O - vindoline, vindorosine and vinblastine biosynthesis:
catharanthine + hydrogen peroxide + vindoline ⟶ α-3',4'-anhydrovinblastine radical + H2O - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
2-oxoglutaramate + H2O ⟶ 2-oxoglutarate + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
2-oxoglutaramate + H2O ⟶ 2-oxoglutarate + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
2-oxoglutaramate + H2O ⟶ 2-oxoglutarate + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
2-oxoglutaramate + H2O ⟶ 2-oxoglutarate + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
2-oxoglutaramate + H2O ⟶ 2-oxoglutarate + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate biosynthesis III:
H2O + NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
2-oxoglutaramate + H2O ⟶ 2-oxoglutarate + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
2-oxoglutaramate + H2O ⟶ 2-oxoglutarate + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
2-oxoglutaramate + H2O ⟶ 2-oxoglutarate + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
2-oxoglutaramate + H2O ⟶ 2-oxoglutarate + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
2-oxoglutaramate + H2O ⟶ 2-oxoglutarate + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
2-oxoglutaramate + H2O ⟶ 2-oxoglutarate + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
2-oxoglutaramate + H2O ⟶ 2-oxoglutarate + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
2-oxoglutaramate + H2O ⟶ 2-oxoglutarate + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
2-oxoglutaramate + H2O ⟶ 2-oxoglutarate + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
2-oxoglutaramate + H2O ⟶ 2-oxoglutarate + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
2-oxoglutaramate + H2O ⟶ 2-oxoglutarate + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
2-oxoglutaramate + H2O ⟶ 2-oxoglutarate + ammonium - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
2-oxoglutaramate + H2O ⟶ 2-oxoglutarate + ammonium - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
2-oxoglutaramate + H2O ⟶ 2-oxoglutarate + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
2-oxoglutaramate + H2O ⟶ 2-oxoglutarate + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
2-oxoglutaramate + H2O ⟶ 2-oxoglutarate + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
2-oxoglutaramate + H2O ⟶ 2-oxoglutarate + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
2-oxoglutaramate + H2O ⟶ 2-oxoglutarate + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate biosynthesis III:
H2O + NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate biosynthesis III:
H2O + NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-methionine salvage cycle II (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+ - L-methionine salvage cycle I (bacteria and plants):
dAdoMet + putrescine ⟶ S-methyl-5'-thioadenosine + H+ + spermidine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-alanine degradation II (to D-lactate):
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-glutamate biosynthesis III:
H2O + NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + ammonium - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
(R)-lactate + NAD+ ⟶ H+ + NADH + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
(R)-lactate + NAD+ ⟶ H+ + NADH + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
(R)-lactate + NAD+ ⟶ H+ + NADH + pyruvate - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
(R)-lactate + NAD+ ⟶ H+ + NADH + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
(R)-lactate + NAD+ ⟶ H+ + NADH + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-alanine degradation II (to D-lactate):
(R)-lactate + NAD+ ⟶ H+ + NADH + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
(R)-lactate + NAD+ ⟶ H+ + NADH + pyruvate - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-methionine salvage cycle II (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+ - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-alanine degradation II (to D-lactate):
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one + O2 ⟶ 4-(methylsulfanyl)-2-oxobutanoate + H+ + formate - L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH - L-alanine degradation II (to D-lactate):
2-oxoglutarate + ala ⟶ glu + pyruvate - L-methionine salvage cycle I (bacteria and plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-methionine salvage cycle II (plants):
4-(methylsulfanyl)-2-oxobutanoate + gln ⟶ 2-oxoglutaramate + met - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
4-(methylsulfanyl)-2-oxobutanoate + gln ⟶ 2-oxoglutaramate + met - L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium - L-alanine degradation II (to D-lactate):
(R)-lactate + NAD+ ⟶ H+ + NADH + pyruvate - L-glutamate degradation I:
H2O + NAD+ + glu ⟶ 2-oxoglutarate + H+ + NADH + ammonium - L-methionine salvage cycle I (bacteria and plants):
4-(methylsulfanyl)-2-oxobutanoate + gln ⟶ 2-oxoglutaramate + met - L-methionine salvage cycle II (plants):
4-(methylsulfanyl)-2-oxobutanoate + gln ⟶ 2-oxoglutaramate + met - L-methionine salvage cycle I (bacteria and plants):
4-(methylsulfanyl)-2-oxobutanoate + gln ⟶ 2-oxoglutaramate + met - L-methionine salvage cycle II (plants):
4-(methylsulfanyl)-2-oxobutanoate + gln ⟶ 2-oxoglutaramate + met - L-methionine salvage cycle I (bacteria and plants):
4-(methylsulfanyl)-2-oxobutanoate + gln ⟶ 2-oxoglutaramate + met - S-methyl-5-thio-α-D-ribose 1-phosphate degradation I:
4-(methylsulfanyl)-2-oxobutanoate + gln ⟶ 2-oxoglutaramate + met - L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glu
COVID-19 Disease Map(0)
PathBank(0)
PharmGKB(0)
0 个相关的物种来源信息
在这里通过桑基图来展示出与当前的这个代谢物在我们的BioDeep知识库中具有相关联信息的其他代谢物。在这里进行关联的信息来源主要有：
- PubMed: 来源于PubMed文献库中的文献信息，我们通过自然语言数据挖掘得到的在同一篇文献中被同时提及的相关代谢物列表，这个列表按照代谢物同时出现的文献数量降序排序，取前10个代谢物作为相关研究中关联性很高的代谢物集合展示在桑基图中。
- NCBI Taxonomy: 通过文献数据挖掘，得到的代谢物物种来源信息关联。这个关联信息同样按照出现的次数降序排序，取前10个代谢物作为高关联度的代谢物集合展示在桑吉图上。
- Chemical Taxonomy: 在物质分类上处于同一个分类集合中的其他代谢物
- Chemical Reaction: 在化学反应过程中，存在为当前代谢物相关联的生化反应过程中的反应底物或者反应产物的关联代谢物信息。
点击图上的相关代谢物的名称，可以跳转到相关代谢物的信息页面。
文献列表
- Tingting Lv, Xiude Fan, Chang He, Suwei Zhu, Xiaofeng Xiong, Wei Yan, Mei Liu, Hongwei Xu, Ruihua Shi, Qin He. SLC7A11-ROS/αKG-AMPK axis regulates liver inflammation through mitophagy and impairs liver fibrosis and NASH progression.
Redox biology.
