Coenzyme II (BioDeep_00000840370)
代谢物信息卡片
化学式: C21H25N7O17P3-3 (740.051977)
中文名称:
谱图信息:
最多检出来源 () 0%
分子结构信息
SMILES: C1=CC(=C[N+](=C1)C2C(C(C(O2)COP(=O)([O-])OP(=O)([O-])OCC3C(C(C(O3)N4C=NC5=C(N=CN=C54)N)OP(=O)([O-])[O-])O)O)O)C(=O)N
InChI: InChI=1S/C21H28N7O17P3/c22-17-12-19(25-7-24-17)28(8-26-12)21-16(44-46(33,34)35)14(30)11(43-21)6-41-48(38,39)45-47(36,37)40-5-10-13(29)15(31)20(42-10)27-3-1-2-9(4-27)18(23)32/h1-4,7-8,10-11,13-16,20-21,29-31H,5-6H2,(H7-,22,23,24,25,32,33,34,35,36,37,38,39)/p-3/t10-,11-,13-,14-,15-,16-,20-,21-/m1/s1
描述信息
COVID info from COVID-19 Disease Map
Corona-virus
Coronavirus
SARS-CoV-2
COVID-19
SARS-CoV
COVID19
SARS2
SARS
同义名列表
1 个代谢物同义名
相关代谢途径
Reactome(121)
- Metabolism
- Biological oxidations
- Aflatoxin activation and detoxification
- Phase I - Functionalization of compounds
- Metabolism of vitamins and cofactors
- Metabolism of fat-soluble vitamins
- Retinoid metabolism and transport
- Visual phototransduction
- Sensory Perception
- Metabolism of proteins
- Post-translational protein modification
- Disease
- Phase II - Conjugation of compounds
- Amino acid and derivative metabolism
- Diseases of signal transduction by growth factor receptors and second messengers
- FLT3 signaling in disease
- Drug ADME
- Asparagine N-linked glycosylation
- Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein
- Synthesis of substrates in N-glycan biosythesis
- GDP-fucose biosynthesis
- Metabolism of lipids
- Metabolism of steroids
- Cholesterol biosynthesis
- Metabolism of cofactors
- Synthesis of Dolichyl-phosphate
- Diseases of metabolism
- Transport of small molecules
- Cytochrome P450 - arranged by substrate type
- Signaling Pathways
- Signaling by Rho GTPases
- RHO GTPase Effectors
- Signaling by Rho GTPases, Miro GTPases and RHOBTB3
- Immune System
- Innate Immune System
- ROS and RNS production in phagocytes
- Nucleotide metabolism
- Nucleotide catabolism
- Biosynthesis of specialized proresolving mediators (SPMs)
- Biosynthesis of EPA-derived SPMs
- Biosynthesis of E-series 18(R)-resolvins
- Fatty acid metabolism
- Metabolism of water-soluble vitamins and cofactors
- Tryptophan catabolism
- Bile acid and bile salt metabolism
- Synthesis of bile acids and bile salts
- Synthesis of bile acids and bile salts via 27-hydroxycholesterol
- Endogenous sterols
- Sterols are 12-hydroxylated by CYP8B1
- Metabolism of nitric oxide: NOS3 activation and regulation
- eNOS activation
- Signaling by Receptor Tyrosine Kinases
- Signaling by VEGF
- VEGFA-VEGFR2 Pathway
- RHO GTPases Activate NADPH Oxidases
- Cellular responses to stimuli
- Cellular responses to stress
- Detoxification of Reactive Oxygen Species
- Infectious disease
- Latent infection - Other responses of Mtb to phagocytosis
- Gene expression (Transcription)
- RNA Polymerase II Transcription
- Generic Transcription Pathway
- Transcriptional Regulation by TP53
- TP53 Regulates Transcription of Cell Death Genes
- TP53 regulates transcription of several additional cell death genes whose specific roles in p53-dependent apoptosis remain uncertain
- Infection with Mycobacterium tuberculosis
- Leishmania infection
- Killing mechanisms
- WNT5:FZD7-mediated leishmania damping
- Cellular response to chemical stress
- Cytoprotection by HMOX1
- Bacterial Infection Pathways
- Parasitic Infection Pathways
- Arachidonic acid metabolism
- Synthesis of Prostaglandins (PG) and Thromboxanes (TX)
- Selenoamino acid metabolism
- Biosynthesis of electrophilic -3 PUFA oxo-derivatives
- Iron uptake and transport
- Carbohydrate metabolism
- Fatty acyl-CoA biosynthesis
- The citric acid (TCA) cycle and respiratory electron transport
- Pyruvate metabolism and Citric Acid (TCA) cycle
- Pentose phosphate pathway
- Sulfur amino acid metabolism
- Degradation of cysteine and homocysteine
- Porphyrin metabolism
- Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol
- Hemostasis
- Sphingolipid metabolism
- Glutathione conjugation
- APAP ADME
- Vitamin D (calciferol) metabolism
- Vitamins
- Nicotinate metabolism
- Metabolism of amine-derived hormones
- Thyroxine biosynthesis
- Sphingolipid de novo biosynthesis
- Lipid metabolism
- Platelet homeostasis
- Nitric oxide stimulates guanylate cyclase
- VEGFR2 mediated vascular permeability
- Signaling by Nuclear Receptors
- ESR-mediated signaling
- Extra-nuclear estrogen signaling
- Synthesis of epoxy (EET) and dihydroxyeicosatrienoic acids (DHET)
- Cytosolic iron-sulfur cluster assembly
- Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation
- Synthesis of bile acids and bile salts via 24-hydroxycholesterol
- Metabolism of steroid hormones
- Pregnenolone biosynthesis
- Glucocorticoid biosynthesis
- Mineralocorticoid biosynthesis
- Estrogen biosynthesis
- Metabolism of folate and pterines
- NADPH regeneration
- Heme degradation
- Eicosanoids
- Signaling by Retinoic Acid
- RA biosynthesis pathway
- Glutamate and glutamine metabolism
BioCyc(312)
- superpathway of pyrimidine ribonucleosides degradation
- 4-hydroxyacetophenone degradation
- 4-nitrophenol degradation I
- O-antigen building blocks biosynthesis (E. coli)
- superpathway of L-phenylalanine biosynthesis
- patulin biosynthesis
- superpathway of L-methionine biosynthesis (transsulfuration)
- superpathway of L-homoserine and L-methionine biosynthesis
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis I
- superpathway of aromatic amino acid biosynthesis
- chorismate biosynthesis I
- chorismate biosynthesis from 3-dehydroquinate
- superpathway of bacteriochlorophyll a biosynthesis
- superpathway of L-tyrosine biosynthesis
- superpathway of hyoscyamine and scopolamine biosynthesis
- superpathway of chorismate metabolism
- gallate degradation III (anaerobic)
- aspartate superpathway
- superpathway of S-adenosyl-L-methionine biosynthesis
- superpathway of L-tryptophan biosynthesis
- superpathway of UDP-N-acetylglucosamine-derived O-antigen building blocks biosynthesis
- gallate biosynthesis
- hyoscyamine and scopolamine biosynthesis
- kauralexin biosynthesis
- oryzalide A biosynthesis
- Amaryllidacea alkaloids biosynthesis
- plant sterol biosynthesis
- spinosyn A biosynthesis
- bacteriochlorophyll e biosynthesis
- superpathway of tryptophan utilization
- superpathway of diterpene resin acids biosynthesis
- superpathway of C28 brassinosteroid biosynthesis
- brassinosteroid biosynthesis I
- superpathway of cytosolic glycolysis (plants), pyruvate dehydrogenase and TCA cycle
- coumarin metabolism (to melilotic acid)
- protocatechuate degradation I (meta-cleavage pathway)
- glycolysis IV (plant cytosol)
- trans-4-hydroxy-L-proline degradation II
- bacteriochlorophyll c biosynthesis
- bacteriochlorophyll d biosynthesis
- pyrimidine deoxyribonucleotides de novo biosynthesis III
- L-lysine biosynthesis II
- L-lysine biosynthesis I
- glucosinolate biosynthesis from hexahomomethionine
- canavanine degradation
- nicotine degradation I (pyridine pathway)
- superpathway of arginine and polyamine biosynthesis
- clavulanate biosynthesis
- superpathway of L-citrulline metabolism
- L-citrulline biosynthesis
- L-Nδ-acetylornithine biosynthesis
- superpathway of L-arginine, putrescine, and 4-aminobutanoate degradation
- superpathway of L-arginine and L-ornithine degradation
- superpathway of citrulline metabolism
- citrulline biosynthesis
- L-Nδ-acetylornithine biosynthesis
- superpathway of aromatic compound degradation
- nicotine degradation II
- formaldehyde oxidation I
- phosphopantothenate biosynthesis I
- morphine biosynthesis
- methanol oxidation to formaldehyde III
- pterocarpan phytoalexins modification (maackiain, medicarpin, pisatin, phaseollin)
- superpathway of trimethylamine degradation
- trimethylamine degradation
- propane degradation II
- superpathway of coenzyme A biosynthesis I (bacteria)
- nicotine degradation IV
- ectoine biosynthesis
- formaldehyde assimilation I (serine pathway)
- dimethyl sulfide degradation II (oxidation)
- formaldehyde oxidation VII (THF pathway)
- colchicine biosynthesis
- formaldehyde oxidation V (tetrahydrofolate pathway)
- matairesinol biosynthesis
- justicidin B biosynthesis
- glucosinolate biosynthesis from dihomomethionine
- polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium)
- polymethylated quercetin glucoside biosynthesis II - quercetagetin series (Chrysosplenium)
- phenylmercury acetate degradation
- superpathway of polymethylated quercetin/quercetagetin glucoside biosynthesis (Chrysosplenium)
- aurachin A, B, C and D biosynthesis
- L-arabinose degradation II
- superpathway of pentose and pentitol degradation
- pentachlorophenol degradation
- hentriaconta-3,6,9,12,15,19,22,25,28-nonaene biosynthesis
- anhydromuropeptides recycling I
- glyceollin biosynthesis
- superpathway of pterocarpan biosynthesis (via daidzein)
- ubiquinol-10 biosynthesis
- ubiquinol-10 biosynthesis (eukaryotic)
- ubiquinol-10 biosynthesis (prokaryotic)
- superpathway of nicotine biosynthesis
- superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass
- superpathay of heme b biosynthesis from glutamate
- TCA cycle I (prokaryotic)
- formate oxidation to CO2
- curcumin degradation
- superpathway of microbial D-galacturonate and D-glucuronate degradation
- mixed acid fermentation
- nicotine degradation II (pyrrolidine pathway)
- 1,3-propanediol biosynthesis (engineered)
- glycocholate metabolism (bacteria)
- superpathway of glyoxylate bypass and TCA
- tetrapyrrole biosynthesis I (from glutamate)
- superpathway of proto- and siroheme biosynthesis
- phenolphthiocerol biosynthesis
- 6-methylpretetramide biosynthesis
- superpathway of tetracycline and oxytetracycline biosynthesis
- bacteriochlorophyll a biosynthesis
- superpathway of testosterone and androsterone degradation
- CMP-pseudaminate biosynthesis
- 2,3-cis-flavanols biosynthesis
- plant sterol biosynthesis II
- bacteriochlorophyll b biosynthesis
- 3,8-divinyl-chlorophyllide a biosynthesis I (aerobic, light-dependent)
- 3,8-divinyl-chlorophyllide a biosynthesis III (aerobic, light independent)
- heme degradation V
- superpathway of carotenoid biosynthesis in plants
- superpathway of carotenoid biosynthesis
- jasmonic acid biosynthesis
- superpathway of L-lysine degradation
- tetrahydrofolate biosynthesis
- superpathway of tetrahydrofolate biosynthesis
- superpathway of tetrahydrofolate biosynthesis and salvage
- N10-formyl-tetrahydrofolate biosynthesis
- superpathway of ergotamine biosynthesis
- ergotamine biosynthesis
- isopropanol biosynthesis (engineered)
- acetone degradation III (to propane-1,2-diol)
- acetone degradation I (to methylglyoxal)
- acetone degradation II (to acetoacetate)
- linear furanocoumarin biosynthesis
- superpathway of Clostridium acetobutylicum acidogenic and solventogenic fermentation
- superpathway of Clostridium acetobutylicum solventogenic fermentation
- propane degradation I
- simple coumarins biosynthesis
- D-galactose degradation IV
- galactose degradation IV
- 2,4-dichlorophenoxyacetate degradation
- (-)-maackiain biosynthesis
- tetrahydroxyxanthone biosynthesis (from benzoate)
- tetrahydroxyxanthone biosynthesis (from 3-hydroxybenzoate)
- plumbagin biosynthesis
- superpathway of pterocarpan biosynthesis (via formononetin)
- superpathway of tetrahydroxyxanthone biosynthesis
- superpathway of formononetin derivative biosynthesis
- superpathway of glycolysis and the Entner-Doudoroff pathway
- photosynthetic 3-hydroxybutanoate biosynthesis (engineered)
- Entner-Doudoroff pathway I
- pentose phosphate pathway
- NAD/NADP-NADH/NADPH cytosolic interconversion (yeast)
- superpathway NAD/NADP - NADH/NADPH interconversion (yeast)
- gluconeogenesis I
- L-arginine biosynthesis II (acetyl cycle)
- superpathway NAD/NADP - NADH/NADPH interconversion
- NAD/NADP-NADH/NADPH cytosolic interconversion
- 1,8-cineole degradation
- oleandomycin biosynthesis
- menthol biosynthesis
- phenol degradation I (aerobic)
- diphenyl ethers degradation
- glucosinolate biosynthesis from pentahomomethionine
- juvenile hormone III biosynthesis I
- juvenile hormone III biosynthesis II
- brassinosteroid biosynthesis II
- glutamate and glutamine biosynthesis
- tryptophan degradation III (eukaryotic)
- uracil degradation II (reductive)
- arginine biosynthesis IV
- purine nucleotides degradation IV (anaerobic)
- folate transformations II (plants)
- tetrapyrrole biosynthesis I
- superpathway of glutamate biosynthesis
- leucine degradation IV
- isoleucine degradation III
- suberin biosynthesis
- heme biosynthesis I
- TCA cycle VI (obligate autotrophs)
- tryptophan degradation X (mammalian, via tryptamine)
- glutamine biosynthesis III
- tetracycline and oxytetracycline biosynthesis
- Methanobacterium thermoautotrophicum biosynthetic metabolism
- 2,4,6-trinitrophenol and 2,4-dinitrophenol degradation
- superpathway of ergosterol biosynthesis I
- ergosterol biosynthesis I
- superpathway of ergosterol biosynthesis
- ergosterol biosynthesis
- superpathway of cholesterol degradation II (cholesterol dehydrogenase)
- superpathway of cholesterol degradation I (cholesterol oxidase)
- limonene degradation II (L-limonene)
- L-lysine degradation IV
- Spodoptera littoralis pheromone biosynthesis
- phenylpropanoid biosynthesis
- lysine degradation I (saccharopine pathway)
- secologanin and strictosidine biosynthesis
- fumigaclavine biosynthesis
- UDP-N-acetylmuramoyl-pentapeptide biosynthesis II (lysine-containing)
- UDP-N-acetylmuramoyl-pentapeptide biosynthesis I (meso-diaminopimelate containing)
- 2-nitrobenzoate degradation I
- ammonia assimilation cycle III
- ethylmalonyl-CoA pathway
- ethylene glycol biosynthesis (engineered)
- methylaspartate cycle
- colanic acid building blocks biosynthesis
- suberin monomers biosynthesis
- L-glutamine degradation II
- crotonyl-CoA/ethylmalonyl-CoA/hydroxybutyryl-CoA cycle (engineered)
- TCA cycle V (2-oxoglutarate:ferredoxin oxidoreductase)
- (4S)-carvone biosynthesis
- geraniol and geranial biosynthesis
- Entner-Doudoroff pathway II (non-phosphorylative)
- L-lysine degradation XI (mammalian)
- superpathway of Clostridium acetobutylicum acidogenic fermentation
- grixazone biosynthesis
- L-glutamate and L-glutamine biosynthesis
- L-carnitine degradation III
- reductive TCA cycle I
- 4-hydroxymandelate degradation
- superpathway of aromatic compound degradation via 2-hydroxypentadienoate
- 4-hydroxyphenylacetate degradation
- purine nucleobases degradation II (anaerobic)
- superpathway of aromatic compound degradation via 3-oxoadipate
- UDP-sugars interconversion
- norspermidine biosynthesis
- peptidoglycan biosynthesis I (meso-diaminopimelate containing)
- peptidoglycan biosynthesis II (staphylococci)
- superpathway of polyamine biosynthesis III
- superpathway of geranylgeranyl diphosphate biosynthesis II (via MEP)
- taxadiene biosynthesis (engineered)
- superpathway of GDP-mannose-derived O-antigen building blocks biosynthesis
- superpathway of rifamycin B biosynthesis
- novobiocin biosynthesis
- L-valine biosynthesis
- superpathway of CDP-glucose-derived O-antigen building blocks biosynthesis
- phosphinothricin tripeptide biosynthesis
- L-arginine biosynthesis I (via L-ornithine)
- 2-nitrophenol degradation
- artemisinin biosynthesis
- L-rhamnose degradation II
- L-ornithine biosynthesis I
- androstenedione degradation
- Entner-Doudoroff pathway III (semi-phosphorylative)
- mandelate degradation to acetyl-CoA
- methylerythritol phosphate pathway I
- methylerythritol phosphate pathway II
- ubiquinol-8 biosynthesis (prokaryotic)
- L-ascorbate biosynthesis IV
- superpathway of phylloquinol biosynthesis
- superpathway of ubiquinol-8 biosynthesis (prokaryotic)
- superpathway of L-threonine metabolism
- sphingolipid biosynthesis (plants)
- erythro-tetrahydrobiopterin biosynthesis I
- zymosterol biosynthesis
- cholesterol biosynthesis I
- cholesterol biosynthesis III (via desmosterol)
- superpathway of cholesterol biosynthesis
- epoxypseudoisoeugenol-2-methylbutanoate biosynthesis
- (+)-pisatin biosynthesis
- versicolorin B biosynthesis
- 1,2-propanediol biosynthesis from lactate (engineered)
- 2,4-xylenol degradation to protocatechuate
- t-anethole biosynthesis
- hyperxanthone E biosynthesis
- phylloquinol biosynthesis
- ascorbate glutathione cycle
- superpathway of mycolyl-arabinogalactan-peptidoglycan complex biosynthesis
- polyacyltrehalose biosynthesis
- resorcinol degradation
- citrulline-nitric oxide cycle
- nitric oxide biosynthesis II (mammals)
- nitric oxide biosynthesis I (plants)
- L-citrulline-nitric oxide cycle
- nitric oxide biosynthesis (plants)
- coelimycin P1 biosynthesis
- salicortin biosynthesis
- benzoate biosynthesis I (CoA-dependent, β-oxidative)
- stipitatate biosynthesis
- pinitol biosynthesis II
- cholesterol biosynthesis II (via 24,25-dihydrolanosterol)
- bisphenol A degradation
- isoprene biosynthesis II (engineered)
- isoprene biosynthesis I
- γ-coniciene and coniine biosynthesis
- 7-dehydroporiferasterol biosynthesis
- pyruvate fermentation to isobutanol (engineered)
- nylon-6 oligomer degradation
- tetracenomycin C biosynthesis
- L-glutamate degradation VII (to butanoate)
- L-ascorbate degradation IV
- superpathway of erythromycin biosynthesis
- superpathway of megalomicin A biosynthesis
- erythromycin D biosynthesis
- superpathway of erythromycin biosynthesis (without sugar biosynthesis)
- phaseollin biosynthesis
- detoxification of reactive carbonyls in chloroplasts
- superpathway of seleno-compound metabolism
- L-homoserine biosynthesis
- superpathway of L-threonine biosynthesis
- superpathway of L-isoleucine biosynthesis I
- 2,3-trans-flavanols biosynthesis
- cardenolide biosynthesis
- vestitol and sativan biosynthesis
- polybrominated dihydroxylated diphenyl ethers biosynthesis
- spongiadioxin C biosynthesis
- ajmaline and sarpagine biosynthesis
- dTDP-L-daunosamine biosynthesis
- leucopelargonidin and leucocyanidin biosynthesis
- glucosinolate biosynthesis from tetrahomomethionine
- androgen biosynthesis
- superpathway of gibberellin biosynthesis
- uracil degradation I (reductive)
PlantCyc(104)
- superpathway of hyoscyamine and scopolamine biosynthesis
- hyoscyamine and scopolamine biosynthesis
- superpathway of isoflavonoids (via naringenin)
- oryzalide A biosynthesis
- kauralexin biosynthesis
- superpathway of diterpene resin acids biosynthesis
- brassinolide biosynthesis II
- brassinolide biosynthesis I
- brassinosteroid biosynthesis I
- superpathway of C28 brassinosteroid biosynthesis
- glycolysis IV (plant cytosol)
- superpathway of cytosolic glycolysis (plants), pyruvate dehydrogenase and TCA cycle
- coumarin metabolism (to melilotic acid)
- leucodelphinidin biosynthesis
- luteolinidin 5-O-glucoside biosynthesis
- leucopelargonidin and leucocyanidin biosynthesis
- superpathway of L-citrulline metabolism
- L-arginine degradation VI (arginase 2 pathway)
- canavanine degradation
- L-citrulline biosynthesis
- L-Nδ-acetylornithine biosynthesis
- superpathway of hyoscyamine (atropine) and scopolamine biosynthesis
- formaldehyde oxidation VII (THF pathway)
- formaldehyde oxidation II (glutathione-dependent)
- colchicine biosynthesis
- morphine biosynthesis
- superpathway of pterocarpan biosynthesis (via daidzein)
- polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium)
- polymethylated quercetin glucoside biosynthesis II - quercetagetin series (Chrysosplenium)
- superpathway of polymethylated quercetin/quercetagetin glucoside biosynthesis (Chrysosplenium)
- ajmaline and sarpagine biosynthesis
- phytosterol biosynthesis (plants)
- NAD/NADH phosphorylation and dephosphorylation
- superpathway of gibberellin biosynthesis
- gibberellin biosynthesis II (early C-3 hydroxylation)
- ubiquinol-10 biosynthesis (eukaryotic)
- ubiquinol-10 biosynthesis (late decarboxylation)
- superpathway of proto- and siroheme biosynthesis
- superpathway of nicotine biosynthesis
- 2,3-cis-flavanols biosynthesis
- 3,8-divinyl-chlorophyllide a biosynthesis III (aerobic, light independent)
- superpathway of carotenoid biosynthesis in plants
- vindoline, vindorosine and vinblastine biosynthesis
- capsaicin biosynthesis
- linear furanocoumarin biosynthesis
- tetrahydroxyxanthone biosynthesis (from 3-hydroxybenzoate)
- superpathway of tetrahydroxyxanthone biosynthesis
- (-)-maackiain biosynthesis
- superpathway of pterocarpan biosynthesis (via formononetin)
- plumbagin biosynthesis
- tetrahydroxyxanthone biosynthesis (from benzoate)
- superpathway of formononetin derivative biosynthesis
- calystegine biosynthesis
- tropane alkaloids biosynthesis
- menthol biosynthesis
- glucosinolate biosynthesis from pentahomomethionine
- juvenile hormone III biosynthesis I
- L-lysine degradation I
- superpathway of photosynthetic hydrogen production
- photosynthesis light reactions
- brassinosteroid biosynthesis II
- L-glutamate biosynthesis I
- matairesinol biosynthesis
- phenylpropanoid biosynthesis
- superpathway of phylloquinol biosynthesis
- (4S)-carvone biosynthesis
- suberin monomers biosynthesis
- rosmarinic acid biosynthesis II
- superpathway of rosmarinic acid biosynthesis
- geraniol and geranial biosynthesis
- sphingolipid biosynthesis (plants)
- sanguinarine and macarpine biosynthesis
- phosphatidylglycerol biosynthesis II (non-plastidic)
- artemisinin and arteannuin B biosynthesis
- chorismate biosynthesis I
- cholesterol biosynthesis I
- zymosterol biosynthesis
- superpathway of seleno-compound metabolism
- selenate reduction
- epoxypseudoisoeugenol-2-methylbutanoate biosynthesis
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II
- t-anethole biosynthesis
- hyperxanthone E biosynthesis
- ascorbate glutathione cycle
- (-)-glycinol biosynthesis
- jasmonic acid biosynthesis
- Amaryllidacea alkaloids biosynthesis
- pinitol biosynthesis II
- L-ascorbate biosynthesis VI (plants, myo-inositol pathway)
- cholesterol biosynthesis (plants)
- cholesterol biosynthesis (plants, early side-chain reductase)
- isoprene biosynthesis II (engineered)
- isoprene biosynthesis I
- L-ascorbate degradation IV
- phylloquinol biosynthesis
- detoxification of reactive carbonyls in chloroplasts
- botryococcenes and methylated squalene biosynthesis
- justicidin B biosynthesis
- 2,3-trans-flavanols biosynthesis
- proanthocyanidins biosynthesis from flavanols
- cardenolide biosynthesis
- vestitol and sativan biosynthesis
- glucosinolate biosynthesis from tetrahomomethionine
- fatty acid β-oxidation IV (unsaturated, even number)
代谢反应
8756 个相关的代谢反应过程信息。
Reactome(1492)
- Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP
- Glutathione conjugation:
GSH + H2O ⟶ CysGly + L-Glu
- Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Biological oxidations:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + SAH ⟶ Ade-Rib + HCYS
- Glutathione conjugation:
GSH + H2O ⟶ CysGly + L-Glu
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP
- Glutathione conjugation:
GSH + H2O ⟶ CysGly + L-Glu
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP
- Glutathione conjugation:
GSH + H2O ⟶ CysGly + L-Glu
- Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi
- Biological oxidations:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + SAH ⟶ Ade-Rib + HCYS
- Glutathione conjugation:
CysGly + H2O ⟶ Gly + L-Cys
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Biological oxidations:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Phase II - Conjugation of compounds:
H2O + SAH ⟶ Ade-Rib + HCYS
- Glutathione conjugation:
GSH + H2O ⟶ CysGly + L-Glu
- Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Biological oxidations:
H+ + Oxygen + TPNH + progesterone ⟶ 11DCORST + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP
- Glutathione conjugation:
GSH + H2O ⟶ CysGly + L-Glu
- Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP
- Glutathione conjugation:
GSH + H2O ⟶ CysGly + L-Glu
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP
- Glutathione conjugation:
GSH + H2O ⟶ CysGly + L-Glu
- Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP
- Glutathione conjugation:
GSH + H2O ⟶ CysGly + L-Glu
- Metabolism:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine
- Biological oxidations:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Phase II - Conjugation of compounds:
H2O + SAH ⟶ Ade-Rib + HCYS
- Glutathione conjugation:
GSH + H2O ⟶ CysGly + L-Glu
- Metabolism:
GAA + SAM ⟶ CRET + H+ + SAH
- Biological oxidations:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Phase II - Conjugation of compounds:
H2O + SAH ⟶ Ade-Rib + HCYS
- Glutathione conjugation:
GSH + H2O ⟶ CysGly + L-Glu
- Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi
- Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Phase II - Conjugation of compounds:
PAPS + beta-estradiol ⟶ E2-SO4 + PAP
- Glutathione conjugation:
CysGly + H2O ⟶ Gly + L-Cys
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP
- Glutathione conjugation:
GSH + H2O ⟶ CysGly + L-Glu
- Metabolism of lipids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Fatty acyl-CoA biosynthesis:
Mal-CoA + PALM-CoA ⟶ 3OOD-CoA + CoA-SH + carbon dioxide
- Synthesis of very long-chain fatty acyl-CoAs:
Mal-CoA + PALM-CoA ⟶ 3OOD-CoA + CoA-SH + carbon dioxide
- Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Fatty acyl-CoA biosynthesis:
ATP + CIT + CoA-SH ⟶ ADP + Ac-CoA + OA + Pi
- Synthesis of very long-chain fatty acyl-CoAs:
Mal-CoA + PALM-CoA ⟶ 3OOD-CoA + CoA-SH + carbon dioxide
- Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Fatty acyl-CoA biosynthesis:
ATP + CIT + CoA-SH ⟶ ADP + Ac-CoA + OA + Pi
- Synthesis of very long-chain fatty acyl-CoAs:
Mal-CoA + PALM-CoA ⟶ 3OOD-CoA + CoA-SH + carbon dioxide
- Metabolism of lipids:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi
- Fatty acid metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi
- Fatty acyl-CoA biosynthesis:
ATP + CIT + CoA-SH ⟶ ADP + Ac-CoA + OA + Pi
- Synthesis of very long-chain fatty acyl-CoAs:
Mal-CoA + PALM-CoA ⟶ 3OOD-CoA + CoA-SH + carbon dioxide
- Metabolism of lipids:
3-oxopristanoyl-CoA + CoA-SH ⟶ 4,8,12-trimethyltridecanoyl-CoA + propionyl CoA
- Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Fatty acyl-CoA biosynthesis:
ATP + CIT + CoA-SH ⟶ ADP + Ac-CoA + OA + Pi
- Synthesis of very long-chain fatty acyl-CoAs:
Mal-CoA + PALM-CoA ⟶ 3OOD-CoA + CoA-SH + carbon dioxide
- Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Fatty acyl-CoA biosynthesis:
ATP + CIT + CoA-SH ⟶ ADP + Ac-CoA + OA + Pi
- Synthesis of very long-chain fatty acyl-CoAs:
Mal-CoA + PALM-CoA ⟶ 3OOD-CoA + CoA-SH + carbon dioxide
- Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Fatty acid metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi
- Fatty acyl-CoA biosynthesis:
ATP + CIT + CoA-SH ⟶ ADP + Ac-CoA + OA + Pi
- Synthesis of very long-chain fatty acyl-CoAs:
Mal-CoA + PALM-CoA ⟶ 3OOD-CoA + CoA-SH + carbon dioxide
- Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Fatty acyl-CoA biosynthesis:
ATP + CIT + CoA-SH ⟶ ADP + Ac-CoA + OA + Pi
- Synthesis of very long-chain fatty acyl-CoAs:
Mal-CoA + PALM-CoA ⟶ 3OOD-CoA + CoA-SH + carbon dioxide
- Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Metabolism of lipids:
H2O + lysoPC ⟶ GPCho + LCFA(-)
- Fatty acid metabolism:
12S-HpETE + GSH ⟶ 12S-HETE + GSSG + H2O
- Fatty acyl-CoA biosynthesis:
Mal-CoA + PALM-CoA ⟶ 3OOD-CoA + CoA-SH + carbon dioxide
- Synthesis of very long-chain fatty acyl-CoAs:
Mal-CoA + PALM-CoA ⟶ 3OOD-CoA + CoA-SH + carbon dioxide
- Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Fatty acyl-CoA biosynthesis:
ATP + CIT + CoA-SH ⟶ ADP + Ac-CoA + OA + Pi
- Synthesis of very long-chain fatty acyl-CoAs:
Mal-CoA + PALM-CoA ⟶ 3OOD-CoA + CoA-SH + carbon dioxide
- Metabolism of lipids:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine
- Fatty acid metabolism:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine
- Fatty acyl-CoA biosynthesis:
ATP + Ac-CoA + HCO3- ⟶ ADP + Mal-CoA + Pi
- Synthesis of very long-chain fatty acyl-CoAs:
AA + ATP + CoA-SH ⟶ AA-CoA + AMP + H2O + PPi
- Metabolism of lipids:
ACA + H+ + NADH ⟶ NAD + bHBA
- Fatty acid metabolism:
ATP + CIT + CoA-SH ⟶ ADP + Ac-CoA + OA + Pi
- Fatty acyl-CoA biosynthesis:
ATP + CIT + CoA-SH ⟶ ADP + Ac-CoA + OA + Pi
- Synthesis of very long-chain fatty acyl-CoAs:
AA + ATP + CoA-SH ⟶ AA-CoA + AMP + H2O + PPi
- Metabolism of lipids:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi
- Fatty acid metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi
- Fatty acyl-CoA biosynthesis:
ATP + CIT + CoA-SH ⟶ ADP + Ac-CoA + OA + Pi
- Synthesis of very long-chain fatty acyl-CoAs:
Mal-CoA + PALM-CoA ⟶ 3OOD-CoA + CoA-SH + carbon dioxide
- Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Fatty acyl-CoA biosynthesis:
ATP + CIT + CoA-SH ⟶ ADP + Ac-CoA + OA + Pi
- Synthesis of very long-chain fatty acyl-CoAs:
Mal-CoA + PALM-CoA ⟶ 3OOD-CoA + CoA-SH + carbon dioxide
- Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Phase I - Functionalization of compounds:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Cytochrome P450 - arranged by substrate type:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Endogenous sterols:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Phase I - Functionalization of compounds:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Cytochrome P450 - arranged by substrate type:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Endogenous sterols:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Phase I - Functionalization of compounds:
H+ + Oxygen + TPNH + progesterone ⟶ 11DCORST + H2O + TPN
- Cytochrome P450 - arranged by substrate type:
H+ + Oxygen + TPNH + progesterone ⟶ 11DCORST + H2O + TPN
- Endogenous sterols:
H+ + Oxygen + TPNH + progesterone ⟶ 11DCORST + H2O + TPN
- Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Phase I - Functionalization of compounds:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Cytochrome P450 - arranged by substrate type:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Endogenous sterols:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Phase I - Functionalization of compounds:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Cytochrome P450 - arranged by substrate type:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Endogenous sterols:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Phase I - Functionalization of compounds:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Cytochrome P450 - arranged by substrate type:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Endogenous sterols:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Metabolism of steroids:
17aHPROG + H+ + Oxygen + TPNH ⟶ 11-deoxycortisol + H2O + TPN
- Bile acid and bile salt metabolism:
CHOL + H+ + Oxygen + TPNH ⟶ 7alpha-hydroxycholesterol + H2O + TPN
- Synthesis of bile acids and bile salts:
CHOL + H+ + Oxygen + TPNH ⟶ 7alpha-hydroxycholesterol + H2O + TPN
- Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 7alpha-hydroxycholesterol + H2O + TPN
- Phase I - Functionalization of compounds:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Cytochrome P450 - arranged by substrate type:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Endogenous sterols:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Phase I - Functionalization of compounds:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Cytochrome P450 - arranged by substrate type:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Endogenous sterols:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Cobalamin (Cbl, vitamin B12) transport and metabolism:
ATP + B12s ⟶ AdoCbl + PPP
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Cobalamin (Cbl, vitamin B12) transport and metabolism:
ATP + B12s ⟶ AdoCbl + PPP
- Metabolism of vitamins and cofactors:
6x(PCCA:PCCB) + ATP + Btn ⟶ 6x(Btn-PCCA:PCCB) + AMP + PPi
- Metabolism of water-soluble vitamins and cofactors:
6x(PCCA:PCCB) + ATP + Btn ⟶ 6x(Btn-PCCA:PCCB) + AMP + PPi
- Cobalamin (Cbl, vitamin B12) transport and metabolism:
ATP + B12s ⟶ AdoCbl + PPP
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Cobalamin (Cbl, vitamin B12) transport and metabolism:
ATP + B12s ⟶ AdoCbl + PPP
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Cobalamin (Cbl, vitamin B12) transport and metabolism:
ATP + B12s ⟶ AdoCbl + PPP
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Cobalamin (Cbl, vitamin B12) transport and metabolism:
ATP + B12s ⟶ AdoCbl + PPP
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Cobalamin (Cbl, vitamin B12) transport and metabolism:
B12r + NADH ⟶ B12s + H+ + NAD
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Cobalamin (Cbl, vitamin B12) transport and metabolism:
ATP + B12s ⟶ AdoCbl + PPP
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Cobalamin (Cbl, vitamin B12) transport and metabolism:
ATP + B12s ⟶ AdoCbl + PPP
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Cobalamin (Cbl, vitamin B12) transport and metabolism:
ATP + B12s ⟶ AdoCbl + PPP
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Cobalamin (Cbl, vitamin B12) transport and metabolism:
ATP + B12s ⟶ AdoCbl + PPP
- Cobalamin (Cbl) metabolism:
H+ + MMACHC:cob(I)alamin + NAD ⟶ MMACHC:cob(II)alamin + NADH
- Cobalamin (Cbl) metabolism:
H+ + MMACHC:cob(I)alamin + NAD ⟶ MMACHC:cob(II)alamin + NADH
- Cobalamin (Cbl) metabolism:
H+ + MMACHC:cob(I)alamin + NAD ⟶ MMACHC:cob(II)alamin + NADH
- Cobalamin (Cbl) metabolism:
H+ + MMACHC:cob(I)alamin + NAD ⟶ MMACHC:cob(II)alamin + NADH
- Cobalamin (Cbl) metabolism:
H+ + MMACHC:cob(I)alamin + NAD ⟶ MMACHC:cob(II)alamin + NADH
- Cobalamin (Cbl) metabolism:
H+ + MMACHC:cob(I)alamin + NAD ⟶ MMACHC:cob(II)alamin + NADH
- Cobalamin (Cbl) metabolism:
H+ + MMACHC:cob(I)alamin + NAD ⟶ MMACHC:cob(II)alamin + NADH
- Cobalamin (Cbl) metabolism:
H+ + MMACHC:cob(I)alamin + NAD ⟶ MMACHC:cob(II)alamin + NADH
- Cobalamin (Cbl) metabolism:
H+ + MMACHC:cob(I)alamin + NAD ⟶ MMACHC:cob(II)alamin + NADH
- Cobalamin (Cbl) metabolism:
H+ + MMACHC:cob(I)alamin + NAD ⟶ MMACHC:cob(II)alamin + NADH
- Cobalamin (Cbl) metabolism:
H+ + MMACHC:cob(I)alamin + NAD ⟶ MMACHC:cob(II)alamin + NADH
- Metabolism of folate and pterines:
FOLA + Q0VCN9 ⟶ FOLR2:FOLA
- Metabolism of folate and pterines:
FOLA + H+ + TPNH ⟶ DHF + TPN
- Metabolism of folate and pterines:
A0A5F4C041 + FOLA ⟶ FOLR2:FOLA
- Metabolism of folate and pterines:
FOLA + folr ⟶ FOLR2:FOLA
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of folate and pterines:
FOLA + H+ + TPNH ⟶ DHF + TPN
- Metabolism of folate and pterines:
FOLA + FOLR2_HUMAN ⟶ FOLR2:FOLA
- Metabolism of folate and pterines:
FOLA + Folr2 ⟶ FOLR2:FOLA
- Metabolism of folate and pterines:
D4A4S5 + FOLA ⟶ FOLR2:FOLA
- Metabolism of folate and pterines:
A0A5G2QLX9 + FOLA ⟶ FOLR2:FOLA
- Metabolism of folate and pterines:
FOLA + H+ + TPNH ⟶ DHF + TPN
- Plasmalogen biosynthesis:
GO3P + H+ + TPNH ⟶ HXDG3P + TPN
- Wax and plasmalogen biosynthesis:
H+ + PALM-CoA + TPNH ⟶ CoA-SH + HXOL + TPN
- Plasmalogen biosynthesis:
HXOL + Palmitoylglycerone phosphate ⟶ GO3P + PALM
- Wax and plasmalogen biosynthesis:
H+ + PALM-CoA + TPNH ⟶ CoA-SH + HXOL + TPN
- Plasmalogen biosynthesis:
HXOL + Palmitoylglycerone phosphate ⟶ GO3P + PALM
- Wax and plasmalogen biosynthesis:
H+ + PALM-CoA + TPNH ⟶ CoA-SH + HXOL + TPN
- Metabolism of lipids:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Plasmalogen biosynthesis:
HXOL + Palmitoylglycerone phosphate ⟶ GO3P + PALM
- Wax and plasmalogen biosynthesis:
H+ + PALM-CoA + TPNH ⟶ CoA-SH + HXOL + TPN
- Plasmalogen biosynthesis:
GO3P + H+ + TPNH ⟶ HXDG3P + TPN
- Wax and plasmalogen biosynthesis:
H+ + PALM-CoA + TPNH ⟶ CoA-SH + HXOL + TPN
- Plasmalogen biosynthesis:
GO3P + H+ + TPNH ⟶ HXDG3P + TPN
- Wax and plasmalogen biosynthesis:
H+ + PALM-CoA + TPNH ⟶ CoA-SH + HXOL + TPN
- Plasmalogen biosynthesis:
HXOL + Palmitoylglycerone phosphate ⟶ GO3P + PALM
- Wax and plasmalogen biosynthesis:
H+ + PALM-CoA + TPNH ⟶ CoA-SH + HXOL + TPN
- Plasmalogen biosynthesis:
HXOL + Palmitoylglycerone phosphate ⟶ GO3P + PALM
- Wax and plasmalogen biosynthesis:
H+ + PALM-CoA + TPNH ⟶ CoA-SH + HXOL + TPN
- Plasmalogen biosynthesis:
HXOL + Palmitoylglycerone phosphate ⟶ GO3P + PALM
- Wax and plasmalogen biosynthesis:
H+ + PALM-CoA + TPNH ⟶ CoA-SH + HXOL + TPN
- Plasmalogen biosynthesis:
HXOL + Palmitoylglycerone phosphate ⟶ GO3P + PALM
- Wax and plasmalogen biosynthesis:
H+ + PALM-CoA + TPNH ⟶ CoA-SH + HXOL + TPN
- Plasmalogen biosynthesis:
HXOL + Palmitoylglycerone phosphate ⟶ GO3P + PALM
- Wax and plasmalogen biosynthesis:
H+ + PALM-CoA + TPNH ⟶ CoA-SH + HXOL + TPN
- Arachidonic acid metabolism:
H+ + e- + prostaglandin G2 ⟶ H2O + prostaglandin H2
- Synthesis of Leukotrienes (LT) and Eoxins (EX):
H2O + leukotriene A4 ⟶ leukotriene B4
- Cholesterol biosynthesis:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN
- Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Cholesterol biosynthesis:
7-dehydroCHOL + H+ + TPNH ⟶ CHOL + TPN
- Cholesterol biosynthesis:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN
- Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Cholesterol biosynthesis:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN
- Cholesterol biosynthesis:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN
- Cholesterol biosynthesis:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN
- Cholesterol biosynthesis:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN
- Cholesterol biosynthesis:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN
- Cholesterol biosynthesis:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN
- Cholesterol biosynthesis:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN
- Metabolism of steroid hormones:
17aHPROG + H+ + Oxygen + TPNH ⟶ 11-deoxycortisol + H2O + TPN
- Pregnenolone biosynthesis:
STAR:CHOL ⟶ CHOL + STAR
- Metabolism of steroid hormones:
H+ + Oxygen + TEST + TPNH ⟶ EST17b + H2O + HCOOH + TPN
- Pregnenolone biosynthesis:
H+ + ISCAL + TPNH ⟶ MePeOH + TPN
- Metabolism of steroid hormones:
17aHPROG + H+ + Oxygen + TPNH ⟶ 11-deoxycortisol + H2O + TPN
- Pregnenolone biosynthesis:
STAR:CHOL ⟶ CHOL + STAR
- Metabolism of steroid hormones:
17aHPROG + H+ + Oxygen + TPNH ⟶ 11-deoxycortisol + H2O + TPN
- Pregnenolone biosynthesis:
STAR:CHOL ⟶ CHOL + star
- Metabolism of steroids:
H+ + TPNH + estrone ⟶ EST17b + TPN
- Metabolism of steroid hormones:
H+ + TPNH + estrone ⟶ EST17b + TPN
- Pregnenolone biosynthesis:
H+ + ISCAL + TPNH ⟶ MePeOH + TPN
- Metabolism of steroids:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Metabolism of steroid hormones:
H+ + Oxygen + TEST + TPNH ⟶ EST17b + H2O + HCOOH + TPN
- Pregnenolone biosynthesis:
H+ + ISCAL + TPNH ⟶ MePeOH + TPN
- Metabolism of steroid hormones:
17aHPROG + H+ + Oxygen + TPNH ⟶ 11-deoxycortisol + H2O + TPN
- Pregnenolone biosynthesis:
STAR:CHOL ⟶ CHOL + STAR
- Metabolism of steroid hormones:
11-deoxycortisol ⟶ 11DCORT
- Pregnenolone biosynthesis:
STAR:CHOL ⟶ CHOL + STAR
- Metabolism of steroid hormones:
17aHPROG + H+ + Oxygen + TPNH ⟶ 11-deoxycortisol + H2O + TPN
- Pregnenolone biosynthesis:
STAR:CHOL ⟶ CHOL + Star
- Metabolism of steroid hormones:
17aHPROG + H+ + Oxygen + TPNH ⟶ 11-deoxycortisol + H2O + TPN
- Pregnenolone biosynthesis:
STAR:CHOL ⟶ CHOL + Star
- Metabolism of steroids:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN
- Metabolism of steroid hormones:
EST17b + TPN ⟶ H+ + TPNH + estrone
- Metabolism of steroids:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN
- Metabolism of steroid hormones:
H+ + TPNH + estrone ⟶ EST17b + TPN
- Pregnenolone biosynthesis:
H+ + ISCAL + TPNH ⟶ MePeOH + TPN
- Metabolism of steroid hormones:
17aHPROG + H+ + Oxygen + TPNH ⟶ 11-deoxycortisol + H2O + TPN
- Pregnenolone biosynthesis:
H+ + ISCAL + TPNH ⟶ MePeOH + TPN
- Metabolism of steroid hormones:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Pregnenolone biosynthesis:
STAR:CHOL ⟶ CHOL + STAR
- Pregnenolone biosynthesis:
H+ + ISCAL + TPNH ⟶ MePeOH + TPN
- Signaling Pathways:
ADORA2A,B + Ade-Rib ⟶ ADORA2A,B:Ade-Rib
- Visual phototransduction:
H+ + RBP2:atRAL + TPNH ⟶ RBP2:atROL + TPN
- The canonical retinoid cycle in rods (twilight vision):
DHA + H+ + Oxygen + TPNH ⟶ H2O + HDoHE + TPN
- The retinoid cycle in cones (daylight vision):
H+ + TPNH + atRAL ⟶ TPN + atROL
- Signaling by Nuclear Receptors:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN
- Signaling by Retinoic Acid:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN
- RA biosynthesis pathway:
H+ + TPNH + atRAL ⟶ TPN + atROL
- Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- Visual phototransduction:
H+ + RBP2:atRAL + TPNH ⟶ RBP2:atROL + TPN
- Signaling by Nuclear Receptors:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN
- Signaling by Retinoic Acid:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN
- RA biosynthesis pathway:
H+ + TPNH + atRAL ⟶ TPN + atROL
- Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- Visual phototransduction:
atREs + nascent CM ⟶ nascent CM:atREs
- The canonical retinoid cycle in rods (twilight vision):
RLBP1:11cROL + TPN ⟶ H+ + RLBP1:11cRAL + TPNH
- The retinoid cycle in cones (daylight vision):
H+ + TPNH + atRAL ⟶ TPN + atROL
- Signaling by Nuclear Receptors:
E2QW22 + E2RPT1 + ESR1:ER:PGR:P4 + F6UTY3 + J9P0C0 ⟶ ESR1:ESTG:PGR:P4:FOXA1:GATA3:TLE3:NRIP:EP300
- Signaling by Retinoic Acid:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN
- RA biosynthesis pathway:
H+ + TPNH + atRAL ⟶ TPN + atROL
- Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- Visual phototransduction:
atREs + nascent CM ⟶ nascent CM:atREs
- The canonical retinoid cycle in rods (twilight vision):
RLBP1:11cROL + TPN ⟶ H+ + RLBP1:11cRAL + TPNH
- The retinoid cycle in cones (daylight vision):
H+ + TPNH + atRAL ⟶ TPN + atROL
- Signaling by Nuclear Receptors:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + F8W2D1 + HSP90:HSP90 + Pi + Q7SZQ8
- Signaling by Retinoic Acid:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN
- RA biosynthesis pathway:
E9QD41 + atRA ⟶ SUMO-CRABP1:atRA
- Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- Signaling by Nuclear Receptors:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Signaling by Retinoic Acid:
H+ + TPNH + atRAL ⟶ TPN + atROL
- RA biosynthesis pathway:
H+ + TPNH + atRAL ⟶ TPN + atROL
- Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- Visual phototransduction:
RLBP1:11cROL + TPN ⟶ H+ + RLBP1:11cRAL + TPNH
- The canonical retinoid cycle in rods (twilight vision):
RLBP1:11cROL + TPN ⟶ H+ + RLBP1:11cRAL + TPNH
- The retinoid cycle in cones (daylight vision):
H+ + TPNH + atRAL ⟶ TPN + atROL
- Signaling by Nuclear Receptors:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + HSP90:HSP90 + Pi + Q9VH95 + Q9VL78
- Signaling by Retinoic Acid:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN
- RA biosynthesis pathway:
atRA + fabp ⟶ SUMO-CRABP1:atRA
- Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- Visual phototransduction:
H+ + RBP2:atRAL + TPNH ⟶ RBP2:atROL + TPN
- The canonical retinoid cycle in rods (twilight vision):
DHA + H+ + Oxygen + TPNH ⟶ H2O + HDoHE + TPN
- The retinoid cycle in cones (daylight vision):
H+ + TPNH + atRAL ⟶ TPN + atROL
- Signaling by Nuclear Receptors:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN
- Signaling by Retinoic Acid:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN
- RA biosynthesis pathway:
CRABP1 + atRA ⟶ SUMO-CRABP1:atRA
- Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- Visual phototransduction:
atREs + nascent CM ⟶ nascent CM:atREs
- The canonical retinoid cycle in rods (twilight vision):
RLBP1:11cROL + TPN ⟶ H+ + RLBP1:11cRAL + TPNH
- The retinoid cycle in cones (daylight vision):
11cROL + TPN ⟶ 11cRAL + H+ + TPNH
- Signaling by Nuclear Receptors:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + HSP90:HSP90 + Immunophilin FKBP52 + Pi + cPGES
- Signaling by Retinoic Acid:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN
- RA biosynthesis pathway:
H+ + TPNH + atRAL ⟶ TPN + atROL
- Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- Visual phototransduction:
atREs + nascent CM ⟶ nascent CM:atREs
- The canonical retinoid cycle in rods (twilight vision):
RLBP1:11cROL + TPN ⟶ H+ + RLBP1:11cRAL + TPNH
- The retinoid cycle in cones (daylight vision):
H+ + TPNH + atRAL ⟶ TPN + atROL
- Signaling by Nuclear Receptors:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + Fkbp4 + HSP90:HSP90 + Pi + Q9R0Q7
- Signaling by Retinoic Acid:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN
- RA biosynthesis pathway:
H+ + TPNH + atRAL ⟶ TPN + atROL
- Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- Visual phototransduction:
atREs + nascent CM ⟶ nascent CM:atREs
- The canonical retinoid cycle in rods (twilight vision):
DHA + H+ + Oxygen + TPNH ⟶ H2O + HDoHE + TPN
- The retinoid cycle in cones (daylight vision):
H+ + TPNH + atRAL ⟶ TPN + atROL
- Signaling by Nuclear Receptors:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + HSP90:HSP90 + Pi + Ptges3 + Q9QVC8
- Signaling by Retinoic Acid:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN
- RA biosynthesis pathway:
H+ + TPNH + atRAL ⟶ TPN + atROL
- Signaling Pathways:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP
- Visual phototransduction:
H+ + TPNH + atRAL ⟶ TPN + atROL
- The canonical retinoid cycle in rods (twilight vision):
H+ + TPNH + atRAL ⟶ TPN + atROL
- The retinoid cycle in cones (daylight vision):
H+ + TPNH + atRAL ⟶ TPN + atROL
- Signaling by Nuclear Receptors:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Signaling by Retinoic Acid:
H2O + NAD + atRAL ⟶ H+ + NADH + atRA
- RA biosynthesis pathway:
H2O + NAD + atRAL ⟶ H+ + NADH + atRA
- Signaling Pathways:
PKA tetramer + cAMP ⟶ PKA tetramer:4xcAMP
- Signaling by Nuclear Receptors:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Signaling by Retinoic Acid:
H2O + NAD + atRAL ⟶ H+ + NADH + atRA
- RA biosynthesis pathway:
H2O + NAD + atRAL ⟶ H+ + NADH + atRA
- Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- Visual phototransduction:
atREs + nascent CM ⟶ nascent CM:atREs
- The canonical retinoid cycle in rods (twilight vision):
RLBP1:11cROL + TPN ⟶ H+ + RLBP1:11cRAL + TPNH
- The retinoid cycle in cones (daylight vision):
H+ + TPNH + atRAL ⟶ TPN + atROL
- Signaling by Nuclear Receptors:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN
- Signaling by Retinoic Acid:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN
- RA biosynthesis pathway:
H+ + TPNH + atRAL ⟶ TPN + atROL
- Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- Visual phototransduction:
atREs + nascent CM ⟶ nascent CM:atREs
- The retinoid cycle in cones (daylight vision):
F6T9Q4 + atROL ⟶ RLBP1:atROL
- Signaling by Nuclear Receptors:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ A0A310SUH5 + ADP + ESR1:ER:PGR:P4 + HSP90:HSP90 + Pi + Q5U4Z0
- Signaling by Retinoic Acid:
CAR + PALM-CoA ⟶ CoA-SH + L-PCARN
- RA biosynthesis pathway:
H+ + TPNH + atRAL ⟶ TPN + atROL
- The retinoid cycle in cones (daylight vision):
H+ + TPNH + atRAL ⟶ TPN + atROL
- Sensory Perception:
H2O + RPALM ⟶ PALM + atROL
- Sensory Perception:
atREs + nascent CM ⟶ nascent CM:atREs
- Sensory Perception:
atREs + nascent CM ⟶ nascent CM:atREs
- Sensory Perception:
atREs + nascent CM ⟶ nascent CM:atREs
- Sensory Perception:
H2O + RPALM ⟶ PALM + atROL
- Sensory Perception:
atREs + nascent CM ⟶ nascent CM:atREs
- Sensory Perception:
atREs + nascent CM ⟶ nascent CM:atREs
- Sensory Perception:
H2O + RPALM ⟶ PALM + atROL
- Sensory Perception:
H2O + RPALM ⟶ PALM + atROL
- Sensory Perception:
H+ + TPNH + atRAL ⟶ TPN + atROL
- Sensory Perception:
atREs + nascent CM ⟶ nascent CM:atREs
- Sensory Perception:
GTP + odorant:Olfactory Receptor:GNAL:GDP:GNB1:GNG13 ⟶ GDP + odorant:Olfactory Receptor:GNAL:GTP:GNB1:GNG13
- The canonical retinoid cycle in rods (twilight vision):
H+ + TPNH + atRAL ⟶ TPN + atROL
- Metabolism of fat-soluble vitamins:
TTPA + alpha-TOH ⟶ TTPA:alpha-TOH
- Retinoid metabolism and transport:
H+ + RBP2:atRAL + TPNH ⟶ RBP2:atROL + TPN
- Retinoid metabolism and transport:
H+ + RBP2:atRAL + TPNH ⟶ RBP2:atROL + TPN
- Metabolism of fat-soluble vitamins:
H+ + RBP2:atRAL + TPNH ⟶ RBP2:atROL + TPN
- Retinoid metabolism and transport:
atREs + nascent CM ⟶ nascent CM:atREs
- Metabolism of fat-soluble vitamins:
atREs + nascent CM ⟶ nascent CM:atREs
- Retinoid metabolism and transport:
H+ + RBP2:atRAL + TPNH ⟶ RBP2:atROL + TPN
- Metabolism of fat-soluble vitamins:
Homologues of TTPA + alpha-TOH ⟶ TTPA:alpha-TOH
- Metabolism of fat-soluble vitamins:
TTPA + alpha-TOH ⟶ TTPA:alpha-TOH
- Retinoid metabolism and transport:
H+ + RBP2:atRAL + TPNH ⟶ RBP2:atROL + TPN
- Metabolism of fat-soluble vitamins:
atREs + nascent CM ⟶ nascent CM:atREs
- Retinoid metabolism and transport:
atREs + nascent CM ⟶ nascent CM:atREs
- Metabolism of fat-soluble vitamins:
atREs + nascent CM ⟶ nascent CM:atREs
- Retinoid metabolism and transport:
atREs + nascent CM ⟶ nascent CM:atREs
- Metabolism of fat-soluble vitamins:
atREs + nascent CM ⟶ nascent CM:atREs
- Retinoid metabolism and transport:
atREs + nascent CM ⟶ nascent CM:atREs
- Metabolism of fat-soluble vitamins:
atREs + nascent CM ⟶ nascent CM:atREs
- Retinoid metabolism and transport:
atREs + nascent CM ⟶ nascent CM:atREs
- Metabolism of fat-soluble vitamins:
atREs + nascent CM ⟶ nascent CM:atREs
- Retinoid metabolism and transport:
atREs + nascent CM ⟶ nascent CM:atREs
- Porphyrin metabolism:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Heme degradation:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Transport of small molecules:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Iron uptake and transport:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cellular responses to stimuli:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cellular responses to stress:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cellular responses to stimuli:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cellular responses to stress:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Transport of small molecules:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Iron uptake and transport:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Porphyrin metabolism:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Heme degradation:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cellular responses to stimuli:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cellular responses to stress:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Transport of small molecules:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Iron uptake and transport:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Porphyrin metabolism:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Heme degradation:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cellular responses to stimuli:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cellular responses to stress:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Transport of small molecules:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Iron uptake and transport:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Porphyrin metabolism:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Heme degradation:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Porphyrin metabolism:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Heme degradation:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Transport of small molecules:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Iron uptake and transport:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cellular responses to stimuli:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cellular responses to stress:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Transport of small molecules:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Iron uptake and transport:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Porphyrin metabolism:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Heme degradation:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cellular responses to stimuli:
BIL:ALB + O2.- ⟶ ALB + BV
- Cellular responses to stress:
BIL:ALB + O2.- ⟶ ALB + BV
- Porphyrin metabolism:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Heme degradation:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Transport of small molecules:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Iron uptake and transport:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cellular responses to stimuli:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cellular responses to stress:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Porphyrin metabolism:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Heme degradation:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cellular responses to stimuli:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cellular responses to stress:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Transport of small molecules:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Iron uptake and transport:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cellular responses to stimuli:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cellular responses to stress:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Porphyrin metabolism:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Heme degradation:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Transport of small molecules:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Iron uptake and transport:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Porphyrin metabolism:
BV + TPNH ⟶ BIL + TPN
- Heme degradation:
BV + TPNH ⟶ BIL + TPN
- Cellular responses to stimuli:
BV + TPNH ⟶ BIL + TPN
- Cellular responses to stress:
BV + TPNH ⟶ BIL + TPN
- Transport of small molecules:
ATP + CHOL + H2O ⟶ ADP + CHOL + Pi
- Iron uptake and transport:
CIT ⟶ ISCIT
- Cellular response to chemical stress:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cytoprotection by HMOX1:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cellular response to chemical stress:
BV + TPNH ⟶ BIL + TPN
- Cytoprotection by HMOX1:
BV + TPNH ⟶ BIL + TPN
