S-Adenosyl-L-methionine (BioDeep_00000840349)
代谢物信息卡片
化学式: C15H23N6O5S+ (399.1450568)
中文名称:
谱图信息:
最多检出来源 Viridiplantae(plant) 10%
分子结构信息
SMILES: C[S+](CCC(C(=O)[O-])[NH3+])CC1C(C(C(O1)N2C=NC3=C(N=CN=C32)N)O)O
InChI: InChI=1S/C15H22N6O5S/c1-27(3-2-7(16)15(24)25)4-8-10(22)11(23)14(26-8)21-6-20-9-12(17)18-5-19-13(9)21/h5-8,10-11,14,22-23H,2-4,16H2,1H3,(H2-,17,18,19,24,25)/p+1/t7-,8+,10+,11+,14+,27?/m0/s1
描述信息
COVID info from COVID-19 Disease Map
Corona-virus
Coronavirus
SARS-CoV-2
COVID-19
SARS-CoV
COVID19
SARS2
SARS
同义名列表
1 个代谢物同义名
数据库引用编号
6 个数据库交叉引用编号
- ChEBI: CHEBI:142094
- ChEBI: CHEBI:142093
- ChEBI: CHEBI:59789
- PubChem: 24762165
- MeSH: S-Adenosylmethionine
- CAS: 139517-02-5
分类词条
相关代谢途径
Reactome(63)
- Metabolism
- Biological oxidations
- Metabolism of vitamins and cofactors
- Visual phototransduction
- Sensory Perception
- Metabolism of proteins
- Post-translational protein modification
- Gamma carboxylation, hypusinylation, hydroxylation, and arylsulfatase activation
- Disease
- Phase II - Conjugation of compounds
- Diseases of programmed cell death
- Defective pyroptosis
- Amino acid and derivative metabolism
- Glyoxylate metabolism and glycine degradation
- Drug ADME
- Metabolism of lipids
- Diseases of metabolism
- Transport of small molecules
- SLC-mediated transmembrane transport
- Metabolism of polyamines
- Developmental Biology
- Methylation
- DNA Repair
- Signaling Pathways
- Cell Cycle
- Cell Cycle, Mitotic
- M Phase
- Mitotic Prophase
- Condensation of Prophase Chromosomes
- Chromatin organization
- Chromatin modifying enzymes
- Maternal to zygotic transition (MZT)
- Transport of inorganic cations/anions and amino acids/oligopeptides
- Metabolism of water-soluble vitamins and cofactors
- Azathioprine ADME
- Cellular responses to stimuli
- Cellular responses to stress
- Gene expression (Transcription)
- RNA Polymerase II Transcription
- Generic Transcription Pathway
- Transcriptional Regulation by TP53
- Selenoamino acid metabolism
- Metabolism of ingested SeMet, Sec, MeSec into H2Se
- Histidine catabolism
- Phospholipid metabolism
- Glycerophospholipid biosynthesis
- Sulfur amino acid metabolism
- Neuronal System
- Transmission across Chemical Synapses
- Neurotransmitter clearance
- Clearance of dopamine
- Enzymatic degradation of dopamine by COMT
- Enzymatic degradation of Dopamine by monoamine oxidase
- Metabolism of RNA
- tRNA processing
- tRNA modification in the nucleus and cytosol
- Defects in vitamin and cofactor metabolism
- Metabolic disorders of biological oxidation enzymes
- Nicotinate metabolism
- Metabolism of amine-derived hormones
- Methylation of MeSeH for excretion
- Defective TPMT causes TPMT deficiency
- Nicotinamide salvaging
BioCyc(145)
- superpathway of L-methionine biosynthesis (transsulfuration)
- superpathway of L-homoserine and L-methionine biosynthesis
- L-methionine biosynthesis I
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis I
- superpathway of bacteriochlorophyll a biosynthesis
- superpathway of menaquinol-8 biosynthesis I
- superpathway of hyoscyamine and scopolamine biosynthesis
- superpathway of chorismate metabolism
- aspartate superpathway
- superpathway of betalain biosynthesis
- superpathway of S-adenosyl-L-methionine biosynthesis
- Amaryllidacea alkaloids biosynthesis
- plant sterol biosynthesis
- spinosyn A biosynthesis
- bacteriochlorophyll e biosynthesis
- superpathway of tryptophan utilization
- indolmycin biosynthesis
- gossypol biosynthesis
- shinorine biosynthesis
- bacteriochlorophyll c biosynthesis
- bacteriochlorophyll d biosynthesis
- spermidine biosynthesis III
- superpathway of polyamine biosynthesis I
- superpathway of arginine and polyamine biosynthesis
- nevadensin biosynthesis
- colchicine biosynthesis
- polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium)
- polymethylated quercetin glucoside biosynthesis II - quercetagetin series (Chrysosplenium)
- isoflavonoid biosynthesis II
- polymethylated kaempferol biosynthesis
- aflatoxins B1 and G1 biosynthesis
- acacetin biosynthesis
- kaempferide triglycoside biosynthesis
- superpathway of polymethylated quercetin/quercetagetin glucoside biosynthesis (Chrysosplenium)
- meleagrin biosynthesis
- superpathway of roquefortine, meleagrin and neoxaline biosynthesis
- ubiquinol-10 biosynthesis
- ubiquinol-10 biosynthesis (eukaryotic)
- ubiquinol-10 biosynthesis (prokaryotic)
- superpathway of nicotine biosynthesis
- berberine biosynthesis
- N-methyl-Δ1-pyrrolinium cation biosynthesis
- superpathway of proto- and siroheme biosynthesis
- phenolphthiocerol biosynthesis
- 6-methylpretetramide biosynthesis
- superpathway of tetracycline and oxytetracycline biosynthesis
- vindoline and vinblastine biosynthesis
- methylphosphonate degradation I
- methylphosphonate degradation II
- 3,8-divinyl-chlorophyllide a biosynthesis I (aerobic, light-dependent)
- 3,8-divinyl-chlorophyllide a biosynthesis II (anaerobic)
- 3,8-divinyl-chlorophyllide a biosynthesis III (aerobic, light independent)
- heme degradation V
- spheroidene and spheroidenone biosynthesis
- gadusol biosynthesis
- superpathway of L-lysine degradation
- L-lysine fermentation to acetate and butanoate
- superpathway of ergotamine biosynthesis
- glyphosate degradation III
- linear furanocoumarin biosynthesis
- p-HBAD biosynthesis
- scopoletin biosynthesis
- coumarins biosynthesis (engineered)
- esculetin modification
- superpathway of scopolin and esculin biosynthesis
- simple coumarins biosynthesis
- aflatoxins B2 and G2 biosynthesis
- superpathway of pterocarpan biosynthesis (via formononetin)
- salvigenin biosynthesis
- spermidine biosynthesis I
- polymethylated quercetin biosynthesis
- oleandomycin biosynthesis
- theobromine biosynthesis II (via xanthine)
- eupatolitin 3-O-glucoside biosynthesis
- juvenile hormone III biosynthesis I
- juvenile hormone III biosynthesis II
- spirilloxanthin and 2,2'-diketo-spirilloxanthin biosynthesis
- trigonelline biosynthesis
- factor 420 biosynthesis
- tetracycline and oxytetracycline biosynthesis
- superpathway of ergosterol biosynthesis I
- ergosterol biosynthesis I
- superpathway of ergosterol biosynthesis
- ergosterol biosynthesis
- volatile benzenoid biosynthesis I (ester formation)
- volatile cinnamoic ester biosynthesis
- ephedrine biosynthesis
- phenylpropanoid biosynthesis
- hopanoid biosynthesis (bacteria)
- secologanin and strictosidine biosynthesis
- homogalacturonan biosynthesis
- superpathway of heme b biosynthesis from uroporphyrinogen-III
- sanguinarine and macarpine biosynthesis
- (aminomethyl)phosphonate degradation
- methyl indole-3-acetate interconversion
- suberin monomers biosynthesis
- sakuranetin biosynthesis
- gliotoxin biosynthesis
- emetine biosynthesis
- vitexin and derivatives biosynthesis
- cephamycin C biosynthesis
- superpathway of rifamycin B biosynthesis
- novobiocin biosynthesis
- superpathway of penicillin, cephalosporin and cephamycin biosynthesis
- phosphinothricin tripeptide biosynthesis
- puromycin biosynthesis
- ubiquinol-8 biosynthesis (prokaryotic)
- superpathway of phylloquinol biosynthesis
- superpathway of ubiquinol-8 biosynthesis (prokaryotic)
- (S)-reticuline biosynthesis I
- superpathway of L-methionine salvage and degradation
- S-adenosyl-L-methionine cycle II
- epoxypseudoisoeugenol-2-methylbutanoate biosynthesis
- (+)-pisatin biosynthesis
- okenone biosynthesis
- isoflavonoid biosynthesis I
- formononetin biosynthesis
- fumitremorgin C biosynthesis
- superpathway of fumitremorgin biosynthesis
- t-anethole biosynthesis
- phylloquinol biosynthesis
- histamine degradation
- superpathway of benzoxazinoid glucosides biosynthesis
- 4'-methoxyviridicatin biosynthesis
- stipitatate biosynthesis
- pinitol biosynthesis I
- pinitol biosynthesis II
- γ-coniciene and coniine biosynthesis
- 7-dehydroporiferasterol biosynthesis
- L-methionine salvage cycle I (bacteria and plants)
- L-methionine salvage cycle II (plants)
- tetracenomycin C biosynthesis
- rebeccamycin biosynthesis
- superpathway of erythromycin biosynthesis
- superpathway of megalomicin A biosynthesis
- superpathway of erythromycin biosynthesis (without sugar biosynthesis)
- bixin biosynthesis
- superpathway of seleno-compound metabolism
- seleno-amino acid detoxification and volatilization I
- seleno-amino acid detoxification and volatilization II
- cyclopropane fatty acid (CFA) biosynthesis
- prodigiosin biosynthesis
- vestitol and sativan biosynthesis
- ajmaline and sarpagine biosynthesis
- sulfur volatiles biosynthesis
PlantCyc(76)
- superpathway of hyoscyamine and scopolamine biosynthesis
- superpathway of betalain biosynthesis
- superpathway of isoflavonoids (via naringenin)
- gossypol biosynthesis
- hesperitin glycoside biosynthesis
- superpathway of hyoscyamine (atropine) and scopolamine biosynthesis
- nevadensin biosynthesis
- colchicine biosynthesis
- polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium)
- polymethylated kaempferol biosynthesis
- polymethylated quercetin glucoside biosynthesis II - quercetagetin series (Chrysosplenium)
- kaempferide triglycoside biosynthesis
- superpathway of polymethylated quercetin/quercetagetin glucoside biosynthesis (Chrysosplenium)
- ajmaline and sarpagine biosynthesis
- phytosterol biosynthesis (plants)
- pinobanksin biosynthesis
- ubiquinol-10 biosynthesis (eukaryotic)
- ubiquinol-10 biosynthesis (late decarboxylation)
- superpathway of proto- and siroheme biosynthesis
- N-methyl-Δ1-pyrrolinium cation biosynthesis
- superpathway of nicotine biosynthesis
- berberine biosynthesis
- 3,8-divinyl-chlorophyllide a biosynthesis III (aerobic, light independent)
- vindoline, vindorosine and vinblastine biosynthesis
- capsaicin biosynthesis
- linear furanocoumarin biosynthesis
- simple coumarins biosynthesis
- simplecoumarins biosynthesis
- scopoletin biosynthesis
- coumarins biosynthesis (engineered)
- esculetin modification
- superpathway of scopolin and esculin biosynthesis
- superpathway of pterocarpan biosynthesis (via formononetin)
- salvigenin biosynthesis
- superpathway of flavones and derivatives biosynthesis
- polymethylated quercetin biosynthesis
- eupatolitin 3-O-glucoside biosynthesis
- juvenile hormone III biosynthesis I
- trigonelline biosynthesis
- ephedrine biosynthesis
- volatile benzenoid biosynthesis I (ester formation)
- volatile cinnamoic ester biosynthesis
- syringetin biosynthesis
- phenylpropanoid biosynthesis
- methyl indole-3-acetate interconversion
- sakuranetin biosynthesis
- superpathway of phylloquinol biosynthesis
- vitexin and derivatives biosynthesis
- (S)-reticuline biosynthesis I
- suberin monomers biosynthesis
- S-adenosyl-L-methionine cycle II
- palmatine biosynthesis
- superpathway of phospholipid biosynthesis II (plants)
- sanguinarine and macarpine biosynthesis
- homogalacturonan biosynthesis
- emetine biosynthesis
- superpathway of seleno-compound metabolism
- epoxypseudoisoeugenol-2-methylbutanoate biosynthesis
- S-adenosyl-L-methionine salvage II
- guaiacol biosynthesis
- t-anethole biosynthesis
- superpathway of benzoxazinoid glucosides biosynthesis
- Amaryllidacea alkaloids biosynthesis
- pinitol biosynthesis II
- pinitol biosynthesis I
- L-methionine salvage cycle II (plants)
- L-methionine salvage cycle I (bacteria and plants)
- isoflavonoid biosynthesis I
- phylloquinol biosynthesis
- bixin biosynthesis
- seleno-amino acid detoxification and volatilization I
- seleno-amino acid detoxification and volatilization II
- botryococcenes and methylated squalene biosynthesis
- formononetin biosynthesis
- vestitol and sativan biosynthesis
- sulfur volatiles biosynthesis
代谢反应
7421 个相关的代谢反应过程信息。
Reactome(383)
- Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Creatine metabolism:
GAA + SAM ⟶ CRET + H+ + SAH
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Creatine metabolism:
ATP + CRET ⟶ ADP + Pcr
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Creatine metabolism:
GAA + SAM ⟶ CRET + H+ + SAH
- Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Creatine metabolism:
GAA + SAM ⟶ CRET + H+ + SAH
- Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Creatine metabolism:
GAA + SAM ⟶ CRET + H+ + SAH
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Creatine metabolism:
GAA + SAM ⟶ CRET + H+ + SAH
- Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Creatine metabolism:
GAA + SAM ⟶ CRET + H+ + SAH
- Metabolism:
CAR + propionyl CoA ⟶ CoA-SH + Propionylcarnitine
- Amino acid and derivative metabolism:
GAA + SAM ⟶ CRET + H+ + SAH
- Metabolism:
GAA + SAM ⟶ CRET + H+ + SAH
- Amino acid and derivative metabolism:
GAA + SAM ⟶ CRET + H+ + SAH
- Creatine metabolism:
GAA + SAM ⟶ CRET + H+ + SAH
- Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Creatine metabolism:
GAA + SAM ⟶ CRET + H+ + SAH
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Creatine metabolism:
GAA + SAM ⟶ CRET + H+ + SAH
- Creatine metabolism:
GAA + SAM ⟶ CRET + H+ + SAH
- Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Gamma carboxylation, hypusine formation and arylsulfatase activation:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Synthesis of diphthamide-EEF2:
Q3SYU2 + SAM ⟶ Q3SYU2 + SAH
- Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Gamma carboxylation, hypusine formation and arylsulfatase activation:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Synthesis of diphthamide-EEF2:
SAM + nascent EEF2 ⟶ MTAD + aminocarboxypropyl EEF2
- Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Gamma carboxylation, hypusine formation and arylsulfatase activation:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Synthesis of diphthamide-EEF2:
F6XRY2 + SAM ⟶ F6XRY2 + MTAD
- Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Gamma carboxylation, hypusine formation and arylsulfatase activation:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Synthesis of diphthamide-EEF2:
Homologues of nascent EEF2 + SAM ⟶ Homologues of aminocarboxypropyl EEF2 + MTAD
- Metabolism of proteins:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a
- Post-translational protein modification:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a
- Gamma carboxylation, hypusine formation and arylsulfatase activation:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a
- Synthesis of diphthamide-EEF2:
SAM + efbA ⟶ MTAD + efbA
- Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH + Q9GU68
- Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH + Q9GU68
- Gamma carboxylation, hypusine formation and arylsulfatase activation:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH + Q9GU68
- Synthesis of diphthamide-EEF2:
SAM + nascent EEF2 ⟶ MTAD + aminocarboxypropyl EEF2
- Metabolism of proteins:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Post-translational protein modification:
DOLP + UDP-GlcNAc ⟶ GlcNAcDOLDP + UMP
- Gamma carboxylation, hypusine formation and arylsulfatase activation:
A0A1D5NW08 + PAPS ⟶ A0A1D5NW08 + PAP
- Synthesis of diphthamide-EEF2:
A0A1D5PS29 + SAM ⟶ A0A1D5PS29 + MTAD
- Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Gamma carboxylation, hypusine formation and arylsulfatase activation:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Synthesis of diphthamide-EEF2:
SAM + nascent EEF2 ⟶ MTAD + aminocarboxypropyl EEF2
- Metabolism of RNA:
Editosome for C to U editing + H2O ⟶ C to U edited ApoB RNA:Editosome complex + ammonia
- rRNA processing:
SAM ⟶ SAH
- rRNA processing in the nucleus and cytosol:
SAM ⟶ SAH
- rRNA modification in the nucleus and cytosol:
SAM ⟶ SAH
- Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Gamma carboxylation, hypusine formation and arylsulfatase activation:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Synthesis of diphthamide-EEF2:
SAM + nascent EEF2 ⟶ MTAD + aminocarboxypropyl EEF2
- Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Gamma carboxylation, hypusine formation and arylsulfatase activation:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Synthesis of diphthamide-EEF2:
Q8IKW5 + SAM ⟶ MTAD + Q8IKW5
- Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Gamma carboxylation, hypusine formation and arylsulfatase activation:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Synthesis of diphthamide-EEF2:
SAM + nascent EEF2 ⟶ MTAD + aminocarboxypropyl EEF2
- Metabolism of proteins:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Post-translational protein modification:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Gamma carboxylation, hypusine formation and arylsulfatase activation:
NAD + SPM ⟶ 1,3-diaminopropane + H+ + NADH
- Synthesis of diphthamide-EEF2:
SAM + nascent EEF2 ⟶ MTAD + aminocarboxypropyl EEF2
- Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Gamma carboxylation, hypusine formation and arylsulfatase activation:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Synthesis of diphthamide-EEF2:
I3LII3 + SAM ⟶ I3LII3 + SAH
- Metabolism of proteins:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a
- Post-translational protein modification:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a
- Gamma carboxylation, hypusine formation and arylsulfatase activation:
NAD + SPM + eif5a ⟶ 1,3-diaminopropane + H+ + NADH + eif5a
- Synthesis of diphthamide-EEF2:
A0A6I8QPT9 + SAM ⟶ A0A6I8QPT9 + SAH
- Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP
- Methylation:
6MMP + H+ + Oxygen + TPNH ⟶ 6MP + CH2O + H2O + TPN
- Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP
- Methylation:
H2O + SAH ⟶ Ade-Rib + HCYS
- Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP
- Methylation:
H2O + SAH ⟶ Ade-Rib + HCYS
- Metabolism:
ATP + PROP-CoA + carbon dioxide ⟶ ADP + MEMA-CoA + Pi
- Biological oxidations:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + SAH ⟶ Ade-Rib + HCYS
- Methylation:
H2O + SAH ⟶ Ade-Rib + HCYS
- Biological oxidations:
H+ + Oxygen + TPNH + progesterone ⟶ 11DCORST + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP
- Methylation:
H2O + SAH ⟶ Ade-Rib + HCYS
- Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP
- Methylation:
H2O + SAH ⟶ Ade-Rib + HCYS
- Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP
- Methylation:
H2O + SAH ⟶ Ade-Rib + HCYS
- Metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP
- Methylation:
H2O + SAH ⟶ Ade-Rib + HCYS
- Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Phase II - Conjugation of compounds:
PAPS + beta-estradiol ⟶ E2-SO4 + PAP
- Methylation:
6MMP + H+ + Oxygen + TPNH ⟶ 6MP + CH2O + H2O + TPN
- Biological oxidations:
11DCORT + H+ + Oxygen + TPNH ⟶ CORT + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + PNPB ⟶ BUT + PNP
- Methylation:
6MMP + H+ + Oxygen + TPNH ⟶ 6MP + CH2O + H2O + TPN
- Biological oxidations:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Phase II - Conjugation of compounds:
H2O + SAH ⟶ Ade-Rib + HCYS
- Methylation:
H2O + SAH ⟶ Ade-Rib + HCYS
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Cobalamin (Cbl, vitamin B12) transport and metabolism:
ATP + B12s ⟶ AdoCbl + PPP
- Metabolism:
3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-one-CoA + CoA-SH ⟶ choloyl-CoA + propionyl CoA
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Cobalamin (Cbl, vitamin B12) transport and metabolism:
ATP + B12s ⟶ AdoCbl + PPP
- Metabolism of vitamins and cofactors:
6x(PCCA:PCCB) + ATP + Btn ⟶ 6x(Btn-PCCA:PCCB) + AMP + PPi
- Metabolism of water-soluble vitamins and cofactors:
6x(PCCA:PCCB) + ATP + Btn ⟶ 6x(Btn-PCCA:PCCB) + AMP + PPi
- Cobalamin (Cbl, vitamin B12) transport and metabolism:
ATP + B12s ⟶ AdoCbl + PPP
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Cobalamin (Cbl, vitamin B12) transport and metabolism:
ATP + B12s ⟶ AdoCbl + PPP
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Cobalamin (Cbl, vitamin B12) transport and metabolism:
ATP + B12s ⟶ AdoCbl + PPP
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Cobalamin (Cbl, vitamin B12) transport and metabolism:
B12r + NADH ⟶ B12s + H+ + NAD
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Cobalamin (Cbl, vitamin B12) transport and metabolism:
ATP + B12s ⟶ AdoCbl + PPP
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Cobalamin (Cbl, vitamin B12) transport and metabolism:
ATP + B12s ⟶ AdoCbl + PPP
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Cobalamin (Cbl, vitamin B12) transport and metabolism:
ATP + B12s ⟶ AdoCbl + PPP
- Cobalamin (Cbl) metabolism:
H+ + MMACHC:cob(I)alamin + NAD ⟶ MMACHC:cob(II)alamin + NADH
- Cobalamin (Cbl) metabolism:
H+ + MMACHC:cob(I)alamin + NAD ⟶ MMACHC:cob(II)alamin + NADH
- Cobalamin (Cbl) metabolism:
H+ + MMACHC:cob(I)alamin + NAD ⟶ MMACHC:cob(II)alamin + NADH
- Cobalamin (Cbl) metabolism:
H+ + MMACHC:cob(I)alamin + NAD ⟶ MMACHC:cob(II)alamin + NADH
- Cobalamin (Cbl) metabolism:
H+ + MMACHC:cob(I)alamin + NAD ⟶ MMACHC:cob(II)alamin + NADH
- Cobalamin (Cbl) metabolism:
H+ + MMACHC:cob(I)alamin + NAD ⟶ MMACHC:cob(II)alamin + NADH
- Cobalamin (Cbl) metabolism:
H+ + MMACHC:cob(I)alamin + NAD ⟶ MMACHC:cob(II)alamin + NADH
- Cobalamin (Cbl) metabolism:
H+ + MMACHC:cob(I)alamin + NAD ⟶ MMACHC:cob(II)alamin + NADH
- Cobalamin (Cbl) metabolism:
H+ + MMACHC:cob(I)alamin + NAD ⟶ MMACHC:cob(II)alamin + NADH
- Signaling Pathways:
ADORA2A,B + Ade-Rib ⟶ ADORA2A,B:Ade-Rib
- MAPK family signaling cascades:
PALM-CoA + S-Farn-Me RAS ⟶ CoA-SH + S-Farn-Me PalmS KRAS4A,HRAS, NRAS
- ERK1/ERK2 pathway:
PALM-CoA + S-Farn-Me RAS ⟶ CoA-SH + S-Farn-Me PalmS KRAS4A,HRAS, NRAS
- RAF/MAP kinase cascade:
PALM-CoA + S-Farn-Me RAS ⟶ CoA-SH + S-Farn-Me PalmS KRAS4A,HRAS, NRAS
- Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- MAPK family signaling cascades:
ATP + S-Farn-Me KRAS4B ⟶ ADP + pS181-S-Farn-Me KRAS4B
- ERK1/ERK2 pathway:
ATP + S-Farn-Me KRAS4B ⟶ ADP + pS181-S-Farn-Me KRAS4B
- RAF/MAP kinase cascade:
ATP + S-Farn-Me KRAS4B ⟶ ADP + pS181-S-Farn-Me KRAS4B
- Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- MAPK family signaling cascades:
ATP + kras ⟶ A0A2R8Q8S1 + ADP
- ERK1/ERK2 pathway:
ATP + kras ⟶ A0A2R8Q8S1 + ADP
- RAF/MAP kinase cascade:
ATP + kras ⟶ A0A2R8Q8S1 + ADP
- Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- MAPK family signaling cascades:
ATP + Ras85D ⟶ ADP + phospho-Ras85D
- ERK1/ERK2 pathway:
ATP + Ras85D ⟶ ADP + phospho-Ras85D
- RAF/MAP kinase cascade:
ATP + Ras85D ⟶ ADP + phospho-Ras85D
- Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- MAPK family signaling cascades:
ATP + KRAS ⟶ A0A1D5PT95 + ADP
- ERK1/ERK2 pathway:
ATP + KRAS ⟶ A0A1D5PT95 + ADP
- RAF/MAP kinase cascade:
ATP + KRAS ⟶ A0A1D5PT95 + ADP
- Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- MAPK family signaling cascades:
ATP + Ki-Ras ⟶ ADP + Ki-Ras
- ERK1/ERK2 pathway:
ATP + Ki-Ras ⟶ ADP + Ki-Ras
- RAF/MAP kinase cascade:
ATP + Ki-Ras ⟶ ADP + Ki-Ras
- Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- MAPK family signaling cascades:
ATP + Kras ⟶ ADP + phospho-Kras
- ERK1/ERK2 pathway:
ATP + Kras ⟶ ADP + phospho-Kras
- RAF/MAP kinase cascade:
ATP + Kras ⟶ ADP + phospho-Kras
- Metabolism of proteins:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Post-translational protein modification:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Gamma carboxylation, hypusine formation and arylsulfatase activation:
EIF5A + NAD + SPM ⟶ 1,3-diaminopropane + EIF5A(Dhp) + H+ + NADH
- Signaling Pathways:
AcK685- p-Y705,S727-STAT3 dimer + H2O ⟶ CH3COO- + p-Y705,S727-STAT3 dimer
- MAPK family signaling cascades:
ATP + Kras ⟶ ADP + phospho-Kras
- ERK1/ERK2 pathway:
ATP + Kras ⟶ ADP + phospho-Kras
- RAF/MAP kinase cascade:
ATP + Kras ⟶ ADP + phospho-Kras
- RAS processing:
ATP + S-Farn-Me KRAS4B ⟶ ADP + pS181-S-Farn-Me KRAS4B
- RAS processing:
ATP + kras ⟶ A0A2R8Q8S1 + ADP
- RAS processing:
ATP + KRAS ⟶ A0A1D5PT95 + ADP
- RAS processing:
ATP + Kras ⟶ ADP + phospho-Kras
- RAS processing:
PALM-CoA + S-Farn-Me RAS ⟶ CoA-SH + S-Farn-Me PalmS KRAS4A,HRAS, NRAS
- RAS processing:
ATP + Ras85D ⟶ ADP + phospho-Ras85D
- RAS processing:
ATP + Kras ⟶ ADP + phospho-Kras
- RAS processing:
ATP + Ki-Ras ⟶ ADP + Ki-Ras
- Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH
- Nicotinamide salvaging:
NAM + SAM ⟶ MNA + SAH
- Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH
- Nicotinamide salvaging:
NAM + SAM ⟶ MNA + SAH
- Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH
- Nicotinamide salvaging:
NAM + SAM ⟶ MNA + SAH
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH
- Nicotinamide salvaging:
NAM + SAM ⟶ MNA + SAH
- Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH
- Nicotinamide salvaging:
NAM + SAM ⟶ MNA + SAH
- Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH
- Nicotinamide salvaging:
NAM + SAM ⟶ MNA + SAH
- Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH
- Nicotinamide salvaging:
NAM + SAM ⟶ MNA + SAH
- Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH
- Nicotinamide salvaging:
NAM + SAM ⟶ MNA + SAH
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Nicotinate metabolism:
NAM + SAM ⟶ MNA + SAH
- Nicotinamide salvaging:
NAM + SAM ⟶ MNA + SAH
- Biological oxidations:
H+ + Oxygen + TPNH + aflatoxin B1 ⟶ AFXBO + H2O + TPN
- Phase II - Conjugation of compounds:
H2O + SAH ⟶ Ade-Rib + HCYS
- Methylation:
H2O + SAH ⟶ Ade-Rib + HCYS
- Selenoamino acid metabolism:
H2O + SeMet ⟶ 2OBUTA + MeSeH + ammonia
- Formation of selenosugars for excretion:
MeSebGalNac ⟶ 2-acetamidoglucal + MeSeO2H
- Metabolism:
1-3-oxo-THA-CoA + CoA-SH ⟶ DHA-CoA + propionyl CoA
- Biological oxidations:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Phase II - Conjugation of compounds:
H2O + SAH ⟶ Ade-Rib + HCYS
- Methylation:
H2O + SAH ⟶ Ade-Rib + HCYS
- Biological oxidations:
ATP + CH3COO- + CoA-SH ⟶ AMP + Ac-CoA + PPi
- Phase II - Conjugation of compounds:
ATP + Gly + gGluCys ⟶ ADP + GSH + Pi
- Methylation:
3,4DHBNZ + SAM ⟶ 3H,4MBNZ + SAH
- Biological oxidations:
CH3CHO + H2O + NAD ⟶ CH3COO- + H+ + NADH
- Phase II - Conjugation of compounds:
H2O + SAH ⟶ Ade-Rib + HCYS
- Methylation:
H2O + SAH ⟶ Ade-Rib + HCYS
- Metabolism of amine-derived hormones:
Iodine + L-Tyr ⟶ HI + MIT
- Serotonin and melatonin biosynthesis:
5HT + Ac-CoA ⟶ Ac5HT + CoA-SH
- Metabolism of amine-derived hormones:
Iodine + L-Tyr ⟶ HI + MIT
- Serotonin and melatonin biosynthesis:
5HTP ⟶ 5HT + carbon dioxide
- Metabolism of amine-derived hormones:
MIT + TPNH ⟶ I- + L-Tyr + TPN
- Serotonin and melatonin biosynthesis:
5HTP ⟶ 5HT + carbon dioxide
- Amino acid and derivative metabolism:
2MACA-CoA + CoA ⟶ Ac-CoA + PROP-CoA
- Metabolism of amine-derived hormones:
Iodine + L-Tyr ⟶ HI + MIT
- Serotonin and melatonin biosynthesis:
L-Trp + Oxygen + Tetrahydrobiopterin ⟶ 4aOH-BH4 + 5HTP
- Metabolism of amine-derived hormones:
Iodine + L-Tyr ⟶ HI + MIT
- Serotonin and melatonin biosynthesis:
5HTP ⟶ 5HT + carbon dioxide
- Metabolism of amine-derived hormones:
Iodine + L-Tyr ⟶ HI + MIT
- Serotonin and melatonin biosynthesis:
5HTP ⟶ 5HT + carbon dioxide
- Metabolism of amine-derived hormones:
Iodine + L-Tyr ⟶ HI + MIT
- Serotonin and melatonin biosynthesis:
5HTP ⟶ 5HT + carbon dioxide
- Metabolism of amine-derived hormones:
Iodine + L-Tyr ⟶ HI + MIT
- Serotonin and melatonin biosynthesis:
5HTP ⟶ 5HT + carbon dioxide
- Metabolism of amine-derived hormones:
Iodine + L-Tyr ⟶ HI + MIT
- Serotonin and melatonin biosynthesis:
5HTP ⟶ 5HT + carbon dioxide
- Metabolism of amine-derived hormones:
NAd + SAM ⟶ ADR + H+ + SAH
- Serotonin and melatonin biosynthesis:
5HT + Ac-CoA ⟶ Ac5HT + CoA-SH
- Protein repair:
R-MetO + TXN ⟶ G8JKZ8 + L-Met
- Protein repair:
R-MetO + TXN ⟶ 2xHC-TXN + L-Met
- Protein repair:
R-MetO + TXN ⟶ J9NWJ5 + L-Met
- Protein repair:
Homologues of TXN + R-MetO ⟶ Homologues of 2xHC-TXN + L-Met
- Protein repair:
SAM + isoAsp ⟶ MetAsp + SAH
- Protein repair:
R-MetO + TXN ⟶ L-Met + Q9V429
- Protein repair:
R-MetO + TXN ⟶ L-Met + TXN
- Protein repair:
H2O2 + L-Met ⟶ H2O + MetO
- Protein repair:
R-MetO + Txn ⟶ L-Met + Txn
- Protein repair:
SAM + isoAsp ⟶ MetAsp + SAH
- Protein repair:
R-MetO + Txn ⟶ L-Met + Txn
- Protein repair:
SAM + isoAsp ⟶ MetAsp + SAH
- Protein repair:
Homologues of TXN + R-MetO ⟶ Homologues of 2xHC-TXN + L-Met
- Protein repair:
R-MetO + TXN ⟶ F6ZMN7 + L-Met
- Enzymatic degradation of dopamine by COMT:
DA + SAM ⟶ 3MT + SAH
- Metabolism of ingested SeMet, Sec, MeSec into H2Se:
H2O + SeMet ⟶ 2OBUTA + MeSeH + ammonia
- Enzymatic degradation of Dopamine by monoamine oxidase:
DOPAC + SAM ⟶ HCYS + HVA
- Gene expression (Transcription):
Ac-K94,K171-RUNX3:CBFB:BRD2:CCND1:HDAC4 + H2O ⟶ BRD2 homodimer + CH3COO- + RUNX3:CBFB:CCND1:HDAC4
- Epigenetic regulation of gene expression:
Chromatin (H4K5ac, H4K8ac, H4K16ac) + SAM ⟶ CH3COO- + Chromatin (H3K9me2) + SAH
- Negative epigenetic regulation of rRNA expression:
Chromatin (H4K5ac, H4K8ac, H4K16ac) + SAM ⟶ CH3COO- + Chromatin (H3K9me2) + SAH
- NoRC negatively regulates rRNA expression:
Chromatin (H4K5ac, H4K8ac, H4K16ac) + SAM ⟶ CH3COO- + Chromatin (H3K9me2) + SAH
- Histidine catabolism:
ATP + L-His + b-Ala ⟶ ADP + CARN + Pi
- Drug ADME:
APAP + UDP-GlcA ⟶ APAP-GlcA + UDP
- Azathioprine ADME:
6MP + H2O + NAD ⟶ 6TU + H+ + NADH
- Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic
- Azathioprine ADME:
6MP + H2O + NAD ⟶ 6TU + H+ + NADH
- Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic
- Azathioprine ADME:
6MP + H2O + NAD ⟶ 6TU + H+ + NADH
- Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic
- Azathioprine ADME:
6MP + H2O + NAD ⟶ 6TU + H+ + NADH
- Drug ADME:
AMP + abacavir ⟶ Ade-Rib + xenobiotic
- Azathioprine ADME:
6MP + H2O + NAD ⟶ 6TU + H+ + NADH
- Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic
- Azathioprine ADME:
6MP + H2O + NAD ⟶ 6TU + H+ + NADH
- Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic
- Azathioprine ADME:
6MP + H2O + NAD ⟶ 6TU + H+ + NADH
- Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic
- Azathioprine ADME:
6MP + H2O + NAD ⟶ 6TU + H+ + NADH
- Drug ADME:
IMP + carbovir ⟶ Ino + xenobiotic
- Azathioprine ADME:
6MP + H2O + NAD ⟶ 6TU + H+ + NADH
- Neuronal System:
DA + SAM ⟶ 3MT + SAH
- Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH
- Neurotransmitter clearance:
DA + SAM ⟶ 3MT + SAH
- Clearance of dopamine:
DA + SAM ⟶ 3MT + SAH
- Enzymatic degradation of dopamine by COMT:
DA + SAM ⟶ 3MT + SAH
- Neuronal System:
DA + SAM ⟶ 3MT + SAH
- Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH
- Neurotransmitter clearance:
DA + SAM ⟶ 3MT + SAH
- Clearance of dopamine:
DA + SAM ⟶ 3MT + SAH
- Enzymatic degradation of dopamine by COMT:
DA + SAM ⟶ 3MT + SAH
- Neuronal System:
DA + SAM ⟶ 3MT + SAH
- Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH
- Neurotransmitter clearance:
DA + SAM ⟶ 3MT + SAH
- Clearance of dopamine:
DA + SAM ⟶ 3MT + SAH
- Enzymatic degradation of dopamine by COMT:
DA + SAM ⟶ 3MT + SAH
- Neuronal System:
DA + SAM ⟶ 3MT + SAH
- Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH
- Neurotransmitter clearance:
DA + SAM ⟶ 3MT + SAH
- Clearance of dopamine:
DA + SAM ⟶ 3MT + SAH
- Enzymatic degradation of dopamine by COMT:
DA + SAM ⟶ 3MT + SAH
- Neuronal System:
DA + SAM ⟶ 3MT + SAH
- Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH
- Neurotransmitter clearance:
DA + SAM ⟶ 3MT + SAH
- Clearance of dopamine:
DA + SAM ⟶ 3MT + SAH
- Enzymatic degradation of dopamine by COMT:
DA + SAM ⟶ 3MT + SAH
- Neuronal System:
DA + SAM ⟶ 3MT + SAH
- Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH
- Neurotransmitter clearance:
DA + SAM ⟶ 3MT + SAH
- Clearance of dopamine:
DA + SAM ⟶ 3MT + SAH
- Enzymatic degradation of dopamine by COMT:
DA + SAM ⟶ 3MT + SAH
- Neuronal System:
DA + SAM ⟶ 3MT + SAH
- Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH
- Neurotransmitter clearance:
DA + SAM ⟶ 3MT + SAH
- Clearance of dopamine:
DA + SAM ⟶ 3MT + SAH
- Enzymatic degradation of dopamine by COMT:
DA + SAM ⟶ 3MT + SAH
- Neuronal System:
DA + SAM ⟶ 3MT + SAH
- Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH
- Neurotransmitter clearance:
DA + SAM ⟶ 3MT + SAH
- Clearance of dopamine:
DA + SAM ⟶ 3MT + SAH
- Enzymatic degradation of dopamine by COMT:
DA + SAM ⟶ 3MT + SAH
- Neuronal System:
DA + SAM ⟶ 3MT + SAH
- Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH
- Neurotransmitter clearance:
DA + SAM ⟶ 3MT + SAH
- Clearance of dopamine:
DA + SAM ⟶ 3MT + SAH
- Enzymatic degradation of dopamine by COMT:
DA + SAM ⟶ 3MT + SAH
- Neuronal System:
DA + SAM ⟶ 3MT + SAH
- Transmission across Chemical Synapses:
DA + SAM ⟶ 3MT + SAH
- Neurotransmitter clearance:
DA + SAM ⟶ 3MT + SAH
- Clearance of dopamine:
DA + SAM ⟶ 3MT + SAH
- Enzymatic degradation of dopamine by COMT:
DA + SAM ⟶ 3MT + SAH
- Enzymatic degradation of Dopamine by monoamine oxidase:
DA + H2O + Oxygen ⟶ DOPAC + H2O2 + ammonia
- Enzymatic degradation of Dopamine by monoamine oxidase:
DA + H2O + Oxygen ⟶ DOPAC + H2O2 + ammonia
- Enzymatic degradation of Dopamine by monoamine oxidase:
DOPAC + SAM ⟶ HCYS + HVA
- Enzymatic degradation of Dopamine by monoamine oxidase:
DA + H2O + Oxygen ⟶ DOPAC + H2O2 + ammonia
- Enzymatic degradation of Dopamine by monoamine oxidase:
DA + H2O + Oxygen ⟶ DOPAC + H2O2 + ammonia
- Enzymatic degradation of Dopamine by monoamine oxidase:
DA + H2O + Oxygen ⟶ DOPAC + H2O2 + ammonia
- Enzymatic degradation of Dopamine by monoamine oxidase:
DA + H2O + Oxygen ⟶ DOPAC + H2O2 + ammonia
- Enzymatic degradation of Dopamine by monoamine oxidase:
DOPAC + SAM ⟶ HCYS + HVA
- Enzymatic degradation of Dopamine by monoamine oxidase:
DA + H2O + Oxygen ⟶ 5HT-N-CH3 + ammonia
- Enzymatic degradation of Dopamine by monoamine oxidase:
DOPAC + SAM ⟶ HCYS + HVA
- Methylation of MeSeH for excretion:
MeSeH + SAM ⟶ Me2Se + SAH
- Molybdenum cofactor biosynthesis:
L-Cys + MOCS3:Zn2+ (red.) ⟶ L-Ala + MOCS3-S-S(1-):Zn2+
- Molybdenum cofactor biosynthesis:
L-Cys + MOCS3:Zn2+ (red.) ⟶ L-Ala + MOCS3-S-S(1-):Zn2+
- Molybdenum cofactor biosynthesis:
L-Cys + MOCS3:Zn2+ (red.) ⟶ L-Ala + MOCS3-S-S(1-):Zn2+
- Molybdenum cofactor biosynthesis:
L-Cys + MOCS3:Zn2+ (red.) ⟶ L-Ala + MOCS3-S-S(1-):Zn2+
- Metabolism of vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Metabolism of water-soluble vitamins and cofactors:
H2O + Oxygen + PXL ⟶ H2O2 + PDXate
- Molybdenum cofactor biosynthesis:
L-Cys + MOCS3:Zn2+ (red.) ⟶ L-Ala + MOCS3-S-S(1-):Zn2+
- Molybdenum cofactor biosynthesis:
L-Cys + MOCS3:Zn2+ (red.) ⟶ L-Ala + MOCS3-S-S(1-):Zn2+
- Molybdenum cofactor biosynthesis:
L-Cys + MOCS3:Zn2+ (red.) ⟶ L-Ala + MOCS3-S-S(1-):Zn2+
- Molybdenum cofactor biosynthesis:
L-Cys + MOCS3:Zn2+ (red.) ⟶ L-Ala + MOCS3-S-S(1-):Zn2+
- Molybdenum cofactor biosynthesis:
L-Cys + MOCS3:Zn2+ (red.) ⟶ L-Ala + MOCS3-S-S(1-):Zn2+
- Molybdenum cofactor biosynthesis:
L-Cys + MOCS3:Zn2+ (red.) ⟶ L-Ala + MOCS3-S-S(1-):Zn2+
- Molybdenum cofactor biosynthesis:
L-Cys + MOCS3:Zn2+ (red.) ⟶ L-Ala + MOCS3-S-S(1-):Zn2+
- Disease:
ADORA2B + Ade-Rib ⟶ ADORA2B:Ade-Rib
- Diseases of programmed cell death:
SAM ⟶ SAH
- Defective pyroptosis:
SAM ⟶ SAH
BioCyc(335)
- hopanoid biosynthesis (bacteria):
SAM + methylcob(III)alamin + tetrahymanol ⟶ 2-methyltetrahymanol + 5'-deoxyadenosine + cob(III)alamin + met
- β-alanine betaine biosynthesis:
N,N-dimethyl-β-alanine + SAM ⟶ β-alanine betaine + H+ + SAH
- β-alanine betaine biosynthesis:
N,N-dimethyl-β-alanine + SAM ⟶ β-alanine betaine + H+ + SAH
- β-alanine betaine biosynthesis:
β-alanine + SAM ⟶ H+ + N-methyl-β-alanine + SAH
- arctigenin and isoarctigenin biosynthesis:
(-)-matairesinol + SAM ⟶ H+ + SAH + arctigenin
- elloramycin biosynthesis:
8-demethyl-8-(2-O-methyl-α-L-rhamnosyl)-tetracenomycin C + SAM ⟶ 8-demethyl-8-(2,3-O-dimethyl-α-L-rhamnosyl)-tetracenomycin C + H+ + SAH
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- sanguinarine and macarpine biosynthesis:
S-stylopine + SAM ⟶ (S)-cis-N-methylstylopine + SAH
- sanguinarine and macarpine biosynthesis:
H+ + NADPH + O2 + S-cheilanthifoline ⟶ H2O + NADP+ + S-stylopine
- mithramycin biosynthesis:
dTDP-α-D-olivose + premithramycin A3 ⟶ 3A-deolivosylpremithramycin B + H+ + dTDP
- Amaryllidacea alkaloids biosynthesis:
4'-O-methylnorbelladine + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (4aS,10bR)-noroxomaritidine + H2O + an oxidized [NADPH-hemoprotein reductase]
- phylloquinol biosynthesis:
SAM + demethylphylloquinol ⟶ H+ + SAH + phylloquinol
- superpathway of phylloquinol biosynthesis:
SAM + demethylphylloquinol ⟶ H+ + SAH + phylloquinol
- bacteriochlorophyll e biosynthesis:
(31R)-8-ethyl-12-methylbacteriochlorophyllide d ⟶ 8-ethyl-12-methyl-3-vinylbacteriochlorophyllide d + H2O
- bacteriochlorophyll c biosynthesis:
(31R)-8-ethyl-12-methylbacteriochlorophyllide d ⟶ 8-ethyl-12-methyl-3-vinylbacteriochlorophyllide d + H2O
- bacteriochlorophyll d biosynthesis:
(31R)-8-ethyl-12-methylbacteriochlorophyllide d ⟶ 8-ethyl-12-methyl-3-vinylbacteriochlorophyllide d + H2O
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
5-hydroxy-coniferaldehyde + SAM ⟶ H+ + SAH + sinapaldehyde
- phenylpropanoid biosynthesis:
5-hydroxy-coniferaldehyde + SAM ⟶ H+ + SAH + sinapaldehyde
- ferulate and sinapate biosynthesis:
5-hydroxy-coniferaldehyde + SAM ⟶ H+ + SAH + sinapaldehyde
- t-anethole biosynthesis:
trans-anol + SAM ⟶ t-anethole + H+ + SAH
- epoxypseudoisoeugenol-2-methylbutanoate biosynthesis:
2-methylbutanoate + pseudoisoeugenol ⟶ epoxypseudoisoeugenol-2-methylbutanoate
- botryococcenes and methylated squalene biosynthesis:
SAM + showacene ⟶ 3,20-dimethyl-1,2,21,22-tetradehydro-2,3,20,21-tetrahydrobotryococcene + H+ + SAH
- dimethyl sulfide biosynthesis from methionine:
SAM + methanethiol ⟶ H+ + SAH + dimethyl sulfide
- coniferyl alcohol 9-methyl ester biosynthesis:
SAM + coniferyl alcohol ⟶ H+ + SAH + coniferyl alcohol 9-methyl ester
- nevadensin biosynthesis:
2-oxoglutarate + O2 + gardenin B ⟶ CO2 + formaldehyde + nevadensin + succinate
- prodigiosin biosynthesis:
2-methyl-3-pentyl-1H-pyrrole + 4-methoxy-2,2'-bipyrrole-5-carbaldehyde + ATP ⟶ ADP + H+ + phosphate + prodigiosin
- esculetin modification:
SAM + esculetin ⟶ H+ + SAH + scopoletin
- superpathway of scopolin and esculin biosynthesis:
(Z)-6'-hydroxyferulate ⟶ scopoletin
- superpathway of scopolin and esculin biosynthesis:
SAM + esculetin ⟶ H+ + SAH + scopoletin
- simple coumarins biosynthesis:
scopoletin ⟶ a demethylated methyl donor + scoparone
- colchicine biosynthesis:
O-methylandrocymbine + O2 ⟶ H2O + N-formyldemecolcine
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + H+ + HMP-P + carbon monoxide + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + H+ + HMP-P + carbon monoxide + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + H+ + HMP-P + carbon monoxide + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + H+ + HMP-P + carbon monoxide + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + H+ + HMP-P + carbon monoxide + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + H+ + HMP-P + carbon monoxide + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + H+ + HMP-P + carbon monoxide + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + H+ + HMP-P + carbon monoxide + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- pinobanksin biosynthesis:
(2S)-pinocembrin + SAM ⟶ SAH + pinostrobin
- phosalacine biosynthesis:
N-acetylphosphinothricyl-L-alanyl-L-leucine + H2O ⟶ acetate + phosalacine
- 26,27-dehydrozymosterol metabolism:
26,27-dehydrozymosterol + H+ + MeOH + SAM ⟶ 26-hydroxy-27-methyl-zymosterol + SAH + methyl
- aflatoxins B2 and G2 biosynthesis:
8-O-methyldihydrosterigmatocystin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ CO2 + H2O + MeOH + aflatoxin B2 + an oxidized [NADPH-hemoprotein reductase]
- rot-2'-enonate biosynthesis:
2',7-dihydroxy-4',5'-dimethoxyisoflavone + SAM ⟶ 7-hydroxy-2',4',5'-trimethoxyisoflavone + H+ + SAH
- emetine biosynthesis:
SAM + cephaeline ⟶ H+ + SAH + emetine
- polymethylated quercetin glucoside biosynthesis II - quercetagetin series (Chrysosplenium):
3,6,7-trimethylquercetagetin + SAM ⟶ 3,6,7,4'-tetramethylquercetagetin + H+ + SAH
- superpathway of polymethylated quercetin/quercetagetin glucoside biosynthesis (Chrysosplenium):
3,6,7-trimethylquercetagetin + SAM ⟶ 3,6,7,4'-tetramethylquercetagetin + H+ + SAH
- (+)-pisatin biosynthesis:
(-)-maackiain ⟶ (+)-maackiain
- superpathway of pterocarpan biosynthesis (via formononetin):
O2 + a reduced [NADPH-hemoprotein reductase] + formononetin ⟶ 2-hydroxyformononetin + H2O + an oxidized [NADPH-hemoprotein reductase]
- oleandomycin biosynthesis:
(S)-methylmalonyl-CoA + H+ + NADPH + acetyl-CoA ⟶ 8,8a-deoxyoleandolide + CO2 + H2O + NADP+ + coenzyme A
- palmatine biosynthesis:
(S)-tetrahydropalmatine + H+ + O2 ⟶ hydrogen peroxide + palmatine
- diphthamide biosynthesis:
SAM + an L-histidine-[translation elongation factor 2] ⟶ S-methyl-5'-thioadenosine + H+ + a 2-[(3S)-3-amino-3-carboxypropyl]-L-histidine-[translation elongation factor 2]
- wybutosine biosynthesis:
7-[(3S)-4-methoxy-(3-amino-3-carboxypropyl)]-wyosine37 in tRNAPhe + CO2 + SAM ⟶ H+ + SAH + wybutosine37 in tRNAPhe
- 7-(3-amino-3-carboxypropyl)-wyosine biosynthesis:
SAM + an N1-methylguanine37 in tRNAPhe + pyruvate ⟶ 4-demethylwyosine37 in tRNAPhe + 5'-deoxyadenosine + CO2 + H2O + met
- autoinducer CAI-1 biosynthesis:
SAM + decanoyl-CoA ⟶ 3-aminotridec-2-en-4-one + S-methyl-5'-thioadenosine + CO2 + coenzyme A
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis I (archaea):
SAM + an L-histidine-[translation elongation factor 2] ⟶ S-methyl-5'-thioadenosine + H+ + a 2-[(3S)-3-amino-3-carboxypropyl]-L-histidine-[translation elongation factor 2]
- staphylopine biosynthesis:
D-histidine + SAM ⟶ (2S)-2-amino-4-{[(1R)-1-carboxy-2-(1H-imidazol-4-yl)ethyl]amino}butanoate + S-methyl-5'-thioadenosine + H+
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- diacylglyceryl-N,N,N-trimethylhomoserine biosynthesis:
SAM + a 1,2-diacyl-sn-glycerol ⟶ S-methyl-5'-thioadenosine + H+ + a diacylglycerolhomoserine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- nocardicin A biosynthesis:
H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster + nocardicin C ⟶ H2O + an oxidized ferredoxin [iron-sulfur] cluster + nocardicin A
- L-methionine salvage cycle II (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- wybutosine biosynthesis:
4-demethylwyosine37 in tRNAPhe + SAM ⟶ 7-[(3S)-3-amino-3-carboxypropyl]-4-demethylwyosine37 in tRNAPhe + S-methyl-5'-thioadenosine + H+
- 7-(3-amino-3-carboxypropyl)-wyosine biosynthesis:
4-demethylwyosine37 in tRNAPhe + SAM ⟶ 7-[(3S)-3-amino-3-carboxypropyl]-4-demethylwyosine37 in tRNAPhe + S-methyl-5'-thioadenosine + H+
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- diphthamide biosynthesis:
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- wybutosine biosynthesis:
7-[(3S)-4-methoxy-(3-amino-3-carboxypropyl)]-wyosine37 in tRNAPhe + CO2 + SAM ⟶ H+ + SAH + wybutosine37 in tRNAPhe
- 7-(3-amino-3-carboxypropyl)-wyosine biosynthesis:
SAM + an N1-methylguanine37 in tRNAPhe + pyruvate ⟶ 4-demethylwyosine37 in tRNAPhe + 5'-deoxyadenosine + CO2 + H2O + met
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- diphthamide biosynthesis (archaea):
SAM + an L-histidine-[translation elongation factor 2] ⟶ S-methyl-5'-thioadenosine + H+ + a 2-[(3S)-3-amino-3-carboxypropyl]-L-histidine-[translation elongation factor 2]
- staphylopine biosynthesis:
H2O + NADP+ + staphylopine ⟶ 2-amino-4-{[1-carboxy-2-(1H-imidazol-4-yl)ethyl]amino}butanoate + H+ + NADPH + pyruvate
- bixin biosynthesis:
SAM + bixin ⟶ SAH + bixin dimethyl ester
- 6-methylpretetramide biosynthesis:
nonaketamide tricyclic intermediate-[OxyC acyl-carrier protein] ⟶ H+ + OxyC acyl-carrier protein + pretetramide
- superpathway of tetracycline and oxytetracycline biosynthesis:
nonaketamide tricyclic intermediate-[OxyC acyl-carrier protein] ⟶ H+ + OxyC acyl-carrier protein + pretetramide
- volatile cinnamoic ester biosynthesis:
SAM + isoeugenol ⟶ H+ + SAH + isomethyleugenol
- 3-hydroxy-4-methyl-anthranilate biosynthesis II:
N-Formyl-L-kynurenine + H2O ⟶ H+ + L-kynurenine + formate
- isoflavonoid biosynthesis II:
SAM + genistein ⟶ SAH + prunetin
- superpathway of isoflavonoids (via naringenin):
SAM + genistein ⟶ SAH + prunetin
- S-adenosyl-L-methionine biosynthesis:
ATP + H2O + met ⟶ SAM + diphosphate + phosphate
- aspartate superpathway:
ATP + L-homoserine ⟶ ADP + H+ + O-phospho-L-homoserine
- superpathway of S-adenosyl-L-methionine biosynthesis:
ATP + H2O + met ⟶ SAM + diphosphate + phosphate
- L-methionine degradation I (to L-homocysteine):
ATP + H2O + met ⟶ SAM + diphosphate + phosphate
- superpathway of S-adenosyl-L-methionine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- S-adenosyl-L-methionine biosynthesis:
ATP + H2O + met ⟶ SAM + diphosphate + phosphate
- S-adenosyl-L-methionine cycle I:
H2O + SAH ⟶ S-ribosyl-L-homocysteine + adenine
- aspartate superpathway:
O2 + asp ⟶ 2-iminosuccinate + H+ + hydrogen peroxide
- S-adenosyl-L-methionine biosynthesis:
ATP + H2O + met ⟶ SAM + diphosphate + phosphate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- methionine degradation I (to homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- yatein biosynthesis I:
(-)-5'-demethylyatein + SAM ⟶ (-)-yatein + H+ + SAH
- 5,6-dimethylbenzimidazole biosynthesis II (anaerobic):
5-hydroxybenzimidazole + SAM ⟶ 5-methoxybenzimidazole + H+ + SAH
- tetracycline and oxytetracycline biosynthesis:
4-dedimethylamino-4-oxoanhydrotetracycline + an aminated amino group donor ⟶ 4-amino-4-de(dimethylamino)anhydrotetracycline + a deaminated amino group donor
- superpathway of ergosterol biosynthesis I:
(3S)-2,3-epoxy-2,3-dihydrosqualene ⟶ lanosterol
- ergosterol biosynthesis I:
SAM + zymosterol ⟶ H+ + SAH + fecosterol
- superpathway of ergosterol biosynthesis:
NADP+ + ergosterol ⟶ H+ + NADPH + ergosta-5,7,22,24(28)-tetraen-3-β-ol
- ergosterol biosynthesis:
NADP+ + ergosterol ⟶ H+ + NADPH + ergosta-5,7,22,24(28)-tetraen-3-β-ol
- fumitremorgin C biosynthesis:
6-hydroxytryprostatin B + SAM ⟶ H+ + SAH + tryprostatin A
- superpathway of fumitremorgin biosynthesis:
DMAPP + verruculogen ⟶ diphosphate + fumitremorgin A
- p-HBAD biosynthesis:
dTDP-β-L-rhamnose + p-HBAD-I ⟶ O-methyl-4-O-[α-L-rhamnopyranosyl-(1→3)-2-O-methyl-α-L-rhamnopyranosyl]-hydroxybenzoate + H+ + dTDP
- p-HBAD biosynthesis:
dTDP-β-L-rhamnose + p-HBAD-I ⟶ O-methyl-4-O-[α-L-rhamnopyranosyl-(1→3)-2-O-methyl-α-L-rhamnopyranosyl]-hydroxybenzoate + H+ + dTDP
- theobromine biosynthesis II (via xanthine):
3-methylxanthine + SAM ⟶ H+ + SAH + theobromine
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- shinorine biosynthesis:
(R)-4-deoxygadusol ⟶ (S)-4-deoxygadusol
- sakuranetin biosynthesis:
(2S)-naringenin + SAM ⟶ (2S)-sakuranetin + H+ + SAH
- vitamin E biosynthesis (tocopherols):
δ-tocopherol ⟶ 2-methyl-6-phytyl-1,4-benzoquinol
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol ⟶ 2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol
- vitamin E biosynthesis (tocotrienols):
2-methyl-6-geranylgeranyl-1,4-benzoquinol + SAM ⟶ 2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol + H+ + SAH
- pinosylvin metabolism:
SAM + pinosylvin ⟶ H+ + SAH + pinosylvin monomethylether
- spirilloxanthin and 2,2'-diketo-spirilloxanthin biosynthesis:
2-oxospirilloxanthin + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ 2,2'-dioxospirilloxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster
- 3,8-divinyl-chlorophyllide a biosynthesis II (anaerobic):
131-oxo-magnesium-protoporphyrin IX 13-monomethyl ester + SAM ⟶ 3,8-divinyl protochlorophyllide a + 5'-deoxyadenosine + H+ + met
- superpathway of bacteriochlorophyll a biosynthesis:
131-oxo-magnesium-protoporphyrin IX 13-monomethyl ester + SAM ⟶ 3,8-divinyl protochlorophyllide a + 5'-deoxyadenosine + H+ + met
- histamine degradation:
H2O + O2 + histamine ⟶ ammonium + hydrogen peroxide + imidazole acetaldehyde
- histamine degradation:
SAM + histamine ⟶ Nτ-methylhistamine + H+ + SAH
- isoflavonoid biosynthesis I:
SAM + daidzein ⟶ H+ + SAH + isoformononetin
- formononetin biosynthesis:
SAM + daidzein ⟶ H+ + SAH + formononetin
- daunorubicin biosynthesis:
ε-rhodomycinone + dTDP-L-daunosamine ⟶ H+ + dTDP + rhodomycinone D
- aclacinomycin biosynthesis:
aklavinone + dTDP-β-L-rhodosamine ⟶ H+ + aclacinomycin T + dTDP
- trigonelline biosynthesis:
SAM + nicotinate ⟶ SAH + trigonelline
- aflatoxins B1 and G1 biosynthesis:
8-O-methylsterigmatocystin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ CO2 + H2O + MeOH + aflatoxin B1 + an oxidized [NADPH-hemoprotein reductase]
- sterigmatocystin biosynthesis:
6-demethylsterigmatocystin + SAM ⟶ H+ + SAH + sterigmatocystin
- fluoroacetate and fluorothreonine biosynthesis:
SAM + fluoride ⟶ 5'-deoxy-5'-fluoroadenosine + met
- secologanin and strictosidine biosynthesis:
(6E)-8-oxogeranial + H+ + NAD(P)H ⟶ (+)-cis,trans-nepetalactol + NAD(P)+
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- superpathway of chorismate metabolism:
3-octaprenyl-4-hydroxybenzoate + H+ ⟶ 2-octaprenylphenol + CO2
- ubiquinol-8 biosynthesis (prokaryotic):
3-octaprenyl-4-hydroxybenzoate + H+ ⟶ 2-octaprenylphenol + CO2
- superpathway of ubiquinol-8 biosynthesis (prokaryotic):
3-octaprenyl-4-hydroxybenzoate + H+ ⟶ 2-octaprenylphenol + CO2
- ubiquinol-8 biosynthesis (prokaryotic):
3-octaprenyl-4-hydroxybenzoate + H+ ⟶ 2-octaprenylphenol + CO2
- superpathway of chorismate metabolism:
2-oxoglutarate + phe ⟶ 3-phenyl-2-oxopropanoate + glu
- superpathway of ubiquinol-8 biosynthesis (prokaryotic):
3-octaprenyl-4-hydroxybenzoate + H+ ⟶ 2-octaprenylphenol + CO2
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- ubiquinol-10 biosynthesis (prokaryotic):
6-(all-trans-decaprenyl)-2-methoxy-phenol + H+ + NADPH + O2 ⟶ all trans-decaprenyl-2-methoxy-6-1,4-benzoquinol + H2O + NADP+
- caffeine biosynthesis I:
SAM + theobromine ⟶ H+ + SAH + caffeine
- theobromine biosynthesis I:
7-methylxanthine + SAM ⟶ H+ + SAH + theobromine
- methylhalides biosynthesis (plants):
SAM + iodide ⟶ SAH + methyl iodide
- methylhalides biosynthesis (plants):
SAM + iodide ⟶ SAH + methyl iodide
- 1,4-dihydroxy-6-naphthoate biosynthesis II:
3-[(1-carboxyvinyl)oxy]benzoate + H2O + SAM ⟶ 6-amino-6-deoxyfutalosine + H+ + hydrogencarbonate + met
- 1,4-dihydroxy-6-naphthoate biosynthesis I:
3-[(1-carboxyvinyl)oxy]benzoate + H2O + SAM ⟶ 6-amino-6-deoxyfutalosine + H+ + hydrogencarbonate + met
- superpathway of demethylmenaquinol-6 biosynthesis II:
3-[(1-carboxyvinyl)oxy]benzoate + H2O + SAM ⟶ 6-amino-6-deoxyfutalosine + H+ + hydrogencarbonate + met
- superpathway of menaquinol-8 biosynthesis II:
3-[(1-carboxyvinyl)oxy]benzoate + H2O + SAM ⟶ 6-amino-6-deoxyfutalosine + H+ + hydrogencarbonate + met
- superpathway of menaquinol-8 biosynthesis III:
3-[(1-carboxyvinyl)oxy]benzoate + H2O + SAM ⟶ 6-amino-6-deoxyfutalosine + H+ + hydrogencarbonate + met
- 1,4-dihydroxy-6-naphthoate biosynthesis II:
6-amino-6-deoxyfutalosine + H2O ⟶ adenine + dehypoxanthine futalosine
- superpathway of demethylmenaquinol-6 biosynthesis II:
6-amino-6-deoxyfutalosine + H2O ⟶ adenine + dehypoxanthine futalosine
- cyclopropane fatty acid (CFA) biosynthesis:
SAM + a [phospholipid] olefinic fatty acid ⟶ H+ + SAH + a [phospholipid] cyclopropane fatty acid
- cyclopropane fatty acid (CFA) biosynthesis:
SAM + a [phospholipid] olefinic fatty acid ⟶ H+ + SAH + a [phospholipid] cyclopropane fatty acid
- rebeccamycin biosynthesis:
4'-O-demethylrebeccamycin + SAM ⟶ H+ + SAH + rebeccamycin
- tetracenomycin C biosynthesis:
H+ + NADPH + O2 + tetracenomycin A2 ⟶ H2O + NADP+ + tetracenomycin C
- phenolphthiocerol biosynthesis:
19-(4-hydroxyphenyl)nonadecanoyl adenylate + holo-(phenol)carboxyphthiodiolenone synthase ⟶ AMP + H+ + a 19-(4-hydroxyphenyl)-nonadecanoyl-[(phenol)carboxyphthiodiolenone synthase]
- phenolphthiocerol biosynthesis:
19-(4-hydroxyphenyl)nonadecanoyl adenylate + holo-(phenol)carboxyphthiodiolenone synthase ⟶ AMP + H+ + a 19-(4-hydroxyphenyl)-nonadecanoyl-[(phenol)carboxyphthiodiolenone synthase]
- spinosyn A biosynthesis:
2',3',4'-O-methyl-rhamnosyl tetracyclic spinosyn pseudoaglycone + dTDP-α-D-forosamine ⟶ H+ + dTDP + spinosyn A
- chelerythrine biosynthesis:
(S)-canadine + SAM ⟶ (S)-N-methylcanadine + SAH
- noscapine biosynthesis:
(S)-canadine + SAM ⟶ (S)-N-methylcanadine + SAH
- 1,3,5-trimethoxybenzene biosynthesis:
3,5-dimethoxyphenol + SAM ⟶ 1,3,5-trimethoxybenzene + H+ + SAH
- 1,3,5-trimethoxybenzene biosynthesis:
3,5-dihydroxyanisole + SAM ⟶ 3,5-dimethoxyphenol + H+ + SAH
- plant sterol biosynthesis:
4α-formyl-ergosta-7,24(241)-dien-3β-ol + H+ + O2 + a ferrocytochrome b5 ⟶ 4α-carboxy-ergosta-7,24(241)-dien-3β-ol + H2O + a ferricytochrome b5
- echinomycin and triostin A biosynthesis:
ATP + SAM + a quinoxaline-2-carboxyl-D-seryl-L-alanyl-[non-ribosomal peptide synthase] + cys + val ⟶ AMP + H+ + SAH + diphosphate + non-ribosomal peptide synthase + triostin A dithiol
- ubiquinol-8 biosynthesis (prokaryotic):
3-octaprenyl-4-hydroxybenzoate + H+ ⟶ 2-octaprenylphenol + CO2
- superpathway of chorismate metabolism:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- superpathway of ubiquinol-8 biosynthesis (prokaryotic):
3-octaprenyl-4-hydroxybenzoate + H+ ⟶ 2-octaprenylphenol + CO2
- ubiquinol-8 biosynthesis (prokaryotic):
2-octaprenylphenol + H+ + NADPH + O2 ⟶ 3-(all-trans-octaprenyl)benzene-1,2-diol + H2O + NADP+
- ubiquinol-8 biosynthesis (prokaryotic):
2-octaprenylphenol + H+ + NADPH + O2 ⟶ 3-(all-trans-octaprenyl)benzene-1,2-diol + H2O + NADP+
- superpathway of chorismate metabolism:
2-oxoglutarate + tyr ⟶ 4-hydroxyphenylpyruvate + glt
- ubiquinol-8 biosynthesis (prokaryotic):
2-octaprenylphenol + H+ + NADPH + O2 ⟶ 3-(all-trans-octaprenyl)benzene-1,2-diol + H2O + NADP+
- superpathway of ubiquinol-8 biosynthesis (prokaryotic):
2-octaprenylphenol + H+ + NADPH + O2 ⟶ 3-(all-trans-octaprenyl)benzene-1,2-diol + H2O + NADP+
- heme d1 biosynthesis:
12,18-didecarboxysiroheme + H2O + SAM ⟶ 5'-deoxyadenosine + H+ + met + pre-heme d1 + propanoate
- plastoquinol-9 biosynthesis II:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis II:
2-nonaprenylphenol + H+ + NADPH + O2 ⟶ 2-(all-trans-nonaprenyl)benzene-1,4-diol + H2O + NADP+
- neoxaline biosynthesis:
N1-hydroxy-roquefortine C + SAM ⟶ H+ + SAH + roquefortine F
- superpathway of roquefortine, meleagrin and neoxaline biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + roquefortine D ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + roquefortine C
- toxoflavin biosynthesis:
1,6-didemethyltoxoflavin + SAM ⟶ H+ + SAH + reumycin
- gossypol biosynthesis:
(+)-δ-cadinene + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 8-hydroxy-(+)-δ-cadinene + H2O + an oxidized [NADPH-hemoprotein reductase]
- polymethylated quercetin biosynthesis:
SAM + rhamnetin ⟶ 7,3'-dimethylquercetin + H+ + SAH
- yatein biosynthesis II:
O4,O5--dimethylthujaplicatin + H+ + NADPH + O2 ⟶ (-)-yatein + H2O + NADP+
- pterostilbene biosynthesis:
3-methoxy-4',5-dihydroxy-trans-stilbene + SAM ⟶ H+ + SAH + pterostilbene
- glucosinolate biosynthesis from tryptophan:
1-hydroxyglucobrassicin + SAM ⟶ H+ + SAH + neoglucobrassicin
- ephedrine biosynthesis:
(+)-norpseudoephedrine + SAM ⟶ H+ + SAH + pseudoephedrine
- pinitol biosynthesis I:
myo-inositol + SAM ⟶ D-ononitol + H+ + SAH
- pinitol biosynthesis II:
myo-inositol + SAM ⟶ H+ + SAH + sequoyitol
- 6-methoxymellein biosynthesis:
6-hydroxymellein + SAM ⟶ 6-methoxymellein + H+ + SAH
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- queuosine biosynthesis:
a guanine34 in tRNA + preQ1 ⟶ a 7-aminomethyl-7-deazaguanosine34 in tRNA + guanine
- queuosine biosynthesis:
SAM + a 7-aminomethyl-7-deazaguanosine34 in tRNA ⟶ H+ + adenine + an epoxyqueuosine34 in tRNA + met
- queuosine biosynthesis:
SAM + a 7-aminomethyl-7-deazaguanosine34 in tRNA ⟶ H+ + adenine + an epoxyqueuosine34 in tRNA + met
- queuosine biosynthesis:
SAM + a 7-aminomethyl-7-deazaguanosine34 in tRNA ⟶ H+ + adenine + an epoxyqueuosine34 in tRNA + met
- queuosine biosynthesis:
SAM + a 7-aminomethyl-7-deazaguanosine34 in tRNA ⟶ H+ + adenine + an epoxyqueuosine34 in tRNA + met
- queuosine biosynthesis:
SAM + a 7-aminomethyl-7-deazaguanosine34 in tRNA ⟶ H+ + adenine + an epoxyqueuosine34 in tRNA + met
- queuosine biosynthesis:
SAM + a 7-aminomethyl-7-deazaguanosine34 in tRNA ⟶ H+ + adenine + an epoxyqueuosine34 in tRNA + met
- queuosine biosynthesis:
SAM + a 7-aminomethyl-7-deazaguanosine34 in tRNA ⟶ H+ + adenine + an epoxyqueuosine34 in tRNA + met
- queuosine biosynthesis:
SAM + a 7-aminomethyl-7-deazaguanosine34 in tRNA ⟶ H+ + adenine + an epoxyqueuosine34 in tRNA + met
- queuosine biosynthesis:
SAM + a 7-aminomethyl-7-deazaguanosine34 in tRNA ⟶ H+ + adenine + an epoxyqueuosine34 in tRNA + met
- queuosine biosynthesis:
SAM + a 7-aminomethyl-7-deazaguanosine34 in tRNA ⟶ H+ + adenine + an epoxyqueuosine34 in tRNA + met
- queuosine biosynthesis:
SAM + a 7-aminomethyl-7-deazaguanosine34 in tRNA ⟶ H+ + adenine + an epoxyqueuosine34 in tRNA + met
- queuosine biosynthesis:
SAM + a 7-aminomethyl-7-deazaguanosine34 in tRNA ⟶ H+ + adenine + an epoxyqueuosine34 in tRNA + met
- queuosine biosynthesis:
SAM + a 7-aminomethyl-7-deazaguanosine34 in tRNA ⟶ H+ + adenine + an epoxyqueuosine34 in tRNA + met
- queuosine biosynthesis:
SAM + a 7-aminomethyl-7-deazaguanosine34 in tRNA ⟶ H+ + adenine + an epoxyqueuosine34 in tRNA + met
- queuosine biosynthesis:
SAM + a 7-aminomethyl-7-deazaguanosine34 in tRNA ⟶ H+ + adenine + an epoxyqueuosine34 in tRNA + met
- superpathway of tryptophan utilization:
N-formylkynurenine + H2O ⟶ H+ + L-kynurenine + formate
- serotonin and melatonin biosynthesis:
5-hydroxy-L-tryptophan + H+ ⟶ CO2 + serotonin
- serotonin and melatonin biosynthesis:
N-acetyl-serotonin + SAM ⟶ H+ + SAH + melatonin
- serotonin and melatonin biosynthesis:
5-hydroxy-L-tryptophan + H+ ⟶ CO2 + serotonin
- ubiquinol-10 biosynthesis:
3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate + H+ ⟶ 6-(all-trans-decaprenyl)-2-methoxy-phenol + CO2
- ubiquinol-10 biosynthesis (eukaryotic):
3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate + H+ ⟶ 6-(all-trans-decaprenyl)-2-methoxy-phenol + CO2
- polymethylated myricetin biosynthesis (tomato):
3',4',5'-trimethylmyricetin + SAM ⟶ 3,3',4',5'-tetramethylmyricetin + H+ + SAH
- peramine biosynthesis:
(S)-1-pyrroline-5-carboxylate + ATP + SAM + arg ⟶ AMP + H+ + H2O + SAH + diphosphate + peramine
- phthiocerol biosynthesis:
(behenoyl)adenylate + holo-(phenol)carboxyphthiodiolenone synthase ⟶ AMP + H+ + a behenoyl-[(phenol)carboxyphthiodiolenone synthase]
- phthiocerol biosynthesis:
(behenoyl)adenylate + holo-(phenol)carboxyphthiodiolenone synthase ⟶ AMP + H+ + a behenoyl-[(phenol)carboxyphthiodiolenone synthase]