2024 Jun; 72(?):103159. doi:
10.1016/j.redox.2024.103159. [PMID: 38642501] - Kristina Žuna, Tatyana Tyschuk, Taraneh Beikbaghban, Felix Sternberg, Jürgen Kreiter, Elena E Pohl. The 2-oxoglutarate/malate carrier extends the family of mitochondrial carriers capable of fatty acid and 2,4-dinitrophenol-activated proton transport.
Acta physiologica (Oxford, England).
2024 Jun; 240(6):e14143. doi:
10.1111/apha.14143. [PMID: 38577966] - Qiming Tang, Yuhui Huang, Xiaoxiang Ni, Ming-Ju Amy Lyu, Genyun Chen, Rowan Sage, Xin-Guang Zhu. Increased α-ketoglutarate links the C3-C4 intermediate state to C4 photosynthesis in the genus Flaveria.
Plant physiology.
2024 Apr; 195(1):291-305. doi:
10.1093/plphys/kiae077. [PMID: 38377473] - Zhao Cui, Caifeng Li, Wei Liu, Mo Sun, Shiwen Deng, Junxian Cao, Hongjun Yang, Peng Chen. Scutellarin activates IDH1 to exert antitumor effects in hepatocellular carcinoma progression.
Cell death & disease.
2024 Apr; 15(4):267. doi:
10.1038/s41419-024-06625-6. [PMID: 38622131] - Ying Zhang, Chun-Yan Sang, Xing-Rong Wang, Cheng-Bo Wang, Xian-Hua Meng, Wei-Feng Wang, Jun-Li Yang. Rapid evaluation of PHD2 inhibitory activity of natural products based on capillary electrophoresis online stacking strategy.
Journal of chromatography. B, Analytical technologies in the biomedical and life sciences.
2024 Apr; 1236(?):124064. doi:
10.1016/j.jchromb.2024.124064. [PMID: 38430605] - Qing-Hua Qian, Ya-Ping Song, Yu Zhang, Hao Xue, Wei-Wei Zhang, Yapeng Han, Yán Wāng, De-Xiang Xu. Gestational α-ketoglutarate supplementation ameliorates arsenic-induced hepatic lipid deposition via epigenetic reprogramming of β-oxidation process in female offspring.
Environment international.
2024 Mar; 185(?):108488. doi:
10.1016/j.envint.2024.108488. [PMID: 38359550] - Hao Yu, Daojing Gan, Zhen Luo, Qilin Yang, Dongqi An, Hao Zhang, Yingchun Hu, Zhuang Ma, Qingchun Zeng, Dingli Xu, Hao Ren. α-Ketoglutarate improves cardiac insufficiency through NAD+-SIRT1 signaling-mediated mitophagy and ferroptosis in pressure overload-induced mice.
Molecular medicine (Cambridge, Mass.).
2024 Jan; 30(1):15. doi:
10.1186/s10020-024-00783-1. [PMID: 38254035] - San Kim, Se Hyeon Jang, Min Jeong Kim, Jeong Jae Lee, Kyung-Min Kim, Young Hoon Kim, Ju-Hoon Lee, Sung Keun Jung. Hybrid nutraceutical of 2-ketoglutaric acid in improving inflammatory bowel disease: Role of prebiotics and TAK1 inhibitor.
Biomedicine & pharmacotherapy = Biomedecine & pharmacotherapie.
2024 Jan; 171(?):116126. doi:
10.1016/j.biopha.2024.116126. [PMID: 38219386] - Zhen-Ye Luo, Yin-Xia Hu, Chuan-Wei Qiu, Wei-Cong Chen, Li Li, Fei-Long Chen, Chang-Shun Liu. Coptidis Rhizoma processed with Evodia Rutaecarpa improves the effect on ulcerative colitis by increasing intestinal energy metabolites alpha-ketoglutarate and Lactobacillus reuteri.
Phytomedicine : international journal of phytotherapy and phytopharmacology.
2023 Dec; 121(?):155115. doi:
10.1016/j.phymed.2023.155115. [PMID: 37801896] - Theo Lange, Nadiem Atiq, Maria João Pimenta Lange. GAS2 encodes a 2-oxoglutarate dependent dioxygenase involved in ABA catabolism.
Nature communications.
2023 Nov; 14(1):7602. doi:
10.1038/s41467-023-43187-1. [PMID: 37990018] - Oleh Demianchuk, Myroslava Vatashchuk, Dmytro Gospodaryov, Viktoria Hurza, Marian Ivanochko, Vitalii Derkachov, Vladyslav Berezovkyi, Oleh Lushchak, Kenneth B Storey, Maria Bayliak, Volodymyr I Lushchak. High-fat high-fructose diet and alpha-ketoglutarate affect mouse behavior that is accompanied by changes in oxidative stress response and energy metabolism in the cerebral cortex.
Biochimica et biophysica acta. General subjects.
2023 Nov; ?(?):130521. doi:
10.1016/j.bbagen.2023.130521. [PMID: 37967727] - Stephen M G Duff, Meiying Zhang, Fred Zinnel, Timothy Rydel, Christina M Taylor, Danqi Chen, Gregory Tilton, Patricia Mamanella, David Duda, Yanfei Wang, Bosong Xiang, Balasulojini Karunanandaa, Rita Varagona, Jaishree Chittoor, Qungang Qi, Erin Hall, Graeme Garvey, Jiamin Zeng, Jun Zhang, Xin Li, Tommi White, Agoston Jerga, Jeff Haas. Structural and functional characterization of triketone dioxygenase from Oryza Sativa.
Biochimica et biophysica acta. General subjects.
2023 Nov; ?(?):130504. doi:
10.1016/j.bbagen.2023.130504. [PMID: 37967728] - Melanie N Hurst, Connor J Beebout, Alexis Hollingsworth, Kirsten R Guckes, Alexandria Purcell, Tomas A Bermudez, Diamond Williams, Seth A Reasoner, M Stephen Trent, Maria Hadjifrangiskou. The QseB response regulator imparts tolerance to positively charged antibiotics by controlling metabolism and minor changes to LPS.
mSphere.
2023 10; 8(5):e0005923. doi:
10.1128/msphere.00059-23. [PMID: 37676915] - Zuliang Zhou, Jianhua Zhao, Clement R de Cruz, Hong Xu, Liansheng Wang, Qiyou Xu. Alpha-ketoglutaric acid mitigates the detrimental effects of soy antigenic protein on the intestinal health and growth performance of Mirror carp Cyprinus carpio.
Fish physiology and biochemistry.
2023 Oct; 49(5):951-965. doi:
10.1007/s10695-023-01234-0. [PMID: 37665506] - Samiksha Saxena, Gaurav Pal, Ashutosh Pandey. Functional characterization of 2-oxoglutarate-dependent dioxygenase gene family in chickpea.
Plant science : an international journal of experimental plant biology.
