Ubiquinone-1 (BioDeep_00000017802)
human metabolite Endogenous blood metabolite natural product
代谢物信息卡片
2,3-dimethoxy-5-methyl-6-(3-methylbut-2-en-1-yl)cyclohexa-2,5-diene-1,4-dione
化学式: C14H18O4 (250.1205028)
中文名称: 泛醌1, 辅酶Q1
谱图信息:
最多检出来源 Homo sapiens(blood) 0.17%
Reviewed
Last reviewed on 2024-10-24.
Cite this Page
Ubiquinone-1. BioDeep Database v3. PANOMIX ltd, a top metabolomics service provider from China.
https://query.biodeep.cn/s/ubiquinone-1 (retrieved
2024-11-21) (BioDeep RN: BioDeep_00000017802). Licensed
under the Attribution-Noncommercial 4.0 International License (CC BY-NC 4.0).
分子结构信息
SMILES: CC(=CCC1=C(C)C(=O)C(=C(C1=O)OC)OC)C
InChI: InChI=1S/C14H18O4/c1-8(2)6-7-10-9(3)11(15)13(17-4)14(18-5)12(10)16/h6H,7H2,1-5H3
描述信息
Ubiquinone-1 is a member of the chemical class known as Polyprenylbenzoquinones. These are compounds containing a polyisoprene chain attached to a quinone at the second ring position. Ubiquione-1 has just 1 isoprene unit. Normally in humans it has 10. Ubiquinone-1 is an intermediate in the synthesis of Ubiquionone 10, which is also called Coenzyme Q (CoQ). CoQ is found in the membranes of endoplasmic reticulum, peroxisomes, lysosomes, vesicles and notably the inner membrane of the mitochondrion where it is an important part of the electron transport chain; there it passes reducing equivalents to acceptors such as Coenzyme Q : cytochrome c - oxidoreductase. CoQ is also essential in the formation of the apoptosome along with other adapter proteins. The loss of trophic factors activates pro-apoptotic enzymes, causing the breakdown of mitochondria. Because of its ability to transfer electrons and therefore act as an antioxidant, Coenzyme Q has become a valued dietary supplement. CoQ10 has been widely used for the treatment of heart disease (especially heart failure), gum diseases, and also breast cancer. The benzoquinone portion of Coenzyme Q10 is synthesized from amino acids, while the isoprene sidechain is synthesized from acetyl CoA through the mevalonate pathway. The mevalonate pathway is used for the first steps of cholesterol biosynthesis.
A compound composed of the standard 2,3-dimethoxy-5-methylbenzoquinone nucleus common to ubiquinones; and a side chain of a single isoprenoid unit. [ChEBI]
COVID info from COVID-19 Disease Map
Corona-virus
Coronavirus
SARS-CoV-2
COVID-19
SARS-CoV
COVID19
SARS2
SARS
同义名列表
12 个代谢物同义名
2,3-dimethoxy-5-methyl-6-(3-methylbut-2-en-1-yl)cyclohexa-2,5-diene-1,4-dione; 2,3-Dimethoxy-5-methyl-6-(3-methyl-2-butenyl)-2,5-cyclohexadiene-1,4-dione; 2,3-Dimethoxy-5-methyl-6-(3-methylbut-2-en-1-yl)-1,4-benzoquinone; 2,3-Dimethoxy-5-methyl-6-(3-methylbut-2-enyl)benzo-1,4-quinone; Ubiquinone Q1; Ubiquinone-Q1; Ubiquionone 1; Ubiquinone-1; Ubiquinone 5; Coenzyme Q5; Coenzyme Q1; CoQ1
数据库引用编号
12 个数据库交叉引用编号
- ChEBI: CHEBI:16389
- ChEBI: CHEBI:46234
- PubChem: 4462
- HMDB: HMDB0002012
- DrugBank: DB08689
- ChEMBL: CHEMBL1236594
- foodb: FDB022794
- chemspider: 4307
- CAS: 727-81-1
- PMhub: MS000000326
- RefMet: Ubiquinone-1
- LOTUS: LTS0159026
分类词条
相关代谢途径
Reactome(0)
BioCyc(18)
- NADH to cytochrome bo oxidase electron transfer I
- NADH to cytochrome bd oxidase electron transfer I
- caffeine degradation V (bacteria, via trimethylurate)
- superpathway NAD/NADP - NADH/NADPH interconversion (yeast)
- superpathway NAD/NADP - NADH/NADPH interconversion
- ammonia oxidation IV (autotrophic ammonia oxidizers)
- TCA cycle VI (obligate autotrophs)
- glucose degradation (oxidative)
- glucose and glucose-1-phosphate degradation
- succinate to cytochrome bo oxidase electron transfer
- NADH to cytochrome bo oxidase electron transfer II
- D-lactate to cytochrome bo oxidase electron transfer
- glycerol-3-phosphate to cytochrome bo oxidase electron transfer
- proline to cytochrome bo oxidase electron transfer
- pyruvate to cytochrome bo oxidase electron transfer
- NADH to cytochrome bd oxidase electron transfer II
- succinate to cytochrome bd oxidase electron transfer
- nitrate reduction VIIIb (dissimilatory)
PlantCyc(0)
代谢反应
1169 个相关的代谢反应过程信息。
Reactome(0)
BioCyc(332)
- superpathway of glyoxylate bypass and TCA:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - aerobic respiration -- electron donors reaction list:
UQ + succinate ⟶ UQH2 + fumarate - TCA cycle:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - aerobic respiration -- electron donor III:
UQ + succinate ⟶ UQH2 + fumarate - superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - aerobic respiration -- electron donor II:
UQ + succinate ⟶ UQH2 + fumarate - superpathway of glyoxylate cycle:
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - aerobic respiration -- electron donor II:
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration -- electron donors reaction list:
UQ + succinate ⟶ UQH2 + fumarate - TCA cycle variation III (eukaryotic):
H2O + acetyl-CoA + oxaloacetate ⟶ H+ + citrate + coenzyme A - aerobic respiration -- electron donor II:
UQ + succinate ⟶ UQH2 + fumarate - TCA cycle variation III (eukaryotic):
citrate ⟶ cis-aconitate + H2O - aerobic respiration -- electron donor III:
UQ + succinate ⟶ UQH2 + fumarate - nitrate reduction VIIIb (dissimilatory):
H+ + UQH2 + nitrate ⟶ H+ + H2O + UQ + nitrite - nitrate reduction VIIIb (dissimilatory):
H+ + UQH2 + nitrate ⟶ H+ + H2O + UQ + nitrite - methylglyoxal degradation I:
(R)-lactate + UQ ⟶ UQH2 + pyruvate - superpathway of conversion of glucose to acetyl CoA and entry into the TCA cycle:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - TCA cycle:
D-threo-isocitrate + NAD+ ⟶ 2-oxoglutarate + CO2 + NADH - nitrate reduction X (dissimilatory, periplasmic):
H+ + a reduced [NapC protein] + nitrate ⟶ H2O + an oxidized [NapC protein] + nitrite - NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast):
H+ + NADH + UQ ⟶ NAD+ + UQH2 - superpathway NAD/NADP - NADH/NADPH interconversion (yeast):
D-glucopyranose 6-phosphate + NADP+ ⟶ 6-phospho D-glucono-1,5-lactone + H+ + NADPH - NAD/NADH phosphorylation and dephosphorylation:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - 2-chloroacrylate degradation I:
(R)-lactate + UQ ⟶ UQH2 + pyruvate - long chain fatty acid ester synthesis (engineered):
UQ + ethanol ⟶ UQH2 + acetaldehyde - succinate to cytochrome bo oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - NADH to cytochrome bd oxidase electron transfer II:
H+ + NADH + UQ ⟶ NAD+ + UQH2 - NADH to cytochrome bo oxidase electron transfer II:
H+ + NADH + UQ ⟶ NAD+ + UQH2 - D-lactate to cytochrome bo oxidase electron transfer:
(R)-lactate + UQ ⟶ UQH2 + pyruvate - glycerol-3-phosphate to cytochrome bo oxidase electron transfer:
sn-glycerol 3-phosphate + UQ ⟶ DHAP + UQH2 - proline to cytochrome bo oxidase electron transfer:
UQ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + UQH2 - TCA cycle III (animals):
UQ + succinate ⟶ UQH2 + fumarate - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - NADH to cytochrome bo oxidase electron transfer I:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NADH to cytochrome bd oxidase electron transfer I:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - pyruvate to cytochrome bd oxidase electron transfer:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate - pyruvate to cytochrome bo oxidase electron transfer:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate - aerobic respiration II (cytochrome c) (yeast):
UQH2 + an oxidized c-type cytochrome ⟶ H+ + UQ + a reduced c-type cytochrome - aerobic respiration III (alternative oxidase pathway):
O2 + UQH2 ⟶ H2O + UQ - superpathway of methylglyoxal degradation:
(S)-propane-1,2-diol + NAD+ ⟶ H+ + NADH + acetol - aerobic respiration I (cytochrome c):
UQH2 + an oxidized c-type cytochrome ⟶ H+ + UQ + a reduced c-type cytochrome - methylglyoxal degradation I:
(R)-S-lactoylglutathione + H2O ⟶ (R)-lactate + H+ + glutathione - ammonia oxidation IV (autotrophic ammonia oxidizers):
A(H2) + O2 + ammonia ⟶ A + H2O + hydroxylamine - caffeine degradation V (bacteria, via trimethylurate):
1,6,8-trimethylallantoate + H2O ⟶ N,N'-dimethylurea + N-methylurea + glyoxylate - L-ascorbate biosynthesis VI (engineered pathway):
D-glucopyranose + UQ ⟶ D-glucono-1,5-lactone + UQH2 - Fe(II) oxidation:
UQH2 + an oxidized CycA1 cytochrome ⟶ H+ + UQ + a reduced CycA1 cytochrome - glucose degradation (oxidative):
D-glucopyranose + UQ ⟶ D-glucono-1,5-lactone + UQH2 - glucose and glucose-1-phosphate degradation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - TCA cycle I (prokaryotic):
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - methylglyoxal degradation I:
(R)-lactate + UQ ⟶ UQH2 + pyruvate - glucose and glucose-1-phosphate degradation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - proline degradation:
H2O + L-glutamate-5-semialdehyde + NAD+ ⟶ H+ + NADH + glu - glycerophosphodiester degradation:
sn-glycerol 3-phosphate + MQ ⟶ DHAP + MQH2 - glycerol and glycerophosphodiester degradation:
ATP + glycerol ⟶ sn-glycerol 3-phosphate + ADP + H+ - nitrate reduction X (dissimilatory, periplasmic):
H+ + a reduced [NapC protein] + nitrate ⟶ H2O + an oxidized [NapC protein] + nitrite - superpathway of glyoxylate bypass and TCA:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - glycerol degradation I:
ATP + glycerol ⟶ sn-glycerol 3-phosphate + ADP + H+ - NADH to cytochrome bd oxidase electron transfer II:
H+ + O2 + UQH2 ⟶ H+ + H2O + UQ - NADH to cytochrome bo oxidase electron transfer II:
H+ + O2 + UQH2 ⟶ H+ + H2O + UQ - D-lactate to cytochrome bo oxidase electron transfer:
(R)-lactate + UQ ⟶ UQH2 + pyruvate - glycerol-3-phosphate to cytochrome bo oxidase electron transfer:
H+ + O2 + UQH2 ⟶ H+ + H2O + UQ - proline to cytochrome bo oxidase electron transfer:
H+ + O2 + UQH2 ⟶ H+ + H2O + UQ - superpathway of methylglyoxal degradation:
NADP+ + acetol ⟶ H+ + NADPH + methylglyoxal - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - NADH to cytochrome bo oxidase electron transfer I:
H+ + O2 + UQH2 ⟶ H+ + H2O + UQ - NADH to cytochrome bd oxidase electron transfer I:
H+ + O2 + UQH2 ⟶ H+ + H2O + UQ - succinate to cytochrome bo oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - pyruvate to cytochrome bd oxidase electron transfer:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate - pyruvate to cytochrome bo oxidase electron transfer:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate - superpathway NAD/NADP - NADH/NADPH interconversion:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast):
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration (cytochrome c):
succinate + ubiquinone-6 ⟶ fumarate + ubiquinol - aerobic respiration (linear view):
succinate + ubiquinone-6 ⟶ fumarate + ubiquinol - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - methylglyoxal degradation I:
(R)-lactate + UQ ⟶ UQH2 + pyruvate - TCA cycle variation V (plant):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - methylglyoxal degradation I:
(R)-lactate + UQ ⟶ UQH2 + pyruvate - nitrate reduction X (dissimilatory, periplasmic):
H+ + a reduced [NapC protein] + nitrate ⟶ H2O + an oxidized [NapC protein] + nitrite - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NADH to cytochrome bd oxidase electron transfer I:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
asp + carbamoyl-phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
asp + carbamoyl-phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - glucose and glucose-1-phosphate degradation:
D-glucopyranose + UQ ⟶ D-glucono-1,5-lactone + UQH2 - TCA cycle I (prokaryotic):
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - UMP biosynthesis:
asp + carbamoyl-phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - glycerophosphodiester degradation:
sn-glycerol 3-phosphate + UQ ⟶ DHAP + UQH2 - glycerol and glycerophosphodiester degradation:
ATP + glycerol ⟶ sn-glycerol 3-phosphate + ADP + H+ - glycerol degradation I:
ATP + glycerol ⟶ sn-glycerol 3-phosphate + ADP + H+ - pyruvate oxidation pathway:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate - superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - methylglyoxal degradation I:
(R)-lactate + UQ ⟶ UQH2 + pyruvate - superpathway of glyoxylate bypass and TCA:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glycerol-3-phosphate to cytochrome bo oxidase electron transfer:
sn-glycerol 3-phosphate + UQ ⟶ DHAP + UQH2 - NADH to cytochrome bd oxidase electron transfer I:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - pyruvate to cytochrome bo oxidase electron transfer:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate - D-lactate to cytochrome bo oxidase electron transport:
(R)-lactate + UQ ⟶ UQH2 + pyruvate - NADH to cytochrome bo oxidase electron transfer I:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - pyruvate to cytochrome bd terminal oxidase electron transfer:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - succinate to cytochrome bo oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - uridine-5'-phosphate biosynthesis:
H+ + orotidine-5'-phosphate ⟶ CO2 + UMP - pyrimidine ribonucleotides de novo biosynthesis:
H+ + orotidine-5'-phosphate ⟶ CO2 + UMP - pyruvate oxidation pathway:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate - glucose and glucose-1-phosphate degradation:
β-D-glucose + UQ ⟶ D-glucono-1,5-lactone + UQH2 - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - NADH to cytochrome bd oxidase electron transfer II:
H+ + NADH + UQ ⟶ NAD+ + UQH2 - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NADH to cytochrome bd oxidase electron transfer I:
H+ + O2 + UQH2 ⟶ H+ + H2O + UQ - glycerol degradation I:
ATP + glycerol ⟶ sn-glycerol 3-phosphate + ADP + H+ - superpathway of glyoxylate bypass and TCA:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - glycerol and glycerophosphodiester degradation:
ATP + glycerol ⟶ sn-glycerol 3-phosphate + ADP + H+ - glycerophosphodiester degradation:
sn-glycerol 3-phosphate + UQ ⟶ DHAP + UQH2 - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - glucose and glucose-1-phosphate degradation:
D-glucopyranose + UQ ⟶ D-glucono-1,5-lactone + UQH2 - NADH to cytochrome bd oxidase electron transfer I:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - TCA cycle I (prokaryotic):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
D-glucopyranose + UQ ⟶ D-glucono-1,5-lactone + UQH2 - TCA cycle I (prokaryotic):
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - UMP biosynthesis:
asp + carbamoyl-phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
asp + carbamoyl-phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
asp + carbamoyl-phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - pyruvate oxidation pathway:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate - NADH to cytochrome bo oxidase electron transfer:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - succinate to cytochrome bo oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - NADH to cytochrome bd oxidase electron transfer:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - superpathway of glyoxylate bypass and TCA:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - NADH to cytochrome bd oxidase electron transfer:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
asp + carbamoyl-phosphate ⟶ N-carbamoyl-L-aspartate + H+ + phosphate - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
α-D-glucose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - TCA cycle I (prokaryotic):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - UMP biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of glyoxylate bypass and TCA:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - pyruvate oxidation pathway:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate - superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - NADH to cytochrome bo oxidase electron transfer:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - succinate to cytochrome bo oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + orotate - glycerophosphodiester degradation:
sn-glycerol 3-phosphate + UQ ⟶ UQH2 + dihydroxyacetone phosphate - glycerol and glycerophosphodiester degradation:
ATP + glycerol ⟶ sn-glycerol 3-phosphate + ADP + H+ - TCA cycle I (prokaryotic):
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - glucose and glucose-1-phosphate degradation:
α-D-glucose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - UMP biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + orotate - superpathway of glyoxylate bypass and TCA:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - NADH to cytochrome bo oxidase electron transfer I:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - succinate to cytochrome bo oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - proline to cytochrome bo oxidase electron transfer:
UQ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + UQH2 - NADH to cytochrome bd oxidase electron transfer:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - glycerol degradation I:
ATP + glycerol ⟶ sn-glycerol 3-phosphate + ADP + H+ - D-lactate to cytochrome bo oxidase electron transfer:
(R)-lactate + UQ ⟶ UQH2 + pyruvate - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - succinate to cytochrome bo oxidase electron transfer:
H+ + O2 + UQH2 ⟶ H+ + H2O + UQ - aerobic respiration (cytochrome c):
UQH2 + an oxidized c-type cytochrome ⟶ H+ + UQ + a reduced c-type cytochrome - NADH to cytochrome bo oxidase electron transfer II:
H+ + NADH + UQ ⟶ NAD+ + UQH2 - proline to cytochrome bo oxidase electron transfer:
UQ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + UQH2 - NADH to cytochrome bd oxidase electron transfer I:
H+ + O2 + UQH2 ⟶ H+ + H2O + UQ - pyruvate to cytochrome bo oxidase electron transfer:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate - NADH to cytochrome bd oxidase electron transfer II:
H+ + NADH + UQ ⟶ NAD+ + UQH2 - glycerol-3-phosphate to cytochrome bo oxidase electron transfer:
sn-glycerol 3-phosphate + UQ ⟶ DHAP + UQH2 - NADH to cytochrome bo oxidase electron transfer I:
H+ + O2 + UQH2 ⟶ H+ + H2O + UQ - pyruvate to cytochrome bd oxidase electron transfer:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate - methylglyoxal degradation I:
(R)-lactate + UQ ⟶ UQH2 + pyruvate - glucose and glucose-1-phosphate degradation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - glucose degradation (oxidative):
D-glucopyranose + UQ ⟶ D-glucono-1,5-lactone + UQH2 - nitrate reduction X (dissimilatory, periplasmic):
H+ + a reduced [NapC protein] + nitrate ⟶ H2O + an oxidized [NapC protein] + nitrite - glucose degradation (oxidative):
D-glucopyranose + UQ ⟶ D-glucono-1,5-lactone + UQH2 - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - NADH to cytochrome bd oxidase electron transfer II:
H+ + NADH + UQ ⟶ NAD+ + UQH2 - methylglyoxal degradation I:
(R)-lactate + UQ ⟶ UQH2 + pyruvate - NADH to cytochrome bd oxidase electron transfer I:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration -- electron donors reaction list:
UQ + succinate ⟶ UQH2 + fumarate - TCA cycle variation III (eukaryotic):
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - glucose and glucose-1-phosphate degradation:
β-D-glucose + ATP ⟶ β-D-glucose-6-phosphate + ADP + H+ - NADH to cytochrome bo oxidase electron transfer I:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NADH to cytochrome bd oxidase electron transfer I:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - uridine-5'-phosphate biosynthesis:
ATP + H2O + bicarbonate + gln ⟶ ADP + H+ + carbamoyl-phosphate + glt + phosphate - aerobic respiration -- electron donor II:
UQ + succinate ⟶ UQH2 + fumarate - pyrimidine ribonucleotides de novo biosynthesis:
ATP + CDP ⟶ ADP + CTP - TCA cycle:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - glucose and glucose-1-phosphate degradation:
α-D-glucose 1-phosphate + H2O ⟶ D-glucose + phosphate - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose degradation (oxidative):
D-glucopyranose + UQ ⟶ D-glucono-1,5-lactone + UQH2 - respiration (anaerobic)-- electron donors reaction list:
H+ + MQ + formate ⟶ CO2 + H+ + MQH2 - superpathway of glyoxylate cycle and fatty acid degradation:
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - methylglyoxal degradation I:
(R)-lactate + UQ ⟶ UQH2 + pyruvate - glycerophosphodiester degradation:
sn-glycerol 3-phosphate + UQ ⟶ DHAP + UQH2 - glycerol-3-phosphate shuttle:
sn-glycerol 3-phosphate + NAD+ ⟶ DHAP + H+ + NADH - aerobic respiration -- electron donors reaction list:
UQ + succinate ⟶ UQH2 + fumarate - methylglyoxal degradation I:
(R)-lactate + UQ ⟶ UQH2 + pyruvate - superpathway of glyoxylate cycle and fatty acid degradation:
O2 + a 2,3,4-saturated fatty acyl CoA ⟶ a trans-2-enoyl-CoA + hydrogen peroxide - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glycerol degradation I:
ATP + glycerol ⟶ sn-glycerol 3-phosphate + ADP + H+ - glucose and glucose-1-phosphate degradation:
D-glucopyranose + UQ ⟶ D-glucono-1,5-lactone + UQH2 - glycerol and glycerophosphodiester degradation:
ATP + glycerol ⟶ sn-glycerol 3-phosphate + ADP + H+ - TCA cycle III (animals):
D-threo-isocitrate + NAD+ ⟶ 2-oxoglutarate + CO2 + NADH - NAD/NADH phosphorylation and dephosphorylation:
ATP + NADH ⟶ ADP + H+ + NADPH - NADH to cytochrome bd oxidase electron transfer:
H+ + NADH + UQ ⟶ NAD+ + UQH2 - NADH to cytochrome bo oxidase electron transfer:
H+ + NADH + UQ ⟶ NAD+ + UQH2 - glucose and glucose-1-phosphate degradation:
α-D-glucose 1-phosphate + H2O ⟶ D-glucose + phosphate - TCA cycle I (prokaryotic):
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - UMP biosynthesis:
(S)-dihydroorotate + UQ ⟶ UQH2 + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + UQ ⟶ UQH2 + orotate - proline to cytochrome bo oxidase electron transfer:
UQ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + UQH2 - NADH to cytochrome bd oxidase electron transfer:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NADH to cytochrome bo oxidase electron transfer:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - succinate to cytochrome bo oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - pyruvate oxidation pathway:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate - glucose and glucose-1-phosphate degradation:
α-D-glucose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - superpathway of glyoxylate bypass and TCA:
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - TCA cycle I (prokaryotic):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - pyruvate oxidation pathway:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of glyoxylate bypass and TCA:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - NADH to cytochrome bo oxidase electron transfer:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - succinate to cytochrome bo oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - proline to cytochrome bo oxidase electron transfer:
UQ + pro ⟶ (S)-1-pyrroline-5-carboxylate + H+ + UQH2 - NADH to cytochrome bd oxidase electron transfer:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - glucose and glucose-1-phosphate degradation:
α-D-glucose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - UMP biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - glycerol degradation I:
ATP + glycerol ⟶ sn-glycerol-3-phosphate + ADP + H+ - glycerophosphodiester degradation:
sn-glycerol-3-phosphate + UQ ⟶ UQH2 + dihydroxyacetone phosphate - TCA cycle:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - uridine-5'-phosphate biosynthesis:
ATP + H2O + bicarbonate + gln ⟶ ADP + H+ + carbamoyl-phosphate + glt + phosphate - glycerol and glycerophosphodiester degradation:
ATP + glycerol ⟶ sn-glycerol-3-phosphate + ADP + H+ - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NADH to cytochrome bd oxidase electron transfer:
H+ + NADH + UQ ⟶ NAD+ + UQH2 - pyrimidine ribonucleotides de novo biosynthesis:
ATP + CMP ⟶ ADP + CDP - succinate to cytochrome bo oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - NADH to cytochrome bo oxidase electron transfer:
H+ + NADH + UQ ⟶ NAD+ + UQH2 - glycerol degradation I:
ATP + glycerol ⟶ sn-glycerol-3-phosphate + ADP + H+ - glucose and glucose-1-phosphate degradation:
β-D-glucose + UQ ⟶ D-glucono-1,5-lactone + UQH2 - NADH to cytochrome bd oxidase electron transfer:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - uridine-5'-phosphate biosynthesis:
(S)-dihydroorotate + UQ ⟶ UQH2 + orotate - pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + UQ ⟶ UQH2 + orotate - glycerophosphodiester degradation:
sn-glycerol-3-phosphate + UQ ⟶ UQH2 + dihydroxyacetone phosphate - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glycerol and glycerophosphodiester degradation:
ATP + glycerol ⟶ sn-glycerol-3-phosphate + ADP + H+ - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glycerol degradation I:
ATP + glycerol ⟶ sn-glycerol-3-phosphate + ADP + H+ - pyrimidine ribonucleotides de novo biosynthesis:
ATP + CMP ⟶ ADP + CDP - pyruvate oxidation pathway:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate - TCA cycle I (prokaryotic):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - uridine-5'-phosphate biosynthesis:
ATP + H2O + bicarbonate + gln ⟶ ADP + H+ + carbamoyl-phosphate + glt + phosphate - TCA cycle VI (obligate autotrophs):
H2O + NADP+ + glt ⟶ 2-oxoglutarate + H+ + NADPH + ammonia - glucose and glucose-1-phosphate degradation:
β-D-glucose + UQ ⟶ D-glucono-1,5-lactone + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - glycerophosphodiester degradation:
sn-glycerol-3-phosphate + UQ ⟶ UQH2 + dihydroxyacetone phosphate - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine-5'-phosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + orotate - NADH to cytochrome bd oxidase electron transfer:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - glycerol and glycerophosphodiester degradation:
ATP + glycerol ⟶ sn-glycerol-3-phosphate + ADP + H+ - UMP biosynthesis:
diphosphate + orotidine-5'-phosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine-5'-phosphate ⟶ 5-phospho-α-D-ribose 1-diphosphate + orotate - glycerol degradation I:
ATP + glycerol ⟶ sn-glycerol-3-phosphate + ADP + H+ - glucose and glucose-1-phosphate degradation:
β-D-glucose + ATP ⟶ β-D-glucose 6-phosphate + ADP + H+ - pyruvate oxidation pathway:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate - NADH to cytochrome bo oxidase electron transfer:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - TCA cycle I (prokaryotic):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - succinate to cytochrome bo oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - NADH to cytochrome bd oxidase electron transfer:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - glucose and glucose-1-phosphate degradation:
α-D-glucose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - aerobic respiration (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NADH to cytochrome bd oxidase electron transfer:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NADH to cytochrome bo oxidase electron transfer:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - methylglyoxal degradation I:
(R)-lactate + UQ ⟶ UQH2 + pyruvate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - glycerol-3-phosphate shuttle:
sn-glycerol 3-phosphate + NAD+ ⟶ DHAP + H+ + NADH - TCA cycle I (prokaryotic):
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - pyruvate oxidation pathway:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate - glycerophosphodiester degradation:
sn-glycerol 3-phosphate + UQ ⟶ DHAP + UQH2 - NADH to cytochrome bd oxidase electron transport II:
H+ + NADH + UQ ⟶ NAD+ + UQH2 - methylglyoxal degradation I:
(R)-lactate + UQ ⟶ UQH2 + pyruvate - pyruvate to cytochrome bd terminal oxidase electron transfer:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - UMP biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - NADH to cytochrome bd oxidase electron transfer I:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - glycerophosphodiester degradation:
sn-glycerol 3-phosphate + UQ ⟶ DHAP + UQH2 - glycerol and glycerophosphodiester degradation:
sn-glycerol 3-phosphate + UQ ⟶ DHAP + UQH2 - glycerol degradation I:
sn-glycerol 3-phosphate + UQ ⟶ DHAP + UQH2 - methylglyoxal degradation I:
(R)-lactate + UQ ⟶ UQH2 + pyruvate - TCA cycle I (prokaryotic):
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - glycerol and glycerophosphodiester degradation:
ATP + glycerol ⟶ sn-glycerol 3-phosphate + ADP + H+ - glycerophosphodiester degradation:
sn-glycerol 3-phosphate + UQ ⟶ DHAP + UQH2 - superpathway of glyoxylate bypass and TCA:
D-threo-isocitrate + NADP+ ⟶ 2-oxoglutarate + CO2 + NADPH - glycerol degradation I:
ATP + glycerol ⟶ sn-glycerol 3-phosphate + ADP + H+ - pyruvate to cytochrome bd terminal oxidase electron transfer:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate - NADH to cytochrome bd oxidase electron transfer I:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - methylglyoxal degradation I:
(R)-lactate + UQ ⟶ UQH2 + pyruvate - UMP biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - glycerol and glycerophosphodiester degradation:
ATP + glycerol ⟶ sn-glycerol 3-phosphate + ADP + H+ - glycerol degradation I:
ATP + glycerol ⟶ sn-glycerol 3-phosphate + ADP + H+ - glycerophosphodiester degradation:
sn-glycerol 3-phosphate + UQ ⟶ DHAP + UQH2 - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - methylglyoxal degradation I:
(R)-lactate + UQ ⟶ UQH2 + pyruvate - TCA cycle I (prokaryotic):
2-oxoglutarate + NAD+ + coenzyme A ⟶ CO2 + NADH + succinyl-CoA - ammonia oxidation IV (autotrophic ammonia oxidizers):
A(H2) + O2 + ammonia ⟶ A + H2O + hydroxylamine - pyruvate to cytochrome bd oxidase electron transfer:
H2O + UQ + pyruvate ⟶ CO2 + UQH2 + acetate - succinate to cytochrome bd oxidase electron transfer:
UQ + succinate ⟶ UQH2 + fumarate
WikiPathways(0)
Plant Reactome(216)
- Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Carbohydrate metabolism:
ATP + beta-D-glucose ⟶ ADP + H+ + beta-D-glucose-6-phosphate - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Carbohydrate metabolism:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Carbohydrate metabolism:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Carbohydrate metabolism:
H2O + alpha,alpha-trehalose ⟶ beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Carbohydrate metabolism:
ATP + beta-D-glucose ⟶ ADP + H+ + beta-D-glucose-6-phosphate - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
L-Glu + imidazole acetol-phosphate ⟶ 2OG + L-histidinol-phosphate - Carbohydrate metabolism:
ATP + Glycerol ⟶ ADP + G3P - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
FAD + PROP-CoA ⟶ FADH2 + acryloyl-CoA - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
ATP + CoA + propionate ⟶ AMP + PPi + PROP-CoA - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P - Metabolism and regulation:
CoA + NAD + methylmalonate-semialdehyde ⟶ NADH + PROP-CoA + carbon dioxide - Carbohydrate metabolism:
Suc ⟶ 1-kestose + beta-D-glucose - Glycerol degradation I:
ATP + Glycerol ⟶ ADP + G3P
INOH(0)
PlantCyc(594)
- superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - trans-lycopene biosynthesis II (oxygenic phototrophs and green sulfur bacteria):
prolycopene ⟶ all-trans-lycopene - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - glycerol degradation I:
ATP + glycerol ⟶ sn-glycerol 3-phosphate + ADP + H+ - glycerol-3-phosphate shuttle:
sn-glycerol 3-phosphate + NAD+ ⟶ DHAP + H+ + NADH - L-proline degradation I:
H2O + L-glutamate-5-semialdehyde + NAD+ ⟶ H+ + NADH + glu - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - glycerophosphodiester degradation:
sn-glycerol 3-phosphate + an electron-transfer quinone ⟶ DHAP + an electron-transfer quinol - trans-lycopene biosynthesis II (oxygenic phototrophs and green sulfur bacteria):
prolycopene ⟶ all-trans-lycopene - trans-lycopene biosynthesis II (oxygenic phototrophs and green sulfur bacteria):
prolycopene ⟶ all-trans-lycopene - trans-lycopene biosynthesis II (oxygenic phototrophs and green sulfur bacteria):
prolycopene ⟶ all-trans-lycopene - trans-lycopene biosynthesis II (oxygenic phototrophs and green sulfur bacteria):
prolycopene ⟶ all-trans-lycopene - trans-lycopene biosynthesis II (oxygenic phototrophs and green sulfur bacteria):
prolycopene ⟶ all-trans-lycopene - trans-lycopene biosynthesis II (oxygenic phototrophs and green sulfur bacteria):
prolycopene ⟶ all-trans-lycopene - trans-lycopene biosynthesis II (oxygenic phototrophs and green sulfur bacteria):
prolycopene ⟶ all-trans-lycopene - trans-lycopene biosynthesis II (oxygenic phototrophs and green sulfur bacteria):