- Cellular response to chemical stress:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cytoprotection by HMOX1:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cellular response to chemical stress:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cytoprotection by HMOX1:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cellular response to chemical stress:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cytoprotection by HMOX1:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cellular response to chemical stress:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cytoprotection by HMOX1:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cellular response to chemical stress:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cytoprotection by HMOX1:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cellular response to chemical stress:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cytoprotection by HMOX1:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cellular response to chemical stress:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cytoprotection by HMOX1:
Oxygen + TPNH + heme ⟶ BV + CO + Fe2+ + H2O + TPN
- Cellular response to chemical stress:
BIL:ALB + O2.- ⟶ ALB + BV
- Cytoprotection by HMOX1:
BIL:ALB + O2.- ⟶ ALB + BV
- Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Sterols are 12-hydroxylated by CYP8B1:
4CHOL7aOLONE + H+ + Oxygen + TPNH ⟶ 4CHOL7a,12aDONE + H2O + TPN
- Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Phase I - Functionalization of compounds:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Cytochrome P450 - arranged by substrate type:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Endogenous sterols:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Sterols are 12-hydroxylated by CYP8B1:
4CHOL7aOLONE + H+ + Oxygen + TPNH ⟶ 4CHOL7a,12aDONE + H2O + TPN
- Bile acid and bile salt metabolism:
CHOL + H+ + Oxygen + TPNH ⟶ 25OH-CHOL + H2O + TPN
- Synthesis of bile acids and bile salts:
CHOL + H+ + Oxygen + TPNH ⟶ 25OH-CHOL + H2O + TPN
- Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
25(S) THCA-CoA + Oxygen ⟶ H2O2 + THCA-CoA
- Bile acid and bile salt metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Synthesis of bile acids and bile salts:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Sterols are 12-hydroxylated by CYP8B1:
4CHOL7aOLONE + H+ + Oxygen + TPNH ⟶ 4CHOL7a,12aDONE + H2O + TPN
- Sterols are 12-hydroxylated by CYP8B1:
4CHOL7aOLONE + H+ + Oxygen + TPNH ⟶ 4CHOL7a,12aDONE + H2O + TPN
- Sterols are 12-hydroxylated by CYP8B1:
4CHOL7aOLONE + H+ + Oxygen + TPNH ⟶ 4CHOL7a,12aDONE + H2O + TPN
- Bile acid and bile salt metabolism:
CHOL + H+ + Oxygen + TPNH ⟶ 25OH-CHOL + H2O + TPN
- Synthesis of bile acids and bile salts:
CHOL + H+ + Oxygen + TPNH ⟶ 25OH-CHOL + H2O + TPN
- Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
H2O + choloyl-CoA ⟶ CoA-SH + cholate
- Bile acid and bile salt metabolism:
CHOL + H+ + Oxygen + TPNH ⟶ 25OH-CHOL + H2O + TPN
- Synthesis of bile acids and bile salts:
CHOL + H+ + Oxygen + TPNH ⟶ 25OH-CHOL + H2O + TPN
- Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol:
4CHOL7a,12aDONE + H+ + TPNH ⟶ 5beta-cholesten-7alpha, 12alpha-diol-3-one + TPN
- Sterols are 12-hydroxylated by CYP8B1:
4CHOL7aOLONE + H+ + Oxygen + TPNH ⟶ 4CHOL7a,12aDONE + H2O + TPN
- Sterols are 12-hydroxylated by CYP8B1:
4CHOL7aOLONE + H+ + Oxygen + TPNH ⟶ 4CHOL7a,12aDONE + H2O + TPN
- Androgen biosynthesis:
DHEA + NAD ⟶ ANDST + H+ + NADH
- Estrogen biosynthesis:
H+ + Oxygen + TEST + TPNH ⟶ EST17b + H2O + HCOOH + TPN
- Androgen biosynthesis:
ANDST + H+ + TPNH ⟶ TEST + TPN
- Phase I - Functionalization of compounds:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Cytochrome P450 - arranged by substrate type:
ANDST + H+ + Oxygen + TPNH ⟶ H2O + HCOOH + TPN + estrone
- Endogenous sterols:
ANDST + H+ + Oxygen + TPNH ⟶ H2O + HCOOH + TPN + estrone
- Androgen biosynthesis:
DHEA + NAD ⟶ ANDST + H+ + NADH
- Estrogen biosynthesis:
H+ + TPNH + estrone ⟶ EST17b + TPN
- Androgen biosynthesis:
DHEA + NAD ⟶ ANDST + H+ + NADH
- Estrogen biosynthesis:
H+ + Oxygen + TEST + TPNH ⟶ EST17b + H2O + HCOOH + TPN
- Androgen biosynthesis:
DHEA + NAD ⟶ ANDST + H+ + NADH
- Androgen biosynthesis:
ANDST + H+ + TPNH ⟶ TEST + TPN
- Estrogen biosynthesis:
H+ + Oxygen + TEST + TPNH ⟶ EST17b + H2O + HCOOH + TPN
- Phase I - Functionalization of compounds:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Cytochrome P450 - arranged by substrate type:
ANDST + H+ + Oxygen + TPNH ⟶ H2O + HCOOH + TPN + estrone
- Endogenous sterols:
ANDST + H+ + Oxygen + TPNH ⟶ H2O + HCOOH + TPN + estrone
- Androgen biosynthesis:
DHEA + NAD ⟶ ANDST + H+ + NADH
- Estrogen biosynthesis:
H+ + Oxygen + TEST + TPNH ⟶ EST17b + H2O + HCOOH + TPN
- Androgen biosynthesis:
DHEA + NAD ⟶ ANDST + H+ + NADH
- Estrogen biosynthesis:
H+ + Oxygen + TEST + TPNH ⟶ EST17b + H2O + HCOOH + TPN
- Androgen biosynthesis:
DHEA + NAD ⟶ ANDST + H+ + NADH
- Estrogen biosynthesis:
H+ + Oxygen + TEST + TPNH ⟶ EST17b + H2O + HCOOH + TPN
- Metabolism of steroids:
H+ + TEST + TPNH ⟶ DHTEST + TPN
- Metabolism of steroid hormones:
H+ + TEST + TPNH ⟶ DHTEST + TPN
- Androgen biosynthesis:
H+ + TEST + TPNH ⟶ DHTEST + TPN
- Androgen biosynthesis:
H+ + Oxygen + TPNH + progesterone ⟶ 17aHPROG + H2O + TPN
- Estrogen biosynthesis:
H+ + Oxygen + TEST + TPNH ⟶ EST17b + H2O + HCOOH + TPN
- Androgen biosynthesis:
H+ + Oxygen + TPNH + progesterone ⟶ 17aHPROG + H2O + TPN
- Estrogen biosynthesis:
EST17b + TPN ⟶ H+ + TPNH + estrone
- Androgen biosynthesis:
H+ + Oxygen + TPNH + progesterone ⟶ 17aHPROG + H2O + TPN
- Estrogen biosynthesis:
H+ + Oxygen + TEST + TPNH ⟶ EST17b + H2O + HCOOH + TPN
- Estrogen biosynthesis:
H+ + Oxygen + TEST + TPNH ⟶ EST17b + H2O + HCOOH + TPN
- Cholesterol biosynthesis:
H+ + LAN + Oxygen + TPNH ⟶ 4,4DMCHtOL + H2O + HCOOH + TPN
- Cholesterol biosynthesis:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN
- Cholesterol biosynthesis:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN
- Gene expression (Transcription):
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4
- RNA Polymerase II Transcription:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4
- Generic Transcription Pathway:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4
- Transcriptional Regulation by TP53:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O
- TP53 Regulates Transcription of Cell Death Genes:
1,2-Naphthoquinone + H+ + TPNH ⟶ TPN + semiquinone
- TP53 regulates transcription of several additional cell death genes whose specific roles in p53-dependent apoptosis remain uncertain:
1,2-Naphthoquinone + H+ + TPNH ⟶ TPN + semiquinone
- Gene expression (Transcription):
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O
- RNA Polymerase II Transcription:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O
- Generic Transcription Pathway:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O
- Transcriptional Regulation by TP53:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O
- TP53 Regulates Transcription of Cell Death Genes:
1,2-Naphthoquinone + H+ + TPNH ⟶ TPN + semiquinone
- TP53 regulates transcription of several additional cell death genes whose specific roles in p53-dependent apoptosis remain uncertain:
1,2-Naphthoquinone + H+ + TPNH ⟶ TPN + semiquinone
- Gene expression (Transcription):
H2O2 + Homologues of TXN ⟶ H2O + Homologues of 2xHC-TXN
- RNA Polymerase II Transcription:
H2O2 + Homologues of TXN ⟶ H2O + Homologues of 2xHC-TXN
- Generic Transcription Pathway:
H2O2 + Homologues of TXN ⟶ H2O + Homologues of 2xHC-TXN
- Transcriptional Regulation by TP53:
H2O2 + Homologues of TXN ⟶ H2O + Homologues of 2xHC-TXN
- TP53 Regulates Transcription of Cell Death Genes:
1,2-Naphthoquinone + H+ + TPNH ⟶ TPN + semiquinone
- TP53 regulates transcription of several additional cell death genes whose specific roles in p53-dependent apoptosis remain uncertain:
1,2-Naphthoquinone + H+ + TPNH ⟶ TPN + semiquinone
- Gene expression (Transcription):
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4
- RNA Polymerase II Transcription:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4
- Generic Transcription Pathway:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4
- Transcriptional Regulation by TP53:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O
- TP53 Regulates Transcription of Cell Death Genes:
1,2-Naphthoquinone + H+ + TPNH ⟶ TPN + semiquinone
- TP53 regulates transcription of several additional cell death genes whose specific roles in p53-dependent apoptosis remain uncertain:
1,2-Naphthoquinone + H+ + TPNH ⟶ TPN + semiquinone
- Gene expression (Transcription):
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4
- RNA Polymerase II Transcription:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4
- Generic Transcription Pathway:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4
- Transcriptional Regulation by TP53:
Cytochrome c-Fe2+ + H+ + Oxygen ⟶ Cytochrome c-Fe3+ + H+ + H2O
- TP53 Regulates Transcription of Cell Death Genes:
1,2-Naphthoquinone + H+ + TPNH ⟶ TPN + semiquinone
- TP53 regulates transcription of several additional cell death genes whose specific roles in p53-dependent apoptosis remain uncertain:
1,2-Naphthoquinone + H+ + TPNH ⟶ TPN + semiquinone
- Gene expression (Transcription):
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4
- RNA Polymerase II Transcription:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4
- Generic Transcription Pathway:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4
- Transcriptional Regulation by TP53:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O
- TP53 Regulates Transcription of Cell Death Genes:
1,2-Naphthoquinone + H+ + TPNH ⟶ TPN + semiquinone
- TP53 regulates transcription of several additional cell death genes whose specific roles in p53-dependent apoptosis remain uncertain:
1,2-Naphthoquinone + H+ + TPNH ⟶ TPN + semiquinone
- Gene expression (Transcription):
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4
- RNA Polymerase II Transcription:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4
- Generic Transcription Pathway:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4
- Transcriptional Regulation by TP53:
H2O2 + TXN ⟶ F6ZMN7 + H2O
- TP53 Regulates Transcription of Cell Death Genes:
1,2-Naphthoquinone + H+ + TPNH ⟶ TPN + semiquinone
- TP53 regulates transcription of several additional cell death genes whose specific roles in p53-dependent apoptosis remain uncertain:
1,2-Naphthoquinone + H+ + TPNH ⟶ TPN + semiquinone
- Arachidonic acid metabolism:
H+ + e- + prostaglandin G2 ⟶ H2O + prostaglandin H2
- Synthesis of Leukotrienes (LT) and Eoxins (EX):
H2O + leukotriene C4 ⟶ L-Glu + leukotriene D4
- Arachidonic acid metabolism:
H+ + e- + prostaglandin G2 ⟶ H2O + prostaglandin H2
- Synthesis of Leukotrienes (LT) and Eoxins (EX):
H2O + leukotriene A4 ⟶ leukotriene B4
- Fatty acid metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Arachidonic acid metabolism:
H+ + e- + prostaglandin G2 ⟶ H2O + prostaglandin H2
- Synthesis of Leukotrienes (LT) and Eoxins (EX):
H2O + leukotriene A4 ⟶ leukotriene B4
- Arachidonic acid metabolism:
H+ + e- + prostaglandin G2 ⟶ H2O + prostaglandin H2
- Synthesis of Leukotrienes (LT) and Eoxins (EX):
H2O + leukotriene A4 ⟶ leukotriene B4
- Arachidonic acid metabolism:
H+ + e- + prostaglandin G2 ⟶ H2O + prostaglandin H2
- Synthesis of Leukotrienes (LT) and Eoxins (EX):
H2O + leukotriene A4 ⟶ leukotriene B4
- Arachidonic acid metabolism:
H+ + e- + prostaglandin G2 ⟶ H2O + prostaglandin H2
- Synthesis of Leukotrienes (LT) and Eoxins (EX):
H2O + leukotriene A4 ⟶ leukotriene B4
- Arachidonic acid metabolism:
H+ + e- + prostaglandin G2 ⟶ H2O + prostaglandin H2
- Synthesis of Leukotrienes (LT) and Eoxins (EX):
H2O + leukotriene A4 ⟶ leukotriene B4
- Biosynthesis of specialized proresolving mediators (SPMs):
DHA + Oxygen ⟶ 17-HDHA
- Biosynthesis of electrophilic -3 PUFA oxo-derivatives:
DHA + Oxygen ⟶ 17-HDHA
- Kandutsch-Russell pathway:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN
- Kandutsch-Russell pathway:
7-dehydroCHOL + H+ + TPNH ⟶ CHOL + TPN
- Kandutsch-Russell pathway:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN
- Kandutsch-Russell pathway:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN
- Kandutsch-Russell pathway:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN
- Kandutsch-Russell pathway:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN
- Kandutsch-Russell pathway:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN
- Kandutsch-Russell pathway:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN
- Kandutsch-Russell pathway:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN
- Kandutsch-Russell pathway:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN
- Aflatoxin activation and detoxification:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ H2O + TPN + aflatoxin Q1
- Aflatoxin activation and detoxification:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ H2O + TPN + aflatoxin Q1
- Aflatoxin activation and detoxification:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ H2O + TPN + aflatoxin Q1
- Aflatoxin activation and detoxification:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ H2O + TPN + aflatoxin Q1
- Aflatoxin activation and detoxification:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ H2O + TPN + aflatoxin Q1
- Aflatoxin activation and detoxification:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ H2O + TPN + aflatoxin Q1
- Aflatoxin activation and detoxification:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ H2O + TPN + aflatoxin Q1
- Aflatoxin activation and detoxification:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ H2O + TPN + aflatoxin M1
- Aflatoxin activation and detoxification:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ H2O + TPN + aflatoxin Q1
- Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN
- Formation of xylulose-5-phosphate:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN
- Carbohydrate metabolism:
L-gulonate + NAD ⟶ 3-dehydro-L-gulonate + H+ + NADH
- Formation of xylulose-5-phosphate:
L-gulonate + NAD ⟶ 3-dehydro-L-gulonate + H+ + NADH
- Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN
- Formation of xylulose-5-phosphate:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN
- Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN
- Formation of xylulose-5-phosphate:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN
- Carbohydrate metabolism:
L-gulonate + NAD ⟶ 3-dehydro-L-gulonate + H+ + NADH
- Formation of xylulose-5-phosphate:
L-gulonate + NAD ⟶ 3-dehydro-L-gulonate + H+ + NADH
- Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN
- Formation of xylulose-5-phosphate:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN
- Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN
- Formation of xylulose-5-phosphate:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN
- Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN
- Formation of xylulose-5-phosphate:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN
- Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN
- Formation of xylulose-5-phosphate:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN
- Carbohydrate metabolism:
ATP + PYR + carbon dioxide ⟶ ADP + OAA + Pi
- Formation of xylulose-5-phosphate:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN
- Carbohydrate metabolism:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN
- Formation of xylulose-5-phosphate:
D-glucuronate + H+ + TPNH ⟶ L-gulonate + TPN
- Phase I - Functionalization of compounds:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Phase I - Functionalization of compounds:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Metabolism of nitric oxide: NOS3 activation and regulation:
ADMA + H2O ⟶ DMA + L-Cit
- eNOS activation:
ADMA + H2O ⟶ DMA + L-Cit
- Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH
- Signaling by Receptor Tyrosine Kinases:
H2O + cAMP ⟶ AMP
- Signaling by VEGF:
Oxygen + TPNH ⟶ H+ + O2.- + TPN
- VEGFA-VEGFR2 Pathway:
Oxygen + TPNH ⟶ H+ + O2.- + TPN
- VEGFR2 mediated vascular permeability:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Signaling by Receptor Tyrosine Kinases:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- Signaling by VEGF:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- VEGFA-VEGFR2 Pathway:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- VEGFR2 mediated vascular permeability:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH
- Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH
- Metabolism of nitric oxide: NOS3 activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- eNOS activation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Nicotinate metabolism:
H+ + PRPP + QUIN ⟶ NAMN + PPi + carbon dioxide
- Signaling by Receptor Tyrosine Kinases:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- Signaling by VEGF:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- VEGFA-VEGFR2 Pathway:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- VEGFR2 mediated vascular permeability:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Signaling by Receptor Tyrosine Kinases:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- Signaling by VEGF:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- VEGFA-VEGFR2 Pathway:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- VEGFR2 mediated vascular permeability:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Metabolism of nitric oxide: NOS3 activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- eNOS activation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Nicotinate metabolism:
(ADP-D-ribosyl)(n)-acceptor + NAD ⟶ (ADP-D-ribosyl)(n+1)-acceptor + NAM
- Metabolism of nitric oxide: NOS3 activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- eNOS activation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Nicotinate metabolism:
H+ + Oxygen + dh-beta-NAD ⟶ H2O2 + NAD
- Signaling by Receptor Tyrosine Kinases:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- Signaling by VEGF:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- VEGFA-VEGFR2 Pathway:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- VEGFR2 mediated vascular permeability:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Metabolism of nitric oxide: NOS3 activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- eNOS activation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH
- Signaling by Receptor Tyrosine Kinases:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- Signaling by VEGF:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- VEGFA-VEGFR2 Pathway:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- VEGFR2 mediated vascular permeability:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Metabolism of nitric oxide: NOS3 activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- eNOS activation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH
- Signaling by Receptor Tyrosine Kinases:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- Signaling by VEGF:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- VEGFA-VEGFR2 Pathway:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- VEGFR2 mediated vascular permeability:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Signaling Pathways:
H2O + cAMP ⟶ AMP
- Signaling by Receptor Tyrosine Kinases:
H2O + cAMP ⟶ AMP
- Signaling by VEGF:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- VEGFA-VEGFR2 Pathway:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- VEGFR2 mediated vascular permeability:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Metabolism of nitric oxide: NOS3 activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- eNOS activation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH
- Signaling by Receptor Tyrosine Kinases:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- Signaling by VEGF:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- VEGFA-VEGFR2 Pathway:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- VEGFR2 mediated vascular permeability:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Signaling by Receptor Tyrosine Kinases:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Signaling by VEGF:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- VEGFA-VEGFR2 Pathway:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- VEGFR2 mediated vascular permeability:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Metabolism of nitric oxide: NOS3 activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- eNOS activation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Metabolism of vitamins and cofactors:
4x(PC:Mn2+) + ATP + Btn ⟶ 4x(Btn-PC:Mn2+) + AMP + PPi
- Metabolism of water-soluble vitamins and cofactors:
4x(PC:Mn2+) + ATP + Btn ⟶ 4x(Btn-PC:Mn2+) + AMP + PPi
- Nicotinate metabolism:
H+ + PRPP + QUIN ⟶ NAMN + PPi + carbon dioxide
- Metabolism of vitamins and cofactors:
4x(PC:Mn2+) + ATP + Btn ⟶ 4x(Btn-PC:Mn2+) + AMP + PPi
- Metabolism of water-soluble vitamins and cofactors:
4x(PC:Mn2+) + ATP + Btn ⟶ 4x(Btn-PC:Mn2+) + AMP + PPi
- Nicotinate metabolism:
ATP + NR ⟶ ADP + H+ + NMN
- Signaling by Receptor Tyrosine Kinases:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Signaling by VEGF:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- VEGFA-VEGFR2 Pathway:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- VEGFR2 mediated vascular permeability:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Metabolism of nitric oxide: NOS3 activation and regulation:
H+ + TPNH + sepiapterin ⟶ TPN + dihydrobiopterin
- eNOS activation:
H+ + TPNH + sepiapterin ⟶ TPN + dihydrobiopterin
- Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH
- Signaling by Receptor Tyrosine Kinases:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- Signaling by VEGF:
Oxygen + TPNH ⟶ H+ + O2.- + TPN
- VEGFA-VEGFR2 Pathway:
Oxygen + TPNH ⟶ H+ + O2.- + TPN
- VEGFR2 mediated vascular permeability:
PAK1,2,3 dimer + p-VAV family:PIP3:RAC1:GTP ⟶ 2 x p-VAV family:PIP3:RAC1:GTP:PAK 1-3
- Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH
- Metabolism of nitric oxide: NOS3 activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- eNOS activation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Metabolism of nitric oxide: NOS3 activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- eNOS activation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Metabolism of nitric oxide: NOS3 activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- eNOS activation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi
- Nucleotide catabolism:
AMP + H2O ⟶ Ade-Rib + Pi
- Pyrimidine catabolism:
H2O + Hydrouracil ⟶ H+ + UPROP
- Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi
- Nucleotide catabolism:
H+ + TPNH + Ura ⟶ Hydrouracil + TPN
- Pyrimidine catabolism:
H+ + TPNH + Ura ⟶ Hydrouracil + TPN
- Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi
- Nucleotide catabolism:
AMP + H2O ⟶ Ade-Rib + Pi
- Pyrimidine catabolism:
H+ + TPNH + Ura ⟶ Hydrouracil + TPN
- Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi
- Nucleotide catabolism:
AMP + H2O ⟶ Ade-Rib + Pi
- Pyrimidine catabolism:
H+ + TPNH + Ura ⟶ Hydrouracil + TPN
- Nucleotide metabolism:
ATP + Thy-dRib ⟶ ADP + TMP
- Nucleotide catabolism:
H+ + TPNH + Ura ⟶ Hydrouracil + TPN
- Pyrimidine catabolism:
H+ + TPNH + Ura ⟶ Hydrouracil + TPN
- Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi
- Nucleotide catabolism:
H+ + TPNH + Ura ⟶ Hydrouracil + TPN
- Pyrimidine catabolism:
H+ + TPNH + Ura ⟶ Hydrouracil + TPN
- Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi
- Nucleotide catabolism:
AMP + H2O ⟶ Ade-Rib + Pi
- Pyrimidine catabolism:
H+ + TPNH + Ura ⟶ Hydrouracil + TPN
- Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi
- Nucleotide catabolism:
AMP + H2O ⟶ Ade-Rib + Pi
- Pyrimidine catabolism:
H+ + TPNH + Ura ⟶ Hydrouracil + TPN
- Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi
- Nucleotide catabolism:
AMP + H2O ⟶ Ade-Rib + Pi
- Pyrimidine catabolism:
H+ + TPNH + Ura ⟶ Hydrouracil + TPN
- Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi
- Nucleotide catabolism:
AMP + H2O ⟶ Ade-Rib + Pi
- Pyrimidine catabolism:
H+ + TPNH + Ura ⟶ Hydrouracil + TPN
- Nucleotide metabolism:
Ade + PRPP ⟶ AMP + PPi
- Nucleotide catabolism:
AMP + H2O ⟶ Ade-Rib + Pi
- Pyrimidine catabolism:
H+ + TPNH + Ura ⟶ Hydrouracil + TPN
- Nucleotide metabolism:
AMP + H2O ⟶ Ade-Rib + Pi
- Nucleotide catabolism:
AMP + H2O ⟶ Ade-Rib + Pi
- Pyrimidine catabolism:
H2O + Hydrouracil ⟶ H+ + UPROP
- Synthesis of bile acids and bile salts via 27-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 27OH-CHOL + H2O + TPN
- Synthesis of bile acids and bile salts via 27-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 27OH-CHOL + H2O + TPN
- Synthesis of bile acids and bile salts via 27-hydroxycholesterol:
4CHOL7a,12a,27TONE + H+ + TPNH ⟶ 5beta-cholestan-7alpha,12alpha,27-triol-3-one + TPN
- Synthesis of bile acids and bile salts via 27-hydroxycholesterol:
4CHOL7a,12a,27TONE + H+ + TPNH ⟶ 5beta-cholestan-7alpha,12alpha,27-triol-3-one + TPN
- Synthesis of bile acids and bile salts via 27-hydroxycholesterol:
27HCHOL + H+ + Oxygen + TPNH ⟶ 7alpha,26-dihydroxycholesterol + H2O + TPN
- Synthesis of bile acids and bile salts via 27-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 27OH-CHOL + H2O + TPN
- Synthesis of bile acids and bile salts via 27-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 27OH-CHOL + H2O + TPN
- Synthesis of bile acids and bile salts via 27-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 27OH-CHOL + H2O + TPN
- Synthesis of bile acids and bile salts via 27-hydroxycholesterol:
4CHOL7a,12a,27TONE + H+ + TPNH ⟶ 5beta-cholestan-7alpha,12alpha,27-triol-3-one + TPN
- Synthesis of bile acids and bile salts via 27-hydroxycholesterol:
4CHOL7a,12a,27TONE + H+ + TPNH ⟶ 5beta-cholestan-7alpha,12alpha,27-triol-3-one + TPN
- Synthesis of bile acids and bile salts via 27-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 27OH-CHOL + H2O + TPN
- Synthesis of bile acids and bile salts via 27-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 27OH-CHOL + H2O + TPN
- Synthesis of bile acids and bile salts via 27-hydroxycholesterol:
5beta-cholestan-7alpha,12alpha,27-triol-3-one + H+ + TPNH ⟶ 5beta-cholestan-3alpha,7alpha,12alpha,27-tetrol + TPN
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Metabolism of amine-derived hormones:
Iodine + L-Tyr ⟶ HI + MIT
- Thyroxine biosynthesis:
Iodine + L-Tyr ⟶ HI + MIT
- Regulation of thyroid hormone activity:
H+ + TPNH + Thyroxine ⟶ 3,5,3'-triiodothyronine + I- + TPN
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Metabolism of amine-derived hormones:
Iodine + L-Tyr ⟶ HI + MIT
- Thyroxine biosynthesis:
Iodine + L-Tyr ⟶ HI + MIT
- Regulation of thyroid hormone activity:
H+ + TPNH + Thyroxine ⟶ 3,5,3'-triiodothyronine + I- + TPN
- Regulation of thyroid hormone activity:
H+ + TPNH + Thyroxine ⟶ 3,5,3'-triiodothyronine + I- + TPN
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Metabolism of amine-derived hormones:
Iodine + L-Tyr ⟶ HI + MIT
- Thyroxine biosynthesis:
Iodine + L-Tyr ⟶ HI + MIT
- Regulation of thyroid hormone activity:
H+ + TPNH + Thyroxine ⟶ 3,5,3'-triiodothyronine + I- + TPN
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Metabolism of amine-derived hormones:
Iodine + L-Tyr ⟶ HI + MIT
- Thyroxine biosynthesis:
Iodine + L-Tyr ⟶ HI + MIT
- Regulation of thyroid hormone activity:
H+ + TPNH + Thyroxine ⟶ 3,5,3'-triiodothyronine + I- + TPN
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Metabolism of amine-derived hormones:
Iodine + L-Tyr ⟶ HI + MIT
- Thyroxine biosynthesis:
Iodine + L-Tyr ⟶ HI + MIT
- Regulation of thyroid hormone activity:
H+ + TPNH + Thyroxine ⟶ 3,5,3'-triiodothyronine + I- + TPN
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Metabolism of amine-derived hormones:
Iodine + L-Tyr ⟶ HI + MIT
- Thyroxine biosynthesis:
Iodine + L-Tyr ⟶ HI + MIT
- Regulation of thyroid hormone activity:
H+ + TPNH + Thyroxine ⟶ 3,5,3'-triiodothyronine + I- + TPN
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Metabolism of amine-derived hormones:
Iodine + L-Tyr ⟶ HI + MIT
- Thyroxine biosynthesis:
Iodine + L-Tyr ⟶ HI + MIT
- Regulation of thyroid hormone activity:
H+ + TPNH + Thyroxine ⟶ 3,5,3'-triiodothyronine + I- + TPN
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Metabolism of amine-derived hormones:
Iodine + L-Tyr ⟶ HI + MIT
- Thyroxine biosynthesis:
Iodine + L-Tyr ⟶ HI + MIT
- Regulation of thyroid hormone activity:
H+ + TPNH + Thyroxine ⟶ 3,5,3'-triiodothyronine + I- + TPN
- Regulation of thyroid hormone activity:
H+ + TPNH + Thyroxine ⟶ 3,5,3'-triiodothyronine + I- + TPN
- Metabolism of nitric oxide: NOS3 activation and regulation:
H+ + TPNH + sepiapterin ⟶ TPN + dihydrobiopterin
- eNOS activation:
H+ + TPNH + sepiapterin ⟶ TPN + dihydrobiopterin
- Metabolism of nitric oxide: NOS3 activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- eNOS activation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Metabolism of nitric oxide: NOS3 activation and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- eNOS activation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Eicosanoids:
H+ + Oxygen + TPNH + Trioxilin A3 ⟶ 20OH-TrXA3 + H2O + TPN
- Eicosanoids:
prostaglandin H2 ⟶ Prostacyclin
- Eicosanoids:
prostaglandin H2 ⟶ Prostacyclin
- Eicosanoids:
H+ + Oxygen + TPNH + leukotriene B4 ⟶ 20OH-LTB4 + H2O + TPN
- Eicosanoids:
H+ + Oxygen + TPNH + leukotriene B4 ⟶ 20OH-LTB4 + H2O + TPN
- Eicosanoids:
H+ + Oxygen + TPNH + leukotriene B4 ⟶ 20OH-LTB4 + H2O + TPN
- Eicosanoids:
H+ + Oxygen + TPNH + leukotriene B4 ⟶ 20OH-LTB4 + H2O + TPN
- Eicosanoids:
prostaglandin H2 ⟶ Prostacyclin
- Synthesis of Prostaglandins (PG) and Thromboxanes (TX):
H+ + e- + prostaglandin G2 ⟶ H2O + prostaglandin H2
- Arachidonic acid metabolism:
12S-HpETE + GSH ⟶ 12S-HETE + GSSG + H2O
- Synthesis of Prostaglandins (PG) and Thromboxanes (TX):
prostaglandin H2 ⟶ prostaglandin D2
- Arachidonic acid metabolism:
H2O + leukotriene A4 ⟶ leukotriene B4
- Synthesis of Prostaglandins (PG) and Thromboxanes (TX):
prostaglandin H2 ⟶ prostaglandin D2
- Arachidonic acid metabolism:
prostaglandin H2 ⟶ prostaglandin E2
- Synthesis of Prostaglandins (PG) and Thromboxanes (TX):
prostaglandin H2 ⟶ prostaglandin E2
- Synthesis of Prostaglandins (PG) and Thromboxanes (TX):
H+ + e- + prostaglandin G2 ⟶ H2O + prostaglandin H2
- Synthesis of Prostaglandins (PG) and Thromboxanes (TX):
H+ + e- + prostaglandin G2 ⟶ H2O + prostaglandin H2
- Synthesis of Prostaglandins (PG) and Thromboxanes (TX):
H+ + e- + prostaglandin G2 ⟶ H2O + prostaglandin H2
- Arachidonic acid metabolism:
H2O + leukotriene A4 ⟶ leukotriene B4
- Synthesis of Prostaglandins (PG) and Thromboxanes (TX):
prostaglandin H2 ⟶ prostaglandin E2
- Arachidonic acid metabolism:
H2O + leukotriene A4 ⟶ leukotriene B4
- Synthesis of Prostaglandins (PG) and Thromboxanes (TX):
H+ + TPNH + prostaglandin D2 ⟶ 11epi-PGF2a + TPN
- Synthesis of Prostaglandins (PG) and Thromboxanes (TX):
H+ + e- + prostaglandin G2 ⟶ H2O + prostaglandin H2
- Synthesis of Prostaglandins (PG) and Thromboxanes (TX):
H+ + e- + prostaglandin G2 ⟶ H2O + prostaglandin H2
- Estrogen biosynthesis:
H+ + TPNH + estrone ⟶ EST17b + TPN
- Estrogen biosynthesis:
EST17b + TPN ⟶ H+ + TPNH + estrone
- Estrogen biosynthesis:
H+ + TPNH + estrone ⟶ EST17b + TPN
- Metabolism of folate and pterines:
FOLA + H+ + TPNH ⟶ DHF + TPN
- Metabolism of folate and pterines:
F1N9X0 + FOLA ⟶ FOLR2:FOLA
- Metabolism of folate and pterines:
ATP + HCOOH + THF ⟶ 10-formyl-THF + ADP + Pi
- Metabolism of folate and pterines:
FOLA + H+ + TPNH ⟶ DHF + TPN
- Selenoamino acid metabolism:
H2O + SeMet ⟶ 2OBUTA + MeSeH + ammonia
- Metabolism of ingested H2SeO4 and H2SeO3 into H2Se:
H+ + PAPSe + TPNH ⟶ H2O + PAP + SeO3(2-) + TPN
- Vitamin D (calciferol) metabolism:
H+ + Oxygen + TPNH + calciol ⟶ CDL + H2O + TPN
- Vitamin D (calciferol) metabolism:
H+ + Oxygen + TPNH + calciol ⟶ CDL + H2O + TPN
- Vitamin D (calciferol) metabolism:
H+ + Oxygen + TPNH + calciol ⟶ CDL + H2O + TPN
- Vitamin D (calciferol) metabolism:
7-dehydroCHOL ⟶ calciol
- Vitamin D (calciferol) metabolism:
H+ + Oxygen + TPNH + calciol ⟶ CDL + H2O + TPN
- Vitamin D (calciferol) metabolism:
H+ + Oxygen + TPNH + calciol ⟶ CDL + H2O + TPN
- Vitamin D (calciferol) metabolism:
H+ + Oxygen + TPNH + calciol ⟶ CDL + H2O + TPN
- Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK
- Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK
- Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK
- Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK
- Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK
- Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK
- Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK
- Amino acid and derivative metabolism:
GAA + SAM ⟶ CRET + H+ + SAH
- Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK
- Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Tryptophan catabolism:
L-Trp + Oxygen ⟶ NFK
- Synthesis of bile acids and bile salts via 24-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 24OH-CHOL + H2O + TPN
- Synthesis of bile acids and bile salts via 24-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 24OH-CHOL + H2O + TPN
- Synthesis of bile acids and bile salts via 24-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 24OH-CHOL + H2O + TPN
- Synthesis of bile acids and bile salts via 24-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 24OH-CHOL + H2O + TPN
- Synthesis of bile acids and bile salts via 24-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 24OH-CHOL + H2O + TPN
- Synthesis of bile acids and bile salts via 24-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 24OH-CHOL + H2O + TPN
- Synthesis of bile acids and bile salts via 24-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 24OH-CHOL + H2O + TPN
- Synthesis of bile acids and bile salts via 24-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 24OH-CHOL + H2O + TPN
- Fructose metabolism:
GA + H2O + NAD ⟶ DGA + H+ + NADH
- Fructose biosynthesis:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN
- Fructose metabolism:
GA + H2O + NAD ⟶ DGA + H+ + NADH
- Fructose biosynthesis:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN
- Fructose metabolism:
GA + H2O + NAD ⟶ DGA + H+ + NADH
- Fructose biosynthesis:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN
- Fructose metabolism:
ATP + DGA ⟶ 3PDGA + ADP + H+
- Fructose biosynthesis:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN
- Carbohydrate metabolism:
H2O + Heparan(3)-PGs ⟶ CH3COO- + Heparan(4)-PGs
- Fructose metabolism:
GA + H2O + NAD ⟶ DGA + H+ + NADH
- Fructose biosynthesis:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN
- Fructose metabolism:
GA + H2O + NAD ⟶ DGA + H+ + NADH
- Fructose biosynthesis:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN
- Fructose metabolism:
GA + H2O + NAD ⟶ DGA + H+ + NADH
- Fructose biosynthesis:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN
- Fructose metabolism:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN
- Fructose biosynthesis:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN
- Fructose metabolism:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN
- Fructose biosynthesis:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN
- Fructose metabolism:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN
- Fructose biosynthesis:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN
- Carbohydrate metabolism:
ATP + PYR + carbon dioxide ⟶ ADP + OAA + Pi
- Fructose metabolism:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN
- Fructose biosynthesis:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN
- Carbohydrate metabolism:
ATP + PYR + carbon dioxide ⟶ ADP + OAA + Pi
- Fructose metabolism:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN
- Fructose biosynthesis:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN
- Fructose metabolism:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN
- Fructose biosynthesis:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN
- Fructose metabolism:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN
- Fructose biosynthesis:
Glc + H+ + TPNH ⟶ D-sorbitol + TPN
- The canonical retinoid cycle in rods (twilight vision):
DHA + H+ + Oxygen + TPNH ⟶ H2O + HDoHE + TPN
- Glucocorticoid biosynthesis:
17aHPROG + H+ + Oxygen + TPNH ⟶ 11-deoxycortisol + H2O + TPN
- Glucocorticoid biosynthesis:
17aHPROG + H+ + Oxygen + TPNH ⟶ 11-deoxycortisol + H2O + TPN
- Glucocorticoid biosynthesis:
17aHPROG + H+ + Oxygen + TPNH ⟶ 11-deoxycortisol + H2O + TPN
- Glucocorticoid biosynthesis:
17aHPROG + H+ + Oxygen + TPNH ⟶ 11-deoxycortisol + H2O + TPN
- Glucocorticoid biosynthesis:
11-deoxycortisol ⟶ 11DCORT
- Glucocorticoid biosynthesis:
17aHPROG + H+ + Oxygen + TPNH ⟶ 11-deoxycortisol + H2O + TPN
- Glucocorticoid biosynthesis:
17aHPROG + H+ + Oxygen + TPNH ⟶ 11-deoxycortisol + H2O + TPN
- Glucocorticoid biosynthesis:
17aHPROG + H+ + Oxygen + TPNH ⟶ 11-deoxycortisol + H2O + TPN
- Glucocorticoid biosynthesis:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Synthesis of Lipoxins (LX):
NAD + lipoxin A4 ⟶ 15k-LXA4 + H+ + NADH
- Biosynthesis of EPA-derived SPMs:
18(R)-HpEPE + GSH ⟶ 18(R)-HEPE + GSSG + H2O
- Biosynthesis of E-series 18(R)-resolvins:
18(R)-HpEPE + GSH ⟶ 18(R)-HEPE + GSSG + H2O
- Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Synthesis of substrates in N-glycan biosythesis:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P
- GDP-fucose biosynthesis:
GDP-KDGal + H+ + TPNH ⟶ GDP-Fuc + TPN
- Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Synthesis of substrates in N-glycan biosythesis:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P
- GDP-fucose biosynthesis:
GDP-KDGal + H+ + TPNH ⟶ GDP-Fuc + TPN
- Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Synthesis of substrates in N-glycan biosythesis:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P
- GDP-fucose biosynthesis:
alpha-Fuc ⟶ beta-Fuc
- Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Synthesis of substrates in N-glycan biosythesis:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P
- GDP-fucose biosynthesis:
alpha-Fuc ⟶ beta-Fuc
- Metabolism of proteins:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a
- Post-translational protein modification:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a
- Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Synthesis of substrates in N-glycan biosythesis:
ATP + MVA5PP ⟶ ADP + IPPP + Pi + carbon dioxide
- GDP-fucose biosynthesis:
GDP-KDGal + H+ + TPNH ⟶ GDP-Fuc + TPN
- Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH + Q9GU68
- Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH + Q9GU68
- Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Synthesis of substrates in N-glycan biosythesis:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P
- GDP-fucose biosynthesis:
GDP-KDGal + H+ + TPNH ⟶ GDP-Fuc + TPN
- Metabolism of proteins:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Post-translational protein modification:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Synthesis of substrates in N-glycan biosythesis:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P
- GDP-fucose biosynthesis:
GDP-KDGal + H+ + TPNH ⟶ GDP-Fuc + TPN
- Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Synthesis of substrates in N-glycan biosythesis:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P
- GDP-fucose biosynthesis:
alpha-Fuc ⟶ beta-Fuc
- Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Synthesis of substrates in N-glycan biosythesis:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P
- GDP-fucose biosynthesis:
alpha-Fuc ⟶ beta-Fuc
- Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Synthesis of substrates in N-glycan biosythesis:
TPNH + pPNOL ⟶ DCHOL + TPN
- GDP-fucose biosynthesis:
GDP-KDGal + H+ + TPNH ⟶ GDP-Fuc + TPN
- Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Synthesis of substrates in N-glycan biosythesis:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P
- GDP-fucose biosynthesis:
alpha-Fuc ⟶ beta-Fuc
- Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Synthesis of substrates in N-glycan biosythesis:
GlcNGc-6-P + H2O ⟶ CCA + GlcN6P
- GDP-fucose biosynthesis:
alpha-Fuc ⟶ beta-Fuc
- Metabolism of proteins:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a
- Post-translational protein modification:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a
- Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Synthesis of substrates in N-glycan biosythesis:
ATP + MVA5PP ⟶ ADP + IPPP + Pi + carbon dioxide
- GDP-fucose biosynthesis:
GDP-KDGal + H+ + TPNH ⟶ GDP-Fuc + TPN
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Amino acid and derivative metabolism:
GAA + SAM ⟶ CRET + H+ + SAH
- Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala
- Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala
- Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala
- Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala
- Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala
- Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala
- Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala
- Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala
- Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala
- Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala
- Glutamate and glutamine metabolism:
L-Gln + PYR ⟶ 2OGA + L-Ala
- Glutamate and glutamine metabolism:
Glu + L-Glu5S ⟶ 2OG + L-Orn
- Vitamins:
CTL + H+ + Oxygen + TPNH ⟶ CTLA + H2O + TPN
- Vitamins:
CTL + H+ + Oxygen + TPNH ⟶ CTLA + H2O + TPN
- Vitamins:
CTL + H+ + Oxygen + TPNH ⟶ CTLA + H2O + TPN
- Vitamins:
CTL + H+ + Oxygen + TPNH ⟶ CTLA + H2O + TPN
- Vitamins:
CTL + H+ + Oxygen + TPNH ⟶ CTLA + H2O + TPN
- Vitamins:
CTL + H+ + Oxygen + TPNH ⟶ CTLA + H2O + TPN
- Vitamins:
CTL + H+ + Oxygen + TPNH ⟶ CTLA + H2O + TPN
- Metabolism of cofactors:
ISCIT + TPN ⟶ 2OG + H+ + TPNH + carbon dioxide
- Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation:
GTP + H2O ⟶ DHNTP + HCOOH
- Metabolism of cofactors:
H+ + TPNH + sepiapterin ⟶ TPN + dihydrobiopterin
- Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation:
H+ + TPNH + sepiapterin ⟶ TPN + dihydrobiopterin
- Metabolism of cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Metabolism of cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Metabolism of cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Metabolism of cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Metabolism of cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Metabolism of cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Metabolism of cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Metabolism of cofactors:
H+ + TPNH + sepiapterin ⟶ TPN + dihydrobiopterin
- Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation:
H+ + TPNH + sepiapterin ⟶ TPN + dihydrobiopterin
- Metabolism of cofactors:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation:
dihydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH4 ⟶ Tetrahydrobiopterin + p-S1177-eNOS:CaM:HSP90:p-AKT1:BH2
- ESR-mediated signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- ESR-mediated signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- ESR-mediated signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- ESR-mediated signaling:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + HSP90:HSP90 + Pi + Q9VH95 + Q9VL78
- ESR-mediated signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- ESR-mediated signaling:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + HSP90:HSP90 + Immunophilin FKBP52 + Pi + cPGES
- ESR-mediated signaling:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + Fkbp4 + HSP90:HSP90 + Pi + Q9R0Q7
- Signaling by Nuclear Receptors:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- ESR-mediated signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- ESR-mediated signaling:
ESR1 dimer:ESTG + HSP90:ATP:PTGES3:FKBP52:PGR:P4 ⟶ ADP + ESR1:ER:PGR:P4 + HSP90:HSP90 + Pi + Ptges3 + Q9QVC8
- ESR-mediated signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- ESR-mediated signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- ESR-mediated signaling:
SPG ⟶ S1P
- Extra-nuclear estrogen signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Extra-nuclear estrogen signaling:
SPG ⟶ S1P
- Extra-nuclear estrogen signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Extra-nuclear estrogen signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Extra-nuclear estrogen signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Extra-nuclear estrogen signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Extra-nuclear estrogen signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Extra-nuclear estrogen signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Extra-nuclear estrogen signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Extra-nuclear estrogen signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Extra-nuclear estrogen signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Extra-nuclear estrogen signaling:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Biosynthesis of E-series 18(S)-resolvins:
EPA + H+ + Oxygen + TPNH ⟶ 18(S)-HpEPE + TPN
- Metabolism:
H2O + PBG ⟶ HMBL + ammonia
- Lipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Synthesis of bile acids and bile salts via 27-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 27OH-CHOL + H2O + TPN
- Mineralocorticoid biosynthesis:
H+ + Oxygen + TPNH + progesterone ⟶ 11DCORST + H2O + TPN
- Mineralocorticoid biosynthesis:
H+ + Oxygen + TPNH + progesterone ⟶ 11DCORST + H2O + TPN
- Cytochrome P450 - arranged by substrate type:
EtOH + H+ + Oxygen + TPNH ⟶ CH3CHO + H2O + TPN
- Endogenous sterols:
H+ + LAN + Oxygen + TPNH ⟶ 4,4DMCHtOL + H2O + HCOOH + TPN
- Mineralocorticoid biosynthesis:
H+ + Oxygen + TPNH + progesterone ⟶ 11DCORST + H2O + TPN
- Mineralocorticoid biosynthesis:
H+ + Oxygen + TPNH + progesterone ⟶ 11DCORST + H2O + TPN
- Mineralocorticoid biosynthesis:
H+ + Oxygen + TPNH + progesterone ⟶ 11DCORST + H2O + TPN
- Mineralocorticoid biosynthesis:
H+ + Oxygen + TPNH + progesterone ⟶ 11DCORST + H2O + TPN
- Mineralocorticoid biosynthesis:
H+ + Oxygen + TPNH + progesterone ⟶ 11DCORST + H2O + TPN
- Mineralocorticoid biosynthesis:
pregn-5-ene-3,20-dione ⟶ progesterone
- Cytochrome P450 - arranged by substrate type:
H+ + LAN + Oxygen + TPNH ⟶ 4,4DMCHtOL + H2O + HCOOH + TPN
- Endogenous sterols:
H+ + LAN + Oxygen + TPNH ⟶ 4,4DMCHtOL + H2O + HCOOH + TPN
- Phase I - Functionalization of compounds:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Cytochrome P450 - arranged by substrate type:
H+ + LAN + Oxygen + TPNH ⟶ 4,4DMCHtOL + H2O + HCOOH + TPN
- Endogenous sterols:
H+ + LAN + Oxygen + TPNH ⟶ 4,4DMCHtOL + H2O + HCOOH + TPN
- Aflatoxin activation and detoxification:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN
- Aflatoxin activation and detoxification:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN
- Aflatoxin activation and detoxification:
AFXBO-NAC,AFNBO-NAC + H2O ⟶ AFXBO-C,AFNBO-C + CH3COO-
- Synthesis of bile acids and bile salts via 24-hydroxycholesterol:
CHOL + H+ + Oxygen + TPNH ⟶ 24OH-CHOL + H2O + TPN
- Glucocorticoid biosynthesis:
CORT + TPN ⟶ COR + H+ + TPNH
- Glucocorticoid biosynthesis:
CORT + TPN ⟶ COR + H+ + TPNH
- Kandutsch-Russell pathway:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN
- Kandutsch-Russell pathway:
H+ + LTHSOL + Oxygen + TPNH ⟶ 7-dehydroCHOL + H2O + TPN
- Vitamins:
H+ + Oxygen + TPNH + calciol ⟶ CDL + H2O + TPN
- Vitamin D (calciferol) metabolism:
H+ + Oxygen + TPNH + calciol ⟶ CDL + H2O + TPN
- Vitamins:
H+ + Oxygen + TPNH + calciol ⟶ CDL + H2O + TPN
- Vitamin D (calciferol) metabolism:
H+ + Oxygen + TPNH + calciol ⟶ CDL + H2O + TPN
- Vitamins:
H+ + Oxygen + TPNH + atRA ⟶ 4OH-atRA + H2O + TPN
- Vitamin D (calciferol) metabolism:
H+ + Oxygen + TPNH + calciol ⟶ CDL + H2O + TPN
- Vitamins:
CTL + H+ + Oxygen + TPNH ⟶ CTLA + H2O + TPN
- Vitamin D (calciferol) metabolism:
H+ + Oxygen + TPNH + calciol ⟶ CDL + H2O + TPN
- Vitamin D (calciferol) metabolism:
H+ + Oxygen + TPNH + calciol ⟶ CDL + H2O + TPN
- Vitamins:
H+ + Oxygen + TPNH + calciol ⟶ CDL + H2O + TPN
- Synthesis of Prostaglandins (PG) and Thromboxanes (TX):
H+ + e- + prostaglandin G2 ⟶ H2O + prostaglandin H2
- Synthesis of Prostaglandins (PG) and Thromboxanes (TX):
H+ + e- + prostaglandin G2 ⟶ H2O + prostaglandin H2
- Arachidonic acid metabolism:
prostaglandin H2 ⟶ prostaglandin E2
- Synthesis of Prostaglandins (PG) and Thromboxanes (TX):
prostaglandin H2 ⟶ prostaglandin E2
- Metabolism of ingested MeSeO2H into MeSeH:
H+ + MeSeO2H + TPNH ⟶ H2O + MeSeOH + TPN
- Synthesis of epoxy (EET) and dihydroxyeicosatrienoic acids (DHET):
AA + H+ + Oxygen + TPNH ⟶ 5,6-EET + H2O + TPN
- Synthesis of epoxy (EET) and dihydroxyeicosatrienoic acids (DHET):
AA + H+ + Oxygen + TPNH ⟶ 5,6-EET + H2O + TPN
- Synthesis of epoxy (EET) and dihydroxyeicosatrienoic acids (DHET):
AA + H+ + Oxygen + TPNH ⟶ 5,6-EET + H2O + TPN
- Synthesis of epoxy (EET) and dihydroxyeicosatrienoic acids (DHET):
AA + H+ + Oxygen + TPNH ⟶ 5,6-EET + H2O + TPN
- Synthesis of epoxy (EET) and dihydroxyeicosatrienoic acids (DHET):
AA + H+ + Oxygen + TPNH ⟶ 5,6-EET + H2O + TPN
- Synthesis of epoxy (EET) and dihydroxyeicosatrienoic acids (DHET):
AA + H+ + Oxygen + TPNH ⟶ 5,6-EET + H2O + TPN
- Synthesis of epoxy (EET) and dihydroxyeicosatrienoic acids (DHET):
AA + H+ + Oxygen + TPNH ⟶ 5,6-EET + H2O + TPN
- Synthesis of epoxy (EET) and dihydroxyeicosatrienoic acids (DHET):
AA + H+ + Oxygen + TPNH ⟶ 5,6-EET + H2O + TPN
- Synthesis of epoxy (EET) and dihydroxyeicosatrienoic acids (DHET):
AA + H+ + Oxygen + TPNH ⟶ 5,6-EET + H2O + TPN
- Synthesis of epoxy (EET) and dihydroxyeicosatrienoic acids (DHET):
AA + H+ + Oxygen + TPNH ⟶ 5,6-EET + H2O + TPN
- Synthesis of epoxy (EET) and dihydroxyeicosatrienoic acids (DHET):
AA + H+ + Oxygen + TPNH ⟶ 5,6-EET + H2O + TPN
- Synthesis of epoxy (EET) and dihydroxyeicosatrienoic acids (DHET):
AA + H+ + Oxygen + TPNH ⟶ 5,6-EET + H2O + TPN
- Fatty acyl-CoA biosynthesis:
ATP + CIT + CoA-SH ⟶ ADP + Ac-CoA + OA + Pi
- Synthesis of very long-chain fatty acyl-CoAs:
Mal-CoA + PALM-CoA ⟶ 3OOD-CoA + CoA-SH + carbon dioxide
- Androgen biosynthesis:
DHEA + NAD ⟶ ANDST + H+ + NADH
- Androgen biosynthesis:
DHEA + NAD ⟶ ANDST + H+ + NADH
- Bloch pathway:
DESMOL + H+ + TPNH ⟶ CHOL + TPN
- Bloch pathway:
DESMOL + H+ + TPNH ⟶ CHOL + TPN
- Bloch pathway:
DESMOL + H+ + TPNH ⟶ CHOL + TPN
- Bloch pathway:
DESMOL + H+ + TPNH ⟶ CHOL + TPN
- Bloch pathway:
DESMOL + H+ + TPNH ⟶ CHOL + TPN
- Bloch pathway:
DESMOL + H+ + TPNH ⟶ CHOL + TPN
- Bloch pathway:
DESMOL + H+ + TPNH ⟶ CHOL + TPN
- Bloch pathway:
DESMOL + H+ + TPNH ⟶ CHOL + TPN
- Bloch pathway:
CHdOL + H+ + Oxygen + TPNH ⟶ 7dhDESOL + H2O + TPN
- Bloch pathway:
DESMOL + H+ + TPNH ⟶ CHOL + TPN
- Drug ADME:
APAP + UDP-GlcA ⟶ APAP-GlcA + UDP
- APAP ADME:
APAP + UDP-GlcA ⟶ APAP-GlcA + UDP
- Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic
- APAP ADME:
APAP + UDP-GlcA ⟶ APAP-GlcA + UDP
- Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic
- APAP ADME:
APAP + UDP-GlcA ⟶ APAP-GlcA + UDP
- Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic
- APAP ADME:
APAP + UDP-GlcA ⟶ APAP-GlcA + UDP
- Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic
- APAP ADME:
APAP + UDP-GlcA ⟶ APAP-GlcA + UDP
- Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic
- APAP ADME:
APAP + UDP-GlcA ⟶ APAP-GlcA + UDP
- Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic
- APAP ADME:
APAP + UDP-GlcA ⟶ APAP-GlcA + UDP
- Drug ADME:
AMP + abacavir ⟶ Ade-Rib + xenobiotic
- APAP ADME:
APAP + UDP-GlcA ⟶ APAP-GlcA + UDP
- Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic
- APAP ADME:
APAP + UDP-GlcA ⟶ APAP-GlcA + UDP
- Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic
- APAP ADME:
APAP + UDP-GlcA ⟶ APAP-GlcA + UDP
- Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic
- APAP ADME:
APAP + UDP-GlcA ⟶ APAP-GlcA + UDP
- Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic
- APAP ADME:
APAP + UDP-GlcA ⟶ APAP-GlcA + UDP
- Glucocorticoid biosynthesis:
17aHPREG + NAD ⟶ H+ + NADH + pregn-5-ene-3,20-dione-17-ol
- Synthesis of 5-eicosatetraenoic acids:
5S-HpETE + GSH ⟶ 5S-HETE + GSSG + H2O
- Selenoamino acid metabolism:
Sec ⟶ H2Se + L-Ala
- Metabolism of ingested MeSeO2H into MeSeH:
H+ + MeSeO2H + TPNH ⟶ H2O + MeSeOH + TPN
- Selenoamino acid metabolism:
Sec ⟶ H2Se + L-Ala
- Metabolism of ingested MeSeO2H into MeSeH:
H+ + MeSeO2H + TPNH ⟶ H2O + MeSeOH + TPN
- Metabolism of ingested MeSeO2H into MeSeH:
H+ + MeSeO2H + TPNH ⟶ H2O + MeSeOH + TPN
- Selenoamino acid metabolism:
Sec ⟶ H2Se + L-Ala
- Metabolism of ingested MeSeO2H into MeSeH:
H+ + MeSeO2H + TPNH ⟶ H2O + MeSeOH + TPN
- Metabolism of ingested MeSeO2H into MeSeH:
H+ + MeSeO2H + TPNH ⟶ H2O + MeSeOH + TPN
- Selenoamino acid metabolism:
Sec ⟶ H2Se + L-Ala
- Metabolism of ingested MeSeO2H into MeSeH:
H+ + MeSeO2H + TPNH ⟶ H2O + MeSeOH + TPN
- Selenoamino acid metabolism:
H+ + MeSeO2H + TPNH ⟶ H2O + MeSeOH + TPN
- Selenoamino acid metabolism:
Sec ⟶ H2Se + L-Ala
- Metabolism of ingested MeSeO2H into MeSeH:
H+ + MeSeO2H + TPNH ⟶ H2O + MeSeOH + TPN
- Metabolism of ingested MeSeO2H into MeSeH:
H+ + MeSeO2H + TPNH ⟶ H2O + MeSeOH + TPN
- Metabolism of ingested MeSeO2H into MeSeH:
H+ + MeSeO2H + TPNH ⟶ H2O + MeSeOH + TPN
- Metabolism of ingested MeSeO2H into MeSeH:
H+ + MeSeO2H + TPNH ⟶ H2O + MeSeOH + TPN
- Wax and plasmalogen biosynthesis:
H+ + PALM-CoA + TPNH ⟶ CoA-SH + HXOL + TPN
- Wax biosynthesis:
H+ + PALM-CoA + TPNH ⟶ CoA-SH + HXOL + TPN
- Wax biosynthesis:
H+ + PALM-CoA + TPNH ⟶ CoA-SH + HXOL + TPN
- Wax biosynthesis:
H+ + PALM-CoA + TPNH ⟶ CoA-SH + HXOL + TPN
- Wax biosynthesis:
H+ + PALM-CoA + TPNH ⟶ CoA-SH + HXOL + TPN
- Wax biosynthesis:
H+ + PALM-CoA + TPNH ⟶ CoA-SH + HXOL + TPN
- Wax biosynthesis:
H+ + PALM-CoA + TPNH ⟶ CoA-SH + HXOL + TPN
- Wax biosynthesis:
H+ + PALM-CoA + TPNH ⟶ CoA-SH + HXOL + TPN
- Wax biosynthesis:
H+ + PALM-CoA + TPNH ⟶ CoA-SH + HXOL + TPN
- Wax biosynthesis:
H+ + PALM-CoA + TPNH ⟶ CoA-SH + HXOL + TPN
- Wax biosynthesis:
H+ + PALM-CoA + TPNH ⟶ CoA-SH + HXOL + TPN
- Wax biosynthesis:
H+ + PALM-CoA + TPNH ⟶ CoA-SH + HXOL + TPN
- Hemostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF
- Platelet homeostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF
- Nitric oxide stimulates guanylate cyclase:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Immune System:
Rap1 cAMP-GEFs + cAMP ⟶ Rap1 cAMP-GEFs:cAMP
- Innate Immune System:
Cl- + H+ + H2O2 ⟶ H2O + HOCl
- ROS and RNS production in phagocytes:
Cl- + H+ + H2O2 ⟶ H2O + HOCl
- Immune System:
Rap1 cAMP-GEFs + cAMP ⟶ Rap1 cAMP-GEFs:cAMP
- Innate Immune System:
TLR4:TLR6 + oxLDL:CD36 ⟶ TLR4:TLR6:CD36:oxLDL
- ROS and RNS production in phagocytes:
Cl- + H+ + H2O2 ⟶ H2O + HOCl
- Hemostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF
- Platelet homeostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF
- Nitric oxide stimulates guanylate cyclase:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Hemostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF
- Platelet homeostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF
- Nitric oxide stimulates guanylate cyclase:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Immune System:
Rap1 cAMP-GEFs + cAMP ⟶ Rap1 cAMP-GEFs:cAMP
- Innate Immune System:
TLR4:TLR6 + oxLDL:CD36 ⟶ TLR4:TLR6:CD36:oxLDL
- ROS and RNS production in phagocytes:
Cl- + H+ + H2O2 ⟶ H2O + HOCl
- Hemostasis:
2AG + H2O ⟶ AA + Glycerol + H+
- Platelet homeostasis:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Nitric oxide stimulates guanylate cyclase:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Immune System:
cAMP ⟶ Rap1 cAMP-GEFs:cAMP
- Innate Immune System:
Cl- + H+ + H2O2 ⟶ H2O + HOCl
- ROS and RNS production in phagocytes:
Cl- + H+ + H2O2 ⟶ H2O + HOCl
- Immune System:
Epac + cAMP ⟶ RAPGEF3:cAMP complex
- Innate Immune System:
Cl- + H+ + H2O2 ⟶ H2O + HOCl
- ROS and RNS production in phagocytes:
Cl- + H+ + H2O2 ⟶ H2O + HOCl
- Hemostasis:
3AG + H2O ⟶ AA + Glycerol + H+
- Platelet homeostasis:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Nitric oxide stimulates guanylate cyclase:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Hemostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF
- Platelet homeostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF
- Nitric oxide stimulates guanylate cyclase:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Immune System:
Rap1 cAMP-GEFs + cAMP ⟶ Rap1 cAMP-GEFs:cAMP
- Innate Immune System:
Cl- + H+ + H2O2 ⟶ H2O + HOCl
- ROS and RNS production in phagocytes:
Cl- + H+ + H2O2 ⟶ H2O + HOCl
- Hemostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF
- Platelet homeostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF
- Nitric oxide stimulates guanylate cyclase:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Immune System:
Rap1 cAMP-GEFs + cAMP ⟶ Rap1 cAMP-GEFs:cAMP
- Innate Immune System:
TLR4:TLR6 + oxLDL:CD36 ⟶ TLR4:TLR6:CD36:oxLDL
- ROS and RNS production in phagocytes:
H+ + O2.- ⟶ H2O2
- Immune System:
Rap1 cAMP-GEFs + cAMP ⟶ Rap1 cAMP-GEFs:cAMP
- Innate Immune System:
TLR4:TLR6 + oxLDL:CD36 ⟶ TLR4:TLR6:CD36:oxLDL
- ROS and RNS production in phagocytes:
Cl- + H+ + H2O2 ⟶ H2O + HOCl
- Hemostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF
- Platelet homeostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF
- Nitric oxide stimulates guanylate cyclase:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Hemostasis:
3AG + H2O ⟶ AA + Glycerol + H+
- Platelet homeostasis:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Nitric oxide stimulates guanylate cyclase:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Immune System:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Innate Immune System:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- ROS and RNS production in phagocytes:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Hemostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF
- Platelet homeostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF
- Nitric oxide stimulates guanylate cyclase:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Immune System:
Rap1 cAMP-GEFs + cAMP ⟶ Rap1 cAMP-GEFs:cAMP
- Innate Immune System:
TLR4:TLR6 + oxLDL:CD36 ⟶ TLR4:TLR6:CD36:oxLDL
- ROS and RNS production in phagocytes:
Cl- + H+ + H2O2 ⟶ H2O + HOCl
- Hemostasis:
2AG + H2O ⟶ AA + Glycerol + H+
- Platelet homeostasis:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Nitric oxide stimulates guanylate cyclase:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Immune System:
H2O + PC ⟶ Cho + PA
- Innate Immune System:
H2O + PC ⟶ Cho + PA
- ROS and RNS production in phagocytes:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Hemostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF
- Platelet homeostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF
- Immune System:
H2O + PC ⟶ Cho + PA
- Innate Immune System:
H2O + PC ⟶ Cho + PA
- ROS and RNS production in phagocytes:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Hemostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF
- Platelet homeostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF
- Nitric oxide stimulates guanylate cyclase:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Immune System:
Rap1 cAMP-GEFs + cAMP ⟶ Rap1 cAMP-GEFs:cAMP
- Innate Immune System:
TLR4:TLR6 + oxLDL:CD36 ⟶ TLR4:TLR6:CD36:oxLDL
- ROS and RNS production in phagocytes:
Cl- + H+ + H2O2 ⟶ H2O + HOCl
- Nitric oxide stimulates guanylate cyclase:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Synthesis of Dolichyl-phosphate:
ATP + MVA5PP ⟶ ADP + IPPP + Pi + carbon dioxide
- Synthesis of Dolichyl-phosphate:
ATP + MVA5PP ⟶ ADP + IPPP + Pi + carbon dioxide
- Synthesis of Dolichyl-phosphate:
ATP + MVA5PP ⟶ ADP + IPPP + Pi + carbon dioxide
- Synthesis of Dolichyl-phosphate:
ATP + MVA5PP ⟶ ADP + IPPP + Pi + carbon dioxide
- Synthesis of Dolichyl-phosphate:
ATP + MVA5PP ⟶ ADP + IPPP + Pi + carbon dioxide
- Synthesis of Dolichyl-phosphate:
ATP + MVA5PP ⟶ ADP + IPPP + Pi + carbon dioxide
- Synthesis of Dolichyl-phosphate:
ATP + MVA5PP ⟶ ADP + IPPP + Pi + carbon dioxide
- Synthesis of Dolichyl-phosphate:
ATP + MVA5PP ⟶ ADP + IPPP + Pi + carbon dioxide
- Synthesis of Dolichyl-phosphate:
ATP + MVA5PP ⟶ ADP + IPPP + Pi + carbon dioxide
- Synthesis of Dolichyl-phosphate:
TPNH + pPNOL ⟶ DCHOL + TPN
- Synthesis of Dolichyl-phosphate:
ATP + MVA5PP ⟶ ADP + IPPP + Pi + carbon dioxide
- Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Synthesis of substrates in N-glycan biosythesis:
ATP + MVA5PP ⟶ ADP + IPPP + Pi + carbon dioxide
- Synthesis of Dolichyl-phosphate:
ATP + MVA5PP ⟶ ADP + IPPP + Pi + carbon dioxide
- Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Asparagine N-linked glycosylation:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Synthesis of substrates in N-glycan biosythesis:
ATP + MVA5PP ⟶ ADP + IPPP + Pi + carbon dioxide
- Synthesis of Dolichyl-phosphate:
ATP + MVA5PP ⟶ ADP + IPPP + Pi + carbon dioxide
- Synthesis of Dolichyl-phosphate:
ATP + MVA5PP ⟶ ADP + IPPP + Pi + carbon dioxide
- Synthesis of Dolichyl-phosphate:
ATP + MVA5PP ⟶ ADP + IPPP + Pi + carbon dioxide
- Bloch pathway:
CHdOL + H+ + Oxygen + TPNH ⟶ 7dhDESOL + H2O + TPN
- Bloch pathway:
CHdOL + H+ + Oxygen + TPNH ⟶ 7dhDESOL + H2O + TPN
- Cholesterol biosynthesis:
ATP + MVA5PP ⟶ ADP + IPPP + Pi + carbon dioxide
- Biosynthesis of DHA-derived SPMs:
17(S)-Hp-DHA + TPN ⟶ 16S,17S-epoxy-DHA + TPNH
- Biosynthesis of maresins:
14(S)-HDHA + H+ + Oxygen + TPNH ⟶ 14(S),22-diHDHA + H2O + TPN
- Biosynthesis of maresin-like SPMs:
14(S)-HDHA + H+ + Oxygen + TPNH ⟶ 14(S),22-diHDHA + H2O + TPN
- Hemostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF
- Factors involved in megakaryocyte development and platelet production:
Oxygen + TPNH ⟶ H2O2 + TPN
- Factors involved in megakaryocyte development and platelet production:
Oxygen + TPNH ⟶ H2O2 + TPN
- Factors involved in megakaryocyte development and platelet production:
Oxygen + TPNH ⟶ H2O2 + TPN
- Factors involved in megakaryocyte development and platelet production:
Oxygen + TPNH ⟶ H2O2 + TPN
- Factors involved in megakaryocyte development and platelet production:
Oxygen + TPNH ⟶ H2O2 + TPN
- Disease:
ADORA2B + Ade-Rib ⟶ ADORA2B:Ade-Rib
- Diseases of signal transduction by growth factor receptors and second messengers:
H+ + Oxygen + TPNH ⟶ H2O2 + TPN
- Factors involved in megakaryocyte development and platelet production:
Oxygen + TPNH ⟶ H2O2 + TPN
- Hemostasis:
H2O + PAF ⟶ CH3COO- + lyso-PAF
- Factors involved in megakaryocyte development and platelet production:
Oxygen + TPNH ⟶ H2O2 + TPN
- FLT3 signaling in disease:
H+ + Oxygen + TPNH ⟶ H2O2 + TPN
- Signaling by FLT3 ITD and TKD mutants:
H+ + Oxygen + TPNH ⟶ H2O2 + TPN
- STAT5 activation downstream of FLT3 ITD mutants:
H+ + Oxygen + TPNH ⟶ H2O2 + TPN
- Signaling by FLT3 fusion proteins:
H+ + Oxygen + TPNH ⟶ H2O2 + TPN
- Nucleotide salvage:
Ade + PRPP ⟶ AMP + PPi
- Purine salvage:
Ade + PRPP ⟶ AMP + PPi
- Nucleotide salvage:
Ade + PRPP ⟶ AMP + PPi
- Purine salvage:
Ade + PRPP ⟶ AMP + PPi
- Nucleotide salvage:
Ade + PRPP ⟶ AMP + PPi
- Purine salvage:
Ade + PRPP ⟶ AMP + PPi
- Nucleotide salvage:
Ade + PRPP ⟶ AMP + PPi
- Purine salvage:
Ade + PRPP ⟶ AMP + PPi
- Nucleotide salvage:
Ade + PRPP ⟶ AMP + PPi
- Purine salvage:
Ade + PRPP ⟶ AMP + PPi
- Nucleotide salvage:
Ade + PRPP ⟶ AMP + PPi
- Purine salvage:
Ade + PRPP ⟶ AMP + PPi
- Nucleotide salvage:
Ade + PRPP ⟶ AMP + PPi
- Purine salvage:
Ade + PRPP ⟶ AMP + PPi
- Nucleotide salvage:
Ade + PRPP ⟶ AMP + PPi
- Purine salvage:
Ade + PRPP ⟶ AMP + PPi
- Nucleotide salvage:
Ade + PRPP ⟶ AMP + PPi
- Purine salvage:
Ade + PRPP ⟶ AMP + PPi
- Nucleotide salvage:
Gua + R1P, dRibP ⟶ G, dG + Pi
- Purine salvage:
Gua + R1P, dRibP ⟶ G, dG + Pi
- Detoxification of Reactive Oxygen Species:
GSSG + H+ + TPNH ⟶ GSH + TPN
- Signaling by Rho GTPases:
TPNH + dioxygen ⟶ H+ + O2.- + TPN
- RHO GTPase Effectors:
TPNH + dioxygen ⟶ H+ + O2.- + TPN
- RHO GTPases Activate NADPH Oxidases:
TPNH + dioxygen ⟶ H+ + O2.- + TPN
- Detoxification of Reactive Oxygen Species:
GSH + H2O2 ⟶ GSSG + H2O
- Signaling by Receptor Tyrosine Kinases:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- Signaling by VEGF:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- VEGFA-VEGFR2 Pathway:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Signaling by Rho GTPases:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3
- RHO GTPase Effectors:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3
- RHO GTPases Activate NADPH Oxidases:
TPNH + dioxygen ⟶ H+ + O2.- + TPN
- Signaling by Receptor Tyrosine Kinases:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- Signaling by VEGF:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- VEGFA-VEGFR2 Pathway:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Signaling by Rho GTPases:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + Homologues of KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3
- RHO GTPase Effectors:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + Homologues of KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3
- RHO GTPases Activate NADPH Oxidases:
NOX2 complex:RAC2:GTP + S100A8:S100A9:AA:Ca2+ ⟶ NOX2 complex:S100A8:S100A9:Ca2+
- Detoxification of Reactive Oxygen Species:
GSH + H2O2 ⟶ GSSG + H2O
- Cellular responses to stimuli:
GSSG + H+ + TPNH ⟶ GSH + TPN
- Cellular responses to stress:
GSSG + H+ + TPNH ⟶ GSH + TPN
- Detoxification of Reactive Oxygen Species:
GSSG + H+ + TPNH ⟶ GSH + TPN
- Detoxification of Reactive Oxygen Species:
H+ + O2.- ⟶ H2O2 + Oxygen
- Signaling by Rho GTPases:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3
- RHO GTPase Effectors:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3
- RHO GTPases Activate NADPH Oxidases:
NOX2 complex:RAC2:GTP + S100A8:S100A9:AA:Ca2+ ⟶ NOX2 complex:S100A8:S100A9:Ca2+
- Detoxification of Reactive Oxygen Species:
GSH + H2O2 ⟶ GSSG + H2O
- Signaling by Rho GTPases:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3
- RHO GTPase Effectors:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3
- RHO GTPases Activate NADPH Oxidases:
NOX2 complex:RAC2:GTP + S100A8:S100A9:AA:Ca2+ ⟶ NOX2 complex:S100A8:S100A9:Ca2+
- Detoxification of Reactive Oxygen Species:
GSH + H2O2 ⟶ GSSG + H2O
- Infectious disease:
ADORA2B + Ade-Rib ⟶ ADORA2B:Ade-Rib
- Detoxification of Reactive Oxygen Species:
GSH + H2O2 ⟶ GSSG + H2O
- Signaling by Rho GTPases:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + Kdm4c + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3
- RHO GTPase Effectors:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + Kdm4c + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3
- RHO GTPases Activate NADPH Oxidases:
NOX2 complex:RAC2:GTP + S100A8:S100A9:AA:Ca2+ ⟶ NOX2 complex:S100A8:S100A9:Ca2+
- Detoxification of Reactive Oxygen Species:
GSH + H2O2 ⟶ GSSG + H2O
- Signaling by Rho GTPases:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,Me2K-10-H3:KDM1A ⟶ CH2O + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,MeK-10-H3:KDM1A
- RHO GTPase Effectors:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,Me2K-10-H3:KDM1A ⟶ CH2O + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,KLK3 Gene:Nucleosome with p-T12,MeK-10-H3:KDM1A
- RHO GTPases Activate NADPH Oxidases:
NOX2 complex:RAC2:GTP + S100A8:S100A9:AA:Ca2+ ⟶ NOX2 complex:S100A8:S100A9:Ca2+
- Cellular responses to stimuli:
GSSG + H+ + TPNH ⟶ GSH + TPN
- Cellular responses to stress:
GSSG + H+ + TPNH ⟶ GSH + TPN
- Detoxification of Reactive Oxygen Species:
GSSG + H+ + TPNH ⟶ GSH + TPN
- Detoxification of Reactive Oxygen Species:
GSH + H2O2 ⟶ GSSG + H2O
- Signaling by Rho GTPases:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3
- RHO GTPase Effectors:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + KDM4C + SUCCA + carbon dioxide + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3
- RHO GTPases Activate NADPH Oxidases:
NOX2 complex:RAC2:GTP + S100A8:S100A9:AA:Ca2+ ⟶ NOX2 complex:S100A8:S100A9:Ca2+
- Detoxification of Reactive Oxygen Species:
GSH + H2O2 ⟶ GSSG + H2O
- Immune System:
Rap1 cAMP-GEFs + cAMP ⟶ Rap1 cAMP-GEFs:cAMP
- Innate Immune System:
Cl- + H+ + H2O2 ⟶ H2O + HOCl
- ROS and RNS production in phagocytes:
Cl- + H+ + H2O2 ⟶ H2O + HOCl
- Signaling by Receptor Tyrosine Kinases:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- Signaling by VEGF:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- VEGFA-VEGFR2 Pathway:
L-Arg + Oxygen + TPNH ⟶ L-Cit + NO + TPN
- Signaling by Rho GTPases:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + SUCCA + carbon dioxide + kdm4b + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3
- RHO GTPase Effectors:
2OG + Oxygen + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12, Me3K-10-H3:KDM4C ⟶ CH2O + SUCCA + carbon dioxide + kdm4b + p-T774-PKN1:AR:Androgen:KLK2,3 Gene:Nucleosome with p-T12-Me2K-10-H3
- RHO GTPases Activate NADPH Oxidases:
NOX2 complex:RAC2:GTP + S100A8:S100A9:AA:Ca2+ ⟶ NOX2 complex:S100A8:S100A9:Ca2+
- Leishmania infection:
ADORA2B + Ade-Rib ⟶ ADORA2B:Ade-Rib
- Killing mechanisms:
Oxygen + TPNH ⟶ H+ + O2.- + TPN
- WNT5:FZD7-mediated leishmania damping:
Oxygen + TPNH ⟶ H+ + O2.- + TPN
- Signaling by Rho GTPases, Miro GTPases and RHOBTB3:
NOX2 complex:RAC2:GTP + S100A8:S100A9:AA:Ca2+ ⟶ NOX2 complex:S100A8:S100A9:Ca2+
- Signaling by Rho GTPases, Miro GTPases and RHOBTB3:
NOX2 complex:RAC2:GTP + S100A8:S100A9:AA:Ca2+ ⟶ NOX2 complex:S100A8:S100A9:Ca2+
- Signaling by Rho GTPases, Miro GTPases and RHOBTB3:
NOX2 complex:RAC2:GTP + S100A8:S100A9:AA:Ca2+ ⟶ NOX2 complex:S100A8:S100A9:Ca2+
- Signaling by Rho GTPases, Miro GTPases and RHOBTB3:
NOX2 complex:RAC2:GTP + S100A8:S100A9:AA:Ca2+ ⟶ NOX2 complex:S100A8:S100A9:Ca2+
- Signaling by Rho GTPases, Miro GTPases and RHOBTB3:
NOX2 complex:RAC2:GTP + S100A8:S100A9:AA:Ca2+ ⟶ NOX2 complex:S100A8:S100A9:Ca2+
- Signaling by Rho GTPases, Miro GTPases and RHOBTB3:
TPNH + dioxygen ⟶ H+ + O2.- + TPN
- Signaling by Rho GTPases, Miro GTPases and RHOBTB3:
TPNH + dioxygen ⟶ H+ + O2.- + TPN
- Cellular response to chemical stress:
GSSG + H+ + TPNH ⟶ GSH + TPN
- Cellular response to chemical stress:
GSSG + H+ + TPNH ⟶ GSH + TPN
- Signaling by Rho GTPases, Miro GTPases and RHOBTB3:
NOX2 complex:RAC2:GTP + S100A8:S100A9:AA:Ca2+ ⟶ NOX2 complex:S100A8:S100A9:Ca2+
- Signaling by Rho GTPases, Miro GTPases and RHOBTB3:
NOX2 complex:RAC2:GTP + S100A8:S100A9:AA:Ca2+ ⟶ NOX2 complex:S100A8:S100A9:Ca2+
- Parasitic Infection Pathways:
Adenylate cyclase (Mg2+ cofactor) + Gs:GTP ⟶ Gs-activated adenylate cyclase
- TP53 Regulates Metabolic Genes:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O
- Pentose phosphate pathway:
PDG + TPN ⟶ H+ + RU5P + TPNH + carbon dioxide
- Pentose phosphate pathway:
PDG + TPN ⟶ H+ + RU5P + TPNH + carbon dioxide
- Gene expression (Transcription):
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4
- RNA Polymerase II Transcription:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4
- Generic Transcription Pathway:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4
- Transcriptional Regulation by TP53:
GSH + H2O2 ⟶ GSSG + H2O
- TP53 Regulates Metabolic Genes:
GSH + H2O2 ⟶ GSSG + H2O
- TP53 Regulates Metabolic Genes:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O
- Pentose phosphate pathway:
PDG + TPN ⟶ H+ + RU5P + TPNH + carbon dioxide
- Pentose phosphate pathway:
PDG + TPN ⟶ H+ + RU5P + TPNH + carbon dioxide
- TP53 Regulates Metabolic Genes:
H2O2 + Homologues of TXN ⟶ H2O + Homologues of 2xHC-TXN
- Gene expression (Transcription):
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4
- RNA Polymerase II Transcription:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4
- Generic Transcription Pathway:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4
- Transcriptional Regulation by TP53:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O
- TP53 Regulates Metabolic Genes:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O
- Pentose phosphate pathway:
PDG + TPN ⟶ H+ + RU5P + TPNH + carbon dioxide
- Pentose phosphate pathway:
PDG + TPN ⟶ H+ + RU5P + TPNH + carbon dioxide
- TP53 Regulates Metabolic Genes:
Cytochrome c-Fe2+ + H+ + Oxygen ⟶ Cytochrome c-Fe3+ + H+ + H2O
- Pentose phosphate pathway:
PDG + TPN ⟶ H+ + RU5P + TPNH + carbon dioxide
- Gene expression (Transcription):
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4
- RNA Polymerase II Transcription:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4
- Generic Transcription Pathway:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4
- Transcriptional Regulation by TP53:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O
- TP53 Regulates Metabolic Genes:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O
- Carbohydrate metabolism:
Glu + OAA ⟶ 2OG + L-Asp
- Pentose phosphate pathway:
G6P + TPN ⟶ 6-Phospho-D-glucono-1,5-lactone + H+ + TPNH
- Gene expression (Transcription):
GSSG + H+ + TPNH ⟶ GSH + TPN
- RNA Polymerase II Transcription:
GSSG + H+ + TPNH ⟶ GSH + TPN
- Generic Transcription Pathway:
GSSG + H+ + TPNH ⟶ GSH + TPN
- Transcriptional Regulation by TP53:
GSSG + H+ + TPNH ⟶ GSH + TPN
- TP53 Regulates Metabolic Genes:
GSSG + H+ + TPNH ⟶ GSH + TPN
- Pentose phosphate pathway:
PDG + TPN ⟶ H+ + RU5P + TPNH + carbon dioxide
- Gene expression (Transcription):
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4
- RNA Polymerase II Transcription:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4
- Generic Transcription Pathway:
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4
- Transcriptional Regulation by TP53:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O
- TP53 Regulates Metabolic Genes:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O
- Gene expression (Transcription):
H2O2 + PRDX1 dimer ⟶ H2O + HOOS-C52-PRDX1 dimer
- RNA Polymerase II Transcription:
H2O2 + PRDX1 dimer ⟶ H2O + HOOS-C52-PRDX1 dimer
- Generic Transcription Pathway:
H2O2 + PRDX1 dimer ⟶ H2O + HOOS-C52-PRDX1 dimer
- Transcriptional Regulation by TP53:
H2O2 + PRDX1 dimer ⟶ H2O + HOOS-C52-PRDX1 dimer
- TP53 Regulates Metabolic Genes:
H2O2 + PRDX1 dimer ⟶ H2O + HOOS-C52-PRDX1 dimer
- Pentose phosphate pathway:
PDG + TPN ⟶ H+ + RU5P + TPNH + carbon dioxide
- Gene expression (Transcription):
H2O2 + PRDX1 dimer ⟶ H2O + HOOS-C52-PRDX1 dimer
- RNA Polymerase II Transcription:
H2O2 + PRDX1 dimer ⟶ H2O + HOOS-C52-PRDX1 dimer
- Generic Transcription Pathway:
H2O2 + PRDX1 dimer ⟶ H2O + HOOS-C52-PRDX1 dimer
- Transcriptional Regulation by TP53:
H2O2 + PRDX1 dimer ⟶ H2O + HOOS-C52-PRDX1 dimer
- TP53 Regulates Metabolic Genes:
H2O2 + PRDX1 dimer ⟶ H2O + HOOS-C52-PRDX1 dimer
- Pentose phosphate pathway:
PDG + TPN ⟶ H+ + RU5P + TPNH + carbon dioxide
- Pentose phosphate pathway:
PDG + TPN ⟶ H+ + RU5P + TPNH + carbon dioxide
- TP53 Regulates Metabolic Genes:
Cytochrome c (reduced) + H+ + Oxygen ⟶ Cytochrome c (oxidised) + H+ + H2O
- TP53 Regulates Metabolic Genes:
H2O2 + TXN ⟶ F6ZMN7 + H2O
- Pentose phosphate pathway:
PDG + TPN ⟶ H+ + RU5P + TPNH + carbon dioxide
- Diseases of metabolism:
2OG + H+ + TPNH ⟶ 2HG + TPN
- Abnormal conversion of 2-oxoglutarate to 2-hydroxyglutarate:
2OG + H+ + TPNH ⟶ 2HG + TPN
BioCyc(1018)
- acetone degradation I (to methylglyoxal):
H+ + acetoacetate ⟶ CO2 + acetone
- isopropanol biosynthesis (engineered):
NADP+ + propan-2-ol ⟶ H+ + NADPH + acetone
- acetone degradation III (to propane-1,2-diol):
NADP+ + propan-2-ol ⟶ H+ + NADPH + acetone
- acetone degradation I (to methylglyoxal):
NADP+ + propan-2-ol ⟶ H+ + NADPH + acetone
- acetone degradation II (to acetoacetate):
NADP+ + propan-2-ol ⟶ H+ + NADPH + acetone
- propane degradation I:
NAD+ + propan-2-ol ⟶ H+ + NADH + acetone
- sanguinarine and macarpine biosynthesis:
H+ + NADPH + O2 + S-cheilanthifoline ⟶ H2O + NADP+ + S-stylopine
- (-)-medicarpin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + formononetin ⟶ 2-hydroxyformononetin + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of pterocarpan biosynthesis (via formononetin):
O2 + a reduced [NADPH-hemoprotein reductase] + formononetin ⟶ 2-hydroxyformononetin + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of formononetin derivative biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + formononetin ⟶ 2-hydroxyformononetin + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of chorismate metabolism:
3-octaprenyl-4-hydroxybenzoate + H+ ⟶ 2-octaprenylphenol + CO2
- ubiquinol-8 biosynthesis (prokaryotic):
3-octaprenyl-4-hydroxybenzoate + H+ ⟶ 2-octaprenylphenol + CO2
- superpathway of ubiquinol-8 biosynthesis (prokaryotic):
3-octaprenyl-4-hydroxybenzoate + H+ ⟶ 2-octaprenylphenol + CO2
- ubiquinol-8 biosynthesis (prokaryotic):
3-octaprenyl-4-hydroxybenzoate + H+ ⟶ 2-octaprenylphenol + CO2
- superpathway of chorismate metabolism:
2-oxoglutarate + phe ⟶ 3-phenyl-2-oxopropanoate + glu
- superpathway of ubiquinol-8 biosynthesis (prokaryotic):
3-octaprenyl-4-hydroxybenzoate + H+ ⟶ 2-octaprenylphenol + CO2
- ubiquinol-8 biosynthesis (prokaryotic):
3-octaprenyl-4-hydroxybenzoate + H+ ⟶ 2-octaprenylphenol + CO2
- superpathway of chorismate metabolism:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- superpathway of ubiquinol-8 biosynthesis (prokaryotic):
3-octaprenyl-4-hydroxybenzoate + H+ ⟶ 2-octaprenylphenol + CO2
- ubiquinol-8 biosynthesis (prokaryotic):
3-octaprenyl-4-hydroxybenzoate + H+ ⟶ 2-octaprenylphenol + CO2
- superpathway of chorismate metabolism:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- superpathway of ubiquinol-8 biosynthesis (prokaryotic):
3-octaprenyl-4-hydroxybenzoate + H+ ⟶ 2-octaprenylphenol + CO2
- ubiquinol-8 biosynthesis (prokaryotic):
2-octaprenylphenol + H+ + NADPH + O2 ⟶ 3-(all-trans-octaprenyl)benzene-1,2-diol + H2O + NADP+
- superpathway of ubiquinol-8 biosynthesis (prokaryotic):
2-octaprenylphenol + H+ + NADPH + O2 ⟶ 3-(all-trans-octaprenyl)benzene-1,2-diol + H2O + NADP+
- ubiquinol-8 biosynthesis (prokaryotic):
2-methoxy-6-(all-trans-octaprenyl)phenol + H+ + NADPH + O2 ⟶ 2-methoxy-6-all trans-octaprenyl-2-methoxy-1,4-benzoquinol + H2O + NADP+
- superpathway of ubiquinol-8 biosynthesis (prokaryotic):
2-methoxy-6-(all-trans-octaprenyl)phenol + H+ + NADPH + O2 ⟶ 2-methoxy-6-all trans-octaprenyl-2-methoxy-1,4-benzoquinol + H2O + NADP+
- superpathway of chorismate metabolism:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- ubiquinol-8 biosynthesis (prokaryotic):
2-octaprenyl-6-methoxyphenol + H+ + NADPH + O2 ⟶ 2-octaprenyl-6-methoxyquinol + H2O + NADP+
- ubiquinol-8 biosynthesis (prokaryotic):
2-octaprenylphenol + H+ + NADPH + O2 ⟶ 3-(all-trans-octaprenyl)benzene-1,2-diol + H2O + NADP+
- ubiquinol-8 biosynthesis (prokaryotic):
2-octaprenylphenol + H+ + NADPH + O2 ⟶ 3-(all-trans-octaprenyl)benzene-1,2-diol + H2O + NADP+
- superpathway of chorismate metabolism:
2-oxoglutarate + tyr ⟶ 4-hydroxyphenylpyruvate + glt
- ubiquinol-8 biosynthesis (prokaryotic):
2-octaprenylphenol + H+ + NADPH + O2 ⟶ 3-(all-trans-octaprenyl)benzene-1,2-diol + H2O + NADP+
- superpathway of ubiquinol-8 biosynthesis (prokaryotic):
2-octaprenylphenol + H+ + NADPH + O2 ⟶ 3-(all-trans-octaprenyl)benzene-1,2-diol + H2O + NADP+
- ubiquinol-8 biosynthesis (prokaryotic):
2-octaprenylphenol + H+ + NADPH + O2 ⟶ 3-(all-trans-octaprenyl)benzene-1,2-diol + H2O + NADP+
- superpathway of chorismate metabolism:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- superpathway of ubiquinol-8 biosynthesis (prokaryotic):
2-octaprenylphenol + H+ + NADPH + O2 ⟶ 3-(all-trans-octaprenyl)benzene-1,2-diol + H2O + NADP+
- superpathway of ubiquinol-8 biosynthesis (prokaryotic):
2-octaprenylphenol + H+ + NADPH + O2 ⟶ 3-(all-trans-octaprenyl)benzene-1,2-diol + H2O + NADP+
- superpathway of chorismate metabolism:
2-oxoglutarate + tyr ⟶ 4-hydroxyphenylpyruvate + glt
- ubiquinol-8 biosynthesis (prokaryotic):
2-octaprenylphenol + H+ + NADPH + O2 ⟶ 3-(all-trans-octaprenyl)benzene-1,2-diol + H2O + NADP+
- superpathway of ubiquinol-8 biosynthesis (prokaryotic):
2-octaprenylphenol + H+ + NADPH + O2 ⟶ 3-(all-trans-octaprenyl)benzene-1,2-diol + H2O + NADP+
- ubiquinol-8 biosynthesis (prokaryotic):
2-octaprenylphenol + H+ + NADPH + O2 ⟶ 3-(all-trans-octaprenyl)benzene-1,2-diol + H2O + NADP+
- ubiquinol-8 biosynthesis (prokaryotic):
2-octaprenylphenol + H+ + NADPH + O2 ⟶ 3-(all-trans-octaprenyl)benzene-1,2-diol + H2O + NADP+
- ubiquinol-8 biosynthesis (prokaryotic):
2-octaprenylphenol + H+ + NADPH + O2 ⟶ 3-(all-trans-octaprenyl)benzene-1,2-diol + H2O + NADP+
- ubiquinol-8 biosynthesis (prokaryotic):
2-methoxy-6-(all-trans-octaprenyl)phenol + H+ + NADPH + O2 ⟶ 2-methoxy-6-all trans-octaprenyl-2-methoxy-1,4-benzoquinol + H2O + NADP+
- superpathway of ubiquinol-8 biosynthesis (prokaryotic):
2-methoxy-6-(all-trans-octaprenyl)phenol + H+ + NADPH + O2 ⟶ 2-methoxy-6-all trans-octaprenyl-2-methoxy-1,4-benzoquinol + H2O + NADP+
- daunorubicin biosynthesis:
ε-rhodomycinone + dTDP-L-daunosamine ⟶ H+ + dTDP + rhodomycinone D
- ecdysteroid metabolism (arthropods):
3-dehydroecdysone + H+ + NADPH ⟶ 3-epiecdysone + NADP+
- ethionamide activation:
H+ + NADPH + O2 + ethionamide S-oxide ⟶ (2-ethylpyridin-4-yl)(imino)methanesulfinate + H2O + NADP+
- ethionamide activation:
H+ + NADPH + O2 + ethionamide S-oxide ⟶ (2-ethylpyridin-4-yl)(imino)methanesulfinate + H2O + NADP+
- bile acid biosynthesis, neutral pathway:
(25R)-3α,7α-dihydroxy-5-β-cholestanate + ATP + coenzyme A ⟶ (25R)-3α,7α-dihydroxy-5β-cholestanoyl-CoA + AMP + diphosphate
- limonene degradation I (D-limonene):
(1S,2S,4R)-limonene-1,2-diol + oxidized DCPIP ⟶ (1S,4R)-1-hydroxymenth-8-en-2-one + H+ + reduced DCPIP
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
5-hydroxy-coniferaldehyde + SAM ⟶ H+ + SAH + sinapaldehyde
- phenylpropanoid biosynthesis:
5-hydroxy-coniferaldehyde + SAM ⟶ H+ + SAH + sinapaldehyde
- ferulate and sinapate biosynthesis:
5-hydroxy-coniferaldehyde + SAM ⟶ H+ + SAH + sinapaldehyde
- phenol degradation I (aerobic):
H+ + NADPH + O2 + phenol ⟶ H2O + NADP+ + catechol
- 2-nitrophenol degradation:
2-nitrophenol + H+ + NADPH + O2 ⟶ H2O + NADP+ + catechol + nitrite
- phenol degradation I (aerobic):
H+ + NADPH + O2 + phenol ⟶ H2O + NADP+ + catechol
- phenol degradation I (aerobic):
H+ + NADPH + O2 + phenol ⟶ H2O + NADP+ + catechol
- phenol degradation I (aerobic):
H+ + NADPH + O2 + phenol ⟶ H2O + NADP+ + catechol
- superpathway of aromatic compound degradation:
O2 + protocatechuate ⟶ 3-carboxy-cis,cis-muconate + H+
- camalexin biosynthesis:
2-(cystein-S-yl)-2-(1H-indol-3-yl)-acetonitrile + NADP+ ⟶ H+ + NADPH + dihydrocamalexate + hydrogen cyanide
- albaflavenone biosynthesis:
(5R)-albaflavenol + H+ + NADPH + O2 ⟶ H2O + NADP+ + albaflavenone
- albaflavenone biosynthesis:
(+)-epi-isozizaene + H+ + NADPH + O2 ⟶ (5S)-albaflavenol + H2O + NADP+
- t-anethole biosynthesis:
trans-anol + SAM ⟶ t-anethole + H+ + SAH
- epoxypseudoisoeugenol-2-methylbutanoate biosynthesis:
2-methylbutanoate + pseudoisoeugenol ⟶ epoxypseudoisoeugenol-2-methylbutanoate
- matairesinol biosynthesis:
(-)-secoisolariciresinol + NAD+ ⟶ (3R,4R)-3,4-bis(4-hydroxy-3-methoxybenzyl)tetrahydro-2-furanol + H+ + NADH
- justicidin B biosynthesis:
NAD+ + collinusin ⟶ H+ + NADH + justicidin B
- matairesinol biosynthesis:
(+)-lariciresinol + H+ + NADPH ⟶ (-)-secoisolariciresinol + NADP+
- superpathway of Clostridium acetobutylicum acidogenic and solventogenic fermentation:
H+ + acetoacetate ⟶ CO2 + acetone
- superpathway of Clostridium acetobutylicum solventogenic fermentation:
H+ + acetoacetate ⟶ CO2 + acetone
- detoxification of reactive carbonyls in chloroplasts:
(Z)-but-2-enal + H+ + NADPH ⟶ NADP+ + butan-1-al
- glycerol degradation to butanol:
NAD+ + butan-1-ol ⟶ H+ + NADH + butan-1-al
- pyruvate fermentation to butanol I:
NAD+ + butan-1-ol ⟶ H+ + NADH + butan-1-al
- detoxification of reactive carbonyls in chloroplasts:
(Z)-but-2-enal + H+ + NADPH ⟶ NADP+ + butan-1-al
- glycerol degradation to butanol:
NAD+ + glycerol ⟶ H+ + NADH + dihydroxyacetone
- glycerol degradation to butanol:
NAD+ + glycerol ⟶ H+ + NADH + dihydroxyacetone
- glycerol degradation to butanol:
NAD+ + glycerol ⟶ H+ + NADH + dihydroxyacetone
- dimethyl sulfide degradation II (oxidation):
H+ + NADPH + O2 + dimethyl sulfide ⟶ H2O + NADP+ + dimethyl sulfoxide
- superpathway of cholesterol biosynthesis:
H+ + O2 + a ferrocytochrome b5 + lathosterol ⟶ 7-dehydrocholesterol + H2O + a ferricytochrome b5
- cholesterol biosynthesis II (via 24,25-dihydrolanosterol):
H+ + O2 + a ferrocytochrome b5 + lathosterol ⟶ 7-dehydrocholesterol + H2O + a ferricytochrome b5
- cholesterol biosynthesis II (via 24,25-dihydrolanosterol):
24,25-dihydrolanosterol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of cholesterol biosynthesis:
24,25-dihydrolanosterol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol + H2O + an oxidized [NADPH-hemoprotein reductase]
- 2,4-xylenol degradation to protocatechuate:
4-hydroxy-3-methylbenzaldehyde + H2O + NADP+ ⟶ 4-hydroxy-3-methylbenzoate + H+ + NADPH
- dTDP-L-daunosamine biosynthesis:
2-oxoglutarate + dTDP-3-amino-4-dehydro-2,3,6-trideoxy-β-L-glucose ⟶ dTDP-3,4-didehydro-2,6-dideoxy-β-L-glucose + glu
- senecionine N-oxide biosynthesis:
H+ + NADPH + O2 + senecionine ⟶ H2O + NADP+ + senecionine N-oxide
- erythritol degradation I:
D-erythrulose 1-phosphate ⟶ L-erythrulose 1-phosphate
- superpathway of ubiquinol-6 biosynthesis (eukaryotic):
3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate + H+ ⟶ 2-hexaprenyl-6-methoxyphenol + CO2
- ubiquinol-6 biosynthesis from 4-hydroxybenzoate (eukaryotic):
3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate + H+ ⟶ 2-hexaprenyl-6-methoxyphenol + CO2
- ubiquinol-6 bypass biosynthesis (eukaryotic):
3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate + H+ ⟶ 2-hexaprenyl-6-methoxyphenol + CO2
- ubiquinol-6 bypass biosynthesis:
3,4-dihydroxy-5-all-trans-hexaprenylbenzoate + SAM ⟶ 3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate + H+ + SAH
- ubiquinol-6 biosynthesis (eukaryotic):
3-hexaprenyl-4-hydroxybenzoate + H+ + NADPH + O2 ⟶ 3,4-dihydroxy-5-all-trans-hexaprenylbenzoate + H2O + NADP+
- ubiquinol-6 biosynthesis (eukaryotic):
3-hexaprenyl-4-hydroxybenzoate + H+ + NADPH + O2 ⟶ 3,4-dihydroxy-5-all-trans-hexaprenylbenzoate + H2O + NADP+
- kauralexin biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- GA12 biosynthesis:
ent-kaurene + H+ + NADPH + O2 ⟶ ent-kaurenol + H2O + NADP+
- (4S)-carveol and (4S)-dihydrocarveol degradation:
(4S,6S)-cis-carveol + oxidized DCPIP ⟶ (+)-carvone + H+ + reduced DCPIP
- pterocarpan phytoalexins modification (maackiain, medicarpin, pisatin, phaseollin):
(-)-maackiain + H+ + NAD(P)H + O2 ⟶ 1α-hydroxy-maackiain + H2O + NAD(P)+
- retinol biosynthesis:
all-trans-retinol + NADP+ ⟶ all-trans-retinal + H+ + NADPH
- the visual cycle I (vertebrates):
all-trans-retinol + NADP+ ⟶ all-trans-retinal + H+ + NADPH
- retinol biosynthesis:
H2O + a dietary all-trans-retinyl ester ⟶ all-trans-retinol + H+ + a fatty acid
- the visual cycle I (vertebrates):
all-trans-retinol + NADP+ ⟶ all-trans-retinal + H+ + NADPH
- retinol biosynthesis:
all-trans-retinol + NADP+ ⟶ all-trans-retinal + H+ + NADPH
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- L-galactose degradation:
L-galactopyranose + NADP+ ⟶ H+ + L-galactono-1,5-lactone + NADPH
- lycopadiene biosynthesis:
A(H2) + lycopaoctaene ⟶ (2E6E,10E,14E,18E,22E)-lycopahexaene + A
- aflatoxins B1 and G1 biosynthesis:
8-O-methylsterigmatocystin + H+ + NADPH + O2 ⟶ CO2 + H2O + NADP+ + aflatoxin B1 + methanol
- aflatoxins B2 and G2 biosynthesis:
H+ + NADPH + O2 + dihydro-O-methylsterigmatocystin ⟶ CO2 + H2O + NADP+ + aflatoxin B2 + methanol
- (E,E)-4,8,12-trimethyltrideca-1,3,7,11-tetraene biosynthesis:
(E,E)-geranyllinalool + H+ + NADPH + O2 ⟶ H2O + NADP+ + TMTT + but-1-en-3-one
- (4S)-carvone biosynthesis:
(+)-trans-carveol + NAD+ ⟶ (+)-carvone + H+ + NADH
- reductive acetyl coenzyme A pathway I (homoacetogenic bacteria):
CO + H2O + an oxidized ferredoxin [iron-sulfur] cluster ⟶ CO2 + H+ + a reduced ferredoxin [iron-sulfur] cluster
- carbon tetrachloride degradation II:
A(H2) + carbon tetrachloride ⟶ A + H+ + chloride + trichloromethyl radical
- cyclohexanol degradation:
H+ + NADPH + O2 + cyclohexanone ⟶ ε-caprolactone + H2O + NADP+
- oleandomycin biosynthesis:
(S)-methylmalonyl-CoA + H+ + NADPH + acetyl-CoA ⟶ 8,8a-deoxyoleandolide + CO2 + H2O + NADP+ + coenzyme A
- ajmaline and sarpagine biosynthesis:
H2O + polyneuridine aldehyde ⟶ 16-epivellosimine + CO2 + MeOH
- ethene and chloroethene degradation:
H+ + NADH + O2 + ethene ⟶ H2O + NAD+ + ethylene oxide
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- androgen biosynthesis:
17-α-hydroxypregnenolone + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-β-hydroxyandrost-5-en-17-one + H+ + H2O + acetate + an oxidized [NADPH-hemoprotein reductase]
- androgen biosynthesis:
NADP+ + testosterone ⟶ H+ + NADPH + androst-4-ene-3,17-dione
- mithramycin biosynthesis:
dTDP-α-D-olivose + premithramycin A3 ⟶ 3A-deolivosylpremithramycin B + H+ + dTDP
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxotyphasterol + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
6-deoxotyphasterol + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- ursolate biosynthesis:
H+ + NADPH + O2 + uvaol ⟶ H2O + NADP+ + ursolic aldehyde
- pentachlorophenol degradation:
2,3,5,6-tetrachlorohydroquinone + H+ + NAD+ ⟶ 2,3,5,6-tetrachloro-1,4-benzoquinone + NADH
- plant sterol biosynthesis:
4α-formyl-ergosta-7,24(241)-dien-3β-ol + H+ + O2 + a ferrocytochrome b5 ⟶ 4α-carboxy-ergosta-7,24(241)-dien-3β-ol + H2O + a ferricytochrome b5
- juvenile hormone III biosynthesis I:
(2E,6E)-farnesol + NADP+ ⟶ (2E,6E)-farnesal + H+ + NADPH
- juvenile hormone III biosynthesis II:
(2E,6E)-farnesol + NADP+ ⟶ (2E,6E)-farnesal + H+ + NADPH
- farnesylcysteine salvage pathway:
(2E,6E)-farnesol + NADP+ ⟶ (2E,6E)-farnesal + H+ + NADPH
- farnesylcysteine salvage pathway:
(2E,6E)-farnesol + NADP+ ⟶ (2E,6E)-farnesal + H+ + NADPH
- juvenile hormone III biosynthesis I:
(2E,6E)-farnesol + NADP+ ⟶ (2E,6E)-farnesal + H+ + NADPH
- juvenile hormone III biosynthesis II:
(2E,6E)-farnesol + NADP+ ⟶ (2E,6E)-farnesal + H+ + NADPH
- cardenolide biosynthesis:
5-α-pregnane-3,20-dione + NADP+ ⟶ H+ + NADPH + progesterone
- cardenolide biosynthesis:
NADP+ + allopregnanolone ⟶ 5-α-pregnane-3,20-dione + H+ + NADPH
- selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol
- Amaryllidacea alkaloids biosynthesis:
4'-O-methylnorbelladine + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (4aS,10bR)-noroxomaritidine + H2O + an oxidized [NADPH-hemoprotein reductase]
- methyl tert-butyl ether degradation:
H+ + NADH + O2 + methyl tert-butyl ether ⟶ tert-butoxymethanol + H2O + NAD+
- TCA cycle variation I:
2-oxoglutarate + H+ ⟶ CO2 + succinate semialdehyde
- 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutyrate ⟶ glt + succinate semialdehyde
- superpathway of 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutyrate ⟶ glt + succinate semialdehyde
- eugenol and isoeugenol biosynthesis:
acetyl-CoA + coniferyl alcohol ⟶ coenzyme A + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
acetyl-CoA + coniferyl alcohol ⟶ coenzyme A + coniferyl acetate
- diadinoxanthin and diatoxanthin interconversion:
H+ + NADPH + O2 + diatoxanthin ⟶ H2O + NADP+ + diadinoxanthin
- leucodelphinidin biosynthesis:
(2R,3S,4S)-leucodelphinidin + NADP+ ⟶ (+)-dihydromyricetin + H+ + NADPH
- 2,3-trans-flavanols biosynthesis:
(+)-gallocatechin + H2O + NADP+ ⟶ (2R,3S,4S)-leucodelphinidin + H+ + NADPH
- cocaine biosynthesis:
NADP+ + ecgonine methyl ester ⟶ H+ + NADPH + methyl ecgonone
- cholesterol biosynthesis III (via desmosterol):
H+ + NADPH + desmosterol ⟶ NADP+ + cholesterol
- zymosterol biosynthesis:
4α-carboxy-5α-cholesta-8,24-dien-3β-ol + NAD(P)+ ⟶ CO2 + NAD(P)H + zymosterone
- cholesterol biosynthesis I:
H+ + O2 + a ferrocytochrome b5 + lathosterol ⟶ 7-dehydrocholesterol + H2O + a ferricytochrome b5
- superpathway of ergosterol biosynthesis I:
(3S)-2,3-epoxy-2,3-dihydrosqualene ⟶ lanosterol
- zymosterol biosynthesis:
NADP+ + zymosterol ⟶ H+ + NADPH + zymosterone
- cholesterol biosynthesis I:
(3S)-2,3-epoxy-2,3-dihydrosqualene ⟶ lanosterol
- cholesterol biosynthesis III (via desmosterol):
(3S)-2,3-epoxy-2,3-dihydrosqualene ⟶ lanosterol
- superpathway of ergosterol biosynthesis:
NADP+ + ergosterol ⟶ H+ + NADPH + ergosta-5,7,22,24(28)-tetraen-3-β-ol
- zymosterol biosynthesis:
4α-carboxy-5α-cholesta-8,24-dien-3β-ol + NAD(P)+ ⟶ CO2 + NAD(P)H + zymosterone
- zymosterol biosynthesis:
H+ + NADPH + O2 + lanosterol ⟶ 14-demethyllanosterol + H2O + NADP+ + formate
- phosphopantothenate biosynthesis II:
β-alanine + (R)-pantolactone ⟶ (R)-pantothenate + H+
- aurachin RE biosynthesis:
H+ + NADPH + O2 + aurachin D ⟶ 9'-hydroxy-aurachin D + H2O + NADP+
- aurachin A, B, C and D biosynthesis:
aurachin B epoxide ⟶ aurachin A
- very long chain fatty acid biosynthesis:
NADP+ + a (3R)-3-hydroxyacyl-CoA ⟶ H+ + NADPH + a 3-oxoacyl-CoA
- 1,2-propanediol biosynthesis from lactate (engineered):
(S)-propane-1,2-diol + NADP+ ⟶ (S)-lactaldehyde + H+ + NADPH
- galactose degradation IV:
D-galactitol + NAD+ ⟶ H+ + L-xylo-3-hexulose + NADH
- D-glucuronate degradation:
L-gulonate + NADP+ ⟶ aldehydo-D-glucuronate + H+ + NADPH
- L-arabinose degradation II:
NADP+ + xylitol ⟶ H+ + L-xylulose + NADPH
- D-xylose degradation II:
NADP+ + xylitol ⟶ D-xylopyranose + H+ + NADPH
- D-glucuronate degradation I:
NADP+ + xylitol ⟶ H+ + L-xylulose + NADPH
- superpathway of pentose and pentitol degradation:
H2O + L-arabinono-1,4-lactone ⟶ H+ + L-arabinonate
- xylose degradation II:
NADP+ + xylitol ⟶ D-xylopyranose + H+ + NADPH
- yatein biosynthesis II:
O4,O5--dimethylthujaplicatin + H+ + NADPH + O2 ⟶ (-)-yatein + H2O + NADP+
- paspaline biosynthesis:
10,11-epoxy-3-geranylgeranylindole ⟶ emindole-SB
- superpathway of trimethylamine degradation:
H+ + NADPH + O2 + dimethylamine ⟶ H2O + NADP+ + formaldehyde + methylamine
- trimethylamine degradation:
H+ + NADPH + O2 + dimethylamine ⟶ H2O + NADP+ + formaldehyde + methylamine
- colchicine biosynthesis:
O-methylandrocymbine + O2 ⟶ H2O + N-formyldemecolcine
- nitrobenzene degradation I:
N-phenylhydroxylamine ⟶ 2-aminophenol
- nitrobenzene degradation I:
N-phenylhydroxylamine ⟶ 2-aminophenol
- 3,8-divinyl-chlorophyllide a biosynthesis I (aerobic, light-dependent):
3,8-divinyl chlorophyllide a + NADP+ ⟶ 3,8-divinyl protochlorophyllide a + H+ + NADPH + hν
- 3,8-divinyl-chlorophyllide a biosynthesis III (aerobic, light independent):
131-oxo-magnesium-protoporphyrin IX 13-monomethyl ester + NADPH + O2 ⟶ 3,8-divinyl protochlorophyllide a + H2O + NADP+
- menthol biosynthesis:
(-)-menthone + NADP+ ⟶ (+)-pulegone + H+ + NADPH
- canavanine degradation:
H+ + L-canaline + NADPH ⟶ L-homoserine + NADP+ + ammonia
- coumestrol biosynthesis:
H+ + NADPH + daidzein ⟶ (S)-dihydrodaidzein + NADP+
- daidzin and daidzein degradation:
(3R,4S)-tetrahydrodaidzein + A(H2) ⟶ (S)-equol + A + H2O
- plant sterol biosynthesis:
4α-hydroxymethyl-ergosta-7,24(241)-dien-3β-ol + H+ + NADH + O2 ⟶ 4α-formyl-ergosta-7,24(241)-dien-3β-ol + H2O + NAD+
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis:
(2E,6E)-farnesyl diphosphate + H2O ⟶ (3R,6E)-nerolidol + diphosphate
- tetracycline and oxytetracycline biosynthesis:
4-dedimethylamino-4-oxoanhydrotetracycline + an aminated amino group donor ⟶ 4-amino-4-de(dimethylamino)anhydrotetracycline + a deaminated amino group donor
- superpathway of tetracycline and oxytetracycline biosynthesis:
nonaketamide tricyclic intermediate-[OxyC acyl-carrier protein] ⟶ H+ + OxyC acyl-carrier protein + pretetramide
- chlorophyll a biosynthesis II:
NADP+ + chlorophyll a ⟶ H+ + NADPH + tetrahydrogeranylgeranyl chlorophyll a
- chlorophyll a biosynthesis I:
H+ + chlorophyllide a + phytyl diphosphate ⟶ chlorophyll a + diphosphate
- superpathway of bacteriochlorophyll a biosynthesis:
131-oxo-magnesium-protoporphyrin IX 13-monomethyl ester + SAM ⟶ 3,8-divinyl protochlorophyllide a + 5'-deoxyadenosine + H+ + met
- bacteriochlorophyll e biosynthesis:
(31R)-8-ethyl-12-methylbacteriochlorophyllide d ⟶ 8-ethyl-12-methyl-3-vinylbacteriochlorophyllide d + H2O
- bacteriochlorophyll c biosynthesis:
(31R)-8-ethyl-12-methylbacteriochlorophyllide d ⟶ 8-ethyl-12-methyl-3-vinylbacteriochlorophyllide d + H2O
- bacteriochlorophyll d biosynthesis:
(31R)-8-ethyl-12-methylbacteriochlorophyllide d ⟶ 8-ethyl-12-methyl-3-vinylbacteriochlorophyllide d + H2O
- bacteriochlorophyll a biosynthesis:
an oxidized ferredoxin [iron-sulfur] cluster + chlorophyllide a ⟶ 3,8-divinyl chlorophyllide a + H+ + a reduced ferredoxin [iron-sulfur] cluster
- 1,3-propanediol biosynthesis (engineered):
1,3-propanediol + NADP+ ⟶ 3-hydroxypropionaldehyde + H+ + NADPH
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- androgen biosynthesis:
NAD+ + dehydroepiandrosterone ⟶ 5-androstene-3,17-dione + H+ + NADH
- elloramycin biosynthesis:
8-demethyl-8-(2-O-methyl-α-L-rhamnosyl)-tetracenomycin C + SAM ⟶ 8-demethyl-8-(2,3-O-dimethyl-α-L-rhamnosyl)-tetracenomycin C + H+ + SAH
- morphine biosynthesis:
2-oxoglutarate + O2 + codeine ⟶ CO2 + formaldehyde + morphine + succinate
- morphine biosynthesis:
2-oxoglutarate + O2 + codeine ⟶ CO2 + formaldehyde + morphine + succinate
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- superpathway of carotenoid biosynthesis in plants:
γ-carotene ⟶ β-carotene
- 3-hydroxypropanoate/4-hydroxybutanate cycle:
NADP+ + propanoyl-CoA ⟶ H+ + NADPH + acryloyl-CoA
- TCA cycle V (2-oxoglutarate:ferredoxin oxidoreductase):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH
- chorismate biosynthesis from 3-dehydroquinate:
NADP+ + shikimate ⟶ 3-dehydroshikimate + H+ + NADPH
- chorismate biosynthesis II (archaea):
NADP+ + shikimate ⟶ 3-dehydroshikimate + H+ + NADPH
- glyoxylate assimilation:
NADP+ + propanoyl-CoA ⟶ H+ + NADPH + acryloyl-CoA
- D-arabinose degradation III:
D-arabinofuranose + NADP+ ⟶ D-arabinono-1,4-lactone + H+ + NADPH
- mixed acid fermentation:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH
- TCA cycle V (2-oxoglutarate:ferredoxin oxidoreductase):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH
- superpathway of ergosterol biosynthesis II:
(3S)-2,3-epoxy-2,3-dihydrosqualene ⟶ cycloartenol
- ergosterol biosynthesis I:
SAM + zymosterol ⟶ H+ + SAH + fecosterol
- ergosterol biosynthesis II:
(3S)-2,3-epoxy-2,3-dihydrosqualene ⟶ cycloartenol
- ergosterol biosynthesis:
NADP+ + ergosterol ⟶ H+ + NADPH + ergosta-5,7,22,24(28)-tetraen-3-β-ol
- betulinate biosynthesis:
H+ + NADPH + O2 + lupeol ⟶ H2O + NADP+ + betulin
- α-tocopherol degradation:
α-tocopherol + H+ + NADPH + O2 ⟶ 13'-hydroxy-α-tocopherol + H2O + NADP+
- tryptophan degradation via tryptamine:
H2O + O2 + tryptamine ⟶ (indol-3-yl)acetaldehyde + ammonium + hydrogen peroxide
- superpathway of tryptophan utilization:
N-formylkynurenine + H2O ⟶ H+ + L-kynurenine + formate
- L-tryptophan degradation X (mammalian, via tryptamine):
(indol-3-yl)acetaldehyde + H+ + NADPH ⟶ NADP+ + indole-3-ethanol
- tryptophan degradation X (mammalian, via tryptamine):
H2O + O2 + tryptamine ⟶ H+ + ammonia + hydrogen peroxide + indole acetaldehyde
- (4R)-carvone biosynthesis:
geranyl diphosphate ⟶ (4S)-limonene + diphosphate
- ubiquinol-10 biosynthesis:
3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate + H+ ⟶ 6-(all-trans-decaprenyl)-2-methoxy-phenol + CO2
- ubiquinol-10 biosynthesis (eukaryotic):
3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate + H+ ⟶ 6-(all-trans-decaprenyl)-2-methoxy-phenol + CO2
- ubiquinol-10 biosynthesis (prokaryotic):
6-(all-trans-decaprenyl)-2-methoxy-phenol + H+ + NADPH + O2 ⟶ all trans-decaprenyl-2-methoxy-6-1,4-benzoquinol + H2O + NADP+
- pyrimidine ribonucleosides degradation:
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation:
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
3-ureidopropanoate + H+ + H2O ⟶ β-alanine + CO2 + ammonium
- superpathway of pyrimidine ribonucleosides degradation:
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropionate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation II (reductive):
3-ureidopropionate + H2O + H+ ⟶ β-alanine + CO2 + ammonia
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- superpathway of pyrimidine ribonucleosides degradation:
H2O + cytidine ⟶ ammonia + uridine
- uracil degradation I (reductive):
3-ureidopropionate + H2O + H+ ⟶ β-alanine + CO2 + ammonia
- superpathway of pyrimidine ribonucleosides degradation:
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- superpathway of pyrimidine ribonucleosides degradation:
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- tetracycline resistance:
11a-hydroxytetracycline ⟶ 11a-hydroxytetracycline-6,12-hemiketal
- nitrate reduction V (assimilatory):
H2O + NADP+ + nitrite ⟶ H+ + NADPH + nitrate
- nitrate reduction V (assimilatory):
ATP + ammonia + glt ⟶ ADP + H+ + gln + phosphate
- nitrate reduction V (assimilatory):
Glu + H2O + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- tetracenomycin C biosynthesis:
H+ + NADPH + O2 + tetracenomycin A2 ⟶ H2O + NADP+ + tetracenomycin C
- plumbagin biosynthesis:
1,8-dihydroxy-3-methylnaphthalene ⟶ plumbagin
- raspberry ketone biosynthesis:
4-hydroxyphenylbutan-2-one + NADP+ ⟶ 4-hydroxybenzalacetone + H+ + NADPH
- superpathway of diterpene resin acids biosynthesis:
(+)-copalyl diphosphate ⟶ abieta-7,13-diene + diphosphate
- dehydroabietic acid biosynthesis:
(+)-copalyl diphosphate ⟶ abieta-7,13-diene + diphosphate
- homofuraneol biosynthesis:
NADP+ + homofuraneol ⟶ (2E)-2-ethylidene-4-hydroxy-5-methyl-3(2H)-furanone + H+ + NADPH
- homofuraneol biosynthesis:
NADP+ + homofuraneol ⟶ (2E)-2-ethylidene-4-hydroxy-5-methyl-3(2H)-furanone + H+ + NADPH
- hydrogen oxidation III (anaerobic, NADP):
H2 + NADP+ ⟶ H+ + NADPH
- hydrogen production IV:
H2 + NADP+ ⟶ H+ + NADPH
- hydrogen oxidation III (anaerobic, NADP):
H2 + NADP+ ⟶ H+ + NADPH
- hydrogen oxidation III (anaerobic, NADP):
H2 + NADP+ ⟶ H+ + NADPH
- hydrogen oxidation III (anaerobic, NADP):
H2 + NADP+ ⟶ H+ + NADPH
- secologanin and strictosidine biosynthesis:
(6E)-8-oxogeranial + H+ + NAD(P)H ⟶ (+)-cis,trans-nepetalactol + NAD(P)+
- limonene degradation II (L-limonene):
(1R,2R,4S)-limonene-1,2-diol + oxidized DCPIP ⟶ (1R,4S)-1-hydroxymenth-8-en-2-one + H+ + reduced DCPIP
- curcumin degradation:
H+ + NADPH + dihydrocurcumin ⟶ NADP+ + tetrahydrocurcumin
- curcumin degradation:
H+ + NADPH + curcumin ⟶ NADP+ + dihydrocurcumin
- curcumin degradation:
H+ + NADPH + curcumin ⟶ NADP+ + dihydrocurcumin
- curcumin degradation:
H+ + NADPH + dihydrocurcumin ⟶ NADP+ + tetrahydrocurcumin
- pentose phosphate pathway (oxidative branch):
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- NAD/NADP-NADH/NADPH cytosolic interconversion (yeast):
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- superpathway NAD/NADP - NADH/NADPH interconversion (yeast):
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- formaldehyde oxidation I:
hexulose 6-phosphate ⟶ D-ribulose 5-phosphate + formaldehyde
- superpathway of glycolysis and the Entner-Doudoroff pathway:
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate
- D-sorbitol biosynthesis I:
D-sorbitol 6-phosphate + NADP+ ⟶ D-glucopyranose 6-phosphate + H+ + NADPH
- Entner-Doudoroff pathway I:
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate
- heterolactic fermentation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- pentose phosphate pathway:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- pentose phosphate pathway (oxidative branch) I:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- superpathway of glucose and xylose degradation:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- pentose phosphate pathway (oxidative branch) I:
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- superpathway of glycolysis and the Entner-Doudoroff pathway:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- pentose phosphate pathway:
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- superpathway NAD/NADP - NADH/NADPH interconversion:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH
- NAD/NADP-NADH/NADPH cytosolic interconversion:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH
- pentose phosphate pathway (oxidative branch):
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- pentose phosphate pathway:
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- pentose phosphate pathway (oxidative branch) I:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- pentose phosphate pathway:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- superpathway of glycolysis and the Entner-Doudoroff pathway:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- pentose phosphate pathway (oxidative branch) I:
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- pentose phosphate pathway:
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- pentose phosphate pathway (oxidative branch) I:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- pentose phosphate pathway:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- pentose phosphate pathway (oxidative branch):
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- superpathway of glycolysis and the Entner-Doudoroff pathway:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- pentose phosphate pathway (oxidative branch):
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- pentose phosphate pathway:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- pentose phosphate pathway (oxidative branch) I:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- pentose phosphate pathway:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- superpathway of glucose and xylose degradation:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- superpathway of glycolysis and the Entner-Doudoroff pathway:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- Entner-Doudoroff pathway I:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- pentose phosphate pathway (oxidative branch) I:
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- superpathway of glucose and xylose degradation:
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- pentose phosphate pathway:
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- superpathway of glycolysis and the Entner-Doudoroff pathway:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- formaldehyde oxidation I:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- heterolactic fermentation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- superpathway of glycolysis and Entner-Doudoroff:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- pentose phosphate pathway:
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- pentose phosphate pathway (oxidative branch):
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- pentose phosphate pathway (oxidative branch) I:
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- pentose phosphate pathway:
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- superpathway of glycolysis and the Entner-Doudoroff pathway:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- pentose phosphate pathway (oxidative branch):
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- superpathway of glycolysis and Entner-Doudoroff:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- pentose phosphate pathway:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- superpathway of glycolysis and Entner-Doudoroff:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- pentose phosphate pathway (oxidative branch):
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- pentose phosphate pathway:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- pentose phosphate pathway:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- pentose phosphate pathway (oxidative branch):
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- heterolactic fermentation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- heterolactic fermentation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- pentose phosphate pathway:
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- pentose phosphate pathway (oxidative branch) I:
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- superpathway of glucose and xylose degradation:
D-gluconate 6-phosphate + NADP+ ⟶ CO2 + D-ribulose 5-phosphate + NADPH
- superpathway of glycolysis and Entner-Doudoroff:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- formaldehyde oxidation I:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- pentose phosphate pathway (oxidative branch) I:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- pentose phosphate pathway:
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH
- heterolactic fermentation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+
- allopregnanolone biosynthesis:
5-α-pregnane-3,20-dione + NADP+ ⟶ H+ + NADPH + progesterone
- allopregnanolone biosynthesis:
NAD(P)+ + allopregnanolone ⟶ 5-α-pregnane-3,20-dione + H+ + NAD(P)H
- (R)-canadine biosynthesis:
7,8-dihydroberberine + H+ + NADPH ⟶ (R)-canadine + NADP+
- chlorinated phenols degradation:
3-chlorophenol + H+ + NADPH + O2 ⟶ 3-chlorocatechol + H2O + NADP+
- plant sterol biosynthesis II:
4α-methyl-zymosterol ⟶ 4α-methyl-5α-cholesta-7,24-dien-3β-ol
- superpathway of microbial D-galacturonate and D-glucuronate degradation:
aldehydo-D-glucuronate ⟶ D-fructuronate
- D-galacturonate degradation III:
NADP+ + glycerol ⟶ H+ + L-glyceraldehyde + NADPH
- ubiquinol-8 biosynthesis (eukaryotic):
3-methoxy-4-hydroxy-5-all-trans-octaprenylbenzoate + H+ ⟶ 2-methoxy-6-(all-trans-octaprenyl)phenol + CO2
- ubiquinol-8 biosynthesis (eukaryotic):
2-methoxy-6-(all-trans-octaprenyl)phenol + H+ + NADPH + O2 ⟶ 2-methoxy-6-all trans-octaprenyl-2-methoxy-1,4-benzoquinol + H2O + NADP+
- ubiquinol-8 biosynthesis (eukaryotic):
3-octaprenyl-4-hydroxybenzoate + H+ + NADPH + O2 ⟶ 3,4-dihydroxy-5-all-trans-octaprenylbenzoate + H2O + NADP+
- pyruvate fermentation to acetate VIII:
H2O + NADP+ + acetaldehyde ⟶ H+ + NADPH + acetate
- triethylamine degradation:
H+ + diethylamine N-oxide ⟶ acetaldehyde + ethylamine
- pyruvate fermentation to acetate VIII:
H+ + pyruvate ⟶ CO2 + acetaldehyde
- oxidative ethanol degradation III (microsomal):
H+ + NADPH + O2 + ethanol ⟶ H2O + NADP+ + acetaldehyde
- oxidative ethanol degradation III (microsomal):
H+ + NADPH + O2 + ethanol ⟶ H2O + NADP+ + acetaldehyde
- ethylene glycol biosynthesis (engineered):
H+ + NADPH + glycolaldehyde ⟶ NADP+ + ethylene glycol
- autoinducer CAI-1 biosynthesis:
SAM + decanoyl-CoA ⟶ 3-aminotridec-2-en-4-one + S-methyl-5'-thioadenosine + CO2 + coenzyme A
- superpathway of hyoscyamine and scopolamine biosynthesis:
(S)-atropinium + 2-oxoglutarate + O2 ⟶ (6S)-hydroxyhyoscyamine + CO2 + succinate
- calystegine biosynthesis:
pseudotropine ⟶ an unknown compound
- hyoscyamine and scopolamine biosynthesis:
(S)-atropinium + 2-oxoglutarate + O2 ⟶ (6S)-hydroxyhyoscyamine + CO2 + succinate
- dihydroconiferyl alcohol biosynthesis:
H+ + NADPH + coniferaldehyde ⟶ NADP+ + dihydroconiferyl aldehyde
- D-galactose degradation IV:
H+ + L-xylo-3-hexulose + NADPH ⟶ D-sorbitol + NADP+
- phenolphthiocerol biosynthesis:
19-(4-hydroxyphenyl)nonadecanoyl adenylate + holo-(phenol)carboxyphthiodiolenone synthase ⟶ AMP + H+ + a 19-(4-hydroxyphenyl)-nonadecanoyl-[(phenol)carboxyphthiodiolenone synthase]
- phenolphthiocerol biosynthesis:
19-(4-hydroxyphenyl)nonadecanoyl adenylate + holo-(phenol)carboxyphthiodiolenone synthase ⟶ AMP + H+ + a 19-(4-hydroxyphenyl)-nonadecanoyl-[(phenol)carboxyphthiodiolenone synthase]
- 4-hydroxymandelate degradation:
2-(4-hydroxyphenyl)-2-oxoacetate + H+ ⟶ 4-hydroxybenzaldehyde + CO2
- superpathway of aromatic compound degradation via 2-hydroxypentadienoate:
O2 + catechol ⟶ H+ + HMS
- superpathway of aromatic compound degradation via 3-oxoadipate:
O2 + catechol ⟶ H+ + HMS
- toluene degradation III (aerobic) (via p-cresol):
4-methylphenol + H2O + an oxidized azurin ⟶ 4-hydroxybenzyl alcohol + H+ + a reduced azurin
- 4-methylphenol degradation to protocatechuate:
4-methylphenol + H2O + an oxidized azurin ⟶ 4-hydroxybenzyl alcohol + H+ + a reduced azurin
- superpathway of aerobic toluene degradation:
4-methylphenol + H2O + an oxidized azurin ⟶ 4-hydroxybenzyl alcohol + H+ + a reduced azurin
- 4-hydroxymandelate degradation:
4-hydroxybenzoate + H+ + NADPH + O2 ⟶ H2O + NADP+ + protocatechuate
- 4-hydroxymandelate degradation:
4-hydroxybenzoate + H+ + NADPH + O2 ⟶ H2O + NADP+ + protocatechuate
- superpathway of aromatic compound degradation via 3-oxoadipate:
O2 + trp ⟶ N-formylkynurenine
- 4-hydroxymandelate degradation:
4-hydroxybenzoate + H+ + NADPH + O2 ⟶ H2O + NADP+ + protocatechuate
- 4-hydroxymandelate degradation:
4-hydroxybenzoate + H+ + NADPH + O2 ⟶ H2O + NADP+ + protocatechuate
- superpathway of ergotamine biosynthesis:
chanoclavine-I aldehyde ⟶ 6,8-dimethyl-6,7,8,9-tetradehydroergoline + H2O
- ergotamine biosynthesis:
chanoclavine-I aldehyde ⟶ 6,8-dimethyl-6,7,8,9-tetradehydroergoline + H2O
- 2,4-dichlorophenoxyacetate degradation:
2,4-dichlorophenoxyacetate + 2-oxoglutarate + O2 ⟶ 2,4-dichlorophenol + CO2 + glyoxylate + succinate
- patulin biosynthesis:
NADP+ + ascladiol ⟶ H+ + NADPH + patulin
- carnosate bioynthesis:
11-hydroxyferruginol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H+ + H2O + an oxidized [NADPH-hemoprotein reductase] + carnosate
- 2,3-cis-flavanols biosynthesis:
(-)-epicatechin + NADP+ ⟶ H+ + NADPH + cyanidin
- 2,3-cis-flavanols biosynthesis:
(-)-epicatechin + NADP+ ⟶ H+ + NADPH + cyanidin
- isopimaric acid biosynthesis:
(+)-isopimara-7,15-diene + H+ + NADPH + O2 ⟶ H2O + NADP+ + isopimara-7,15-dienol
- stipitatate biosynthesis:
H2O + stipitatonate ⟶ CO2 + H+ + stipitatate
- chlorophyll cycle:
H+ + chlorophyllide a + phytyl diphosphate ⟶ chlorophyll a + diphosphate
- resorcinol degradation:
O2 + hydroxyquinol ⟶ 2-maleylacetate + H+
- resorcinol degradation:
H+ + NADPH + O2 + resorcinol ⟶ H2O + NADP+ + hydroxyquinol
- rosamicin biosynthesis:
(2S)-ethylmalonyl-CoA + (S)-methylmalonyl-CoA + H+ + NADPH + malonyl-CoA ⟶ CO2 + H2O + NADP+ + coenzyme A + tylactone
- tylosin biosynthesis:
(2S)-ethylmalonyl-CoA + (S)-methylmalonyl-CoA + H+ + NADPH + malonyl-CoA ⟶ CO2 + H2O + NADP+ + coenzyme A + tylactone
- vestitol and sativan biosynthesis:
(-)-medicarpin + H+ + NADPH ⟶ (-)-vestitol + NADP+
- baicalein metabolism:
UDP-α-D-glucose + baicalein ⟶ H+ + UDP + baicalein 7-O-β-D-glucoside
- assimilatory sulfate reduction I:
H2O + NADP+ + hydrogen sulfide ⟶ H+ + NADPH + sulfite
- assimilatory sulfate reduction III:
H2O + NADP+ + hydrogen sulfide ⟶ H+ + NADPH + sulfite
- superpathway of sulfate assimilation and cysteine biosynthesis:
H2O + NADP+ + hydrogen sulfide ⟶ H+ + NADPH + sulfite
- superpathway of L-methionine biosynthesis (by sulfhydrylation):
H2O + NADP+ + hydrogen sulfide ⟶ H+ + NADPH + sulfite
- superpathway of sulfur amino acid biosynthesis (Saccharomyces cerevisiae):
H2O + NADP+ + hydrogen sulfide ⟶ H+ + NADPH + sulfite
- assimilatory sulfate reduction I:
ATP + H+ + sulfate ⟶ APS + diphosphate
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phosphooxypyruvate + glu
- superpathway of sulfur amino acid biosynthesis (Saccharomyces cerevisiae):
ATP + H+ + sulfate ⟶ APS + diphosphate
- sulfate reduction I (assimilatory):
ATP + H+ + sulfate ⟶ APS + diphosphate
- sulfate reduction I (assimilatory):
ATP + H+ + sulfate ⟶ APS + diphosphate
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phosphooxypyruvate + Glu
- sulfate reduction I (assimilatory):
ATP + H+ + sulfate ⟶ APS + diphosphate
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phospho-hydroxypyruvate + glt
- superpathway of L-methionine biosynthesis (by sulfhydrylation):
3',5'-ADP + H+ + an oxidized thioredoxin + sulfite ⟶ PAPS + a reduced thioredoxin
- assimilatory sulfate reduction I:
3',5'-ADP + H+ + an oxidized thioredoxin + sulfite ⟶ PAPS + a reduced thioredoxin
- superpathway of sulfate assimilation and cysteine biosynthesis:
3',5'-ADP + H+ + an oxidized thioredoxin + sulfite ⟶ PAPS + a reduced thioredoxin
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phospho-hydroxypyruvate + glt
- sulfate reduction I (assimilatory):
ATP + H+ + sulfate ⟶ APS + diphosphate
- sulfate reduction I (assimilatory):
ATP + H+ + sulfate ⟶ APS + diphosphate
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phospho-hydroxypyruvate + glt
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phospho-hydroxypyruvate + glt
- sulfate reduction I (assimilatory):
ATP + H+ + sulfate ⟶ APS + diphosphate
- superpathway of methionine biosynthesis (by sulfhydrylation):
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- sulfate reduction I (assimilatory):
ATP + H+ + sulfate ⟶ adenosine 5'-phosphosulfate + diphosphate
- sulfate reduction III (assimilatory):
ATP + H+ + sulfate ⟶ adenosine 5'-phosphosulfate + diphosphate
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phospho-hydroxypyruvate + glt
- sulfate reduction I (assimilatory):
ATP + H+ + sulfate ⟶ APS + diphosphate
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phospho-hydroxypyruvate + glt
- superpathway of L-methionine biosynthesis (by sulfhydrylation):
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- superpathway of L-methionine biosynthesis (by sulfhydrylation):
H2O + NADP+ + hydrogen sulfide ⟶ H+ + NADPH + sulfite
- assimilatory sulfate reduction I:
H2O + NADP+ + hydrogen sulfide ⟶ H+ + NADPH + sulfite
- superpathway of sulfate assimilation and cysteine biosynthesis:
H2O + NADP+ + hydrogen sulfide ⟶ H+ + NADPH + sulfite
- superpathway of L-methionine biosynthesis (by sulfhydrylation):
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phosphooxypyruvate + glu
- sulfate reduction I (assimilatory):
ATP + H+ + sulfate ⟶ APS + diphosphate
- sulfate reduction I (assimilatory):
ATP + H+ + sulfate ⟶ APS + diphosphate
- sulfate reduction I (assimilatory):
ATP + H+ + sulfate ⟶ APS + diphosphate
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phospho-hydroxypyruvate + glt
- assimilatory sulfate reduction I:
ATP + H+ + sulfate ⟶ APS + diphosphate
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phosphooxypyruvate + glu
- superpathway of sulfur amino acid biosynthesis (Saccharomyces cerevisiae):
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- sulfate reduction I (assimilatory):
ATP + adenosine 5'-phosphosulfate ⟶ ADP + H+ + phosphoadenosine-5'-phosphosulfate
- sulfate reduction I (assimilatory):
ATP + H+ + sulfate ⟶ APS + diphosphate
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phospho-hydroxypyruvate + glt
- sulfate reduction I (assimilatory):
ATP + H+ + sulfate ⟶ APS + diphosphate
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phospho-hydroxypyruvate + glt
- sulfate reduction I (assimilatory):
ATP + H+ + sulfate ⟶ APS + diphosphate
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phospho-hydroxypyruvate + glt
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phospho-hydroxypyruvate + glt
- sulfate reduction I (assimilatory):
ATP + adenosine 5'-phosphosulfate ⟶ ADP + H+ + phosphoadenosine-5'-phosphosulfate
- sulfate reduction III (assimilatory):
ATP + H+ + sulfate ⟶ adenosine 5'-phosphosulfate + diphosphate
- sulfate reduction I (assimilatory):
ATP + adenosine 5'-phosphosulfate ⟶ ADP + H+ + phosphoadenosine-5'-phosphosulfate
- superpathway of sulfate assimilation and cysteine biosynthesis:
2-oxoglutarate + 3-phospho-L-serine ⟶ 3-phospho-hydroxypyruvate + glt
- sulfate reduction I (assimilatory):
ATP + H+ + sulfate ⟶ APS + diphosphate
- superpathway of L-methionine biosynthesis (by sulfhydrylation):
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- sulfate reduction I (assimilatory):
ATP + H+ + sulfate ⟶ APS + diphosphate
- nicotine degradation III:
H2O + O2 + nicotine-Δ1'5'-iminium ion ⟶ H+ + cotinine + hydrogen peroxide
- phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
H2O + O2 + phe ⟶ CO2 + ammonia + hydrogen peroxide + phenylacetaldehyde
- superpathway of citrulline metabolism:
ATP + CO2 + H2O + ammonia ⟶ ADP + H+ + carbamoyl-phosphate + phosphate
- citrulline-nitric oxide cycle:
L-arginino-succinate ⟶ arg + fumarate
- citrulline-nitric oxide cycle:
L-arginino-succinate ⟶ arg + fumarate
- superpathway of citrulline metabolism:
H2O + gln ⟶ H+ + ammonia + glt
- citrulline-nitric oxide cycle:
L-arginino-succinate ⟶ arg + fumarate
- citrulline-nitric oxide cycle:
L-arginino-succinate ⟶ arg + fumarate
- superpathway of erythromycin biosynthesis:
dTDP-β-L-mycarose + erythronolide B ⟶ 3-α-mycarosylerythronolide B + H+ + dTDP
- superpathway of megalomicin A biosynthesis:
dTDP-β-L-mycarose + erythronolide B ⟶ 3-α-mycarosylerythronolide B + H+ + dTDP
- erythromycin D biosynthesis:
dTDP-β-L-mycarose + erythronolide B ⟶ 3-α-mycarosylerythronolide B + H+ + dTDP
- superpathway of erythromycin biosynthesis (without sugar biosynthesis):
dTDP-β-L-mycarose + erythronolide B ⟶ 3-α-mycarosylerythronolide B + H+ + dTDP
- phaseollin biosynthesis:
(-)-phaseollidin + H+ + NADPH + O2 ⟶ (-)-phaseollin + H2O + NADP+
- superpathway of pterocarpan biosynthesis (via daidzein):
(-)-glycinol + DMAPP ⟶ (6αS,11αS)-2-dimethylallyl-3,6α,9-trihydroxypterocarpan + diphosphate
- artemisinin biosynthesis:
(+)-amorpha-4,11-diene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + artemisinic alcohol
- superpathway of lipoxygenase:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(Z)-hex-3-en-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- trichloroethene degradation:
O2 + trichloroethanol ⟶ 2,2,2-trichloroacetate + H+ + H2O
- nitrobenzene degradation I:
hydroxyaminobenzene ⟶ 2-aminophenol
- ceramide de novo biosynthesis:
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine + CO2 + coenzyme A
- sphingolipid biosynthesis (mammals):
D-erythro-sphinganine + an acyl-CoA ⟶ H+ + a dihydroceramide + coenzyme A
- ceramide de novo biosynthesis:
D-erythro-sphinganine + an acyl-CoA ⟶ H+ + a dihydroceramide + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + O2 + a dihydroceramide + a ferrocytochrome b5 ⟶ H2O + a ferricytochrome b5 + a phytoceramide
- sphingolipid biosynthesis (yeast):
D-erythro-sphinganine + NADP+ ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis:
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine + CO2 + coenzyme A
- ceramide de novo biosynthesis:
D-erythro-sphinganine + NADP+ ⟶ 3-dehydrosphinganine + H+ + NADPH
- hinokinin biosynthesis:
(-)-matairesinol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (-)-pluviatolide + H2O + an oxidized [NADPH-hemoprotein reductase]
- methylglyoxal degradation III:
NADP+ + acetol ⟶ H+ + NADPH + methylglyoxal
- superpathway of methylglyoxal degradation:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + acetol
- propane degradation II:
NAD+ + propan-2-ol ⟶ H+ + NADH + acetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + acetol
- methylglyoxal degradation III:
NADP+ + acetol ⟶ H+ + NADPH + methylglyoxal
- superpathway of methylglyoxal degradation:
NADP+ + acetol ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + acetol
- methylglyoxal degradation III:
NADP+ + acetol ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + acetol ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + acetol ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + acetol ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + acetol ⟶ H+ + NADPH + methylglyoxal
- superpathway of methylglyoxal degradation:
NADP+ + acetol ⟶ H+ + NADPH + methylglyoxal
- superpathway of methylglyoxal degradation:
NADP+ + acetol ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + acetol ⟶ H+ + NADPH + methylglyoxal
- superpathway of methylglyoxal degradation:
NADP+ + acetol ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + acetol ⟶ H+ + NADPH + methylglyoxal
- lactose degradation II:
3'-ketolactose + H2O ⟶ β-D-glucose + 3-keto-β-D-galactose
- lactose degradation II:
3'-ketolactose + H2O ⟶ β-D-glucose + 3-keto-β-D-galactose
- coumarin metabolism (to melilotic acid):
H2O + dihydrocoumarin ⟶ H+ + melilotate
- phenylmercury acetate degradation:
H+ + mercuriphenyl acetate ⟶ Hg2+ + acetate + benzene
- phenylmercury acetate degradation:
H+ + mercuriphenyl acetate ⟶ Hg2+ + acetate + benzene
- phenylmercury acetate degradation:
H+ + mercuriphenyl acetate ⟶ Hg2+ + acetate + benzene
- phenylmercury acetate degradation:
H+ + mercuriphenyl acetate ⟶ Hg2+ + acetate + benzene
- phenylmercury acetate degradation:
H+ + mercuriphenyl acetate ⟶ Hg2+ + acetate + benzene
- phenylmercury acetate degradation:
H+ + mercuriphenyl acetate ⟶ Hg2+ + acetate + benzene
- sphingosine and sphingosine-1-phosphate metabolism:
NADP+ + palmitaldehyde ⟶ (2E)-hexadecenal + H+ + NADPH
- sphingosine and sphingosine-1-phosphate metabolism:
sphingosine 1-phosphate ⟶ (2E)-hexadecenal + O-phosphoethanolamine
- sphingosine and sphingosine-1-phosphate metabolism:
ATP + sphingosine ⟶ ADP + H+ + sphingosine-1-phosphate
- sphingosine and sphingosine-1-phosphate metabolism:
NADP+ + palmitaldehyde ⟶ (2E)-hexadecenal + H+ + NADPH
- sphingosine and sphingosine-1-phosphate metabolism:
ATP + sphingosine ⟶ ADP + H+ + sphingosine-1-phosphate
- sphingosine and sphingosine-1-phosphate metabolism:
ATP + sphingosine ⟶ ADP + H+ + sphingosine-1-phosphate
- polybrominated dihydroxylated diphenyl ethers biosynthesis:
3,5-dibromocatechol + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ 3-bromo-5-(3,5-dibromo-2-hydroxyphenoxy)benzene-1,2-diol + H2O + an oxidized ferredoxin [iron-sulfur] cluster + bromide
- spongiadioxin C biosynthesis:
2,4-dibromophenol + 3,5-dibromocatechol + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ 6,6'-oxybis(2,4-dibromophenol) + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- bacteriochlorophyll b biosynthesis:
ADP + an oxidized ferredoxin [iron-sulfur] cluster + bacteriochlorophyllide g + phosphate ⟶ 3,8-divinyl chlorophyllide a + ATP + H+ + H2O + a reduced ferredoxin [iron-sulfur] cluster
- superpathway of seleno-compound metabolism:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol
- selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol
- selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol
- selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol
- selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol
- selenate reduction:
H+ + NADPH + selenodiglutathione ⟶ NADP+ + glutathione + glutathioselenol
- selenate reduction:
H+ + NADPH + selenodiglutathione ⟶ NADP+ + glutathione + glutathioselenol
- selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol
- mannitol biosynthesis:
D-mannitol 1-phosphate + H2O ⟶ D-mannitol + phosphate
- mannitol biosynthesis:
D-mannitol 1-phosphate + H2O ⟶ D-mannitol + phosphate
- tetrahydroxyxanthone biosynthesis (from benzoate):
2,3',4,6-tetrahydroxybenzophenone + NADPH + O2 ⟶ 1,3,7-trihydroxyxanthone + H2O + NADP+
- tetrahydroxyxanthone biosynthesis (from 3-hydroxybenzoate):
2,3',4,6-tetrahydroxybenzophenone + NADPH + O2 ⟶ 1,3,5-trihydroxyxanthone + H2O + NADP+
- superpathway of tetrahydroxyxanthone biosynthesis:
2,3',4,6-tetrahydroxybenzophenone + NADPH + O2 ⟶ 1,3,5-trihydroxyxanthone + H2O + NADP+
- methylglyoxal degradation V:
(S)-lactaldehyde + H2O + NAD+ ⟶ (S)-lactate + H+ + NADH
- methylglyoxal degradation IV:
(S)-lactaldehyde + H2O + NAD+ ⟶ (S)-lactate + H+ + NADH
- L-rhamnose degradation II:
2-dehydro-3-deoxy-L-rhamnonate ⟶ (S)-lactaldehyde + pyruvate
- methylglyoxal degradation IV:
(S)-lactaldehyde + NADP+ ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation V:
(S)-lactaldehyde + NADP+ ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation V:
L-lactaldehyde + NADP+ ⟶ H+ + NADPH + methylglyoxal
- L-rhamnose degradation II:
H2O + L-lactaldehyde + NADP+ ⟶ (S)-lactate + H+ + NADPH
- methylglyoxal degradation V:
L-lactaldehyde + NADP+ ⟶ H+ + NADPH + methylglyoxal
- plant sterol biosynthesis:
24-epi-campesterol + NADP+ ⟶ H+ + NADPH + brassicasterol
- L-rhamnose degradation III:
L-rhamnofuranose + NADP+ ⟶ H+ + L-rhamnono-1,4-lactone + NADPH
- narbomycin, pikromycin and novapikromycin biosynthesis:
(S)-methylmalonyl-CoA + H+ + NADPH + malonyl-CoA ⟶ CO2 + H2O + NADP+ + coenzyme A + narbonolide
- L-arabinose degradation II:
D-xylitol + NADP+ ⟶ H+ + L-xylulose + NADPH
- L-arabinose degradation II:
L-arabitol + NADP+ ⟶ H+ + L-arabinose + NADPH
- (-)-maackiain biosynthesis:
(3R,4R)-3-(6-hydroxy-1,3-benzodioxol-5-yl)-3,4-dihydro-2H-chromene-4,7-diol ⟶ (-)-maackiain + H2O
- 4-nitrophenol degradation I:
4-nitrophenol + H+ + NAD(P)H + O2 ⟶ 1,4-benzoquinone + H2O + NAD(P)+ + nitrite
- ursodeoxycholate biosynthesis (bacteria):
NADP+ + ursodeoxycholate ⟶ 7-oxolithocholate + H+ + NADPH
- Entner-Doudoroff pathway II (non-phosphorylative):
D-glucopyranose + NADP+ ⟶ D-glucono-1,5-lactone + H+ + NADPH
- sucrose degradation VII (sucrose 3-dehydrogenase):
A + sucrose ⟶ 3'-ketosucrose + A(H2)
- Entner-Doudoroff pathway III (semi-phosphorylative):
D-glucopyranose + NADP+ ⟶ D-glucono-1,5-lactone + H+ + NADPH
- brassinosteroid biosynthesis I:
6-deoxotyphasterol + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis III:
NAD+ + campesterol ⟶ NADH + campest-5-en-3-one
- botryococcenes and methylated squalene biosynthesis:
SAM + showacene ⟶ 3,20-dimethyl-1,2,21,22-tetradehydro-2,3,20,21-tetrahydrobotryococcene + H+ + SAH
- D-xylose degradation III:
D-xylopyranose + NADP+ ⟶ D-xylono-1,5-lactone + H+ + NADPH
- cinchona alkaloids biosynthesis:
corynantheal ⟶ quinidinone
- aclacinomycin biosynthesis:
aklavinone + dTDP-β-L-rhodosamine ⟶ H+ + aclacinomycin T + dTDP
- oryzalide A biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-isokaurene + diphosphate
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucodelphinidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- flavonol biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- syringetin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- flavonoid biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ (+)-dihydrokaempferol + CO2 + succinate
- flavonoid biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ (+)-dihydrokaempferol + CO2 + succinate
- methylglyoxal degradation II:
H2O + NADP+ + methylglyoxal ⟶ H+ + NADPH + pyruvate
- shikonin biosynthesis:
A + H2O + deoxyshikonin ⟶ A(H2) + shikonin
- diphenyl ethers degradation:
O2 + diphenyl ether 2,3-diol ⟶ (2Z,4E)-2-hydroxy-6-oxo-6-phenoxyhexa-2,4-dienoate + H+
- 2,5-xylenol and 3,5-xylenol degradation:
(2E)-3-methyl-4,6-dioxohept-2-enedioate + H2O ⟶ H+ + citraconate + pyruvate
- pinitol biosynthesis II:
myo-inositol + SAM ⟶ H+ + SAH + sequoyitol
- (4R)-carveol and (4R)-dihydrocarveol degradation:
(-)-cis-carveol + oxidized DCPIP ⟶ (-)-carvone + H+ + reduced DCPIP
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- phthiocerol biosynthesis:
(behenoyl)adenylate + holo-(phenol)carboxyphthiodiolenone synthase ⟶ AMP + H+ + a behenoyl-[(phenol)carboxyphthiodiolenone synthase]
- phthiocerol biosynthesis:
(behenoyl)adenylate + holo-(phenol)carboxyphthiodiolenone synthase ⟶ AMP + H+ + a behenoyl-[(phenol)carboxyphthiodiolenone synthase]
- polymethylated quercetin glucoside biosynthesis II - quercetagetin series (Chrysosplenium):
3,6,7-trimethylquercetagetin + SAM ⟶ 3,6,7,4'-tetramethylquercetagetin + H+ + SAH
- superpathway of polymethylated quercetin/quercetagetin glucoside biosynthesis (Chrysosplenium):
3,6,7-trimethylquercetagetin + SAM ⟶ 3,6,7,4'-tetramethylquercetagetin + H+ + SAH
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis (yeast):
2'-hydroxypyridoxol + A(H2) ⟶ A + H2O + pyridoxine
- pyridoxal 5'-phosphate salvage II (plants):
H2O + pyridoxine 5'-phosphate ⟶ phosphate + pyridoxine
- superpathway of thiamin diphosphate biosynthesis III (eukaryotes):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- 4-amino-2-methyl-5-phosphomethylpyrimidine biosynthesis:
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
ATP + pyridoxal ⟶ ADP + H+ + PLP
- polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
2-oxoglutarate + 3,7,4'-trimethylquercetin + O2 ⟶ 3,7,4'-trimethylquercetagetin + CO2 + succinate
- (-)-glycinol biosynthesis:
(6aR,11aR)-3,9-dihydroxypterocarpan + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (-)-glycinol + H2O + an oxidized [NADPH-hemoprotein reductase]
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- cholesterol biosynthesis III (via desmosterol):
4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol + NADPH + O2 ⟶ 4,4-dimethyl-5-α-cholesta-8,14,24-trien-3-β-ol + H2O + NADP+ + formate
- superpathway of cholesterol biosynthesis:
ATP + mevalonate-diphosphate ⟶ ADP + CO2 + H+ + isopentenyl diphosphate + phosphate
- cholesterol biosynthesis III (via desmosterol):
4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol + NADPH + O2 ⟶ 4,4-dimethyl-5-α-cholesta-8,14,24-trien-3-β-ol + H2O + NADP+ + formate
- cholesterol biosynthesis III (via desmosterol):
4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol + NADPH + O2 ⟶ 4,4-dimethyl-5-α-cholesta-8,14,24-trien-3-β-ol + H2O + NADP+ + formate
- superpathway of cholesterol biosynthesis:
H+ + NADPH + desmosterol ⟶ NADP+ + cholesterol
- cholesterol biosynthesis III (via desmosterol):
H+ + NADPH + desmosterol ⟶ NADP+ + cholesterol
- methymycin, neomethymycin and novamethymycin biosynthesis:
(S)-methylmalonyl-CoA + H+ + NADPH + malonyl-CoA ⟶ 10-deoxymethynolide + CO2 + H2O + NADP+ + coenzyme A
- 1,8-cineole degradation:
1,6,6-trimethyl-2,7-dioxobicyclo-(3,2,2)nonan-3-one ⟶ 4,5-dihydro-5,5-dimethyl-4-(3-oxobutyl)furan-2(3H)-one
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- 6-methoxymellein biosynthesis:
6-hydroxymellein + SAM ⟶ 6-methoxymellein + H+ + SAH
- coelimycin P1 biosynthesis:
(2E,5S,6E,8E,10E)-1-aminododeca-2,6,8,10-tetraen-5-ol + pyruvate ⟶ (2E,5S,6E,8E,10E)-5-hydroxydodeca-2,6,8,10-tetraenal + ala
- L-homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- L-lysine biosynthesis VI:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- L-lysine biosynthesis II:
L-2-acetamido-6-oxoheptanedioate + glu ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate
- L-lysine biosynthesis III:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- L-lysine biosynthesis I:
N-succinyl-L,L-2,6-diaminopimelate + H2O ⟶ L,L-diaminopimelate + succinate
- spermidine biosynthesis II:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- grixazone biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- norspermidine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of polyamine biosynthesis III:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- ectoine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-methionine biosynthesis (transsulfuration):
L-homocysteine + a 5-methyltetrahydrofolate ⟶ a tetrahydrofolate + met
- superpathway of L-homoserine and L-methionine biosynthesis:
L-homocysteine + a 5-methyltetrahydrofolate ⟶ a tetrahydrofolate + met
- L-methionine biosynthesis IV (archaea):
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis I:
ATP + L-homoserine ⟶ ADP + H+ + O-phospho-L-homoserine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
ATP + L-homoserine ⟶ ADP + H+ + O-phospho-L-homoserine
- superpathway of L-threonine biosynthesis:
ATP + L-homoserine ⟶ ADP + H+ + O-phospho-L-homoserine
- aspartate superpathway:
ATP + L-homoserine ⟶ ADP + H+ + O-phospho-L-homoserine
- superpathway of S-adenosyl-L-methionine biosynthesis:
ATP + H2O + met ⟶ SAM + diphosphate + phosphate
- 3-dehydroquinate biosynthesis II (archaea):
enolaldehyde ⟶ methylglyoxal
- superpathway of L-isoleucine biosynthesis I:
ATP + L-homoserine ⟶ ADP + H+ + O-phospho-L-homoserine
- superpathway of S-adenosyl-L-methionine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis I:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- L-homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glu
- aspartate superpathway:
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide
- superpathway of L-homoserine and L-methionine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- L-lysine biosynthesis VI:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-isoleucine biosynthesis I:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
N5-methyl--tetrahydropteroyl tri-L-glutamate + L-homocysteine ⟶ met + tetrahydropteroyl tri-L-glutamate
- superpathway of L-threonine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- L-homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- L-homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-methionine biosynthesis (transsulfuration):
2-oxoglutarate + asp ⟶ Glu + oxaloacetate
- L-homoserine and L-methionine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + Glu
- ectoine biosynthesis:
2-oxoglutarate + L-2,4-diaminobutanoate ⟶ Glu + L-aspartate-semialdehyde
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + Glu
- aspartate superpathway:
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ Glu + oxaloacetate
- L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + Glu
- superpathway of lysine, threonine and methionine biosynthesis I:
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt
- isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glt
- threonine biosynthesis:
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- superpathway of S-adenosyl-L-methionine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- aspartate superpathway:
O2 + asp ⟶ α-iminosuccinate + H+ + hydrogen peroxide
- homoserine and methionine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of methionine biosynthesis (transsulfuration):
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- aspartate superpathway:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt
- superpathway of lysine, threonine and methionine biosynthesis I:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- threonine biosynthesis:
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- L-homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-threonine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- L-lysine biosynthesis I:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-isoleucine biosynthesis I:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- L-homoserine and L-methionine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt
- L-homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of S-adenosyl-L-methionine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- L-homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glu
- isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glt
- lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt
- homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- homoserine and methionine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of methionine biosynthesis (transsulfuration):
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- superpathway of lysine, threonine and methionine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt
- aspartate superpathway:
O2 + asp ⟶ α-iminosuccinate + H+ + hydrogen peroxide
- threonine biosynthesis:
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- superpathway of S-adenosyl-L-methionine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of S-adenosyl-L-methionine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- aspartate superpathway:
O2 + asp ⟶ α-iminosuccinate + H+ + hydrogen peroxide
- isoleucine biosynthesis I:
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- homoserine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt
- superpathway of lysine, threonine and methionine biosynthesis I:
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- homoserine and methionine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of methionine biosynthesis (transsulfuration):
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- threonine biosynthesis:
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt
- homoserine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of methionine biosynthesis (transsulfuration):
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- homoserine and methionine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of S-adenosyl-L-methionine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- isoleucine biosynthesis I:
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- L-homoserine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt
- superpathway of L-methionine biosynthesis (transsulfuration):
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- L-homoserine and L-methionine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of S-adenosyl-L-methionine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- aspartate superpathway:
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide
- L-lysine biosynthesis I:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-isoleucine biosynthesis I:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glu
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- ectoine biosynthesis:
2-oxoglutarate + L-2,4-diaminobutanoate ⟶ L-aspartate 4-semialdehyde + glu
- L-homoserine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- aspartate superpathway:
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis I:
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- ectoine biosynthesis:
2-oxoglutarate + L-2,4-diaminobutanoate ⟶ L-aspartate-semialdehyde + glt
- L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt
- aspartate threonine lysine biosynthesis superpathway:
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- homoserine and methionine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glt
- superpathway of S-adenosyl-L-methionine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-homoserine and L-methionine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis II:
L-2-acetamido-6-oxoheptanedioate + glu ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glt
- L-lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glt
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- superpathway of S-adenosyl-L-methionine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-methionine biosynthesis (transsulfuration):
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- L-homoserine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- homoserine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt
- superpathway of lysine, threonine and methionine biosynthesis I:
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- homoserine and methionine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of S-adenosyl-L-methionine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- threonine biosynthesis:
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- aspartate superpathway:
O2 + asp ⟶ α-iminosuccinate + H+ + hydrogen peroxide
- superpathway of S-adenosyl-L-methionine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- threonine biosynthesis:
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- aspartate superpathway:
O2 + asp ⟶ α-iminosuccinate + H+ + hydrogen peroxide
- superpathway of lysine, threonine and methionine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt
- homoserine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt
- homoserine and methionine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt
- homoserine and methionine biosynthesis:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of S-adenosyl-L-methionine biosynthesis:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- lysine biosynthesis II:
L-2-acetamido-6-oxoheptanedioate + glt ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate
- threonine biosynthesis:
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- isoleucine biosynthesis I:
thr ⟶ 2-oxobutanoate + H+ + ammonia
- superpathway of S-adenosyl-L-methionine biosynthesis:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- homoserine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of methionine biosynthesis (transsulfuration):
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- homoserine and methionine biosynthesis:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- superpathway of S-adenosyl-L-methionine biosynthesis:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- homoserine and methionine biosynthesis:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- superpathway of methionine biosynthesis (transsulfuration):
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H2O + H+ + glt
- homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- threonine biosynthesis:
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- isoleucine biosynthesis I:
thr ⟶ 2-oxobutanoate + H+ + ammonia
- threonine biosynthesis:
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- superpathway of methionine biosynthesis (by sulfhydrylation):
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- homoserine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- homoserine and methionine biosynthesis:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- isoleucine biosynthesis I:
thr ⟶ 2-oxobutanoate + H+ + ammonia
- superpathway of methionine biosynthesis (transsulfuration):
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- lysine biosynthesis II:
L-2-acetamido-6-oxoheptanedioate + glt ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate
- spermidine biosynthesis II:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- homoserine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt
- homoserine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt
- L-lysine biosynthesis II:
Glu + L-2-acetamido-6-oxoheptanedioate ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ Glu + oxaloacetate
- superpathway of S-adenosyl-L-methionine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-homoserine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-homoserine and L-methionine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-methionine biosynthesis (transsulfuration):
2-oxoglutarate + asp ⟶ Glu + oxaloacetate
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + asp ⟶ Glu + oxaloacetate
- threonine biosynthesis:
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- superpathway of methionine biosynthesis (transsulfuration):
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- homoserine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- homoserine and methionine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- lysine biosynthesis III:
meso-diaminopimelate + H2O + NADP+ ⟶ H+ + L-α-amino-ε-keto-pimelate + NADPH + ammonium
- superpathway of methionine biosynthesis (by sulfhydrylation):
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- isoleucine biosynthesis I:
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glt
- L-homoserine and L-methionine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis I:
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- superpathway of L-methionine biosynthesis (transsulfuration):
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- L-homoserine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- aspartate superpathway:
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide
- superpathway of S-adenosyl-L-methionine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis III:
meso-diaminopimelate + H2O + NADP+ ⟶ H+ + L-α-amino-ε-keto-pimelate + NADPH + ammonium
- L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt
- L-lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glt
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- L-lysine biosynthesis II:
L-2-acetamido-6-oxoheptanedioate + glt ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate
- L-homoserine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + Glu
- L-lysine biosynthesis III:
meso-diaminopimelate + H2O + NADP+ ⟶ H+ + L-α-amino-ε-keto-pimelate + NADPH + ammonium
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ Glu + oxaloacetate
- L-homoserine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ Glu + oxaloacetate
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + Glu
- L-homoserine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis III:
meso-diaminopimelate + H2O + NADP+ ⟶ H+ + L-α-amino-ε-keto-pimelate + NADPH + ammonium
- L-lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + Glu + H+ + H2O
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + asp ⟶ Glu + oxaloacetate
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ Glu + oxaloacetate
- L-homoserine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + Glu + H+ + H2O
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + Glu
- L-homoserine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis III:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + Glu + H+ + H2O
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ Glu + oxaloacetate
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- L-lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glt
- L-homoserine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis II:
Glu + L-2-acetamido-6-oxoheptanedioate ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate
- L-homoserine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-homoserine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ Glu + oxaloacetate
- L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + Glu
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + Glu
- L-lysine biosynthesis II:
Glu + L-2-acetamido-6-oxoheptanedioate ⟶ 2-oxoglutarate + N-acetyl-L,L-2,6-diaminopimelate
- cholesterol biosynthesis I:
NADP+ + cholesterol ⟶ 7-dehydro-cholesterol + H+ + NADPH
- cholesterol biosynthesis II (via 24,25-dihydrolanosterol):
NADP+ + cholesterol ⟶ 7-dehydro-cholesterol + H+ + NADPH
- ascorbate recycling (cytosolic):
H+ + NADPH + monodehydroascorbate radical ⟶ H+ + L-ascorbate + NADP+
- ascorbate glutathione cycle:
monodehydroascorbate radical ⟶ H+ + L-ascorbate + L-dehydro-ascorbate
- ascorbate recycling (cytosolic):
monodehydroascorbate radical ⟶ H+ + L-ascorbate + L-dehydro-ascorbate
- 4-nitrotoluene degradation II:
(S)-4-hydroxy-2-oxohexanoate + A ⟶ (3Z)-4-hydroxy-2-oxohexenoate + A(H2)
- dechlorogriseofulvin biosynthesis:
H+ + NADPH + O2 + griseophenone C ⟶ H2O + NADP+ + desmethyl-dehydro-dechlorogriseofulvin
- polybrominated phenols biosynthesis:
2,4-dibromophenol + H+ + NADPH + O2 + bromide ⟶ 2,4,6-tribromophenol + H2O + NADP+
- superpathway of polybrominated aromatic compound biosynthesis:
2,4-dibromophenol + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ 2-bromo-4-(2,4-dibromophenoxy)phenol + H2O + an oxidized ferredoxin [iron-sulfur] cluster + bromide
- ergosterol biosynthesis:
5,7,24(28)-ergostatrienol + H+ + NADPH + O2 ⟶ 5,7,22,24(28)-ergostatetraenol + H2O + NADP+
- superpathway of ergosterol biosynthesis:
ATP + mevalonate-5-phosphate ⟶ ADP + H+ + mevalonate-diphosphate
- superpathway of ergosterol biosynthesis:
(R)-mevalonate + ATP ⟶ ADP + H+ + mevalonate-5-phosphate
- ergosterol biosynthesis:
NADP+ + ergosterol ⟶ 5,7,22,24(28)-ergostatetraenol + H+ + NADPH
- superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate
- TCA cycle I (prokaryotic):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH
- mixed acid fermentation:
ATP + pyruvate ⟶ ADP + H+ + phosphoenolpyruvate
- superpathway of geranylgeranyl diphosphate biosynthesis II (via MEP):
IPP ⟶ DMAPP
- taxadiene biosynthesis (engineered):
IPP ⟶ DMAPP
- gluconeogenesis I:
β-D-fructose 1,6-bisphosphate ⟶ D-glyceraldehyde 3-phosphate + DHAP
- methylerythritol phosphate pathway I:
IPP ⟶ DMAPP
- methylerythritol phosphate pathway II:
MEP + NADP+ ⟶ 1-deoxy-D-xylulose 5-phosphate + H+ + NADPH
- superpathway of glyoxylate bypass and TCA:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH
- TCA cycle I (prokaryotic):
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA
- mixed acid fermentation:
NAD+ + ethanol ⟶ H+ + NADH + acetaldehyde
- superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA
- superpathway of glyoxylate bypass and TCA:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA
- gluconeogenesis I:
(S)-malate + NADP+ ⟶ CO2 + NADPH + pyruvate
- methylerythritol phosphate pathway I:
D-glyceraldehyde 3-phosphate + H+ + pyruvate ⟶ 1-deoxy-D-xylulose 5-phosphate + CO2
- nicotine degradation II (pyrrolidine pathway):
6-hydroxy-3-succinoyl-pyridine + H+ + NADH + O2 ⟶ 2,5-dihydroxypyridine + H2O + NAD+ + succinate semialdehyde
- nicotine degradation IV:
(S)-nicotine + A + H2O ⟶ A(H2) + formaldehyde + nornicotine
- bisphenol A degradation:
NAD+ + S-1-(4-hydroxyphenyl)-ethanol ⟶ 4-hydroxyacetophenone + H+ + NADH
- citrulline-nitric oxide cycle:
ATP + L-citrulline + asp ⟶ AMP + H+ + L-arginino-succinate + diphosphate
- nitric oxide biosynthesis II (mammals):
H+ + NADPH + O2 + arg ⟶ H2O + L-citrulline + NADP+ + nitric oxide
- superpathway of L-citrulline metabolism:
ATP + ammonium + hydrogencarbonate ⟶ ADP + H+ + carbamoyl phosphate + phosphate
- nitric oxide biosynthesis I (plants):
Nω-hydroxy-L-arginine + NADPH + O2 ⟶ H+ + H2O + L-citrulline + NADP+ + nitric oxide
- L-citrulline-nitric oxide cycle:
H+ + NADPH + O2 + arg ⟶ H2O + L-citrulline + NADP+ + nitric oxide
- nitric oxide biosynthesis (plants):
H+ + NADPH + O2 + arg ⟶ H2O + L-citrulline + NADP+ + nitric oxide
- L-citrulline-nitric oxide cycle:
L-arginino-succinate ⟶ arg + fumarate
- gallate degradation III (anaerobic):
acetate + butanoyl-CoA ⟶ acetyl-CoA + butanoate
- gallate degradation III (anaerobic):
3-hydroxy-5-oxohexanoate + acetyl-CoA ⟶ 3-hydroxy-5- oxohexanoyl-CoA + acetate
- gallate degradation III (anaerobic):
acetate + butanoyl-CoA ⟶ acetyl-CoA + butanoate
- gallate degradation III (anaerobic):
3-hydroxy-5-oxohexanoate + acetyl-CoA ⟶ 3-hydroxy-5- oxohexanoyl-CoA + acetate
- gallate degradation III (anaerobic):
3-hydroxy-5- oxohexanoyl-CoA + acetate ⟶ 3-hydroxy-5-oxohexanoate + acetyl-CoA
- selenate reduction:
H+ + NADPH + glutathioselenol ⟶ NADP+ + glutathione + hydrogen selenide
- lysine biosynthesis IV:
2-oxoglutarate + H2O + acetyl-CoA ⟶ (R)-homocitrate + H+ + coenzyme A
- salicortin biosynthesis:
benzylbenzoate ⟶ benzyl-6-hydroxy-2-cyclohexene-on-oyl
- mandelate degradation I:
H+ + phenylglyoxylate ⟶ CO2 + benzaldehyde
- mandelate degradation to acetyl-CoA:
O2 + catechol ⟶ H+ + HMS
- mandelate degradation I:
H2O + NADP+ + benzaldehyde ⟶ H+ + NADPH + benzoate
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- formylTHF biosynthesis I:
H+ + NAD+ + gly + tetrahydrofolate ⟶ 5,10-methylenetetrahydrofolate + CO2 + NADH + ammonia
- formylTHF biosynthesis II:
H+ + NAD+ + gly + tetrahydrofolate ⟶ 5,10-methylenetetrahydrofolate + CO2 + NADH + ammonia
- tetrahydrofolate biosynthesis:
7,8-dihydropteroate + ATP + glt ⟶ 7,8-dihydrofolate + ADP + H+ + phosphate
- formylTHF biosynthesis I:
H+ + NAD+ + gly + tetrahydrofolate ⟶ 5,10-methylenetetrahydrofolate + CO2 + NADH + ammonia
- tetrahydrofolate biosynthesis II:
ATP + glt + tetrahydrofolate ⟶ ADP + H+ + phosphate + tetrahydrofolate-L-glutamate
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- superpathway of carotenoid biosynthesis:
all-trans-β-carotene + H+ + NADH + O2 ⟶ β-cryptoxanthin + H2O + NAD+
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- levopimaric acid biosynthesis:
H+ + NADPH + O2 + levopimaradiene ⟶ H2O + NADP+ + levopimaradienol
- m-cresol degradation:
3-hydroxybenzyl alcohol + NAD+ ⟶ 3-hydroxybenzaldehyde + H+ + NADH
- 4-hydroxyacetophenone degradation:
(4-hydroxyphenyl)acetate + H2O ⟶ acetate + hydroquinone
- lactose degradation II:
α-lactose + A ⟶ 3'-ketolactose + A(H2)
- lactose degradation II:
3'-ketolactose + H2O ⟶ 3-keto-β-D-galactose + D-glucopyranose
- luteolinidin 5-O-glucoside biosynthesis:
UDP-α-D-glucose + luteolinidin ⟶ H+ + UDP + luteolinidin 5-O-glucoside
- cholesterol biosynthesis II (via 24,25-dihydrolanosterol):
4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol + NADPH + O2 ⟶ 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol + H2O + NADP+ + formate
- cholesterol biosynthesis II (via 24,25-dihydrolanosterol):
4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol + NADPH + O2 ⟶ 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol + H2O + NADP+ + formate
- cholesterol biosynthesis II (via 24,25-dihydrolanosterol):
4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol + NADPH + O2 ⟶ 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol + H2O + NADP+ + formate
- succinate fermentation to butanoate:
acetate + butanoyl-CoA ⟶ acetyl-CoA + butanoate
- crotonyl-CoA/ethylmalonyl-CoA/hydroxybutyryl-CoA cycle (engineered):
4-hydroxybutanoate + ATP + coenzyme A ⟶ 4-hydroxybutanoyl-CoA + ADP + phosphate
- TCA cycle IV (2-oxoglutarate decarboxylase):
2-oxoglutarate + H+ ⟶ CO2 + succinate semialdehyde
- 4-hydroxyphenylacetate degradation:
(4Z)-2-oxohept-4-enedioate + H2O ⟶ (4S)-4-hydroxy-2-oxoheptanedioate
- nicotine degradation I (pyridine pathway):
2,6-dihydroxypyridine + H+ + NADH + O2 ⟶ 2,3,6-trihydroxypyridine + H2O + NAD+
- 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde
- superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde
- superpathway of L-arginine, putrescine, and 4-aminobutanoate degradation:
H2O + agmatine ⟶ putrescine + urea
- superpathway of L-arginine and L-ornithine degradation:
4-aminobutanal ⟶ 1-pyrroline + H2O
- L-glutamate degradation IV:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde
- superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde
- 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde
- superpathway of L-arginine, putrescine, and 4-aminobutanoate degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ 4-(γ-L-glutamylamino)butanal + ammonium + hydrogen peroxide
- superpathway of L-arginine and L-ornithine degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ 4-(γ-L-glutamylamino)butanal + ammonium + hydrogen peroxide
- 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde
- superpathway of 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde
- glutamate degradation IX (via 4-aminobutyrate):
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde
- 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde
- TCA cycle IV (2-oxoglutarate decarboxylase):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH
- 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde
- glutamate degradation IX (via 4-aminobutyrate):
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde
- 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde
- 4-hydroxyphenylacetate degradation:
4-hydroxyphenylacetate + FADH2 + O2 ⟶ 3,4-dihydroxyphenylacetate + FAD + H+ + H2O
- superpathway of 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde
- glutamate degradation IX (via 4-aminobutyrate):
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde
- 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde
- 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde
- superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde
- TCA cycle IV (2-oxoglutarate decarboxylase):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH
- superpathway of glycolysis and TCA variant VIII:
2-oxoglutarate + H+ ⟶ CO2 + succinate semialdehyde
- superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde
- TCA cycle IV (2-oxoglutarate decarboxylase):
2-oxoglutarate + H+ ⟶ CO2 + succinate semialdehyde
- 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde
- superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde
- 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde
- TCA cycle IV (2-oxoglutarate decarboxylase):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH
- superpathway of arginine, putrescine, and 4-aminobutyrate degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ 4-(γ-glutamylamino)butanal + ammonium + hydrogen peroxide
- superpathway of arginine and ornithine degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ 4-(γ-glutamylamino)butanal + ammonium + hydrogen peroxide
- 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde
- superpathway of 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde
- 4-hydroxyphenylacetate degradation:
4-hydroxyphenylacetate + FADH2 + O2 ⟶ 3,4-dihydroxyphenylacetate + FAD + H+ + H2O
- 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde
- superpathway of 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde
- superpathway of arginine, putrescine, and 4-aminobutyrate degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ 4-(γ-glutamylamino)butanal + ammonium + hydrogen peroxide
- superpathway of arginine and ornithine degradation:
γ-glutamyl-L-putrescine + H2O + O2 ⟶ 4-(γ-glutamylamino)butanal + ammonium + hydrogen peroxide
- 4-hydroxyphenylacetate degradation:
4-hydroxyphenylacetate + FADH2 + O2 ⟶ 3,4-dihydroxyphenylacetate + FAD + H+ + H2O
- TCA cycle variation I:
2-oxoglutarate + H+ ⟶ CO2 + succinate semialdehyde
- 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutyrate ⟶ glt + succinate semialdehyde
- 4-hydroxyphenylacetate degradation:
4-hydroxyphenylacetate + FADH2 + O2 ⟶ 3,4-dihydroxyphenylacetate + FAD + H2O
- glutamate degradation IX (via 4-aminobutyrate):
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde
- 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde
- 3-hydroxypropionate/4-hydroxybutyrate cycle:
ATP + bicarbonate + propanoyl-CoA ⟶ (S)-methylmalonyl-CoA + ADP + H+ + phosphate
- superpathway of 4-aminobutyrate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde
- 4-aminobutyrate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde
- succinate fermentation to butanoate:
acetate + butanoyl-CoA ⟶ acetyl-CoA + butanoate
- superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde
- 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde
- 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ glt + succinate semialdehyde
- succinate fermentation to butanoate:
acetate + succinyl-CoA ⟶ acetyl-CoA + succinate
- 4-aminobutanoate degradation II:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde
- superpathway of 4-aminobutanoate degradation:
2-oxoglutarate + 4-aminobutanoate ⟶ Glu + succinate semialdehyde
- heme degradation V:
δ-anaerubin + NADP+ ⟶ H+ + NADPH + anaerobilin
- hentriaconta-3,6,9,12,15,19,22,25,28-nonaene biosynthesis:
(6Z,9Z,12Z,15Z)-3-hydroxy-2-[(2Z,5Z,8Z,11Z)-tetradeca-2,5,8,11-tetraen-1-yl]octadeca-6,9,12,15-tetraenoate + ATP ⟶ 3-[(3Z,6Z,9Z,12Z)-pentadeca-3,6,9,12-tetraen-1-yl]-4-[(2Z,5Z,8Z,11Z)-tetradeca-2,5,8,11-tetraen-1-yl]oxetan-2-one + AMP + diphosphate
- soybean saponin I biosynthesis:
β-amyrin + H+ + NADPH + O2 ⟶ H2O + NADP+ + sophoradiol
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3R-hydroxyoctanoyl)-CoA + NAD+ ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxooctanoyl)-CoA + H+ + NADH
- (+)-pisatin biosynthesis:
(-)-maackiain ⟶ (+)-maackiain
- nitrate reduction VI (assimilatory):
H2O + an oxidized ferredoxin [iron-sulfur] cluster + nitrite ⟶ H+ + a reduced ferredoxin [iron-sulfur] cluster + nitrate
- canavanine degradation:
H2O + L-canavanine ⟶ H+ + L-canaline + urea
- partial TCA cycle (obligate autotrophs):
oxaloacetate + phosphate ⟶ hydrogencarbonate + phosphoenolpyruvate
- L-glutamate and L-glutamine biosynthesis:
ATP + ammonium + glu ⟶ ADP + H+ + gln + phosphate
- toyocamycin biosynthesis:
NADP+ + [(1R,2R,3S,4S)-4-{5-cyano-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl}-2,3-dihydroxycyclopentyl]methyl phosphate + ammonium ⟶ 5-phospho-α-D-ribose-1-preQ0 + H+ + NADPH
- L-glutamate biosynthesis III:
H2O + NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- linuron degradation:
3,4-dichloroaniline + H+ + NADPH + O2 ⟶ 4,5-dichlorobenzene-1,2-diol + NADP+ + ammonium
- L-glutamate biosynthesis III:
H2O + NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- glutamate biosynthesis from ammonia:
H2O + NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- L-glutamate biosynthesis III:
Glu + H2O + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- L-glutamate biosynthesis III:
Glu + H2O + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- L-glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- L-glutamate biosynthesis III:
H2O + NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- L-glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- L-glutamate and L-glutamine biosynthesis:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- L-glutamate biosynthesis III:
H2O + NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- L-glutamate biosynthesis III:
H2O + NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- L-glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- valine degradation III:
H2O + NAD+ + coenzyme A + methylmalonate semialdehyde ⟶ H+ + NADH + hydrogen carbonate + propanoyl-CoA
- L-glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- L-glutamate and L-glutamine biosynthesis:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- nitrate reduction VI (assimilatory):
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- L-glutamate biosynthesis III:
Glu + H2O + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- L-glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- L-glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- L-glutamate biosynthesis III:
Glu + H2O + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- L-glutamate biosynthesis III:
Glu + H2O + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- L-glutamate biosynthesis III:
Glu + H2O + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- L-glutamate biosynthesis III:
Glu + H2O + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- L-glutamate biosynthesis III:
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- L-glutamate biosynthesis III:
Glu + H2O + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- L-glutamate biosynthesis III:
Glu + H2O + NADP+ ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+
- NAD phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+
- arginine biosynthesis IV:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + NAD(P)H + ammonia
- proline biosynthesis III:
2-oxoglutarate + L-ornithine ⟶ L-glutamate γ-semialdehyde + glt
- arginine biosynthesis IV:
H2O + NAD(P)+ + glt ⟶ 2-oxoglutarate + NAD(P)H + ammonia
- NAD/NADH phosphorylation and dephosphorylation:
ATP + NADH ⟶ ADP + H+ + NADPH
- Spodoptera littoralis pheromone biosynthesis:
acetyl-CoA + tetradecan-1-ol ⟶ coenzyme A + tetradecan-1-yl acetate
- thymine degradation:
3-(carbamoylamino)-2-methylpropanoate + H+ + H2O ⟶ (R)-3-amino-2-methylpropanoate + CO2 + ammonium
- thymine degradation:
5,6-dihydrothymine + H2O ⟶ 3-(carbamoylamino)-2-methylpropanoate + H+
- thymine degradation:
(R)-3-ureido-isobutanoate + H+ + H2O ⟶ (R)-3-amino-2-methylpropanoate + CO2 + ammonium
- thymine degradation:
3-(carbamoylamino)-2-methylpropanoate + H+ + H2O ⟶ (R)-3-amino-2-methylpropanoate + CO2 + ammonium
- thymine degradation:
5,6-dihydrothymine + NADP+ ⟶ H+ + NADPH + thymine
- thymine degradation:
5,6-dihydrothymine + NADP+ ⟶ H+ + NADPH + thymine
- thymine degradation:
3-ureido-isobutyrate + H2O + H+ ⟶ (R)-3-amino-2-methylpropanoate + CO2 + ammonia
- thymine degradation:
5,6-dihydrothymine + NADP+ ⟶ H+ + NADPH + thymine
- thymine degradation:
5,6-dihydrothymine + NADP+ ⟶ H+ + NADPH + thymine
- thymine degradation:
5,6-dihydrothymine + NADP+ ⟶ H+ + NADPH + thymine
- thymine degradation:
5,6-dihydrothymine + NADP+ ⟶ H+ + NADPH + thymine
- thymine degradation:
5,6-dihydrothymine + NADP+ ⟶ H+ + NADPH + thymine
- indole-3-acetate biosynthesis II:
(indole-3-yl)acetonitrile + H2O ⟶ (indol-3-yl)acetate + ammonium
- indole-3-acetate biosynthesis II:
(E)-indol-3-ylacetaldoxime ⟶ H2O + indole-3-acetonitrile
- IAA biosynthesis I:
H2O + indole-3-acetamide ⟶ H+ + ammonia + indole-3-acetate
- tetrahydrobiopterin de novo biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + NADP+ ⟶ (6R)-6-pyruvoyl-5,6,7,8-tetrahydropterin + H+ + NADPH
- erythro-tetrahydrobiopterin biosynthesis II:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + NADP+ ⟶ (6R)-6-lactoyl-5,6,7,8-tetrahydropterin + H+ + NADPH
- erythro-tetrahydrobiopterin biosynthesis I:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + NADP+ ⟶ (6R)-6-pyruvoyl-5,6,7,8-tetrahydropterin + H+ + NADPH
- tetrahydrobiopterin biosynthesis II:
GTP + H2O ⟶ 7,8-dihydroneopterin 3'-triphosphate + H+ + formate
- tetrahydrobiopterin biosynthesis I:
GTP + H2O ⟶ 7,8-dihydroneopterin 3'-triphosphate + H+ + formate
- tetrahydrobiopterin biosynthesis I:
GTP + H2O ⟶ 7,8-dihydroneopterin 3'-triphosphate + H+ + formate
- camptothecin biosynthesis:
H+ + NADPH + O2 + loganin ⟶ H2O + NADP+ + secologanin
- 4-chloro-2-methylphenoxyacetate degradation:
2-methyl-4-chlorophenol + H+ + NADPH + O2 ⟶ 5-chloro-3-methylcatechol + H2O + NADP+
- chrysophanol biosynthesis:
H+ + NADPH + emodin ⟶ H2O + NADP+ + chrysophanol
- mycinamicin biosynthesis:
(S)-methylmalonyl-CoA + H+ + NADPH + malonyl-CoA ⟶ CO2 + H2O + NADP+ + coenzyme A + protomycinolide IV
- hydroxyjasmonate sulfate biosynthesis:
PAPS + tuberonic acid ⟶ 3',5'-ADP + H+ + a 12-hydroxyjasmonate sulfate
- bombykol biosynthesis:
(10E,12Z)-10,12-hexadecadienoate + H+ + NADPH ⟶ H2O + NADP+ + bombykol
- phylloquinol biosynthesis:
SAM + demethylphylloquinol ⟶ H+ + SAH + phylloquinol
- superpathway of phylloquinol biosynthesis:
SAM + demethylphylloquinol ⟶ H+ + SAH + phylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- plant sterol biosynthesis:
H+ + NADPH + O2 + sitosterol ⟶ H2O + NADP+ + stigmasterol
- 4-coumarate degradation (aerobic):
4-hydroxybenzaldehyde + H2O + NAD(P)+ ⟶ 4-hydroxybenzoate + H+ + NAD(P)H
- 4-chlorobenzoate degradation:
4-chlorobenzoyl-coA + H2O ⟶ 4-hydroxybenzoyl-CoA + H+ + chloride
WikiPathways(0)
Plant Reactome(62)
- Metabolism and regulation:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA
- Secondary metabolism:
GPP + H2O ⟶ PPi + geraniol
- Linear furanocoumarin biosynthesis:
H+ + H2O + TPNH + psoralen ⟶ TPN + bergaptol
- Medicarpin biosynthesis:
H+ + Oxygen + TPNH + formononetin ⟶ 2-hydroxyformononetin + H2O + TPN
- Phenylpropanoid biosynthesis, initial reactions:
L-Phe ⟶ ammonia + trans-cinnamate
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Coumarin biosynthesis (via 2-coumarate):
H2O + coumarinic acid-beta-D-glucoside ⟶ beta-D-glucose + coumarinate
- Lignin biosynthesis:
4-coumarate + ATP + CoA-SH ⟶ 4-coumaroyl-CoA + AMP + PPi
- Fatty acid and lipid metabolism:
NAD(P)H + Oxygen + lathosterol ⟶ H2O + NAD(P)+ + Provitamin D3
- Cholesterol biosynthesis II (via 24,25-dihydrolanosterol):
NAD(P)H + Oxygen + lathosterol ⟶ H2O + NAD(P)+ + Provitamin D3
- Leucodelphinidin biosynthesis:
2OG + Oxygen + eriodictyol ⟶ (+)-taxifolin + SUCCA + carbon dioxide
- Hormone signaling, transport, and metabolism:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate + Oxygen ⟶ CH3COO- + jasmonic acid
- GA12 biosynthesis:
H+ + Oxygen + TPNH + ent-kaurene ⟶ H2O + TPN + ent-kaur-16-en-19-ol
- Cholesterol biosynthesis I:
NAD(P)H + Oxygen + lathosterol ⟶ H2O + NAD(P)+ + Provitamin D3
- Cholesterol biosynthesis III (via desmosterol):
DESMO + TPNH ⟶ CHOL + TPN
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis I:
2OG + L-Val ⟶ KIV + L-Glu
- Pantothenate biosynthesis II:
2OG + L-Val ⟶ KIV + L-Glu
- Brassinosteroid biosynthesis II:
H+ + Oxygen + TPNH + campesterol ⟶ (22S)-22-hydroxycampesterol + H2O + TPN
- Trans-zeatin biosynthesis:
AMP + DMAPP ⟶ PPi + isopentenyladenosine-5'-monophosphate
- Growth and developmental processes:
AMP + DMAPP ⟶ PPi + isopentenyladenosine-5'-monophosphate
- Vegetative structure development:
AMP + DMAPP ⟶ PPi + isopentenyladenosine-5'-monophosphate
- Regulation of leaf development:
AMP + DMAPP ⟶ PPi + isopentenyladenosine-5'-monophosphate
- Sterol biosynthesis:
delta24-25-sitosterol ⟶ sitosterol
- Capsidiol biosynthesis:
5-epi-aristolochene + H+ + Oxygen + TPNH ⟶ 3-deoxy-capsidiol + H2O + TPN
- Pantothenate and coenzyme A biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK
- Pantothenate biosynthesis III:
b-Ala + pantoyl lactone ⟶ PanK
- Amino acid metabolism:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA
- Amino acid biosynthesis:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA
- Valine biosynthesis:
2,3-dihydroxy-isovalerate ⟶ H2O + KIV
- IAA biosynthesis I:
CH3COO- + indole ⟶ IAA
- Secologanin and strictosidine biosynthesis:
GPP + H2O ⟶ PPi + geraniol
- Flavin biosynthesis:
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine + H2O ⟶ 5-amino-6-(5'-phosphoribosylamino)uracil + ammonia
- Homoserine biosynthesis:
H+ + L-aspartyl-4-phosphate + TPNH ⟶ L-aspartate-semialdehyde + Pi + TPN
- Lysine biosynthesis I:
L-Glu + N-succinyl-2-amino-6-ketopimelate ⟶ 2OG + N-succinyl-L,L-2,6-diaminopimelate
- Lysine biosynthesis II:
H2O + N-acetyl-L,L-2,6-diaminopimelate ⟶ CH3COO- + L,L-diaminopimelate
- Maackiain biosynthesis:
Oxygen + TPNH + formononetin ⟶ H2O + TPN + calycosin
- Kievitone biosynthesis:
2'-hydroxygenistein + H+ + TPNH ⟶ TPN + dalbergioidin
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Wighteone and luteone biosynthesis:
DMAPP + genistein ⟶ PPi + lupiwighteone
- Proanthocyanidin biosynthesis from flavanols:
H+ + TPNH + leucopelargonidin ⟶ H2O + TPN + afzelechin
- Sphingolipid metabolism:
PALM-CoA + Ser ⟶ 3-ketosphinganine + CoA-SH + carbon dioxide
- Leucopelargonidin and leucocyanidin biosynthesis:
2OG + Oxygen + eriodictyol ⟶ (+)-taxifolin + SUCCA + carbon dioxide
- Flavonoid biosynthesis:
4-coumarate + ATP + CoA-SH ⟶ 4-coumaroyl-CoA + AMP + PPi
- Salicylate biosynthesis:
L-Phe ⟶ ammonia + trans-cinnamate
- 6,7,4'-Trihydroxyisoflavone biosynthesis:
H+ + Oxygen + TPNH + liquiritigenin ⟶ 6,7,4'-trihydroxyflavanone + H2O + TPN
- Isoleucine biosynthesis from threonine:
L-Thr ⟶ 2OBUTA + ammonia
- Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-4-dehydro-6-deoxy-D-mannose + TPNH ⟶ GDP-Fuc + TPN
- MVA pathway:
HMG-CoA + TPNH ⟶ (R)-mevalonate + CoA-SH + TPN
- Jasmonate biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate + Oxygen ⟶ CH3COO- + jasmonic acid
- Peptidoglycan biosynthesis I:
ATP + L-Ala + UDP-N-acetylmuramate ⟶ ADP + Pi + UDP-N-acetylmuramoyl-L-alanine
- Citrulline biosynthesis:
H2O + L-Gln ⟶ L-Glu + ammonia
- Proline biosynthesis I:
2OG + H+ + TPNH + ammonia ⟶ H2O + L-Glu + TPN
- Detoxification:
H+ + O2.- ⟶ H2O2 + Oxygen
- Reactive oxygen species (ROS) homeostasis:
H+ + O2.- ⟶ H2O2 + Oxygen
- Generation of superoxide radicals:
Oxygen + TPNH ⟶ H+ + O2.- + TPN
- Responses to stimuli: biotic stimuli and stresses:
H+ + O2.- ⟶ H2O2 + Oxygen
- Cell Death and immunity:
H+ + O2.- ⟶ H2O2 + Oxygen
- Inorganic nutrients metabolism:
Nitrite ⟶ H2O + ammonia
- Response to iron deficiency:
2OG + nicotianamine ⟶ 3''-deamino-3''-oxonicotianamine + L-Glu
- Mugineic acid biosynthesis:
2OG + nicotianamine ⟶ 3''-deamino-3''-oxonicotianamine + L-Glu
INOH(0)
PlantCyc(6183)
- linear furanocoumarin biosynthesis:
(+)-marmesin + H+ + NADPH + O2 ⟶ H2O + NADP+ + acetone + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + H+ + NADPH + O2 ⟶ H2O + NADP+ + acetone + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + H+ + NADPH + O2 ⟶ H2O + NADP+ + acetone + psoralen
- sanguinarine and macarpine biosynthesis:
(S)-reticuline + O2 ⟶ (S)-scoulerine + H+ + hydrogen peroxide
- sanguinarine and macarpine biosynthesis:
H+ + O2 + dihydrosanguinarine ⟶ hydrogen peroxide + sanguinarine
- sanguinarine and macarpine biosynthesis:
(S)-reticuline + O2 ⟶ (S)-scoulerine + H+ + hydrogen peroxide
- sanguinarine and macarpine biosynthesis:
(S)-reticuline + O2 ⟶ (S)-scoulerine + H+ + hydrogen peroxide
- sanguinarine and macarpine biosynthesis:
(S)-reticuline + O2 ⟶ (S)-scoulerine + H+ + hydrogen peroxide
- secologanin and strictosidine biosynthesis:
(6E)-8-oxogeranial + H+ + NAD(P)H ⟶ (+)-cis,trans-nepetalactol + NAD(P)+
- L-proline biosynthesis IV:
NAD(P)+ + pro ⟶ 1-pyrroline-2-carboxylate + H+ + NAD(P)H
- superpathway of pterocarpan biosynthesis (via formononetin):
H+ + NADPH + O2 + calycosin ⟶ H2O + NADP+ + pseudobaptigenin
- (-)-medicarpin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + formononetin ⟶ 2-hydroxyformononetin + H2O + an oxidized [NADPH-hemoprotein reductase]
- (-)-medicarpin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + formononetin ⟶ 2-hydroxyformononetin + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of pterocarpan biosynthesis (via formononetin):
O2 + a reduced [NADPH-hemoprotein reductase] + calycosin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + pseudobaptigenin
- (-)-medicarpin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + formononetin ⟶ 2-hydroxyformononetin + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of pterocarpan biosynthesis (via formononetin):
O2 + a reduced [NADPH-hemoprotein reductase] + formononetin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + calycosin
- superpathway of pterocarpan biosynthesis (via formononetin):
O2 + a reduced [NADPH-hemoprotein reductase] + formononetin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + calycosin
- (-)-medicarpin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + formononetin ⟶ 2-hydroxyformononetin + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of pterocarpan biosynthesis (via formononetin):
O2 + a reduced [NADPH-hemoprotein reductase] + formononetin ⟶ 2-hydroxyformononetin + H2O + an oxidized [NADPH-hemoprotein reductase]
- (-)-medicarpin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + formononetin ⟶ 2-hydroxyformononetin + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of formononetin derivative biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + formononetin ⟶ 2-hydroxyformononetin + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of pterocarpan biosynthesis (via formononetin):
O2 + a reduced [NADPH-hemoprotein reductase] + calycosin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + pseudobaptigenin
- (-)-medicarpin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + formononetin ⟶ 2-hydroxyformononetin + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of formononetin derivative biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + formononetin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + calycosin
- superpathway of pterocarpan biosynthesis (via formononetin):
O2 + a reduced [NADPH-hemoprotein reductase] + formononetin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + calycosin
- (-)-medicarpin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + formononetin ⟶ 2-hydroxyformononetin + H2O + an oxidized [NADPH-hemoprotein reductase]
- (-)-medicarpin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + formononetin ⟶ 2-hydroxyformononetin + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of pterocarpan biosynthesis (via formononetin):
O2 + a reduced [NADPH-hemoprotein reductase] + formononetin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + calycosin
- superpathway of formononetin derivative biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + formononetin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + calycosin
- (-)-medicarpin biosynthesis:
(3R,4R)-7,2'-dihydroxy-4'-methoxyisoflavanol + NADP+ ⟶ (3R)-vestitone + H+ + NADPH
- superpathway of formononetin derivative biosynthesis:
(3R)-sophorol + NADP+ ⟶ 2'-hydroxypseudobaptigenin + H+ + NADPH
- soybean saponin I biosynthesis:
24-hydroxy-β-amyrin + H+ + NADPH + O2 ⟶ H2O + NADP+ + soyasapogenol B
- soybean saponin I biosynthesis:
24-hydroxy-β-amyrin + H+ + NADPH + O2 ⟶ H2O + NADP+ + soyasapogenol B
- ginsenosides biosynthesis:
H+ + NADPH + O2 + dammarenediol II ⟶ H2O + NADP+ + protopanaxadiol
- soybean saponin I biosynthesis:
24-hydroxy-β-amyrin + H+ + NADPH + O2 ⟶ H2O + NADP+ + soyasapogenol B
- soybean saponin I biosynthesis:
24-hydroxy-β-amyrin + H+ + NADPH + O2 ⟶ H2O + NADP+ + soyasapogenol B
- soybean saponin I biosynthesis:
UDP-α-D-glucuronate + soyasapogenol B ⟶ H+ + UDP + soyasapogenol B-3-O-β-glucuronide
- phenylpropanoid biosynthesis:
4-coumaryl alcohol + NADP+ ⟶ 4-coumaraldehyde + H+ + NADPH
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + NADPH ⟶ 4-coumaraldehyde + NADP+ + coenzyme A
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
trans-feruloyl-CoA + H+ + NADPH ⟶ NADP+ + coenzyme A + coniferaldehyde
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
NADP+ + sinapyl alcohol ⟶ H+ + NADPH + sinapaldehyde
- phenylpropanoid biosynthesis:
4-coumaryl alcohol + NADP+ ⟶ 4-coumaraldehyde + H+ + NADPH
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
5-hydroxy-coniferaldehyde + SAM ⟶ H+ + SAH + sinapaldehyde
- phenylpropanoid biosynthesis:
trans-feruloyl-CoA + H+ + NADPH ⟶ NADP+ + coenzyme A + coniferaldehyde
- phenylpropanoid biosynthesis:
trans-feruloyl-CoA + H+ + NADPH ⟶ NADP+ + coenzyme A + coniferaldehyde
- phenylpropanoid biosynthesis:
H+ + NADPH + feruloyl-CoA ⟶ NADP+ + coenzyme A + coniferaldehyde
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
NADP+ + coniferyl alcohol ⟶ H+ + NADPH + coniferaldehyde
- phenylpropanoid biosynthesis:
4-coumaryl alcohol + NADP+ ⟶ 4-coumaraldehyde + H+ + NADPH
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + NADPH ⟶ 4-coumaraldehyde + NADP+ + coenzyme A
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
NADP+ + sinapyl alcohol ⟶ H+ + NADPH + sinapaldehyde
- phenylpropanoid biosynthesis:
NADP+ + coniferyl alcohol ⟶ H+ + NADPH + coniferaldehyde
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
NADP+ + sinapyl alcohol ⟶ H+ + NADPH + sinapaldehyde
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
NADP+ + coniferyl alcohol ⟶ H+ + NADPH + coniferaldehyde
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
NADP+ + coniferyl alcohol ⟶ H+ + NADPH + coniferaldehyde
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + NADPH ⟶ 4-coumaraldehyde + NADP+ + coenzyme A
- phenylpropanoid biosynthesis:
4-coumaryl alcohol + NADP+ ⟶ 4-coumaraldehyde + H+ + NADPH
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + NADPH ⟶ 4-coumaraldehyde + NADP+ + coenzyme A
- phenylpropanoid biosynthesis:
4-coumaryl alcohol + NADP+ ⟶ 4-coumaraldehyde + H+ + NADPH
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
H+ + NADPH + feruloyl-CoA ⟶ NADP+ + coenzyme A + coniferaldehyde
- phenylpropanoid biosynthesis:
NADP+ + coniferyl alcohol ⟶ H+ + NADPH + coniferaldehyde
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
NADP+ + coniferyl alcohol ⟶ H+ + NADPH + coniferaldehyde
- phenylpropanoid biosynthesis:
4-coumaryl alcohol + NADP+ ⟶ 4-coumaraldehyde + H+ + NADPH
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + NADPH ⟶ 4-coumaraldehyde + NADP+ + coenzyme A
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
H+ + NADPH + feruloyl-CoA ⟶ NADP+ + coenzyme A + coniferaldehyde
- phenylpropanoid biosynthesis:
4-coumaryl alcohol + NADP+ ⟶ 4-coumaraldehyde + H+ + NADPH
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + NADPH ⟶ 4-coumaraldehyde + NADP+ + coenzyme A
- phenylpropanoid biosynthesis:
4-coumaryl alcohol + NADP+ ⟶ 4-coumaraldehyde + H+ + NADPH
- phenylpropanoid biosynthesis:
trans-feruloyl-CoA + H+ + NADPH ⟶ NADP+ + coenzyme A + coniferaldehyde
- phenylpropanoid biosynthesis:
trans-feruloyl-CoA + H+ + NADPH ⟶ NADP+ + coenzyme A + coniferaldehyde
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
trans-feruloyl-CoA + H+ + NADPH ⟶ NADP+ + coenzyme A + coniferaldehyde
- phenylpropanoid biosynthesis:
trans-feruloyl-CoA + H+ + NADPH ⟶ NADP+ + coenzyme A + coniferaldehyde
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + NADPH ⟶ 4-coumaraldehyde + NADP+ + coenzyme A
- phenylpropanoid biosynthesis:
4-coumaryl alcohol + NADP+ ⟶ 4-coumaraldehyde + H+ + NADPH
- phenylpropanoid biosynthesis:
NADP+ + sinapyl alcohol ⟶ H+ + NADPH + sinapaldehyde
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + NADPH ⟶ 4-coumaraldehyde + NADP+ + coenzyme A
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
trans-feruloyl-CoA + H+ + NADPH ⟶ NADP+ + coenzyme A + coniferaldehyde
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + NADPH ⟶ 4-coumaraldehyde + NADP+ + coenzyme A
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
H+ + NADPH + feruloyl-CoA ⟶ NADP+ + coenzyme A + coniferaldehyde
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
trans-feruloyl-CoA + H+ + NADPH ⟶ NADP+ + coenzyme A + coniferaldehyde
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
NADP+ + coniferyl alcohol ⟶ H+ + NADPH + coniferaldehyde
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
trans-feruloyl-CoA + H+ + NADPH ⟶ NADP+ + coenzyme A + coniferaldehyde
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
H+ + NADPH + feruloyl-CoA ⟶ NADP+ + coenzyme A + coniferaldehyde
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + NADPH ⟶ 4-coumaraldehyde + NADP+ + coenzyme A
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
trans-feruloyl-CoA + H+ + NADPH ⟶ NADP+ + coenzyme A + coniferaldehyde
- phenylpropanoid biosynthesis:
4-coumaryl alcohol + NADP+ ⟶ 4-coumaraldehyde + H+ + NADPH
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
trans-feruloyl-CoA + H+ + NADPH ⟶ NADP+ + coenzyme A + coniferaldehyde
- phenylpropanoid biosynthesis:
H+ + NADPH + feruloyl-CoA ⟶ NADP+ + coenzyme A + coniferaldehyde
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
5-hydroxy-coniferaldehyde + SAM ⟶ H+ + SAH + sinapaldehyde
- ferulate and sinapate biosynthesis:
5-hydroxy-coniferaldehyde + SAM ⟶ H+ + SAH + sinapaldehyde
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
NADP+ + sinapyl alcohol ⟶ H+ + NADPH + sinapaldehyde
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
H+ + NADPH + feruloyl-CoA ⟶ NADP+ + coenzyme A + coniferaldehyde
- t-anethole biosynthesis:
trans-anol + SAM ⟶ t-anethole + H+ + SAH
- t-anethole biosynthesis:
trans-anol + SAM ⟶ t-anethole + H+ + SAH
- t-anethole biosynthesis:
trans-anol + SAM ⟶ t-anethole + H+ + SAH
- t-anethole biosynthesis:
trans-anol + SAM ⟶ t-anethole + H+ + SAH
- epoxypseudoisoeugenol-2-methylbutanoate biosynthesis:
2-methylbutanoate + pseudoisoeugenol ⟶ epoxypseudoisoeugenol-2-methylbutanoate
- t-anethole biosynthesis:
trans-anol + SAM ⟶ t-anethole + H+ + SAH
- t-anethole biosynthesis:
trans-anol + SAM ⟶ t-anethole + H+ + SAH
- t-anethole biosynthesis:
trans-anol + SAM ⟶ t-anethole + H+ + SAH
- t-anethole biosynthesis:
trans-anol + SAM ⟶ t-anethole + H+ + SAH
- t-anethole biosynthesis:
trans-anol + SAM ⟶ t-anethole + H+ + SAH
- t-anethole biosynthesis:
trans-anol + SAM ⟶ t-anethole + H+ + SAH
- t-anethole biosynthesis:
trans-anol + SAM ⟶ t-anethole + H+ + SAH
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
(-)-secoisolariciresinol + NADP+ ⟶ (+)-lariciresinol + H+ + NADPH
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
(-)-secoisolariciresinol + NADP+ ⟶ (+)-lariciresinol + H+ + NADPH
- justicidin B biosynthesis:
NAD+ + collinusin ⟶ H+ + NADH + justicidin B
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- matairesinol biosynthesis:
(-)-secoisolariciresinol + NAD+ ⟶ (3R,4R)-3,4-bis(4-hydroxy-3-methoxybenzyl)tetrahydro-2-furanol + H+ + NADH
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
(Z)-but-2-enal + H+ + NADPH ⟶ NADP+ + butan-1-al
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
(Z)-but-2-enal + H+ + NADPH ⟶ NADP+ + butan-1-al
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
(Z)-but-2-enal + H+ + NADPH ⟶ NADP+ + butan-1-al
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
H+ + NADPH + pent-1-en-3-one ⟶ 1-pentan-3-one + NADP+
- detoxification of reactive carbonyls in chloroplasts:
NADP+ + allyl alcohol ⟶ H+ + NADPH + acrolein
- capsiconiate biosynthesis:
H+ + NADPH + feruloyl-CoA ⟶ NADP+ + coenzyme A + coniferaldehyde
- capsiconiate biosynthesis:
8-methyl-6-nonenoate + H+ + coniferyl alcohol ⟶ H2O + capsiconiate
- gossypol biosynthesis:
H2O + O2 + desoxyhemigossypol ⟶ hemigossypol + hydrogen peroxide
- senecionine N-oxide biosynthesis:
H+ + NADPH + O2 + senecionine ⟶ H2O + NADP+ + senecionine N-oxide
- botryococcenes and methylated squalene biosynthesis:
NADP+ + diphosphate + squalene ⟶ H+ + NADPH + presqualene diphosphate
- superpathway of ergosterol biosynthesis II:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase]
- cholesterol biosynthesis I:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase]
- epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase]
- plant sterol biosynthesis II:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase]
- epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase]
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase]
- epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase]
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase]
- epoxysqualene biosynthesis:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- epoxysqualene biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase]
- apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate
- superpathway of gibberellin biosynthesis:
2-oxoglutarate + O2 + gibberellin A9 ⟶ CO2 + gibberellin A4 + succinate
- superpathway of gibberellin GA12 biosynthesis:
ent-kaurene + H+ + NADPH + O2 ⟶ ent-kaurenol + H2O + NADP+
- kauralexin biosynthesis:
ent-isokaurene + H+ + NADPH + O2 ⟶ H2O + NADP+ + kauralexin B1
- kauralexin biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- superpathway of gibberellin biosynthesis:
2-oxoglutarate + O2 + gibberellin44 (open lactone form) ⟶ CO2 + H2O + gibberellin A19 + succinate
- superpathway of gibberellin GA12 biosynthesis:
ent-kaur-16-en-19-oate + H+ + NADPH + O2 ⟶ ent-7α-hydroxykaur-16-en-19-oate + H2O + NADP+
- glucosinolate biosynthesis from homomethionine:
H2O + O2 + glucoiberin ⟶ 3-hydroxypropyl-glucosinolate + H+ + methanesulfonate
- glucosinolate biosynthesis from homomethionine:
(E)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)butan-1-imine + H2O ⟶ (E)-ω-(methylsulfanyl)butyl-thiohydroximate + ammonium + pyruvate
- glucosinolate biosynthesis from homomethionine:
(E)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)butan-1-imine + H2O ⟶ (E)-ω-(methylsulfanyl)butyl-thiohydroximate + ammonium + pyruvate
- glucosinolate biosynthesis from homomethionine:
(E)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)butan-1-imine + H2O ⟶ (E)-ω-(methylsulfanyl)butyl-thiohydroximate + ammonium + pyruvate
- glucosinolate biosynthesis from homomethionine:
(E)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)butan-1-imine + H2O ⟶ (E)-ω-(methylsulfanyl)butyl-thiohydroximate + ammonium + pyruvate
- glucosinolate biosynthesis from homomethionine:
(E)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)butan-1-imine + H2O ⟶ (E)-ω-(methylsulfanyl)butyl-thiohydroximate + ammonium + pyruvate
- glucosinolate biosynthesis from homomethionine:
(E)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)butan-1-imine + H2O ⟶ (E)-ω-(methylsulfanyl)butyl-thiohydroximate + ammonium + pyruvate
- glucosinolate biosynthesis from homomethionine:
O2 + glucoiberin ⟶ H+ + methanesulfonate + sinigrin
- glucosinolate biosynthesis from homomethionine:
(Z)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)butan-1-imine + H2O ⟶ (Z)-ω-(methylsulfanyl)butyl-thiohydroximate + ammonium + pyruvate
- glucosinolate biosynthesis from homomethionine:
(E)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)butan-1-imine + H2O ⟶ (E)-ω-(methylsulfanyl)butyl-thiohydroximate + ammonium + pyruvate
- glucosinolate biosynthesis from homomethionine:
H2O + O2 + glucoiberin ⟶ 3-hydroxypropyl-glucosinolate + H+ + methanesulfonate
- glucosinolate biosynthesis from homomethionine:
(E)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)butan-1-imine + H2O ⟶ (E)-ω-(methylsulfanyl)butyl-thiohydroximate + ammonium + pyruvate
- glucosinolate biosynthesis from homomethionine:
(E)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)butan-1-imine + H2O ⟶ (E)-ω-(methylsulfanyl)butyl-thiohydroximate + ammonium + pyruvate
- glucosinolate biosynthesis from homomethionine:
(E)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)butan-1-imine + H2O ⟶ (E)-ω-(methylsulfanyl)butyl-thiohydroximate + ammonium + pyruvate
- glucosinolate biosynthesis from homomethionine:
(E)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)butan-1-imine + H2O ⟶ (E)-ω-(methylsulfanyl)butyl-thiohydroximate + ammonium + pyruvate
- glucosinolate biosynthesis from homomethionine:
(E)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)butan-1-imine + H2O ⟶ (E)-ω-(methylsulfanyl)butyl-thiohydroximate + ammonium + pyruvate
- glucosinolate biosynthesis from homomethionine:
(Z)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)butan-1-imine + H2O ⟶ (Z)-ω-(methylsulfanyl)butyl-thiohydroximate + ammonium + pyruvate
- diterpene phytoalexins precursors biosynthesis:
9β-stemod-13(17)-en-19-ol + H+ + NADPH + O2 ⟶ 9β-stemod-13(17)-en-19-al + H2O + NADP+
- zymosterol biosynthesis:
14-demethyllanosterol + H+ + O2 + a ferrocytochrome b5 ⟶ 4α-hydroxymethyl-4β-methyl-5α-cholesta-8,24-dien-3β-ol + H2O + a ferricytochrome b5
- chlorophyll cycle:
71-hydroxychlorophyll a + NAD(P)+ ⟶ NAD(P)H + chlorophyll b
- chlorophyll cycle:
71-hydroxychlorophyll a + NAD(P)+ ⟶ NAD(P)H + chlorophyll b
- chlorophyll cycle:
71-hydroxychlorophyll a + NAD(P)+ ⟶ NAD(P)H + chlorophyll b
- chlorophyll cycle:
71-hydroxychlorophyll a + NAD(P)+ ⟶ NAD(P)H + chlorophyll b
- chlorophyll cycle:
71-hydroxychlorophyll a + NAD(P)+ ⟶ NAD(P)H + chlorophyll b
- chlorophyll cycle:
71-hydroxychlorophyll a + NAD(P)+ ⟶ NAD(P)H + chlorophyll b
- momilactone A biosynthesis:
(-)-9β-pimara-7,15-diene + H+ + NADPH + O2 ⟶ 6β-hydroxy-syn-pimaradiene + H2O + NADP+
- momilactone A biosynthesis:
(-)-9β-pimara-7,15-diene + H+ + NADPH + O2 ⟶ 6β-hydroxy-syn-pimaradiene + H2O + NADP+
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinolide biosynthesis II:
NAD+ + campest-4-en-3β-ol ⟶ H+ + NADH + campest-4-en-3-one
- colchicine biosynthesis:
(S)-isoandrocymbine + SAM ⟶ H+ + O-methylandrocymbine + SAH
- lycopadiene biosynthesis:
A(H2) + lycopaoctaene ⟶ (2E6E,10E,14E,18E,22E)-lycopahexaene + A
- (4S)-carvone biosynthesis:
(4R)-limonene + H+ + NADPH + O2 ⟶ (+)-trans-carveol + H2O + NADP+
- (4S)-carvone biosynthesis:
(4R)-limonene + H+ + NADPH + O2 ⟶ (+)-trans-carveol + H2O + NADP+
- (4S)-carvone biosynthesis:
(+)-trans-carveol + NAD+ ⟶ (+)-carvone + H+ + NADH
- (4S)-carvone biosynthesis:
(+)-trans-carveol + NAD+ ⟶ (+)-carvone + H+ + NADH
- glyceollin biosynthesis:
(6αS,11αS)-4-dimethylallyl-3,6α,9-trihydroxypterocarpan + H+ + NADPH + O2 ⟶ H2O + NADP+ + glyceollin I
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
O2 + coniferyl alcohol ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- justicidin B biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- sesamin biosynthesis:
coniferyl alcohol + hydrogen peroxide ⟶ H2O + coniferyl alcohol radical
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-hydroxyteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-hydroxyteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-hydroxyteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of C28 brassinosteroid biosynthesis:
(22S,24R)-22-hydroxy-5α-ergostan-3-one + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-deoxoteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis II:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
3-dehydro-6-deoxoteasterone + A ⟶ (22R,23R)-22,23-dihydroxy-campest-4-en-3-one + A(H2)
- brassinosteroid biosynthesis II:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
NAD+ + campest-4-en-3β-ol ⟶ H+ + NADH + campest-4-en-3-one
- ursolate biosynthesis:
H+ + NADPH + O2 + ursolic aldehyde ⟶ H2O + NADP+ + ursolate
- ursolate biosynthesis:
H+ + NADPH + O2 + ursolic aldehyde ⟶ H2O + NADP+ + ursolate
- ursolate biosynthesis:
H+ + NADPH + O2 + ursolic aldehyde ⟶ H2O + NADP+ + ursolate
- ursolate biosynthesis:
H+ + NADPH + O2 + ursolic aldehyde ⟶ H2O + NADP+ + ursolate
- ursolate biosynthesis:
H+ + NADPH + O2 + ursolic aldehyde ⟶ H2O + NADP+ + ursolate
- phytosterol biosynthesis (plants):
isofucosterol ⟶ Δ24-25-sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
O2 + a reduced [NADPH-hemoprotein reductase] + sitosterol ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + stigmasterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
NADP+ + isofucosterol ⟶ 5-dehydroavenasterol + H+ + NADPH
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
O2 + a reduced [NADPH-hemoprotein reductase] + sitosterol ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + stigmasterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
isofucosterol ⟶ Δ24-25-sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
4α-carboxy-4β,14α-dimethyl-9β,19-cyclo-5α-ergost-24(241)-en-3β-ol + NAD+ ⟶ CO2 + NADH + cycloeucalenone
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- juvenile hormone III biosynthesis I:
(2E,6E)-farnesol + NADP+ ⟶ (2E,6E)-farnesal + H+ + NADPH
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
(2E,6E)-farnesol + NADP+ ⟶ (2E,6E)-farnesal + H+ + NADPH
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
S-(2E,6E)-farnesyl-L-cysteine + H2O + O2 ⟶ (2E,6E)-farnesal + cys + hydrogen peroxide
- farnesylcysteine salvage pathway:
(2E,6E)-farnesol + NADP+ ⟶ (2E,6E)-farnesal + H+ + NADPH
- leucodelphinidin biosynthesis:
(2S)-eriodictyol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (2S)-dihydrotricetin + H2O + an oxidized [NADPH-hemoprotein reductase]
- leucodelphinidin biosynthesis:
(+)-dihydrokaempferol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-taxifolin + H+ + H2O + an oxidized [NADPH-hemoprotein reductase]
- leucodelphinidin biosynthesis:
(2S)-eriodictyol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (2S)-dihydrotricetin + H2O + an oxidized [NADPH-hemoprotein reductase]
- leucodelphinidin biosynthesis:
(2S)-eriodictyol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (2S)-dihydrotricetin + H2O + an oxidized [NADPH-hemoprotein reductase]
- (+)-pisatin biosynthesis:
(3R,4R)-7,2,4,2'-tetrahydroxy-4',5'-methylenedioxyisoflav-3-ene ⟶ (+)-6a-hydroxymaackiain + H2O
- cardenolide biosynthesis:
NADP+ + allopregnanolone ⟶ 5-α-pregnane-3,20-dione + H+ + NADPH
- Amaryllidacea alkaloids biosynthesis:
SAM + norbelladine ⟶ 4'-O-methylnorbelladine + H+ + SAH
- capsidiol biosynthesis:
(+)-5-epi-aristolochene + H+ + NADPH + O2 ⟶ 3-deoxy-capsidiol + H2O + NADP+
- capsidiol biosynthesis:
(+)-5-epi-aristolochene + H+ + NADPH + O2 ⟶ 3-deoxy-capsidiol + H2O + NADP+
- capsidiol biosynthesis:
1-deoxy-capsidiol + H+ + NADPH + O2 ⟶ H2O + NADP+ + capsidiol
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
acetyl-CoA + coniferyl alcohol ⟶ coenzyme A + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
acetyl-CoA + coniferyl alcohol ⟶ coenzyme A + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + isoeugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
acetyl-CoA + coniferyl alcohol ⟶ coenzyme A + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- eugenol and isoeugenol biosynthesis:
NADP+ + acetate + eugenol ⟶ NADPH + coniferyl acetate
- leucodelphinidin biosynthesis:
(2S)-dihydrotricetin + 2-oxoglutarate + O2 ⟶ (+)-dihydromyricetin + CO2 + succinate
- leucodelphinidin biosynthesis:
(2S)-dihydrotricetin + 2-oxoglutarate + O2 ⟶ (+)-dihydromyricetin + CO2 + succinate
- leucodelphinidin biosynthesis:
(2S)-dihydrotricetin + 2-oxoglutarate + O2 ⟶ (+)-dihydromyricetin + CO2 + succinate
- leucodelphinidin biosynthesis:
(2S)-dihydrotricetin + 2-oxoglutarate + O2 ⟶ (+)-dihydromyricetin + CO2 + succinate
- leucodelphinidin biosynthesis:
(2S)-dihydrotricetin + 2-oxoglutarate + O2 ⟶ (+)-dihydromyricetin + CO2 + succinate
- leucodelphinidin biosynthesis:
(2S)-dihydrotricetin + 2-oxoglutarate + O2 ⟶ (+)-dihydromyricetin + CO2 + succinate
- leucodelphinidin biosynthesis:
(2S)-dihydrotricetin + 2-oxoglutarate + O2 ⟶ (+)-dihydromyricetin + CO2 + succinate
- leucodelphinidin biosynthesis:
(2S)-dihydrotricetin + 2-oxoglutarate + O2 ⟶ (+)-dihydromyricetin + CO2 + succinate
- leucodelphinidin biosynthesis:
(2S)-dihydrotricetin + 2-oxoglutarate + O2 ⟶ (+)-dihydromyricetin + CO2 + succinate
- leucodelphinidin biosynthesis:
(2S)-dihydrotricetin + 2-oxoglutarate + O2 ⟶ (+)-dihydromyricetin + CO2 + succinate
- leucodelphinidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucodelphinidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucodelphinidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucodelphinidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucodelphinidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucodelphinidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucodelphinidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucodelphinidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucodelphinidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucodelphinidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucodelphinidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucodelphinidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucodelphinidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucodelphinidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucodelphinidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucodelphinidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucodelphinidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucodelphinidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucodelphinidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucodelphinidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucodelphinidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucodelphinidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucodelphinidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucodelphinidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- cocaine biosynthesis:
NADP+ + ecgonine methyl ester ⟶ H+ + NADPH + methyl ecgonone
- sanguinarine and macarpine biosynthesis:
(S)-reticuline + O2 ⟶ (S)-scoulerine + H+ + hydrogen peroxide
- sanguinarine and macarpine biosynthesis:
(S)-cis-N-methylstylopine + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H+ + H2O + an oxidized [NADPH-hemoprotein reductase] + protopine
- phosphopantothenate biosynthesis II:
β-alanine + (R)-pantolactone ⟶ (R)-pantothenate + H+
- phosphopantothenate biosynthesis II:
(R)-pantolactone + NADP+ ⟶ 2-dehydropantolactone + H+ + NADPH
- phosphopantothenate biosynthesis II:
(R)-pantolactone + NADP+ ⟶ 2-dehydropantolactone + H+ + NADPH
- superpathway of pterocarpan biosynthesis (via daidzein):
O2 + a reduced [NADPH-hemoprotein reductase] + daidzein ⟶ 2'-hydroxydaidzein + H2O + an oxidized [NADPH-hemoprotein reductase]
- (-)-glycinol biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + daidzein ⟶ 2'-hydroxydaidzein + H2O + an oxidized [NADPH-hemoprotein reductase]
- (-)-glycinol biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + daidzein ⟶ 2'-hydroxydaidzein + H2O + an oxidized [NADPH-hemoprotein reductase]
- (-)-glycinol biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + daidzein ⟶ 2'-hydroxydaidzein + H2O + an oxidized [NADPH-hemoprotein reductase]
- (-)-glycinol biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + daidzein ⟶ 2'-hydroxydaidzein + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of pterocarpan biosynthesis (via daidzein):
(6αS,11αS)-2-dimethylallyl-3,6α,9-trihydroxypterocarpan + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + glyceollin II
- (-)-glycinol biosynthesis:
(3R,4R)-7,2',4'-trihydroxyisoflavanol + NADP+ ⟶ (3R)-2'-hydroxydihydrodaidzein + H+ + NADPH
- coumestrol biosynthesis:
(S)-dihydrodaidzein + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (3R)-2'-hydroxydihydrodaidzein + H2O + an oxidized [NADPH-hemoprotein reductase]
- (-)-glycinol biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + daidzein ⟶ 2'-hydroxydaidzein + H2O + an oxidized [NADPH-hemoprotein reductase]
- (-)-glycinol biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + daidzein ⟶ 2'-hydroxydaidzein + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of pterocarpan biosynthesis (via daidzein):
2,4',7-trihydroxyisoflavanone ⟶ H2O + daidzein
- (-)-glycinol biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + daidzein ⟶ 2'-hydroxydaidzein + H2O + an oxidized [NADPH-hemoprotein reductase]
- (-)-glycinol biosynthesis:
(3R)-2'-hydroxydihydrodaidzein + NADP+ ⟶ 2'-hydroxydaidzein + H+ + NADPH
- yatein biosynthesis II:
O4,O5--dimethylthujaplicatin + H+ + NADPH + O2 ⟶ (-)-yatein + H2O + NADP+
- glucosinolate biosynthesis from dihomomethionine:
4-(methylsulfanyl)butyl-desulfoglucosinolate + PAPS ⟶ 3',5'-ADP + 4-(methylsulfanyl)butyl-glucosinolate + H+
- glucosinolate biosynthesis from dihomomethionine:
(E)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)pentan-1-imine + H2O ⟶ (E)-ω-(methylsulfanyl)pentyl-thiohydroximate + ammonium + pyruvate
- glucosinolate biosynthesis from dihomomethionine:
(E)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)pentan-1-imine + H2O ⟶ (E)-ω-(methylsulfanyl)pentyl-thiohydroximate + ammonium + pyruvate
- glucosinolate biosynthesis from dihomomethionine:
(E)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)pentan-1-imine + H2O ⟶ (E)-ω-(methylsulfanyl)pentyl-thiohydroximate + ammonium + pyruvate
- glucosinolate biosynthesis from dihomomethionine:
(E)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)pentan-1-imine + H2O ⟶ (E)-ω-(methylsulfanyl)pentyl-thiohydroximate + ammonium + pyruvate
- glucosinolate biosynthesis from dihomomethionine:
(E)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)pentan-1-imine + H2O ⟶ (E)-ω-(methylsulfanyl)pentyl-thiohydroximate + ammonium + pyruvate
- glucosinolate biosynthesis from dihomomethionine:
(E)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)pentan-1-imine + H2O ⟶ (E)-ω-(methylsulfanyl)pentyl-thiohydroximate + ammonium + pyruvate
- glucosinolate biosynthesis from dihomomethionine:
4-(methylsulfanyl)butyl-desulfoglucosinolate + PAPS ⟶ 3',5'-ADP + 4-(methylsulfanyl)butyl-glucosinolate + H+
- glucosinolate biosynthesis from dihomomethionine:
(Z)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)pentan-1-imine + H2O ⟶ (Z)-ω-(methylsulfanyl)pentyl-thiohydroximate + ammonium + pyruvate
- glucosinolate biosynthesis from dihomomethionine:
(E)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)pentan-1-imine + H2O ⟶ (E)-ω-(methylsulfanyl)pentyl-thiohydroximate + ammonium + pyruvate
- glucosinolate biosynthesis from dihomomethionine:
4-(methylsulfanyl)butyl-desulfoglucosinolate + PAPS ⟶ 3',5'-ADP + 4-(methylsulfanyl)butyl-glucosinolate + H+
- glucosinolate biosynthesis from dihomomethionine:
(E)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)pentan-1-imine + H2O ⟶ (E)-ω-(methylsulfanyl)pentyl-thiohydroximate + ammonium + pyruvate
- glucosinolate biosynthesis from dihomomethionine:
(E)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)pentan-1-imine + H2O ⟶ (E)-ω-(methylsulfanyl)pentyl-thiohydroximate + ammonium + pyruvate
- glucosinolate biosynthesis from dihomomethionine:
(E)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)pentan-1-imine + H2O ⟶ (E)-ω-(methylsulfanyl)pentyl-thiohydroximate + ammonium + pyruvate
- glucosinolate biosynthesis from dihomomethionine:
(E)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)pentan-1-imine + H2O ⟶ (E)-ω-(methylsulfanyl)pentyl-thiohydroximate + ammonium + pyruvate
- glucosinolate biosynthesis from dihomomethionine:
(E)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)pentan-1-imine + H2O ⟶ (E)-ω-(methylsulfanyl)pentyl-thiohydroximate + ammonium + pyruvate
- glucosinolate biosynthesis from dihomomethionine:
(Z)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)pentan-1-imine + H2O ⟶ (Z)-ω-(methylsulfanyl)pentyl-thiohydroximate + ammonium + pyruvate
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxylignoceroyl-CoA + NADP+ ⟶ 3-oxolignoceroyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxybehenoyl-CoA + NADP+ ⟶ 3-oxobehenoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxybehenoyl-CoA + NADP+ ⟶ 3-oxobehenoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxycerotoyl-CoA + NADP+ ⟶ 3-oxocerotoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxy-arachidoyl-CoA + NADP+ ⟶ 3-oxoicosanoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
NADP+ + cerotoyl-CoA ⟶ trans-cerot-2-enoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxy-arachidoyl-CoA + NADP+ ⟶ 3-oxoicosanoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxybehenoyl-CoA + NADP+ ⟶ 3-oxobehenoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
NADP+ + icosanoyl-CoA ⟶ trans-arachido-2-enoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
NADP+ + icosanoyl-CoA ⟶ trans-arachido-2-enoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
NADP+ + lignoceroyl-CoA ⟶ trans-lignocer-2-enoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxy-arachidoyl-CoA + NADP+ ⟶ 3-oxoicosanoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxycerotoyl-CoA + NADP+ ⟶ 3-oxocerotoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxybehenoyl-CoA + NADP+ ⟶ 3-oxobehenoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
NADP+ + icosanoyl-CoA ⟶ trans-arachido-2-enoyl-CoA + H+ + NADPH
- cuticular wax biosynthesis:
NADP+ + a very-long-chain fatty aldehyde + coenzyme A ⟶ H+ + NADPH + a very-long-chain fatty acyl-CoA
- very long chain fatty acid biosynthesis I:
NADP+ + a very-long-chain (3R)-3-hydroxyacyl-CoA ⟶ H+ + NADPH + a very-long-chain oxoacyl-CoA
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxy-arachidoyl-CoA + NADP+ ⟶ 3-oxoicosanoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxycerotoyl-CoA + NADP+ ⟶ 3-oxocerotoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxy-arachidoyl-CoA + NADP+ ⟶ 3-oxoicosanoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxy-arachidoyl-CoA + NADP+ ⟶ 3-oxoicosanoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis I:
NADP+ + a very-long-chain 2,3,4-saturated fatty acyl CoA ⟶ H+ + NADPH + a very-long-chain (2E)-2-enoyl-CoA
- cuticular wax biosynthesis:
NADP+ + a very-long-chain fatty aldehyde + coenzyme A ⟶ H+ + NADPH + a very-long-chain fatty acyl-CoA
- very long chain fatty acid biosynthesis II:
NADP+ + cerotoyl-CoA ⟶ trans-cerot-2-enoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
NADP+ + cerotoyl-CoA ⟶ trans-cerot-2-enoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis I:
NADP+ + a very-long-chain 2,3,4-saturated fatty acyl CoA ⟶ H+ + NADPH + a very-long-chain (2E)-2-enoyl-CoA
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxycerotoyl-CoA + NADP+ ⟶ 3-oxocerotoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
NADP+ + cerotoyl-CoA ⟶ trans-cerot-2-enoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxy-arachidoyl-CoA + NADP+ ⟶ 3-oxoicosanoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxy-arachidoyl-CoA + NADP+ ⟶ 3-oxoicosanoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis I:
NADP+ + a very-long-chain 2,3,4-saturated fatty acyl CoA ⟶ H+ + NADPH + a very-long-chain (2E)-2-enoyl-CoA
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxy-arachidoyl-CoA + NADP+ ⟶ 3-oxoicosanoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxy-arachidoyl-CoA + NADP+ ⟶ 3-oxoicosanoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxybehenoyl-CoA + NADP+ ⟶ 3-oxobehenoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
NADP+ + cerotoyl-CoA ⟶ trans-cerot-2-enoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis I:
NADP+ + a very-long-chain (3R)-3-hydroxyacyl-CoA ⟶ H+ + NADPH + a very-long-chain oxoacyl-CoA
- cuticular wax biosynthesis:
NADP+ + a very-long-chain fatty aldehyde + coenzyme A ⟶ H+ + NADPH + a very-long-chain fatty acyl-CoA
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxy-arachidoyl-CoA + NADP+ ⟶ 3-oxoicosanoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxy-arachidoyl-CoA + NADP+ ⟶ 3-oxoicosanoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxy-arachidoyl-CoA + NADP+ ⟶ 3-oxoicosanoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxylignoceroyl-CoA + NADP+ ⟶ 3-oxolignoceroyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
NADP+ + docosanoyl-CoA ⟶ trans-docos-2-enoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis I:
NADP+ + a very-long-chain 2,3,4-saturated fatty acyl CoA ⟶ H+ + NADPH + a very-long-chain (2E)-2-enoyl-CoA
- very long chain fatty acid biosynthesis II:
NADP+ + cerotoyl-CoA ⟶ trans-cerot-2-enoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxycerotoyl-CoA + NADP+ ⟶ 3-oxocerotoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
NADP+ + docosanoyl-CoA ⟶ trans-docos-2-enoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis I:
NADP+ + a very-long-chain (3R)-3-hydroxyacyl-CoA ⟶ H+ + NADPH + a very-long-chain oxoacyl-CoA
- cuticular wax biosynthesis:
NADP+ + a very-long-chain fatty aldehyde + coenzyme A ⟶ H+ + NADPH + a very-long-chain fatty acyl-CoA
- very long chain fatty acid biosynthesis II:
NADP+ + lignoceroyl-CoA ⟶ trans-lignocer-2-enoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis I:
NADP+ + a very-long-chain (3R)-3-hydroxyacyl-CoA ⟶ H+ + NADPH + a very-long-chain oxoacyl-CoA
- very long chain fatty acid biosynthesis II:
NADP+ + docosanoyl-CoA ⟶ trans-docos-2-enoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
NADP+ + cerotoyl-CoA ⟶ trans-cerot-2-enoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis I:
NADP+ + a very-long-chain (3R)-3-hydroxyacyl-CoA ⟶ H+ + NADPH + a very-long-chain oxoacyl-CoA
- very long chain fatty acid biosynthesis II:
H+ + malonyl-CoA + stearoyl-CoA ⟶ 3-oxoicosanoyl-CoA + CO2 + coenzyme A
- very long chain fatty acid biosynthesis II:
H+ + malonyl-CoA + stearoyl-CoA ⟶ 3-oxoicosanoyl-CoA + CO2 + coenzyme A
- very long chain fatty acid biosynthesis I:
a very-long-chain 2,3,4-saturated fatty acyl CoA + malonyl-CoA ⟶ CO2 + a very-long-chain oxoacyl-CoA + coenzyme A
- very long chain fatty acid biosynthesis II:
H+ + malonyl-CoA + stearoyl-CoA ⟶ 3-oxoicosanoyl-CoA + CO2 + coenzyme A
- cuticular wax biosynthesis:
a very-long-chain aldehyde ⟶ CO + a very long-chain alkane
- very long chain fatty acid biosynthesis II:
H+ + malonyl-CoA + stearoyl-CoA ⟶ 3-oxoicosanoyl-CoA + CO2 + coenzyme A
- very long chain fatty acid biosynthesis I:
a very-long-chain 2,3,4-saturated fatty acyl CoA + malonyl-CoA ⟶ CO2 + a very-long-chain oxoacyl-CoA + coenzyme A
- very long chain fatty acid biosynthesis II:
H+ + lignoceroyl-CoA + malonyl-CoA ⟶ 3-oxocerotoyl-CoA + CO2 + coenzyme A
- very long chain fatty acid biosynthesis II:
H+ + malonyl-CoA + stearoyl-CoA ⟶ 3-oxoicosanoyl-CoA + CO2 + coenzyme A
- very long chain fatty acid biosynthesis II:
H+ + malonyl-CoA + stearoyl-CoA ⟶ 3-oxoicosanoyl-CoA + CO2 + coenzyme A
- very long chain fatty acid biosynthesis I:
NADP+ + a very-long-chain 2,3,4-saturated fatty acyl CoA ⟶ H+ + NADPH + a very-long-chain (2E)-2-enoyl-CoA
- cuticular wax biosynthesis:
a very-long-chain fatty aldehyde ⟶ CO + a very long-chain alkane
- very long chain fatty acid biosynthesis II:
NADP+ + cerotoyl-CoA ⟶ trans-cerot-2-enoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxy-arachidoyl-CoA + NADP+ ⟶ 3-oxoicosanoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxy-arachidoyl-CoA + NADP+ ⟶ 3-oxoicosanoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
NADP+ + cerotoyl-CoA ⟶ trans-cerot-2-enoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
NADP+ + docosanoyl-CoA ⟶ trans-docos-2-enoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxy-arachidoyl-CoA + NADP+ ⟶ 3-oxoicosanoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxylignoceroyl-CoA + NADP+ ⟶ 3-oxolignoceroyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxy-arachidoyl-CoA + NADP+ ⟶ 3-oxoicosanoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
NADP+ + lignoceroyl-CoA ⟶ trans-lignocer-2-enoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxylignoceroyl-CoA + NADP+ ⟶ 3-oxolignoceroyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxy-arachidoyl-CoA + NADP+ ⟶ 3-oxoicosanoyl-CoA + H+ + NADPH
- cuticular wax biosynthesis:
a very-long-chain aldehyde ⟶ CO + a very long-chain alkane
- very long chain fatty acid biosynthesis I:
NADP+ + a very-long-chain (3R)-3-hydroxyacyl-CoA ⟶ H+ + NADPH + a very-long-chain oxoacyl-CoA
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxybehenoyl-CoA + NADP+ ⟶ 3-oxobehenoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxycerotoyl-CoA + NADP+ ⟶ 3-oxocerotoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
NADP+ + docosanoyl-CoA ⟶ trans-docos-2-enoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