- caffeine biosynthesis II (via paraxanthine):
SAM + paraxanthine ⟶ H+ + SAH + caffeine
- glycine betaine biosynthesis IV (from glycine):
N,N-dimethylglycine + SAM ⟶ H+ + SAH + glycine betaine
- glycine betaine biosynthesis V (from glycine):
N,N-dimethylglycine + SAM ⟶ H+ + SAH + glycine betaine
- (aminomethyl)phosphonate degradation:
AMP + diphosphate ⟶ PRPP + adenine
- (aminomethyl)phosphonate degradation:
(acetamidomethyl)phosphonate + ATP ⟶ α-D-ribose 1-(acetamidomethylphosphonate) 5-triphosphate + adenine
- gadusol biosynthesis:
SAM + desmethyl gadusol ⟶ H+ + SAH + gadusol
- phenylpropanoids methylation (ice plant):
1-O-caffeoyl-β-D-glucose + SAM ⟶ 1-O-feruloyl-β-D-glucose + H+ + SAH
- berberine biosynthesis:
(S)-tetrahydrocolumbamine + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (S)-canadine + H2O + an oxidized [NADPH-hemoprotein reductase]
- vestitol and sativan biosynthesis:
(-)-medicarpin + H+ + NADPH ⟶ (-)-vestitol + NADP+
- meleagrin biosynthesis:
N1-hydroxy-roquefortine C + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + roquefortine L
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
trans-caffeoyl-CoA + spermidine ⟶ H+ + coenzyme A + tricaffeoyl spermidine
- viridicatin biosynthesis:
(-)-cyclopenine ⟶ H+ + methyl isocyanate + viridicatin
- 3,5-dimethoxytoluene biosynthesis:
3-methoxy-5-hydroxytoluene + SAM ⟶ 3,5-dimethoxytoluene + H+ + SAH
- polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
2-oxoglutarate + 3,7,4'-trimethylquercetin + O2 ⟶ 3,7,4'-trimethylquercetagetin + CO2 + succinate
- ponciretin biosynthesis:
(2S)-naringenin + SAM ⟶ H+ + SAH + ponciretin
- aucuparin biosynthesis:
H+ + benzoyl-CoA + malonyl-CoA ⟶ 3,5-dihydroxybiphenyl + CO2 + coenzyme A
- thiocoraline biosynthesis:
3-hydroxyquinaldate adenylate + aryl-carrier protein ⟶ AMP + H+ + a 3-hydroxyquinaldyl-[aryl-carrier protein]
- 3-hydroxy-4-methyl-anthranilate biosynthesis I:
N-Formyl-L-kynurenine + H2O ⟶ H+ + L-kynurenine + formate
- phosphinothricin tripeptide biosynthesis:
2-hydroxyethylphosphonate + NAD+ ⟶ H+ + NADH + phosphonoacetaldehyde
- spheroidene and spheroidenone biosynthesis:
1-hydroxyneurosporene ⟶ all-trans neurosporene + H2O
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ (S)-magnoflorine + H+ + SAH
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ H+ + SAH + magnoflorine
- juvenile hormone III biosynthesis I:
(2E,6E)-farnesol + NADP+ ⟶ (2E,6E)-farnesal + H+ + NADPH
- S-adenosyl-L-methionine cycle II:
ATP + H2O + met ⟶ SAM + diphosphate + phosphate
- juvenile hormone III biosynthesis II:
(2E,6E)-farnesol + NADP+ ⟶ (2E,6E)-farnesal + H+ + NADPH
- eupatolitin 3-O-glucoside biosynthesis:
UDP-α-D-glucose + eupatolitin ⟶ UDP + eupatolitin 3-glucoside
- indolmycin biosynthesis:
(S)-1-pyrroline-5-carboxylate + H+ + H2O ⟶ L-glutamate-5-semialdehyde
- ubiquinol-8 biosynthesis (eukaryotic):
3-methoxy-4-hydroxy-5-all-trans-octaprenylbenzoate + H+ ⟶ 2-methoxy-6-(all-trans-octaprenyl)phenol + CO2
- 4'-methoxyviridicatin biosynthesis:
(-)-4'-methoxycyclopenine ⟶ 4'-methoxyviridicatin + H+ + methyl isocyanate
- okenone biosynthesis:
A + thiothece-474 ⟶ A(H2) + okenone
- methylphosphonate degradation I:
(methyl)phosphonate + ATP ⟶ α-D-ribose-1-(methyl)phosphonate-5-triphosphate + adenine
- methylphosphonate degradation II:
(methyl)phosphonate + ATP ⟶ α-D-ribose-1-(methyl)phosphonate-5-triphosphate + adenine
- methylphosphonate degradation I:
(methyl)phosphonate + ATP ⟶ α-D-ribose-1-(methyl)phosphonate-5-triphosphate + adenine
- methylphosphonate degradation I:
ATP + methylphosphonate ⟶ α-D-ribose-1-methylphosphonate-5-triphosphate + adenine
- superpathway of ubiquinol-6 biosynthesis (eukaryotic):
3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate + H+ ⟶ 2-hexaprenyl-6-methoxyphenol + CO2
- ubiquinol-6 biosynthesis from 4-hydroxybenzoate (eukaryotic):
3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate + H+ ⟶ 2-hexaprenyl-6-methoxyphenol + CO2
- ubiquinol-6 biosynthesis from 4-aminobenzoate (yeast):
3-demethylubiquinol-6 + SAM ⟶ H+ + SAH + ubiquinol
- ubiquinol-6 bypass biosynthesis (eukaryotic):
3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate + H+ ⟶ 2-hexaprenyl-6-methoxyphenol + CO2
- ubiquinol-6 bypass biosynthesis:
3,4-dihydroxy-5-all-trans-hexaprenylbenzoate + SAM ⟶ 3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate + H+ + SAH
- vanillin biosynthesis I:
4-hydroxybenzaldehyde + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3,4-dihydroxybenzaldehyde + H2O + an oxidized [NADPH-hemoprotein reductase]
- factor 420 biosynthesis:
5,10-methylene-tetrahydromethanopterin + H+ + an oxidized coenzyme F420 ⟶ 5,10-methenyltetrahydromethanopterin + a reduced coenzyme F420
- factor 420 biosynthesis:
4-hydroxyphenylpyruvate + ARP + H2O + SAM ⟶ 5'-deoxyadenosine + 7,8-didemethyl-8-hydroxy-5-deazariboflavin + H+ + ammonium + met + oxalate
- factor 420 biosynthesis:
4-hydroxyphenylpyruvate + ARP + H2O + SAM ⟶ 5'-deoxyadenosine + 7,8-didemethyl-8-hydroxy-5-deazariboflavin + H+ + ammonium + met + oxalate
- salinosporamide A biosynthesis:
5'-chloro-5'-deoxyadenosine + phosphate ⟶ 5-chloro-5-deoxyribose 1-phosphate + adenine
- salinosporamide A biosynthesis:
5'-deoxy-5'-chloroadenosine + phosphate ⟶ 5-chloro-5-deoxyribose 1-phosphate + adenine
- actinomycin D biosynthesis:
3-hydroxy-4-methyl-anthranilate pentapeptide lactone + O2 ⟶ H2O + actinomycin D
- heme degradation V:
δ-anaerubin + NADP+ ⟶ H+ + NADPH + anaerobilin
- roseoflavin biosynthesis:
8-amino-8-demethylriboflavin + SAM ⟶ 8-demethyl-8-(methylamino)riboflavin + H+ + SAH
- vindoline and vinblastine biosynthesis:
O2 + vinblastine ⟶ H+ + H2O + vincristine
- gentamicin biosynthesis:
O2 + geneticin + glu ⟶ 2-oxoglutarate + JI-20B + hydrogen peroxide
- dTDP-D-desosamine biosynthesis:
α-D-glucopyranose 1-phosphate + H+ + dTTP ⟶ dTDP-α-D-glucose + diphosphate
- superpathway of erythromycin biosynthesis:
dTDP-β-L-mycarose + erythronolide B ⟶ 3-α-mycarosylerythronolide B + H+ + dTDP
- superpathway of megalomicin A biosynthesis:
dTDP-β-L-mycarose + erythronolide B ⟶ 3-α-mycarosylerythronolide B + H+ + dTDP
- sulfur volatiles biosynthesis:
SAM + thiocyanate ⟶ SAH + methyl thiocyanate
- sulfur volatiles biosynthesis:
SAM + thiocyanate ⟶ SAH + methyl thiocyanate
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ H+ + MeOH + indole-3-acetate
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ MeOH + indole-3-acetate
- glyphosate degradation III:
AMP + diphosphate ⟶ PRPP + adenine
- 6-gingerol biosynthesis:
1-(3,4-dihydroxyphenyl)-5-hydroxy-3-decanone + SAM ⟶ 6-gingerol + H+ + SAH
- 6-methoxypodophyllotoxin biosynthesis:
(-)-yatein + 2-oxoglutarate + O2 ⟶ (-)-deoxypodophyllotoxin + CO2 + H2O + succinate
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- 8-methylmenaquinone biosynthesis:
MQ + SAM + a reduced flavodoxin ⟶ 5'-deoxyadenosine + H+ + SAH + an 8-methylmenaquinone + an oxidized flavodoxin + met
- heme b biosynthesis III (from siroheme):
12,18-didecarboxysiroheme + A(H2) + SAM ⟶ 5'-deoxyadenosine + A + H+ + acetate + coproheme III + met
- heme b biosynthesis II (anaerobic):
SAM + coproporphyrinogen III ⟶ 5'-deoxyadenosine + CO2 + met + protoporphyrinogen IX
- superpathway of heme b biosynthesis from uroporphyrinogen-III:
H+ + O2 + coproporphyrinogen III ⟶ CO2 + H2O + protoporphyrinogen IX
- molybdenum cofactor biosynthesis:
A(H2) + GTP + SAM ⟶ (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate + 5'-deoxyadenosine + A + H+ + met
- paromamine biosynthesis II:
2-deoxy-L-scyllo-inosose + gln ⟶ 2-deoxy-scyllo-inosamine + 2-oxoglutaramate
- tetrahydromethanopterin biosynthesis:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- FeMo cofactor biosynthesis:
SAM + a NifB protein with a K-cluster + a reduced ferredoxin [iron-sulfur] cluster + a sulfurated [sulfur carrier] ⟶ 5'-deoxyadenosine + H+ + SAH + a NifB protein with an L-cluster + an oxidized ferredoxin [iron-sulfur] cluster + an unsulfurated [sulfur carrier] + met
- fosfomycin biosynthesis:
2-hydroxyethylphosphonate + CTP ⟶ cytidine 5'-{[hydroxy(2-hydroxyethyl)phosphonoyl]phosphate} + diphosphate
- methylwyosine biosynthesis:
SAM + an N1-methylguanine37 in tRNAPhe + pyruvate ⟶ 4-demethylwyosine37 in tRNAPhe + 5'-deoxyadenosine + CO2 + H2O + met
- lipoate biosynthesis and incorporation II:
ATP + a [lipoyl-carrier protein]-L-lysine + octanoate ⟶ AMP + H+ + a [lipoyl-carrier protein] N6-octanoyl-L-lysine + diphosphate
- heme b biosynthesis II (anaerobic):
H+ + uroporphyrinogen-III ⟶ CO2 + coproporphyrinogen III
- superpathway of heme b biosynthesis from uroporphyrinogen-III:
O2 + protoporphyrinogen IX ⟶ hydrogen peroxide + protoporphyrin IX
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- lipoate biosynthesis and incorporation II:
H+ + SAM + a [lipoyl-carrier protein] N6-octanoyl-L-lysine + a reduced ferredoxin [iron-sulfur] cluster + an [Fe-S] cluster scaffold protein carrying a [4Fe-4S]+2 cluster ⟶ 5'-deoxyadenosine + Fe2+ + a [lipoyl-carrier protein] N6-[(R)-dihydrolipoyl]-L-lysine + an [Fe-S] cluster scaffold protein + an oxidized ferredoxin [iron-sulfur] cluster + met + sulfide(2-)
- molybdenum cofactor biosynthesis:
A(H2) + GTP + SAM ⟶ (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate + 5'-deoxyadenosine + A + H+ + met
- superpathway of heme b biosynthesis from uroporphyrinogen-III:
O2 + protoporphyrinogen IX ⟶ hydrogen peroxide + protoporphyrin IX
- heme b biosynthesis II (anaerobic):
SAM + coproporphyrinogen III ⟶ 5'-deoxyadenosine + CO2 + met + protoporphyrinogen IX
- molybdenum cofactor biosynthesis:
A(H2) + GTP + SAM ⟶ (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate + 5'-deoxyadenosine + A + H+ + met
- heme b biosynthesis II (anaerobic):
SAM + coproporphyrinogen III ⟶ 5'-deoxyadenosine + CO2 + met + protoporphyrinogen IX
- superpathway of heme b biosynthesis from uroporphyrinogen-III:
O2 + protoporphyrinogen IX ⟶ hydrogen peroxide + protoporphyrin IX
- heme biosynthesis II (anaerobic):
H+ + uroporphyrinogen-III ⟶ CO2 + coproporphyrinogen III
- superpathway of heme biosynthesis from uroporphyrinogen-III:
O2 + protoporphyrinogen IX ⟶ hydrogen peroxide + protoporphyrin IX
- heme biosynthesis from uroporphyrinogen-III II:
H+ + ferroheme b ⟶ Fe2+ + protoporphyrin IX
- superpathway of heme biosynthesis from uroporphyrinogen-III:
O2 + protoporphyrinogen IX ⟶ hydrogen peroxide + protoporphyrin IX
- superpathway of heme b biosynthesis from uroporphyrinogen-III:
O2 + protoporphyrinogen IX ⟶ hydrogen peroxide + protoporphyrin IX
- heme b biosynthesis II (anaerobic):
SAM + coproporphyrinogen III ⟶ 5'-deoxyadenosine + CO2 + met + protoporphyrinogen IX
- heme b biosynthesis II (anaerobic):
H+ + ferroheme b ⟶ Fe2+ + protoporphyrin IX
- superpathway of heme b biosynthesis from uroporphyrinogen-III:
O2 + protoporphyrinogen IX ⟶ hydrogen peroxide + protoporphyrin IX
- heme biosynthesis II (anaerobic):
SAM + coproporphyrinogen III ⟶ 5'-deoxyadenosine + CO2 + met + protoporphyrinogen IX
- heme b biosynthesis II (anaerobic):
H+ + ferroheme b ⟶ Fe2+ + protoporphyrin IX
- superpathway of heme b biosynthesis from uroporphyrinogen-III:
O2 + protoporphyrinogen IX ⟶ hydrogen peroxide + protoporphyrin IX
- heme biosynthesis II (anaerobic):
H+ + uroporphyrinogen-III ⟶ CO2 + coproporphyrinogen III
- superpathway of heme biosynthesis from uroporphyrinogen-III:
O2 + protoporphyrinogen IX ⟶ hydrogen peroxide + protoporphyrin IX
- heme b biosynthesis II (anaerobic):
H+ + ferroheme b ⟶ Fe2+ + protoporphyrin IX
- heme biosynthesis II (anaerobic):
H+ + ferroheme b ⟶ Fe2+ + protoporphyrin IX
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- heme biosynthesis III (from siroheme):
12,18-didecarboxysiroheme + A(H2) + SAM ⟶ 5'-deoxyadenosine + A + Fe-coproporphyrin III + H+ + acetate + met
- aminomethylphosphonate degradation:
AMP + diphosphate ⟶ PRPP + adenine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- tetrahydromethanopterin biosynthesis:
4-(β-D-ribofuranosyl)-N-succinylaminobenzene 5'-phosphate ⟶ 4-(β-D-ribofuranosyl)aminobenzene-5'-phosphate + fumarate
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- polymethylated kaempferol biosynthesis:
SAM + kaempferol ⟶ 3-O-methylkaempferol + SAH
- gibberellin inactivation II (methylation):
SAM + gibberellin A9 ⟶ SAH + methyl gibberellin A9
- gibberellin inactivation II (methylation):
SAM + gibberellin A9 ⟶ SAH + methyl gibberellin A9
WikiPathways(0)
Plant Reactome(25)
- Metabolism and regulation:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA
- Amino acid metabolism:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA
- Amino acid biosynthesis:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA
- Beta-alanine betaine biosynthesis:
SAM + b-Ala ⟶ N-methyl-beta-alanine + SAH
- Secondary metabolism:
GPP + H2O ⟶ PPi + geraniol
- Lignin biosynthesis:
4-coumarate + ATP + CoA-SH ⟶ 4-coumaroyl-CoA + AMP + PPi
- Pterocarpan biosynthesis:
2-hydroxyisoflavanone ⟶ H2O + daidzein
- Fatty acid and lipid metabolism:
NAD(P)H + Oxygen + lathosterol ⟶ H2O + NAD(P)+ + Provitamin D3
- Choline biosynthesis I:
ChoP + H2O ⟶ Cho + Pi
- Suberin biosynthesis:
ATP + CoA-SH + ferulate ⟶ AMP + PPi + feruloyl-CoA
- Yang cycle:
5'-methylthioadenosine + H2O ⟶ 5-methylthioribose + Ade
- Hormone signaling, transport, and metabolism:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate + Oxygen ⟶ CH3COO- + jasmonic acid
- Ethylene biosynthesis and signaling:
1-aminocyclopropane-1-carboxylate + Oxygen + VitC ⟶ H2O + HCN + L-dehydroascorbate + carbon dioxide + ethene
- Ethene biosynthesis from methionine:
1-aminocyclopropane-1-carboxylate + Oxygen + VitC ⟶ H2O + HCN + L-dehydroascorbate + carbon dioxide + ethene
- Inorganic nutrients metabolism:
Nitrite ⟶ H2O + ammonia
- Response to iron deficiency:
2OG + nicotianamine ⟶ 3''-deamino-3''-oxonicotianamine + L-Glu
- Mugineic acid biosynthesis:
2OG + nicotianamine ⟶ 3''-deamino-3''-oxonicotianamine + L-Glu
- Tricin biosynthesis:
Oxygen + TPNH + apigenin ⟶ H2O + TPN + luteolin
- Cofactor biosyntheses:
2OG + L-Val ⟶ KIV + L-Glu
- Biotin biosynthesis II:
9-mercaptodethiobiotin ⟶ Btn
- Sterol biosynthesis:
delta24-25-sitosterol ⟶ sitosterol
- Linear furanocoumarin biosynthesis:
H+ + H2O + TPNH + psoralen ⟶ TPN + bergaptol
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Jasmonate biosynthesis:
3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate + Oxygen ⟶ CH3COO- + jasmonic acid
- SMM cycle:
LHCYS + SMM ⟶ L-Met
INOH(0)
PlantCyc(4378)
- β-alanine betaine biosynthesis:
N,N-dimethyl-β-alanine + SAM ⟶ β-alanine betaine + H+ + SAH
- β-alanine betaine biosynthesis:
β-alanine + SAM ⟶ H+ + N-methyl-β-alanine + SAH
- β-alanine betaine biosynthesis:
N-methyl-β-alanine + SAM ⟶ H+ + N,N-dimethyl-β-alanine + SAH
- β-alanine betaine biosynthesis:
N,N-dimethyl-β-alanine + SAM ⟶ β-alanine betaine + H+ + SAH
- β-alanine betaine biosynthesis:
β-alanine + SAM ⟶ H+ + N-methyl-β-alanine + SAH
- arctigenin and isoarctigenin biosynthesis:
(-)-matairesinol + SAM ⟶ H+ + SAH + arctigenin
- arctigenin and isoarctigenin biosynthesis:
(-)-matairesinol + SAM ⟶ H+ + SAH + arctigenin
- arctigenin and isoarctigenin biosynthesis:
(-)-matairesinol + SAM ⟶ H+ + SAH + arctigenin
- arctigenin and isoarctigenin biosynthesis:
(-)-matairesinol + SAM ⟶ H+ + SAH + isoarctigenin
- arctigenin and isoarctigenin biosynthesis:
(-)-matairesinol + SAM ⟶ H+ + SAH + arctigenin
- arctigenin and isoarctigenin biosynthesis:
(-)-matairesinol + SAM ⟶ H+ + SAH + isoarctigenin
- arctigenin and isoarctigenin biosynthesis:
(-)-matairesinol + SAM ⟶ H+ + SAH + isoarctigenin
- arctigenin and isoarctigenin biosynthesis:
(-)-matairesinol + SAM ⟶ H+ + SAH + isoarctigenin
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
UDP-α-D-glucose + daphnetin ⟶ 3-O-β-D-glucosyl-daphnetin + H+ + UDP
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
D-glucopyranose + daphnetin ⟶ H2O + daphnetin-8-glucoside
- daphnetin modification:
SAM + daphnetin ⟶ 7-hydroxy-8-methoxycoumarin + H+ + SAH
- daphnetin modification:
SAM + daphnetin ⟶ 7-hydroxy-8-methoxycoumarin + H+ + SAH
- sanguinarine and macarpine biosynthesis:
(S)-reticuline + O2 ⟶ (S)-scoulerine + H+ + hydrogen peroxide
- sanguinarine and macarpine biosynthesis:
H+ + O2 + dihydrosanguinarine ⟶ hydrogen peroxide + sanguinarine
- sanguinarine and macarpine biosynthesis:
H+ + O2 + dihydromacarpine ⟶ hydrogen peroxide + macarpine
- sanguinarine and macarpine biosynthesis:
H+ + O2 + dihydrochelirubine ⟶ chelirubine + hydrogen peroxide
- sanguinarine and macarpine biosynthesis:
(S)-reticuline + O2 ⟶ (S)-scoulerine + H+ + hydrogen peroxide
- sanguinarine and macarpine biosynthesis:
(S)-reticuline + O2 ⟶ (S)-scoulerine + H+ + hydrogen peroxide
- sanguinarine and macarpine biosynthesis:
(S)-reticuline + O2 ⟶ (S)-scoulerine + H+ + hydrogen peroxide
- sanguinarine and macarpine biosynthesis:
(S)-reticuline + O2 ⟶ (S)-scoulerine + H+ + hydrogen peroxide
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- methylquercetin biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- superpathway of flavones and derivatives biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- methylquercetin biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- methylquercetin biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- methylquercetin biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- methylquercetin biosynthesis:
SAM + quercetin ⟶ 3-O-methylquercetin + H+ + SAH
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- methylquercetin biosynthesis:
SAM + quercetin ⟶ 3-O-methylquercetin + H+ + SAH
- polymethylated quercetin biosynthesis:
SAM + rhamnetin ⟶ 7,3'-dimethylquercetin + H+ + SAH
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- methylquercetin biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- methylquercetin biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- methylquercetin biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- methylquercetin biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- polymethylated quercetin biosynthesis:
SAM + rhamnetin ⟶ 7,3'-dimethylquercetin + H+ + SAH
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- methylquercetin biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- polymethylated quercetin biosynthesis:
SAM + rhamnetin ⟶ 7,3'-dimethylquercetin + H+ + SAH
- methylquercetin biosynthesis:
SAM + quercetin ⟶ 3-O-methylquercetin + H+ + SAH
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- methylquercetin biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- polymethylated quercetin biosynthesis:
SAM + rhamnetin ⟶ 7,3'-dimethylquercetin + H+ + SAH
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- methylquercetin biosynthesis:
SAM + quercetin ⟶ 3-O-methylquercetin + H+ + SAH
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- methylquercetin biosynthesis:
SAM + quercetin ⟶ 3-O-methylquercetin + H+ + SAH
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- polymethylated quercetin biosynthesis:
SAM + rhamnetin ⟶ 7,3'-dimethylquercetin + H+ + SAH
- phenylpropanoids methylation (ice plant):
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- polymethylated quercetin biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- methylquercetin biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- superpathway of flavones and derivatives biosynthesis:
PAPS + isorhamnetin ⟶ 3',5'-ADP + H+ + isorhamnetin 3-sulfate
- quercetin sulfate biosynthesis:
PAPS + isorhamnetin ⟶ 3',5'-ADP + H+ + isorhamnetin 3-sulfate
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- methylquercetin biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- polymethylated quercetin biosynthesis:
SAM + rhamnetin ⟶ 7,3'-dimethylquercetin + H+ + SAH
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- methylquercetin biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- polymethylated quercetin biosynthesis:
SAM + rhamnetin ⟶ 7,3'-dimethylquercetin + H+ + SAH
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- methylquercetin biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- methylquercetin biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- methylquercetin biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- methylquercetin biosynthesis:
SAM + quercetin ⟶ 3-O-methylquercetin + H+ + SAH
- methylquercetin biosynthesis:
SAM + quercetin ⟶ 3-O-methylquercetin + H+ + SAH
- methylquercetin biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- methylquercetin biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- methylquercetin biosynthesis:
SAM + quercetin ⟶ 3-O-methylquercetin + H+ + SAH
- methylquercetin biosynthesis:
SAM + quercetin ⟶ 3-O-methylquercetin + H+ + SAH
- methylquercetin biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- polymethylated quercetin biosynthesis:
SAM + rhamnetin ⟶ 7,3'-dimethylquercetin + H+ + SAH
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- superpathway of flavones and derivatives biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- methylquercetin biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- quercetin sulfate biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- methylquercetin biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- methylquercetin biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- methylquercetin biosynthesis:
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- Amaryllidacea alkaloids biosynthesis:
SAM + norbelladine ⟶ 4'-O-methylnorbelladine + H+ + SAH
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
SAM + demethylphylloquinol ⟶ H+ + SAH + phylloquinol
- phylloquinol biosynthesis:
SAM + demethylphylloquinol ⟶ H+ + SAH + phylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-oxoglutarate + H+ + isochorismate ⟶ 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate + CO2
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
2-carboxy-1,4-naphthoquinone + H+ + phytyl diphosphate ⟶ CO2 + demethylphylloquinone + diphosphate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
2-carboxy-1,4-naphthoquinone + H+ + phytyl diphosphate ⟶ CO2 + demethylphylloquinone + diphosphate
- phylloquinol biosynthesis:
2-carboxy-1,4-naphthoquinone + H+ + phytyl diphosphate ⟶ CO2 + demethylphylloquinone + diphosphate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
2-carboxy-1,4-naphthoquinone + H+ + phytyl diphosphate ⟶ CO2 + demethylphylloquinone + diphosphate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
2-carboxy-1,4-naphthoquinone + H+ + phytyl diphosphate ⟶ CO2 + demethylphylloquinone + diphosphate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
2-carboxy-1,4-naphthoquinone + H+ + phytyl diphosphate ⟶ CO2 + demethylphylloquinone + diphosphate
- phylloquinol biosynthesis:
2-carboxy-1,4-naphthoquinone + H+ + phytyl diphosphate ⟶ CO2 + demethylphylloquinone + diphosphate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
2-carboxy-1,4-naphthoquinone + H+ + phytyl diphosphate ⟶ CO2 + demethylphylloquinone + diphosphate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
2-carboxy-1,4-naphthoquinone + H+ + phytyl diphosphate ⟶ CO2 + demethylphylloquinone + diphosphate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
2-carboxy-1,4-naphthoquinone + H+ + phytyl diphosphate ⟶ CO2 + demethylphylloquinone + diphosphate
- phylloquinol biosynthesis:
2-carboxy-1,4-naphthoquinone + H+ + phytyl diphosphate ⟶ CO2 + demethylphylloquinone + diphosphate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
2-carboxy-1,4-naphthoquinone + H+ + phytyl diphosphate ⟶ CO2 + demethylphylloquinone + diphosphate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
2-carboxy-1,4-naphthoquinone + H+ + phytyl diphosphate ⟶ CO2 + demethylphylloquinone + diphosphate
- phylloquinol biosynthesis:
2-carboxy-1,4-naphthoquinone + H+ + phytyl diphosphate ⟶ CO2 + demethylphylloquinone + diphosphate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- superpathway of phylloquinol biosynthesis:
SAM + demethylphylloquinol ⟶ H+ + SAH + phylloquinol
- phylloquinol biosynthesis:
SAM + demethylphylloquinol ⟶ H+ + SAH + phylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- superpathway of phylloquinol biosynthesis:
SAM + demethylphylloquinol ⟶ H+ + SAH + phylloquinol
- phylloquinol biosynthesis:
SAM + demethylphylloquinol ⟶ H+ + SAH + phylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- superpathway of phylloquinol biosynthesis:
2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate ⟶ (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + pyruvate
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phylloquinol biosynthesis:
H+ + NADPH + demethylphylloquinone ⟶ NADP+ + demethylphylloquinol
- phenylpropanoid biosynthesis:
4-coumaryl alcohol + NADP+ ⟶ 4-coumaraldehyde + H+ + NADPH
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + NADPH ⟶ 4-coumaraldehyde + NADP+ + coenzyme A
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
trans-feruloyl-CoA + H+ + NADPH ⟶ NADP+ + coenzyme A + coniferaldehyde
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
NADP+ + sinapyl alcohol ⟶ H+ + NADPH + sinapaldehyde
- phenylpropanoid biosynthesis:
4-coumaryl alcohol + NADP+ ⟶ 4-coumaraldehyde + H+ + NADPH
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
5-hydroxy-coniferaldehyde + SAM ⟶ H+ + SAH + sinapaldehyde
- phenylpropanoid biosynthesis:
trans-feruloyl-CoA + H+ + NADPH ⟶ NADP+ + coenzyme A + coniferaldehyde
- phenylpropanoid biosynthesis:
trans-feruloyl-CoA + H+ + NADPH ⟶ NADP+ + coenzyme A + coniferaldehyde
- phenylpropanoid biosynthesis:
H+ + NADPH + feruloyl-CoA ⟶ NADP+ + coenzyme A + coniferaldehyde
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
NADP+ + coniferyl alcohol ⟶ H+ + NADPH + coniferaldehyde
- phenylpropanoid biosynthesis:
4-coumaryl alcohol + NADP+ ⟶ 4-coumaraldehyde + H+ + NADPH
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + NADPH ⟶ 4-coumaraldehyde + NADP+ + coenzyme A
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
NADP+ + sinapyl alcohol ⟶ H+ + NADPH + sinapaldehyde
- phenylpropanoid biosynthesis:
NADP+ + coniferyl alcohol ⟶ H+ + NADPH + coniferaldehyde
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
NADP+ + sinapyl alcohol ⟶ H+ + NADPH + sinapaldehyde
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
NADP+ + coniferyl alcohol ⟶ H+ + NADPH + coniferaldehyde
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
NADP+ + coniferyl alcohol ⟶ H+ + NADPH + coniferaldehyde
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + NADPH ⟶ 4-coumaraldehyde + NADP+ + coenzyme A
- phenylpropanoid biosynthesis:
4-coumaryl alcohol + NADP+ ⟶ 4-coumaraldehyde + H+ + NADPH
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + NADPH ⟶ 4-coumaraldehyde + NADP+ + coenzyme A
- phenylpropanoid biosynthesis:
4-coumaryl alcohol + NADP+ ⟶ 4-coumaraldehyde + H+ + NADPH
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
H+ + NADPH + feruloyl-CoA ⟶ NADP+ + coenzyme A + coniferaldehyde
- phenylpropanoid biosynthesis:
NADP+ + coniferyl alcohol ⟶ H+ + NADPH + coniferaldehyde
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
NADP+ + coniferyl alcohol ⟶ H+ + NADPH + coniferaldehyde
- phenylpropanoid biosynthesis:
4-coumaryl alcohol + NADP+ ⟶ 4-coumaraldehyde + H+ + NADPH
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + NADPH ⟶ 4-coumaraldehyde + NADP+ + coenzyme A
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
H+ + NADPH + feruloyl-CoA ⟶ NADP+ + coenzyme A + coniferaldehyde
- phenylpropanoid biosynthesis:
4-coumaryl alcohol + NADP+ ⟶ 4-coumaraldehyde + H+ + NADPH
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + NADPH ⟶ 4-coumaraldehyde + NADP+ + coenzyme A
- phenylpropanoid biosynthesis:
4-coumaryl alcohol + NADP+ ⟶ 4-coumaraldehyde + H+ + NADPH
- phenylpropanoid biosynthesis:
trans-feruloyl-CoA + H+ + NADPH ⟶ NADP+ + coenzyme A + coniferaldehyde
- phenylpropanoid biosynthesis:
trans-feruloyl-CoA + H+ + NADPH ⟶ NADP+ + coenzyme A + coniferaldehyde
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
trans-feruloyl-CoA + H+ + NADPH ⟶ NADP+ + coenzyme A + coniferaldehyde
- phenylpropanoid biosynthesis:
trans-feruloyl-CoA + H+ + NADPH ⟶ NADP+ + coenzyme A + coniferaldehyde
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + NADPH ⟶ 4-coumaraldehyde + NADP+ + coenzyme A
- phenylpropanoid biosynthesis:
4-coumaryl alcohol + NADP+ ⟶ 4-coumaraldehyde + H+ + NADPH
- phenylpropanoid biosynthesis:
NADP+ + sinapyl alcohol ⟶ H+ + NADPH + sinapaldehyde
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + NADPH ⟶ 4-coumaraldehyde + NADP+ + coenzyme A
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
trans-feruloyl-CoA + H+ + NADPH ⟶ NADP+ + coenzyme A + coniferaldehyde
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + NADPH ⟶ 4-coumaraldehyde + NADP+ + coenzyme A
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
H+ + NADPH + feruloyl-CoA ⟶ NADP+ + coenzyme A + coniferaldehyde
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
trans-feruloyl-CoA + H+ + NADPH ⟶ NADP+ + coenzyme A + coniferaldehyde
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
NADP+ + coniferyl alcohol ⟶ H+ + NADPH + coniferaldehyde
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
trans-feruloyl-CoA + H+ + NADPH ⟶ NADP+ + coenzyme A + coniferaldehyde
