Tetrahydropteroyltri-L-glutamic acid (BioDeep_00000005422)
Secondary id: BioDeep_00000019520, BioDeep_00000279428, BioDeep_00001869442
human metabolite Endogenous
代谢物信息卡片
化学式: C29H37N9O12 (703.2561562000001)
中文名称:
谱图信息:
最多检出来源 Ferula hexiensis(natural_products) 0.39%
分子结构信息
SMILES: C1C(NC2=C(N1)N=C(NC2=O)N)CNC3=CC=C(C=C3)C(=O)NC(CCC(=O)NC(CCC(=O)NC(CCC(=O)O)C(=O)O)C(=O)O)C(=O)O
InChI: InChI=1S/C29H37N9O12/c30-29-37-23-22(25(44)38-29)33-15(12-32-23)11-31-14-3-1-13(2-4-14)24(43)36-18(28(49)50)6-9-20(40)34-16(26(45)46)5-8-19(39)35-17(27(47)48)7-10-21(41)42/h1-4,15-18,31,33H,5-12H2,(H,34,40)(H,35,39)(H,36,43)(H,41,42)(H,45,46)(H,47,48)(H,49,50)(H4,30,32,37,38,44)/t15-,16-,17-,18-/m0/s1
描述信息
Tetrahydropteroyltri-L-glutamic acid (CAS: 4227-85-4), also known as (6S)-H4pteglu3, belongs to the class of organic compounds known as tetrahydrofolic acids and derivatives. These are heterocyclic compounds based on the 5,6,7,8-tetrahydropteroic acid skeleton conjugated with at least one L-glutamic acid unit (or a derivative thereof). Tetrahydropteroyltri-L-glutamic acid is a strong basic compound (based on its pKa). In humans, this compound is produced by the bacteria in the gut and may be found in feces or urine. Tetrahydropteroyltri-L-glutamica cid exists in all living species, ranging from bacteria to humans. Tetrahydropteroyltri-L-glutamic acid is an intermediate in the synthesis of methionine by bacteria. It is a substrate for the enzyme 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase which catalyzes the reaction 5-methyltetrahydropteroyltri-L-glutamic acid + L-homocysteine = tetrahydropteroyltri-L-glutamic acid + L-methionine.
A human metabolite taken as a putative food compound of mammalian origin [HMDB]
同义名列表
9 个代谢物同义名
(2S)-2-[(4S)-4-[(4S)-4-{[4-({[(6S)-2-amino-4-oxo-5,6,7,8-tetrahydro-1H-pteridin-6-yl]methyl}amino)phenyl]formamido}-4-carboxybutanamido]-4-carboxybutanamido]pentanedioic acid; (2S)-2-[(4S)-4-[(4S)-4-{[4-({[(6S)-2-amino-4-oxo-1,4,5,6,7,8-hexahydropteridin-6-yl]methyl}amino)phenyl]formamido}-4-carboxybutanamido]-4-carboxybutanamido]pentanedioic acid; Tetrahydropteroyltri-gamma-glutamic acid; Tetrahydropteroyl tri-L-glutamic acid; Tetrahydropteroyltri-L-glutamic acid; Tetrahydropteroyltri-γ-glutamic acid; Tetrahydropteroyl tri-L-glutamate; Tetrahydropteroyltri-L-glutamate; (6S)-H4PteGlu3
数据库引用编号
12 个数据库交叉引用编号
- ChEBI: CHEBI:17420
- KEGG: C04144
- PubChem: 135398572
- PubChem: 16722112
- HMDB: HMDB0012290
- MetaCyc: CPD-1301
- foodb: FDB028919
- chemspider: 17625690
- CAS: 88903-89-3
- PubChem: 6829
- PDB-CCD: 39S
- NIKKAJI: J2.747.003C
分类词条
相关代谢途径
Reactome(0)
BioCyc(9)
- seleno-amino acid biosynthesis
- methionine biosynthesis
- superpathway of lysine, threonine and methionine biosynthesis II
- superpathway of lysine, threonine and methionine biosynthesis I
- methionine biosynthesis II
- methionine biosynthesis I
- tetrahydrofolate biosynthesis I
- folate polyglutamylation I
- methionine and S-adenosylmethionine synthesis
PlantCyc(9)
- formaldehyde oxidation VII (THF pathway)
- S-adenosyl-L-methionine cycle II
- superpathway of seleno-compound metabolism
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate
- L-methionine biosynthesis II
- S-adenosyl-L-methionine salvage II
- L-methionine biosynthesis II (plants)
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II
- seleno-amino acid biosynthesis (plants)
代谢反应
1739 个相关的代谢反应过程信息。
Reactome(0)
BioCyc(82)
- methionine biosynthesis:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- aspartate superpathway:
ATP + ammonia + nicotinate adenine dinucleotide ⟶ AMP + H+ + NAD+ + diphosphate