2023 Aug; ?(?):111836. doi:
10.1016/j.plantsci.2023.111836. [PMID: 37619866] - Gang Li, Ziwen Gong, Nawaraj Dulal, Margarita Marroquin-Guzman, Raquel O Rocha, Michael Richter, Richard A Wilson. A protein kinase coordinates cycles of autophagy and glutaminolysis in invasive hyphae of the fungus Magnaporthe oryzae within rice cells.
Nature communications.
2023 07; 14(1):4146. doi:
10.1038/s41467-023-39880-w. [PMID: 37438395] - Akiyoshi Yoda, Xiaonan Xie, Kaori Yoneyama, Kenji Miura, Christopher S P McErlean, Takahito Nomura. A Stereoselective Strigolactone Biosynthesis Catalyzed by a 2-Oxoglutarate-Dependent Dioxygenase in Sorghum.
Plant & cell physiology.
2023 Jun; ?(?):. doi:
10.1093/pcp/pcad060. [PMID: 37307421] - Zhijia Gai, Maoming Zhang, Pengfei Zhang, Jingtao Zhang, Jingqi Liu, Lijun Cai, Xu Yang, Na Zhang, Zhengnan Yan, Lei Liu, Guozhong Feng. 2-Oxoglutarate contributes to the effect of foliar nitrogen on enhancing drought tolerance during flowering and grain yield of soybean.
Scientific reports.
2023 May; 13(1):7274. doi:
10.1038/s41598-023-34403-5. [PMID: 37142711] - Ruojing Liu, Yi Gao, Li Huang, Bing Shi, Xing Yin, Shujuan Zou. Alpha-ketoglutarate up-regulates autophagic activity in peri-implant environment and enhances dental implant osseointegration in osteoporotic mice.
Journal of clinical periodontology.
2023 05; 50(5):671-683. doi:
10.1111/jcpe.13784. [PMID: 36734077] - Angelika Janaszkiewicz, Ágota Tóth, Quentin Faucher, Hélène Arnion, Nicolas Védrenne, Chantal Barin-Le Guellec, Pierre Marquet, Florent Di Meo. Substrate binding and lipid-mediated allostery in the human organic anion transporter 1 at the atomic-scale.
Biomedicine & pharmacotherapy = Biomedecine & pharmacotherapie.
2023 Feb; 160(?):114342. doi:
10.1016/j.biopha.2023.114342. [PMID: 36739760] - Athena Papadopoulou, Fabian Meyer, Rebecca M Buller. Engineering Fe(II)/α-Ketoglutarate-Dependent Halogenases and Desaturases.
Biochemistry.
2023 01; 62(2):229-240. doi:
10.1021/acs.biochem.2c00115. [PMID: 35446547] - Hanny Chauhan, Aiana, Kashmir Singh. Genome-wide identification of 2-oxoglutarate and Fe (II)-dependent dioxygenase family genes and their expression profiling under drought and salt stress in potato.
PeerJ.
2023; 11(?):e16449. doi:
10.7717/peerj.16449. [PMID: 38025721] - Maria M Bayliak, Myroslava V Vatashchuk, Dmytro V Gospodaryov, Viktoria V Hurza, Oleh I Demianchuk, Marian V Ivanochko, Nadia I Burdyliuk, Kenneth B Storey, Oleh Lushchak, Volodymyr I Lushchak. High fat high fructose diet induces mild oxidative stress and reorganizes intermediary metabolism in male mouse liver: Alpha-ketoglutarate effects.
Biochimica et biophysica acta. General subjects.
2022 12; 1866(12):130226. doi:
10.1016/j.bbagen.2022.130226. [PMID: 35987369] - Qing-Qi Chang, Long Chen, Ya-Fang Liao, Chun-Lu Yuan, Dan-Dan Zhang. [Mechanism of timosaponin AⅢ in regulation of metabolism against glioblastoma growth].
Zhongguo Zhong yao za zhi = Zhongguo zhongyao zazhi = China journal of Chinese materia medica.
2022 Dec; 47(24):6679-6686. doi:
10.19540/j.cnki.cjcmm.20220728.401. [PMID: 36604918] - Haotian Liu, Yong Xie, Xia Wang, Martine I Abboud, Chao Ma, Wei Ge, Christopher J Schofield. Exploring links between 2-oxoglutarate-dependent oxygenases and Alzheimer's disease.
Alzheimer's & dementia : the journal of the Alzheimer's Association.
2022 12; 18(12):2637-2668. doi:
10.1002/alz.12733. [PMID: 35852137] - Shao-Liang Yang, Hai-Xia Tan, Zhen-Zhen Lai, Hai-Yan Peng, Hui-Li Yang, Qiang Fu, Hai-Yan Wang, Da-Jin Li, Ming-Qing Li. An active glutamine/α-ketoglutarate/HIF-1α axis prevents pregnancy loss by triggering decidual IGF1+GDF15+NK cell differentiation.
Cellular and molecular life sciences : CMLS.
2022 Nov; 79(12):611. doi:
10.1007/s00018-022-04639-x. [PMID: 36449080] - Shuhan Lei, Bingru Huang. Metabolic regulation of α-Ketoglutarate associated with heat tolerance in perennial ryegrass.
Plant physiology and biochemistry : PPB.
2022 Nov; 190(?):164-173. doi:
10.1016/j.plaphy.2022.09.005. [PMID: 36116225] - Zhi-Rong Lin, Zhen-Zhen Li, Yan-Jun Cao, Wen-Jing Yu, Jian-Tao Ye, Pei-Qing Liu. GDH promotes isoprenaline-induced cardiac hypertrophy by activating mTOR signaling via elevation of α-ketoglutarate level.
Naunyn-Schmiedeberg's archives of pharmacology.
2022 11; 395(11):1373-1385. doi:
10.1007/s00210-022-02252-0. [PMID: 35904584] - Daniel Gonzalez Izundegui, Patricia E Miller, Ravi V Shah, Clary B Clish, Maura E Walker, Gary F Mitchell, Robert E Gerszten, Martin G Larson, Ramachandran S Vasan, Matthew Nayor. Response of circulating metabolites to an oral glucose challenge and risk of cardiovascular disease and mortality in the community.
Cardiovascular diabetology.
2022 10; 21(1):213. doi:
10.1186/s12933-022-01647-w. [PMID: 36243866] - Xuewen Zhu, Yaolei Mi, Xiangxiao Meng, Yiming Zhang, Weiqiang Chen, Xue Cao, Huihua Wan, Wei Yang, Jun Li, Sifan Wang, Zhichao Xu, Atia Tul Wahab, Shilin Chen, Wei Sun. Genome-wide identification of key enzyme-encoding genes and the catalytic roles of two 2-oxoglutarate-dependent dioxygenase involved in flavonoid biosynthesis in Cannabis sativa L.