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
H+ + NADPH + feruloyl-CoA ⟶ NADP+ + coenzyme A + coniferaldehyde
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + H+ + NADPH ⟶ 4-coumaraldehyde + NADP+ + coenzyme A
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
trans-feruloyl-CoA + H+ + NADPH ⟶ NADP+ + coenzyme A + coniferaldehyde
- phenylpropanoid biosynthesis:
4-coumaryl alcohol + NADP+ ⟶ 4-coumaraldehyde + H+ + NADPH
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
trans-feruloyl-CoA + H+ + NADPH ⟶ NADP+ + coenzyme A + coniferaldehyde
- phenylpropanoid biosynthesis:
H+ + NADPH + feruloyl-CoA ⟶ NADP+ + coenzyme A + coniferaldehyde
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
5-hydroxy-coniferaldehyde + SAM ⟶ H+ + SAH + sinapaldehyde
- ferulate and sinapate biosynthesis:
5-hydroxy-coniferaldehyde + SAM ⟶ H+ + SAH + sinapaldehyde
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- ferulate and sinapate biosynthesis:
H+ + NADPH + O2 + coniferaldehyde ⟶ 5-hydroxy-coniferaldehyde + H2O + NADP+
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
NADP+ + sinapyl alcohol ⟶ H+ + NADPH + sinapaldehyde
- ferulate and sinapate biosynthesis:
H2O + NADP+ + sinapaldehyde ⟶ H+ + NADPH + sinapate
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
(E)-4-coumaroyl-CoA + L-quinate ⟶ trans-5-O-(4-coumaroyl)-D-quinate + coenzyme A
- phenylpropanoid biosynthesis:
trans-5-O-caffeoyl-D-quinate + coenzyme A ⟶ trans-caffeoyl-CoA + L-quinate
- phenylpropanoid biosynthesis:
H+ + NADPH + feruloyl-CoA ⟶ NADP+ + coenzyme A + coniferaldehyde
- guaiacol biosynthesis:
SAM + catechol ⟶ H+ + SAH + guaiacol
- guaiacol biosynthesis:
SAM + catechol ⟶ H+ + SAH + guaiacol
- guaiacol biosynthesis:
SAM + catechol ⟶ H+ + SAH + guaiacol
- guaiacol biosynthesis:
SAM + catechol ⟶ H+ + SAH + guaiacol
- t-anethole biosynthesis:
trans-anol + SAM ⟶ t-anethole + H+ + SAH
- t-anethole biosynthesis:
trans-anol + SAM ⟶ t-anethole + H+ + SAH
- t-anethole biosynthesis:
trans-anol + SAM ⟶ t-anethole + H+ + SAH
- t-anethole biosynthesis:
trans-anol + SAM ⟶ t-anethole + H+ + SAH
- epoxypseudoisoeugenol-2-methylbutanoate biosynthesis:
2-methylbutanoate + pseudoisoeugenol ⟶ epoxypseudoisoeugenol-2-methylbutanoate
- t-anethole biosynthesis:
trans-anol + SAM ⟶ t-anethole + H+ + SAH
- t-anethole biosynthesis:
trans-anol + SAM ⟶ t-anethole + H+ + SAH
- t-anethole biosynthesis:
trans-anol + SAM ⟶ t-anethole + H+ + SAH
- t-anethole biosynthesis:
trans-anol + SAM ⟶ t-anethole + H+ + SAH
- t-anethole biosynthesis:
trans-anol + SAM ⟶ t-anethole + H+ + SAH
- t-anethole biosynthesis:
trans-anol + SAM ⟶ t-anethole + H+ + SAH
- t-anethole biosynthesis:
trans-anol + SAM ⟶ t-anethole + H+ + SAH
- pinobanksin biosynthesis:
(2S)-pinocembrin + SAM ⟶ SAH + pinostrobin
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- coniferyl alcohol 9-methyl ester biosynthesis:
SAM + coniferyl alcohol ⟶ H+ + SAH + coniferyl alcohol 9-methyl ester
- coniferyl alcohol 9-methyl ester biosynthesis:
SAM + coniferyl alcohol ⟶ H+ + SAH + coniferyl alcohol 9-methyl ester
- coniferyl alcohol 9-methyl ester biosynthesis:
SAM + coniferyl alcohol ⟶ H+ + SAH + coniferyl alcohol 9-methyl ester
- botryococcenes and methylated squalene biosynthesis:
NADP+ + diphosphate + squalene ⟶ H+ + NADPH + presqualene diphosphate
- nevadensin biosynthesis:
2-oxoglutarate + O2 + gardenin B ⟶ CO2 + formaldehyde + nevadensin + succinate
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
(Z)-6'-hydroxyferulate ⟶ scopoletin
- simple coumarins biosynthesis:
scopoletin ⟶ a demethylated methyl donor + scoparone
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- esculetin modification:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- esculetin modification:
SAM + esculetin ⟶ H+ + SAH + scopoletin
- superpathway of scopolin and esculin biosynthesis:
(Z)-6'-hydroxyferulate ⟶ scopoletin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- esculetin modification:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- esculetin modification:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
UDP-α-D-glucose + scopoletin ⟶ H+ + UDP + scopolin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- superpathway of scopolin and esculin biosynthesis:
H2O + esculin ⟶ D-glucopyranose + esculetin
- colchicine biosynthesis:
(S)-isoandrocymbine + SAM ⟶ H+ + O-methylandrocymbine + SAH
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- superpathway of thiamine diphosphate biosynthesis III (eukaryotes):
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis I:
AIR + SAM ⟶ 5'-deoxyadenosine + CO + H+ + HMP-P + formate + met
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- pinobanksin biosynthesis:
(2S)-pinocembrin + 2-oxoglutarate + O2 ⟶ (+)-pinobanksin + CO2 + succinate
- papaverine biosynthesis:
(S)-laudanine + SAM ⟶ (S)-laudanosine + H+ + SAH
- papaverine biosynthesis:
(S)-laudanine + SAM ⟶ (S)-laudanosine + H+ + SAH
- papaverine biosynthesis:
(S)-laudanine + SAM ⟶ (S)-laudanosine + H+ + SAH
- papaverine biosynthesis:
(S)-norlaudanine + SAM ⟶ (S)-tetrahydropapaverine + H+ + SAH
- papaverine biosynthesis:
(S)-laudanine + SAM ⟶ (S)-laudanosine + H+ + SAH
- papaverine biosynthesis:
(S)-laudanine + SAM ⟶ (S)-laudanosine + H+ + SAH
- papaverine biosynthesis:
(S)-norlaudanine + SAM ⟶ (S)-tetrahydropapaverine + H+ + SAH
- papaverine biosynthesis:
(S)-laudanine + SAM ⟶ (S)-laudanosine + H+ + SAH
- papaverine biosynthesis:
(S)-laudanine + SAM ⟶ (S)-laudanosine + H+ + SAH
- papaverine biosynthesis:
(S)-laudanine + SAM ⟶ (S)-laudanosine + H+ + SAH
- papaverine biosynthesis:
(S)-laudanine + SAM ⟶ (S)-laudanosine + H+ + SAH
- papaverine biosynthesis:
(S)-laudanine + SAM ⟶ (S)-laudanosine + H+ + SAH
- papaverine biosynthesis:
(S)-laudanine + SAM ⟶ (S)-laudanosine + H+ + SAH
- papaverine biosynthesis:
(S)-laudanine + SAM ⟶ (S)-laudanosine + H+ + SAH
- papaverine biosynthesis:
A + dihydropapaverine ⟶ A(H2) + papaverine
- papaverine biosynthesis:
(S)-laudanine + SAM ⟶ (S)-laudanosine + H+ + SAH
- papaverine biosynthesis:
(S)-laudanine + SAM ⟶ (S)-laudanosine + H+ + SAH
- papaverine biosynthesis:
(S)-laudanine + SAM ⟶ (S)-laudanosine + H+ + SAH
- papaverine biosynthesis:
(S)-laudanine + SAM ⟶ (S)-laudanosine + H+ + SAH
- papaverine biosynthesis:
(S)-laudanine + SAM ⟶ (S)-laudanosine + H+ + SAH
- papaverine biosynthesis:
(S)-laudanine + SAM ⟶ (S)-laudanosine + H+ + SAH
- papaverine biosynthesis:
(S)-norlaudanine + SAM ⟶ (S)-tetrahydropapaverine + H+ + SAH
- papaverine biosynthesis:
(S)-laudanine + SAM ⟶ (S)-laudanosine + H+ + SAH
- papaverine biosynthesis:
(S)-norlaudanine + SAM ⟶ (S)-tetrahydropapaverine + H+ + SAH
- papaverine biosynthesis:
(S)-laudanine + SAM ⟶ (S)-laudanosine + H+ + SAH
- papaverine biosynthesis:
(S)-laudanine + SAM ⟶ (S)-laudanosine + H+ + SAH
- papaverine biosynthesis:
(S)-laudanine + SAM ⟶ (S)-laudanosine + H+ + SAH
- papaverine biosynthesis:
(S)-laudanine + SAM ⟶ (S)-laudanosine + H+ + SAH
- papaverine biosynthesis:
(S)-laudanine + SAM ⟶ (S)-laudanosine + H+ + SAH
- papaverine biosynthesis:
(S)-laudanine + SAM ⟶ (S)-laudanosine + H+ + SAH
- papaverine biosynthesis:
A + dihydropapaverine ⟶ A(H2) + papaverine
- papaverine biosynthesis:
(S)-norlaudanine + SAM ⟶ (S)-tetrahydropapaverine + H+ + SAH
- papaverine biosynthesis:
(S)-laudanine + SAM ⟶ (S)-laudanosine + H+ + SAH
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
O2 + a reduced [NADPH-hemoprotein reductase] + sitosterol ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + stigmasterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
4α-carboxy-4β,14α-dimethyl-9β,19-cyclo-5α-ergost-24(241)-en-3β-ol + NAD+ ⟶ CO2 + NADH + cycloeucalenone
- 26,27-dehydrozymosterol metabolism:
26,27-dehydrozymosterol + H+ + MeOH + SAM ⟶ 24-alkyl sterol 2 + SAH + methyl
- 26,27-dehydrozymosterol metabolism:
26,27-dehydrozymosterol + H+ + MeOH + SAM ⟶ 26-hydroxy-27-methyl-zymosterol + SAH + methyl
- 26,27-dehydrozymosterol metabolism:
26,27-dehydrozymosterol + H+ + MeOH + SAM ⟶ 24-alkyl sterol 2 + SAH + methyl
- 26,27-dehydrozymosterol metabolism:
26,27-dehydrozymosterol + H+ + MeOH + SAM ⟶ 26-hydroxy-27-methyl-zymosterol + SAH + methyl
- rot-2'-enonate biosynthesis:
SAM + calycosin ⟶ 2',7-dihydroxy-4',5'-dimethoxyisoflavone + SAH
- diacylglyceryl-N,N,N-trimethylhomoserine biosynthesis:
SAM + a 1,2-diacyl-sn-glycerol ⟶ S-methyl-5'-thioadenosine + H+ + a diacylglycerolhomoserine
- diacylglyceryl-N,N,N-trimethylhomoserine biosynthesis:
SAM + a 1,2-diacyl-sn-glycerol ⟶ S-methyl-5'-thioadenosine + H+ + a diacylglycerolhomoserine
- polymethylated quercetin glucoside biosynthesis II - quercetagetin series (Chrysosplenium):
3,6,7-trimethylquercetagetin + SAM ⟶ 3,6,7,4'-tetramethylquercetagetin + H+ + SAH
- superpathway of polymethylated quercetin/quercetagetin glucoside biosynthesis (Chrysosplenium):
3,6,7-trimethylquercetagetin + SAM ⟶ 3,6,7,4'-tetramethylquercetagetin + H+ + SAH
- superpathway of pterocarpan biosynthesis (via formononetin):
H+ + NADPH + O2 + calycosin ⟶ H2O + NADP+ + pseudobaptigenin
- superpathway of pterocarpan biosynthesis (via formononetin):
O2 + a reduced [NADPH-hemoprotein reductase] + formononetin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + calycosin
- (+)-pisatin biosynthesis:
(3R,4R)-7,2,4,2'-tetrahydroxy-4',5'-methylenedioxyisoflav-3-ene ⟶ (+)-6a-hydroxymaackiain + H2O
- palmatine biosynthesis:
(S)-tetrahydrocolumbamine + H+ + O2 ⟶ columbamine + hydrogen peroxide
- palmatine biosynthesis:
H+ + O2 + S-tetrahydrocolumbamine ⟶ columbamine + hydrogen peroxide
- palmatine biosynthesis:
(S)-tetrahydrocolumbamine + SAM ⟶ (S)-tetrahydropalmatine + H+ + SAH
- hesperitin glycoside biosynthesis:
(2S)-eriodictyol + SAM ⟶ (2S)-hesperetin + H+ + SAH
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2-oxoglutarate + L-nicotianamine ⟶ 3''-deamino-3''-oxonicotianamine + glu
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2-oxoglutarate + L-nicotianamine ⟶ 3''-deamino-3''-oxonicotianamine + glu
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2-oxoglutarate + L-nicotianamine ⟶ 3''-deamino-3''-oxonicotianamine + glu
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2-oxoglutarate + L-nicotianamine ⟶ 3''-deamino-3''-oxonicotianamine + glu
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2-oxoglutarate + L-nicotianamine ⟶ 3''-deamino-3''-oxonicotianamine + glu
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2-oxoglutarate + L-nicotianamine ⟶ 3''-deamino-3''-oxonicotianamine + glu
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2-oxoglutarate + L-nicotianamine ⟶ 3''-deamino-3''-oxonicotianamine + glu
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2-oxoglutarate + L-nicotianamine ⟶ 3''-deamino-3''-oxonicotianamine + glu
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2-oxoglutarate + L-nicotianamine ⟶ 3''-deamino-3''-oxonicotianamine + glu
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2-oxoglutarate + L-nicotianamine ⟶ 3''-deamino-3''-oxonicotianamine + glu
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2-oxoglutarate + L-nicotianamine ⟶ 3''-deamino-3''-oxonicotianamine + Glu
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2-oxoglutarate + L-nicotianamine ⟶ 3''-deamino-3''-oxonicotianamine + Glu
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis I (archaea):
SAM + an L-histidine-[translation elongation factor 2] ⟶ S-methyl-5'-thioadenosine + H+ + a 2-[(3S)-3-amino-3-carboxypropyl]-L-histidine-[translation elongation factor 2]
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- diphthamide biosynthesis I (archaea):
SAM + an L-histidine-[translation elongation factor 2] ⟶ S-methyl-5'-thioadenosine + H+ + a 2-[(3S)-3-amino-3-carboxypropyl]-L-histidine-[translation elongation factor 2]
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- diacylglyceryl-N,N,N-trimethylhomoserine biosynthesis:
SAM + a 1,2-diacyl-sn-glycerol ⟶ S-methyl-5'-thioadenosine + H+ + a diacylglycerolhomoserine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- diacylglyceryl-N,N,N-trimethylhomoserine biosynthesis:
SAM + a 1,2-diacyl-sn-glycerol ⟶ S-methyl-5'-thioadenosine + H+ + a diacylglycerolhomoserine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- diacylglyceryl-N,N,N-trimethylhomoserine biosynthesis:
SAM + a 1,2-diacyl-sn-glycerol ⟶ S-methyl-5'-thioadenosine + H+ + a diacylglycerolhomoserine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- diacylglyceryl-N,N,N-trimethylhomoserine biosynthesis:
SAM + a 1,2-diacyl-sn-glycerol ⟶ S-methyl-5'-thioadenosine + H+ + a diacylglycerolhomoserine
- diacylglyceryl-N,N,N-trimethylhomoserine biosynthesis:
SAM + a 1,2-diacyl-sn-glycerol ⟶ S-methyl-5'-thioadenosine + H+ + a diacylglycerolhomoserine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- diacylglyceryl-N,N,N-trimethylhomoserine biosynthesis:
SAM + a 1,2-diacyl-sn-glycerol ⟶ S-methyl-5'-thioadenosine + H+ + a diacylglycerolhomoserine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- diphthamide biosynthesis I (archaea):
SAM + an L-histidine-[translation elongation factor 2] ⟶ S-methyl-5'-thioadenosine + H+ + a 2-[(3S)-3-amino-3-carboxypropyl]-L-histidine-[translation elongation factor 2]
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- diacylglyceryl-N,N,N-trimethylhomoserine biosynthesis:
SAM + a 1,2-diacyl-sn-glycerol ⟶ S-methyl-5'-thioadenosine + H+ + a diacylglycerolhomoserine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- diacylglyceryl-N,N,N-trimethylhomoserine biosynthesis:
SAM + a 1,2-diacyl-sn-glycerol ⟶ S-methyl-5'-thioadenosine + H+ + a diacylglycerolhomoserine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- diacylglyceryl-N,N,N-trimethylhomoserine biosynthesis:
SAM + a 1,2-diacyl-sn-glycerol ⟶ S-methyl-5'-thioadenosine + H+ + a diacylglycerolhomoserine
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- diacylglyceryl-N,N,N-trimethylhomoserine biosynthesis:
SAM + a 1,2-diacyl-sn-glycerol ⟶ S-methyl-5'-thioadenosine + H+ + a diacylglycerolhomoserine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diacylglyceryl-N,N,N-trimethylhomoserine biosynthesis:
SAM + a 1,2-diacyl-sn-glycerol ⟶ S-methyl-5'-thioadenosine + H+ + a diacylglycerolhomoserine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diacylglyceryl-N,N,N-trimethylhomoserine biosynthesis:
SAM + a 1,2-diacyl-sn-glycerol ⟶ S-methyl-5'-thioadenosine + H+ + a diacylglycerolhomoserine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- ethylene biosynthesis I (plants):
1-aminocyclopropane-1-carboxylate + H+ + L-ascorbate + O2 ⟶ CO2 + H2O + L-dehydro-ascorbate + ethene + hydrogen cyanide
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-methionine salvage cycle II (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- diphthamide biosynthesis II (eukaryotes):
H2O + a diphthine methyl ester-[translation elongation factor 2] ⟶ H+ + MeOH + a diphthine-[translation elongation factor 2]
- ethylene biosynthesis I (plants):
SAM ⟶ 1-aminocyclopropane-1-carboxylate + S-methyl-5'-thioadenosine + H+
- L-methionine salvage cycle II (plants):
S-methyl-5'-thioadenosine + H2O ⟶ MTR + adenine
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- L-methionine salvage cycle II (plants):
4-(methylsulfanyl)-2-oxobutanoate + gln ⟶ 2-oxoglutaramate + met
- L-nicotianamine biosynthesis:
SAM ⟶ S-methyl-5'-thioadenosine + H+ + L-nicotianamine
- ethene biosynthesis I (plants):
ATP + H2O + met ⟶ SAM + diphosphate + phosphate
- L-methionine salvage cycle II (plants):
4-(methylsulfanyl)-2-oxobutanoate + gln ⟶ 2-oxoglutaramate + met
- 2'-deoxymugineic acid phytosiderophore biosynthesis:
2'-deoxymugineate + NAD(P)+ ⟶ 3''-deamino-3''-oxonicotianamine + H+ + NAD(P)H
- L-methionine salvage cycle II (plants):
4-(methylsulfanyl)-2-oxobutanoate + gln ⟶ 2-oxoglutaramate + met
- bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin
- bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin
- bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin
- bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin
- bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin
- bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin
- bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin
- bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin
- bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin
- bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin
- bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin
- bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin
- bixin biosynthesis:
SAM + bixin ⟶ SAH + bixin dimethyl ester
- bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin
- bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin
- bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin
- bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin
- bixin biosynthesis:
H2O + NAD+ + bixin aldehyde ⟶ H+ + NADH + norbixin
- bixin biosynthesis:
all-trans-lycopene + O2 ⟶ bixin aldehyde + sulcatone
- sanguinarine and macarpine biosynthesis:
H+ + O2 + dihydrosanguinarine ⟶ hydrogen peroxide + sanguinarine
- sanguinarine and macarpine biosynthesis:
H+ + O2 + dihydrosanguinarine ⟶ hydrogen peroxide + sanguinarine
- sanguinarine and macarpine biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + protopine ⟶ 6-hydroxyprotopine + H2O + an oxidized [NADPH-hemoprotein reductase]
- sanguinarine and macarpine biosynthesis:
(S)-reticuline + O2 ⟶ (S)-scoulerine + H+ + hydrogen peroxide
- sanguinarine and macarpine biosynthesis:
H+ + O2 + dihydrosanguinarine ⟶ hydrogen peroxide + sanguinarine
- sanguinarine and macarpine biosynthesis:
H+ + O2 + dihydrosanguinarine ⟶ hydrogen peroxide + sanguinarine
- sanguinarine and macarpine biosynthesis:
H+ + O2 + dihydrosanguinarine ⟶ hydrogen peroxide + sanguinarine
- sanguinarine and macarpine biosynthesis:
H+ + O2 + dihydrosanguinarine ⟶ hydrogen peroxide + sanguinarine
- sanguinarine and macarpine biosynthesis:
(S)-reticuline + O2 ⟶ (S)-scoulerine + H+ + hydrogen peroxide
- sanguinarine and macarpine biosynthesis:
(S)-cis-N-methylstylopine + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H+ + H2O + an oxidized [NADPH-hemoprotein reductase] + protopine
- sanguinarine and macarpine biosynthesis:
H+ + O2 + dihydrosanguinarine ⟶ hydrogen peroxide + sanguinarine
- sanguinarine and macarpine biosynthesis:
H+ + O2 + dihydrosanguinarine ⟶ hydrogen peroxide + sanguinarine
- sanguinarine and macarpine biosynthesis:
H+ + O2 + dihydrosanguinarine ⟶ hydrogen peroxide + sanguinarine
- sanguinarine and macarpine biosynthesis:
(S)-reticuline + O2 ⟶ (S)-scoulerine + H+ + hydrogen peroxide
- sanguinarine and macarpine biosynthesis:
H+ + O2 + dihydrosanguinarine ⟶ hydrogen peroxide + sanguinarine
- sanguinarine and macarpine biosynthesis:
H+ + O2 + dihydrosanguinarine ⟶ hydrogen peroxide + sanguinarine
- sanguinarine and macarpine biosynthesis:
NAD(P)+ + dihydrosanguinarine ⟶ NAD(P)H + sanguinarine
- volatile cinnamoic ester biosynthesis:
SAM + eugenol ⟶ H+ + SAH + methyleugenol
- volatile cinnamoic ester biosynthesis:
SAM + eugenol ⟶ H+ + SAH + methyleugenol
- volatile cinnamoic ester biosynthesis:
SAM + eugenol ⟶ H+ + SAH + methyleugenol
- volatile cinnamoic ester biosynthesis:
SAM + eugenol ⟶ H+ + SAH + methyleugenol
- volatile cinnamoic ester biosynthesis:
SAM + eugenol ⟶ H+ + SAH + methyleugenol
- volatile cinnamoic ester biosynthesis:
SAM + eugenol ⟶ H+ + SAH + methyleugenol
- volatile cinnamoic ester biosynthesis:
SAM + eugenol ⟶ H+ + SAH + methyleugenol
- volatile cinnamoic ester biosynthesis:
SAM + eugenol ⟶ H+ + SAH + methyleugenol
- volatile cinnamoic ester biosynthesis:
SAM + eugenol ⟶ H+ + SAH + methyleugenol
- volatile cinnamoic ester biosynthesis:
SAM + eugenol ⟶ H+ + SAH + methyleugenol
- volatile cinnamoic ester biosynthesis:
SAM + eugenol ⟶ H+ + SAH + methyleugenol
- volatile cinnamoic ester biosynthesis:
SAM + eugenol ⟶ H+ + SAH + methyleugenol
- volatile cinnamoic ester biosynthesis:
SAM + eugenol ⟶ H+ + SAH + methyleugenol
- volatile cinnamoic ester biosynthesis:
SAM + isoeugenol ⟶ H+ + SAH + isomethyleugenol
- volatile cinnamoic ester biosynthesis:
SAM + eugenol ⟶ H+ + SAH + methyleugenol
- volatile cinnamoic ester biosynthesis:
SAM + eugenol ⟶ H+ + SAH + methyleugenol
- volatile cinnamoic ester biosynthesis:
SAM + eugenol ⟶ H+ + SAH + methyleugenol
- volatile cinnamoic ester biosynthesis:
SAM + eugenol ⟶ H+ + SAH + methyleugenol
- volatile cinnamoic ester biosynthesis:
SAM + eugenol ⟶ H+ + SAH + methyleugenol
- volatile cinnamoic ester biosynthesis:
SAM + eugenol ⟶ H+ + SAH + methyleugenol
- volatile cinnamoic ester biosynthesis:
SAM + eugenol ⟶ H+ + SAH + methyleugenol
- volatile cinnamoic ester biosynthesis:
SAM + eugenol ⟶ H+ + SAH + methyleugenol
- volatile cinnamoic ester biosynthesis:
SAM + eugenol ⟶ H+ + SAH + methyleugenol
- volatile cinnamoic ester biosynthesis:
SAM + eugenol ⟶ H+ + SAH + methyleugenol
- volatile cinnamoic ester biosynthesis:
SAM + eugenol ⟶ H+ + SAH + methyleugenol
- volatile cinnamoic ester biosynthesis:
SAM + eugenol ⟶ H+ + SAH + methyleugenol
- volatile cinnamoic ester biosynthesis:
SAM + eugenol ⟶ H+ + SAH + methyleugenol
- volatile cinnamoic ester biosynthesis:
SAM + eugenol ⟶ H+ + SAH + methyleugenol
- volatile cinnamoic ester biosynthesis:
SAM + isoeugenol ⟶ H+ + SAH + isomethyleugenol
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- superpathway of isoflavonoids (via naringenin):
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H+ + H2O + an oxidized [NADPH-hemoprotein reductase] + apigenin
- isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin
- isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+
- isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+
- isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+
- isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+
- isoflavonoid biosynthesis II:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- superpathway of isoflavonoids (via naringenin):
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + an oxidized [NADPH-hemoprotein reductase]
- isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+
- isoflavonoid biosynthesis II:
(2S)-naringenin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H+ + H2O + an oxidized [NADPH-hemoprotein reductase] + apigenin
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin
- isoflavonoid biosynthesis II:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
SAM + genistein ⟶ SAH + prunetin
- superpathway of isoflavonoids (via naringenin):
SAM + genistein ⟶ SAH + prunetin
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+
- isoflavonoid biosynthesis II:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H+ + H2O + an oxidized [NADPH-hemoprotein reductase] + apigenin
- superpathway of isoflavonoids (via naringenin):
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+
- isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- superpathway of isoflavonoids (via naringenin):
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + H+ + NADPH + O2 ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + NADP+
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + NADPH + O2 ⟶ H2O + NADP+ + apigenin
- isoflavonoid biosynthesis II:
(2S)-naringenin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 2,4',5,7-tetrahydroxyisoflavanone + H2O + an oxidized [NADPH-hemoprotein reductase]
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
(2S)-naringenin + 2-oxoglutarate + O2 ⟶ CO2 + H+ + H2O + apigenin + succinate
- isoflavonoid biosynthesis II:
2,4',5,7-tetrahydroxyisoflavanone + SAM ⟶ 2,5,7-trihydroxy-4'-methoxyisoflavanone + H+ + SAH
- isoflavonoid biosynthesis II:
SAM + genistein ⟶ SAH + prunetin
- yatein biosynthesis I:
(-)-bursehernin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (-)-5'-demethylyatein + H2O + an oxidized [NADPH-hemoprotein reductase]
- yatein biosynthesis I:
(-)-pluviatolide + SAM ⟶ (-)-bursehernin + H+ + SAH
- emetine biosynthesis:
SAM + cephaeline ⟶ H+ + SAH + emetine
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + salicylate ⟶ SAH + methylsalicylate
- sakuranetin biosynthesis:
(2S)-naringenin + SAM ⟶ (2S)-sakuranetin + H+ + SAH
- sakuranetin biosynthesis:
(2S)-naringenin + SAM ⟶ (2S)-sakuranetin + H+ + SAH
- sakuranetin biosynthesis:
(2S)-naringenin + SAM ⟶ (2S)-sakuranetin + H+ + SAH
- sakuranetin biosynthesis:
(2S)-naringenin + SAM ⟶ (2S)-sakuranetin + H+ + SAH
- sakuranetin biosynthesis:
(2S)-naringenin + SAM ⟶ (2S)-sakuranetin + H+ + SAH
- sakuranetin biosynthesis:
(2S)-naringenin + SAM ⟶ (2S)-sakuranetin + H+ + SAH
- sakuranetin biosynthesis:
(2S)-naringenin + SAM ⟶ (2S)-sakuranetin + H+ + SAH
- sakuranetin biosynthesis:
(2S)-naringenin + SAM ⟶ (2S)-sakuranetin + H+ + SAH
- sakuranetin biosynthesis:
(2S)-naringenin + SAM ⟶ (2S)-sakuranetin + H+ + SAH
- sakuranetin biosynthesis:
(2S)-naringenin + SAM ⟶ (2S)-sakuranetin + H+ + SAH
- sakuranetin biosynthesis:
(2S)-naringenin + SAM ⟶ (2S)-sakuranetin + H+ + SAH
- sakuranetin biosynthesis:
(2S)-naringenin + SAM ⟶ (2S)-sakuranetin + H+ + SAH
- sakuranetin biosynthesis:
(2S)-naringenin + SAM ⟶ (2S)-sakuranetin + H+ + SAH
- sakuranetin biosynthesis:
(2S)-naringenin + SAM ⟶ (2S)-sakuranetin + H+ + SAH
- sakuranetin biosynthesis:
(2S)-naringenin + SAM ⟶ (2S)-sakuranetin + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
2-methyl-6-phytyl-1,4-benzoquinol + SAM ⟶ 2,3-dimethyl-6-phytyl-1,4-benzoquinol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
H+ + homogentisate + phytyl diphosphate ⟶ 2-methyl-6-phytyl-1,4-benzoquinol + CO2 + diphosphate
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
2-methyl-6-phytyl-1,4-benzoquinol + SAM ⟶ 2,3-dimethyl-6-phytyl-1,4-benzoquinol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocopherols):
δ-tocopherol + SAM ⟶ β-tocopherol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol ⟶ 2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
2-methyl-6-geranylgeranyl-1,4-benzoquinol + SAM ⟶ 2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
2-methyl-6-geranylgeranyl-1,4-benzoquinol + SAM ⟶ 2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
γ-tocotrienol + SAM ⟶ α-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
δ-tocotrienol + SAM ⟶ β-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
δ-tocotrienol + SAM ⟶ β-tocotrienol + H+ + SAH
- vitamin E biosynthesis (tocotrienols):
δ-tocotrienol + SAM ⟶ β-tocotrienol + H+ + SAH
- pinosylvin metabolism:
SAM + pinosylvin ⟶ H+ + SAH + pinosylvin monomethylether
- isoflavonoid biosynthesis I:
SAM + daidzein ⟶ H+ + SAH + isoformononetin
- formononetin biosynthesis:
SAM + daidzein ⟶ H+ + SAH + formononetin
- formononetin biosynthesis:
SAM + daidzein ⟶ H+ + SAH + formononetin
- isoflavonoid biosynthesis I:
2,4',7-trihydroxyisoflavanone ⟶ H2O + daidzein
- superpathway of pterocarpan biosynthesis (via formononetin):
O2 + a reduced [NADPH-hemoprotein reductase] + calycosin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + pseudobaptigenin
- isoflavonoid biosynthesis I:
2,4',7-trihydroxyisoflavanone ⟶ H2O + daidzein
- formononetin biosynthesis:
2,4',7-trihydroxyisoflavanone ⟶ H2O + daidzein
- formononetin biosynthesis:
SAM + daidzein ⟶ H+ + SAH + formononetin
- isoflavonoid biosynthesis I:
2,4',7-trihydroxyisoflavanone ⟶ H2O + daidzein
- superpathway of pterocarpan biosynthesis (via formononetin):
O2 + a reduced [NADPH-hemoprotein reductase] + formononetin ⟶ 2-hydroxyformononetin + H2O + an oxidized [NADPH-hemoprotein reductase]
- isoflavonoid biosynthesis I:
2,4',7-trihydroxyisoflavanone ⟶ H2O + daidzein
- formononetin biosynthesis:
SAM + daidzein ⟶ H+ + SAH + formononetin
- formononetin biosynthesis:
SAM + daidzein ⟶ H+ + SAH + formononetin
- isoflavonoid biosynthesis I:
SAM + daidzein ⟶ H+ + SAH + isoformononetin
- superpathway of pterocarpan biosynthesis (via formononetin):
O2 + a reduced [NADPH-hemoprotein reductase] + calycosin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + pseudobaptigenin
- formononetin biosynthesis:
2,4',7-trihydroxyisoflavanone ⟶ H2O + daidzein
- superpathway of pterocarpan biosynthesis (via formononetin):
O2 + a reduced [NADPH-hemoprotein reductase] + formononetin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + calycosin
- isoflavonoid biosynthesis I:
2,4',7-trihydroxyisoflavanone ⟶ H2O + daidzein
- superpathway of pterocarpan biosynthesis (via formononetin):
O2 + a reduced [NADPH-hemoprotein reductase] + formononetin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + calycosin
- isoflavonoid biosynthesis I:
2,4',7-trihydroxyisoflavanone ⟶ H2O + daidzein
- formononetin biosynthesis:
2,4',7-trihydroxyisoflavanone ⟶ H2O + daidzein
- isoflavonoid biosynthesis I:
SAM + daidzein ⟶ H+ + SAH + isoformononetin
- formononetin biosynthesis:
SAM + daidzein ⟶ H+ + SAH + formononetin
- trigonelline biosynthesis:
SAM + nicotinate ⟶ SAH + trigonelline
- trigonelline biosynthesis:
SAM + nicotinate ⟶ SAH + trigonelline
- fluoroacetate and fluorothreonine biosynthesis:
5'-deoxy-5'-fluoroadenosine + phosphate ⟶ 5-fluoro-5-deoxy-D-ribose 1-phosphate + adenine
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
H+ + NADPH + O2 + genkwanin ⟶ H2O + NADP+ + scutellarein 7-methyl ether