- superpathway of lysine, threonine and methionine biosynthesis II:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- superpathway of lysine, threonine and methionine biosynthesis I:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- methionine and S-adenosylmethionine synthesis:
ATP + H2O + met ⟶ S-adenosyl-L-methionine + H+ + diphosphate + phosphate
- methionine biosynthesis II:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- methionine biosynthesis I:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- folate polyglutamylation I:
H+ + ser + tetrahydrofolate ⟶ 5,10-methylene-THF + H2O + gly
- tetrahydrofolate biosynthesis I:
6-hydroxymethyl-7,8-dihydropterin + ATP ⟶ 6-hydroxymethyl-dihydropterin diphosphate + AMP + H+
- folate polyglutamylation I:
H+ + ser + tetrahydrofolate ⟶ 5,10-methylenetetrahydrofolate + H2O + gly
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
N5-methyl--tetrahydropteroyl tri-L-glutamate + L-homocysteine ⟶ met + tetrahydropteroyl tri-L-glutamate
- L-methionine biosynthesis II:
N5-methyl--tetrahydropteroyl tri-L-glutamate + L-homocysteine ⟶ met + tetrahydropteroyl tri-L-glutamate
- S-adenosyl-L-methionine cycle II:
N5-methyl--tetrahydropteroyl tri-L-glutamate + L-homocysteine ⟶ met + tetrahydropteroyl tri-L-glutamate
- seleno-amino acid biosynthesis:
L-selenocysteine + O-phospho-L-homoserine ⟶ L-selenocystathionine + phosphate
- S-adenosyl-L-methionine cycle II:
S-adenosyl-L-homocysteine + H2O ⟶ L-homocysteine + adenosine
- methionine and S-adenosylmethionine synthesis:
ATP + H2O + met ⟶ SAM + diphosphate + phosphate
- methionine biosynthesis I:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- aspartate superpathway:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- superpathway of lysine, threonine and methionine biosynthesis I:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- S-adenosyl-L-methionine cycle I:
H2O + SAH ⟶ S-ribosyl-L-homocysteine + adenine
- methionine biosynthesis I:
O-succinyl-L-homoserine + cys ⟶ H+ + L-cystathionine + succinate
- homoserine and methionine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of methionine biosynthesis (transsulfuration):
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- superpathway of lysine, threonine and methionine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt
- aspartate superpathway:
O2 + asp ⟶ α-iminosuccinate + H+ + hydrogen peroxide
- superpathway of S-adenosyl-L-methionine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- superpathway of S-adenosyl-L-methionine biosynthesis:
ATP + asp ⟶ ADP + L-aspartyl-4-phosphate
- S-adenosyl-L-methionine cycle I:
H2O + SAH ⟶ S-ribosyl-L-homocysteine + adenine
- aspartate superpathway:
O2 + asp ⟶ α-iminosuccinate + H+ + hydrogen peroxide
- superpathway of lysine, threonine and methionine biosynthesis I:
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- homoserine and methionine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of methionine biosynthesis (transsulfuration):
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- methionine biosynthesis I:
O-succinyl-L-homoserine + cys ⟶ H+ + L-cystathionine + succinate
- S-adenosyl-L-methionine cycle I:
S-ribosyl-L-homocysteine + adenine ⟶ S-adenosyl-L-homocysteine + H2O
- S-adenosyl-L-methionine cycle II:
S-adenosyl-L-homocysteine + H2O ⟶ L-homocysteine + adenosine
- superpathway of methionine biosynthesis (by sulfhydrylation):
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- methionine biosynthesis I:
H2O + L-cystathionine ⟶ L-homocysteine + ammonium + pyruvate