NADP+ + lignoceroyl-CoA ⟶ trans-lignocer-2-enoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
NADP+ + docosanoyl-CoA ⟶ trans-docos-2-enoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
NADP+ + lignoceroyl-CoA ⟶ trans-lignocer-2-enoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis I:
NADP+ + a very-long-chain 2,3,4-saturated fatty acyl CoA ⟶ H+ + NADPH + a very-long-chain (2E)-2-enoyl-CoA
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxy-arachidoyl-CoA + NADP+ ⟶ 3-oxoicosanoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis I:
NADP+ + a very-long-chain 2,3,4-saturated fatty acyl CoA ⟶ H+ + NADPH + a very-long-chain (2E)-2-enoyl-CoA
- cuticular wax biosynthesis:
a very-long-chain aldehyde ⟶ CO + a very long-chain alkane
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxy-arachidoyl-CoA + NADP+ ⟶ 3-oxoicosanoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
NADP+ + lignoceroyl-CoA ⟶ trans-lignocer-2-enoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxy-arachidoyl-CoA + NADP+ ⟶ 3-oxoicosanoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
NADP+ + lignoceroyl-CoA ⟶ trans-lignocer-2-enoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxy-arachidoyl-CoA + NADP+ ⟶ 3-oxoicosanoyl-CoA + H+ + NADPH
- cuticular wax biosynthesis:
a very-long-chain aldehyde ⟶ CO + a very long-chain alkane
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxy-arachidoyl-CoA + NADP+ ⟶ 3-oxoicosanoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxy-arachidoyl-CoA + NADP+ ⟶ 3-oxoicosanoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxy-arachidoyl-CoA + NADP+ ⟶ 3-oxoicosanoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxy-arachidoyl-CoA + NADP+ ⟶ 3-oxoicosanoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxy-arachidoyl-CoA + NADP+ ⟶ 3-oxoicosanoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxy-arachidoyl-CoA + NADP+ ⟶ 3-oxoicosanoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
NADP+ + cerotoyl-CoA ⟶ trans-cerot-2-enoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxy-arachidoyl-CoA + NADP+ ⟶ 3-oxoicosanoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxy-arachidoyl-CoA + NADP+ ⟶ 3-oxoicosanoyl-CoA + H+ + NADPH
- very long chain fatty acid biosynthesis II:
(3R)-3-hydroxy-arachidoyl-CoA + NADP+ ⟶ 3-oxoicosanoyl-CoA + H+ + NADPH
- 3,8-divinyl-chlorophyllide a biosynthesis I (aerobic, light-dependent):
O2 + protoporphyrinogen IX ⟶ hydrogen peroxide + protoporphyrin IX
- 3,8-divinyl-chlorophyllide a biosynthesis III (aerobic, light independent):
O2 + protoporphyrinogen IX ⟶ hydrogen peroxide + protoporphyrin IX
- menthol biosynthesis:
(-)-menthol + NADP+ ⟶ (-)-menthone + H+ + NADPH
- menthol biosynthesis:
(-)-menthol + NADP+ ⟶ (-)-menthone + H+ + NADPH
- phytyl diphosphate biosynthesis:
NADP+ + dihydrogeranylgeranyl diphosphate ⟶ GGPP + H+ + NADPH
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phytyl diphosphate biosynthesis:
NADP+ + dihydrogeranylgeranyl diphosphate ⟶ GGPP + H+ + NADPH
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phytyl diphosphate biosynthesis:
NADP+ + dihydrogeranylgeranyl diphosphate ⟶ GGPP + H+ + NADPH
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phytyl diphosphate biosynthesis:
NADP+ + dihydrogeranylgeranyl diphosphate ⟶ GGPP + H+ + NADPH
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phytyl diphosphate biosynthesis:
NADP+ + dihydrogeranylgeranyl diphosphate ⟶ GGPP + H+ + NADPH
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phytyl diphosphate biosynthesis:
NADP+ + dihydrogeranylgeranyl diphosphate ⟶ GGPP + H+ + NADPH
- phytyl diphosphate biosynthesis:
NADP+ + dihydrogeranylgeranyl diphosphate ⟶ GGPP + H+ + NADPH
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phytyl diphosphate biosynthesis:
NADP+ + dihydrogeranylgeranyl diphosphate ⟶ GGPP + H+ + NADPH
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phytyl diphosphate biosynthesis:
NADP+ + dihydrogeranylgeranyl diphosphate ⟶ GGPP + H+ + NADPH
- phytyl diphosphate biosynthesis:
NADP+ + dihydrogeranylgeranyl diphosphate ⟶ GGPP + H+ + NADPH
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phytyl diphosphate biosynthesis:
NADP+ + dihydrogeranylgeranyl diphosphate ⟶ GGPP + H+ + NADPH
- phytyl diphosphate biosynthesis:
NADP+ + dihydrogeranylgeranyl diphosphate ⟶ GGPP + H+ + NADPH
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phytyl diphosphate biosynthesis:
NADP+ + dihydrogeranylgeranyl diphosphate ⟶ GGPP + H+ + NADPH
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phytyl diphosphate biosynthesis:
NADP+ + dihydrogeranylgeranyl diphosphate ⟶ GGPP + H+ + NADPH
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phytyl diphosphate biosynthesis:
NADP+ + dihydrogeranylgeranyl diphosphate ⟶ GGPP + H+ + NADPH
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phytyl diphosphate biosynthesis:
NADP+ + dihydrogeranylgeranyl diphosphate ⟶ GGPP + H+ + NADPH
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phytyl diphosphate biosynthesis:
NADP+ + dihydrogeranylgeranyl diphosphate ⟶ GGPP + H+ + NADPH
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phytyl diphosphate biosynthesis:
NADP+ + dihydrogeranylgeranyl diphosphate ⟶ GGPP + H+ + NADPH
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phytyl diphosphate biosynthesis:
NADP+ + dihydrogeranylgeranyl diphosphate ⟶ GGPP + H+ + NADPH
- phytyl diphosphate biosynthesis:
NADP+ + dihydrogeranylgeranyl diphosphate ⟶ GGPP + H+ + NADPH
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phytyl diphosphate biosynthesis:
NADP+ + dihydrogeranylgeranyl diphosphate ⟶ GGPP + H+ + NADPH
- phytyl diphosphate biosynthesis:
NADP+ + dihydrogeranylgeranyl diphosphate ⟶ GGPP + H+ + NADPH
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phytyl diphosphate biosynthesis:
NADP+ + dihydrogeranylgeranyl diphosphate ⟶ GGPP + H+ + NADPH
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phytyl diphosphate biosynthesis:
NADP+ + dihydrogeranylgeranyl diphosphate ⟶ GGPP + H+ + NADPH
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phytyl diphosphate biosynthesis:
NADP+ + tetrahydrogeranylgeranyl diphosphate ⟶ H+ + NADPH + dihydrogeranylgeranyl diphosphate
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3S,6E)-nerolidol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + an oxidized [NADPH-hemoprotein reductase] + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(2E,6E)-farnesyl diphosphate + H2O ⟶ (3R,6E)-nerolidol + diphosphate
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3S,6E)-nerolidol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + an oxidized [NADPH-hemoprotein reductase] + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3S,6E)-nerolidol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + an oxidized [NADPH-hemoprotein reductase] + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3S,6E)-nerolidol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + an oxidized [NADPH-hemoprotein reductase] + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3S,6E)-nerolidol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + an oxidized [NADPH-hemoprotein reductase] + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3S,6E)-nerolidol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + an oxidized [NADPH-hemoprotein reductase] + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3S,6E)-nerolidol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + an oxidized [NADPH-hemoprotein reductase] + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3S,6E)-nerolidol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + an oxidized [NADPH-hemoprotein reductase] + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3S,6E)-nerolidol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + an oxidized [NADPH-hemoprotein reductase] + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3S,6E)-nerolidol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + an oxidized [NADPH-hemoprotein reductase] + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3S,6E)-nerolidol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + an oxidized [NADPH-hemoprotein reductase] + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3S,6E)-nerolidol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + an oxidized [NADPH-hemoprotein reductase] + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3S,6E)-nerolidol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + an oxidized [NADPH-hemoprotein reductase] + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(2E,6E)-farnesyl diphosphate + H2O ⟶ (3R,6E)-nerolidol + diphosphate
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis I:
(3R,6E)-nerolidol + H+ + NADPH + O2 ⟶ (3E)-4,8-dimethylnona-1,3,7-triene + H2O + NADP+ + but-3-en-2-one
- cuticular wax biosynthesis:
a very-long-chain fatty aldehyde ⟶ CO + a very long-chain alkane
- chlorophyll a biosynthesis I:
NADP+ + chlorophyllide a ⟶ 3,8-divinyl chlorophyllide a + H+ + NADPH
- chlorophyll a biosynthesis I:
NADP+ + chlorophyllide a ⟶ 3,8-divinyl chlorophyllide a + H+ + NADPH
- chlorophyll a biosynthesis I:
NADP+ + chlorophyllide a ⟶ 3,8-divinyl chlorophyllide a + H+ + NADPH
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
H+ + NADPH + O2 + genkwanin ⟶ H2O + NADP+ + scutellarein 7-methyl ether
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
H+ + NADPH + O2 + apigenin-7,4'-dimethyl ether ⟶ H2O + NADP+ + ladanein
- salvigenin biosynthesis:
H+ + NADPH + O2 + apigenin-7,4'-dimethyl ether ⟶ H2O + NADP+ + ladanein
- morphine biosynthesis:
2-oxoglutarate + O2 + oripavine ⟶ CO2 + formaldehyde + morphinone + succinate
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- betulinate biosynthesis:
H+ + NADPH + O2 + betulin ⟶ H2O + NADP+ + betulinic aldehyde
- betulinate biosynthesis:
H+ + NADPH + O2 + betulin ⟶ H2O + NADP+ + betulinic aldehyde
- betulinate biosynthesis:
H+ + NADPH + O2 + lupeol ⟶ H2O + NADP+ + betulin
- betulinate biosynthesis:
H+ + NADPH + O2 + betulin ⟶ H2O + NADP+ + betulinic aldehyde
- betulinate biosynthesis:
H+ + NADPH + O2 + betulin ⟶ H2O + NADP+ + betulinic aldehyde
- (4R)-carvone biosynthesis:
(-)-trans-carveol + NADP+ ⟶ (-)-carvone + H+ + NADPH
- ubiquinol-10 biosynthesis (eukaryotic):
6-(all-trans-decaprenyl)-2-methoxy-phenol + H+ + NADPH + O2 ⟶ all trans-decaprenyl-2-methoxy-6-1,4-benzoquinol + H2O + NADP+
- ubiquinol-10 biosynthesis (eukaryotic):
6-(all-trans-decaprenyl)-2-methoxy-phenol + H+ + NADPH + O2 ⟶ all trans-decaprenyl-2-methoxy-6-1,4-benzoquinol + H2O + NADP+
- ubiquinol-10 biosynthesis (eukaryotic):
4-hydroxybenzoate + all-trans-decaprenyl diphosphate ⟶ 3-decaprenyl-4-hydroxybenzoate + diphosphate
- ubiquinol-10 biosynthesis (eukaryotic):
4-hydroxybenzoate + all-trans-decaprenyl diphosphate ⟶ 3-decaprenyl-4-hydroxybenzoate + diphosphate
- ubiquinol-10 biosynthesis (eukaryotic):
4-hydroxybenzoate + all-trans-decaprenyl diphosphate ⟶ 3-decaprenyl-4-hydroxybenzoate + diphosphate
- ubiquinol-10 biosynthesis (eukaryotic):
4-hydroxybenzoate + all-trans-decaprenyl diphosphate ⟶ 3-decaprenyl-4-hydroxybenzoate + diphosphate
- ubiquinol-10 biosynthesis (eukaryotic):
4-hydroxybenzoate + all-trans-decaprenyl diphosphate ⟶ 3-decaprenyl-4-hydroxybenzoate + diphosphate
- ubiquinol-10 biosynthesis (eukaryotic):
4-hydroxybenzoate + all-trans-decaprenyl diphosphate ⟶ 3-decaprenyl-4-hydroxybenzoate + diphosphate
- ubiquinol-10 biosynthesis (eukaryotic):
4-hydroxybenzoate + all-trans-decaprenyl diphosphate ⟶ 3-decaprenyl-4-hydroxybenzoate + diphosphate
- ubiquinol-10 biosynthesis (eukaryotic):
4-hydroxybenzoate + all-trans-decaprenyl diphosphate ⟶ 3-decaprenyl-4-hydroxybenzoate + diphosphate
- ubiquinol-10 biosynthesis (eukaryotic):
4-hydroxybenzoate + all-trans-decaprenyl diphosphate ⟶ 3-decaprenyl-4-hydroxybenzoate + diphosphate
- ubiquinol-10 biosynthesis (eukaryotic):
4-hydroxybenzoate + all-trans-decaprenyl diphosphate ⟶ 3-decaprenyl-4-hydroxybenzoate + diphosphate
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
3-ureidopropanoate + H+ + H2O ⟶ β-alanine + CO2 + ammonium
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + H2O ⟶ 3-ureidopropanoate + H+
- uracil degradation I (reductive):
5,6-dihydrouracil + NADP+ ⟶ H+ + NADPH + uracil
- kievitone biosynthesis:
2,3-dehydrokievitone + H+ + NADPH ⟶ NADP+ + kievitone
- kievitone biosynthesis:
NADP+ + dalbergioidin ⟶ 2'-hydroxygenistein + H+ + NADPH
- superpathway of isoflavonoids (via naringenin):
SAM + genistein ⟶ SAH + prunetin
- kievitone biosynthesis:
NADP+ + dalbergioidin ⟶ 2'-hydroxygenistein + H+ + NADPH
- superpathway of isoflavonoids (via naringenin):
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
ATP + benzoate + coenzyme A ⟶ AMP + benzoyl-CoA + diphosphate
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
3-hydroxy-3-phenylpropanoyl-CoA + NADP+ ⟶ 3-oxo-3-phenylpropanoyl-CoA + H+ + NADPH
- benzoyl-CoA biosynthesis:
3-hydroxy-3-phenylpropanoyl-CoA + NADP+ ⟶ 3-oxo-3-phenylpropanoyl-CoA + H+ + NADPH
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoyl-CoA biosynthesis:
3-hydroxy-3-phenylpropanoyl-CoA + NADP+ ⟶ 3-oxo-3-phenylpropanoyl-CoA + H+ + NADPH
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoyl-CoA biosynthesis:
3-hydroxy-3-phenylpropanoyl-CoA + NADP+ ⟶ 3-oxo-3-phenylpropanoyl-CoA + H+ + NADPH
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
ATP + benzoate + coenzyme A ⟶ AMP + benzoyl-CoA + diphosphate
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoyl-CoA biosynthesis:
3-hydroxy-3-phenylpropanoyl-CoA + NADP+ ⟶ 3-oxo-3-phenylpropanoyl-CoA + H+ + NADPH
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
ATP + benzoate + coenzyme A ⟶ AMP + benzoyl-CoA + diphosphate
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzoyl-CoA ⟶ H+ + benzoate + coenzyme A
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- hyperxanthone E biosynthesis:
3-hydroxy-3-phenylpropanoyl-CoA + NADP+ ⟶ 3-oxo-3-phenylpropanoyl-CoA + H+ + NADPH
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
3-hydroxy-3-phenylpropanoyl-CoA + NADP+ ⟶ 3-oxo-3-phenylpropanoyl-CoA + H+ + NADPH
- benzoyl-CoA biosynthesis:
3-hydroxy-3-phenylpropanoyl-CoA + NADP+ ⟶ 3-oxo-3-phenylpropanoyl-CoA + H+ + NADPH
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
ATP + benzoate + coenzyme A ⟶ AMP + benzoyl-CoA + diphosphate
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
ATP + benzoate + coenzyme A ⟶ AMP + benzoyl-CoA + diphosphate
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
ATP + benzoate + coenzyme A ⟶ AMP + benzoyl-CoA + diphosphate
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoyl-CoA biosynthesis:
3-oxo-3-phenylpropanoyl-CoA + coenzyme A ⟶ acetyl-CoA + benzoyl-CoA
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
ATP + benzoate + coenzyme A ⟶ AMP + benzoyl-CoA + diphosphate
- benzoate biosynthesis I (CoA-dependent, β-oxidative):
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- ajmaline and sarpagine biosynthesis:
3-α(S)-strictosidine + H2O ⟶ D-glucopyranose + strictosidine aglycone
- ajmaline and sarpagine biosynthesis:
3-α(S)-strictosidine + H2O ⟶ D-glucopyranose + strictosidine aglycone
- ajmaline and sarpagine biosynthesis:
H2O + polyneuridine aldehyde ⟶ 16-epivellosimine + CO2 + MeOH
- plumbagin biosynthesis:
1,8-dihydroxy-3-methylnaphthalene ⟶ plumbagin
- raspberry ketone biosynthesis:
4-hydroxyphenylbutan-2-one + NADP+ ⟶ 4-hydroxybenzalacetone + H+ + NADPH
- raspberry ketone biosynthesis:
4-hydroxyphenylbutan-2-one + NADP+ ⟶ 4-hydroxybenzalacetone + H+ + NADPH
- raspberry ketone biosynthesis:
4-hydroxyphenylbutan-2-one + NADP+ ⟶ 4-hydroxybenzalacetone + H+ + NADPH
- raspberry ketone biosynthesis:
4-hydroxyphenylbutan-2-one + NADP+ ⟶ 4-hydroxybenzalacetone + H+ + NADPH
- raspberry ketone biosynthesis:
4-hydroxyphenylbutan-2-one + NADP+ ⟶ 4-hydroxybenzalacetone + H+ + NADPH
- dehydroabietic acid biosynthesis:
A + abieta-7,13-diene ⟶ A(H2) + abietatriene
- superpathway of diterpene resin acids biosynthesis:
A + abieta-7,13-diene ⟶ A(H2) + abietatriene
- noscapine biosynthesis:
(S)-reticuline + O2 ⟶ (S)-scoulerine + H+ + hydrogen peroxide
- noscapine biosynthesis:
(S)-reticuline + O2 ⟶ (S)-scoulerine + H+ + hydrogen peroxide
- noscapine biosynthesis:
(S)-reticuline + O2 ⟶ (S)-scoulerine + H+ + hydrogen peroxide
- noscapine biosynthesis:
(S)-reticuline + O2 ⟶ (S)-scoulerine + H+ + hydrogen peroxide
- formaldehyde oxidation VII (THF pathway):
a tetrahydrofolate + formaldehyde ⟶ H2O + a 5,10-methylenetetrahydrofolate
- formate assimilation into 5,10-methylenetetrahydrofolate:
NADP+ + a 5,10-methylenetetrahydrofolate ⟶ NADPH + a 5,10-methenyltetrahydrofolate
- secologanin and strictosidine biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- secologanin and strictosidine biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- secologanin and strictosidine biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + geraniol ⟶ (6E)-8-hydroxygeraniol + H2O + an oxidized [NADPH-hemoprotein reductase]
- neoabietic acid biosynthesis:
H+ + NADPH + O2 + neoabietadiene ⟶ H2O + NADP+ + neoabietadienol
- cholesterol biosynthesis (plants):
H+ + O2 + a ferrocytochrome b5 + cycloartanol ⟶ (3β,9β)-4α-demethyl-4α-carboxy-9,19-cyclolanost-3-ol + H2O + a ferricytochrome b5
- cholesterol biosynthesis (plants):
NADP+ + cholesterol ⟶ 7-dehydrocholesterol + H+ + NADPH
- cholesterol biosynthesis (plants):
NADP+ + cholesterol ⟶ 7-dehydrocholesterol + H+ + NADPH
- cholesterol biosynthesis (plants):
NADP+ + cholesterol ⟶ 7-dehydrocholesterol + H+ + NADPH
- cholesterol biosynthesis (plants):
NADP+ + cholesterol ⟶ 7-dehydrocholesterol + H+ + NADPH
- cholesterol biosynthesis (plants):
H+ + O2 + a ferrocytochrome b5 + lathosterol ⟶ 7-dehydrocholesterol + H2O + a ferricytochrome b5
- cholesterol biosynthesis (plants):
NADP+ + cholesterol ⟶ 7-dehydrocholesterol + H+ + NADPH
- cholesterol biosynthesis (plants):
H+ + O2 + a ferrocytochrome b5 + lathosterol ⟶ 7-dehydrocholesterol + H2O + a ferricytochrome b5
- cholesterol biosynthesis (plants):
H+ + O2 + a ferrocytochrome b5 + lathosterol ⟶ 7-dehydrocholesterol + H2O + a ferricytochrome b5
- cholesterol biosynthesis (plants):
H+ + O2 + a ferrocytochrome b5 + lathosterol ⟶ 7-dehydrocholesterol + H2O + a ferricytochrome b5
- cholesterol biosynthesis (plants):
NADP+ + cholesterol ⟶ 7-dehydrocholesterol + H+ + NADPH
- cholesterol biosynthesis (plants, early side-chain reductase):
(3β,9β)-4α-demethyl-4α-carboxy-9,19-cyclolanost-3-ol + NAD+ ⟶ 31-norcycloartanone + CO2 + NADH
- cholesterol biosynthesis (plants, early side-chain reductase):
(3β,9β)-4α-demethyl-4α-carboxy-9,19-cyclolanost-3-ol + NAD+ ⟶ 31-norcycloartanone + CO2 + NADH
- cholesterol biosynthesis (plants, early side-chain reductase):
(3β,9β)-4α-demethyl-4α-carboxy-9,19-cyclolanost-3-ol + NAD+ ⟶ 31-norcycloartanone + CO2 + NADH
- cholesterol biosynthesis (plants, early side-chain reductase):
(3β,9β)-4α-demethyl-4α-carboxy-9,19-cyclolanost-3-ol + NAD+ ⟶ 31-norcycloartanone + CO2 + NADH
- cholesterol biosynthesis (plants, early side-chain reductase):
(3β,9β)-4α-demethyl-4α-carboxy-9,19-cyclolanost-3-ol + NAD+ ⟶ 31-norcycloartanone + CO2 + NADH
- cholesterol biosynthesis (plants, early side-chain reductase):
(3β,9β)-4α-demethyl-4α-carboxy-9,19-cyclolanost-3-ol + NAD+ ⟶ 31-norcycloartanone + CO2 + NADH
- cholesterol biosynthesis (plants, early side-chain reductase):
(3β,9β)-4α-demethyl-4α-carboxy-9,19-cyclolanost-3-ol + NAD+ ⟶ 31-norcycloartanone + CO2 + NADH
- cholesterol biosynthesis (plants, early side-chain reductase):
(3β,9β)-4α-demethyl-4α-carboxy-9,19-cyclolanost-3-ol + NAD+ ⟶ 31-norcycloartanone + CO2 + NADH
- cholesterol biosynthesis (plants, early side-chain reductase):
(3β,9β)-4α-demethyl-4α-carboxy-9,19-cyclolanost-3-ol + NAD+ ⟶ 31-norcycloartanone + CO2 + NADH
- cholesterol biosynthesis (plants, early side-chain reductase):
(3β,9β)-4α-demethyl-4α-carboxy-9,19-cyclolanost-3-ol + NAD+ ⟶ 31-norcycloartanone + CO2 + NADH
- cholesterol biosynthesis (plants, early side-chain reductase):
(3β,9β)-4α-demethyl-4α-carboxy-9,19-cyclolanost-3-ol + NAD+ ⟶ 31-norcycloartanone + CO2 + NADH
- cholesterol biosynthesis (plants, early side-chain reductase):
(3β,9β)-4α-demethyl-4α-carboxy-9,19-cyclolanost-3-ol + NAD+ ⟶ 31-norcycloartanone + CO2 + NADH
- cholesterol biosynthesis (plants, early side-chain reductase):
(3β,9β)-4α-demethyl-4α-carboxy-9,19-cyclolanost-3-ol + NAD+ ⟶ 31-norcycloartanone + CO2 + NADH
- cholesterol biosynthesis (plants, early side-chain reductase):
(3β,9β)-4α-demethyl-4α-carboxy-9,19-cyclolanost-3-ol + NAD+ ⟶ 31-norcycloartanone + CO2 + NADH
- cholesterol biosynthesis (plants, early side-chain reductase):
(3β,9β)-4α-demethyl-4α-carboxy-9,19-cyclolanost-3-ol + NAD+ ⟶ 31-norcycloartanone + CO2 + NADH
- cholesterol biosynthesis (plants, early side-chain reductase):
(3β,9β)-4α-demethyl-4α-carboxy-9,19-cyclolanost-3-ol + NAD+ ⟶ 31-norcycloartanone + CO2 + NADH
- cholesterol biosynthesis (plants, early side-chain reductase):
(3β,9β)-4α-demethyl-4α-carboxy-9,19-cyclolanost-3-ol + NAD+ ⟶ 31-norcycloartanone + CO2 + NADH
- cholesterol biosynthesis (plants, early side-chain reductase):
(3β,9β)-4α-demethyl-4α-carboxy-9,19-cyclolanost-3-ol + NAD+ ⟶ 31-norcycloartanone + CO2 + NADH
- cholesterol biosynthesis (plants, early side-chain reductase):
(3β,9β)-4α-demethyl-4α-carboxy-9,19-cyclolanost-3-ol + NAD+ ⟶ 31-norcycloartanone + CO2 + NADH
- (R)-canadine biosynthesis:
7,8-dihydroberberine + H+ + NADPH ⟶ (R)-canadine + NADP+
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + O2 + gibberellin A15 (open lactone form) ⟶ CO2 + gibberellin A37 + succinate
- superpathway of gibberellin biosynthesis:
2-oxoglutarate + O2 + gibberellin A5 ⟶ CO2 + gibberellin A6 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- superpathway of gibberellin biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + O2 + gibberellin A15 (open lactone form) ⟶ CO2 + gibberellin A37 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + O2 + gibberellin A37 ⟶ CO2 + H2O + gibberellin A36 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + O2 + gibberellin A12 ⟶ CO2 + gibberellin A14 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + O2 + gibberellin A12 ⟶ CO2 + gibberellin A14 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + O2 + gibberellin A12 ⟶ CO2 + gibberellin A14 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + O2 + gibberellin A12 ⟶ CO2 + gibberellin A14 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- superpathway of gibberellin biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + O2 + gibberellin A15 (open lactone form) ⟶ CO2 + gibberellin A37 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- superpathway of gibberellin biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-kaurene + diphosphate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- gibberellin biosynthesis II (early C-3 hydroxylation):
2-oxoglutarate + NADP+ + O2 + gibberellin A36 ⟶ CO2 + NADPH + gibberellin A4 + succinate
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
δ-carotene ⟶ α-carotene
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
δ-carotene ⟶ α-carotene
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-cryptoxanthin + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ H2O + an oxidized ferredoxin [iron-sulfur] cluster + zeaxanthin
- superpathway of carotenoid biosynthesis in plants:
β-cryptoxanthin + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ H2O + an oxidized ferredoxin [iron-sulfur] cluster + zeaxanthin
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- superpathway of carotenoid biosynthesis in plants:
β-cryptoxanthin + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ H2O + an oxidized ferredoxin [iron-sulfur] cluster + zeaxanthin
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
γ-carotene ⟶ β-carotene
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-cryptoxanthin + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ H2O + an oxidized ferredoxin [iron-sulfur] cluster + zeaxanthin
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
γ-carotene ⟶ β-carotene
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-cryptoxanthin + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ H2O + an oxidized ferredoxin [iron-sulfur] cluster + zeaxanthin
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-cryptoxanthin + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ H2O + an oxidized ferredoxin [iron-sulfur] cluster + zeaxanthin
- superpathway of carotenoid biosynthesis in plants:
β-cryptoxanthin + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ H2O + an oxidized ferredoxin [iron-sulfur] cluster + zeaxanthin
- superpathway of carotenoid biosynthesis in plants:
β-cryptoxanthin + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ H2O + an oxidized ferredoxin [iron-sulfur] cluster + zeaxanthin
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- lutein biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + zeinoxanthin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + lutein
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- superpathway of carotenoid biosynthesis in plants:
15-cis-phytoene + a plastoquinone ⟶ 15,9'-di-cis-phytofluene + a plastoquinol
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- superpathway of carotenoid biosynthesis in plants:
prephytoene diphosphate ⟶ 15-cis-phytoene + diphosphate
- momilactone A biosynthesis:
3β-hydroxy-9β-pimara-7,15-diene-19,6β-olide + NAD(P)+ ⟶ H+ + NAD(P)H + momilactone A
- momilactone A biosynthesis:
3β-hydroxy-9β-pimara-7,15-diene-19,6β-olide + NAD(P)+ ⟶ H+ + NAD(P)H + momilactone A
- momilactone A biosynthesis:
(-)-9β-pimara-7,15-dien-19-ol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (-)-9β-pimara-7,15-dien-19-al + H2O + an oxidized [NADPH-hemoprotein reductase]
- momilactone A biosynthesis:
3β-hydroxy-9β-pimara-7,15-diene-19,6β-olide + NAD(P)+ ⟶ H+ + NAD(P)H + momilactone A
- momilactone A biosynthesis:
3β-hydroxy-9β-pimara-7,15-diene-19,6β-olide + NAD(P)+ ⟶ H+ + NAD(P)H + momilactone A
- superpathway of photosynthetic hydrogen production:
H2 + an oxidized ferredoxin [iron-sulfur] cluster ⟶ H+ + a reduced ferredoxin [iron-sulfur] cluster
- zealexin biosynthesis:
4-(5,5-dimethylcyclohex-1-en-1-yl)cyclohex-1-ene-1-carbaldehyde + NADPH + O2 ⟶ H2O + NADP+ + zealexin A1
- zealexin biosynthesis:
4-(5,5-dimethylcyclohex-1-en-1-yl)cyclohex-1-ene-1-carbaldehyde + NADPH + O2 ⟶ H2O + NADP+ + zealexin A1
- zealexin biosynthesis:
4-(5,5-dimethylcyclohex-1-en-1-yl)cyclohex-1-ene-1-carbaldehyde + NADPH + O2 ⟶ H2O + NADP+ + zealexin A1
- zealexin biosynthesis:
4-(5,5-dimethylcyclohex-1-en-1-yl)cyclohex-1-ene-1-carbaldehyde + NADPH + O2 ⟶ H2O + NADP+ + zealexin A1
- zealexin biosynthesis:
4-(5,5-dimethylcyclohex-1-en-1-yl)cyclohex-1-ene-1-carbaldehyde + NADPH + O2 ⟶ H2O + NADP+ + zealexin A1
- zealexin biosynthesis:
4-(5,5-dimethylcyclohex-1-en-1-yl)cyclohex-1-ene-1-carbaldehyde + NADPH + O2 ⟶ H2O + NADP+ + zealexin A1
- zealexin biosynthesis:
4-(5,5-dimethylcyclohex-1-en-1-yl)cyclohex-1-ene-1-carbaldehyde + NADPH + O2 ⟶ H2O + NADP+ + zealexin A1
- zealexin biosynthesis:
H+ + NADPH + O2 + [4-(5,5-dimethylcyclohex-1-en-1-yl)-cyclohex-1-en-1-yl] methanol ⟶ 4-(5,5-dimethylcyclohex-1-en-1-yl)cyclohex-1-ene-1-carbaldehyde + H2O + NADP+
- zealexin biosynthesis:
4-(5,5-dimethylcyclohex-1-en-1-yl)cyclohex-1-ene-1-carbaldehyde + NADPH + O2 ⟶ H2O + NADP+ + zealexin A1
- zealexin biosynthesis:
4-(5,5-dimethylcyclohex-1-en-1-yl)cyclohex-1-ene-1-carbaldehyde + NADPH + O2 ⟶ H2O + NADP+ + zealexin A1
- hyoscyamine and scopolamine biosynthesis:
(6S)-hydroxyhyoscyamine + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + scopolamine + succinate
- superpathway of hyoscyamine and scopolamine biosynthesis:
N-methylputrescine + H2O + O2 ⟶ N-methylaminobutanal + ammonium + hydrogen peroxide
- hyoscyamine and scopolamine biosynthesis:
NADP+ + tropine ⟶ H+ + NADPH + tropinone
- calystegine biosynthesis:
NADP+ + pseudotropine ⟶ H+ + NADPH + tropinone
- superpathway of hyoscyamine and scopolamine biosynthesis:
N-methylputrescine + H2O + O2 ⟶ N-methylaminobutanal + ammonium + hydrogen peroxide
- hyoscyamine and scopolamine biosynthesis:
NADP+ + tropine ⟶ H+ + NADPH + tropinone
- superpathway of hyoscyamine and scopolamine biosynthesis:
N-methylputrescine + H2O + O2 ⟶ N-methylaminobutanal + ammonium + hydrogen peroxide
- hyoscyamine and scopolamine biosynthesis:
(S)-atropine + 2-oxoglutarate + O2 ⟶ (6S)-hydroxyhyoscyamine + CO2 + succinate
- superpathway of hyoscyamine and scopolamine biosynthesis:
N-methylputrescine + H2O + O2 ⟶ N-methylaminobutanal + ammonium + hydrogen peroxide
- superpathway of hyoscyamine and scopolamine biosynthesis:
NADP+ + tropine ⟶ H+ + NADPH + tropinone
- hyoscyamine and scopolamine biosynthesis:
NADP+ + tropine ⟶ H+ + NADPH + tropinone
- calystegine biosynthesis:
pseudotropine ⟶ an unknown compound
- calystegine biosynthesis:
NADP+ + pseudotropine ⟶ H+ + NADPH + tropinone
- hyoscyamine and scopolamine biosynthesis:
(S)-atropine + 2-oxoglutarate + O2 ⟶ (6S)-hydroxyhyoscyamine + CO2 + succinate
- superpathway of hyoscyamine and scopolamine biosynthesis:
N-methylputrescine + H2O + O2 ⟶ N-methylaminobutanal + ammonium + hydrogen peroxide
- hyoscyamine and scopolamine biosynthesis:
(S)-atropine + 2-oxoglutarate + O2 ⟶ (6S)-hydroxyhyoscyamine + CO2 + succinate
- calystegine biosynthesis:
NADP+ + pseudotropine ⟶ H+ + NADPH + tropinone
- superpathway of hyoscyamine and scopolamine biosynthesis:
N-methylputrescine + H2O + O2 ⟶ N-methylaminobutanal + ammonium + hydrogen peroxide
- hyoscyamine and scopolamine biosynthesis:
(S)-atropine + 2-oxoglutarate + O2 ⟶ (6S)-hydroxyhyoscyamine + CO2 + succinate
- calystegine biosynthesis:
NADP+ + pseudotropine ⟶ H+ + NADPH + tropinone
- superpathway of hyoscyamine and scopolamine biosynthesis:
N-methylputrescine + H2O + O2 ⟶ N-methylaminobutanal + ammonium + hydrogen peroxide
- hyoscyamine and scopolamine biosynthesis:
NADP+ + tropine ⟶ H+ + NADPH + tropinone
- dihydroconiferyl alcohol biosynthesis:
H+ + NADPH + coniferaldehyde ⟶ NADP+ + dihydroconiferyl aldehyde
- α-tomatine biosynthesis:
cholesterol ⟶ dehydrotomatidine
- superpathway of glycoalkaloid metabolism (Solanaceae):
NADP+ + solasodine ⟶ H+ + NADPH + solasod-4-en-3-one
- carnosate bioynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + ferruginol ⟶ 11-hydroxyferruginol + H2O + an oxidized [NADPH-hemoprotein reductase]
- carnosate bioynthesis:
H+ + NADPH + O2 + abietatriene ⟶ H2O + NADP+ + ferruginol
- 2,3-cis-flavanols biosynthesis:
(-)-epiafzelechin + NADP+ ⟶ H+ + NADPH + pelargonidin
- 2,3-cis-flavanols biosynthesis:
(-)-epiafzelechin + NADP+ ⟶ H+ + NADPH + pelargonidin
- 2,3-cis-flavanols biosynthesis:
(-)-epicatechin + NADP+ ⟶ H+ + NADPH + cyanidin
- 2,3-cis-flavanols biosynthesis:
(-)-epiafzelechin + NADP+ ⟶ H+ + NADPH + pelargonidin
- 2,3-cis-flavanols biosynthesis:
(-)-epiafzelechin + NADP+ ⟶ H+ + NADPH + pelargonidin
- 2,3-cis-flavanols biosynthesis:
(-)-epiafzelechin + NADP+ ⟶ H+ + NADPH + pelargonidin
- 2,3-cis-flavanols biosynthesis:
(-)-epiafzelechin + NADP+ ⟶ H+ + NADPH + pelargonidin
- 2,3-cis-flavanols biosynthesis:
(-)-epiafzelechin + NADP+ ⟶ H+ + NADPH + pelargonidin
- 2,3-cis-flavanols biosynthesis:
(-)-epiafzelechin + NADP+ ⟶ H+ + NADPH + pelargonidin
- 2,3-cis-flavanols biosynthesis:
(-)-epiafzelechin + NADP+ ⟶ H+ + NADPH + pelargonidin
- 2,3-cis-flavanols biosynthesis:
(-)-epicatechin + NADP+ ⟶ H+ + NADPH + cyanidin
- 2,3-cis-flavanols biosynthesis:
(-)-epicatechin + NADP+ ⟶ H+ + NADPH + cyanidin
- 2,3-cis-flavanols biosynthesis:
(-)-epicatechin + NADP+ ⟶ H+ + NADPH + cyanidin
- 2,3-cis-flavanols biosynthesis:
(-)-epicatechin + NADP+ ⟶ H+ + NADPH + cyanidin
- proanthocyanidins biosynthesis from flavanols:
UDP-α-D-glucose + a (2R,3R)-flavan-3-ol ⟶ H+ + UDP + a (2R,3R)-flavan-3-ol-3'-O-glucoside
- 2,3-cis-flavanols biosynthesis:
(-)-epicatechin + NADP+ ⟶ H+ + NADPH + cyanidin
- 2,3-cis-flavanols biosynthesis:
(-)-epicatechin + NADP+ ⟶ H+ + NADPH + cyanidin
- 2,3-cis-flavanols biosynthesis:
(-)-epicatechin + NADP+ ⟶ H+ + NADPH + cyanidin
- 2,3-cis-flavanols biosynthesis:
(-)-epicatechin + NADP+ ⟶ H+ + NADPH + cyanidin
- isopimaric acid biosynthesis:
(+)-isopimara-7,15-diene + H+ + NADPH + O2 ⟶ H2O + NADP+ + isopimara-7,15-dienol
- chlorophyll cycle:
H+ + NADPH + O2 + chlorophyllide a ⟶ 71-hydroxychlorophyllide a + H2O + NADP+
- chlorophyll cycle:
H+ + NADPH + O2 + chlorophyllide a ⟶ 71-hydroxychlorophyllide a + H2O + NADP+
- chlorophyll cycle:
H+ + NADPH + O2 + chlorophyllide a ⟶ 71-hydroxychlorophyllide a + H2O + NADP+
- chlorophyll cycle:
H+ + NADPH + O2 + chlorophyllide a ⟶ 71-hydroxychlorophyllide a + H2O + NADP+
- chlorophyll cycle:
H+ + NADPH + O2 + chlorophyllide a ⟶ 71-hydroxychlorophyllide a + H2O + NADP+
- chlorophyll cycle:
H+ + NADPH + O2 + chlorophyllide a ⟶ 71-hydroxychlorophyllide a + H2O + NADP+
- chlorophyll cycle:
H+ + NADPH + O2 + chlorophyllide a ⟶ 71-hydroxychlorophyllide a + H2O + NADP+
- chlorophyll cycle:
H+ + NADPH + O2 + chlorophyllide a ⟶ 71-hydroxychlorophyllide a + H2O + NADP+
- chlorophyll cycle:
71-hydroxychlorophyll a + NAD(P)+ ⟶ NAD(P)H + chlorophyll b
- chlorophyll cycle:
H+ + NADPH + O2 + chlorophyllide a ⟶ 71-hydroxychlorophyllide a + H2O + NADP+
- chlorophyll cycle:
H+ + NADPH + O2 + chlorophyllide a ⟶ 71-hydroxychlorophyllide a + H2O + NADP+
- chlorophyll cycle:
H+ + NADPH + O2 + chlorophyllide a ⟶ 71-hydroxychlorophyllide a + H2O + NADP+
- chlorophyll cycle:
H+ + NADPH + O2 + chlorophyllide a ⟶ 71-hydroxychlorophyllide a + H2O + NADP+
- chlorophyll cycle:
H+ + NADPH + O2 + chlorophyllide a ⟶ 71-hydroxychlorophyllide a + H2O + NADP+
- chlorophyll cycle:
H+ + NADPH + O2 + chlorophyllide a ⟶ 71-hydroxychlorophyllide a + H2O + NADP+
- chlorophyll cycle:
H+ + NADPH + O2 + chlorophyllide a ⟶ 71-hydroxychlorophyllide a + H2O + NADP+
- chlorophyll cycle:
H+ + NADPH + O2 + chlorophyllide a ⟶ 71-hydroxychlorophyllide a + H2O + NADP+
- chlorophyll cycle:
H+ + NADPH + O2 + chlorophyllide a ⟶ 71-hydroxychlorophyllide a + H2O + NADP+
- chlorophyll cycle:
H+ + NADPH + O2 + chlorophyllide a ⟶ 71-hydroxychlorophyllide a + H2O + NADP+
- chlorophyll cycle:
H+ + NADPH + O2 + chlorophyllide a ⟶ 71-hydroxychlorophyllide a + H2O + NADP+
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- superpathway of isoflavonoids (via naringenin):
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin
- isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+
- isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+
- isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+
- isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+
- isoflavonoid biosynthesis II:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- superpathway of isoflavonoids (via naringenin):
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin
- isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+
- isoflavonoid biosynthesis II:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin
- isoflavonoid biosynthesis II:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+
- isoflavonoid biosynthesis II:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- superpathway of isoflavonoids (via naringenin):
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+
- isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+
- isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin
- vestitol and sativan biosynthesis:
(-)-medicarpin + H+ + NADPH ⟶ (-)-vestitol + NADP+
- vestitol and sativan biosynthesis:
(-)-medicarpin + H+ + NADPH ⟶ (-)-vestitol + NADP+
- vestitol and sativan biosynthesis:
(-)-medicarpin + H+ + NADPH ⟶ (-)-vestitol + NADP+
- vestitol and sativan biosynthesis:
(-)-medicarpin + H+ + NADPH ⟶ (-)-vestitol + NADP+
- vestitol and sativan biosynthesis:
(-)-medicarpin + H+ + NADPH ⟶ (-)-vestitol + NADP+
- vestitol and sativan biosynthesis:
(-)-medicarpin + H+ + NADPH ⟶ (-)-vestitol + NADP+
- vestitol and sativan biosynthesis:
(-)-medicarpin + H+ + NADPH ⟶ (-)-vestitol + NADP+
- vestitol and sativan biosynthesis:
(-)-medicarpin + H+ + NADPH ⟶ (-)-vestitol + NADP+
- vestitol and sativan biosynthesis:
(-)-medicarpin + H+ + NADPH ⟶ (-)-vestitol + NADP+
- vestitol and sativan biosynthesis:
(-)-medicarpin + H+ + NADPH ⟶ (-)-vestitol + NADP+
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- superpathway of glandular trichomes produced diterpenoids (tobacco):
(13E)-8α-hydroxylabd-13-en-15-yl diphosphate ⟶ cis-abienol + diphosphate
- cembratrienediol biosynthesis:
α-cembratriene-ol + H+ + NAD(P)H + O2 ⟶ α-cembratriene-4,6-diol + H2O + NAD(P)+
- superpathway of pterocarpan biosynthesis (via daidzein):
2,4',7-trihydroxyisoflavanone ⟶ H2O + daidzein
- phaseollin biosynthesis:
(6aR,11aR)-3,9-dihydroxypterocarpan + DMAPP ⟶ (-)-phaseollidin + diphosphate
- phaseollin biosynthesis:
(-)-phaseollidin + H+ + NADPH + O2 ⟶ (-)-phaseollin + H2O + NADP+
- phaseollin biosynthesis:
(6aR,11aR)-3,9-dihydroxypterocarpan + DMAPP ⟶ (-)-phaseollidin + diphosphate
- superpathway of glycoalkaloid metabolism (Solanaceae):
NADP+ + solasodine ⟶ H+ + NADPH + solasod-4-en-3-one
- solasodine and soladulcidine biosynthesis:
NADP+ + solasodine ⟶ H+ + NADPH + solasod-4-en-3-one
- solasodine and soladulcidine biosynthesis:
NADP+ + solasodine ⟶ H+ + NADPH + solasod-4-en-3-one
- phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
2-phenylethanol + NAD+ ⟶ H+ + NADH + phenylacetaldehyde
- phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
H+ + H2O + O2 + phe ⟶ CO2 + ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde
- phenylethanol biosynthesis:
2-phenylethylamine + H2O + O2 ⟶ ammonium + hydrogen peroxide + phenylacetaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin 3'-phosphate + H2O ⟶ 7,8-dihydroneopterin + phosphate
- superpathway of tetrahydrofolate biosynthesis:
7,8-dihydroneopterin 3'-phosphate + H2O ⟶ 7,8-dihydroneopterin + phosphate
- tetrahydrofolate biosynthesis:
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- phaseollin biosynthesis:
(6aR,11aR)-3,9-dihydroxypterocarpan + DMAPP ⟶ (-)-phaseollidin + diphosphate
- phaseollin biosynthesis:
(6aR,11aR)-3,9-dihydroxypterocarpan + DMAPP ⟶ (-)-phaseollidin + diphosphate
- artemisinin and arteannuin B biosynthesis:
(2E,6E)-farnesyl diphosphate ⟶ (+)-amorpha-4,11-diene + diphosphate
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + acetyl-CoA ⟶ (3Z)-hex-3-en-1-yl acetate + coenzyme A
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- superpathway of lipoxygenase:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- superpathway of lipoxygenase:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(E)-2-hexenol + NADP+ ⟶ (E)-2-hexenal + H+ + NADPH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- superpathway of lipoxygenase:
(Z)-hex-3-en-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- superpathway of lipoxygenase:
9(S)-HPOTE ⟶ (2E,6Z)-non-2,6-dienal + 9-oxononanoate
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (3Z)-hexenal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- superpathway of lipoxygenase:
(3Z)-hex-3-en-1-ol + acetyl-CoA ⟶ (3Z)-hex-3-en-1-yl acetate + coenzyme A
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + acetyl-CoA ⟶ (3Z)-hex-3-en-1-yl acetate + coenzyme A
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (3Z)-hexenal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (3Z)-hexenal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (3Z)-hexenal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (3Z)-hexenal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (3Z)-hexenal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (3Z)-hexenal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
O2 + linoleate ⟶ (13S)-HPODE
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
O2 + linoleate ⟶ (13S)-HPODE
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
O2 + linoleate ⟶ (13S)-HPODE
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
O2 + linoleate ⟶ (13S)-HPODE
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
O2 + linoleate ⟶ (13S)-HPODE
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
O2 + linoleate ⟶ (13S)-HPODE
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
O2 + linoleate ⟶ (13S)-HPODE
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
O2 + linoleate ⟶ (13S)-HPODE
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
O2 + linoleate ⟶ (13S)-HPODE
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + acetyl-CoA ⟶ (3Z)-hex-3-en-1-yl acetate + coenzyme A
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
O2 + linoleate ⟶ (13S)-HPODE
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
O2 + linoleate ⟶ (13S)-HPODE
- superpathway of lipoxygenase:
(3Z)-hex-3-en-1-ol + acetyl-CoA ⟶ (3Z)-hex-3-en-1-yl acetate + coenzyme A
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
O2 + linoleate ⟶ (13S)-HPODE
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
O2 + linoleate ⟶ (13S)-HPODE
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
O2 + linoleate ⟶ (13S)-HPODE
- superpathway of lipoxygenase:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (Z)-3-hexanal + H+ + NADH
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis:
(3Z)-hex-3-en-1-ol + NAD+ ⟶ (3Z)-hexenal + H+ + NADH
- trichloroethene degradation:
2,2,2-trichloroacetate + NADPH + O2 ⟶ H+ + NADP+ + chloride + oxalate
- trichloroethene degradation:
O2 + trichloroethene ⟶ 2,2,2-trichloroacetate + H+
- trichloroethene degradation:
2,2,2-trichloroacetate + NADPH + O2 ⟶ H+ + NADP+ + chloride + oxalate
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine (C18) ⟶ 3-dehydrosphinganine (C18) + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
H+ + palmitoyl-CoA + ser ⟶ 3-dehydrosphinganine (C18) + CO2 + coenzyme A
- sphingolipid biosynthesis (plants):
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- ceramide de novo biosynthesis:
NADP+ + sphinganine ⟶ 3-dehydrosphinganine + H+ + NADPH
- costunolide biosynthesis:
NADP+ + germacra-1(10),4,11(13)-trien-12-ol ⟶ H+ + NADPH + germacra-1(10),4,11(13)-trien-12-al
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- costunolide biosynthesis:
NADP+ + germacra-1(10),4,11(13)-trien-12-ol ⟶ H+ + NADPH + germacra-1(10),4,11(13)-trien-12-al
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ H2O + NADP+ + parthenolide
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ H2O + NADP+ + parthenolide
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- costunolide biosynthesis:
(+)-germacrene A + H+ + NADPH + O2 ⟶ H2O + NADP+ + germacra-1(10),4,11(13)-trien-12-ol
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ H2O + NADP+ + parthenolide
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ H2O + NADP+ + parthenolide
- costunolide biosynthesis:
H+ + NADPH + O2 + germacra-1(10),4,11(13)-trien-12-oate ⟶ (+)-costunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- costunolide biosynthesis:
H+ + NADPH + O2 + germacra-1(10),4,11(13)-trien-12-oate ⟶ 8β-hydroxy-germacra-1(10),4,11(13)-trien-12-oate + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ H2O + NADP+ + parthenolide
- costunolide biosynthesis:
H+ + NADPH + O2 + germacra-1(10),4,11(13)-trien-12-oate ⟶ (+)-costunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ H2O + NADP+ + parthenolide
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ H2O + NADP+ + parthenolide
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ H2O + NADP+ + parthenolide
- costunolide biosynthesis:
H+ + NADPH + O2 + germacra-1(10),4,11(13)-trien-12-oate ⟶ 8β-hydroxy-germacra-1(10),4,11(13)-trien-12-oate + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- costunolide biosynthesis:
H+ + NADPH + O2 + germacra-1(10),4,11(13)-trien-12-oate ⟶ (+)-costunolide + H2O + NADP+
- costunolide biosynthesis:
(+)-germacrene A + H+ + NADPH + O2 ⟶ H2O + NADP+ + germacra-1(10),4,11(13)-trien-12-ol
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
H+ + NADPH + O2 + parthenolide ⟶ 3β-hydroxyparthenolide + H2O + NADP+
- costunolide biosynthesis:
H+ + NADPH + O2 + germacra-1(10),4,11(13)-trien-12-oate ⟶ (+)-costunolide + H2O + NADP+
- costunolide biosynthesis:
H+ + NADPH + O2 + germacra-1(10),4,11(13)-trien-12-oate ⟶ 6α-hydroxy-germacra-1(10),4,11(13)-trien-12-oate + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- costunolide biosynthesis:
H+ + NADPH + O2 + germacra-1(10),4,11(13)-trien-12-oate ⟶ 8β-hydroxy-germacra-1(10),4,11(13)-trien-12-oate + H2O + NADP+
- costunolide biosynthesis:
NADP+ + germacra-1(10),4,11(13)-trien-12-ol ⟶ H+ + NADPH + germacra-1(10),4,11(13)-trien-12-al
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ H2O + NADP+ + parthenolide
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ H2O + NADP+ + parthenolide
- costunolide biosynthesis:
H+ + NADPH + O2 + germacra-1(10),4,11(13)-trien-12-oate ⟶ 8β-hydroxy-germacra-1(10),4,11(13)-trien-12-oate + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
H+ + NADPH + O2 + parthenolide ⟶ 3β-hydroxyparthenolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
H+ + NADPH + O2 + parthenolide ⟶ 3β-hydroxyparthenolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- costunolide biosynthesis:
H+ + NADPH + O2 + germacra-1(10),4,11(13)-trien-12-oate ⟶ (+)-costunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- costunolide biosynthesis:
NADP+ + germacra-1(10),4,11(13)-trien-12-ol ⟶ H+ + NADPH + germacra-1(10),4,11(13)-trien-12-al
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ H2O + NADP+ + parthenolide
- costunolide biosynthesis:
H+ + NADPH + O2 + germacra-1(10),4,11(13)-trien-12-oate ⟶ 8β-hydroxy-germacra-1(10),4,11(13)-trien-12-oate + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ H2O + NADP+ + parthenolide
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ H2O + NADP+ + parthenolide
- 3β-hydroxysesquiterpene lactone biosynthesis:
H+ + NADPH + O2 + parthenolide ⟶ 3β-hydroxyparthenolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- costunolide biosynthesis:
H+ + NADPH + O2 + germacra-1(10),4,11(13)-trien-12-oate ⟶ 8β-hydroxy-germacra-1(10),4,11(13)-trien-12-oate + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ H2O + NADP+ + parthenolide
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ H2O + NADP+ + parthenolide
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ H2O + NADP+ + parthenolide
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ H2O + NADP+ + parthenolide
- costunolide biosynthesis:
(+)-germacrene A + H+ + NADPH + O2 ⟶ H2O + NADP+ + germacra-1(10),4,11(13)-trien-12-ol
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ H2O + NADP+ + parthenolide
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- costunolide biosynthesis:
H+ + NADPH + O2 + germacra-1(10),4,11(13)-trien-12-oate ⟶ (+)-costunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- costunolide biosynthesis:
H+ + NADPH + O2 + germacra-1(10),4,11(13)-trien-12-oate ⟶ (+)-costunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ H2O + NADP+ + parthenolide
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ H2O + NADP+ + parthenolide
- costunolide biosynthesis:
H+ + NADPH + O2 + germacra-1(10),4,11(13)-trien-12-oate ⟶ (+)-costunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
H+ + NADPH + O2 + parthenolide ⟶ 3β-hydroxyparthenolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- costunolide biosynthesis:
(+)-germacrene A + H+ + NADPH + O2 ⟶ H2O + NADP+ + germacra-1(10),4,11(13)-trien-12-ol
- costunolide biosynthesis:
(+)-germacrene A + H+ + NADPH + O2 ⟶ H2O + NADP+ + germacra-1(10),4,11(13)-trien-12-ol
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ H2O + NADP+ + parthenolide
- costunolide biosynthesis:
NADP+ + germacra-1(10),4,11(13)-trien-12-ol ⟶ H+ + NADPH + germacra-1(10),4,11(13)-trien-12-al
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ H2O + NADP+ + parthenolide
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- costunolide biosynthesis:
(+)-germacrene A + H+ + NADPH + O2 ⟶ H2O + NADP+ + germacra-1(10),4,11(13)-trien-12-ol
- costunolide biosynthesis:
H+ + NADPH + O2 + germacra-1(10),4,11(13)-trien-12-oate ⟶ (+)-costunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ H2O + NADP+ + parthenolide
- costunolide biosynthesis:
H+ + NADPH + O2 + germacra-1(10),4,11(13)-trien-12-oate ⟶ (+)-costunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- costunolide biosynthesis:
H+ + NADPH + O2 + germacra-1(10),4,11(13)-trien-12-oate ⟶ 8β-hydroxy-germacra-1(10),4,11(13)-trien-12-oate + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ H2O + NADP+ + parthenolide
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- costunolide biosynthesis:
(+)-germacrene A + H+ + NADPH + O2 ⟶ H2O + NADP+ + germacra-1(10),4,11(13)-trien-12-ol
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ H2O + NADP+ + parthenolide
- 3β-hydroxysesquiterpene lactone biosynthesis:
H+ + NADPH + O2 + parthenolide ⟶ 3β-hydroxyparthenolide + H2O + NADP+
- costunolide biosynthesis:
H+ + NADPH + O2 + germacra-1(10),4,11(13)-trien-12-oate ⟶ (+)-costunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ H2O + NADP+ + parthenolide
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ H2O + NADP+ + parthenolide
- costunolide biosynthesis:
H+ + NADPH + O2 + germacra-1(10),4,11(13)-trien-12-oate ⟶ (+)-costunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ H2O + NADP+ + parthenolide
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- costunolide biosynthesis:
(+)-germacrene A + H+ + NADPH + O2 ⟶ H2O + NADP+ + germacra-1(10),4,11(13)-trien-12-ol
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ H2O + NADP+ + parthenolide
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ 3β-hydroxycostunolide + H2O + NADP+
- 3β-hydroxysesquiterpene lactone biosynthesis:
(+)-costunolide + H+ + NADPH + O2 ⟶ H2O + NADP+ + parthenolide
- costunolide biosynthesis:
H+ + NADPH + O2 + germacra-1(10),4,11(13)-trien-12-oate ⟶ (+)-costunolide + H2O + NADP+
- oryzalexin D and E biosynthesis:
ent-sandaracopimaradiene + H+ + NADPH + O2 ⟶ ent-sandaracopimaradien-3β-ol + H2O + NADP+
- oryzalexin D and E biosynthesis:
ent-sandaracopimaradiene + H+ + NADPH + O2 ⟶ ent-sandaracopimaradien-3β-ol + H2O + NADP+
- hinokinin biosynthesis:
(-)-matairesinol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (-)-pluviatolide + H2O + an oxidized [NADPH-hemoprotein reductase]
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + acetol ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + acetol
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
NADP+ + hydroxyacetone ⟶ H+ + NADPH + methylglyoxal
- methylglyoxal degradation III:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + hydroxyacetone
- L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu
- L-proline biosynthesis I:
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H
- L-proline biosynthesis III:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu
- L-proline biosynthesis III:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu
- L-arginine degradation VI (arginase 2 pathway):
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu
- L-proline biosynthesis I:
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H
- L-proline biosynthesis III (from L-ornithine):
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H
- L-proline biosynthesis I (from L-glutamate):
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H
- L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea
- L-proline biosynthesis III:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH
- L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea
- L-proline biosynthesis I:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH
- L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea
- L-proline biosynthesis I:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH
- L-proline biosynthesis III:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH
- L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea
- L-proline biosynthesis I:
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H
- L-proline biosynthesis III:
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H
- L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea
- L-proline biosynthesis III:
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H
- L-proline biosynthesis I:
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H
- L-proline biosynthesis III:
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H
- L-arginine degradation VI (arginase 2 pathway):
NAD(P)+ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + NAD(P)H
- L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea
- L-proline biosynthesis III:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH
- L-proline biosynthesis I:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH
- L-proline biosynthesis III:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH
- L-arginine degradation VI (arginase 2 pathway):
H2O + arg ⟶ L-ornithine + urea
- L-proline biosynthesis I:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH
- 2,3-trans-flavanols biosynthesis:
(+)-afzelechin + H2O + NADP+ ⟶ (2R,3S,4S)-leucopelargonidin + H+ + NADPH
- 2,3-trans-flavanols biosynthesis:
(+)-catechin + H2O + NADP+ ⟶ (2R,3S,4S)-leucocyanidin + H+ + NADPH
- 2,3-trans-flavanols biosynthesis:
(+)-afzelechin + H2O + NADP+ ⟶ (2R,3S,4S)-leucopelargonidin + H+ + NADPH
- 2,3-trans-flavanols biosynthesis:
(+)-afzelechin + H2O + NADP+ ⟶ (2R,3S,4S)-leucopelargonidin + H+ + NADPH
- oryzalexin A, B, and C biosynthesis:
NAD(P)+ + oryzalexin A ⟶ H+ + NAD(P)H + oryzalexin C
- oryzalexin A, B, and C biosynthesis:
NAD(P)+ + oryzalexin A ⟶ H+ + NAD(P)H + oryzalexin C
- oryzalexin A, B, and C biosynthesis:
NAD(P)+ + oryzalexin D ⟶ H+ + NAD(P)H + oryzalexin A
- oryzalexin A, B, and C biosynthesis:
NAD(P)+ + oryzalexin D ⟶ H+ + NAD(P)H + oryzalexin B
- oryzalexin A, B, and C biosynthesis:
NAD(P)+ + oryzalexin D ⟶ H+ + NAD(P)H + oryzalexin B
- coumarin metabolism (to melilotic acid):
H+ + NADPH + coumarin ⟶ 3,4-dihydrocoumarin + NADP+
- coumarin metabolism (to melilotic acid):
3,4-dihydrocoumarin + H2O ⟶ H+ + melilotate