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
H+ + NADPH + O2 + apigenin-7,4'-dimethyl ether ⟶ H2O + NADP+ + ladanein
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
SAM + apigenin ⟶ SAH + genkwanin
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
H+ + NADPH + O2 + apigenin-7,4'-dimethyl ether ⟶ H2O + NADP+ + ladanein
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + apigenin-7,4'-dimethyl ether ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + ladanein
- salvigenin biosynthesis:
SAM + genkwanin ⟶ H+ + SAH + apigenin-7,4'-dimethyl ether
- salvigenin biosynthesis:
SAM + scutellarein 7-methyl ether ⟶ H+ + SAH + cirsimaritin
- vitamin E biosynthesis (tocopherols):
γ-tocopherol + SAM ⟶ α-tocopherol + H+ + SAH
- ponciretin biosynthesis:
(2S)-naringenin + SAM ⟶ H+ + SAH + ponciretin
- ponciretin biosynthesis:
(2S)-naringenin + SAM ⟶ H+ + SAH + ponciretin
- theobromine biosynthesis I:
7-methylxanthosine + H2O ⟶ 7-methylxanthine + D-ribofuranose + H+
- caffeine biosynthesis I:
7-methylxanthosine + H2O ⟶ 7-methylxanthine + D-ribofuranose + H+
- theobromine biosynthesis I:
7-methylxanthine + SAM ⟶ H+ + SAH + theobromine
- caffeine biosynthesis I:
SAM + theobromine ⟶ H+ + SAH + caffeine
- theobromine biosynthesis II (via xanthine):
3-methylxanthine + SAM ⟶ H+ + SAH + theobromine
- theobromine biosynthesis I:
7-methylxanthine + SAM ⟶ H+ + SAH + theobromine
- caffeine biosynthesis I:
7-methylxanthine + SAM ⟶ H+ + SAH + theobromine
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + iodide ⟶ SAH + methyl iodide
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + iodide ⟶ SAH + methyl iodide
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + iodide ⟶ SAH + methyl iodide
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + chloride ⟶ SAH + methyl chloride
- methylhalides biosynthesis (plants):
SAM + iodide ⟶ SAH + methyl iodide
- eupatolitin 3-O-glucoside biosynthesis:
SAM + quercetagetin ⟶ H+ + SAH + patuletin
- noscapine biosynthesis:
(S)-reticuline + O2 ⟶ (S)-scoulerine + H+ + hydrogen peroxide
- noscapine biosynthesis:
(S)-reticuline + O2 ⟶ (S)-scoulerine + H+ + hydrogen peroxide
- noscapine biosynthesis:
(S)-reticuline + O2 ⟶ (S)-scoulerine + H+ + hydrogen peroxide
- noscapine biosynthesis:
(S)-reticuline + O2 ⟶ (S)-scoulerine + H+ + hydrogen peroxide
- 1,3,5-trimethoxybenzene biosynthesis:
3,5-dimethoxyphenol + SAM ⟶ 1,3,5-trimethoxybenzene + H+ + SAH
- 1,3,5-trimethoxybenzene biosynthesis:
3,5-dimethoxyphenol + SAM ⟶ 1,3,5-trimethoxybenzene + H+ + SAH
- 1,3,5-trimethoxybenzene biosynthesis:
3,5-dimethoxyphenol + SAM ⟶ 1,3,5-trimethoxybenzene + H+ + SAH
- 1,3,5-trimethoxybenzene biosynthesis:
3,5-dimethoxyphenol + SAM ⟶ 1,3,5-trimethoxybenzene + H+ + SAH
- 1,3,5-trimethoxybenzene biosynthesis:
3,5-dimethoxyphenol + SAM ⟶ 1,3,5-trimethoxybenzene + H+ + SAH
- 1,3,5-trimethoxybenzene biosynthesis:
3,5-dihydroxyanisole + SAM ⟶ 3,5-dimethoxyphenol + H+ + SAH
- 1,3,5-trimethoxybenzene biosynthesis:
3,5-dimethoxyphenol + SAM ⟶ 1,3,5-trimethoxybenzene + H+ + SAH
- 1,3,5-trimethoxybenzene biosynthesis:
3,5-dimethoxyphenol + SAM ⟶ 1,3,5-trimethoxybenzene + H+ + SAH
- 1,3,5-trimethoxybenzene biosynthesis:
3,5-dimethoxyphenol + SAM ⟶ 1,3,5-trimethoxybenzene + H+ + SAH
- 1,3,5-trimethoxybenzene biosynthesis:
3,5-dimethoxyphenol + SAM ⟶ 1,3,5-trimethoxybenzene + H+ + SAH
- 1,3,5-trimethoxybenzene biosynthesis:
3,5-dimethoxyphenol + SAM ⟶ 1,3,5-trimethoxybenzene + H+ + SAH
- phytosterol biosynthesis (plants):
isofucosterol ⟶ Δ24-25-sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
O2 + a reduced [NADPH-hemoprotein reductase] + sitosterol ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + stigmasterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
NADP+ + isofucosterol ⟶ 5-dehydroavenasterol + H+ + NADPH
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
isofucosterol ⟶ Δ24-25-sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phytosterol biosynthesis (plants):
Δ24-25-sitosterol + H+ + NADPH ⟶ NADP+ + sitosterol
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis V:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- superpathway of phosphatidylcholine biosynthesis:
CDP-choline + a 1,2-diacyl-sn-glycerol ⟶ CMP + H+ + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis V:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis IV:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- superpathway of phosphatidylcholine biosynthesis:
ATP + choline ⟶ ADP + H+ + phosphocholine
- phosphatidylcholine biosynthesis IV:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis IV:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis IV:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis V:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- superpathway of phosphatidylcholine biosynthesis:
ATP + choline ⟶ ADP + H+ + phosphocholine
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis IV:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis V:
SAM + an L-1-phosphatidylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-methylethanolamine
- superpathway of phosphatidylcholine biosynthesis:
ATP + choline ⟶ ADP + H+ + phosphocholine
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis IV:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis IV:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis IV:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis IV:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
N-methylethanolamine phosphate + SAM ⟶ H+ + N-dimethylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-methylethanolamine ⟶ H+ + SAH + a phosphatidyl-N-dimethylethanolamine
- phosphatidylcholine biosynthesis IV:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis III:
SAM + a phosphatidyl-N-dimethylethanolamine ⟶ H+ + SAH + a phosphatidylcholine
- phosphatidylcholine biosynthesis IV:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis III:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- phosphatidylcholine biosynthesis IV:
O-phosphoethanolamine + SAM ⟶ H+ + N-methylethanolamine phosphate + SAH
- free phenylpropanoid acid biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + ferulate ⟶ 5-hydroxyferulate + H2O + an oxidized [NADPH-hemoprotein reductase]
- free phenylpropanoid acid biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + ferulate ⟶ 5-hydroxyferulate + H2O + an oxidized [NADPH-hemoprotein reductase]
- free phenylpropanoid acid biosynthesis:
4-coumarate + H+ + NADPH + O2 ⟶ trans-caffeate + H2O + NADP+
- free phenylpropanoid acid biosynthesis:
5-hydroxyferulate + SAM ⟶ H+ + SAH + sinapate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- plastoquinol-9 biosynthesis I:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- plastoquinol-9 biosynthesis I:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- plastoquinol-9 biosynthesis I:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- plastoquinol-9 biosynthesis I:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- plastoquinol-9 biosynthesis I:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- plastoquinol-9 biosynthesis I:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- plastoquinol-9 biosynthesis I:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- plastoquinol-9 biosynthesis I:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- plastoquinol-9 biosynthesis I:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- plastoquinol-9 biosynthesis I:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- superpathway of plastoquinol biosynthesis:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- plastoquinol-9 biosynthesis I:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- superpathway of plastoquinol biosynthesis:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- superpathway of plastoquinol biosynthesis:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- plastoquinol-9 biosynthesis I:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- plastoquinol-9 biosynthesis I:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- superpathway of plastoquinol biosynthesis:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- superpathway of plastoquinol biosynthesis:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- plastoquinol-9 biosynthesis I:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- superpathway of plastoquinol biosynthesis:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- plastoquinol-9 biosynthesis I:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- plastoquinol-9 biosynthesis I:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- superpathway of plastoquinol biosynthesis:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- superpathway of plastoquinol biosynthesis:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- superpathway of plastoquinol biosynthesis:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- superpathway of plastoquinol biosynthesis:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- superpathway of plastoquinol biosynthesis:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- superpathway of plastoquinol biosynthesis:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- superpathway of plastoquinol biosynthesis:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- superpathway of plastoquinol biosynthesis:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- superpathway of plastoquinol biosynthesis:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- plastoquinol-9 biosynthesis I:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- plastoquinol-9 biosynthesis I:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- superpathway of plastoquinol biosynthesis:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- superpathway of plastoquinol biosynthesis:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
all-trans-nonaprenyl diphosphate + H+ + homogentisate ⟶ 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + CO2 + diphosphate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- plastoquinol-9 biosynthesis I:
3-(4-hydroxyphenyl)pyruvate + O2 ⟶ CO2 + homogentisate
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- superpathway of plastoquinol biosynthesis:
2-oxoglutarate + tyr ⟶ 3-(4-hydroxyphenyl)pyruvate + glu
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- plastoquinol-9 biosynthesis I:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- superpathway of plastoquinol biosynthesis:
2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol + SAM ⟶ H+ + SAH + plastoquinol-9
- noscapine biosynthesis:
(S)-reticuline + O2 ⟶ (S)-scoulerine + H+ + hydrogen peroxide
- chelerythrine biosynthesis:
(S)-reticuline + O2 ⟶ (S)-scoulerine + H+ + hydrogen peroxide
- chelerythrine biosynthesis:
(S)-canadine + SAM ⟶ (S)-N-methylcanadine + SAH
- noscapine biosynthesis:
(13S,14R)-13-O-acetyl-1-hydroxy-N-methylcanadine + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (13S,14R)-13-O-acetyl-1,8-dihydroxy-N-methylcanadine + H2O + an oxidized [NADPH-hemoprotein reductase]
- gossypol biosynthesis:
H2O + O2 + desoxyhemigossypol ⟶ hemigossypol + hydrogen peroxide
- gossypol biosynthesis:
H2O + O2 + desoxyhemigossypol ⟶ hemigossypol + hydrogen peroxide
- polymethylated quercetin biosynthesis:
SAM + rhamnetin ⟶ 7,3'-dimethylquercetin + H+ + SAH
- polymethylated quercetin biosynthesis:
SAM + rhamnetin ⟶ 7,3'-dimethylquercetin + H+ + SAH
- echinatin biosynthesis:
isoliquiritigenin ⟶ (2S)-liquiritigenin
- echinatin biosynthesis:
(2S)-liquiritigenin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 2-hydroxyliquiritigenin + H2O + an oxidized [NADPH-hemoprotein reductase]
- echinatin biosynthesis:
(2S)-liquiritigenin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 2-hydroxyliquiritigenin + H2O + an oxidized [NADPH-hemoprotein reductase]
- echinatin biosynthesis:
(2S)-liquiritigenin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 2-hydroxyliquiritigenin + H2O + an oxidized [NADPH-hemoprotein reductase]
- echinatin biosynthesis:
SAM + licodione ⟶ 2'-O-methyllicodione + H+ + SAH
- echinatin biosynthesis:
isoliquiritigenin ⟶ (2S)-liquiritigenin
- echinatin biosynthesis:
(2S)-liquiritigenin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 2-hydroxyliquiritigenin + H2O + an oxidized [NADPH-hemoprotein reductase]
- echinatin biosynthesis:
(2S)-liquiritigenin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 2-hydroxyliquiritigenin + H2O + an oxidized [NADPH-hemoprotein reductase]
- echinatin biosynthesis:
SAM + licodione ⟶ 2'-O-methyllicodione + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
3-methoxy-4',5-dihydroxy-trans-stilbene + SAM ⟶ H+ + SAH + pterostilbene
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- pterostilbene biosynthesis:
trans-resveratrol + SAM ⟶ 3-methoxy-4',5-dihydroxy-trans-stilbene + H+ + SAH
- γ-coniciene and coniine biosynthesis:
SAM + coniine ⟶ H+ + SAH + methylconiine
- ephedrine biosynthesis:
(+)-norpseudoephedrine + SAM ⟶ H+ + SAH + pseudoephedrine
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- superpathway of benzoxazinoid glucosides biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- superpathway of benzoxazinoid glucosides biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one
- superpathway of benzoxazinoid glucosides biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- superpathway of benzoxazinoid glucosides biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- superpathway of benzoxazinoid glucosides biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH
- superpathway of benzoxazinoid glucosides biosynthesis:
DIBOA + UDP-α-D-glucose ⟶ DIBOA-Glc + UDP
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- superpathway of benzoxazinoid glucosides biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one
- superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- superpathway of benzoxazinoid glucosides biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one
- DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH
- DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH
- superpathway of benzoxazinoid glucosides biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH
- DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH
- superpathway of benzoxazinoid glucosides biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- superpathway of benzoxazinoid glucosides biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH
- superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one
- DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH
- DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH
- superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one
- superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one
- DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH
- superpathway of benzoxazinoid glucosides biosynthesis:
(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate ⟶ D-glyceraldehyde 3-phosphate + indole
- DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH
- superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- DIMBOA-glucoside biosynthesis:
2-oxoglutarate + DIBOA-Glc + O2 ⟶ CO2 + TRIBOA-β-D-glucoside + succinate
- superpathway of benzoxazinoid glucosides biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + indole ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + indolin-2-one
- DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH
- DIMBOA-glucoside biosynthesis:
SAM + TRIBOA-β-D-glucoside ⟶ DIMBOA-β-D-glucoside + H+ + SAH
- pinitol biosynthesis I:
myo-inositol + SAM ⟶ D-ononitol + H+ + SAH
- pinitol biosynthesis II:
myo-inositol + SAM ⟶ H+ + SAH + sequoyitol
- pinitol biosynthesis I:
myo-inositol + SAM ⟶ D-ononitol + H+ + SAH
- pinitol biosynthesis I:
myo-inositol + SAM ⟶ D-ononitol + H+ + SAH
- pinitol biosynthesis I:
myo-inositol + SAM ⟶ D-ononitol + H+ + SAH
- pinitol biosynthesis I:
myo-inositol + SAM ⟶ D-ononitol + H+ + SAH
- pinitol biosynthesis I:
D-ononitol + NAD+ ⟶ 4-O-methyl-D-myo-inosose + H+ + NADH
- linear furanocoumarin biosynthesis:
H+ + NADPH + O2 + psoralen ⟶ H2O + NADP+ + bergaptol
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + H+ + NADPH + O2 ⟶ H2O + NADP+ + acetone + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + H+ + NADPH + O2 ⟶ H2O + NADP+ + acetone + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + H+ + NADPH + O2 ⟶ H2O + NADP+ + acetone + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
(+)-marmesin + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ H2O + acetone + an oxidized [NADPH-hemoprotein reductase] + psoralen
- linear furanocoumarin biosynthesis:
H+ + NADPH + O2 + psoralen ⟶ H2O + NADP+ + bergaptol
- linear furanocoumarin biosynthesis:
H+ + NADPH + O2 + psoralen ⟶ H2O + NADP+ + bergaptol
- gibberellin inactivation II (methylation):
SAM + gibberellin A20 ⟶ SAH + methyl gibberellin A20
- gibberellin inactivation II (methylation):
SAM + gibberellin A20 ⟶ SAH + methyl gibberellin A20
- gibberellin inactivation II (methylation):
SAM + gibberellin A34 ⟶ SAH + methyl gibberellin A34
- gibberellin inactivation II (methylation):
SAM + gibberellin A34 ⟶ SAH + methyl gibberellin A34
- gibberellin inactivation II (methylation):
SAM + gibberellin A9 ⟶ SAH + methyl gibberellin A9
- gibberellin inactivation II (methylation):
SAM + gibberellin A34 ⟶ SAH + methyl gibberellin A34
- gibberellin inactivation II (methylation):
SAM + gibberellin A20 ⟶ SAH + methyl gibberellin A20
- gibberellin inactivation II (methylation):
SAM + gibberellin A20 ⟶ SAH + methyl gibberellin A20
- gibberellin inactivation II (methylation):
SAM + gibberellin A20 ⟶ SAH + methyl gibberellin A20
- gibberellin inactivation II (methylation):
SAM + gibberellin A34 ⟶ SAH + methyl gibberellin A34
- gibberellin inactivation II (methylation):
SAM + gibberellin A34 ⟶ SAH + methyl gibberellin A34
- gibberellin inactivation II (methylation):
SAM + gibberellin A34 ⟶ SAH + methyl gibberellin A34
- gibberellin inactivation II (methylation):
SAM + gibberellin A34 ⟶ SAH + methyl gibberellin A34
- gibberellin inactivation II (methylation):
SAM + gibberellin A34 ⟶ SAH + methyl gibberellin A34
- gibberellin inactivation II (methylation):
SAM + gibberellin A20 ⟶ SAH + methyl gibberellin A20
- gibberellin inactivation II (methylation):
SAM + gibberellin A20 ⟶ SAH + methyl gibberellin A20
- gibberellin inactivation II (methylation):
SAM + gibberellin A20 ⟶ SAH + methyl gibberellin A20
- gibberellin inactivation II (methylation):
SAM + gibberellin A34 ⟶ SAH + methyl gibberellin A34
- gibberellin inactivation II (methylation):
SAM + gibberellin A9 ⟶ SAH + methyl gibberellin A9
- gibberellin inactivation II (methylation):
SAM + gibberellin A34 ⟶ SAH + methyl gibberellin A34
- gibberellin inactivation II (methylation):
SAM + gibberellin A34 ⟶ SAH + methyl gibberellin A34
- gibberellin inactivation II (methylation):
SAM + gibberellin A20 ⟶ SAH + methyl gibberellin A20
- gibberellin inactivation II (methylation):
SAM + gibberellin A20 ⟶ SAH + methyl gibberellin A20
- gibberellin inactivation II (methylation):
SAM + gibberellin A20 ⟶ SAH + methyl gibberellin A20
- gibberellin inactivation II (methylation):
SAM + gibberellin A34 ⟶ SAH + methyl gibberellin A34
- gibberellin inactivation II (methylation):
SAM + gibberellin A34 ⟶ SAH + methyl gibberellin A34
- gibberellin inactivation II (methylation):
SAM + gibberellin A4 ⟶ SAH + methyl gibberellin A4
- gibberellin inactivation II (methylation):
SAM + gibberellin A20 ⟶ SAH + methyl gibberellin A20
- gibberellin inactivation II (methylation):
SAM + gibberellin A34 ⟶ SAH + methyl gibberellin A34
- gibberellin inactivation II (methylation):
SAM + gibberellin A9 ⟶ SAH + methyl gibberellin A9
- gibberellin inactivation II (methylation):
SAM + gibberellin A34 ⟶ SAH + methyl gibberellin A34
- gibberellin inactivation II (methylation):
SAM + gibberellin A20 ⟶ SAH + methyl gibberellin A20
- gibberellin inactivation II (methylation):
SAM + gibberellin A20 ⟶ SAH + methyl gibberellin A20
- gibberellin inactivation II (methylation):
SAM + gibberellin A34 ⟶ SAH + methyl gibberellin A34
- gibberellin inactivation II (methylation):
SAM + gibberellin A20 ⟶ SAH + methyl gibberellin A20
- gibberellin inactivation II (methylation):
SAM + gibberellin A20 ⟶ SAH + methyl gibberellin A20
- gibberellin inactivation II (methylation):
SAM + gibberellin A34 ⟶ SAH + methyl gibberellin A34
- gibberellin inactivation II (methylation):
SAM + gibberellin A9 ⟶ SAH + methyl gibberellin A9
- gibberellin inactivation II (methylation):
SAM + gibberellin A20 ⟶ SAH + methyl gibberellin A20
- gibberellin inactivation II (methylation):
SAM + gibberellin A34 ⟶ SAH + methyl gibberellin A34
- gibberellin inactivation II (methylation):
SAM + gibberellin A34 ⟶ SAH + methyl gibberellin A34
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin + O2 + trp ⟶ (6R)-4a-hydroxy-tetrahydrobiopterin + 5-hydroxy-L-tryptophan
- serotonin and melatonin biosynthesis:
N-acetyl-serotonin + SAM ⟶ H+ + SAH + melatonin
- serotonin and melatonin biosynthesis:
N-acetyl-serotonin + SAM ⟶ H+ + SAH + melatonin
- ubiquinol-10 biosynthesis (eukaryotic):
6-(all-trans-decaprenyl)-2-methoxy-phenol + H+ + NADPH + O2 ⟶ all trans-decaprenyl-2-methoxy-6-1,4-benzoquinol + H2O + NADP+
- ubiquinol-10 biosynthesis (eukaryotic):
6-(all-trans-decaprenyl)-2-methoxy-phenol + H+ + NADPH + O2 ⟶ all trans-decaprenyl-2-methoxy-6-1,4-benzoquinol + H2O + NADP+
- ubiquinol-10 biosynthesis (eukaryotic):
4-hydroxybenzoate + all-trans-decaprenyl diphosphate ⟶ 3-decaprenyl-4-hydroxybenzoate + diphosphate
- ubiquinol-10 biosynthesis (eukaryotic):
4-hydroxybenzoate + all-trans-decaprenyl diphosphate ⟶ 3-decaprenyl-4-hydroxybenzoate + diphosphate
- ubiquinol-10 biosynthesis (eukaryotic):
4-hydroxybenzoate + all-trans-decaprenyl diphosphate ⟶ 3-decaprenyl-4-hydroxybenzoate + diphosphate
- ubiquinol-10 biosynthesis (eukaryotic):
4-hydroxybenzoate + all-trans-decaprenyl diphosphate ⟶ 3-decaprenyl-4-hydroxybenzoate + diphosphate
- ubiquinol-10 biosynthesis (eukaryotic):
4-hydroxybenzoate + all-trans-decaprenyl diphosphate ⟶ 3-decaprenyl-4-hydroxybenzoate + diphosphate
- ubiquinol-10 biosynthesis (eukaryotic):
4-hydroxybenzoate + all-trans-decaprenyl diphosphate ⟶ 3-decaprenyl-4-hydroxybenzoate + diphosphate
- ubiquinol-10 biosynthesis (eukaryotic):
4-hydroxybenzoate + all-trans-decaprenyl diphosphate ⟶ 3-decaprenyl-4-hydroxybenzoate + diphosphate
- ubiquinol-10 biosynthesis (eukaryotic):
4-hydroxybenzoate + all-trans-decaprenyl diphosphate ⟶ 3-decaprenyl-4-hydroxybenzoate + diphosphate
- ubiquinol-10 biosynthesis (eukaryotic):
4-hydroxybenzoate + all-trans-decaprenyl diphosphate ⟶ 3-decaprenyl-4-hydroxybenzoate + diphosphate
- ubiquinol-10 biosynthesis (eukaryotic):
4-hydroxybenzoate + all-trans-decaprenyl diphosphate ⟶ 3-decaprenyl-4-hydroxybenzoate + diphosphate
- polymethylated myricetin biosynthesis (tomato):
3-O-methylmyricetin + SAM ⟶ 3,7-dimethylmyricetin + H+ + SAH
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
SAM + a demethylated methyl donor ⟶ H+ + SAH + a methylated methyl donor
- S-adenosyl-L-methionine cycle II:
5-methyltetrahydropteroyl tri-L-glutamate + L-homocysteine ⟶ met + tetrahydropteroyl tri-L-glutamate
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
SAM + a demethylated methyl donor ⟶ H+ + SAH + a methylated methyl donor
- S-adenosyl-L-methionine cycle II:
5-methyltetrahydropteroyl tri-L-glutamate + L-homocysteine ⟶ met + tetrahydropteroyl tri-L-glutamate
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
5-methyltetrahydropteroyl tri-L-glutamate + L-homocysteine ⟶ met + tetrahydropteroyl tri-L-glutamate
- L-methionine degradation I (to L-homocysteine):
SAM + a demethylated methyl donor ⟶ H+ + SAH + a methylated methyl donor
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
ATP + H2O + met ⟶ SAM + diphosphate + phosphate
- S-adenosyl-L-methionine cycle II:
ATP + H2O + met ⟶ SAM + diphosphate + phosphate
- caffeine biosynthesis II (via paraxanthine):
SAM + paraxanthine ⟶ H+ + SAH + caffeine
- caffeine biosynthesis II (via paraxanthine):
7-methylxanthosine + H2O ⟶ 7-methylxanthine + D-ribofuranose + H+
- caffeine biosynthesis II (via paraxanthine):
SAM + paraxanthine ⟶ H+ + SAH + caffeine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine degradation I (to L-homocysteine):
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of pterocarpan biosynthesis (via formononetin):
O2 + a reduced [NADPH-hemoprotein reductase] + formononetin ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + calycosin
- (+)-pisatin biosynthesis:
(+)-maackiain + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ (+)-6a-hydroxymaackiain + H2O + an oxidized [NADPH-hemoprotein reductase]
- phenylpropanoids methylation (ice plant):
trans-caffeate + SAM ⟶ H+ + SAH + ferulate
- phenylpropanoids methylation (ice plant):
SAM + patuletin ⟶ H+ + SAH + quercetagetin 3',6-dimethyl ether
- phenylpropanoids methylation (ice plant):
SAM + gossypetin ⟶ 3,3',4',5,7-pentahydroxy-8-methoxyflavone + H+ + SAH
- phenylpropanoids methylation (ice plant):
SAM + patuletin ⟶ H+ + SAH + quercetagetin 3',6-dimethyl ether
- phenylpropanoids methylation (ice plant):
trans-caffeate + SAM ⟶ H+ + SAH + ferulate
- phenylpropanoids methylation (ice plant):
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- phenylpropanoids methylation (ice plant):
SAM + patuletin ⟶ H+ + SAH + quercetagetin 3',6-dimethyl ether
- phenylpropanoids methylation (ice plant):
SAM + patuletin ⟶ H+ + SAH + quercetagetin 3',6-dimethyl ether
- phenylpropanoids methylation (ice plant):
SAM + gossypetin ⟶ 3,3',4',5,7-pentahydroxy-8-methoxyflavone + H+ + SAH
- phenylpropanoids methylation (ice plant):
trans-caffeoyl-CoA + SAM ⟶ H+ + SAH + feruloyl-CoA
- phenylpropanoids methylation (ice plant):
SAM + gossypetin ⟶ 3,3',4',5,7-pentahydroxy-8-methoxyflavone + H+ + SAH
- phenylpropanoids methylation (ice plant):
trans-caffeate + SAM ⟶ H+ + SAH + ferulate
- phenylpropanoids methylation (ice plant):
trans-caffeate + SAM ⟶ H+ + SAH + ferulate
- phenylpropanoids methylation (ice plant):
SAM + myricetin ⟶ H+ + SAH + laricitrin
- phenylpropanoids methylation (ice plant):
trans-caffeate + SAM ⟶ H+ + SAH + ferulate
- phenylpropanoids methylation (ice plant):
trans-caffeate + SAM ⟶ H+ + SAH + ferulate
- phenylpropanoids methylation (ice plant):
trans-caffeate + SAM ⟶ H+ + SAH + ferulate
- phenylpropanoids methylation (ice plant):
SAM + patuletin ⟶ H+ + SAH + quercetagetin 3',6-dimethyl ether
- phenylpropanoids methylation (ice plant):
SAM + patuletin ⟶ H+ + SAH + quercetagetin 3',6-dimethyl ether
- phenylpropanoids methylation (ice plant):
trans-caffeate + SAM ⟶ H+ + SAH + ferulate
- phenylpropanoids methylation (ice plant):
trans-caffeoyl-CoA + SAM ⟶ H+ + SAH + feruloyl-CoA
- phenylpropanoids methylation (ice plant):
SAM + quercetin ⟶ H+ + SAH + isorhamnetin
- vestitol and sativan biosynthesis:
(-)-medicarpin + H+ + NADPH ⟶ (-)-vestitol + NADP+
- vestitol and sativan biosynthesis:
(-)-medicarpin + H+ + NADPH ⟶ (-)-vestitol + NADP+
- vestitol and sativan biosynthesis:
(-)-medicarpin + H+ + NADPH ⟶ (-)-vestitol + NADP+
- vestitol and sativan biosynthesis:
(-)-medicarpin + H+ + NADPH ⟶ (-)-vestitol + NADP+
- vestitol and sativan biosynthesis:
(-)-medicarpin + H+ + NADPH ⟶ (-)-vestitol + NADP+
- vestitol and sativan biosynthesis:
(-)-medicarpin + H+ + NADPH ⟶ (-)-vestitol + NADP+
- vestitol and sativan biosynthesis:
(-)-medicarpin + H+ + NADPH ⟶ (-)-vestitol + NADP+
- vestitol and sativan biosynthesis:
(-)-medicarpin + H+ + NADPH ⟶ (-)-vestitol + NADP+
- vestitol and sativan biosynthesis:
(-)-medicarpin + H+ + NADPH ⟶ (-)-vestitol + NADP+
- vestitol and sativan biosynthesis:
(-)-medicarpin + H+ + NADPH ⟶ (-)-vestitol + NADP+
- volatile benzenoid biosynthesis I (ester formation):
acetyl-CoA + benzyl alcohol ⟶ benzyl acetate + coenzyme A
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- volatile benzenoid biosynthesis I (ester formation):
SAM + benzoate ⟶ SAH + methyl benzoate
- ajmaline and sarpagine biosynthesis:
3-α(S)-strictosidine + H2O ⟶ D-glucopyranose + strictosidine aglycone
- ajmaline and sarpagine biosynthesis:
3-α(S)-strictosidine + H2O ⟶ D-glucopyranose + strictosidine aglycone
- ajmaline and sarpagine biosynthesis:
H2O + polyneuridine aldehyde ⟶ 16-epivellosimine + CO2 + MeOH
- berberine biosynthesis:
(S)-reticuline + O2 ⟶ (S)-scoulerine + H+ + hydrogen peroxide
- berberine biosynthesis:
(S)-scoulerine + SAM ⟶ (S)-tetrahydrocolumbamine + H+ + SAH
- 6-methoxymellein biosynthesis:
6-hydroxymellein + SAM ⟶ 6-methoxymellein + H+ + SAH
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + trihydroxyferuloyl spermidine ⟶ H+ + SAH + dihydroxyferuloyl-sinapoyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
trans-caffeoyl-CoA + spermidine ⟶ H+ + coenzyme A + tricaffeoyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + trihydroxyferuloyl spermidine ⟶ H+ + SAH + dihydroxyferuloyl-sinapoyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + trihydroxyferuloyl spermidine ⟶ H+ + SAH + dihydroxyferuloyl-sinapoyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + trihydroxyferuloyl spermidine ⟶ H+ + SAH + dihydroxyferuloyl-sinapoyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + trihydroxyferuloyl spermidine ⟶ H+ + SAH + dihydroxyferuloyl-sinapoyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