- superpathway of methionine biosynthesis (transsulfuration):
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- methionine biosynthesis III:
5-methyl-tetrahydrofolate + L-homocysteine ⟶ met + tetrahydrofolate
- homoserine and methionine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- superpathway of S-adenosyl-L-methionine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- S-adenosyl-L-methionine cycle II:
S-adenosyl-L-homocysteine + H2O ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
S-adenosyl-L-homocysteine + H2O ⟶ L-homocysteine + adenosine
- methionine biosynthesis II:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- S-adenosyl-L-methionine cycle I:
S-adenosyl-L-homocysteine + H2O ⟶ S-ribosyl-L-homocysteine + adenine
- S-adenosyl-L-methionine cycle II:
S-adenosyl-L-homocysteine + H2O ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle I:
H2O + SAH ⟶ S-ribosyl-L-homocysteine + adenine
- superpathway of lysine, threonine and methionine biosynthesis I:
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- homoserine and methionine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- methionine biosynthesis I:
O-succinyl-L-homoserine + cys ⟶ H+ + L-cystathionine + succinate
- superpathway of S-adenosyl-L-methionine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- aspartate superpathway:
O2 + asp ⟶ α-iminosuccinate + H+ + hydrogen peroxide
- superpathway of S-adenosyl-L-methionine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- aspartate superpathway:
O2 + asp ⟶ α-iminosuccinate + H+ + hydrogen peroxide
- superpathway of lysine, threonine and methionine biosynthesis I:
2-oxoglutarate + N-succinyl-L,L-2,6-diaminopimelate ⟶ N-succinyl-2-amino-6-ketopimelate + glt
- S-adenosyl-L-methionine cycle I:
H2O + SAH ⟶ S-ribosyl-L-homocysteine + adenine
- methionine biosynthesis I:
O-succinyl-L-homoserine + cys ⟶ H+ + L-cystathionine + succinate
- homoserine and methionine biosynthesis:
L-aspartate-semialdehyde + NADP+ + phosphate ⟶ H+ + L-aspartyl-4-phosphate + NADPH
- homoserine and methionine biosynthesis:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- superpathway of S-adenosyl-L-methionine biosynthesis:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- methionine biosynthesis I:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- superpathway of S-adenosyl-L-methionine biosynthesis:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- superpathway of methionine biosynthesis (transsulfuration):
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- S-adenosyl-L-methionine cycle I:
S-ribosyl-L-homocysteine + adenine ⟶ S-adenosyl-L-homocysteine + H2O
- methionine biosynthesis I:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- homoserine and methionine biosynthesis:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- methionine biosynthesis I:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- superpathway of S-adenosyl-L-methionine biosynthesis:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- methionine biosynthesis II:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- homoserine and methionine biosynthesis:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- superpathway of methionine biosynthesis (transsulfuration):
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- S-adenosyl-L-methionine cycle II:
S-adenosyl-L-homocysteine + H2O ⟶ L-homocysteine + adenosine
- seleno-amino acid biosynthesis:
H2O + L-selenocystathionine ⟶ H+ + ammonia + pyruvate + selenohomocysteine
- S-adenosyl-L-methionine cycle I:
S-adenosyl-L-homocysteine + H2O ⟶ S-ribosyl-L-homocysteine + adenine