Microbial cell factories.
2022 Oct; 21(1):215. doi:
10.1186/s12934-022-01933-y. [PMID: 36243861] - Yong Cai, Zhiyi Dong, Jiying Wang. Circ_0000808 promotes the development of non-small cell lung cancer by regulating glutamine metabolism via the miR-1827/SLC1A5 axis.
World journal of surgical oncology.
2022 Oct; 20(1):329. doi:
10.1186/s12957-022-02777-x. [PMID: 36192755] - Michael H Kramer, Qiang Zhang, Robert Sprung, Ryan B Day, Petra Erdmann-Gilmore, Yang Li, Ziheng Xu, Nichole M Helton, Daniel R George, Yiling Mi, Peter Westervelt, Jacqueline E Payton, Sai M Ramakrishnan, Christopher A Miller, Daniel C Link, John F DiPersio, Matthew J Walter, R Reid Townsend, Timothy J Ley. Proteomic and phosphoproteomic landscapes of acute myeloid leukemia.
Blood.
2022 09; 140(13):1533-1548. doi:
10.1182/blood.2022016033. [PMID: 35895896] - Sawako Suzuki, Divya Venkatesh, Hiroaki Kanda, Akitoshi Nakayama, Hiroyuki Hosokawa, Eunyoung Lee, Takashi Miki, Brent R Stockwell, Koutaro Yokote, Tomoaki Tanaka, Carol Prives. GLS2 Is a Tumor Suppressor and a Regulator of Ferroptosis in Hepatocellular Carcinoma.
Cancer research.
2022 Sep; 82(18):3209-3222. doi:
10.1158/0008-5472.can-21-3914. [PMID: 35895807] - Zalina I Iskhakova, Darya E Zhuravleva, Christopher Heim, Marcus D Hartmann, Aleksandr V Laykov, Karl Forchhammer, Airat R Kayumov. PotN represents a novel energy-state sensing PII subfamily, occurring in firmicutes.
The FEBS journal.
2022 09; 289(17):5305-5321. doi:
10.1111/febs.16431. [PMID: 35285159] - Zhijia Gai, Jingqi Liu, Lijun Cai, Jingtao Zhang, Lei Liu. Foliar application of alpha-ketoglutarate plus nitrogen improves drought resistance in soybean (Glycine max L. Merr.).
Scientific reports.
2022 08; 12(1):14421. doi:
10.1038/s41598-022-18660-4. [PMID: 36002532] - Prashant D Sonawane, Adam Jozwiak, Ranjit Barbole, Sayantan Panda, Bekele Abebie, Yana Kazachkova, Sachin A Gharat, Ofir Ramot, Tamar Unger, Guy Wizler, Sagit Meir, Ilana Rogachev, Adi Doron-Faigenboim, Marina Petreikov, Arthur Schaffer, Ashok P Giri, Tali Scherf, Asaph Aharoni. 2-oxoglutarate-dependent dioxygenases drive expansion of steroidal alkaloid structural diversity in the genus Solanum.
The New phytologist.
2022 05; 234(4):1394-1410. doi:
10.1111/nph.18064. [PMID: 35238413] - James T Tambong, Renlin Xu, Diane Cuppels, Julie Chapados, Suzanne Gerdis, Jackson Eyres, Adam Koziol, Jeremy Dettman. Analysis of Draft Genome Resources of Thirty-Three Canadian Strains of Pseudomonas syringae pv. tomato Isolated Between 1992 and 2008 Reveals Achromobactin Virulence Cluster that Is Absent in the Reference Strain DC3000.
Phytopathology.
2022 04; 112(4):968-972. doi:
10.1094/phyto-08-21-0353-a. [PMID: 34543057] - Lian Wu, Zhanfeng Wang, Yixin Cen, Binju Wang, Jiahai Zhou. Structural Insight into the Catalytic Mechanism of the Endoperoxide Synthase FtmOx1.
Angewandte Chemie (International ed. in English).
2022 03; 61(12):e202112063. doi:
10.1002/anie.202112063. [PMID: 34796596] - Stefan Pierzynowski, Kateryna Pierzynowska. Alpha-ketoglutarate, a key molecule involved in nitrogen circulation in both animals and plants, in the context of human gut microbiota and protein metabolism.
Advances in medical sciences.
2022 Mar; 67(1):142-147. doi:
10.1016/j.advms.2022.02.004. [PMID: 35245838] - Adewale S Adebayo, Marius Roman, Mustafa Zakkar, Syabira Yusoff, Melanie Gulston, Lathishia Joel-David, Bony Anthony, Florence Y Lai, Antonio Murgia, Bryony Eagle-Hemming, Sophia Sheikh, Tracy Kumar, Hardeep Aujla, Will Dott, Julian L Griffin, Gavin J Murphy, Marcin J Woźniak. Gene and metabolite expression dependence on body mass index in human myocardium.
Scientific reports.
2022 01; 12(1):1425. doi:
10.1038/s41598-022-05562-8. [PMID: 35082386] - Divya Subburaj, Bernard Ng, Amina Kariminia, Sayeh Abdossamadi, Madeline Lauener, Eneida R Nemecek, Jacob Rozmus, Sandhya Kharbanda, Carrie L Kitko, Victor A Lewis, Tal Schechter-Finklestein, David A Jacobsohn, Andrew C Harris, Michael A Pulsipher, Henrique Bittencourt, Sung Won Choi, Emi H Caywood, Kimberly A Kasow, Monica Bhatia, Benjamin R Oshrine, Donald Coulter, Joseph H Chewning, Michael Joyce, Anna B Pawlowska, Gail C Megason, Anita Lawitschka, Elena Ostroumov, Ramon Klein Geltink, Geoffrey D E Cuvelier, Kirk R Schultz. Metabolomic identification of α-ketoglutaric acid elevation in pediatric chronic graft-versus-host disease.
Blood.
2022 01; 139(2):287-299. doi:
10.1182/blood.2021013244. [PMID: 34534280] - Elena Sendino Garví, Rosalinde Masereeuw, Manoe J Janssen. Bioengineered Cystinotic Kidney Tubules Recapitulate a Nephropathic Phenotype.
Cells.
2022 01; 11(1):. doi:
10.3390/cells11010177. [PMID: 35011739] - Monica Hoang, Emelien Jentz, Sarah M Janssen, Daniela Nasteska, Federica Cuozzo, David J Hodson, A Russell Tupling, Guo-Hua Fong, Jamie W Joseph. Isoform-specific Roles of Prolyl Hydroxylases in the Regulation of Pancreatic β-Cell Function.