- coumarin metabolism (to melilotic acid):
3,4-dihydrocoumarin + H2O ⟶ H+ + melilotate
- coumarin metabolism (to melilotic acid):
3,4-dihydrocoumarin + H2O ⟶ H+ + melilotate
- coumarin metabolism (to melilotic acid):
3,4-dihydrocoumarin + H2O ⟶ H+ + melilotate
- selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol
- selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol
- superpathway of seleno-compound metabolism:
H2O + O2 + dimethylselenopropanoate-amine ⟶ 3-dimethylselenopropionaldehyde + ammonium + hydrogen peroxide
- selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol
- selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol
- selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol
- selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol
- selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol
- selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol
- selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol
- selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol
- selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol
- selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol
- selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol
- selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol
- selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol
- selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol
- selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol
- selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol
- superpathway of seleno-compound metabolism:
H2O + O2 + dimethylselenopropanoate-amine ⟶ 3-dimethylselenopropionaldehyde + ammonium + hydrogen peroxide
- selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol
- selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol
- selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol
- mannitol biosynthesis:
D-mannitol 1-phosphate + NADP+ ⟶ D-mannopyranose 6-phosphate + H+ + NADPH
- mannitol biosynthesis:
D-mannitol 1-phosphate + NADP+ ⟶ D-mannopyranose 6-phosphate + H+ + NADPH
- mannitol biosynthesis:
D-mannitol 1-phosphate + NADP+ ⟶ D-mannopyranose 6-phosphate + H+ + NADPH
- mannitol biosynthesis:
D-mannitol 1-phosphate + NADP+ ⟶ D-mannopyranose 6-phosphate + H+ + NADPH
- mannitol biosynthesis:
D-mannitol 1-phosphate + H2O ⟶ D-mannitol + phosphate
- mannitol biosynthesis:
D-mannitol 1-phosphate + H2O ⟶ D-mannitol + phosphate
- mannitol biosynthesis:
D-mannitol 1-phosphate + H2O ⟶ D-mannitol + phosphate
- mannitol biosynthesis:
D-mannitol 1-phosphate + H2O ⟶ D-mannitol + phosphate
- tetrahydroxyxanthone biosynthesis (from 3-hydroxybenzoate):
2,3',4,6-tetrahydroxybenzophenone + NADPH + O2 ⟶ 1,3,5-trihydroxyxanthone + H2O + NADP+
- tetrahydroxyxanthone biosynthesis (from 3-hydroxybenzoate):
2,3',4,6-tetrahydroxybenzophenone + NADPH + O2 ⟶ 1,3,5-trihydroxyxanthone + H2O + NADP+
- tetrahydroxyxanthone biosynthesis (from 3-hydroxybenzoate):
2,3',4,6-tetrahydroxybenzophenone + NADPH + O2 ⟶ 1,3,5-trihydroxyxanthone + H2O + NADP+
- superpathway of tetrahydroxyxanthone biosynthesis:
2,3',4,6-tetrahydroxybenzophenone + NADPH + O2 ⟶ 1,3,7-trihydroxyxanthone + H2O + NADP+
- tetrahydroxyxanthone biosynthesis (from benzoate):
2,3',4,6-tetrahydroxybenzophenone + NADPH + O2 ⟶ 1,3,7-trihydroxyxanthone + H2O + NADP+
- tetrahydroxyxanthone biosynthesis (from benzoate):
ATP + benzoate + coenzyme A ⟶ AMP + benzoyl-CoA + diphosphate
- tetrahydroxyxanthone biosynthesis (from 3-hydroxybenzoate):
2,3',4,6-tetrahydroxybenzophenone + NADPH + O2 ⟶ 1,3,5-trihydroxyxanthone + H2O + NADP+
- superpathway of tetrahydroxyxanthone biosynthesis:
ATP + benzoate + coenzyme A ⟶ AMP + benzoyl-CoA + diphosphate
- tetrahydroxyxanthone biosynthesis (from 3-hydroxybenzoate):
2,3',4,6-tetrahydroxybenzophenone + NADPH + O2 ⟶ 1,3,5-trihydroxyxanthone + H2O + NADP+
- superpathway of tetrahydroxyxanthone biosynthesis:
ATP + benzoate + coenzyme A ⟶ AMP + benzoyl-CoA + diphosphate
- tetrahydroxyxanthone biosynthesis (from benzoate):
ATP + benzoate + coenzyme A ⟶ AMP + benzoyl-CoA + diphosphate
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-octa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- (-)-maackiain biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + formononetin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + calycosin
- (-)-maackiain biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + calycosin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + pseudobaptigenin
- (-)-maackiain biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + formononetin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + calycosin
- (-)-maackiain biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + formononetin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + calycosin
- (-)-maackiain biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + formononetin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + calycosin
- (-)-maackiain biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + calycosin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + pseudobaptigenin
- (-)-maackiain biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + formononetin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + calycosin
- (-)-maackiain biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + formononetin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + calycosin
- (-)-maackiain biosynthesis:
(3R)-sophorol + NADP+ ⟶ 2'-hydroxypseudobaptigenin + H+ + NADPH
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
3-dehydro-6-deoxoteasterone + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-hydroxyteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis III:
NAD(P)+ + campesterol ⟶ NAD(P)H + campest-4-en-3-one
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis II:
6-deoxotyphasterol + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- superpathway of C28 brassinosteroid biosynthesis:
6-deoxotyphasterol + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxotyphasterol + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis III:
campest-5-en-3-one ⟶ campest-4-en-3-one
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
3-dehydro-6-deoxoteasterone + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-hydroxyteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxotyphasterol + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
3-dehydro-6-deoxoteasterone + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-hydroxyteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis I:
3-dehydro-6-deoxoteasterone + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3-dehydro-6-hydroxyteasterone + H2O + an oxidized [NADPH-hemoprotein reductase]
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
6-deoxoteasterone + A ⟶ 3-dehydro-6-deoxoteasterone + A(H2)
- brassinosteroid biosynthesis I:
NAD+ + campest-4-en-3β-ol ⟶ H+ + NADH + campest-4-en-3-one
- cinchona alkaloids biosynthesis:
corynantheal ⟶ quinidinone
- furaneol and mesifurane biosynthesis:
furaneol ⟶ furaneol (enol form)
- furaneol and mesifurane biosynthesis:
SAM + furaneol (enol form) ⟶ H+ + SAH + mesifurane (enol form)
- glucosinolate biosynthesis from hexahomomethionine:
(Z)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)nonan-1-imine + H2O ⟶ (Z)-ω-(methylsulfanyl)nonyl-thiohydroximate + ammonium + pyruvate
- glucosinolate biosynthesis from hexahomomethionine:
(Z)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)nonan-1-imine + H2O ⟶ (Z)-ω-(methylsulfanyl)nonyl-thiohydroximate + ammonium + pyruvate
- oryzalide A biosynthesis:
ent-isokaurene + H+ + NADPH + O2 ⟶ ent-isokauren-2α-ol + H2O + NADP+
- oryzalide A biosynthesis:
ent-isokaurene + H+ + NADPH + O2 ⟶ ent-isokauren-2α-ol + H2O + NADP+
- oryzalide A biosynthesis:
ent-isokaurene + H+ + NADPH + O2 ⟶ ent-isokauren-2α-ol + H2O + NADP+
- oryzalide A biosynthesis:
(-)-ent-copalyl diphosphate ⟶ ent-isokaurene + diphosphate
- oryzalide A biosynthesis:
ent-isokaurene + H+ + NADPH + O2 ⟶ ent-isokauren-2α-ol + H2O + NADP+
- oryzalide A biosynthesis:
ent-isokaurene + H+ + NADPH + O2 ⟶ ent-isokauren-2α-ol + H2O + NADP+
- oryzalide A biosynthesis:
ent-isokaurene + H+ + NADPH + O2 ⟶ ent-isokauren-2α-ol + H2O + NADP+
- oryzalide A biosynthesis:
ent-isokaurene + H+ + NADPH + O2 ⟶ ent-isokauren-2α-ol + H2O + NADP+
- glucosinolate biosynthesis from tetrahomomethionine:
(Z)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)heptan-1-imine + H2O ⟶ (Z)-ω-(methylsulfanyl)heptyl-thiohydroximate + ammonium + pyruvate
- glucosinolate biosynthesis from tetrahomomethionine:
(Z)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)heptan-1-imine + H2O ⟶ (Z)-ω-(methylsulfanyl)heptyl-thiohydroximate + ammonium + pyruvate
- leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate
- leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate
- syringetin biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate
- syringetin biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate
- leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate
- leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate
- syringetin biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate
- syringetin biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate
- leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate
- syringetin biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate
- leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate
- leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate
- leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate
- syringetin biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate
- leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate
- syringetin biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate
- leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate
- leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate
- leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate
- syringetin biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate
- leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate
- syringetin biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate
- leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate
- syringetin biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate
- leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate
- leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate
- syringetin biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate
- leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate
- syringetin biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate
- leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate
- leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate
- syringetin biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate
- leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate
- syringetin biosynthesis:
(+)-dihydromyricetin + 2-oxoglutarate + O2 ⟶ CO2 + H2O + myricetin + succinate
- leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate
- leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- syringetin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- syringetin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- syringetin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- syringetin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- syringetin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- superpathway of flavones and derivatives biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- syringetin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucopelargonidin and leucocyanidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucopelargonidin and leucocyanidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucopelargonidin and leucocyanidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- syringetin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucopelargonidin and leucocyanidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- syringetin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- syringetin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- syringetin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- syringetin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- syringetin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- syringetin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucopelargonidin and leucocyanidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- syringetin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucopelargonidin and leucocyanidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- flavonol biosynthesis:
(+)-dihydrokaempferol + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + kaempferol + succinate
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- syringetin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucopelargonidin and leucocyanidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- syringetin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- syringetin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- syringetin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- syringetin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- syringetin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- syringetin biosynthesis:
(+)-dihydrokaempferol + NADPH + O2 ⟶ (+)-taxifolin + H2O + NADP+
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + NADPH + malonyl-CoA ⟶ CO2 + H2O + NADP+ + coenzyme A + isoliquiritigenin
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + NADPH + malonyl-CoA ⟶ CO2 + H2O + NADP+ + coenzyme A + isoliquiritigenin
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ (+)-dihydrokaempferol + CO2 + succinate
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + NADPH + malonyl-CoA ⟶ CO2 + H2O + NADP+ + coenzyme A + isoliquiritigenin
- flavonoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + NADPH + malonyl-CoA ⟶ CO2 + H2O + NADP+ + coenzyme A + isoliquiritigenin
- salicortin biosynthesis:
H2O + benzylbenzoate ⟶ H+ + benzoate + benzyl alcohol
- salicortin biosynthesis:
H2O + NAD+ + benzaldehyde ⟶ H+ + NADH + benzoate
- shikonin biosynthesis:
3''-hydroxy-geranylhydroquinone ⟶ deoxyshikonin
- cuticular wax biosynthesis:
NADP+ + a very-long-chain fatty alcohol + coenzyme A ⟶ H+ + NADPH + a very-long-chain fatty acyl-CoA
- very long chain fatty acid biosynthesis I:
NADP+ + a very-long-chain (3R)-3-hydroxyacyl-CoA ⟶ H+ + NADPH + a very-long-chain oxoacyl-CoA
- very long chain fatty acid biosynthesis I:
NADP+ + a very-long-chain 2,3,4-saturated fatty acyl CoA ⟶ H+ + NADPH + a very-long-chain (2E)-2-enoyl-CoA
- cuticular wax biosynthesis:
NADP+ + a very-long-chain fatty aldehyde + coenzyme A ⟶ H+ + NADPH + a very-long-chain fatty acyl-CoA
- very long chain fatty acid biosynthesis I:
NADP+ + a very-long-chain 2,3,4-saturated fatty acyl CoA ⟶ H+ + NADPH + a very-long-chain (2E)-2-enoyl-CoA
- cuticular wax biosynthesis:
NADP+ + a very-long-chain fatty aldehyde + coenzyme A ⟶ H+ + NADPH + a very-long-chain fatty acyl-CoA
- very long chain fatty acid biosynthesis I:
NADP+ + a very-long-chain (3R)-3-hydroxyacyl-CoA ⟶ H+ + NADPH + a very-long-chain oxoacyl-CoA
- cuticular wax biosynthesis:
NADP+ + a very-long-chain fatty aldehyde + coenzyme A ⟶ H+ + NADPH + a very-long-chain fatty acyl-CoA
- cuticular wax biosynthesis:
NADP+ + a very-long-chain fatty aldehyde + coenzyme A ⟶ H+ + NADPH + a very-long-chain fatty acyl-CoA
- very long chain fatty acid biosynthesis I:
NADP+ + a very-long-chain (3R)-3-hydroxyacyl-CoA ⟶ H+ + NADPH + a very-long-chain oxoacyl-CoA
- very long chain fatty acid biosynthesis I:
NADP+ + a very-long-chain 2,3,4-saturated fatty acyl CoA ⟶ H+ + NADPH + a very-long-chain (2E)-2-enoyl-CoA
- cuticular wax biosynthesis:
NADP+ + a very-long-chain fatty aldehyde + coenzyme A ⟶ H+ + NADPH + a very-long-chain fatty acyl-CoA
- cuticular wax biosynthesis:
a very-long-chain aldehyde ⟶ CO + a very long-chain alkane
- very long chain fatty acid biosynthesis I:
NADP+ + a very-long-chain 2,3,4-saturated fatty acyl CoA ⟶ H+ + NADPH + a very-long-chain (2E)-2-enoyl-CoA
- very long chain fatty acid biosynthesis I:
NADP+ + a very-long-chain (3R)-3-hydroxyacyl-CoA ⟶ H+ + NADPH + a very-long-chain oxoacyl-CoA
- cuticular wax biosynthesis:
a very-long-chain aldehyde ⟶ CO + a very long-chain alkane
- very long chain fatty acid biosynthesis I:
NADP+ + a very-long-chain 2,3,4-saturated fatty acyl CoA ⟶ H+ + NADPH + a very-long-chain (2E)-2-enoyl-CoA
- cuticular wax biosynthesis:
a very-long-chain aldehyde ⟶ CO + a very long-chain alkane
- very long chain fatty acid biosynthesis I:
NADP+ + a very-long-chain 2,3,4-saturated fatty acyl CoA ⟶ H+ + NADPH + a very-long-chain (2E)-2-enoyl-CoA
- cuticular wax biosynthesis:
a very-long-chain aldehyde ⟶ CO + a very long-chain alkane
- cuticular wax biosynthesis:
a very-long-chain aldehyde ⟶ CO + a very long-chain alkane
- very long chain fatty acid biosynthesis I:
NADP+ + a very-long-chain 2,3,4-saturated fatty acyl CoA ⟶ H+ + NADPH + a very-long-chain (2E)-2-enoyl-CoA
- cuticular wax biosynthesis:
a very-long-chain aldehyde ⟶ CO + a very long-chain alkane
- very long chain fatty acid biosynthesis I:
NADP+ + a very-long-chain (3R)-3-hydroxyacyl-CoA ⟶ H+ + NADPH + a very-long-chain oxoacyl-CoA
- very long chain fatty acid biosynthesis I:
NADP+ + a very-long-chain (3R)-3-hydroxyacyl-CoA ⟶ H+ + NADPH + a very-long-chain oxoacyl-CoA
- cuticular wax biosynthesis:
a very-long-chain aldehyde ⟶ CO + a very long-chain alkane
- pinitol biosynthesis II:
myo-inositol + SAM ⟶ H+ + SAH + sequoyitol
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
H2O + geranyl diphosphate ⟶ diphosphate + geraniol
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- geraniol and geranial biosynthesis:
NADP+ + geraniol ⟶ H+ + NADPH + geranial
- canavanine degradation:
H+ + L-canaline + NADPH ⟶ L-homoserine + NADP+ + ammonium
- polymethylated quercetin glucoside biosynthesis II - quercetagetin series (Chrysosplenium):
3,6,7-trimethylquercetagetin + SAM ⟶ 3,6,7,4'-tetramethylquercetagetin + H+ + SAH
- superpathway of polymethylated quercetin/quercetagetin glucoside biosynthesis (Chrysosplenium):
3,6,7-trimethylquercetagetin + SAM ⟶ 3,6,7,4'-tetramethylquercetagetin + H+ + SAH
- superpathway of tetrahydrofolate biosynthesis:
7,8-dihydroneopterin 3'-phosphate + H2O ⟶ 7,8-dihydroneopterin + phosphate
- tetrahydrofolate biosynthesis:
(7,8-dihydropterin-6-yl)methyl diphosphate + 4-aminobenzoate ⟶ 7,8-dihydropteroate + diphosphate
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin 3'-phosphate + H2O ⟶ 7,8-dihydroneopterin + phosphate
- superpathway of tetrahydrofolate biosynthesis:
GTP + H2O ⟶ 7,8-dihydroneopterin 3'-triphosphate + H+ + formate
- tetrahydrofolate biosynthesis I:
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- dTMP de novo biosynthesis (mitochondrial):
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate
- dTMP de novo biosynthesis (mitochondrial):
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate
- dTMP de novo biosynthesis (mitochondrial):
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate
- dTMP de novo biosynthesis (mitochondrial):
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate
- dTMP de novo biosynthesis (mitochondrial):
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate
- dTMP de novo biosynthesis (mitochondrial):
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate
- dTMP de novo biosynthesis (mitochondrial):
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate
- tetrahydrofolate biosynthesis II:
4-amino-4-deoxychorismate ⟶ 4-aminobenzoate + H+ + pyruvate
- tetrahydrofolate biosynthesis:
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate
- superpathway of tetrahydrofolate biosynthesis:
4-amino-4-deoxychorismate ⟶ 4-aminobenzoate + H+ + pyruvate
- dTMP de novo biosynthesis (mitochondrial):
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate
- dTMP de novo biosynthesis (mitochondrial):
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate
- dTMP de novo biosynthesis (mitochondrial):
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate
- dTMP de novo biosynthesis (mitochondrial):
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate
- dTMP de novo biosynthesis (mitochondrial):
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate
- dTMP de novo biosynthesis (mitochondrial):
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate
- dTMP de novo biosynthesis (mitochondrial):
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate
- dTMP de novo biosynthesis (mitochondrial):
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate
- dTMP de novo biosynthesis (mitochondrial):
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate
- dTMP de novo biosynthesis (mitochondrial):
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate
- dTMP de novo biosynthesis (mitochondrial):
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate
- dTMP de novo biosynthesis (mitochondrial):
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate
- dTMP de novo biosynthesis (mitochondrial):
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate
- dTMP de novo biosynthesis (mitochondrial):
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate
- dTMP de novo biosynthesis (mitochondrial):
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate
- dTMP de novo biosynthesis (mitochondrial):
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate
- dTMP de novo biosynthesis (mitochondrial):
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate
- phytocassanes biosynthesis, shared reactions:
ent-3β-hydroxycassa-12,15-dien-2-one + H+ + NADPH + O2 ⟶ ent-cassa-12,15-diene-2β,3β-diol-11-one + H2O + NADP+
- pyridoxal 5'-phosphate salvage II (plants):
ATP + pyridoxal ⟶ ADP + H+ + PLP
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
H2O + O2 + pyridoxamine 5'-phosphate ⟶ PLP + ammonium + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
H2O + O2 + pyridoxamine 5'-phosphate ⟶ PLP + ammonium + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
ATP + pyridoxal ⟶ ADP + H+ + PLP
- pyridoxal 5'-phosphate salvage II (plants):
H2O + O2 + pyridoxamine 5'-phosphate ⟶ PLP + ammonium + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
ATP + pyridoxine ⟶ ADP + H+ + pyridoxine 5'-phosphate
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
O2 + pyridoxine 5'-phosphate ⟶ PLP + hydrogen peroxide
- pyridoxal 5'-phosphate salvage II (plants):
NADP+ + pyridoxine ⟶ H+ + NADPH + pyridoxal
- polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
3,7,4'-trimethylquercetin + H+ + NADPH + O2 ⟶ 2'-hydroxy 3,7,4'-trimethylquercetin + H2O + NADP+
- polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
3,7,4'-trimethylquercetin + H+ + NADPH + O2 ⟶ 2'-hydroxy 3,7,4'-trimethylquercetin + H2O + NADP+
- polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
3,7,4'-trimethylquercetin + H+ + NADPH + O2 ⟶ 2'-hydroxy 3,7,4'-trimethylquercetin + H2O + NADP+
- polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
2'-hydroxy 3,7,4'-trimethylquercetin + SAM ⟶ 2'-hydroxy 3,7,3',4'-tetramethylquercetin + H+ + SAH
- polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
3,7,4'-trimethylquercetin + H+ + NADPH + O2 ⟶ 2'-hydroxy 3,7,4'-trimethylquercetin + H2O + NADP+
- polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
2'-hydroxy 3,7,4'-trimethylquercetin + SAM ⟶ 2'-hydroxy 3,7,3',4'-tetramethylquercetin + H+ + SAH
- polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
2'-hydroxy 3,7,4'-trimethylquercetin + UDP-α-D-glucose ⟶ 3,7,4'-trimethylquercetin 2'-O-β-D-glucoside + H+ + UDP
- polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
2'-hydroxy 3,7,4'-trimethylquercetin + SAM ⟶ 2'-hydroxy 3,7,3',4'-tetramethylquercetin + H+ + SAH
- polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
2'-hydroxy 3,7,4'-trimethylquercetin + SAM ⟶ 2'-hydroxy 3,7,3',4'-tetramethylquercetin + H+ + SAH
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- proanthocyanidins biosynthesis from flavanols:
UDP-α-D-glucose + a (2R,3R)-flavan-3-ol ⟶ H+ + UDP + a (2R,3R)-flavan-3-ol-3'-O-glucoside
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
UDP-α-D-glucose + a (2R,3R)-flavan-3-ol ⟶ H+ + UDP + a (2R,3R)-flavan-3-ol-3'-O-glucoside
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- naringenin C-glucosylation:
(2S)-naringenin + NADPH + O2 ⟶ 2-hydroxynaringenin + H2O + NADP+
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- luteolin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ CO2 + H2O + luteolin + succinate
- naringenin C-glucosylation:
(2S)-naringenin + NADPH + O2 ⟶ 2-hydroxynaringenin + H2O + NADP+
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate
- naringenin C-glucosylation:
(2S)-naringenin + NADPH + O2 ⟶ 2-hydroxynaringenin + H2O + NADP+
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- naringenin C-glucosylation:
(2S)-naringenin + NADPH + O2 ⟶ 2-hydroxynaringenin + H2O + NADP+
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+
- luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+
- naringenin C-glucosylation:
(2S)-naringenin + NADPH + O2 ⟶ 2-hydroxynaringenin + H2O + NADP+
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- naringenin C-glucosylation:
(2S)-naringenin + NADPH + O2 ⟶ 2-hydroxynaringenin + H2O + NADP+
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- naringenin C-glucosylation:
(2S)-naringenin + NADPH + O2 ⟶ 2-hydroxynaringenin + H2O + NADP+
- apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- naringenin C-glucosylation:
(2S)-naringenin + NADPH + O2 ⟶ 2-hydroxynaringenin + H2O + NADP+
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- naringenin C-glucosylation:
(2S)-naringenin + NADPH + O2 ⟶ 2-hydroxynaringenin + H2O + NADP+
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- naringenin C-glucosylation:
(2S)-naringenin + NADPH + O2 ⟶ 2-hydroxynaringenin + H2O + NADP+
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- naringenin C-glucosylation:
(2S)-naringenin + NADPH + O2 ⟶ 2-hydroxynaringenin + H2O + NADP+
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- naringenin C-glucosylation:
(2S)-naringenin + NADPH + O2 ⟶ 2-hydroxynaringenin + H2O + NADP+
- naringenin C-glucosylation:
(2S)-naringenin + NADPH + O2 ⟶ 2-hydroxynaringenin + H2O + NADP+
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate
- luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate
- luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+
- naringenin C-glucosylation:
(2S)-naringenin + NADPH + O2 ⟶ 2-hydroxynaringenin + H2O + NADP+
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- naringenin C-glucosylation:
(2S)-naringenin + NADPH + O2 ⟶ 2-hydroxynaringenin + H2O + NADP+
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+
- naringenin C-glucosylation:
(2S)-naringenin + NADPH + O2 ⟶ 2-hydroxynaringenin + H2O + NADP+
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- naringenin C-glucosylation:
(2S)-naringenin + NADPH + O2 ⟶ 2-hydroxynaringenin + H2O + NADP+
- luteolin biosynthesis:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin
- luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- naringenin C-glucosylation:
(2S)-naringenin + NADPH + O2 ⟶ 2-hydroxynaringenin + H2O + NADP+
- luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin
- flavonoid biosynthesis (in equisetum):
naringenin chalcone ⟶ (2S)-naringenin
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ (2S)-eriodictyol + H2O + NADP+
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- naringenin C-glucosylation:
(2S)-naringenin + NADPH + O2 ⟶ 2-hydroxynaringenin + H2O + NADP+
- flavonoid biosynthesis (in equisetum):
4-coumaroyl-CoA + H+ + malonyl-CoA ⟶ CO2 + coenzyme A + naringenin chalcone
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- luteolin biosynthesis:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- apigeninidin 5-O-glucoside biosynthesis:
2-oxoglutarate + O2 + apiforol ⟶ CO2 + H2O + apigeninidin + succinate
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- apigeninidin 5-O-glucoside biosynthesis:
NADP+ + apiforol ⟶ (2S)-naringenin + H+ + NADPH
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
(2E,6E)-farnesyl diphosphate + H+ + NAD(P)H ⟶ NAD(P)+ + diphosphate + squalene
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- plant sterol biosynthesis II:
NADP+ + cholesterol ⟶ H+ + NADPH + desmosterol
- β-alanine biosynthesis I:
H2O + O2 + propane-1,3-diamine ⟶ 3-aminopropanal + ammonium + hydrogen peroxide
- β-alanine biosynthesis I:
H2O + O2 + propane-1,3-diamine ⟶ 3-aminopropanal + ammonium + hydrogen peroxide
- β-alanine biosynthesis I:
H2O + O2 + propane-1,3-diamine ⟶ 3-aminopropanal + ammonium + hydrogen peroxide
- β-alanine biosynthesis I:
H2O + O2 + propane-1,3-diamine ⟶ 3-aminopropanal + ammonium + hydrogen peroxide
- β-alanine biosynthesis I:
H2O + O2 + propane-1,3-diamine ⟶ 3-aminopropanal + ammonium + hydrogen peroxide
- β-alanine biosynthesis I:
H2O + O2 + propane-1,3-diamine ⟶ 3-aminopropanal + ammonium + hydrogen peroxide
- β-alanine biosynthesis I:
H2O + O2 + propane-1,3-diamine ⟶ 3-aminopropanal + ammonium + hydrogen peroxide
- β-alanine biosynthesis I:
3-aminopropanal + H2O + NAD(P)+ ⟶ β-alanine + H+ + NAD(P)H
- β-alanine biosynthesis I:
H2O + O2 + propane-1,3-diamine ⟶ 3-aminopropanal + ammonium + hydrogen peroxide
- β-alanine biosynthesis I:
H2O + O2 + propane-1,3-diamine ⟶ 3-aminopropanal + ammonium + hydrogen peroxide
- glucosinolate biosynthesis from pentahomomethionine:
(Z)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)octan-1-imine + H2O ⟶ (Z)-ω-(methylsulfanyl)octyl-thiohydroximate + ammonium + pyruvate
- glucosinolate biosynthesis from pentahomomethionine:
(Z)-1-(L-cystein-S-yl)-N-hydroxy-ω-(methylsulfanyl)octan-1-imine + H2O ⟶ (Z)-ω-(methylsulfanyl)octyl-thiohydroximate + ammonium + pyruvate
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
(indol-3-yl)pyruvate + H+ + NADPH + O2 ⟶ (indol-3-yl)acetate + CO2 + H2O + NADP+
- indole-3-acetate biosynthesis II:
(E)-(indol-3-yl)acetaldehyde oxime ⟶ (indole-3-yl)acetonitrile + H2O
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis II:
(indol-3-yl)acetamide ⟶ (indole-3-yl)acetonitrile + H2O
- indole-3-acetate biosynthesis I:
(indol-3-yl)pyruvate + H+ + NADPH + O2 ⟶ (indol-3-yl)acetate + CO2 + H2O + NADP+
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
(indol-3-yl)pyruvate + H+ + NADPH + O2 ⟶ (indol-3-yl)acetate + CO2 + H2O + NADP+
- indole-3-acetate biosynthesis II:
(indol-3-yl)acetamide ⟶ (indole-3-yl)acetonitrile + H2O
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- indole-3-acetate biosynthesis I:
pyruvate + trp ⟶ (indol-3-yl)pyruvate + ala
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
UDP-4-dehydro-6-deoxy-α-D-glucose ⟶ UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
UDP-4-dehydro-6-deoxy-α-D-glucose ⟶ UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-β-L-rhamnose biosynthesis:
UDP-4-dehydro-6-deoxy-α-D-glucose ⟶ UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-sugars interconversion:
H2O + NAD+ + UDP-α-D-glucose ⟶ H+ + NADH + UDP-α-D-glucuronate
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
UDP-4-dehydro-6-deoxy-α-D-glucose ⟶ UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- UDP-β-L-rhamnose biosynthesis:
NADP+ + UDP-β-L-rhamnose ⟶ H+ + NADPH + UDP-4-dehydro-β-L-rhamnose
- 6-methoxymellein biosynthesis:
6-hydroxymellein + SAM ⟶ 6-methoxymellein + H+ + SAH
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- L-lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- L-lysine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glu
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu
- L-lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- L-lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-isoleucine biosynthesis I:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
5-methyltetrahydropteroyl tri-L-glutamate + L-homocysteine ⟶ met + tetrahydropteroyl tri-L-glutamate
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- L-lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- L-lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- L-lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu
- L-lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- L-lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- L-lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- L-lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu
- L-lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- L-lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu
- L-lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- L-lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- L-lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- L-lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu
- superpathway of L-isoleucine biosynthesis I:
2-oxoglutarate + ile ⟶ (S)-3-methyl-2-oxopentanoate + glu
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- L-lysine biosynthesis VI:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-homoserine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-aspartate 4-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-lysine biosynthesis VI:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
5-methyltetrahydropteroyl tri-L-glutamate + L-homocysteine ⟶ met + tetrahydropteroyl tri-L-glutamate
- L-homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-isoleucine biosynthesis I:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-threonine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- L-homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-threonine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-threonine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- L-homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- L-homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
5-methyltetrahydropteroyl tri-L-glutamate + L-homocysteine ⟶ met + tetrahydropteroyl tri-L-glutamate
- L-homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- L-lysine biosynthesis VI:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-isoleucine biosynthesis I:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-threonine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- L-homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
2-oxoglutarate + asp ⟶ glu + oxaloacetate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-homoserine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- superpathway of L-threonine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of L-isoleucine biosynthesis I:
2-oxobutanoate + H+ + pyruvate ⟶ (S)-2-aceto-2-hydroxybutanoate + CO2
- L-lysine biosynthesis VI:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-homoserine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- superpathway of L-threonine biosynthesis:
L-homoserine + NAD(P)+ ⟶ H+ + L-aspartate 4-semialdehyde + NAD(P)H
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + NADPH + monodehydroascorbate radical ⟶ H+ + L-ascorbate + NADP+
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + NADPH + monodehydroascorbate radical ⟶ H+ + L-ascorbate + NADP+
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate recycling (cytosolic):
NADH + monodehydroascorbate radical ⟶ H+ + L-ascorbate + NAD+
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
H+ + L-ascorbate + hydrogen peroxide ⟶ H2O + monodehydroascorbate radical
- ascorbate glutathione cycle:
NADPH + monodehydroascorbate radical ⟶ H+ + L-ascorbate + NADP+
- leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate
- proanthocyanidins biosynthesis from flavanols:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate
- proanthocyanidins biosynthesis from flavanols:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- leucopelargonidin and leucocyanidin biosynthesis:
(2S)-eriodictyol + 2-oxoglutarate + O2 ⟶ (+)-taxifolin + CO2 + succinate
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- leucopelargonidin and leucocyanidin biosynthesis:
(2R,3S,4S)-leucopelargonidin + NADP+ ⟶ (+)-dihydrokaempferol + H+ + NADPH
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
NAD(P)+ + a (2R,3R)-flavan-3-ol ⟶ H+ + NAD(P)H + an anthocyanidin with a 3-hydroxy group
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-α-D-mannose ⟶ GDP-4-dehydro-α-D-rhamnose + H2O
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-α-D-mannose ⟶ GDP-4-dehydro-α-D-rhamnose + H2O
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-α-D-mannose ⟶ GDP-4-dehydro-α-D-rhamnose + H2O
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- GDP-L-fucose biosynthesis I (from GDP-D-mannose):
GDP-β-L-fucose + NADP+ ⟶ GDP-4-dehydro-6-deoxy-β-L-galactose + H+ + NADPH
- arachidonate biosynthesis IV (8-detaturase, lower eukaryotes):
(11Z,14Z)-icosadienoyl-CoA + NADP+ ⟶ (2E,11Z,14Z)-icosatrienoyl-CoA + H+ + NADPH
- arachidonate biosynthesis IV (8-detaturase, lower eukaryotes):
(3R,11Z,14Z)-3-hydroxyicosadienoyl-CoA + NADP+ ⟶ (11Z,14Z)-3-oxoicosadienoyl-CoA + H+ + NADPH
- arachidonate biosynthesis IV (8-detaturase, lower eukaryotes):
(3R,11Z,14Z)-3-hydroxyicosadienoyl-CoA + NADP+ ⟶ (11Z,14Z)-3-oxoicosadienoyl-CoA + H+ + NADPH
- arachidonate biosynthesis IV (8-detaturase, lower eukaryotes):
(3R,11Z,14Z)-3-hydroxyicosadienoyl-CoA + NADP+ ⟶ (11Z,14Z)-3-oxoicosadienoyl-CoA + H+ + NADPH
- arachidonate biosynthesis IV (8-detaturase, lower eukaryotes):
(3R,11Z,14Z)-3-hydroxyicosadienoyl-CoA + NADP+ ⟶ (11Z,14Z)-3-oxoicosadienoyl-CoA + H+ + NADPH
- sciadonate biosynthesis:
(3R,11Z,14Z)-3-hydroxyicosadienoyl-CoA + NADP+ ⟶ (11Z,14Z)-3-oxoicosadienoyl-CoA + H+ + NADPH
- arachidonate biosynthesis IV (8-detaturase, lower eukaryotes):
(3R,11Z,14Z)-3-hydroxyicosadienoyl-CoA + NADP+ ⟶ (11Z,14Z)-3-oxoicosadienoyl-CoA + H+ + NADPH
- arachidonate biosynthesis IV (8-detaturase, lower eukaryotes):
(3R,11Z,14Z)-3-hydroxyicosadienoyl-CoA + NADP+ ⟶ (11Z,14Z)-3-oxoicosadienoyl-CoA + H+ + NADPH
- arachidonate biosynthesis IV (8-detaturase, lower eukaryotes):
(3R,11Z,14Z)-3-hydroxyicosadienoyl-CoA + NADP+ ⟶ (11Z,14Z)-3-oxoicosadienoyl-CoA + H+ + NADPH
- arachidonate biosynthesis IV (8-detaturase, lower eukaryotes):
(3R,11Z,14Z)-3-hydroxyicosadienoyl-CoA + NADP+ ⟶ (11Z,14Z)-3-oxoicosadienoyl-CoA + H+ + NADPH
- sciadonate biosynthesis:
(3R,11Z,14Z)-3-hydroxyicosadienoyl-CoA + NADP+ ⟶ (11Z,14Z)-3-oxoicosadienoyl-CoA + H+ + NADPH
- nitric oxide biosynthesis II (mammals):
L-arginino-succinate ⟶ arg + fumarate
- nitric oxide biosynthesis II (mammals):
L-arginino-succinate ⟶ arg + fumarate
- selenate reduction:
H+ + glutathione + selenite ⟶ GSSG + H2O + selenodiglutathione
- superpathway of seleno-compound metabolism:
H+ + glutathione + selenite ⟶ GSSG + H2O + selenodiglutathione
- selenate reduction:
H+ + glutathione + selenite ⟶ GSSG + H2O + selenodiglutathione
- selenate reduction:
NADP+ + glutathione + hydrogen selenide ⟶ H+ + NADPH + glutathioselenol
- superpathway of seleno-compound metabolism:
H+ + glutathione + selenite ⟶ GSSG + H2O + selenodiglutathione
- selenate reduction:
H+ + glutathione + selenite ⟶ GSSG + H2O + selenodiglutathione
- superpathway of seleno-compound metabolism:
H+ + glutathione + selenite ⟶ GSSG + H2O + selenodiglutathione
- pinitol biosynthesis I:
D-ononitol + NAD+ ⟶ 4-O-methyl-D-myo-inosose + H+ + NADH
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
UDP-α-D-glucose + baicalein ⟶ H+ + UDP + baicalein 7-O-β-D-glucoside
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H2O + baicalin ⟶ D-glucopyranuronate + baicalein
- baicalein metabolism:
H+ + NADPH + O2 + chrysin ⟶ H2O + NADP+ + baicalein
- baicalein metabolism:
H+ + NADPH + O2 + chrysin ⟶ H2O + NADP+ + baicalein
- linear furanocoumarin biosynthesis:
H+ + NADPH + O2 + psoralen ⟶ H2O + NADP+ + bergaptol
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
H+ + NADPH + O2 + psoralen ⟶ H2O + NADP+ + bergaptol
- linear furanocoumarin biosynthesis:
H+ + NADPH + O2 + psoralen ⟶ H2O + NADP+ + bergaptol
- lutein biosynthesis:
α-carotene + H+ + NADPH + O2 ⟶ H2O + NADP+ + zeinoxanthin
- superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- proanthocyanidins biosynthesis from flavanols:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate
- proanthocyanidins biosynthesis from flavanols:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate
- proanthocyanidins biosynthesis from flavanols:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate
- proanthocyanidins biosynthesis from flavanols:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate
- proanthocyanidins biosynthesis from flavanols:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate
- proanthocyanidins biosynthesis from flavanols:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate
- proanthocyanidins biosynthesis from flavanols:
2-oxoglutarate + O2 + a (2R,3S,4S)-leucoanthocyanidin ⟶ CO2 + H2O + a (4S)- 2,3-dehydroflavan-3,4-diol + succinate
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- proanthocyanidins biosynthesis from flavanols:
O2 + a (2R,3R)-flavan-3-ol-3'-O-glucoside + a (2R,3S)-flavan-3-ol-3'-O-glucoside ⟶ β-D-glucopyranose + H2O + a proanthocyanidin
- levopimaric acid biosynthesis:
(+)-copalyl diphosphate ⟶ diphosphate + levopimaradiene
- cutin biosynthesis:
16-hydroxypalmitoyl-CoA + H+ + NADPH + O2 ⟶ 10,16-dihydroxypalmitoyl-CoA + H2O + NADP+
- suberin monomers biosynthesis:
22-oxo-docosanoyl-CoA + H2O + NADP+ ⟶ 22-carboxy-docosanoyl-CoA + H+ + NADPH
- cutin biosynthesis:
18-oxo-oleate + H2O + NADP+ ⟶ α,ω-9Z-octadecenedioate + H+ + NADPH
- suberin monomers biosynthesis:
18-oxo-oleate + H2O + NADP+ ⟶ α,ω-9Z-octadecenedioate + H+ + NADPH
- cutin biosynthesis:
16-hydroxypalmitate + NADP+ ⟶ 16-oxo-palmitate + H+ + NADPH
- suberin monomers biosynthesis:
18-hydroxyoleate + NADP+ ⟶ 18-oxo-oleate + H+ + NADPH
- suberin monomers biosynthesis:
22-oxo-docosanoyl-CoA + H2O + NADP+ ⟶ 22-carboxy-docosanoyl-CoA + H+ + NADPH
- cutin biosynthesis:
18-oxo-oleate + H2O + NADP+ ⟶ α,ω-9Z-octadecenedioate + H+ + NADPH
- cutin biosynthesis:
16-hydroxypalmitoyl-CoA + H+ + NADPH + O2 ⟶ 10,16-dihydroxypalmitoyl-CoA + H2O + NADP+
- suberin monomers biosynthesis:
18-oxo-oleate + H2O + NADP+ ⟶ α,ω-9Z-octadecenedioate + H+ + NADPH
- cutin biosynthesis:
16-hydroxypalmitoyl-CoA + H+ + NADPH + O2 ⟶ 10,16-dihydroxypalmitoyl-CoA + H2O + NADP+
- suberin monomers biosynthesis:
18-hydroxyoleate + NADP+ ⟶ 18-oxo-oleate + H+ + NADPH
- cutin biosynthesis:
16-oxo-palmitate + H2O + NADP+ ⟶ H+ + NADPH + hexadecanedioate
- suberin monomers biosynthesis:
22-oxo-docosanoyl-CoA + H2O + NADP+ ⟶ 22-carboxy-docosanoyl-CoA + H+ + NADPH
- suberin monomers biosynthesis:
22-oxo-docosanoyl-CoA + H2O + NADP+ ⟶ 22-carboxy-docosanoyl-CoA + H+ + NADPH
- cutin biosynthesis:
16-oxo-palmitate + H2O + NADP+ ⟶ H+ + NADPH + hexadecanedioate
- suberin monomers biosynthesis:
18-oxo-oleate + H2O + NADP+ ⟶ α,ω-9Z-octadecenedioate + H+ + NADPH
- cutin biosynthesis:
18-oxo-oleate + H2O + NADP+ ⟶ α,ω-9Z-octadecenedioate + H+ + NADPH
- suberin monomers biosynthesis:
22-oxo-docosanoyl-CoA + H2O + NADP+ ⟶ 22-carboxy-docosanoyl-CoA + H+ + NADPH
- cutin biosynthesis:
18-oxo-oleate + H2O + NADP+ ⟶ α,ω-9Z-octadecenedioate + H+ + NADPH
- cutin biosynthesis:
16-hydroxypalmitoyl-CoA + H+ + NADPH + O2 ⟶ 10,16-dihydroxypalmitoyl-CoA + H2O + NADP+
- suberin monomers biosynthesis:
18-hydroxyoleate + NADP+ ⟶ 18-oxo-oleate + H+ + NADPH
- cutin biosynthesis:
a hydroperoxy-fatty-acyl-[lipid] + oleate ⟶ 9,10-epoxystearate + a hydroxy-fatty-acyl-[lipid]
- suberin monomers biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + oleate ⟶ 18-hydroxyoleate + H2O + an oxidized [NADPH-hemoprotein reductase]
- cutin biosynthesis:
a hydroperoxy-fatty-acyl-[lipid] + oleate ⟶ 9,10-epoxystearate + a hydroxy-fatty-acyl-[lipid]
- suberin monomers biosynthesis:
H2O + oleoyl-CoA ⟶ H+ + coenzyme A + oleate
- cutin biosynthesis:
H2O + oleoyl-CoA ⟶ H+ + coenzyme A + oleate
- suberin monomers biosynthesis:
H2O + oleoyl-CoA ⟶ H+ + coenzyme A + oleate
- cutin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + oleate ⟶ 18-hydroxyoleate + H2O + an oxidized [NADPH-hemoprotein reductase]
- suberin monomers biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + oleate ⟶ 18-hydroxyoleate + H2O + an oxidized [NADPH-hemoprotein reductase]
- cutin biosynthesis:
H2O + oleoyl-CoA ⟶ H+ + coenzyme A + oleate
- suberin monomers biosynthesis:
H2O + oleoyl-CoA ⟶ H+ + coenzyme A + oleate
- cutin biosynthesis:
a hydroperoxy-fatty-acyl-[lipid] + oleate ⟶ 9,10-epoxystearate + a hydroxy-fatty-acyl-[lipid]
- suberin monomers biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + oleate ⟶ 18-hydroxyoleate + H2O + an oxidized [NADPH-hemoprotein reductase]
- cutin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + oleate ⟶ 18-hydroxyoleate + H2O + an oxidized [NADPH-hemoprotein reductase]
- cutin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + oleate ⟶ 18-hydroxyoleate + H2O + an oxidized [NADPH-hemoprotein reductase]
- suberin monomers biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + oleate ⟶ 18-hydroxyoleate + H2O + an oxidized [NADPH-hemoprotein reductase]
- cutin biosynthesis:
a hydroperoxy-fatty-acyl-[lipid] + oleate ⟶ 9,10-epoxystearate + a hydroxy-fatty-acyl-[lipid]
- suberin monomers biosynthesis:
H2O + oleoyl-CoA ⟶ H+ + coenzyme A + oleate
- cutin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + oleate ⟶ 18-hydroxyoleate + H2O + an oxidized [NADPH-hemoprotein reductase]
- suberin monomers biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + oleate ⟶ 18-hydroxyoleate + H2O + an oxidized [NADPH-hemoprotein reductase]
- suberin monomers biosynthesis:
H2O + oleoyl-CoA ⟶ H+ + coenzyme A + oleate
- cutin biosynthesis:
H2O + oleoyl-CoA ⟶ H+ + coenzyme A + oleate
- suberin monomers biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + oleate ⟶ 18-hydroxyoleate + H2O + an oxidized [NADPH-hemoprotein reductase]
- cutin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + oleate ⟶ 18-hydroxyoleate + H2O + an oxidized [NADPH-hemoprotein reductase]
- cutin biosynthesis:
16-hydroxypalmitate + NADP+ ⟶ 16-oxo-palmitate + H+ + NADPH
- suberin monomers biosynthesis:
18-oxo-oleate + H2O + NADP+ ⟶ α,ω-9Z-octadecenedioate + H+ + NADPH
- vindoline, vindorosine and vinblastine biosynthesis:
catharanthine + hydrogen peroxide + vindoline ⟶ α-3',4'-anhydrovinblastine radical + H2O
- vindoline, vindorosine and vinblastine biosynthesis:
catharanthine + hydrogen peroxide + vindoline ⟶ α-3',4'-anhydrovinblastine radical + H2O
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-octa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoate + ATP + coenzyme A ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA + AMP + diphosphate
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoate + NADP+ ⟶ H+ + NADPH + dinor-12-oxo-phytodienoate
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-octa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoate + ATP + coenzyme A ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA + AMP + diphosphate
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-octa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-hexa-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-buta-2-enoyl)-CoA + hydrogen peroxide
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3R-hydroxyhexanoyl)-CoA + NAD+ ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxohexanoyl)-CoA + H+ + NADH
- superpathway of nicotine biosynthesis:
N-methylputrescine + H2O + O2 ⟶ N-methylaminobutanal + ammonium + hydrogen peroxide
- nicotine biosynthesis:
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide
- nicotine biosynthesis:
(S)-nicotine + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H+ + H2O + an oxidized [NADPH-hemoprotein reductase] + formate + nornicotine
- superpathway of nicotine biosynthesis:
(S)-nicotine + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H+ + H2O + an oxidized [NADPH-hemoprotein reductase] + formate + nornicotine
- luteolinidin 5-O-glucoside biosynthesis:
NADP+ + luteoforol ⟶ (2S)-eriodictyol + H+ + NADPH
- luteolinidin 5-O-glucoside biosynthesis:
2-oxoglutarate + H+ + O2 + luteoforol ⟶ CO2 + H2O + luteolinidin + succinate
- palustric acid biosynthesis:
NADPH + O2 + palustradienal ⟶ H2O + NADP+ + palustric acid
- 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
2-oxoglutarate + 4-aminobutanoate ⟶ glu + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- crotonyl-CoA/ethylmalonyl-CoA/hydroxybutyryl-CoA cycle (engineered):
4-hydroxybutanoate + NADP+ ⟶ H+ + NADPH + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- 4-aminobutanoate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- L-glutamate degradation IV:
4-aminobutanoate + pyruvate ⟶ ala + succinate semialdehyde
- jasmonic acid biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA + O2 ⟶ 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(E-octa-2-enoyl)-CoA + hydrogen peroxide
- L-glutamate biosynthesis III:
H2O + NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- L-glutamate biosynthesis III:
H2O + NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- L-glutamate biosynthesis III:
H2O + NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- L-glutamate biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium
- L-glutamate biosynthesis III:
H2O + NADP+ + glu ⟶ 2-oxoglutarate + H+ + NADPH + ammonium
- L-ornithine biosynthesis II:
H2O + NAD(P)+ + glu ⟶ 2-oxoglutarate + H+ + NAD(P)H + ammonium
- L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH
- L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH
- L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH
- L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH
- L-ornithine biosynthesis II:
L-glutamate-5-semialdehyde + NADP+ + phosphate ⟶ γ-L-glutamyl 5-phosphate + H+ + NADPH
- thymine degradation:
5,6-dihydrothymine + NADP+ ⟶ H+ + NADPH + thymine
- indole-3-acetate biosynthesis II:
(indol-3-yl)pyruvate + H+ + NADPH + O2 ⟶ (indol-3-yl)acetate + CO2 + H2O + NADP+
- chrysophanol biosynthesis:
H+ + NADPH + emodin ⟶ H2O + NADP+ + chrysophanol
- chelerythrine biosynthesis:
(S)-canadine + SAM ⟶ (S)-N-methylcanadine + SAH
- thymine degradation:
5,6-dihydrothymine + H2O ⟶ 3-(carbamoylamino)-2-methylpropanoate + H+
- thymine degradation:
5,6-dihydrothymine + NADP+ ⟶ H+ + NADPH + thymine
- thymine degradation:
5,6-dihydrothymine + H2O ⟶ 3-(carbamoylamino)-2-methylpropanoate + H+
- thymine degradation:
3-(carbamoylamino)-2-methylpropanoate + H+ + H2O ⟶ (R)-3-amino-2-methylpropanoate + CO2 + ammonium
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
SAM + demethylphylloquinol ⟶ H+ + SAH + phylloquinol
- phylloquinol biosynthesis:
SAM + demethylphylloquinol ⟶ H+ + SAH + phylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
2-carboxy-1,4-naphthoquinone + H+ + phytyl diphosphate ⟶ CO2 + demethylphylloquinone + diphosphate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
2-carboxy-1,4-naphthoquinone + H+ + phytyl diphosphate ⟶ CO2 + demethylphylloquinone + diphosphate
- phylloquinol biosynthesis:
2-carboxy-1,4-naphthoquinone + H+ + phytyl diphosphate ⟶ CO2 + demethylphylloquinone + diphosphate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
2-carboxy-1,4-naphthoquinone + H+ + phytyl diphosphate ⟶ CO2 + demethylphylloquinone + diphosphate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
2-carboxy-1,4-naphthoquinone + H+ + phytyl diphosphate ⟶ CO2 + demethylphylloquinone + diphosphate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
2-carboxy-1,4-naphthoquinone + H+ + phytyl diphosphate ⟶ CO2 + demethylphylloquinone + diphosphate
- phylloquinol biosynthesis:
2-carboxy-1,4-naphthoquinone + H+ + phytyl diphosphate ⟶ CO2 + demethylphylloquinone + diphosphate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
2-carboxy-1,4-naphthoquinone + H+ + phytyl diphosphate ⟶ CO2 + demethylphylloquinone + diphosphate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
2-carboxy-1,4-naphthoquinone + H+ + phytyl diphosphate ⟶ CO2 + demethylphylloquinone + diphosphate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
2-carboxy-1,4-naphthoquinone + H+ + phytyl diphosphate ⟶ CO2 + demethylphylloquinone + diphosphate
- phylloquinol biosynthesis:
2-carboxy-1,4-naphthoquinone + H+ + phytyl diphosphate ⟶ CO2 + demethylphylloquinone + diphosphate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
2-carboxy-1,4-naphthoquinone + H+ + phytyl diphosphate ⟶ CO2 + demethylphylloquinone + diphosphate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
2-carboxy-1,4-naphthoquinone + H+ + phytyl diphosphate ⟶ CO2 + demethylphylloquinone + diphosphate
- phylloquinol biosynthesis:
2-carboxy-1,4-naphthoquinone + H+ + phytyl diphosphate ⟶ CO2 + demethylphylloquinone + diphosphate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- superpathway of phylloquinol biosynthesis:
SAM + demethylphylloquinol ⟶ H+ + SAH + phylloquinol
- phylloquinol biosynthesis:
SAM + demethylphylloquinol ⟶ H+ + SAH + phylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- superpathway of phylloquinol biosynthesis:
SAM + demethylphylloquinol ⟶ H+ + SAH + phylloquinol
- phylloquinol biosynthesis:
SAM + demethylphylloquinol ⟶ H+ + SAH + phylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
COVID-19 Disease Map(1)
- @COVID-19 Disease
Map["name"]:
2-Methyl-3-acetoacetyl-CoA + Coenzyme A ⟶ Acetyl-CoA + Propanoyl-CoA
PathBank(0)
PharmGKB(0)
0 个相关的物种来源信息
在这里通过桑基图来展示出与当前的这个代谢物在我们的BioDeep知识库中具有相关联信息的其他代谢物。在这里进行关联的信息来源主要有:
- PubMed: 来源于PubMed文献库中的文献信息,我们通过自然语言数据挖掘得到的在同一篇文献中被同时提及的相关代谢物列表,这个列表按照代谢物同时出现的文献数量降序排序,取前10个代谢物作为相关研究中关联性很高的代谢物集合展示在桑基图中。
- NCBI Taxonomy: 通过文献数据挖掘,得到的代谢物物种来源信息关联。这个关联信息同样按照出现的次数降序排序,取前10个代谢物作为高关联度的代谢物集合展示在桑吉图上。
- Chemical Taxonomy: 在物质分类上处于同一个分类集合中的其他代谢物
- Chemical Reaction: 在化学反应过程中,存在为当前代谢物相关联的生化反应过程中的反应底物或者反应产物的关联代谢物信息。
点击图上的相关代谢物的名称,可以跳转到相关代谢物的信息页面。
文献列表
- Lara Vogelsang, Jürgen Eirich, Iris Finkemeier, Karl-Josef Dietz. Specificity and dynamics of H2O2 detoxification by the cytosolic redox regulatory network as revealed by in vitro reconstitution.