- methionine biosynthesis I:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- superpathway of methionine biosynthesis (by sulfhydrylation):
2-oxoglutarate + asp ⟶ glt + oxaloacetate
- homoserine and methionine biosynthesis:
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- S-adenosyl-L-methionine cycle I:
S-ribosyl-L-homocysteine + adenine ⟶ S-adenosyl-L-homocysteine + H2O
- superpathway of methionine biosynthesis (transsulfuration):
H2O + L-cystathionine ⟶ H+ + L-homocysteine + ammonia + pyruvate
- methionine biosynthesis III:
5-methyltetrahydropteroyltri-L-glutamate + H+ + L-homocysteine ⟶ met + tetrahydropteroyl tri-L-glutamate
- methionine biosynthesis III:
5-methyltetrahydropteroyl tri-L-glutamate + L-homocysteine ⟶ met + tetrahydropteroyl tri-L-glutamate
- methionine biosynthesis III:
5-methyl-tetrahydrofolate + L-homocysteine ⟶ met + tetrahydrofolate
WikiPathways(0)
Plant Reactome(370)
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Amino acid metabolism:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Amino acid metabolism:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA
- Amino acid metabolism:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
ATP + H2O + L-Met ⟶ PPi + Pi + SAM
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- Amino acid metabolism:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide
- SAM cycle:
H2O + SAH ⟶ Ade-Rib + LHCYS
- Amino acid biosynthesis:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA
- Methionine biosynthesis II:
CYSTA + H2O ⟶ L-homocysteine + PYR + ammonia
INOH(1)
- Folate metabolism ( Folate metabolism ):
6-Pyruvoyl-5,6,7,8-tetrahydro-pterin + NADPH ⟶ 5,6,7,8-Tetrahydro-biopterin + NADP+
PlantCyc(1270)
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
a tetrahydrofolate + formaldehyde ⟶ H2O + a 5,10-methylenetetrahydrofolate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
a tetrahydrofolate + formaldehyde ⟶ H2O + a 5,10-methylenetetrahydrofolate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- formaldehyde oxidation VII (THF pathway):
H2O + a 10-formyltetrahydrofolate ⟶ H+ + a tetrahydrofolate + formate
- glycine biosynthesis I:
a tetrahydrofolate + ser ⟶ H2O + a 5,10-methylenetetrahydrofolate + gly
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- superpathway of pantothenate and coenzymeA biosynthesis:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- glycine biosynthesis:
a tetrahydrofolate + ser ⟶ H2O + a 5,10-methylenetetrahydrofolate + gly
- folate polyglutamylation:
ATP + a 5,10-methylenetetrahydrofolate + glu ⟶ ADP + a 5,10-methylenetetrahydrofolate + phosphate
- superpathway of coenzyme A biosynthesis II (plants):
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- L-methionine biosynthesis II (plants):
5-methyltetrahydropteroyl tri-L-glutamate + L-homocysteine ⟶ met + tetrahydropteroyl tri-L-glutamate
- seleno-amino acid biosynthesis (plants):
5-methyltetrahydropteroyl tri-L-glutamate + seleno-L-homocysteine ⟶ SeMet + tetrahydropteroyl tri-L-glutamate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
5-methyltetrahydropteroyl tri-L-glutamate + L-homocysteine ⟶ met + tetrahydropteroyl tri-L-glutamate
- S-adenosyl-L-methionine cycle II:
5-methyltetrahydropteroyl tri-L-glutamate + L-homocysteine ⟶ met + tetrahydropteroyl tri-L-glutamate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-oxoglutarate + L,L-diaminopimelate ⟶ (S)-2,3,4,5-tetrahydrodipicolinate + H+ + H2O + glu
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- seleno-amino acid biosynthesis (plants):
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of seleno-compound metabolism:
H+ + glutathione + selenite ⟶ GSSG + H2O + selenodiglutathione
- L-methionine biosynthesis II (plants):
5-methyltetrahydropteroyl tri-L-glutamate + L-homocysteine ⟶ met + tetrahydropteroyl tri-L-glutamate
- S-adenosyl-L-methionine cycle II:
5-methyltetrahydropteroyl tri-L-glutamate + L-homocysteine ⟶ met + tetrahydropteroyl tri-L-glutamate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
5-methyltetrahydropteroyl tri-L-glutamate + L-homocysteine ⟶ met + tetrahydropteroyl tri-L-glutamate
- seleno-amino acid biosynthesis (plants):
5-methyltetrahydropteroyl tri-L-glutamate + seleno-L-homocysteine ⟶ SeMet + tetrahydropteroyl tri-L-glutamate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- seleno-amino acid biosynthesis (plants):
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- seleno-amino acid biosynthesis (plants):
O-acetyl-L-serine + hydrogen selenide ⟶ H+ + L-selenocysteine + acetate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
L-aspartate 4-semialdehyde + pyruvate ⟶ (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + H+ + H2O
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
5-methyltetrahydropteroyl tri-L-glutamate + L-homocysteine ⟶ met + tetrahydropteroyl tri-L-glutamate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
5-methyltetrahydropteroyl tri-L-glutamate + L-homocysteine ⟶ met + tetrahydropteroyl tri-L-glutamate
- superpathway of seleno-compound metabolism:
H+ + glutathione + selenite ⟶ GSSG + H2O + selenodiglutathione
- seleno-amino acid biosynthesis (plants):
5-methyltetrahydropteroyl tri-L-glutamate + seleno-L-homocysteine ⟶ SeMet + tetrahydropteroyl tri-L-glutamate
- L-methionine biosynthesis II (plants):
5-methyltetrahydropteroyl tri-L-glutamate + L-homocysteine ⟶ met + tetrahydropteroyl tri-L-glutamate
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of seleno-compound metabolism:
H+ + glutathione + selenite ⟶ GSSG + H2O + selenodiglutathione
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- superpathway of L-lysine, L-threonine and L-methionine biosynthesis II:
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- L-methionine biosynthesis II (plants):
2-iminopropanoate + H2O ⟶ ammonium + pyruvate
- S-adenosyl-L-methionine cycle II:
H2O + SAH ⟶ L-homocysteine + adenosine
- S-adenosyl-L-methionine cycle II:
ATP + H2O + met ⟶ SAM + diphosphate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin 3'-phosphate + H2O ⟶ 7,8-dihydroneopterin + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- folate polyglutamylation:
ATP + a tetrahydrofolate + glu ⟶ ADP + a tetrahydrofolate + phosphate
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
6-(hydroxymethyl)-7,8-dihydropterin + ATP ⟶ (7,8-dihydropterin-6-yl)methyl diphosphate + AMP + H+
- folate polyglutamylation:
ATP + a tetrahydrofolate + formate ⟶ ADP + a 10-formyltetrahydrofolate + phosphate
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- tetrahydrofolate biosynthesis II:
7,8-dihydroneopterin ⟶ 6-(hydroxymethyl)-7,8-dihydropterin + glycolaldehyde
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- inosine-5'-phosphate biosynthesis II:
SAICAR ⟶ AICAR + fumarate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- inosine-5'-phosphate biosynthesis II:
SAICAR ⟶ AICAR + fumarate
- superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate
- inosine-5'-phosphate biosynthesis II:
SAICAR ⟶ AICAR + fumarate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- inosine-5'-phosphate biosynthesis II:
SAICAR ⟶ AICAR + fumarate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- superpathway of purine nucleotides de novo biosynthesis I:
ATP + H2O + XMP + gln ⟶ AMP + GMP + H+ + diphosphate + glu
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + an N10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- 5-aminoimidazole ribonucleotide biosynthesis I:
GAR + an N10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- superpathway of tetrahydrofolate biosynthesis:
7,8-dihydroneopterin 3'-phosphate + H2O ⟶ 7,8-dihydroneopterin + phosphate
- inosine-5'-phosphate biosynthesis II:
H2O + IMP ⟶ FAICAR
- tetrahydrofolate biosynthesis:
NADP+ + a tetrahydrofolate ⟶ H+ + NADPH + a 7,8-dihydrofolate
- formate assimilation into 5,10-methylenetetrahydrofolate:
NADP+ + a 5,10-methylenetetrahydrofolate ⟶ NADPH + a 5,10-methenyltetrahydrofolate
- inosine-5'-phosphate biosynthesis II:
SAICAR ⟶ AICAR + fumarate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- inosine-5'-phosphate biosynthesis II:
SAICAR ⟶ AICAR + fumarate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- inosine-5'-phosphate biosynthesis II:
SAICAR ⟶ AICAR + fumarate
- superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- inosine-5'-phosphate biosynthesis II:
SAICAR ⟶ AICAR + fumarate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate
- inosine-5'-phosphate biosynthesis II:
SAICAR ⟶ AICAR + fumarate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate
- inosine-5'-phosphate biosynthesis II:
SAICAR ⟶ AICAR + fumarate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate
- inosine-5'-phosphate biosynthesis II:
SAICAR ⟶ AICAR + fumarate
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- inosine-5'-phosphate biosynthesis II:
SAICAR ⟶ AICAR + fumarate
- inosine-5'-phosphate biosynthesis II:
SAICAR ⟶ AICAR + fumarate
- superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- inosine-5'-phosphate biosynthesis II:
SAICAR ⟶ AICAR + fumarate
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate
- inosine-5'-phosphate biosynthesis II:
SAICAR ⟶ AICAR + fumarate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- inosine-5'-phosphate biosynthesis II:
SAICAR ⟶ AICAR + fumarate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- inosine-5'-phosphate biosynthesis II:
SAICAR ⟶ AICAR + fumarate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- inosine-5'-phosphate biosynthesis II:
SAICAR ⟶ AICAR + fumarate
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- inosine-5'-phosphate biosynthesis II:
SAICAR ⟶ AICAR + fumarate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- inosine-5'-phosphate biosynthesis II:
SAICAR ⟶ AICAR + fumarate
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate
- inosine-5'-phosphate biosynthesis II:
SAICAR ⟶ AICAR + fumarate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- inosine-5'-phosphate biosynthesis II:
SAICAR ⟶ AICAR + fumarate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- inosine-5'-phosphate biosynthesis II:
SAICAR ⟶ AICAR + fumarate
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- inosine-5'-phosphate biosynthesis II:
SAICAR ⟶ AICAR + fumarate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- inosine-5'-phosphate biosynthesis II:
SAICAR ⟶ AICAR + fumarate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- inosine-5'-phosphate biosynthesis II:
SAICAR ⟶ AICAR + fumarate
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- inosine-5'-phosphate biosynthesis II:
SAICAR ⟶ AICAR + fumarate
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- inosine-5'-phosphate biosynthesis II:
SAICAR ⟶ AICAR + fumarate
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- superpathway of purine nucleotides de novo biosynthesis I:
adenylo-succinate ⟶ AMP + fumarate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- inosine-5'-phosphate biosynthesis II:
CAIR + H+ ⟶ AIR + CO2
- superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- inosine-5'-phosphate biosynthesis II:
CAIR + H+ ⟶ AIR + CO2
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- inosine-5'-phosphate biosynthesis II:
CAIR + H+ ⟶ AIR + CO2
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- inosine-5'-phosphate biosynthesis II:
CAIR + H+ ⟶ AIR + CO2
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- inosine-5'-phosphate biosynthesis II:
CAIR + H+ ⟶ AIR + CO2
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- superpathway of purine nucleotides de novo biosynthesis I:
CAIR + H+ ⟶ AIR + CO2
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- inosine-5'-phosphate biosynthesis II:
CAIR + H+ ⟶ AIR + CO2
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- inosine-5'-phosphate biosynthesis II:
CAIR + H+ ⟶ AIR + CO2
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- inosine-5'-phosphate biosynthesis II:
CAIR + H+ ⟶ AIR + CO2
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- inosine-5'-phosphate biosynthesis II:
CAIR + H+ ⟶ AIR + CO2
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- inosine-5'-phosphate biosynthesis II:
CAIR + H+ ⟶ AIR + CO2
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- inosine-5'-phosphate biosynthesis II:
CAIR + H+ ⟶ AIR + CO2
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- inosine-5'-phosphate biosynthesis II:
CAIR + H+ ⟶ AIR + CO2
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + an N10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- inosine-5'-phosphate biosynthesis II:
CAIR + H+ ⟶ AIR + CO2
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- inosine-5'-phosphate biosynthesis II:
CAIR + H+ ⟶ AIR + CO2
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- inosine-5'-phosphate biosynthesis II:
CAIR + H+ ⟶ AIR + CO2
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- inosine-5'-phosphate biosynthesis II:
CAIR + H+ ⟶ AIR + CO2
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- inosine-5'-phosphate biosynthesis II:
CAIR + H+ ⟶ AIR + CO2
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + an N10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- superpathway of coenzyme A biosynthesis II (plants):
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- superpathway of purine nucleotides de novo biosynthesis I:
H2O + IMP + NAD+ ⟶ H+ + NADH + XMP
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- superpathway of coenzyme A biosynthesis II (plants):
H+ + an oxidized electron-transfer flavoprotein + propanoyl-CoA ⟶ a reduced electron-transfer flavoprotein + acryloyl-CoA
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
GTP + IMP + asp ⟶ GDP + H+ + adenylo-succinate + phosphate
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + an N10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- inosine-5'-phosphate biosynthesis II:
H2O + IMP ⟶ FAICAR
- 5-aminoimidazole ribonucleotide biosynthesis I:
GAR + an N10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- superpathway of purine nucleotides de novo biosynthesis I:
ATP + GMP ⟶ ADP + GDP
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- superpathway of coenzyme A biosynthesis II (plants):
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- 5-aminoimidazole ribonucleotide biosynthesis I:
ATP + FGAR + H2O + gln ⟶ ADP + FGAM + H+ + glu + phosphate