Endocrinology.
2022 01; 163(1):. doi:
10.1210/endocr/bqab226. [PMID: 34718519] - Jenifer Masip, Norma Rallón, Elena Yeregui, Montserrat Olona, Salvador Resino, José M Benito, Consuelo Viladés, Graciano García-Pardo, José Alcamí, Ezequiel Ruiz-Mateos, Frederic Gómez-Bertomeu, Montserrat Vargas, Marta Navarro, José A Oteo, Juan A Pineda, Anna Martí, Verónica Alba, Francesc Vidal, Joaquin Peraire, Anna Rull. Elevated α-Ketoglutaric Acid Concentrations and a Lipid-Balanced Signature Are the Key Factors in Long-Term HIV Control.
Frontiers in immunology.
2022; 13(?):822272. doi:
10.3389/fimmu.2022.822272. [PMID: 35514981] - Ahmet Hatipoglu, Deepak Menon, Talia Levy, Maria A Frias, David A Foster. Inhibiting glutamine utilization creates a synthetic lethality for suppression of ATP citrate lyase in KRas-driven cancer cells.
PloS one.
2022; 17(10):e0276579. doi:
10.1371/journal.pone.0276579. [PMID: 36269753] - Chiranjiv Pradhan, Uzma Soharwardi, Namitha Dileep, Nikhila Peter, Rachel Fernandez, Sweta Das, Amitha Kurian, Preetham Elumalai. Suitable ratio of dietary L-carnitine and α-ketoglutarate improves growth and health performance in Nile tilapia, Oreochromis niloticus.
Fish physiology and biochemistry.
2021 Dec; 47(6):1933-1950. doi:
10.1007/s10695-021-01020-w. [PMID: 34628555] - Maria I Matias, Carmen S Yong, Amir Foroushani, Chloe Goldsmith, Cédric Mongellaz, Erdinc Sezgin, Kandice R Levental, Ali Talebi, Julie Perrault, Anais Rivière, Jonas Dehairs, Océane Delos, Justine Bertand-Michel, Jean-Charles Portais, Madeline Wong, Julien C Marie, Ameeta Kelekar, Sandrina Kinet, Valérie S Zimmermann, Ilya Levental, Laurent Yvan-Charvet, Johannes V Swinnen, Stefan A Muljo, Hector Hernandez-Vargas, Saverio Tardito, Naomi Taylor, Valérie Dardalhon. Regulatory T cell differentiation is controlled by αKG-induced alterations in mitochondrial metabolism and lipid homeostasis.
Cell reports.
2021 11; 37(5):109911. doi:
10.1016/j.celrep.2021.109911. [PMID: 34731632] - Nishith M Shrimali, Sakshi Agarwal, Simrandeep Kaur, Sulagna Bhattacharya, Sankar Bhattacharyya, Josef T Prchal, Prasenjit Guchhait. α-Ketoglutarate Inhibits Thrombosis and Inflammation by Prolyl Hydroxylase-2 Mediated Inactivation of Phospho-Akt.
EBioMedicine.
2021 Nov; 73(?):103672. doi:
10.1016/j.ebiom.2021.103672. [PMID: 34740102] - Jialiang Shao, Tiezhu Shi, Hua Yu, Yufeng Ding, Liping Li, Xiang Wang, Xiongjun Wang. Cytosolic GDH1 degradation restricts protein synthesis to sustain tumor cell survival following amino acid deprivation.
The EMBO journal.
2021 10; 40(20):e107480. doi:
10.15252/embj.2020107480. [PMID: 34269483] - Lalita Mehra, Aditi Bhattacharya, Harish Rawat, Amit Kumar, Abhinav Jaimini, Gaurav Mittal. In-vitro and in-vivo functional observation studies to establish therapeutic potential of alpha-ketoglutarate against methotrexate induced liver injury.
Biomedical journal.
2021 10; 44(5):611-619. doi:
10.1016/j.bj.2020.05.012. [PMID: 34736875] - Wenjun Li, Bin Yang, Jiangyu Xu, Liling Peng, Shan Sun, Zhibo Huang, Xiuhua Jiang, Yongqi He, Zhoufei Wang. A genome-wide association study reveals that the 2-oxoglutarate/malate translocator mediates seed vigor in rice.
The Plant journal : for cell and molecular biology.
2021 10; 108(2):478-491. doi:
10.1111/tpj.15455. [PMID: 34376020] - Yue Chen, Nelamangala V Nagaraja, Bin Fan, Luke Utley, Rene M Lemieux, Janeta Popovici-Muller, Lenny Dang, Hyeryun Kim, Liping Yan, Shin-San M Su, Scott A Biller, Hua Yang. Preclinical Drug Metabolism, Pharmacokinetic, and Pharmacodynamic Profiles of Ivosidenib, an Inhibitor of Mutant Isocitrate Dehydrogenase 1 for Treatment of Isocitrate Dehydrogenase 1-Mutant Malignancies.
Drug metabolism and disposition: the biological fate of chemicals.
2021 10; 49(10):870-881. doi:
10.1124/dmd.120.000234. [PMID: 34321251] - Naijie Feng, Minglong Yu, Yao Li, Dan Jin, Dianfeng Zheng. Prohexadione-calcium alleviates saline-alkali stress in soybean seedlings by improving the photosynthesis and up-regulating antioxidant defense.
Ecotoxicology and environmental safety.
2021 Sep; 220(?):112369. doi:
10.1016/j.ecoenv.2021.112369. [PMID: 34090109] - Saud Alamri, Qasi D Alsubaie, Abdullah A Al-Amri, Bandar Al-Munqedi, Hayssam M Ali, Bishwajit K Kushwaha, Vijay P Singh, Manzer H Siddiqui. Priming of tomato seedlings with 2-oxoglutarate induces arsenic toxicity alleviatory responses by involving endogenous nitric oxide.
Physiologia plantarum.
2021 Sep; 173(1):45-57. doi:
10.1111/ppl.13168. [PMID: 32656764] - Jia-Yuan Zhang, Bo Zhou, Ru-Yue Sun, Yuan-Li Ai, Kang Cheng, Fu-Nan Li, Bao-Rui Wang, Fan-Jian Liu, Zhi-Hong Jiang, Wei-Jia Wang, Dawang Zhou, Hang-Zi Chen, Qiao Wu. The metabolite α-KG induces GSDMC-dependent pyroptosis through death receptor 6-activated caspase-8.
Cell research.