Redox biology.
2024 Jun; 72(?):103141. doi:
10.1016/j.redox.2024.103141
. [PMID: 38599017] - Ashley E Maloney, Sebastian H Kopf, Zhaoyue Zhang, Jamie McFarlin, Daniel B Nelson, Andrew L Masterson, Xinning Zhang. Large enrichments in fatty acid 2H/1H ratios distinguish respiration from aerobic fermentation in yeast Saccharomyces cerevisiae.
Proceedings of the National Academy of Sciences of the United States of America.
2024 May; 121(20):e2310771121. doi:
10.1073/pnas.2310771121
. [PMID: 38709917] - Jia Wang, Xiao Zhou, Kexin Li, Herong Wang, Chenglong Zhang, Yi Shi, Mingdong Yao, Ying Wang, Wenhai Xiao. Systems Metabolic Engineering for Efficient Violaxanthin Production in Yeast.
Journal of agricultural and food chemistry.
2024 May; 72(18):10459-10468. doi:
10.1021/acs.jafc.4c01240
. [PMID: 38666490] - Xiangpeng Meng, Fang Peng, Shijie Yu, Xinming Chi, Wenchi Wang, Shujuan Shao. Knockdown of NADK promotes LUAD ferroptosis via NADPH/FSP1 axis.
Journal of cancer research and clinical oncology.
2024 May; 150(5):228. doi:
10.1007/s00432-024-05752-z
. [PMID: 38700533] - Xue Bai, Shuling Wang, Qin Zhang, Yuhan Hu, Jiawei Zhou, Lianhui Men, Dengyu Li, Jing Ma, Qiuhui Wei, Mengdie Xu, Xiaopu Yin, Tianyuan Hu. Reprogramming the Metabolism of Yeast for High-Level Production of Miltiradiene.
Journal of agricultural and food chemistry.
2024 Apr; 72(15):8704-8714. doi:
10.1021/acs.jafc.4c01203
. [PMID: 38572931] - Wenjing Ouyang, Emilie Wientjes, Peter E L van der Putten, Ludovico Caracciolo, Ruixuan Zhao, Collins Agho, Maurizio Junior Chiurazzi, Marius Bongers, Paul C Struik, Herbert van Amerongen, Xinyou Yin. Roles for leakiness and O2 evolution in explaining lower-than-theoretical quantum yields of photosynthesis in the PEP-CK subtype of C4 plants.
The New phytologist.
2024 Apr; 242(2):431-443. doi:
10.1111/nph.19614
. [PMID: 38406986] - Mingming Sun, Qi Feng, Qi Yan, Huifang Zhao, Haiyan Wang, Shuai Zhang, Changliang Shan, Shuangping Liu, Jiyan Wang, Hongyan Zhai. Malate, a natural inhibitor of 6PGD, improves the efficacy of chemotherapy in lung cancer.
Lung cancer (Amsterdam, Netherlands).
2024 Apr; 190(?):107541. doi:
10.1016/j.lungcan.2024.107541
. [PMID: 38531154] - Xinxin Wang, Mei Li, Fan Wang, Guanghui Mao, Junchao Wu, Rong Han, Rui Sheng, Zhenghong Qin, Hong Ni. TIGAR reduces neuronal ferroptosis by inhibiting succinate dehydrogenase activity in cerebral ischemia.
Free radical biology & medicine.
2024 Apr; 216(?):89-105. doi:
10.1016/j.freeradbiomed.2024.03.011
. [PMID: 38494143] - Ray Singh Rathore, Manjari Mishra, Ashwani Pareek, Sneh Lata Singla-Pareek. A glutathione-independent DJ-1/Pfp1 domain containing glyoxalase III, OsDJ-1C, functions in abiotic stress adaptation in rice.
Planta.
2024 Mar; 259(4):81. doi:
10.1007/s00425-023-04315-9
. [PMID: 38438662] - Parisa Taghvimi, Mohammad Mohsenzadeh Golfazani, Mohammad Mahdi Taghvaei, Habibollah Samizadeh Lahiji. Investigating the effect of drought stress and methanol spraying on the influential genes in the Calvin cycle and photorespiration of rapeseed (Brassica napus).
Functional plant biology : FPB.
2024 03; 51(?):. doi:
10.1071/fp23280
. [PMID: 38467163] - Mingyu Yue, Mengsu Liu, Song Gao, Xuefeng Ren, Shenghu Zhou, Yijian Rao, Jingwen Zhou. High-Level De Novo Production of (2S)-Eriodictyol in Yarrowia Lipolytica by Metabolic Pathway and NADPH Regeneration Engineering.
Journal of agricultural and food chemistry.
2024 Feb; 72(8):4292-4300. doi:
10.1021/acs.jafc.3c08861
. [PMID: 38364826] - Yangzhen Liao, Wenmin Du, Jingqiong Wan, Jiahe Fan, Jilan Pi, Min Wu, Yuan Wei, Zhen Ouyang. Mining and functional characterization of NADPH-cytochrome P450 reductases of the DNJ biosynthetic pathway in mulberry leaves.
BMC plant biology.
2024 Feb; 24(1):133. doi:
10.1186/s12870-024-04815-0
. [PMID: 38395770] - Jaroslaw Szponar, Agnieszka Gorska, Marta Ostrowska-Lesko, Agnieszka Korga-Plewko, Michal Tchorz, Erwin Ciechanski, Anna Dabrowska, Ewa Poleszak, Franciszek Burdan, Jaroslaw Dudka, Marek Murias, Slawomir Mandziuk. Assessment of the Impact of Carvedilol Administered Together with Dexrazoxan and Doxorubicin on Liver Structure and Function, Iron Metabolism, and Myocardial Redox System in Rats.
International journal of molecular sciences.
2024 Feb; 25(4):. doi:
10.3390/ijms25042219
. [PMID: 38396896] - Jing Li, Wei Wang, Bingze Li, Yunzhuan Xue, Xinxin Wang, Shihui Liu, Shuwei Hu, Jiaxuan Tang, Bo Yan, Tong Li, Jiao Xue. NADP+-dependent isocitrate dehydrogenase as a novel target for altering carbon flux to lipid accumulation and enhancing antioxidant capacity in Tetradesmus obliquus.
Bioresource technology.
2024 Jan; 395(?):130365. doi:
10.1016/j.biortech.2024.130365
. [PMID: 38266784] - Ildefonso Rodriguez-Ramiro, Andrés Pastor-Fernández, José Luis López-Aceituno, Esther Garcia-Dominguez, Aranzazu Sierra-Ramirez, Angela M Valverde, Bárbara Martinez-Pastor, Alejo Efeyan, Mari Carmen Gomez-Cabrera, José Viña, Pablo J Fernandez-Marcos. Pharmacological and genetic increases in liver NADPH levels ameliorate NASH progression in female mice.
Free radical biology & medicine.
2024 Jan; 210(?):448-461. doi:
10.1016/j.freeradbiomed.2023.11.019
. [PMID: 38036067] - Chaomurilege, Atsuko Miyagi, Toshiki Ishikawa, Masatoshi Yamaguchi, Hideki Murayama, Maki Kawai-Yamada. Metabolic changes associated with dark-induced leaf senescence in Arabidopsis nadk2 mutants.
Plant signaling & behavior.
2023 12; 18(1):2215618. doi:
10.1080/15592324.2023.2215618
. [PMID: 37272565] - Dong-Oh Moon. NADPH Dynamics: Linking Insulin Resistance and β-Cells Ferroptosis in Diabetes Mellitus.
International journal of molecular sciences.
2023 Dec; 25(1):. doi:
10.3390/ijms25010342
. [PMID: 38203517] - Shaojie Cheng, Xueying Wan, Liping Yang, Yilu Qin, Shanchun Chen, Yongcan Liu, Yan Sun, Yuxiang Qiu, Luyi Huang, Qizhong Qin, Xiaojiang Cui, Mingjun Wu, Manran Liu. RGCC-mediated PLK1 activity drives breast cancer lung metastasis by phosphorylating AMPKα2 to activate oxidative phosphorylation and fatty acid oxidation.
Journal of experimental & clinical cancer research : CR.
2023 Dec; 42(1):342. doi:
10.1186/s13046-023-02928-2
. [PMID: 38102722] - Judith Scharte, Sebastian Hassa, Cornelia Herrfurth, Ivo Feussner, Giuseppe Forlani, Engelbert Weis, Antje von Schaewen. Metabolic priming in G6PDH isoenzyme-replaced tobacco lines improves stress tolerance and seed yields via altering assimilate partitioning.
The Plant journal : for cell and molecular biology.
2023 Dec; 116(6):1696-1716. doi:
10.1111/tpj.16460
. [PMID: 37713307] - Mengnan Zhao, Tao Lu, Guoshu Bi, Zhengyang Hu, Jiaqi Liang, Yunyi Bian, Mingxiang Feng, Cheng Zhan. PLK1 regulating chemoradiotherapy sensitivity of esophageal squamous cell carcinoma through pentose phosphate pathway/ferroptosis.
Biomedicine & pharmacotherapy = Biomedecine & pharmacotherapie.
2023 Dec; 168(?):115711. doi:
10.1016/j.biopha.2023.115711
. [PMID: 37879213] - Xin Lin, Xiaoxia Zhao, Qingfeng Chen, Xiaoyue Wang, Yongya Wu, Hao Zhao. Quercetin ameliorates ferroptosis of rat cardiomyocytes via activation of the SIRT1/p53/SLC7A11 signaling pathway to alleviate sepsis‑induced cardiomyopathy.
International journal of molecular medicine.
2023 Dec; 52(6):. doi:
10.3892/ijmm.2023.5319
. [PMID: 37859612] - Akiko Yoshihara, Keiko Kobayashi, Noriko Nagata, Sho Fujii, Hajime Wada, Koichi Kobayashi. Anionic lipids facilitate membrane development and protochlorophyllide biosynthesis in etioplasts.
Plant physiology.
2023 Nov; ?(?):. doi:
10.1093/plphys/kiad604
. [PMID: 37962588] - Shoki Ito, Atsuko Watanabe, Takashi Osanai. Regulation of l-aspartate oxidase contributes to NADP+ biosynthesis in Synechocystis sp. PCC 6803.
Plant physiology.
2023 Nov; ?(?):. doi:
10.1093/plphys/kiad580
. [PMID: 37936332] - Jingping Cheng, Guodong Li, Xue Wang, Congwei Yang, Furong Xu, Zigang Qian, Xiaohui Ma. Cloning and Functional Characterization of NADPH-Cytochrome P450 Reductases in Aconitum vilmorinianum.
Molecules (Basel, Switzerland).
2023 Nov; 28(21):. doi:
10.3390/molecules28217409
. [PMID: 37959828] - Konosuke Takemoto, Akiho Tsurugi-Sakurada, Ryota Moriuchi, Yuko Yoneda, Shingo Kawai. Cloning and characterization of NADPH-dependent double-bond reductases from Alnus sieboldiana that recognize linear diarylheptanoids as substrates.
Phytochemistry.
2023 Nov; 215(?):113850. doi:
10.1016/j.phytochem.2023.113850
. [PMID: 37659705] - Agata Jacewicz, Swathi Dantuluri, Stewart Shuman. Structural basis for Tpt1-catalyzed 2'-PO4 transfer from RNA and NADP(H) to NAD.
Proceedings of the National Academy of Sciences of the United States of America.
2023 Oct; 120(44):e2312999120. doi:
10.1073/pnas.2312999120
. [PMID: 37883434] - Alka Jangra, Siddhant Chaturvedi, Sonia Sihag, Garima Sharma, Siddharth Tiwari, Vinod Chhokar. Identification and functional characterization of a novel aldo-keto reductase from Aloe vera.
Planta.
2023 Oct; 258(6):107. doi:
10.1007/s00425-023-04256-3
. [PMID: 37897513] - Qiqi Zhang, Shilong Tian, Genyun Chen, Qiming Tang, Yijing Zhang, Andrew J Fleming, Xin-Guang Zhu, Peng Wang. Regulatory NADH dehydrogenase-like complex optimizes C4 photosynthetic carbon flow and cellular redox in maize.
The New phytologist.
2023 Oct; ?(?):. doi:
10.1111/nph.19332
. [PMID: 37872738] - Eda Dagsuyu, Refiye Yanardag. Purification and characterization of thioredoxin reductase enzyme from commercial Spirulina platensis tablets by affinity chromatography and investigation of the effects of some chemicals and drugs on enzyme activity.
Biotechnology and applied biochemistry.
2023 Oct; ?(?):. doi:
10.1002/bab.2530
. [PMID: 37864368] - Binyan Wu, Fan Qi, Yan Liang. Fuels for ROS signaling in plant immunity.
Trends in plant science.
2023 10; 28(10):1124-1131. doi:
10.1016/j.tplants.2023.04.007
. [PMID: 37188557] - Kenneth K Y Ting, Pei Yu, Riley Dow, Eric Floro, Hisham Ibrahim, Corey A Scipione, Sharon J Hyduk, Chanele K Polenz, Olga Zaslaver, Peer W F Karmaus, Michael B Fessler, Hannes L Röst, Michael Ohh, Sue Tsai, Daniel A Winer, Minna Woo, Jonathan Rocheleau, Jenny Jongstra-Bilen, Myron I Cybulsky. Oxidized Low-Density Lipoprotein Accumulation Suppresses Glycolysis and Attenuates the Macrophage Inflammatory Response by Diverting Transcription from the HIF-1α to the Nrf2 Pathway.
Journal of immunology (Baltimore, Md. : 1950).
2023 Sep; ?(?):. doi:
10.4049/jimmunol.2300293
. [PMID: 37756544] - Ivan Kushkevych, Dani Dordević, Mohammad I Alberfkani, Márió Gajdács, Eszter Ostorházi, Monika Vítězová, Simon K-M R Rittmann. NADH and NADPH peroxidases as antioxidant defense mechanisms in intestinal sulfate-reducing bacteria.
Scientific reports.
2023 08; 13(1):13922. doi:
10.1038/s41598-023-41185-3
. [PMID: 37626119] - Yanqiu Yang, Tingyu Hao, Xiaohu Yao, Yue Che, Yueyang Liu, Mingxia Fang, Yingjie Wang, Di Zhou, Huifang Chai, Ning Li, Yue Hou. Crebanine ameliorates ischemia-reperfusion brain damage by inhibiting oxidative stress and neuroinflammation mediated by NADPH oxidase 2 in microglia.
Phytomedicine : international journal of phytotherapy and phytopharmacology.
2023 Aug; 120(?):155044. doi:
10.1016/j.phymed.2023.155044
. [PMID: 37634486] - Deepika Kandoi, Baishnab C Tripathy. Overexpression of chloroplastic Zea mays NADP-malic enzyme (ZmNADP-ME) confers tolerance to salt stress in Arabidopsis thaliana.
Photosynthesis research.
2023 Aug; ?(?):. doi:
10.1007/s11120-023-01041-x
. [PMID: 37561272] - Jihye Yang, Yoontae Lee, Cheol-Sang Hwang. The ubiquitin-proteasome system links NADPH metabolism to ferroptosis.
Trends in cell biology.
2023 Aug; ?(?):. doi:
10.1016/j.tcb.2023.07.003
. [PMID: 37558595] - Moges A Retta, Xinyou Yin, Quang Tri Ho, Rodrigo Watté, Herman N C Berghuijs, Pieter Verboven, Wouter Saeys, Francisco Javier Cano, Oula Ghannoum, Paul C Struik, Bart M Nicolaï. The role of chloroplast movement in C4 photosynthesis: a theoretical analysis using a three-dimensional reaction-diffusion model for maize.
Journal of experimental botany.
2023 08; 74(14):4125-4142. doi:
10.1093/jxb/erad138
. [PMID: 37083863] - Ruiyuan Liu, Leng Wang, Yue Meng, Yiyi Tian, Fang Li, Huizhe Lu. Theoretical and Experimental Studies on Plant Light-Dependent Protochlorophyllide Oxidoreductase as a Novel Target for Searching Potential Herbicides.
Journal of agricultural and food chemistry.
2023 Aug; 71(30):11654-11666. doi:
10.1021/acs.jafc.3c01783
. [PMID: 37467369] - Sai Krishna Talla, Bobba Sunil, Duvvarapu Easwar Rao, Pidakala Rajsheel, Deepak Saini, Agepati S Raghavendra. Redox basis of photosynthesis inhibition at supra-optimal bicarbonate in mesophyll protoplasts of Arabidopsis thaliana.
Journal of plant physiology.
2023 Aug; 287(?):154047. doi:
10.1016/j.jplph.2023.154047
. [PMID: 37393886] - Karen Zinzius, Giulia Maria Marchetti, Ronja Fischer, Yuval Milrad, Anne Oltmanns, Simon Kelterborn, Iftach Yacoby, Peter Hegemann, Martin Scholz, Michael Hippler. Calredoxin regulates the chloroplast NADPH-dependent thioredoxin reductase in Chlamydomonas reinhardtii.
Plant physiology.
2023 Jul; ?(?):. doi:
10.1093/plphys/kiad426
. [PMID: 37474113] - Maria Pilarska, Ewa Niewiadomska, Jerzy Kruk. Salinity-induced changes in plastoquinone pool redox state in halophytic Mesembryanthemum crystallinum L.
Scientific reports.
2023 07; 13(1):11160. doi:
10.1038/s41598-023-38194-7
. [PMID: 37430104] - Ziyu Zhu, Xiaoqian Chen, Wenhao Li, Yingping Zhuang, Yuzheng Zhao, Guan Wang. Understanding the effect of temperature downshift on CHO cell growth, antibody titer and product quality by intracellular metabolite profiling and in vivo monitoring of redox state.
Biotechnology progress.
2023 Jul; 39(4):e3352. doi:
10.1002/btpr.3352
. [PMID: 37141532] - Toshitaka Nakamura, Clara Hipp, André Santos Dias Mourão, Jan Borggräfe, Maceler Aldrovandi, Bernhard Henkelmann, Jonas Wanninger, Eikan Mishima, Elena Lytton, David Emler, Bettina Proneth, Michael Sattler, Marcus Conrad. Phase separation of FSP1 promotes ferroptosis.
Nature.
2023 Jul; 619(7969):371-377. doi:
10.1038/s41586-023-06255-6
. [PMID: 37380771] - Tomasz Piechowiak, Bartosz Skóra, Maciej Balawejder. Effect of postharvest nicotinamide treatment on NAD+ metabolism and redox status in strawberry fruit during storage.
Phytochemistry.
2023 Jun; 213(?):113766. doi:
10.1016/j.phytochem.2023.113766
. [PMID: 37343736] - Miriam Ferrer, Nicholas Mourikis, Emma E Davidson, Sam O Kleeman, Marta Zaccaria, Jill Habel, Rachel Rubino, Qing Gao, Thomas R Flint, Lisa Young, Claire M Connell, Michael J Lukey, Marcus D Goncalves, Eileen P White, Ashok R Venkitaraman, Tobias Janowitz. Ketogenic diet promotes tumor ferroptosis but induces relative corticosterone deficiency that accelerates cachexia.
Cell metabolism.
2023 Jun; ?(?):. doi:
10.1016/j.cmet.2023.05.008
. [PMID: 37311455] - Pamela E Molinari, Adriana R Krapp, Andrea Weiner, Hannes M Beyer, Arun Kumar Kondadi, Tim Blomeier, Melina López, Pilar Bustos-Sanmamed, Evelyn Tevere, Wilfried Weber, Andreas S Reichert, Nora B Calcaterra, Mathias Beller, Nestor Carrillo, Matias D Zurbriggen. NERNST: a genetically-encoded ratiometric non-destructive sensing tool to estimate NADP(H) redox status in bacterial, plant and animal systems.
Nature communications.
2023 06; 14(1):3277. doi:
10.1038/s41467-023-38739-4
. [PMID: 37280202] - Paulo V L Souza, Liang-Yu Hou, Hu Sun, Louis Poeker, Martin Lehman, Humaira Bahadar, Adilson P Domingues-Junior, Avilien Dard, Laetitia Bariat, Jean-Philippe Reichheld, Joaquim Albenisio G Silveira, Alisdair R Fernie, Stefan Timm, Peter Geigenberger, Danilo M Daloso. Plant NADPH-dependent thioredoxin reductases are crucial for the metabolism of sink leaves and plant acclimation to elevated CO2.
Plant, cell & environment.
2023 Jun; ?(?):. doi:
10.1111/pce.14631
. [PMID: 37267089] - Xiaohui Ma, Qi Wang, Chunyu Liu, Jianghanzi Liu, Ganqing Luo, Liangliang He, Tianhui Yuan, Rong-Rong He, Zhihong Yao. Regulation of phospholipid peroxidation signaling by a traditional Chinese medicine formula for coronary heart disease.
Phytomedicine : international journal of phytotherapy and phytopharmacology.
2023 Jun; 114(?):154749. doi:
10.1016/j.phymed.2023.154749
. [PMID: 36931097] - David M Dinh, Leonard M Thomas, Elizabeth A Karr. Crystal structure of a putative 3-hydroxypimelyl-CoA dehydrogenase, Hcd1, from Syntrophus aciditrophicus strain SB at 1.78 Å resolution.
Acta crystallographica. Section F, Structural biology communications.
2023 Jun; ?(?):. doi:
10.1107/s2053230x23004399
. [PMID: 37227375] - Yanqiu Yang, Ru Chen, Yue Che, Xiaohu Yao, Mingxia Fang, Yingjie Wang, Di Zhou, Ning Li, Yue Hou. Isoamericanin A improves lipopolysaccharide-induced memory impairment in mice through suppression of the nicotinamide adenine dinucleotide phosphateoxidase-dependent nuclear factor kappa B signaling pathway.
Phytotherapy research : PTR.
2023 May; ?(?):. doi:
10.1002/ptr.7858
. [PMID: 37209001] - Pamela E Molinari, Adriana R Krapp, Matias D Zurbriggen, Néstor Carrillo. Lighting the light reactions of photosynthesis by means of redox-responsive genetically encoded biosensors for photosynthetic intermediates.
Photochemical & photobiological sciences : Official journal of the European Photochemistry Association and the European Society for Photobiology.
2023 May; ?(?):. doi:
10.1007/s43630-023-00425-1
. [PMID: 37195389] - Shunsuke Goto, Hideki Fujii, Kentaro Watanabe, Mao Shimizu, Hidehisa Okamoto, Kazuo Sakamoto, Keiji Kono, Shinichi Nishi. Renal protective effects of astragalus root in rat models of chronic kidney disease.
Clinical and experimental nephrology.
2023 May; ?(?):. doi:
10.1007/s10157-023-02356-8
. [PMID: 37140734] - Viviane Cacefo, Alessandra Ferreira Ribas, Luiz Gonzaga Esteves Vieira. Proline metabolism as a mechanism for the energy dissipation in VaP5CSF129A transgenic tobacco plants under water deficit.
Journal of plant physiology.
2023 Apr; 283(?):153964. doi:
10.1016/j.jplph.2023.153964
. [PMID: 36917876] - Shota Suzuki, Daimu Tanaka, Atsuko Miyagi, Kentaro Takahara, Masaru Kono, Chaomurilege, Ko Noguchi, Toshiki Ishikawa, Minoru Nagano, Masatoshi Yamaguchi, Maki Kawai-Yamada. Loss of peroxisomal NAD kinase 3 (NADK3) affects photorespiration metabolism in Arabidopsis.
Journal of plant physiology.
2023 Apr; 283(?):153950. doi:
10.1016/j.jplph.2023.153950
. [PMID: 36889102] - Olga A Fedotova, Elizaveta A Polyakova, Olga I Grabelnych. Ca2+-dependent oxidation of exogenous NADH and NADPH by the mitochondria of spring wheat and its relation with AOX capacity and ROS content at high temperatures.
Journal of plant physiology.
2023 Apr; 283(?):153943. doi:
10.1016/j.jplph.2023.153943
. [PMID: 36841182] - Xiaowen Da, Jiangfan Guo, Peng Yan, Chao Yang, Hongfei Zhao, Wei Li, Yuzhu Kong, Ruirui Jiang, Yi He, Jiming Xu, Ouyuan Xu, Chuanzao Mao, Xiaorong Mo. Characterizing membrane anchoring of leaf-form ferredoxin-NADP+ oxidoreductase in rice.
Plant, cell & environment.
2023 04; 46(4):1195-1206. doi:
10.1111/pce.14446
. [PMID: 36138316] - Minting Liang, Dachuan Gu, Zhiyang Lie, Yongyi Yang, Longxin Lu, Guangyi Dai, Tao Peng, Ling Deng, Feng Zheng, Xuncheng Liu. Regulation of chlorophyll biosynthesis by light-dependent acetylation of NADPH:protochlorophyll oxidoreductase A in Arabidopsis.
Plant science : an international journal of experimental plant biology.
2023 Feb; 330(?):111641. doi:
10.1016/j.plantsci.2023.111641
. [PMID: 36806610] - Hanan Y Aati, Hala Attia, Razan Babtin, Najla Al-Qahtani, Juergen Wanner. Headspace Solid Phase Micro-Extraction of Volatile Constituents Produced from Saudi Ruta chalepensis and Molecular Docking Study of Potential Antioxidant Activity.
Molecules (Basel, Switzerland).
2023 Feb; 28(4):. doi:
10.3390/molecules28041891
. [PMID: 36838880] - Gustaf E Degen, Philip J Jackson, Matthew S Proctor, Nicholas Zoulias, Stuart A Casson, Matthew P Johnson. High cyclic electron transfer via the PGR5 pathway in the absence of photosynthetic control.
Plant physiology.
2023 Feb; ?(?):. doi:
10.1093/plphys/kiad084
. [PMID: 36774530] - Krishnamoorthy Gurushankar, Hrvoje Rimac, Palko Nadezhda, Maria Grishina. Exploring the potential and identifying Withania somnifera alkaloids as novel dihydrofolate reductase (DHFR) inhibitors by the AlteQ method.
Journal of biomolecular structure & dynamics.
2023 Feb; ?(?):1-14. doi:
10.1080/07391102.2023.2175727
. [PMID: 36762693] - Didem Ilter, Stanislav Drapela, Tanya Schild, Nathan P Ward, Emma Adhikari, Vivien Low, John Asara, Thordur Oskarsson, Eric K Lau, Gina M DeNicola, Melanie R McReynolds, Ana P Gomes. NADK-mediated de novo NADP(H) synthesis is a metabolic adaptation essential for breast cancer metastasis.
Redox biology.
2023 Feb; 61(?):102627. doi:
10.1016/j.redox.2023.102627
. [PMID: 36841051] - Yangyang Zhan, Haixia Xu, Hween Tong Tan, Ying Swan Ho, Dongxiao Yang, Shuwen Chen, Dave Siak-Wei Ow, Xin Lv, Fang Wei, Xuezhi Bi, Shouwen Chen. Systematic Adaptation of Bacillus licheniformis to 2-Phenylethanol Stress.
Applied and environmental microbiology.
2023 Feb; ?(?):e0156822. doi:
10.1128/aem.01568-22
. [PMID: 36752618] - Mengxue Liu, Yao Liu, Lei Zhang, Facheng Qiu. NADPH oxidase contributes to the production of reactive oxygen species in Chlorella pyrenoidosa.
Biotechnology letters.
2023 Feb; 45(2):199-207. doi:
10.1007/s10529-022-03330-2
. [PMID: 36504267] - Maryam Masoumi, Samira Alesaeidi, Hossein Khorramdelazad, Mousa Behzadi, Rasoul Baharlou, Shahin Alizadeh-Fanalou, Jafar Karami. Role of T Cells in the Pathogenesis of Rheumatoid Arthritis: Focus on Immunometabolism Dysfunctions.
Inflammation.
2023 Feb; 46(1):88-102. doi:
10.1007/s10753-022-01751-9
. [PMID: 36215002] - Soudeh Bahramian Nasab, Ahmad Homaei, Roberto Fernandez-Lafuente, Jon Del Arco, Jesús Fernández-Lucas. A Novel, Highly Potent NADPH-Dependent Cytochrome P450 Reductase from Waste Liza klunzingeri Liver.
Marine drugs.
2023 Jan; 21(2):. doi:
10.3390/md21020099
. [PMID: 36827140] - Xianhai Zhao, Yunjun Zhao, Mingyue Gou, Chang-Jun Liu. Tissue-preferential recruitment of electron transfer chains for cytochrome P450-catalyzed phenolic biosynthesis.
Science advances.
2023 01; 9(2):eade4389. doi:
10.1126/sciadv.ade4389
. [PMID: 36630494] - Yuan Wang, Qiang Wang, Di Luo, Pu Zhao, Sha-Sha Zhong, Biao Dai, Jia-Jyu Wang, Yi-Tong Wan, Zhi-Bin Liu, Huan Yang. Electroacupuncture Improves Blood-Brain Barrier and Hippocampal Neuroinflammation in SAMP8 Mice by Inhibiting HMGB1/TLR4 and RAGE/NADPH Signaling Pathways.
Chinese journal of integrative medicine.
2023 Jan; ?(?):. doi:
10.1007/s11655-023-3592-5
. [PMID: 36609953] - Cláudio F Costa, Hongli Li, Mohamed A F Hussein, Yi Yang, Celien Lismont, Marc Fransen. Assessment of the Peroxisomal Redox State in Living Cells Using NADPH- and NAD+/NADH-Specific Fluorescent Protein Sensors.
Methods in molecular biology (Clifton, N.J.).
2023; 2643(?):183-197. doi:
10.1007/978-1-0716-3048-8_13
. [PMID: 36952186] - Nagasuryaprasad Kotikalapudi, Samuel Joshua Pragasam Sampath, Sukesh Narayan Sinha, Bhonde R, Sathish Kumar Mungamuri, Vijayalakshmi Venkatesan. Placental mesenchymal stem cells restore glucose and energy homeostasis in obesogenic adipocytes.
Cell and tissue research.
2023 Jan; 391(1):127-144. doi:
10.1007/s00441-022-03693-y
. [PMID: 36227376] - F O Areche, J M M López, C M C Mamani, M N M Alberto, V G S Araujo, P A P Pastrana, B F Camayo-Lapa, M A Quispe-Solano, J Y Saldarriaga, C P E Ayre, S M Carrasco, A V Roman, D D C Flores, D D Cruz Nieto. Photosynthetic modification of plants through recent technologies: a valuable way to ensure crop fortification.
Brazilian journal of biology = Revista brasleira de biologia.
2023; 83(?):e271809. doi:
10.1590/1519-6984.271809
. [PMID: 37222373] - Shirin Alipour, Natalia Wojciechowska, Barbara Bujarska-Borkowska, Ewa Marzena Kalemba. Distinct redox state regulation in the seedling performance of Norway maple and sycamore.
Journal of plant research.
2023 Jan; 136(1):83-96. doi:
10.1007/s10265-022-01419-3
. [PMID: 36385674] - Jinyao Yan, Xiaolei Ye, Yi Song, Tao Ren, Chongming Wang, Xiaokun Li, Rihuan Cong, Zhifeng Lu, Jianwei Lu. Sufficient potassium improves inorganic phosphate-limited photosynthesis in Brassica napus by enhancing metabolic phosphorus fractions and Rubisco activity.
The Plant journal : for cell and molecular biology.
2023 01; 113(2):416-429. doi:
10.1111/tpj.16057
. [PMID: 36479950] - Magdalena Kwolek-Mirek, Sabina Bednarska, Aleksandra Dubicka-Lisowska, Roman Maslanka, Renata Zadrag-Tecza, Pawel Kaszycki. Unbalance between Pyridine Nucleotide Cofactors in The SOD1 Deficient Yeast Saccharomyces cerevisiae Causes Hypersensitivity to Alcohols and Aldehydes.
International journal of molecular sciences.
2022 Dec; 24(1):. doi:
10.3390/ijms24010659
. [PMID: 36614102] - Fraser A Armstrong, Beichen Cheng, Ryan A Herold, Clare F Megarity, Bhavin Siritanaratkul. From Protein Film Electrochemistry to Nanoconfined Enzyme Cascades and the Electrochemical Leaf.
Chemical reviews.
2022 Dec; ?(?):. doi:
10.1021/acs.chemrev.2c00397
. [PMID: 36573907] - Yumei Feng, Yuanmin Zhu, Zhendong Bao, Bohan Wang, Tingting Liu, Huihui Wang, Tianyi Yu, Ying Yang, Longjiang Yu. Construction of Glucose-6-Phosphate Dehydrogenase Overexpression Strain of Schizochytrium sp. H016 to Improve Docosahexaenoic Acid Production.
Marine drugs.
2022 Dec; 21(1):. doi:
10.3390/md21010017
. [PMID: 36662190] - Danny K Fung, Kaihong Bai, Jin Yang, Xiaoli Xu, David M Stevenson, Daniel Amador-Noguez, Laixin Luo, Jue D Wang. Metabolic Promiscuity of an Orphan Small Alarmone Hydrolase Facilitates Bacterial Environmental Adaptation.
mBio.
2022 12; 13(6):e0242222. doi:
10.1128/mbio.02422-22
. [PMID: 36472432] - Jinhong Liu, Shey-Li Lim, Jia Yi Zhong, Boon Leong Lim. Bioenergetics of pollen tube growth in Arabidopsis thaliana revealed by ratiometric genetically encoded biosensors.
Nature communications.
2022 12; 13(1):7822. doi:
10.1038/s41467-022-35486-w
. [PMID: 36535933] - Zhengrong Jiang, Ming Wang, Michael Nicolas, Laurent Ogé, Maria-Dolores Pérez-Garcia, Laurent Crespel, Ganghua Li, Yanfeng Ding, José Le Gourrierec, Philippe Grappin, Soulaiman Sakr. Glucose-6-Phosphate Dehydrogenases: The Hidden Players of Plant Physiology.
International journal of molecular sciences.
2022 Dec; 23(24):. doi:
10.3390/ijms232416128
. [PMID: 36555768] - Shin-Ichiro Ozawa, Felix Buchert, Ruby Reuys, Michael Hippler, Yuichiro Takahashi. Algal PETC-Pro171-Leu suppresses electron transfer in cytochrome b6f under acidic lumenal conditions.
Plant physiology.
2022 Dec; ?(?):. doi:
10.1093/plphys/kiac575
. [PMID: 36516417] - Pengfei Chen, Xin Liu, Chenhui Gu, Peiyu Zhong, Nan Song, Mobai Li, Zhanqiu Dai, Xiangqian Fang, Zhaoming Liu, Jianfeng Zhang, Ruikang Tang, Shunwu Fan, Xianfeng Lin. A plant-derived natural photosynthetic system for improving cell anabolism.
Nature.
2022 12; 612(7940):546-554. doi:
10.1038/s41586-022-05499-y
. [PMID: 36477541] - Shuwahida Shuib, Mohamed Yusuf Mohamed Nazir, Izyanti Ibrahim, Yuanda Song, Colin Ratledge, Aidil Abdul Hamid. Co-existence of type I fatty acid synthase and polyketide synthase metabolons in Aurantiochytrium SW1 and their implications for lipid biosynthesis.
Biochimica et biophysica acta. Molecular and cell biology of lipids.
2022 12; 1867(12):159224. doi:
10.1016/j.bbalip.2022.159224
. [PMID: 36007759] - Qingwen Yang, Junjie Yang, Xuesong Liu, Yi Zhang, Yue Li, Da Ao, Peng Zhong, Kang Yong. Crosstalk Between the Mitochondrial Dynamics and Oxidative Stress in Zinc-induced Cytotoxicity.
Biological trace element research.
2022 Nov; ?(?):. doi:
10.1007/s12011-022-03504-z
. [PMID: 36445560] - Meliha Koldemir Gündüz. BGM, a Newly Synthesised Boron Compound, Induces Apoptosis and Reduces Oxidative Stress by Inhibiting Lipogenesis in 3T3-L1 Adipocytes via PPARγ and CTRP3.
Biological trace element research.
2022 Nov; 200(11):4807-4816. doi:
10.1007/s12011-022-03261-z
. [PMID: 35508889] - YaJuan Ni, Jing Zhang, Wenjing Zhu, Yixuan Duan, HongYuan Bai, Chunhong Luan. Echinacoside inhibited cardiomyocyte pyroptosis and improved heart function of HF rats induced by isoproterenol via suppressing NADPH/ROS/ER stress.
Journal of cellular and molecular medicine.
2022 11; 26(21):5414-5425. doi:
10.1111/jcmm.17564
. [PMID: 36201630] - Weijian Li, Zeyu Wang, Ruirong Lin, Shuai Huang, Huijie Miao, Lu Zou, Ke Liu, Xuya Cui, Ziyi Wang, Yijian Zhang, Chengkai Jiang, Shimei Qiu, Jiyao Ma, Wenguang Wu, Yingbin Liu. Lithocholic acid inhibits gallbladder cancer proliferation through interfering glutaminase-mediated glutamine metabolism.
Biochemical pharmacology.
2022 11; 205(?):115253. doi:
10.1016/j.bcp.2022.115253
. [PMID: 36176239] - Alexander G Volkov, Jewel S Hairston, Gamaliel Taengwa, Jade Roberts, Lincoln Liburd, Darayas Patel. Redox Reactions of Biologically Active Molecules upon Cold Atmospheric Pressure Plasma Treatment of Aqueous Solutions.
Molecules (Basel, Switzerland).
2022 Oct; 27(20):. doi:
10.3390/molecules27207051
. [PMID: 36296644] - Zhenzhen Li, Yue Tan, Xiang Li, Jing Quan, Ann M Bode, Ya Cao, Xiangjian Luo. DHRS2 inhibits cell growth and metastasis in ovarian cancer by downregulation of CHKα to disrupt choline metabolism.
Cell death & disease.
2022 10; 13(10):845. doi:
10.1038/s41419-022-05291-w
. [PMID: 36192391] - Alexander Günzel, Vera Engelbrecht, Thomas Happe. Changing the tracks: screening for electron transfer proteins to support hydrogen production.
Journal of biological inorganic chemistry : JBIC : a publication of the Society of Biological Inorganic Chemistry.
2022 Oct; 27(7):631-640. doi:
10.1007/s00775-022-01956-1
. [PMID: 36038787] - Samrat Rakshit, Nisha Sahu, Satendra Kumar Nirala, Monika Bhadauria. Protective activity of purpurin against d-galactosamine and lipopolysaccharide-induced hepatorenal injury by upregulation of heme oxygenase-1 in the RBC degradation cycle.
Journal of biochemical and molecular toxicology.
2022 Oct; 36(10):e23168. doi:
10.1002/jbt.23168
. [PMID: 35838105] - Alessandro Morotti, Cristina Barale, Elena Melchionda, Isabella Russo. Platelet Redox Imbalance in Hypercholesterolemia: A Big Problem for a Small Cell.
International journal of molecular sciences.
2022 Sep; 23(19):. doi:
10.3390/ijms231911446
. [PMID: 36232746] - Kuenzang Om, Nico N Arias, Chaney C Jambor, Alexandra MacGregor, Ashley N Rezachek, Carlan Haugrud, Hans-Henning Kunz, Zhonghui Wang, Pu Huang, Quan Zhang, Josh Rosnow, Thomas P Brutnell, Asaph B Cousins, Chris J Chastain. Pyruvate, phosphate dikinase regulatory protein impacts light response of C4 photosynthesis in Setaria viridis.
Plant physiology.
2022 09; 190(2):1117-1133. doi:
10.1093/plphys/kiac333
. [PMID: 35876823] - Esther García-Domínguez, Aitor Carretero, Aurora Viña-Almunia, Julio Domenech-Fernandez, Gloria Olaso-Gonzalez, Jose Viña, Mari Carmen Gomez-Cabrera. Glucose 6-P Dehydrogenase-An Antioxidant Enzyme with Regulatory Functions in Skeletal Muscle during Exercise.
Cells.
2022 09; 11(19):. doi:
10.3390/cells11193041
. [PMID: 36231003] - Chundong Niu, Lijuan Jiang, Fuguo Cao, Chen Liu, Junxing Guo, Zitong Zhang, Qianyu Yue, Nan Hou, Zeyuan Liu, Xuewei Li, Muhammad Mobeen Tahir, Jieqiang He, Zhongxing Li, Chao Li, Fengwang Ma, Qingmei Guan. Methylation of a MITE insertion in the MdRFNR1-1 promoter is positively associated with its allelic expression in apple in response to drought stress.
The Plant cell.
2022 09; 34(10):3983-4006. doi:
10.1093/plcell/koac220
. [PMID: 35897144] - Amna Devi, Romit Seth, Mamta Masand, Gopal Singh, Ashlesha Holkar, Shikha Sharma, Ashok Singh, Ram Kumar Sharma. Spatial Genomic Resource Reveals Molecular Insights into Key Bioactive-Metabolite Biosynthesis in Endangered Angelica glauca Edgew.
International journal of molecular sciences.
2022 Sep; 23(19):. doi:
10.3390/ijms231911064
. [PMID: 36232367] - Sonia Spinelli, Lucrezia Guida, Tiziana Vigliarolo, Mario Passalacqua, Giulia Begani, Mirko Magnone, Laura Sturla, Andrea Benzi, Pietro Ameri, Edoardo Lazzarini, Claudia Bearzi, Roberto Rizzi, Elena Zocchi. The ABA-LANCL1/2 Hormone-Receptors System Protects H9c2 Cardiomyocytes from Hypoxia-Induced Mitochondrial Injury via an AMPK- and NO-Mediated Mechanism.
Cells.
2022 09; 11(18):. doi:
10.3390/cells11182888
. [PMID: 36139463] - Thomas Weidman, Alexis A Nagengast, Justin R DiAngelo. The splicing factor 9G8 regulates the expression of NADPH-producing enzyme genes in Drosophila.
Biochemical and biophysical research communications.
2022 09; 620(?):92-97. doi:
10.1016/j.bbrc.2022.06.073
. [PMID: 35780586] - Yeshveer Singh, Ruby Sharma, Manasi Mishra, Praveen Kumar Verma, Ajay Kumar Saxena. Crystal structure of ArOYE6 reveals a novel C-terminal helical extension and mechanistic insights into the distinct class III OYEs from pathogenic fungi.
The FEBS journal.
2022 09; 289(18):5531-5550. doi:
10.1111/febs.16445
. [PMID: 35313092] - Sergey S Popov, Evgenii D Kryl'skii, Konstantin K Shulgin, Ekaterina A Raskina, Tatyana N Popova, Alexander N Pashkov, Galina N Kuptsova. Inflammation is associated with impairment of oxidative status, carbohydrate and lipid metabolism in type 2 diabetes complicated by non-alcoholic fatty liver disease.
Minerva endocrinology.
2022 Sep; 47(3):304-313. doi:
10.23736/s2724-6507.20.03257-5
. [PMID: 35195377] - Junhuan Yang, Xiuwen Wang, Hassan Mohamed, Shaoqi Li, Chen Wu, Wenyue Shi, Futing Xue, Sergio López-García, Yuanda Song. Homologous and Heterologous Expression of Delta(12)-Desaturase in Mucor circinelloides Enhanced the Production of Linolenic Acid.
Molecules (Basel, Switzerland).
2022 Aug; 27(17):. doi:
10.3390/molecules27175511
. [PMID: 36080278] - Gustaf E Degen. Under (stromal redox) pressure: NADP+ synthesis regulates photosystem I biogenesis.
Plant physiology.
2022 08; 189(4):1890-1892. doi:
10.1093/plphys/kiac235
. [PMID: 35762965]