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- superpathway of coenzyme A biosynthesis II (plants):
ATP + coenzyme A + propanoate ⟶ AMP + diphosphate + propanoyl-CoA
- tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate:
GAR + a 10-formyltetrahydrofolate ⟶ FGAR + H+ + a tetrahydrofolate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- 5-aminoimidazole ribonucleotide biosynthesis I:
5-phospho-β-D-ribosylamine + diphosphate + glu ⟶ H2O + PRPP + gln
- inosine-5'-phosphate biosynthesis II:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- glutamate removal from folates:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
- superpathway of purine nucleotides de novo biosynthesis I:
ATP + CAIR + asp ⟶ ADP + H+ + SAICAR + phosphate
- phosphopantothenate biosynthesis I:
3-methyl-2-oxobutanoate + H2O + a 5,10-methylenetetrahydrofolate ⟶ 2-dehydropantoate + a tetrahydrofolate
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
ATP + a folylpolyglutamate(n) + glu ⟶ ADP + a folylpolyglutamate(n) + phosphate
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- glycine biosynthesis:
thr ⟶ acetaldehyde + gly
- folate polyglutamylation II:
H2O + a tetrahydrofolate ⟶ 5,6,7,8-tetrahydrofolate + glu
COVID-19 Disease Map(0)
PathBank(16)
- Amino Sugar and Nucleotide Sugar Metabolism III:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate
- Polymyxin Resistance:
L-Glutamic acid + UDP- -L-threo-pentapyranos-4-ulose ⟶ Oxoglutaric acid + UDP-4-amino-4-deoxy- -L-arabinopyranose
- Amino Sugar and Nucleotide Sugar Metabolism III:
N-Acetyl-D-Glucosamine 6-Phosphate + Water ⟶ Acetic acid + Glucosamine 6-phosphate
- Polymyxin Resistance:
L-Glutamic acid + UDP- -L-threo-pentapyranos-4-ulose ⟶ Oxoglutaric acid + UDP-4-amino-4-deoxy- -L-arabinopyranose
- Selenocompound Metabolism:
Selenomethionine + Water ⟶ 2-Ketobutyric acid + Ammonia + methylselenol
- Sarcosine Oncometabolite Pathway:
L-Serine + Tetrahydrofolic acid ⟶ 5,10-Methylene-THF + Glycine + Water
- Sarcosine Oncometabolite Pathway:
L-Serine + Tetrahydrofolic acid ⟶ 5,10-Methylene-THF + Glycine + Water
- Sarcosine Oncometabolite Pathway:
L-Serine + Tetrahydrofolic acid ⟶ 5,10-Methylene-THF + Glycine + Water
- One Carbon Pool by Folate:
S-Aminomethyldihydrolipoylprotein; + Tetrahydrofolic acid ⟶ 5,10-Methylene-THF + Ammonia + dihydrolipoylprotein
- Tetrahydrofolate Biosynthesis:
7,8-Dihydroneopterin ⟶ 6-hydroxymethyl-7,8-dihydropterin + Glycolaldehyde
- One Carbon Pool by Folate I:
S-Aminomethyldihydrolipoylprotein; + Tetrahydrofolic acid ⟶ 5,10-Methylene-THF + Ammonia + dihydrolipoylprotein
- One Carbon Pool by Folate:
S-Aminomethyldihydrolipoylprotein; + Tetrahydrofolic acid ⟶ 5,10-Methylene-THF + Ammonia + dihydrolipoylprotein
- Folate Biosynthesis:
Adenosine triphosphate + HMDHP ⟶ Adenosine monophosphate + HMDHP pyrophosphate + Hydrogen Ion
- Methionine Biosynthesis:
L-Cysteine + O-succinyl-L-homoserine ⟶ Hydrogen Ion + L-Cystathionine + Succinic acid
- Methionine Metabolism and Salvage:
2-Oxo-4-methylthiobutanoic acid + L-Phenylalanine ⟶ 2-Ketobutyric acid + L-Methionine
- Methionine Biosynthesis:
L-Cysteine + O-succinyl-L-homoserine ⟶ Hydrogen Ion + L-Cystathionine + Succinic acid
PharmGKB(0)
1 个相关的物种来源信息
在这里通过桑基图来展示出与当前的这个代谢物在我们的BioDeep知识库中具有相关联信息的其他代谢物。在这里进行关联的信息来源主要有:
- PubMed: 来源于PubMed文献库中的文献信息,我们通过自然语言数据挖掘得到的在同一篇文献中被同时提及的相关代谢物列表,这个列表按照代谢物同时出现的文献数量降序排序,取前10个代谢物作为相关研究中关联性很高的代谢物集合展示在桑基图中。
- NCBI Taxonomy: 通过文献数据挖掘,得到的代谢物物种来源信息关联。这个关联信息同样按照出现的次数降序排序,取前10个代谢物作为高关联度的代谢物集合展示在桑吉图上。
- Chemical Taxonomy: 在物质分类上处于同一个分类集合中的其他代谢物
- Chemical Reaction: 在化学反应过程中,存在为当前代谢物相关联的生化反应过程中的反应底物或者反应产物的关联代谢物信息。
点击图上的相关代谢物的名称,可以跳转到相关代谢物的信息页面。