2021 09; 31(9):980-997. doi:
10.1038/s41422-021-00506-9. [PMID: 34012073] - Jie Zheng, Hao Xiao, Yehui Duan, Bo Song, Changbing Zheng, Qiuping Guo, Fengna Li, Tiejun Li. Roles of amino acid derivatives in the regulation of obesity.
Food & function.
2021 Jul; 12(14):6214-6225. doi:
10.1039/d1fo00780g. [PMID: 34105579] - Fengzhu Ling, Xin Tang, Hao Zhang, Yong Q Chen, Jianxin Zhao, Haiqin Chen, Wei Chen. Role of the mitochondrial citrate-oxoglutarate carrier in lipid accumulation in the oleaginous fungus Mortierella alpina.
Biotechnology letters.
2021 Jul; 43(7):1455-1466. doi:
10.1007/s10529-021-03133-x. [PMID: 33907945] - Wan-Qiu Peng, Gang Xiao, Bai-Yu Li, Ying-Ying Guo, Liang Guo, Qi-Qun Tang. l-Theanine Activates the Browning of White Adipose Tissue Through the AMPK/α-Ketoglutarate/Prdm16 Axis and Ameliorates Diet-Induced Obesity in Mice.
Diabetes.
2021 07; 70(7):1458-1472. doi:
10.2337/db20-1210. [PMID: 33863801] - Ryota Akiyama, Bunta Watanabe, Masaru Nakayasu, Hyoung Jae Lee, Junpei Kato, Naoyuki Umemoto, Toshiya Muranaka, Kazuki Saito, Yukihiro Sugimoto, Masaharu Mizutani. The biosynthetic pathway of potato solanidanes diverged from that of spirosolanes due to evolution of a dioxygenase.
Nature communications.
2021 02; 12(1):1300. doi:
10.1038/s41467-021-21546-0. [PMID: 33637735] - Shuo Wei, Wen Zhang, Rao Fu, Yang Zhang. Genome-wide characterization of 2-oxoglutarate and Fe(II)-dependent dioxygenase family genes in tomato during growth cycle and their roles in metabolism.
BMC genomics.
2021 Feb; 22(1):126. doi:
10.1186/s12864-021-07434-3. [PMID: 33602133] - Daichi Watanabe, Ikuo Takahashi, Naiyanate Jaroensanti-Tanaka, Sho Miyazaki, Kai Jiang, Masaru Nakayasu, Masato Wada, Tadao Asami, Masaharu Mizutani, Kazuma Okada, Masatoshi Nakajima. The apple gene responsible for columnar tree shape reduces the abundance of biologically active gibberellin.
The Plant journal : for cell and molecular biology.
2021 02; 105(4):1026-1034. doi:
10.1111/tpj.15084. [PMID: 33211343] - Shirin Zamani-Nour, Hsiang-Chun Lin, Berkley J Walker, Tabea Mettler-Altmann, Roxana Khoshravesh, Shanta Karki, Efren Bagunu, Tammy L Sage, W Paul Quick, Andreas P M Weber. Overexpression of the chloroplastic 2-oxoglutarate/malate transporter disturbs carbon and nitrogen homeostasis in rice.
Journal of experimental botany.
2021 01; 72(1):137-152. doi:
10.1093/jxb/eraa343. [PMID: 32710115] - Chunxia Ge, Changxiao Tang, Yu-Xiu Zhu, Guan-Feng Wang. Genome-wide identification of the maize 2OGD superfamily genes and their response to Fusarium verticillioides and Fusarium graminearum.
Gene.
2021 Jan; 764(?):145078. doi:
10.1016/j.gene.2020.145078. [PMID: 32858175] - Elisabet Rodríguez-Tomàs, Meritxell Arenas, Junior Gómez, Johana Acosta, Jordi Trilla, Yolanda López, Miguel Árquez, Laura Torres, Pablo Araguas, Anna Hernández-Aguilera, Gerard Baiges-Gaya, Helena Castañé, Jordi Camps, Jorge Joven. Identification of potential metabolic biomarkers of rectal cancer and of the effect of neoadjuvant radiochemotherapy.
PloS one.
2021; 16(4):e0250453. doi:
10.1371/journal.pone.0250453. [PMID: 33886674] - Samantha J Wong, Alison E Ringel, William Yuan, Joao A Paulo, Haejin Yoon, Mark A Currie, Marcia C Haigis. Development of a colorimetric α-ketoglutarate detection assay for prolyl hydroxylase domain (PHD) proteins.
The Journal of biological chemistry.
2021 Jan; 296(?):100397. doi:
10.1016/j.jbc.2021.100397. [PMID: 33571527] - Xingjun Meng, Bo Zhu, Yan Liu, Lei Fang, Binbin Yin, Yanni Sun, Mengni Ma, Yuli Huang, Yuning Zhu, Yunlong Zhang. Unique Biomarker Characteristics in Gestational Diabetes Mellitus Identified by LC-MS-Based Metabolic Profiling.
Journal of diabetes research.
2021; 2021(?):6689414. doi:
10.1155/2021/6689414. [PMID: 34212051] - Leonie Drews, Marcel Zimmermann, Philipp Westhoff, Dominik Brilhaus, Rebecca E Poss, Laura Bergmann, Constanze Wiek, Peter Brenneisen, Roland P Piekorz, Tabea Mettler-Altmann, Andreas P M Weber, Andreas S Reichert. Ammonia inhibits energy metabolism in astrocytes in a rapid and glutamate dehydrogenase 2-dependent manner.
Disease models & mechanisms.
2020 11; 13(10):. doi:
10.1242/dmm.047134. [PMID: 32917661] - Martin Kery, Ioanna Papandreou. Emerging strategies to target cancer metabolism and improve radiation therapy outcomes.
The British journal of radiology.
2020 Nov; 93(1115):20200067. doi:
10.1259/bjr.20200067. [PMID: 32462882] - Priscilla Biswas, Cinzia Dellanoce, Alessandra Vezzoli, Simona Mrakic-Sposta, Mauro Malnati, Alberto Beretta, Roberto Accinni. Antioxidant Activity with Increased Endogenous Levels of Vitamin C, E and A Following Dietary Supplementation with a Combination of Glutathione and Resveratrol Precursors.
Nutrients.
2020 Oct; 12(11):. doi:
10.3390/nu12113224. [PMID: 33105552] - Zhijia Gai, Lei Liu, Jingtao Zhang, Jingqi Liu, Lijun Cai. Effects of exogenous α-oxoglutarate on proline accumulation, ammonium assimilation and photosynthesis of soybean seedling (Glycine max(L.) Merr.) exposed to cold stress.
Scientific reports.