O2 + a reduced [NADPH-hemoprotein reductase] + tricoumaroyl spermidine ⟶ H2O + an oxidized [NADPH-hemoprotein reductase] + tricaffeoyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
SAM + tricaffeoyl spermidine ⟶ H+ + SAH + triferuloyl spermidine
- spermidine hydroxycinnamic acid conjugates biosynthesis:
(E)-4-coumaroyl-CoA + spermidine ⟶ H+ + coenzyme A + tricoumaroyl spermidine
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
3-methoxy-5-hydroxytoluene + SAM ⟶ 3,5-dimethoxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- 3,5-dimethoxytoluene biosynthesis:
SAM + orcinol ⟶ 3-methoxy-5-hydroxytoluene + H+ + SAH
- polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
3,7,4'-trimethylquercetin + H+ + NADPH + O2 ⟶ 2'-hydroxy 3,7,4'-trimethylquercetin + H2O + NADP+
- polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
3,7,4'-trimethylquercetin + H+ + NADPH + O2 ⟶ 2'-hydroxy 3,7,4'-trimethylquercetin + H2O + NADP+
- polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
3,7,4'-trimethylquercetin + H+ + NADPH + O2 ⟶ 2'-hydroxy 3,7,4'-trimethylquercetin + H2O + NADP+
- polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
2'-hydroxy 3,7,4'-trimethylquercetin + SAM ⟶ 2'-hydroxy 3,7,3',4'-tetramethylquercetin + H+ + SAH
- polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
3,7,4'-trimethylquercetin + H+ + NADPH + O2 ⟶ 2'-hydroxy 3,7,4'-trimethylquercetin + H2O + NADP+
- polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
2'-hydroxy 3,7,4'-trimethylquercetin + SAM ⟶ 2'-hydroxy 3,7,3',4'-tetramethylquercetin + H+ + SAH
- polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
2'-hydroxy 3,7,4'-trimethylquercetin + UDP-α-D-glucose ⟶ 3,7,4'-trimethylquercetin 2'-O-β-D-glucoside + H+ + UDP
- polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
2'-hydroxy 3,7,4'-trimethylquercetin + SAM ⟶ 2'-hydroxy 3,7,3',4'-tetramethylquercetin + H+ + SAH
- polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium):
2'-hydroxy 3,7,4'-trimethylquercetin + SAM ⟶ 2'-hydroxy 3,7,3',4'-tetramethylquercetin + H+ + SAH
- aucuparin biosynthesis:
H+ + benzoyl-CoA + malonyl-CoA ⟶ 3,5-dihydroxybiphenyl + CO2 + coenzyme A
- aucuparin biosynthesis:
3,5-dihydroxybiphenyl + SAM ⟶ 3-hydroxy-5-methoxybiphenyl + H+ + SAH
- aucuparin biosynthesis:
SAM + noraucuparin ⟶ H+ + SAH + aucuparin
- aucuparin biosynthesis:
SAM + noraucuparin ⟶ H+ + SAH + aucuparin
- aucuparin biosynthesis:
3,5-dihydroxybiphenyl + SAM ⟶ 3-hydroxy-5-methoxybiphenyl + H+ + SAH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
(indol-3-yl)acetate + SAM ⟶ SAH + methyl (indol-3-yl)acetate
- methyl indole-3-acetate interconversion:
(indol-3-yl)acetate + SAM ⟶ SAH + methyl (indol-3-yl)acetate
- sulfur volatiles biosynthesis:
SAM + a thiol ⟶ H+ + SAH + a methyl thioether
- sulfur volatiles biosynthesis:
SAM + a thiol ⟶ H+ + SAH + a methyl thioether
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ (S)-magnoflorine + H+ + SAH
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ (S)-magnoflorine + H+ + SAH
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ (S)-magnoflorine + H+ + SAH
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ (S)-magnoflorine + H+ + SAH
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ (S)-magnoflorine + H+ + SAH
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ (S)-magnoflorine + H+ + SAH
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ (S)-magnoflorine + H+ + SAH
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ (S)-magnoflorine + H+ + SAH
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ (S)-magnoflorine + H+ + SAH
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ (S)-magnoflorine + H+ + SAH
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ (S)-magnoflorine + H+ + SAH
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ (S)-magnoflorine + H+ + SAH
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ (S)-magnoflorine + H+ + SAH
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ (S)-magnoflorine + H+ + SAH
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ (S)-magnoflorine + H+ + SAH
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ (S)-magnoflorine + H+ + SAH
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ (S)-magnoflorine + H+ + SAH
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ (S)-magnoflorine + H+ + SAH
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ (S)-magnoflorine + H+ + SAH
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ (S)-magnoflorine + H+ + SAH
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ (S)-magnoflorine + H+ + SAH
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ (S)-magnoflorine + H+ + SAH
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ (S)-magnoflorine + H+ + SAH
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ (S)-magnoflorine + H+ + SAH
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ (S)-magnoflorine + H+ + SAH
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ (S)-magnoflorine + H+ + SAH
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ (S)-magnoflorine + H+ + SAH
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ (S)-magnoflorine + H+ + SAH
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ (S)-magnoflorine + H+ + SAH
- magnoflorine biosynthesis:
(S)-corytuberine + SAM ⟶ (S)-magnoflorine + H+ + SAH
- juvenile hormone III biosynthesis I:
(2E,6E)-farnesol + NADP+ ⟶ (2E,6E)-farnesal + H+ + NADPH
- eupatolitin 3-O-glucoside biosynthesis:
H+ + NADPH + O2 + quercetin ⟶ H2O + NADP+ + quercetagetin
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- superpathway of methylsalicylate metabolism:
H2O + methylsalicylate ⟶ H+ + MeOH + salicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- superpathway of methylsalicylate metabolism:
H2O + methylsalicylate ⟶ H+ + MeOH + salicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- superpathway of methylsalicylate metabolism:
H2O + methylsalicylate ⟶ H+ + MeOH + salicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- methylsalicylate biosynthesis:
SAM + salicylate ⟶ SAH + methylsalicylate
- ergosterol biosynthesis II:
4α, 14α-dimethyl ergosta-8,25(27)-dienol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 4α-methyl ergosta-8,14,25(27)-trienol + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] + formate
- ergosterol biosynthesis II:
4α, 14α-dimethyl ergosta-8,25(27)-dienol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 4α-methyl ergosta-8,14,25(27)-trienol + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] + formate
- superpathway of ergosterol biosynthesis II:
O2 + a reduced [NADPH-hemoprotein reductase] + squalene ⟶ (3S)-2,3-epoxy-2,3-dihydrosqualene + H2O + an oxidized [NADPH-hemoprotein reductase]
- superpathway of ergosterol biosynthesis II:
4α, 14α-dimethyl ergosta-8,25(27)-dienol + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 4α-methyl ergosta-8,14,25(27)-trienol + H+ + H2O + an oxidized [NADPH-hemoprotein reductase] + formate
- acacetin biosynthesis:
SAM + apigenin ⟶ H+ + SAH + acacetin
- acacetin biosynthesis:
SAM + apigenin ⟶ H+ + SAH + acacetin
- vanillin biosynthesis I:
4-hydroxybenzaldehyde + O2 + a reduced [NADPH-hemoprotein reductase] ⟶ 3,4-dihydroxybenzaldehyde + H2O + an oxidized [NADPH-hemoprotein reductase]
- sulfur volatiles biosynthesis:
SAM + thiocyanate ⟶ SAH + methyl thiocyanate
- sulfur volatiles biosynthesis:
SAM + a thiol ⟶ H+ + SAH + a methyl thioether
- sulfur volatiles biosynthesis:
SAM + a thiol ⟶ H+ + SAH + a methyl thioether
- sulfur volatiles biosynthesis:
SAM + a thiol ⟶ H+ + SAH + a methyl thioether
- sulfur volatiles biosynthesis:
SAM + thiocyanate ⟶ SAH + methyl thiocyanate
- sulfur volatiles biosynthesis:
SAM + a thiol ⟶ H+ + SAH + a methyl thioether
- sulfur volatiles biosynthesis:
SAM + thiocyanate ⟶ SAH + methyl thiocyanate
- sulfur volatiles biosynthesis:
SAM + thiocyanate ⟶ SAH + methyl thiocyanate
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + H+ + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- methyl indole-3-acetate interconversion:
H2O + methyl (indol-3-yl)acetate ⟶ (indol-3-yl)acetate + MeOH
- 6-gingerol biosynthesis:
1-(3,4-dihydroxyphenyl)-5-hydroxy-3-decanone + SAM ⟶ 6-gingerol + H+ + SAH
- 6-methoxypodophyllotoxin biosynthesis:
(-)-yatein + 2-oxoglutarate + O2 ⟶ (-)-deoxypodophyllotoxin + CO2 + H2O + succinate
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
A(H2) + GTP + SAM ⟶ (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate + 5'-deoxyadenosine + A + H+ + met
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
A(H2) + GTP + SAM ⟶ (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate + 5'-deoxyadenosine + A + H+ + met
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
A(H2) + GTP + SAM ⟶ (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate + 5'-deoxyadenosine + A + H+ + met
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- molybdenum cofactor biosynthesis:
an [L-cysteine desulfurase]-L-cysteine + cys ⟶ ala + an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
- polymethylated kaempferol biosynthesis:
SAM + kaempferide ⟶ 7,4'-dimethylkaempferol + SAH
- polymethylated kaempferol biosynthesis:
SAM + kaempferide ⟶ 7,4'-dimethylkaempferol + SAH
- polymethylated kaempferol biosynthesis:
SAM + kaempferide ⟶ 7,4'-dimethylkaempferol + SAH
- polymethylated kaempferol biosynthesis:
SAM + kaempferide ⟶ 7,4'-dimethylkaempferol + SAH
- polymethylated kaempferol biosynthesis:
SAM + kaempferide ⟶ 7,4'-dimethylkaempferol + SAH
- polymethylated kaempferol biosynthesis:
SAM + kaempferol ⟶ 3-O-methylkaempferol + SAH
- polymethylated kaempferol biosynthesis:
SAM + kaempferide ⟶ 7,4'-dimethylkaempferol + SAH
- polymethylated kaempferol biosynthesis:
SAM + kaempferide ⟶ 7,4'-dimethylkaempferol + SAH
- polymethylated kaempferol biosynthesis:
SAM + kaempferide ⟶ 7,4'-dimethylkaempferol + SAH
- polymethylated kaempferol biosynthesis:
SAM + kaempferide ⟶ 7,4'-dimethylkaempferol + SAH
- polymethylated kaempferol biosynthesis:
SAM + kaempferide ⟶ 7,4'-dimethylkaempferol + SAH
- polymethylated myricetin biosynthesis (tomato):
3,7,3',5'-tetramethylmyricetin + SAM ⟶ 3,7,3',4',5'-pentamethylmyricetin + H+ + SAH
COVID-19 Disease Map(1)
- @COVID-19 Disease
Map["name"]:
2-Methyl-3-acetoacetyl-CoA + Coenzyme A ⟶ Acetyl-CoA + Propanoyl-CoA
PathBank(2299)
- Tyrosine Biosynthesis:
4-Hydroxyphenylpyruvic acid + L-Glutamic acid ⟶ L-Tyrosine + Oxoglutaric acid
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine biosynthesis PC(14:0/18:1(11Z)):
PE(14:0/18:1(11Z)) + S-Adenosylmethionine ⟶ Hydrogen Ion + PE-NMe(14:0/18:1(11Z)) + S-Adenosylhomocysteine
- Phosphatidylcholine Biosynthesis PC(14:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Flavone and Flavonol Biosynthesis:
Phosphoadenosine phosphosulfate + Quercetin ⟶ Adenosine 3',5'-diphosphate + Hydrogen Ion + Quercetin 3'-sulfate
- Phosphatidylcholine Biosynthesis PC(18:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine biosynthesis PC(16:0/18:1(9Z)):
PE(16:0/18:1(9Z)) + S-Adenosylmethionine ⟶ Hydrogen Ion + PE-NMe(16:0/18:1(9Z)) + S-Adenosylhomocysteine
- Phosphatidylcholine Biosynthesis PC(16:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/18:1(9Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(16:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Azathioprine Action Pathway:
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate
- Mercaptopurine Action Pathway:
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate
- Thioguanine Action Pathway:
Deoxyadenosine + Phosphate ⟶ Adenine + Deoxyribose 1-phosphate
- Mercaptopurine Metabolism Pathway:
Adenosine triphosphate + L-Glutamine + Thioxanthine monophosphate + Water ⟶ 6-Thioguanosine monophosphate + Adenosine monophosphate + Pyrophosphate
- Phylloquinol Biosynthesis:
2-carboxy-1,4-naphthoquinone + Hydrogen Ion + Phytyl diphosphate ⟶ Carbon dioxide + Demethylphylloquinone + Pyrophosphate
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/22:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(20:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Lysolipid Incorporation into ER PC(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
Glycerophosphocholine + Water ⟶ Choline + Glycerol 3-phosphate + Hydrogen Ion
- Lysolipid incorporation into Mitochondria PC(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + LysoPC(20:4(5Z,8Z,11Z,14Z)) + Water ⟶ Adenosine diphosphate + LysoPC(20:4(5Z,8Z,11Z,14Z)) + Phosphate
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine biosynthesis PC(14:0/18:0):
PE(14:0/18:0) + S-Adenosylmethionine ⟶ Hydrogen Ion + PE-NMe(14:0/18:0) + S-Adenosylhomocysteine
- Phosphatidylcholine Biosynthesis PC(14:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Lysolipid incorporation into Mitochondria PC(16:0/16:0):
Adenosine triphosphate + LysoPC(16:0) + Water ⟶ Adenosine diphosphate + LysoPC(16:0) + Phosphate
- Lysolipid Incorporation into ER PC(16:0/16:0):
Adenosine triphosphate + LysoPC(16:0) + Water ⟶ Adenosine diphosphate + LysoPC(16:0) + Phosphate
- Phosphatidylcholine biosynthesis PC(16:0/16:0):
PE-NMe2(16:0/16:0) + S-Adenosylmethionine ⟶ Hydrogen Ion + PC(16:0/16:0) + S-Adenosylhomocysteine
- Phosphatidylcholine Biosynthesis PC(16:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/16:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(16:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:1(11Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Thiamin Diphosphate Biosynthesis:
L-Glutamine + Phosphoribosyl pyrophosphate + Water ⟶ 5-Phosphoribosylamine + L-Glutamic acid + Pyrophosphate
- Thiamin Diphosphate Biosynthesis:
L-Glutamine + Phosphoribosyl pyrophosphate + Water ⟶ 5-Phosphoribosylamine + L-Glutamic acid + Pyrophosphate
- Phosphatidylcholine Biosynthesis PC(20:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Tryptophan Metabolism:
L-Tryptophan + Oxygen ⟶ N'-Formylkynurenine
- Tryptophan Metabolism:
L-Tryptophan + Oxygen ⟶ N'-Formylkynurenine
- Tryptophan Metabolism:
L-Tryptophan + Oxygen ⟶ N'-Formylkynurenine
- Tryptophan Metabolism:
L-Tryptophan + Oxygen ⟶ N'-Formylkynurenine
- Tryptophan Metabolism:
L-Tryptophan + Oxygen ⟶ N'-Formylkynurenine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Estrone Metabolism:
2-Hydroxyestrone + S-Adenosylmethionine ⟶ 2-Methoxyestrone + S-Adenosylhomocysteine
- Estrone Metabolism:
2-Hydroxyestrone + S-Adenosylmethionine ⟶ 2-Methoxyestrone + S-Adenosylhomocysteine
- Estrone Metabolism:
2-Hydroxyestrone + S-Adenosylmethionine ⟶ 2-Methoxyestrone + S-Adenosylhomocysteine
- Estrone Metabolism:
2-Hydroxyestrone + S-Adenosylmethionine ⟶ 2-Methoxyestrone + S-Adenosylhomocysteine
- Estrone Metabolism:
2-Hydroxyestrone + S-Adenosylmethionine ⟶ 2-Methoxyestrone + S-Adenosylhomocysteine
- Estrone Metabolism:
2-Hydroxyestrone + S-Adenosylmethionine ⟶ 2-Methoxyestrone + S-Adenosylhomocysteine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/22:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(16:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine biosynthesis PC(14:0/16:1(9Z)):
PE(14:0/16:1(9Z)) + S-Adenosylmethionine ⟶ Hydrogen Ion + PE-NMe(14:0/16:1(9Z)) + S-Adenosylhomocysteine
- Phosphatidylcholine Biosynthesis PC(14:0/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Lipoic Acid Metabolism:
Lipoyl-AMP + apoprotein ⟶ Adenosine monophosphate + Protein N6-(lipoyl)lysine
- Phosphatidylcholine Biosynthesis PC(16:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/22:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(16:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:2(9Z,12Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine biosynthesis PC(16:1(9Z)/18:1(11Z)):
PE(16:1(9Z)/18:1(11Z)) + S-Adenosylmethionine ⟶ Hydrogen Ion + PE-NMe(16:1(9Z)/18:1(11Z)) + S-Adenosylhomocysteine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/18:3(6Z,9Z,12Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(16:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Carnitine Synthesis:
4-Trimethylammoniobutanoic acid + Oxoglutaric acid + Oxygen ⟶ Carbon dioxide + L-Carnitine + Succinic acid
- Carnitine Synthesis:
4-Trimethylammoniobutanoic acid + Oxoglutaric acid + Oxygen ⟶ Carbon dioxide + L-Carnitine + Succinic acid
- Carnitine Synthesis:
4-Trimethylammoniobutanoic acid + Oxoglutaric acid + Oxygen ⟶ Carbon dioxide + L-Carnitine + Succinic acid
- Carnitine Synthesis:
4-Trimethylammoniobutanoic acid + Oxoglutaric acid + Oxygen ⟶ Carbon dioxide + L-Carnitine + Succinic acid
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Methionine Metabolism:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Spermidine and Spermine Biosynthesis:
Ornithine ⟶ Carbon dioxide + Putrescine
- Cystathionine beta-Synthase Deficiency:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Hypermethioninemia:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- S-Adenosylhomocysteine (SAH) Hydrolase Deficiency:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Glycine N-Methyltransferase Deficiency:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Methylenetetrahydrofolate Reductase Deficiency (MTHFRD):
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Methionine Adenosyltransferase Deficiency:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Homocystinuria-Megaloblastic Anemia Due to Defect in Cobalamin Metabolism, cblG Complementation Type:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- S-Adenosyl-L-Methionine Biosynthesis:
5'-S-methyl-5'-thioadenosine + Water ⟶ 5-Methylthioribose + Adenine
- Spermidine Biosynthesis and Metabolism:
5'-S-methyl-5'-thioadenosine + Water ⟶ 5-Methylthioribose + Adenine
- beta-Alanine Metabolism:
(R)-pantoate + -Alanine + Adenosine triphosphate ⟶ Adenosine monophosphate + Hydrogen Ion + Pantothenic acid + Pyrophosphate
- Methionine Metabolism:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Spermidine and Spermine Biosynthesis:
Putrescine + S-Adenosylmethioninamine ⟶ 5'-Methylthioadenosine + Spermidine
- Cystathionine beta-Synthase Deficiency:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Glycine N-Methyltransferase Deficiency:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Hypermethioninemia:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Methionine Adenosyltransferase Deficiency:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- S-Adenosylhomocysteine (SAH) Hydrolase Deficiency:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Homocystinuria-Megaloblastic Anemia Due to Defect in Cobalamin Metabolism, cblG Complementation Type:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Spermidine and Spermine Biosynthesis:
Putrescine + S-Adenosylmethioninamine ⟶ 5'-Methylthioadenosine + Spermidine
- Methionine Metabolism:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Spermidine and Spermine Biosynthesis:
Putrescine + S-Adenosylmethioninamine ⟶ 5'-Methylthioadenosine + Spermidine
- Methionine Metabolism:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Spermidine and Spermine Biosynthesis:
Putrescine + S-Adenosylmethioninamine ⟶ 5'-Methylthioadenosine + Spermidine
- Methionine Metabolism:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Spermidine and Spermine Biosynthesis:
Putrescine + S-Adenosylmethioninamine ⟶ 5'-Methylthioadenosine + Spermidine
- Methionine Metabolism:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Cystathionine beta-Synthase Deficiency:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Glycine N-Methyltransferase Deficiency:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Hypermethioninemia:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Methionine Adenosyltransferase Deficiency:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- S-Adenosylhomocysteine (SAH) Hydrolase Deficiency:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- Homocystinuria-Megaloblastic Anemia Due to Defect in Cobalamin Metabolism, cblG Complementation Type:
L-Cystathionine + Water ⟶ 2-Ketobutyric acid + L-Cysteine
- S-Adenosyl-L-Methionine Biosynthesis:
5'-S-methyl-5'-thioadenosine + Water ⟶ 5-Methylthioribose + Adenine
- Steroid Biosynthesis:
Farnesyl pyrophosphate + NADPH ⟶ NADP + Pyrophosphate + Squalene
- Cholesterol biosynthesis and metabolism CE(14:0):
Desmosterol ⟶ Cholesterol
- Cholesterol biosynthesis and metabolism CE(10:0):
Desmosterol ⟶ Cholesterol
- Cholesterol Biosynthesis and Metabolism CE(12:0):
Cholesterol + Lauroyl-CoA ⟶ CE(12:0) + Coenzyme A
- Cholesterol Biosynthesis and Metabolism CE(16:0):
Cholesterol + Palmityl-CoA ⟶ CE(16:0) + Coenzyme A
- Cholesterol biosynthesis and metabolism CE(18:0):
Desmosterol ⟶ Cholesterol
- Cholesterol Biosynthesis and Metabolism:
Cholesterol + long-chain fatty acyl-CoA ⟶ Cholesteryl ester + Coenzyme A
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine biosynthesis PC(18:1(9Z)/18:1(11Z)):
PE(18:1(9Z)/18:1(11Z)) + S-Adenosylmethionine ⟶ Hydrogen Ion + PE-NMe(18:1(9Z)/18:1(11Z)) + S-Adenosylhomocysteine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:1(11Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Lysolipid Incorporation into ER PC(18:1(9Z)/18:1(9Z)):
Glycerophosphocholine + Water ⟶ Choline + Glycerol 3-phosphate + Hydrogen Ion
- Lysolipid incorporation into Mitochondria PC(18:1(9Z)/18:1(9Z)):
Adenosine triphosphate + LysoPC(18:1(9Z)) + Water ⟶ Adenosine diphosphate + LysoPC(18:1(9Z)) + Phosphate
- Phosphatidylcholine biosynthesis PC(18:1(9Z)/18:1(9Z)):
PE(18:1(9Z)/18:1(9Z)) + S-Adenosylmethionine ⟶ Hydrogen Ion + PE-NMe(18:1(9Z)/18:1(9Z)) + S-Adenosylhomocysteine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:1(9Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine biosynthesis PC(18:0/18:1(9Z)):
PE(18:0/18:1(9Z)) + S-Adenosylmethionine ⟶ Hydrogen Ion + PE-NMe(18:0/18:1(9Z)) + S-Adenosylhomocysteine
- Phosphatidylcholine Biosynthesis PC(18:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Thiazole Biosynthesis I:
L-Tyrosine + NADPH + S-Adenosylmethionine ⟶ 4-Methylcatechol + 5'-Deoxyadenosine + Dehydroglycine + Hydrogen Ion + L-Methionine + NADP
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine biosynthesis PC(18:0/18:1(11Z)):
PE(18:0/18:1(11Z)) + S-Adenosylmethionine ⟶ Hydrogen Ion + PE-NMe(18:0/18:1(11Z)) + S-Adenosylhomocysteine
- Phosphatidylcholine Biosynthesis PC(18:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Steroid Biosynthesis:
Hydrogen Ion + Lathosterol + Oxygen + ferrocytochrome b5 ⟶ 7-Dehydrocholesterol + Water + ferricytochrome b5
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Nicotinate and Nicotinamide Metabolism:
NAD + Water ⟶ Adenosine monophosphate + Nicotinamide ribotide
- Nicotinate and Nicotinamide Metabolism:
Adenosine triphosphate + L-Glutamine + Nicotinic acid adenine dinucleotide + Water ⟶ Adenosine monophosphate + L-Glutamic acid + NAD + Pyrophosphate
- Nicotinate and Nicotinamide Metabolism:
Adenosine triphosphate + L-Glutamine + Nicotinic acid adenine dinucleotide + Water ⟶ Adenosine monophosphate + L-Glutamic acid + NAD + Pyrophosphate
- Nicotinate and Nicotinamide Metabolism:
Adenosine triphosphate + L-Glutamine + Nicotinic acid adenine dinucleotide + Water ⟶ Adenosine monophosphate + L-Glutamic acid + NAD + Pyrophosphate
- Nicotinate and Nicotinamide Metabolism:
Adenosine triphosphate + L-Glutamine + Nicotinic acid adenine dinucleotide + Water ⟶ Adenosine monophosphate + L-Glutamic acid + NAD + Pyrophosphate
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine biosynthesis PC(16:0/18:0):
PE(16:0/18:0) + S-Adenosylmethionine ⟶ Hydrogen Ion + PE-NMe(16:0/18:0) + S-Adenosylhomocysteine
- Phosphatidylcholine Biosynthesis PC(16:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Biotin Metabolism:
Dethiobiotin + Hydrogen Ion + S-Adenosylmethionine + a sulfurated [sulfur carrier] ⟶ 5'-Deoxyadenosine + Biotin + L-Methionine
- Biotin Metabolism:
Adenosine triphosphate + Biotin ⟶ Biotinyl-5'-AMP + diphosphate
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Porphyrin Metabolism:
Adenosine triphosphate + Hydrogen Ion + L-Glutamic acid ⟶ Adenosine monophosphate + Pyrophosphate
- Porphyrin Metabolism:
Adenosine triphosphate + Hydrogen Ion + L-Glutamic acid ⟶ Adenosine monophosphate + Pyrophosphate
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Ubiquinone Biosynthesis:
3-Hexaprenyl-4,5-Dihydroxybenzoic acid + S-Adenosylmethionine ⟶ 3-Hexaprenyl-4-hydroxy-5-methoxybenzoic acid + S-Adenosylhomocysteine
- Ubiquinone Biosynthesis:
3-Hexaprenyl-4,5-Dihydroxybenzoic acid + S-Adenosylmethionine ⟶ 3-Hexaprenyl-4-hydroxy-5-methoxybenzoic acid + S-Adenosylhomocysteine
- Ubiquinone Biosynthesis:
3-Hexaprenyl-4,5-Dihydroxybenzoic acid + S-Adenosylmethionine ⟶ 3-Hexaprenyl-4-hydroxy-5-methoxybenzoic acid + S-Adenosylhomocysteine
- Ubiquinone Biosynthesis:
3-Hexaprenyl-4,5-Dihydroxybenzoic acid + S-Adenosylmethionine ⟶ 3-Hexaprenyl-4-hydroxy-5-methoxybenzoic acid + S-Adenosylhomocysteine
- Ubiquinone Biosynthesis:
3-Hexaprenyl-4,5-Dihydroxybenzoic acid + S-Adenosylmethionine ⟶ 3-Hexaprenyl-4-hydroxy-5-methoxybenzoic acid + S-Adenosylhomocysteine
- Ubiquinone Biosynthesis:
3-Hexaprenyl-4,5-Dihydroxybenzoic acid + S-Adenosylmethionine ⟶ 3-Hexaprenyl-4-hydroxy-5-methoxybenzoic acid + S-Adenosylhomocysteine
- Ubiquinone Biosynthesis:
3-Hexaprenyl-4,5-Dihydroxybenzoic acid + S-Adenosylmethionine ⟶ 3-Hexaprenyl-4-hydroxy-5-methoxybenzoic acid + S-Adenosylhomocysteine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Lysolipid Incorporation into ER PC(16:1(9Z)/16:1(9Z)):
Glycerophosphocholine + Water ⟶ Choline + Glycerol 3-phosphate + Hydrogen Ion
- Lysolipid incorporation into Mitochondria PC(16:1(9Z)/16:1(9Z)):
Adenosine triphosphate + LysoPC(16:1(9Z)/0:0) + Water ⟶ Adenosine diphosphate + LysoPC(16:1(9Z)/0:0) + Phosphate
- Phosphatidylcholine biosynthesis PC(16:1(9Z)/16:1(9Z)):
PE(16:1(9Z)/16:1(9Z)) + S-Adenosylmethionine ⟶ Hydrogen Ion + PE-NMe(16:1(9Z)/16:1(9Z)) + S-Adenosylhomocysteine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Betaine Metabolism:
S-Adenosylhomocysteine + Water ⟶ Adenosine + Homocysteine
- Betaine Metabolism:
S-Adenosylhomocysteine + Water ⟶ Adenosine + Homocysteine
- Betaine Metabolism:
S-Adenosylhomocysteine + Water ⟶ Adenosine + Homocysteine
- Betaine Metabolism:
S-Adenosylhomocysteine + Water ⟶ Adenosine + Homocysteine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Secondary Metabolites: Ubiquinol Biosynthesis:
2-Octaprenylphenol + Hydrogen Ion + NADPH + Oxygen ⟶ 2-Octaprenyl-6-hydroxyphenol + NADP + Water
- Secondary Metabolites: Ubiquinol Biosynthesis 2:
2-Octaprenylphenol + Hydrogen Ion + NADPH + Oxygen ⟶ 2-Octaprenyl-6-hydroxyphenol + NADP + Water
- Secondary Metabolites: Ubiquinol Biosynthesis:
Chorismate ⟶ 4-Hydroxybenzoic acid + Pyruvic acid
- Secondary Metabolites: Ubiquinol Biosynthesis 2:
Chorismate ⟶ 4-Hydroxybenzoic acid + Pyruvic acid
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine biosynthesis PC(14:0/18:1(9Z)):
PE(14:0/18:1(9Z)) + S-Adenosylmethionine ⟶ Hydrogen Ion + PE-NMe(14:0/18:1(9Z)) + S-Adenosylhomocysteine
- Phosphatidylcholine Biosynthesis PC(14:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Plastoquinol-9 Biosynthesis:
L-Tyrosine + Oxoglutaric acid ⟶ 4-Hydroxyphenylpyruvic acid + L-Glutamic acid
- Phosphatidylcholine Biosynthesis PC(14:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine biosynthesis PC(15:0/16:0):
PE(15:0/16:0) + S-Adenosylmethionine ⟶ Hydrogen Ion + PE-NMe(15:0/16:0) + S-Adenosylhomocysteine
- Phosphatidylcholine Biosynthesis PC(15:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine biosynthesis PC(14:0/16:0):
PE(14:0/16:0) + S-Adenosylmethionine ⟶ Hydrogen Ion + PE-NMe(14:0/16:0) + S-Adenosylhomocysteine
- Phosphatidylcholine Biosynthesis PC(14:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:1(11Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:1(11Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Histidine Metabolism:
-Alanine + Adenosine triphosphate + L-Histidine ⟶ Adenosine diphosphate + Carnosine + Phosphate
- Histidinemia:
-Alanine + Adenosine triphosphate + L-Histidine ⟶ Adenosine diphosphate + Carnosine + Phosphate
- Histidine Metabolism:
Carnosine + Water ⟶ -Alanine + L-Histidine
- Histidinemia:
Carnosine + Water ⟶ -Alanine + L-Histidine
- Histidine Metabolism:
Carnosine + Water ⟶ -Alanine + L-Histidine
- Histidine Metabolism:
Carnosine + Water ⟶ -Alanine + L-Histidine
- Histidinemia:
Carnosine + Water ⟶ -Alanine + L-Histidine
- Phosphatidylcholine Biosynthesis PC(24:0/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Arsenate Detoxification:
Dimethylarsinate + Hydrogen Ion + reduced electron acceptor ⟶ Dimethylarsinous acid + Water + oxidized electron acceptor
- Phosphatidylcholine Biosynthesis PC(16:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine biosynthesis PC(16:1(9Z)/18:0):
PE(16:1(9Z)/18:0) + S-Adenosylmethionine ⟶ Hydrogen Ion + PE-NMe(16:1(9Z)/18:0) + S-Adenosylhomocysteine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:2(9Z,12Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- PreQ0 Metabolism:
S-Adenosylmethionine ⟶ Adenine + Hydrogen Ion + L-Methionine + epoxyqueuosine
- PreQ0 Metabolism:
S-Adenosylmethionine ⟶ Adenine + Hydrogen Ion + L-Methionine + epoxyqueuosine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Glycine and Serine Metabolism:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Arginine and Proline Metabolism:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Prolidase Deficiency (PD):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Arginine: Glycine Amidinotransferase Deficiency (AGAT Deficiency):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Hyperprolinemia Type II:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Hyperprolinemia Type I:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Prolinemia Type II:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Guanidinoacetate Methyltransferase Deficiency (GAMT Deficiency):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Ornithine Aminotransferase Deficiency (OAT Deficiency):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Dimethylglycine Dehydrogenase Deficiency:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Dihydropyrimidine Dehydrogenase Deficiency (DHPD):
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Sarcosinemia:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Non-Ketotic Hyperglycinemia:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Dimethylglycine Dehydrogenase Deficiency:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Hyperglycinemia, Non-Ketotic:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Creatine Deficiency, Guanidinoacetate Methyltransferase Deficiency:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Hyperornithinemia with Gyrate Atrophy (HOGA):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Hyperornithinemia-Hyperammonemia-Homocitrullinuria [HHH-syndrome]:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- L-Arginine:Glycine Amidinotransferase Deficiency:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- 3-Phosphoglycerate Dehydrogenase Deficiency:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Arginine and Proline Metabolism:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Arginine and Proline Metabolism:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Glycine and Serine Metabolism:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- 3-Phosphoglycerate Dehydrogenase Deficiency:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Arginine: Glycine Amidinotransferase Deficiency (AGAT Deficiency):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Dihydropyrimidine Dehydrogenase Deficiency (DHPD):
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Dimethylglycine Dehydrogenase Deficiency:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Guanidinoacetate Methyltransferase Deficiency (GAMT Deficiency):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Hyperprolinemia Type I:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Hyperprolinemia Type II:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Sarcosinemia:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Non-Ketotic Hyperglycinemia:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Ornithine Aminotransferase Deficiency (OAT Deficiency):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Prolinemia Type II:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Prolidase Deficiency (PD):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Hyperglycinemia, Non-Ketotic:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Creatine Deficiency, Guanidinoacetate Methyltransferase Deficiency:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Hyperornithinemia with Gyrate Atrophy (HOGA):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Hyperornithinemia-Hyperammonemia-Homocitrullinuria [HHH-syndrome]:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- L-Arginine:Glycine Amidinotransferase Deficiency:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- 3-Phosphoglycerate Dehydrogenase Deficiency:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Arginine and Proline Metabolism:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Glycine and Serine Metabolism:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Arginine and Proline Metabolism:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Glycine and Serine Metabolism:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Glycine and Serine Metabolism:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Glycine and Serine Metabolism:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Arginine: Glycine Amidinotransferase Deficiency (AGAT Deficiency):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Dihydropyrimidine Dehydrogenase Deficiency (DHPD):
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Dimethylglycine Dehydrogenase Deficiency:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Guanidinoacetate Methyltransferase Deficiency (GAMT Deficiency):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Hyperprolinemia Type I:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Hyperprolinemia Type II:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Sarcosinemia:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Non-Ketotic Hyperglycinemia:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Ornithine Aminotransferase Deficiency (OAT Deficiency):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Prolinemia Type II:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Prolidase Deficiency (PD):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Hyperglycinemia, Non-Ketotic:
Guanidoacetic acid + S-Adenosylhomocysteine ⟶ Creatine + S-Adenosylmethionine
- Creatine Deficiency, Guanidinoacetate Methyltransferase Deficiency:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Hyperornithinemia with Gyrate Atrophy (HOGA):
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Hyperornithinemia-Hyperammonemia-Homocitrullinuria [HHH-syndrome]:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- L-Arginine:Glycine Amidinotransferase Deficiency:
Guanidoacetic acid + S-Adenosylmethionine ⟶ Creatine + S-Adenosylhomocysteine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:3(9Z,12Z,15Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/22:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(20:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:3(9Z,12Z,15Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine biosynthesis PC(14:0/15:0):
PE(14:0/15:0) + S-Adenosylmethionine ⟶ Hydrogen Ion + PE-NMe(14:0/15:0) + S-Adenosylhomocysteine
- Phosphatidylcholine Biosynthesis PC(14:0/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine biosynthesis PC(16:1(9Z)/18:1(9Z)):
PE(16:1(9Z)/18:1(9Z)) + S-Adenosylmethionine ⟶ Hydrogen Ion + PE-NMe(16:1(9Z)/18:1(9Z)) + S-Adenosylhomocysteine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Quorum Sensing:
S-Adenosylhomocysteine + Water ⟶ Adenine + S-ribosyl-L-homocysteine
- S-Adenosyl-L-Methionine Cycle:
S-Adenosylhomocysteine + Water ⟶ Adenine + S-ribosyl-L-homocysteine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Molybdenum Cofactor Biosynthesis:
Hydrogen Ion + Molybdate + Molybdopterin-AMP ⟶ Adenosine monophosphate + Water + molybdenum cofactor (Moco)
- Thio-Molybdenum Cofactor Biosynthesis:
Hydrogen Ion + Molybdate + Molybdopterin-AMP ⟶ Adenosine monophosphate + Water + molybdenum cofactor (Moco)
- Flavonoid Biosynthesis:
Hydrogen Ion + NADPH + Naringenin ⟶ Apiforol + NADP
- Stilbenoid, Diarylheptanoid, and Gingerol Biosynthesis:
Caffeoyl-CoA + Quinate ⟶ Chlorogenic acid + Coenzyme A
- Phosphatidylcholine Biosynthesis PC(18:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/18:2(9Z,12Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Tyrosine Metabolism:
Homovanillin + NADP + Water ⟶ NADPH + p-Hydroxyphenylacetic acid
- Catecholamine Biosynthesis:
Ascorbic acid + Dopamine + Oxygen ⟶ Dehydroascorbic acid + Norepinephrine + Water
- Aromatic L-Aminoacid Decarboxylase Deficiency:
Ascorbic acid + Dopamine + Oxygen ⟶ Dehydroascorbic acid + Norepinephrine + Water
- Alkaptonuria:
Homovanillin + NADP + Water ⟶ NADPH + p-Hydroxyphenylacetic acid
- Hawkinsinuria:
Homovanillin + NADP + Water ⟶ NADPH + p-Hydroxyphenylacetic acid
- Tyrosinemia Type I:
Homovanillin + NADP + Water ⟶ NADPH + p-Hydroxyphenylacetic acid
- Disulfiram Action Pathway:
Homovanillin + NADP + Water ⟶ NADPH + p-Hydroxyphenylacetic acid
- Tyrosinemia, Transient, of the Newborn:
Homovanillin + NADP + Water ⟶ NADPH + p-Hydroxyphenylacetic acid
- Tyrosine Hydroxylase Deficiency:
Ascorbic acid + Dopamine + Oxygen ⟶ Dehydroascorbic acid + Norepinephrine + Water
- Dopamine beta-Hydroxylase Deficiency:
Homovanillin + NADP + Water ⟶ NADPH + p-Hydroxyphenylacetic acid
- Monoamine Oxidase-A Deficiency (MAO-A):
Homovanillin + NADP + Water ⟶ NADPH + p-Hydroxyphenylacetic acid
- Catecholamine Biosynthesis:
Ascorbic acid + Dopamine + Oxygen ⟶ Dehydroascorbic acid + Norepinephrine + Water
- Tyrosine Metabolism:
Homovanillin + NADP + Water ⟶ NADPH + p-Hydroxyphenylacetic acid
- Alkaptonuria:
Homovanillin + NADP + Water ⟶ NADPH + p-Hydroxyphenylacetic acid
- Hawkinsinuria:
Homovanillin + NADP + Water ⟶ NADPH + p-Hydroxyphenylacetic acid
- Tyrosinemia Type I:
Homovanillin + NADP + Water ⟶ NADPH + p-Hydroxyphenylacetic acid
- Tyrosinemia, Transient, of the Newborn:
Homovanillin + NADP + Water ⟶ NADPH + p-Hydroxyphenylacetic acid
- Dopamine beta-Hydroxylase Deficiency:
Homovanillin + NADP + Water ⟶ NADPH + p-Hydroxyphenylacetic acid
- Monoamine Oxidase-A Deficiency (MAO-A):
Homovanillin + NADP + Water ⟶ NADPH + p-Hydroxyphenylacetic acid
- Tyrosine Metabolism:
Homovanillin + NADP + Water ⟶ NADPH + p-Hydroxyphenylacetic acid
- Tyrosine Metabolism:
Homovanillin + NADP + Water ⟶ NADPH + p-Hydroxyphenylacetic acid
- Tyrosine Metabolism:
Homovanillin + NADP + Water ⟶ NADPH + p-Hydroxyphenylacetic acid
- Alkaptonuria:
Homovanillin + NADP + Water ⟶ NADPH + p-Hydroxyphenylacetic acid
- Aromatic L-Aminoacid Decarboxylase Deficiency:
Ascorbic acid + Dopamine + Oxygen ⟶ Dehydroascorbic acid + Norepinephrine + Water
- Hawkinsinuria:
Homovanillin + NADP + Water ⟶ NADPH + p-Hydroxyphenylacetic acid
- Tyrosinemia Type I:
Homovanillin + NADP + Water ⟶ NADPH + p-Hydroxyphenylacetic acid
- Tyrosinemia, Transient, of the Newborn:
Homovanillin + NADP + Water ⟶ NADPH + p-Hydroxyphenylacetic acid
- Tyrosine Hydroxylase Deficiency:
Ascorbic acid + Dopamine + Oxygen ⟶ Dehydroascorbic acid + Norepinephrine + Water
- Dopamine beta-Hydroxylase Deficiency:
Homovanillin + NADP + Water ⟶ NADPH + p-Hydroxyphenylacetic acid
- Monoamine Oxidase-A Deficiency (MAO-A):
Homovanillin + NADP + Water ⟶ NADPH + p-Hydroxyphenylacetic acid
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/18:1(9Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine biosynthesis PC(16:0/20:1(11Z)):
PE(16:0/20:1(11Z)) + S-Adenosylmethionine ⟶ Hydrogen Ion + PE-NMe(16:0/20:1(11Z)) + S-Adenosylhomocysteine
- Phosphatidylcholine Biosynthesis PC(16:0/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/20:1(11Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(16:0/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phenytoin (Antiarrhythmic) Action Pathway:
Hydrogen Ion + NADPH + Oxygen + Phenytoin ⟶ NADP + Phenytoin arene-oxide + Water
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine biosynthesis PC(16:0/18:1(11Z)):
PE(16:0/18:1(11Z)) + S-Adenosylmethionine ⟶ Hydrogen Ion + PE-NMe(16:0/18:1(11Z)) + S-Adenosylhomocysteine
- Phosphatidylcholine Biosynthesis PC(16:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/18:1(11Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(16:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/22:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/18:3(9Z,12Z,15Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Lysolipid Incorporation into ER PC(18:0/18:0):
Glycerophosphocholine + Water ⟶ Choline + Glycerol 3-phosphate + Hydrogen Ion
- Lysolipid incorporation into Mitochondria PC(18:0/18:0):
Adenosine triphosphate + LysoPC(18:0) + Water ⟶ Adenosine diphosphate + LysoPC(18:0) + Phosphate
- Phosphatidylcholine biosynthesis PC(18:0/18:0):
PE(18:0/18:0) + S-Adenosylmethionine ⟶ Hydrogen Ion + PE-NMe(18:0/18:0) + S-Adenosylhomocysteine
- Phosphatidylcholine Biosynthesis PC(18:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/18:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:0/18:0):
CDP-Ethanolamine + DG(18:0/18:0/0:0) ⟶ Cytidine monophosphate + PE(18:0/18:0)
- Phosphatidylcholine Biosynthesis PC(18:0/18:0):
CDP-Ethanolamine + DG(18:0/18:0/0:0) ⟶ Cytidine monophosphate + PE(18:0/18:0)
- Phosphatidylcholine Biosynthesis PC(18:0/18:0):
CDP-Ethanolamine + DG(18:0/18:0/0:0) ⟶ Cytidine monophosphate + PE(18:0/18:0)
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine biosynthesis PC(18:1(11Z)/18:1(11Z)):
PE(18:1(11Z)/18:1(11Z)) + S-Adenosylmethionine ⟶ Hydrogen Ion + PE-NMe(18:1(11Z)/18:1(11Z)) + S-Adenosylhomocysteine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Lipoic Acid Metabolism:
Lipoyl-AMP + a [lipoyl-carrier protein]-L-lysine ⟶ Adenosine monophosphate + Hydrogen Ion + Protein N6-(lipoyl)lysine
- Lipoate Biosynthesis and Incorporation I:
Reduced ferredoxin + S-Adenosylmethionine + a [lipoyl-carrier protein] N6-octanoyl-L-lysine + a sulfurated [sulfur carrier] ⟶ 5'-Deoxyadenosine + L-Methionine + Oxidized ferredoxin + Protein N6-(lipoyl)lysine + an unsulfurated [sulfur carrier]
- Methionine Metabolism and Salvage:
2-Oxo-4-methylthiobutanoic acid + L-Phenylalanine ⟶ 2-Ketobutyric acid + L-Methionine
- Sarcosine Oncometabolite Pathway:
L-Serine + Tetrahydrofolic acid ⟶ 5,10-Methylene-THF + Glycine + Water
- Methionine Metabolism:
2-iminobutanoate + Hydrogen Ion + Water ⟶ 2-Ketobutyric acid + Ammonium
- Lipoic Acid Metabolism:
Octanoyl-[acyl-carrier protein] + S-Adenosylmethionine + a sulfur donor ⟶ 5'-Deoxyadenosine + L-Methionine + Lipoyl-ACP
- Sarcosine Oncometabolite Pathway:
L-Serine + Tetrahydrofolic acid ⟶ 5,10-Methylene-THF + Glycine + Water
- Sarcosine Oncometabolite Pathway:
L-Serine + Tetrahydrofolic acid ⟶ 5,10-Methylene-THF + Glycine + Water
- Lipoic Acid Metabolism:
Lipoyl-AMP + a [lipoyl-carrier protein]-L-lysine ⟶ Adenosine monophosphate + Protein N6-(lipoyl)lysine
- Lipoate Biosynthesis and Incorporation I:
Reduced ferredoxin + S-Adenosylmethionine + a [lipoyl-carrier protein] N6-octanoyl-L-lysine + a sulfurated [sulfur carrier] ⟶ 5'-Deoxyadenosine + L-Methionine + Oxidized ferredoxin + Protein N6-(lipoyl)lysine + an unsulfurated [sulfur carrier]
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/22:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(16:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Choline Biosynthesis I:
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Choline Biosynthesis II:
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Glycine Betaine Biosynthesis I:
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Glycine Betaine Biosynthesis II:
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis:
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(16:0/18:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(16:0/18:2(9Z,12Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(16:0/20:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(16:0/20:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:0/18:1(11Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:0/18:3(6Z,9Z,12Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:0/18:3(9Z,12Z,15Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:0/20:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:0/20:1(11Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:0/20:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:0/22:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:0/22:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/18:3(6Z,9Z,12Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:1(11Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:1(11Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:2(9Z,12Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:3(6Z,9Z,12Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/22:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/20:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/22:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:1(11Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/20:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/20:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(20:0/20:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(20:0/20:1(11Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(20:0/20:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:1(11Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(20:1(13Z)/20:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(20:1(13Z)/22:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(20:1(13Z)/22:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(22:0/22:0):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/22:1(13Z)):
Hydrogen Ion + L-Serine ⟶ Carbon dioxide + Ethanolamine
- Phosphatidylcholine biosynthesis PC(15:0/18:1(9Z)):
PE(15:0/18:1(9Z)) + S-Adenosylmethionine ⟶ Hydrogen Ion + PE-NMe(15:0/18:1(9Z)) + S-Adenosylhomocysteine
- Phosphatidylcholine Biosynthesis PC(15:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:2(13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(4Z,7Z,10Z,13Z,16Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:0/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine biosynthesis PC(15:0/18:1(11Z)):
PE(15:0/18:1(11Z)) + S-Adenosylmethionine ⟶ Hydrogen Ion + PE-NMe(15:0/18:1(11Z)) + S-Adenosylhomocysteine
- Phosphatidylcholine Biosynthesis PC(15:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:4(7Z,10Z,13Z,16Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/15:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/18:3(6Z,9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine biosynthesis PC(14:1(9Z)/18:1(11Z)):
PE(14:1(9Z)/18:1(11Z)) + S-Adenosylmethionine ⟶ Hydrogen Ion + PE-NMe(14:1(9Z)/18:1(11Z)) + S-Adenosylhomocysteine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:1(9Z)/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/14:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/22:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(8Z,11Z,14Z,17Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(5Z,8Z,11Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/22:1(13Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:1(15Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:4(6Z,9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine biosynthesis PC(15:0/16:1(9Z)):
PE(15:0/16:1(9Z)) + S-Adenosylmethionine ⟶ Hydrogen Ion + PE-NMe(15:0/16:1(9Z)) + S-Adenosylhomocysteine
- Phosphatidylcholine Biosynthesis PC(15:0/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/24:1(15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:2(13Z,16Z)/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:0/16:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:1(9Z)/20:4(8Z,11Z,14Z,17Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/20:3(8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Lysolipid Incorporation into Mitochondria:
Adenosine triphosphate + LysoPC(14:0/0:0) + Water ⟶ Adenosine diphosphate + LysoPC(14:0/0:0) + Phosphate
- Lysolipid Incorporation into ER:
Glycerophosphocholine + Water ⟶ Choline + Glycerol 3-phosphate + Hydrogen Ion
- Phosphatidylcholine Biosynthesis:
PE(14:0/14:0) + S-Adenosylmethionine ⟶ Hydrogen Ion + PE-NMe(14:0/14:0) + S-Adenosylhomocysteine
- Lysolipid Incorporation into ER PC(14:0/14:0):
Glycerophosphocholine + Water ⟶ Choline + Glycerol 3-phosphate + Hydrogen Ion
- Lysolipid incorporation into Mitochondria PC(14:0/14:0):
Adenosine triphosphate + LysoPC(14:0/0:0) + Water ⟶ Adenosine diphosphate + LysoPC(14:0/0:0) + Phosphate
- Phosphatidylcholine Biosynthesis PC(14:0/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine biosynthesis PC(14:0/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(14:0/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/20:2(11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:0/18:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/18:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/18:2(9Z,12Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:1(13Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine biosynthesis PC(16:0/16:1(9Z)):
PE(16:0/16:1(9Z)) + S-Adenosylmethionine ⟶ Hydrogen Ion + PE-NMe(16:0/16:1(9Z)) + S-Adenosylhomocysteine
- Phosphatidylcholine Biosynthesis PC(16:0/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(15:0/20:3(5Z,8Z,11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:4(5Z,8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine biosynthesis PC(18:1(11Z)/18:1(9Z)):
PE(18:1(11Z)/18:1(9Z)) + S-Adenosylmethionine ⟶ Hydrogen Ion + PE-NMe(18:1(11Z)/18:1(9Z)) + S-Adenosylhomocysteine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(11Z)/18:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:5(5Z,8Z,11Z,14Z,17Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:1(9Z)/16:1(9Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(24:0/24:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/18:4(6Z,9Z,12Z,15Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:1(11Z)/20:1(11Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:2(11Z,14Z)/22:4(7Z,10Z,13Z,16Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(16:0/14:0):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
- Phosphatidylcholine Biosynthesis PC(20:3(8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)):
Adenosine triphosphate + Choline ⟶ Adenosine diphosphate + Phosphorylcholine
PharmGKB(0)
0 个相关的物种来源信息
在这里通过桑基图来展示出与当前的这个代谢物在我们的BioDeep知识库中具有相关联信息的其他代谢物。在这里进行关联的信息来源主要有:
- PubMed: 来源于PubMed文献库中的文献信息,我们通过自然语言数据挖掘得到的在同一篇文献中被同时提及的相关代谢物列表,这个列表按照代谢物同时出现的文献数量降序排序,取前10个代谢物作为相关研究中关联性很高的代谢物集合展示在桑基图中。
- NCBI Taxonomy: 通过文献数据挖掘,得到的代谢物物种来源信息关联。这个关联信息同样按照出现的次数降序排序,取前10个代谢物作为高关联度的代谢物集合展示在桑吉图上。
- Chemical Taxonomy: 在物质分类上处于同一个分类集合中的其他代谢物
- Chemical Reaction: 在化学反应过程中,存在为当前代谢物相关联的生化反应过程中的反应底物或者反应产物的关联代谢物信息。
点击图上的相关代谢物的名称,可以跳转到相关代谢物的信息页面。
文献列表
- Qinhua Gan, Haifeng Zheng, Xinyu Li, Jing Li, Jingxue Ma, Yuji Zhang, Jiakun Han, Lin Zhang, Wenxu Zhou, Yandu Lu. Solving the Jigsaw puzzle of phytosterol diversity by a novel sterol methyltransferase from Zea mays.
The Journal of steroid biochemistry and molecular biology.
2024 Jun; 240(?):106498. doi:
10.1016/j.jsbmb.2024.106498
. [PMID: 38447903] - James T Carrillo, Dulal Borthakur. Characterization of a plant S-adenosylmethionine synthetase from Acacia koa.
Plant physiology and biochemistry : PPB.
2024 May; 210(?):108618. doi:
10.1016/j.plaphy.2024.108618
. [PMID: 38631157] - Yi Xiao, Chao Han, Xiaocong Li, Xinting Zhu, Sanhua Li, Nian Jiang, Changyan Yu, Yun Liu, Fang Liu. S-Adenosylmethionine (SAM) diet promotes innate immunity via histone H3K4me3 complex.
International immunopharmacology.
2024 Apr; 131(?):111837. doi:
10.1016/j.intimp.2024.111837
. [PMID: 38471365] - Vandana Sekhar, Houssine Ikhlef, Alexandra Bunea, Viet S Nguyen, Johan Joo, Mukund P Tantak, Holly Moots, Otto Phanstiel. The Development of LAT1 Efflux Agonists as Mechanistic Probes of Cellular Amino Acid Stress.
Biomolecules.
2024 Mar; 14(3):. doi:
10.3390/biom14030326
. [PMID: 38540746] - Daniel Leclerc, Karen E Christensen, Alaina M Reagan, Vafa Keser, Yan Luan, Olga V Malysheva, Brandi Wasek, Teodoro Bottiglieri, Marie A Caudill, Gareth R Howell, Rima Rozen. Folate Deficiency and/or the Genetic Variant Mthfr677C >T Can Drive Hepatic Fibrosis or Steatosis in Mice, in a Sex-Specific Manner.
Molecular nutrition & food research.
2024 Mar; 68(5):e2300355. doi:
10.1002/mnfr.202300355
. [PMID: 38327171] - Hong-Chao Duan, Chi Zhang, Peizhe Song, Junbo Yang, Ye Wang, Guifang Jia. C2-methyladenosine in tRNA promotes protein translation by facilitating the decoding of tandem m2A-tRNA-dependent codons.
Nature communications.
2024 Feb; 15(1):1025. doi:
10.1038/s41467-024-45166-6
. [PMID: 38310199] - Stephen G Andrews, Anthony M Koehle, Devendra Paudel, Thomas Neuberger, A Catharine Ross, Vishal Singh, Teodoro Bottiglieri, Rita Castro. Diet-Induced Severe Hyperhomocysteinemia Promotes Atherosclerosis Progression and Dysregulates the Plasma Metabolome in Apolipoprotein-E-Deficient Mice.
Nutrients.
2024 Jan; 16(3):. doi:
10.3390/nu16030330
. [PMID: 38337615] - Huan He, Ziwei Wang, Xueke Peng, Luolong Qing, Yu Zhang, Shaojuan Fu, Juan Xu, Yuanyuan Li, Silong Zhang. Identification of a Sonically Activated Degrader of Methionine Adenosyltransferase 2A by an in Silico Approach Assisted with the Hole-Electron Analysis.
Journal of medicinal chemistry.
2024 Jan; 67(1):543-554. doi:
10.1021/acs.jmedchem.3c01770
. [PMID: 38166392] - Lucía Barbier-Torres, Jyoti Chhimwal, So Yeon Kim, Komal Ramani, Aaron Robinson, Heping Yang, Jenny Van Eyk, Suthat Liangpunsakul, Ekihiro Seki, José M Mato, Shelly C Lu. S-Adenosylmethionine Negatively Regulates the Mitochondrial Respiratory Chain Repressor MCJ in the Liver.
International journal of biological sciences.
2024; 20(4):1218-1237. doi:
10.7150/ijbs.90104
. [PMID: 38385082] - Jianying Yue, Yan Lu, Zhenqi Sun, Yuqing Guo, David San León, Fabio Pasin, Mingmin Zhao. Methyltransferase-like (METTL) homologues participate in Nicotiana benthamiana antiviral responses.
Plant signaling & behavior.
2023 12; 18(1):2214760. doi:
10.1080/15592324.2023.2214760
. [PMID: 37210738] - Yue Liu, Lianjing Ge, Huimeng Tang, Jinhui Zheng, Jinxiang Hu, Jingru Wang, Xiaoyu Yang, Ruimin Zhang, Xiaoyun Wang, Xiuming Li, Yan Zhang, Qinghua Shi. cGMP functions as an important messenger involved in SlSAMS1-regulated salt stress tolerance in tomato.
Plant physiology and biochemistry : PPB.
2023 Nov; 204(?):108097. doi:
10.1016/j.plaphy.2023.108097
. [PMID: 37864930] - Mengjie An, Doudou Chang, Xiaoli Wang, Kaiyong Wang. Protective effects of polymer amendment on specific metabolites in soil and cotton leaves under cadmium contamination.
Ecotoxicology and environmental safety.
2023 Sep; 264(?):115463. doi:
10.1016/j.ecoenv.2023.115463
. [PMID: 37714036] - Wenli Hu, Shuang Hu, Shaozhuang Li, Qi Zhou, Zijing Xie, Xiaohua Hao, Sha Wu, Lianfu Tian, Dongping Li. AtSAMS regulates floral organ development by DNA methylation and ethylene signaling pathway.
Plant science : an international journal of experimental plant biology.
2023 Sep; 334(?):111767. doi:
10.1016/j.plantsci.2023.111767
. [PMID: 37302530] - Hua Li, Lele Zhang, Baocun Wu, Yang Li, Huijuan Wang, Huixin Teng, Dongwei Wei, Zhiliang Yuan, Zuli Yuan. Physiological and proteomic analyses reveal the important role of arbuscular mycorrhizal fungi on enhancing photosynthesis in wheat under cadmium stress.
Ecotoxicology and environmental safety.
2023 Aug; 261(?):115105. doi:
10.1016/j.ecoenv.2023.115105
. [PMID: 37285679] - Zhong-Ce Hu, Yun-Chao Tao, Jun-Chao Pan, Chui-Mu Zheng, Yuan-Shan Wang, Ya-Ping Xue, Zhi-Qiang Liu, Yu-Guo Zheng. Breeding of Saccharomyces cerevisiae with a High-Throughput Screening Strategy for Improvement of S-Adenosyl-L-Methionine Production.
Applied biochemistry and biotechnology.
2023 Jul; ?(?):. doi:
10.1007/s12010-023-04622-7
. [PMID: 37418127] - Meijing Li, Zheyan Mi, Jinhao Wang, Zhongce Hu, Haibin Qin, Yuanshan Wang, Yuguo Zheng. [Microbial production of S-adenosyl-l-methionine: a review].
Sheng wu gong cheng xue bao = Chinese journal of biotechnology.
2023 Jun; 39(6):2248-2264. doi:
10.13345/j.cjb.220959
. [PMID: 37401593] - Han Li, Lu Wu, Fuping Ye, Dapeng Wang, Li Wang, Wenqi Li, Yuan Xu, Zhenyang Li, Jingshu Zhang, Suhua Wang, Aihua Zhang, Qizhan Liu. As3MT via consuming SAM is involved in arsenic-induced nonalcoholic fatty liver disease by blocking m6A-mediated miR-142-5p maturation.
The Science of the total environment.
2023 Jun; 892(?):164746. doi:
10.1016/j.scitotenv.2023.164746
. [PMID: 37301390] - Timothy Salita, Yepy H Rustam, Vinzenz Hofferek, Michael Jackson, Isaac Tollestrup, Jeffrey P Sheridan, Vern L Schramm, Gary B Evans, Gavin E Reid, Andrew B Munkacsi. Phosphoinositide and redox dysregulation by the anticancer methylthioadenosine phosphorylase transition state inhibitor.
Biochimica et biophysica acta. Molecular and cell biology of lipids.
2023 Jun; ?(?):159346. doi:
10.1016/j.bbalip.2023.159346
. [PMID: 37301365] - Li Yang, Xingxing Wang, Fuyong Zhao, Xianliang Zhang, Wei Li, Junsen Huang, Xiaoyu Pei, Xiang Ren, Yangai Liu, Kunlun He, Fei Zhang, Xiongfeng Ma, Daigang Yang. Roles of S-Adenosylmethionine and Its Derivatives in Salt Tolerance of Cotton.
International journal of molecular sciences.
2023 May; 24(11):. doi:
10.3390/ijms24119517
. [PMID: 37298464] - Pei-Yi Chu, Dev-Aur Chou, Po-Ming Chen, En-Pei Isabel Chiang. Translocation of Methionine Adenosyl Transferase MAT2A and Its Prognostic Relevance for Liver Hepatocellular Carcinoma.
International journal of molecular sciences.
2023 May; 24(10):. doi:
10.3390/ijms24109103
. [PMID: 37240447] - Jun-Min Lee, Min-Ho Park, Bu-Soo Park, Min-Kyu Oh. Production of S-methyl-methionine using engineered Saccharomyces cerevisiae sake K6.