2020 10; 10(1):17017. doi:
10.1038/s41598-020-74094-w. [PMID: 33046814] - Dongxiao Li, Jinqing Song, Xiyuan Li, Yi Liu, Hui Dong, Lulu Kang, Yupeng Liu, Yao Zhang, Ying Jin, Hanzhou Guan, Chongchen Zhou, Yanling Yang. Eleven novel mutations and clinical characteristics in seven Chinese patients with thiamine metabolism dysfunction syndrome.
European journal of medical genetics.
2020 Oct; 63(10):104003. doi:
10.1016/j.ejmg.2020.104003. [PMID: 32679198] - Stuart R Green, Kenneth B Storey. Regulation of the α-ketoglutarate dehydrogenasecomplex during hibernation in a small mammal, the Richardson's ground squirrel (Urocitellus richardsonii).
Biochimica et biophysica acta. Proteins and proteomics.
2020 09; 1868(9):140448. doi:
10.1016/j.bbapap.2020.140448. [PMID: 32445798] - Lalita Mehra, Harish Rawat, Abhinav Jaimini, Amit Tyagi, Gaurav Mittal. Alpha-ketoglutarate mediated hepatoprotection against alcohol induced toxicity: in vivo functional observation studies in Sprague Dawley rats using gamma scintigraphy.
Drug and chemical toxicology.
2020 Sep; 43(5):546-551. doi:
10.1080/01480545.2018.1559183. [PMID: 31094237] - Khaled A Selim, Elena Ermilova, Karl Forchhammer. From cyanobacteria to Archaeplastida: new evolutionary insights into PII signalling in the plant kingdom.
The New phytologist.
2020 08; 227(3):722-731. doi:
10.1111/nph.16492. [PMID: 32077495] - Priya Rani, Gunjan Gautam, Tamanna Anwar, Samudrala Gourinath, Asis Datta. Crystal structure of Gig2 protein from Candida albicans provides a structural insight into DUF1479 family oxygenases.
International journal of biological macromolecules.
2020 May; 150(?):1272-1280. doi:
10.1016/j.ijbiomac.2019.10.138. [PMID: 31743702] - Colin Y Kim, Andrew J Mitchell, Christopher M Glinkerman, Fu-Shuang Li, Tomáš Pluskal, Jing-Ke Weng. The chloroalkaloid (-)-acutumine is biosynthesized via a Fe(II)- and 2-oxoglutarate-dependent halogenase in Menispermaceae plants.
Nature communications.
2020 04; 11(1):1867. doi:
10.1038/s41467-020-15777-w. [PMID: 32313070] - Yexian Yuan, Pingwen Xu, Qingyan Jiang, Xingcai Cai, Tao Wang, Wentong Peng, Jiajie Sun, Canjun Zhu, Cha Zhang, Dong Yue, Zhihui He, Jinping Yang, Yuxian Zeng, Man Du, Fenglin Zhang, Lucas Ibrahimi, Sarah Schaul, Yuwei Jiang, Jiqiu Wang, Jia Sun, Qiaoping Wang, Liming Liu, Songbo Wang, Lina Wang, Xiaotong Zhu, Ping Gao, Qianyun Xi, Cong Yin, Fan Li, Guli Xu, Yongliang Zhang, Gang Shu. Exercise-induced α-ketoglutaric acid stimulates muscle hypertrophy and fat loss through OXGR1-dependent adrenal activation.
The EMBO journal.
2020 04; 39(7):e103304. doi:
10.15252/embj.2019103304. [PMID: 32104923] - Adriano Alves Stefanello, Marco Aurélio Schuler de Oliveira, Emanuel Maltempi Souza, Fábio Oliveira Pedrosa, Leda Satie Chubatsu, Luciano Fernandes Huergo, Ray Dixon, Rose Adele Monteiro. Regulation of Herbaspirillum seropedicae NifA by the GlnK PII signal transduction protein is mediated by effectors binding to allosteric sites.
Biochimica et biophysica acta. Proteins and proteomics.
2020 03; 1868(3):140348. doi:
10.1016/j.bbapap.2019.140348. [PMID: 31866507] - Qian Jiang, Tolulope Oluwadamilare Adebowale, Junquan Tian, Yulong Yin, Kang Yao. Effects of dietary alpha-ketoglutarate on bacteria profiles in the faeces of lactating sows and their suckling piglets.
Archives of animal nutrition.
2020 Feb; 74(1):39-56. doi:
10.1080/1745039x.2019.1639443. [PMID: 31552757] - Norihiro Isogai, Yuta Shiono, Tetsuya Kuramoto, Kenji Yoshioka, Hiroko Ishihama, Haruki Funao, Masaya Nakamura, Morio Matsumoto, Ken Ishii. Potential osteomyelitis biomarkers identified by plasma metabolome analysis in mice.
Scientific reports.
2020 01; 10(1):839. doi:
10.1038/s41598-020-57619-1. [PMID: 31964942] - Qiyu Tian, Junxing Zhao, Qiyuan Yang, Bo Wang, Jeanene M Deavila, Mei-Jun Zhu, Min Du. Dietary alpha-ketoglutarate promotes beige adipogenesis and prevents obesity in middle-aged mice.
Aging cell.
2020 01; 19(1):e13059. doi:
10.1111/acel.13059. [PMID: 31691468] - Lei Zhao, Haolu Guo, Hui Sun. Effects of low-protein diet supplementation with alpha-ketoglutarate on growth performance, nitrogen metabolism and mTOR signalling pathway of skeletal muscle in piglets.
Journal of animal physiology and animal nutrition.
2020 Jan; 104(1):300-309. doi:
10.1111/jpn.13230. [PMID: 31674084] - Asaad M Mahmood, Jim M Dunwell. 2-oxoglutarate-dependent dioxygenases: A renaissance in attention for ascorbic acid in plants.
PloS one.
2020; 15(12):e0242833. doi:
10.1371/journal.pone.0242833. [PMID: 33290424] - Qian Jiang, Tolulope Oluwadamilare Adebowale, Junquan Tian, Yulong Yin, Kang Yao. Effects of maternal alpha-ketoglutarate supplementation during lactation on the performance of lactating sows and suckling piglets.
Archives of animal nutrition.
2019 Dec; 73(6):457-471. doi:
10.1080/1745039x.2019.1640023. [PMID: 31454268] - Pablo D Cárdenas, Prashant D Sonawane, Uwe Heinig, Adam Jozwiak, Sayantan Panda, Bekele Abebie, Yana Kazachkova, Margarita Pliner, Tamar Unger, Dalia Wolf, Itai Ofner, Ester Vilaprinyo, Sagit Meir, Olga Davydov, Amit Gal-On, Saul Burdman, Ashok Giri, Dani Zamir, Tali Scherf, Jedrzej Szymanski, Ilana Rogachev, Asaph Aharoni. Pathways to defense metabolites and evading fruit bitterness in genus Solanum evolved through 2-oxoglutarate-dependent dioxygenases.