Journal of industrial microbiology & biotechnology.
2023 Feb; 50(1):. doi:
10.1093/jimb/kuad026
. [PMID: 37653437] - Tetsuya Hirabayashi, Mai Kawaguchi, Sayaka Harada, Misa Mouri, Rina Takamiya, Yoshimi Miki, Hiroyasu Sato, Yoshitaka Taketomi, Kohei Yokoyama, Tetsuyuki Kobayashi, Suzumi M Tokuoka, Yoshihiro Kita, Emiko Yoda, Shuntaro Hara, Kyohei Mikami, Yasumasa Nishito, Norihito Kikuchi, Rieko Nakata, Mari Kaneko, Hiroshi Kiyonari, Kohji Kasahara, Toshiki Aiba, Kazutaka Ikeda, Tomoyoshi Soga, Makoto Kurano, Yutaka Yatomi, Makoto Murakami. Hepatic phosphatidylcholine catabolism driven by PNPLA7 and PNPLA8 supplies endogenous choline to replenish the methionine cycle with methyl groups.
Cell reports.
2023 Jan; 42(2):111940. doi:
10.1016/j.celrep.2022.111940
. [PMID: 36719796] - Alex Bare, Jaime Thomas, Daniel Etoroma, Soon Goo Lee. Functional analysis of phosphoethanolamine N-methyltransferase in plants and parasites: Essential S-adenosylmethionine-dependent methyltransferase in choline and phospholipid metabolism.
Methods in enzymology.
2023; 680(?):101-137. doi:
10.1016/bs.mie.2022.08.028
. [PMID: 36710008] - Audrey Lashley, Ryan Miller, Stephanie Provenzano, Sara-Alexis Jarecki, Paul Erba, Vonny Salim. Functional Diversification and Structural Origins of Plant Natural Product Methyltransferases.
Molecules (Basel, Switzerland).
2022 Dec; 28(1):. doi:
10.3390/molecules28010043
. [PMID: 36615239] - Francisco J Arriaza-Gallardo, Sebastian Schaupp, Yu-Cong Zheng, Mohd Farid Abdul-Halim, Hui-Jie Pan, Jörg Kahnt, Georgia Angelidou, Nicole Paczia, Xile Hu, Kyle Costa, Seigo Shima. The Function of Two Radical-SAM Enzymes, HcgA and HcgG, in the Biosynthesis of the [Fe]-Hydrogenase Cofactor.
Angewandte Chemie (International ed. in English).
2022 12; 61(50):e202213239. doi:
10.1002/anie.202213239
. [PMID: 36264001] - Gopal Peddinti, Hannu Hotti, Teemu H Teeri, Heiko Rischer. De novo transcriptome assembly of Conium maculatum L. to identify candidate genes for coniine biosynthesis.
Scientific reports.
2022 10; 12(1):17562. doi:
10.1038/s41598-022-21728-w
. [PMID: 36266299] - Atsuko Kitano, Toshio Norikura, Isao Matsui-Yuasa, Hiromi Shimakawa, Makoto Kamezawa, Akiko Kojima-Yuasa. Black carrot extract protects against hepatic injury through epigenetic modifications.
Journal of food biochemistry.
2022 10; 46(10):e14292. doi:
10.1111/jfbc.14292
. [PMID: 35762419] - Qiang Luo, Jiezhen Mo, Hao Chen, Zetao Hu, Baihui Wang, Jiabing Wu, Ziyu Liang, Wenhao Xie, Kangxi Du, Maolin Peng, Yingping Li, Tianyang Li, Yangyi Zhang, Xiaoyan Shi, Wen-Hui Shen, Yang Shi, Aiwu Dong, Hailin Wang, Jinbiao Ma. Structural insights into molecular mechanism for N6-adenosine methylation by MT-A70 family methyltransferase METTL4.
Nature communications.
2022 09; 13(1):5636. doi:
10.1038/s41467-022-33277-x
. [PMID: 36163360] - Amna Devi, Romit Seth, Mamta Masand, Gopal Singh, Ashlesha Holkar, Shikha Sharma, Ashok Singh, Ram Kumar Sharma. Spatial Genomic Resource Reveals Molecular Insights into Key Bioactive-Metabolite Biosynthesis in Endangered Angelica glauca Edgew.
International journal of molecular sciences.
2022 Sep; 23(19):. doi:
10.3390/ijms231911064
. [PMID: 36232367] - Yeong-Biau Yu, Douglas O Adams, Shang Fa Yang. Reprint of: 1-Aminocyclopropanecarboxylate Synthase, a Key Enzyme in Ethylene Biosynthesis.
Archives of biochemistry and biophysics.
2022 09; 726(?):109238. doi:
10.1016/j.abb.2022.109238
. [PMID: 35680445] - Cody T Lloyd, David F Iwig, Bo Wang, Matteo Cossu, William W Metcalf, Amie K Boal, Squire J Booker. Discovery, structure and mechanism of a tetraether lipid synthase.
Nature.
2022 09; 609(7925):197-203. doi:
10.1038/s41586-022-05120-2
. [PMID: 35882349] - Pei-Wen Yang, Ju-Ying Jiao, Zhen Chen, Xiao-Yan Zhu, Chien-Shan Cheng. Keep a watchful eye on methionine adenosyltransferases, novel therapeutic opportunities for hepatobiliary and pancreatic tumours.
Biochimica et biophysica acta. Reviews on cancer.
2022 09; 1877(5):188793. doi:
10.1016/j.bbcan.2022.188793
. [PMID: 36089205] - Renata Orłowska, Jacek Zebrowski, Janusz Zimny, Piotr Androsiuk, Piotr Tomasz Bednarek. S-Adenosyl-L-Methionine and Cu(II) Impact Green Plant Regeneration Efficiency.
Cells.
2022 08; 11(17):. doi:
10.3390/cells11172700
. [PMID: 36078107] - Ayesha M Patel, Karl J Koebke, Timothy J Grunkemeyer, Colleen M Riordan, Youngsoo Kim, Ryan C Bailey, E Neil G Marsh. Purification of the full-length, membrane-associated form of the antiviral enzyme viperin utilizing nanodiscs.
Scientific reports.
2022 07; 12(1):11909. doi:
10.1038/s41598-022-16233-z
. [PMID: 35831548] - Yu Li, Wangdan Xiong, Feng He, Tianxiong Qi, Zhen Sun, Yuchen Liu, Shiqie Bai, Honglun Wang, Zhenying Wu, Chunxiang Fu. Down-regulation of PvSAMS impairs S-adenosyl-L-methionine and lignin biosynthesis, and improves cell wall digestibility in switchgrass.
Journal of experimental botany.
2022 06; 73(12):4157-4169. doi:
10.1093/jxb/erac147
. [PMID: 35383829] - Krisztina A Szigeti, Alexandra Kalmár, Orsolya Galamb, Gábor Valcz, Barbara K Barták, Zsófia B Nagy, Sára Zsigrai, Ildikó Felletár, Árpád V Patai, Tamás Micsik, Márton Papp, Eszter Márkus, Zsolt Tulassay, Peter Igaz, István Takács, Béla Molnár. Global DNA hypomethylation of colorectal tumours detected in tissue and liquid biopsies may be related to decreased methyl-donor content.
BMC cancer.
2022 Jun; 22(1):605. doi:
10.1186/s12885-022-09659-1
. [PMID: 35655145] - Fenglei Sun, Jun Ma, Penglong Wang, Yanlong Yang. Genome-Wide Identification of the SAMS Gene Family in Upland Cotton (Gossypium hirsutum L.) and Expression Analysis in Drought Stress Treatments.
Genes.
2022 05; 13(5):. doi:
10.3390/genes13050860
. [PMID: 35627245] - Takujiro Homma, Sho Kobayashi, Junichi Fujii. Methionine Deprivation Reveals the Pivotal Roles of Cell Cycle Progression in Ferroptosis That Is Induced by Cysteine Starvation.
Cells.
2022 05; 11(10):. doi:
10.3390/cells11101603
. [PMID: 35626640] - Amarnath Bollu, Aileen Peters, Andrea Rentmeister. Chemo-Enzymatic Modification of the 5' Cap To Study mRNAs.
Accounts of chemical research.
2022 05; 55(9):1249-1261. doi:
10.1021/acs.accounts.2c00059
. [PMID: 35420432] - Sarah E Steane, Vinod Kumar, James S M Cuffe, Karen M Moritz, Lisa K Akison. Prenatal Choline Supplementation Alters One Carbon Metabolites in a Rat Model of Periconceptional Alcohol Exposure.
Nutrients.
2022 Apr; 14(9):. doi:
10.3390/nu14091874
. [PMID: 35565848] - Rostom Ahmed-Belkacem, Marcel Hausdorff, Adrien Delpal, Priscila Sutto-Ortiz, Agathe M G Colmant, Franck Touret, Natacha S Ogando, Eric J Snijder, Bruno Canard, Bruno Coutard, Jean-Jacques Vasseur, Etienne Decroly, Françoise Debart. Potent Inhibition of SARS-CoV-2 nsp14 N7-Methyltransferase by Sulfonamide-Based Bisubstrate Analogues.
Journal of medicinal chemistry.
2022 04; 65(8):6231-6249. doi:
10.1021/acs.jmedchem.2c00120
. [PMID: 35439007] - Alexey Sulimov, Danil Kutov, Ivan Ilin, Yibei Xiao, Sheng Jiang, Vladimir Sulimov. Novel Inhibitors of 2'-O-Methyltransferase of the SARS-CoV-2 Coronavirus.
Molecules (Basel, Switzerland).
2022 Apr; 27(9):. doi:
10.3390/molecules27092721
. [PMID: 35566072] - Gokul G, Jogender Singh. Dithiothreitol causes toxicity in C. elegans by modulating the methionine-homocysteine cycle.
eLife.
2022 04; 11(?):. doi:
10.7554/elife.76021
. [PMID: 35438636] - Wen Fang, Yibing Zhu, Sen Yang, Xiaomeng Tong, Cunqi Ye. Reciprocal regulation of phosphatidylcholine synthesis and H3K36 methylation programs metabolic adaptation.
Cell reports.
2022 04; 39(2):110672. doi:
10.1016/j.celrep.2022.110672
. [PMID: 35417718] - Ferrol I Rome, Curtis C Hughey. Disrupted liver oxidative metabolism in glycine N-methyltransferase-deficient mice is mitigated by dietary methionine restriction.
Molecular metabolism.
2022 04; 58(?):101452. doi:
10.1016/j.molmet.2022.101452
. [PMID: 35121169] - Ibrahim H Eissa, Mohamed S Alesawy, Abdulrahman M Saleh, Eslam B Elkaeed, Bshra A Alsfouk, Abdul-Aziz M M El-Attar, Ahmed M Metwaly. Ligand and Structure-Based In Silico Determination of the Most Promising SARS-CoV-2 nsp16-nsp10 2'-o-Methyltransferase Complex Inhibitors among 3009 FDA Approved Drugs.
Molecules (Basel, Switzerland).
2022 Mar; 27(7):. doi:
10.3390/molecules27072287
. [PMID: 35408684] - Mingzhe Ma, Pengfei Kong, Yakai Huang, Jiangli Wang, Xiaocen Liu, YiRen Hu, Xingxing Chen, Chunyan Du, Hui Yang. Activation of MAT2A-ACSL3 pathway protects cells from ferroptosis in gastric cancer.
Free radical biology & medicine.
2022 03; 181(?):288-299. doi:
10.1016/j.freeradbiomed.2022.02.015
. [PMID: 35182729] - Carolyn F McCabe, Jennifer L LaBarre, Steven E Domino, Marjorie C Treadwell, Ana Baylin, Charles F Burant, Dana C Dolinoy, Vasantha Padmanabhan, Jaclyn M Goodrich. Maternal and neonatal one-carbon metabolites and the epigenome-wide infant response.
The Journal of nutritional biochemistry.
2022 03; 101(?):108938. doi:
10.1016/j.jnutbio.2022.108938
. [PMID: 35017001] - Hayley L Knox, Erica K Sinner, Craig A Townsend, Amie K Boal, Squire J Booker. Structure of a B12-dependent radical SAM enzyme in carbapenem biosynthesis.
Nature.
2022 02; 602(7896):343-348. doi:
10.1038/s41586-021-04392-4
. [PMID: 35110734] - Chunling Wang, Junbo Yang, Peizhe Song, Wei Zhang, Qiang Lu, Qiong Yu, Guifang Jia. FIONA1 is an RNA N6-methyladenosine methyltransferase affecting Arabidopsis photomorphogenesis and flowering.
Genome biology.
2022 01; 23(1):40. doi:
10.1186/s13059-022-02612-2
. [PMID: 35101091] - Manikandan Velayutham, Ajay Guru, Mariadhas Valan Arasu, Naif Abdullah Al-Dhabi, Ki Choon Choi, Preetham Elumalai, Ramasamy Harikrishnan, Aziz Arshad, Jesu Arockiaraj. GR15 peptide of S-adenosylmethionine synthase (SAMe) from Arthrospira platensis demonstrated antioxidant mechanism against H2O2 induced oxidative stress in in-vitro MDCK cells and in-vivo zebrafish larvae model.
Journal of biotechnology.
2021 Dec; 342(?):79-91. doi:
10.1016/j.jbiotec.2021.10.010
. [PMID: 34751134] - Lingmei Zeng, Mao Li, Yuting Cen, Zuanyu Wang. Effects of S-adenosyl-L-Methionine Combined with Ursodesoxycholic Acid on Serum Endotoxin, MMP-9 and IL-18 in Neonates with Cholestasis.
Journal of the College of Physicians and Surgeons--Pakistan : JCPSP.
2021 Dec; 31(12):1445-1448. doi:
10.29271/jcpsp.2021.12.1445
. [PMID: 34794285] - Jesús A Rosas-Rodríguez, Elisa M Valenzuela-Soto. The glycine betaine role in neurodegenerative, cardiovascular, hepatic, and renal diseases: Insights into disease and dysfunction networks.
Life sciences.
2021 Nov; 285(?):119943. doi:
10.1016/j.lfs.2021.119943
. [PMID: 34516992] - Ibrahim H Eissa, Mohamed M Khalifa, Eslam B Elkaeed, Elsayed E Hafez, Aisha A Alsfouk, Ahmed M Metwaly. In Silico Exploration of Potential Natural Inhibitors against SARS-Cov-2 nsp10.
Molecules (Basel, Switzerland).
2021 Oct; 26(20):. doi:
10.3390/molecules26206151
. [PMID: 34684735] - Si Liu, Ruyi Liao, Xin Dai, Honghui Guo, Dongliang Wang, Min Xia, Wenhua Ling, Yunjun Xiao. Association between plasma S-adenosylmethionine and risk of mortality in patients with coronary artery disease: A cohort study.
The American journal of clinical nutrition.
2021 10; 114(4):1360-1370. doi:
10.1093/ajcn/nqab210
. [PMID: 34192296] - Bianca Seminotti, Ana Cristina Roginski, Ângela Zanatta, Alexandre Umpierrez Amaral, Thabata Fernandes, Kaleb Pinto Spannenberger, Lucas Henrique Rodrigues da Silva, Rafael Teixeira Ribeiro, Guilhian Leipnitz, Moacir Wajner. S-adenosylmethionine induces mitochondrial dysfunction, permeability transition pore opening and redox imbalance in subcellular preparations of rat liver.
Journal of bioenergetics and biomembranes.
2021 10; 53(5):525-539. doi:
10.1007/s10863-021-09914-3
. [PMID: 34347214] - Pradeep Kumar Sheokand, Monika Narwal, Vandana Thakur, Asif Mohmmed. GlmS mediated knock-down of a phospholipase expedite alternate pathway to generate phosphocholine required for phosphatidylcholine synthesis in Plasmodium falciparum.
The Biochemical journal.
2021 09; 478(18):3429-3444. doi:
10.1042/bcj20200549
. [PMID: 34133721] - Marta Robledo, Natalia I García-Tomsig, Ana M Matia-González, Fernando M García-Rodríguez, José I Jiménez-Zurdo. Synthetase of the methyl donor S-adenosylmethionine from nitrogen-fixing α-rhizobia can bind functionally diverse RNA species.
RNA biology.
2021 08; 18(8):1111-1123. doi:
10.1080/15476286.2020.1829365
. [PMID: 33043803] - Xuanjin Cheng, Junran Yan, Yongxing Liu, Jiahe Wang, Stefan Taubert. eVITTA: a web-based visualization and inference toolbox for transcriptome analysis.
Nucleic acids research.
2021 07; 49(W1):W207-W215. doi:
10.1093/nar/gkab366
. [PMID: 34019643] - Mikyung Kim, Yunmee Rho, Rhoeun Park, Jeeyoun Jung, Geum-Sook Hwang, Youn Kyoung Seo, Ji Hae Seo, Yoonseok Heo, Tae Kyung Ha, Eunyoung Ha. Duodenal-jejunal bypass maintains hepatic S-adenosylmethionine/S-homocysteine ratio in diet-induced obese rats.
Surgery for obesity and related diseases : official journal of the American Society for Bariatric Surgery.
2021 Jul; 17(7):1359-1368. doi:
10.1016/j.soard.2021.02.011
. [PMID: 33753007] - Yan Luan, Daniel Leclerc, Marta Cosín-Tomás, Olga V Malysheva, Brandi Wasek, Teodoro Bottiglieri, Marie A Caudill, Rima Rozen. Moderate Folic Acid Supplementation in Pregnant Mice Results in Altered Methyl Metabolism and in Sex-Specific Placental Transcription Changes.
Molecular nutrition & food research.
2021 07; 65(14):e2100197. doi:
10.1002/mnfr.202100197
. [PMID: 34010503] - Gulin Amasya, Ahmet Dogan Ergin, Ozge Erkan Cakirci, Arif Tanju Ozçelikay, Zerrin Sezgin Bayindir, Nilufer Yuksel. A study to enhance the oral bioavailability of s-adenosyl-l-methionine (SAMe): SLN and SLN nanocomposite particles.
Chemistry and physics of lipids.
2021 07; 237(?):105086. doi:
10.1016/j.chemphyslip.2021.105086
. [PMID: 33930379] - George Minasov, Monica Rosas-Lemus, Ludmilla Shuvalova, Nicole L Inniss, Joseph S Brunzelle, Courtney M Daczkowski, Paul Hoover, Andrew D Mesecar, Karla J F Satchell. Mn2+ coordinates Cap-0-RNA to align substrates for efficient 2'-O-methyl transfer by SARS-CoV-2 nsp16.
Science signaling.
2021 06; 14(689):. doi:
10.1126/scisignal.abh2071
. [PMID: 34131072] - Melissa van Dülmen, Nils Muthmann, Andrea Rentmeister. Chemo-Enzymatic Modification of the 5' Cap Maintains Translation and Increases Immunogenic Properties of mRNA.
Angewandte Chemie (International ed. in English).
2021 06; 60(24):13280-13286. doi:
10.1002/anie.202100352
. [PMID: 33751748] - Kourosh H Ebrahimi, Javier Gilbert-Jaramillo, William S James, James S O McCullagh. Interferon-stimulated gene products as regulators of central carbon metabolism.
The FEBS journal.
2021 06; 288(12):3715-3726. doi:
10.1111/febs.15625
. [PMID: 33185982] - Xiaozhen Huang, Shudong Chen, Weiping Li, Lingli Tang, Yueqin Zhang, Ning Yang, Yupan Zou, Xiawan Zhai, Nan Xiao, Wei Liu, Pilong Li, Cao Xu. ROS regulated reversible protein phase separation synchronizes plant flowering.
Nature chemical biology.
2021 05; 17(5):549-557. doi:
10.1038/s41589-021-00739-0
. [PMID: 33633378] - Jacob Joseph, Anna Giczewska, Brooke Alhanti, Amrita K Cheema, Diane E Handy, Douglas L Mann, Joseph Loscalzo, Michael M Givertz. Associations of methyl donor and methylation inhibitor levels during anti-oxidant therapy in heart failure.
Journal of physiology and biochemistry.
2021 May; 77(2):295-304. doi:
10.1007/s13105-021-00797-x
. [PMID: 33595776] - Tao Guo, Zhe Dai, Ke You, Shyue-Fang Battaglia-Hsu, Juan Feng, Fengliang Wang, Bao Li, Jian Yang, Zhen Li. S-adenosylmethionine upregulates the angiotensin receptor-binding protein ATRAP via the methylation of HuR in NAFLD.
Cell death & disease.
2021 03; 12(4):306. doi:
10.1038/s41419-021-03591-1
. [PMID: 33753727] - Jie Liu, Jun Huang, Peikun Xin, Guiting Liu, Jun Wu. Biomedical applications of methionine-based systems.
Biomaterials science.
2021 Mar; 9(6):1961-1973. doi:
10.1039/d0bm02180f
. [PMID: 33537687] - Annalisa Roberti, Agustín F Fernández, Mario F Fraga. Nicotinamide N-methyltransferase: At the crossroads between cellular metabolism and epigenetic regulation.
Molecular metabolism.
2021 03; 45(?):101165. doi:
10.1016/j.molmet.2021.101165
. [PMID: 33453420] - Pooja Dhiman, Raji Ramachandran Pillai, Anand Babu Wilson, Nancy Premkumar, Balaji Bharadwaj, Veena P Ranjan, Soundravally Rajendiran. Cross-sectional association between vitamin B12 status and probable postpartum depression in Indian women.
BMC pregnancy and childbirth.
2021 Feb; 21(1):146. doi:
10.1186/s12884-021-03622-x
. [PMID: 33596868] - Maria Petrovna Kruglova, Alexander Vladimirovich Ivanov, Edward Danielevich Virus, Polina Olegovna Bulgakova, Andrey Segeevich Samokhin, Anatolij Nikolaevich Fedoseev, Sergej Vital'evich Grachev, Aslan Amirkhanovich Kubatiev. Urine S-Adenosylmethionine are Related to Degree of Renal Insufficiency in Patients with Chronic Kidney Disease.
Laboratory medicine.
2021 Jan; 52(1):47-56. doi:
10.1093/labmed/lmaa034
. [PMID: 32702115] - Xiaofan Yang, Ting Huang, Tiantian Wang, Hongbo Gao, Haitao Zhang, Wen Peng, Jiacong Zhao, Shujing Hu, Panpan Lu, Zhongsi Hong, Bo Li, Kai Deng. MAT2A-Mediated S-Adenosylmethionine Level in CD4+ T Cells Regulates HIV-1 Latent Infection.
Frontiers in immunology.
2021; 12(?):745784. doi:
10.3389/fimmu.2021.745784
. [PMID: 34616406] - George Stojan, Jessica Li, Tian Liu, Maureen A Kane, Michelle A Petri. Intracellular homocysteine metabolites in SLE: plasma S-adenosylhomocysteine correlates with coronary plaque burden.
Lupus science & medicine.
2021 01; 8(1):. doi:
10.1136/lupus-2020-000453
. [PMID: 33479047] - Chie Yokouchi, Yukari Nishimura, Hirohiko Goto, Makoto Sato, Yuya Hidoh, Kenji Takeuchi, Yuji Ishii. Reduction of fatty liver in rats by nicotinamide via the regeneration of the methionine cycle and the inhibition of aldehyde oxidase.
The Journal of toxicological sciences.
2021; 46(1):31-42. doi:
10.2131/jts.46.31
. [PMID: 33408299] - Evgeny Vladimirovich Kryukov, Alexander Vladimirovich Ivanov, Vladimir Olegovich Karpov, Valery Vasil'evich Aleksandrin, Alexander Mikhaylovich Dygai, Maria Petrovna Kruglova, Gennady Ivanovich Kostiuchenko, Sergei Petrovich Kazakov, Aslan Amirkhanovich Kubatiev. Plasma S-Adenosylmethionine Is Associated with Lung Injury in COVID-19.
Disease markers.
2021; 2021(?):7686374. doi:
10.1155/2021/7686374
. [PMID: 34956420] - Vivian Robert Jeyachandran, Jay V Pendyala, Erin L McCarthy, Amie K Boal, Squire J Booker. Biochemical Approaches to Probe the Role of the Auxiliary Iron-Sulfur Cluster of Lipoyl Synthase from Mycobacterium Tuberculosis.
Methods in molecular biology (Clifton, N.J.).
2021; 2353(?):307-332. doi:
10.1007/978-1-0716-1605-5_16
. [PMID: 34292556] - Johanna Rapp, Pascal Rath, Joachim Kilian, Klaus Brilisauer, Stephanie Grond, Karl Forchhammer. A bioactive molecule made by unusual salvage of radical SAM enzyme byproduct 5-deoxyadenosine blurs the boundary of primary and secondary metabolism.
The Journal of biological chemistry.
2021 Jan; 296(?):100621. doi:
10.1016/j.jbc.2021.100621
. [PMID: 33811856] - Salman Sahid, Chandan Roy, Soumitra Paul, Riddhi Datta. Rice lectin protein r40c1 imparts drought tolerance by modulating S-adenosylmethionine synthase 2, stress-associated protein 8 and chromatin-associated proteins.
Journal of experimental botany.
2020 12; 71(22):7331-7346. doi:
10.1093/jxb/eraa400
. [PMID: 32853345] - Beth R Cameron, Ludvina Ferreira, I David MacDonald. Pharmacokinetic study of a novel oral formulation of S-adenosylmethionine (MSI-195) in healthy subjects: dose escalation, food effect and comparison to a commercial nutritional supplement product.
BMC pharmacology & toxicology.
2020 12; 21(1):88. doi:
10.1186/s40360-020-00466-7
. [PMID: 33317621] - Amna Mhamdi. Here, There, and Everywhere: Plastid- and Nuclear-Localized WHIRLY1 Regulates Salicylic Acid Homeostasis during Developmental Senescence.
Plant physiology.
2020 12; 184(4):1620-1621. doi:
10.1104/pp.20.01475
. [PMID: 33277328] - Justin G P Miller, Ankur Jamwal, Yaroslav Ilnytskyy, Alice Hontela, Steve B Wiseman. Dicamba elevates concentrations of S-adenosyl methionine but does not induce oxidative stress or alter DNA methylation in rainbow trout (Oncorhynchus mykiss) hepatocytes.
Comparative biochemistry and physiology. Part D, Genomics & proteomics.
2020 12; 36(?):100744. doi:
10.1016/j.cbd.2020.100744
. [PMID: 32950925] - Mi Young Heo, Ra-Mi Park, Bit-Na Kim, Ngoc-Han Thi Nguyen, Hye Weon Jang, Yang-Hoon Kim, Jiho Min. Lysosomes Alteration in HeLa Cell Exposed with 1-Aminocyclopropane-1-Carboxylic Acid, the Ethylene Precursor of Plant Hormones.
Molecular biotechnology.
2020 Dec; 62(11-12):557-562. doi:
10.1007/s12033-020-00272-w
. [PMID: 32949367] - Shijun Xing, Ling Shi, Guangjuan Liu, Mingrui Zhu, Yanli Xu, Dan Liu, Xin He, Zirong Wang. S-Adenosyl-l-Methionine Promotes Metabolism of Fungicides in Cabernet Sauvignon (Vitis vinifera L.) Berries.
Journal of agricultural and food chemistry.
2020 Nov; 68(44):12413-12420. doi:
10.1021/acs.jafc.0c04016
. [PMID: 33104344] - E Kilanczyk, J M Banales, E Wunsch, O Barbier, M A Avila, J M Mato, M Milkiewicz, P Milkiewicz. S-adenosyl-L-methionine (SAMe) halts the autoimmune response in patients with primary biliary cholangitis (PBC) via antioxidant and S-glutathionylation processes in cholangiocytes.
Biochimica et biophysica acta. Molecular basis of disease.
2020 11; 1866(11):165895. doi:
10.1016/j.bbadis.2020.165895
. [PMID: 32681864] - Annika Rogstam, Maria Nyblom, Signe Christensen, Celeste Sele, Vladimir O Talibov, Therese Lindvall, Anna Andersson Rasmussen, Ingemar André, Zoë Fisher, Wolfgang Knecht, Frank Kozielski. Crystal Structure of Non-Structural Protein 10 from Severe Acute Respiratory Syndrome Coronavirus-2.
International journal of molecular sciences.
2020 Oct; 21(19):. doi:
10.3390/ijms21197375
. [PMID: 33036230] - Rajavel Elango. Methionine Nutrition and Metabolism: Insights from Animal Studies to Inform Human Nutrition.
The Journal of nutrition.
2020 10; 150(Suppl 1):2518S-2523S. doi:
10.1093/jn/nxaa155
. [PMID: 33000159] - Monica Rosas-Lemus, George Minasov, Ludmilla Shuvalova, Nicole L Inniss, Olga Kiryukhina, Joseph Brunzelle, Karla J F Satchell. High-resolution structures of the SARS-CoV-2 2'-O-methyltransferase reveal strategies for structure-based inhibitor design.
Science signaling.
2020 09; 13(651):. doi:
10.1126/scisignal.abe1202
. [PMID: 32994211] - Laura Vergani, Francesca Baldini, Mohamad Khalil, Adriana Voci, Pietro Putignano, Niccolò Miraglia. New Perspectives of S-Adenosylmethionine (SAMe) Applications to Attenuate Fatty Acid-Induced Steatosis and Oxidative Stress in Hepatic and Endothelial Cells.
Molecules (Basel, Switzerland).
2020 Sep; 25(18):. doi:
10.3390/molecules25184237
. [PMID: 32942773] - Rostom Ahmed-Belkacem, Priscila Sutto-Ortiz, Mathis Guiraud, Bruno Canard, Jean-Jacques Vasseur, Etienne Decroly, Françoise Debart. Synthesis of adenine dinucleosides SAM analogs as specific inhibitors of SARS-CoV nsp14 RNA cap guanine-N7-methyltransferase.
European journal of medicinal chemistry.
2020 Sep; 201(?):112557. doi:
10.1016/j.ejmech.2020.112557
. [PMID: 32563813] - Narendranath Bhokisham, Yi Liu, Adam D Brown, Gregory F Payne, James N Culver, William E Bentley. Transglutaminase-mediated assembly of multi-enzyme pathway onto TMV brush surfaces for synthesis of bacterial autoinducer-2.
Biofabrication.
2020 07; 12(4):045017. doi:
10.1088/1758-5090/ab9e7a
. [PMID: 32559753] - Sheng Lin, Hua Chen, Fei Ye, Zimin Chen, Fanli Yang, Yue Zheng, Yu Cao, Jingxin Qiao, Shengyong Yang, Guangwen Lu. Crystal structure of SARS-CoV-2 nsp10/nsp16 2'-O-methylase and its implication on antiviral drug design.
Signal transduction and targeted therapy.
2020 07; 5(1):131. doi:
10.1038/s41392-020-00241-4
. [PMID: 32728018] - Kate F Walker, Lucy C Chappell, William M Hague, Philippa Middleton, Jim G Thornton. Pharmacological interventions for treating intrahepatic cholestasis of pregnancy.
The Cochrane database of systematic reviews.
2020 07; 7(?):CD000493. doi:
10.1002/14651858.cd000493.pub3
. [PMID: 32716060] - Thiruselvam Viswanathan, Shailee Arya, Siu-Hong Chan, Shan Qi, Nan Dai, Anurag Misra, Jun-Gyu Park, Fatai Oladunni, Dmytro Kovalskyy, Robert A Hromas, Luis Martinez-Sobrido, Yogesh K Gupta. Structural basis of RNA cap modification by SARS-CoV-2.
Nature communications.
2020 07; 11(1):3718. doi:
10.1038/s41467-020-17496-8
. [PMID: 32709886] - Courtney A Whalen, Floyd J Mattie, Cristina Florindo, Bertrand van Zelst, Neil K Huang, Isabel Tavares de Almeida, Sandra G Heil, Thomas Neuberger, A Catharine Ross, Rita Castro. No Effect of Diet-Induced Mild Hyperhomocysteinemia on Vascular Methylating Capacity, Atherosclerosis Progression, and Specific Histone Methylation.
Nutrients.
2020 Jul; 12(8):. doi:
10.3390/nu12082182
. [PMID: 32717800] - Ramaian Santhaseela Anand, Dhasarathan Ganesan, Senthilraja Selvam, Sudarshana Rajasekaran, Tamilselvan Jayavelu. Distinct utilization of biotin in and between adipose and brain during aging is associated with a lipogenic shift in Wistar rat brain.
Nutrition research (New York, N.Y.).
2020 07; 79(?):68-76. doi:
10.1016/j.nutres.2020.06.004
. [PMID: 32650222] - Robert M Hoffman, Qinghong Han. Oral Methioninase for Covid-19 Methionine-restriction Therapy.
In vivo (Athens, Greece).
2020 Jun; 34(3 Suppl):1593-1596. doi:
10.21873/invivo.11948
. [PMID: 32503816] - Bartosz Sekula, Milosz Ruszkowski, Zbigniew Dauter. S-adenosylmethionine synthases in plants: Structural characterization of type I and II isoenzymes from Arabidopsis thaliana and Medicago truncatula.
International journal of biological macromolecules.
2020 May; 151(?):554-565. doi:
10.1016/j.ijbiomac.2020.02.100
. [PMID: 32057875] - Justin A North, John A Wildenthal, Tobias J Erb, Bradley S Evans, Kathryn M Byerly, John A Gerlt, Fred R Tabita. A bifunctional salvage pathway for two distinct S-adenosylmethionine by-products that is widespread in bacteria, including pathogenic Escherichia coli.
Molecular microbiology.
2020 05; 113(5):923-937. doi:
10.1111/mmi.14459
. [PMID: 31950558]