Nature communications.
2019 11; 10(1):5169. doi:
10.1038/s41467-019-13211-4. [PMID: 31727889] - Yifeng Zhang, Ping Su, Xiaoyi Wu, Jiawei Zhou, Yujun Zhao, Tianyuan Hu, Yuru Tong, Luqi Huang, Wei Gao. The gibberellin 13-oxidase that specifically converts gibberellin A9 to A20 in Tripterygium wilfordii is a 2-oxoglutarate-dependent dioxygenase.
Planta.
2019 Nov; 250(5):1613-1620. doi:
10.1007/s00425-019-03240-0. [PMID: 31388830] - Marta Sena-Vélez, Sean D Holland, Manu Aggarwal, Nick G Cogan, Mukesh Jain, Dean W Gabriel, Kathryn M Jones. Growth Dynamics and Survival of Liberibacter crescens BT-1, an Important Model Organism for the Citrus Huanglongbing Pathogen 'Candidatus Liberibacter asiaticus'.
Applied and environmental microbiology.
2019 11; 85(21):. doi:
10.1128/aem.01656-19. [PMID: 31420343] - Milan Holeček, Melita Vodeničarovová. Effects of histidine load on ammonia, amino acid, and adenine nucleotide concentrations in rats.
Amino acids.
2019 Nov; 51(10-12):1667-1680. doi:
10.1007/s00726-019-02803-5. [PMID: 31712921] - Jelle Vriend, Charlotte A Hoogstraten, Kevin R Venrooij, Bartholomeus T van den Berge, Larissa P Govers, Arno van Rooij, Marleen C D G Huigen, Tom J J Schirris, Frans G M Russel, Rosalinde Masereeuw, Martijn J Wilmer. Organic anion transporters 1 and 3 influence cellular energy metabolism in renal proximal tubule cells.
Biological chemistry.
2019 09; 400(10):1347-1358. doi:
10.1515/hsz-2018-0446. [PMID: 30653465] - Sangkyu Park, Da-Hye Kim, Bo-Ra Park, Jong-Yeol Lee, Sun-Hyung Lim. Molecular and Functional Characterization of Oryza sativa Flavonol Synthase (OsFLS), a Bifunctional Dioxygenase.
Journal of agricultural and food chemistry.
2019 Jul; 67(26):7399-7409. doi:
10.1021/acs.jafc.9b02142. [PMID: 31244203] - Elisa Elena Baracco, Francesca Castoldi, Sylvère Durand, David P Enot, Jelena Tadic, Katharina Kainz, Frank Madeo, Alexis Chery, Valentina Izzo, Maria Chiara Maiuri, Federico Pietrocola, Guido Kroemer. α-Ketoglutarate inhibits autophagy.
Aging.
2019 06; 11(11):3418-3431. doi:
10.18632/aging.102001. [PMID: 31173576] - R M Satpute, Y D Bhutia, V Lomash, R Bhattacharya. Efficacy assessment of co-treated alpha-ketoglutarate and N-acetyl cysteine against the subchronic toxicity of cyanide in rats.
Toxicology and industrial health.
2019 Jun; 35(6):410-423. doi:
10.1177/0748233719851902. [PMID: 31244408] - Ruikai Wang, Li Liu, Jiejie Kong, Zhiyong Xu, Javaid Akhter Bhat, Tuanjie Zhao. QTL architecture of vine growth habit and gibberellin oxidase gene diversity in wild soybean (Glycine soja).
Scientific reports.
2019 05; 9(1):7393. doi:
10.1038/s41598-019-43887-z. [PMID: 31089185] - Veronica Carbonell, Eerika Vuorio, Eva-Mari Aro, Pauli Kallio. Enhanced stable production of ethylene in photosynthetic cyanobacterium Synechococcus elongatus PCC 7942.
World journal of microbiology & biotechnology.
2019 May; 35(5):77. doi:
10.1007/s11274-019-2652-7. [PMID: 31069553] - María de la Luz Cádiz-Gurrea, Vicente Micol, Jorge Joven, Antonio Segura-Carretero, Salvador Fernández-Arroyo. Different behavior of polyphenols in energy metabolism of lipopolysaccharide-stimulated cells.
Food research international (Ottawa, Ont.).
2019 04; 118(?):96-100. doi:
10.1016/j.foodres.2018.02.027. [PMID: 30898358] - Zhengliang Peng, Qiong Zhan, Xiangkun Xie, Hanlin Li, Yan Tu, Yujia Bai, Xingfu Huang, Wenyan Lai, Boxin Zhao, Qingchun Zeng, Dingli Xu. Association between admission plasma 2-oxoglutarate levels and short-term outcomes in patients with acute heart failure: a prospective cohort study.
Molecular medicine (Cambridge, Mass.).
2019 03; 25(1):8. doi:
10.1186/s10020-019-0078-1. [PMID: 30922225] - Wenkai Ren, Yaoyao Xia, Siyuan Chen, Guoyao Wu, Fuller W Bazer, Beiyan Zhou, Bie Tan, Guoqiang Zhu, Jinping Deng, Yulong Yin. Glutamine Metabolism in Macrophages: A Novel Target for Obesity/Type 2 Diabetes.
Advances in nutrition (Bethesda, Md.).
2019 03; 10(2):321-330. doi:
10.1093/advances/nmy084. [PMID: 30753258] - Ming-Xiang Cheng, Ding Cao, Yong Chen, Jin-Zheng Li, Bing Tu, Jian-Ping Gong. α-ketoglutarate attenuates ischemia-reperfusion injury of liver graft in rats.
Biomedicine & pharmacotherapy = Biomedecine & pharmacotherapie.
2019 Mar; 111(?):1141-1146. doi:
10.1016/j.biopha.2018.12.149. [PMID: 30841427] - Joseph P Dewulf, Elsa Wiame, Imen Dorboz, Monique Elmaleh-Bergès, Apolline Imbard, Dana Dumitriu, Malgorzata Rak, Agnès Bourillon, Raphaël Helaers, Alisha Malla, Florence Renaldo, Odile Boespflug-Tanguy, Marie-Françoise Vincent, Jean-François Benoist, Ron A Wevers, Avner Schlessinger, Emile Van Schaftingen, Marie-Cécile Nassogne, Manuel Schiff. SLC13A3 variants cause acute reversible leukoencephalopathy and α-ketoglutarate accumulation.
Annals of neurology.
2019 03; 85(3):385-395. doi:
10.1002/ana.25412. [PMID: 30635937]