prolycopene ⟶ all-trans-lycopene - superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster - superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster - superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster - superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster - superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster - superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster - superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster - superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster - trans-lycopene biosynthesis II (oxygenic phototrophs and green sulfur bacteria):
prolycopene ⟶ all-trans-lycopene - superpathway of carotenoid biosynthesis in plants:
β-carotene + H+ + O2 + a reduced ferredoxin [iron-sulfur] cluster ⟶ β-cryptoxanthin + H2O + an oxidized ferredoxin [iron-sulfur] cluster - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD(P)/NADPH interconversion:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
D-glucopyranose + UQ ⟶ D-glucono-1,5-lactone + UQH2 - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - glucose and glucose-1-phosphate degradation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - TCA cycle variation V (plant):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD(P)/NADPH interconversion:
H2O + NADP+ ⟶ NAD+ + phosphate - glucose and glucose-1-phosphate degradation:
D-glucopyranose + UQ ⟶ D-glucono-1,5-lactone + UQH2 - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast):
H2O + NADP+ + an aldehyde ⟶ H+ + NADPH + a carboxylate - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast):
H2O + NADP+ + an aldehyde ⟶ H+ + NADPH + a carboxylate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - NAD(P)/NADPH interconversion:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - TCA cycle III (animals):
2-oxoglutarate + H+ + a [2-oxoglutarate dehydrogenase E2 protein] N6-lipoyl-L-lysine ⟶ CO2 + a [2-oxoglutarate dehydrogenase E2 protein] N6-S-succinyldihydrolipoyl-L-lysine - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - L-proline degradation:
H2O + L-glutamate-5-semialdehyde + NAD+ ⟶ H+ + NADH + glu - glycerol-3-phosphate shuttle:
sn-glycerol 3-phosphate + NAD+ ⟶ DHAP + H+ + NADH - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - glycerol degradation I:
ATP + glycerol ⟶ sn-glycerol 3-phosphate + ADP + H+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD(P)/NADPH interconversion:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
D-glucopyranose + UQ ⟶ D-glucono-1,5-lactone + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
D-glucopyranose + UQ ⟶ D-glucono-1,5-lactone + UQH2 - glucose and glucose-1-phosphate degradation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - glucose and glucose-1-phosphate degradation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - L-Nδ-acetylornithine biosynthesis:
2-oxoglutarate + L-ornithine ⟶ L-glutamate-5-semialdehyde + glu - glycerol-3-phosphate shuttle:
sn-glycerol 3-phosphate + NAD+ ⟶ DHAP + H+ + NADH - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - glycerol degradation I:
ATP + glycerol ⟶ sn-glycerol 3-phosphate + ADP + H+ - L-proline degradation:
H2O + L-glutamate-5-semialdehyde + NAD+ ⟶ H+ + NADH + glu - NAD(P)/NADPH interconversion:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
D-glucopyranose + UQ ⟶ D-glucono-1,5-lactone + UQH2 - NAD(P)/NADPH interconversion:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD(P)/NADPH interconversion:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - glucose and glucose-1-phosphate degradation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - methylglyoxal degradation I:
(R)-lactate + UQ ⟶ UQH2 + pyruvate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - glucose and glucose-1-phosphate degradation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - glucose and glucose-1-phosphate degradation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - TCA cycle III (animals):
citrate ⟶ cis-aconitate + H2O - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
D-glucopyranose + UQ ⟶ D-glucono-1,5-lactone + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD(P)/NADPH interconversion:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
D-glucopyranose + UQ ⟶ D-glucono-1,5-lactone + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - glucose and glucose-1-phosphate degradation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - NAD(P)/NADPH interconversion:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - L-proline degradation:
H2O + L-glutamate-5-semialdehyde + NAD+ ⟶ H+ + NADH + glu - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - glycerol-3-phosphate shuttle:
sn-glycerol 3-phosphate + NAD+ ⟶ DHAP + H+ + NADH - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - glycerol degradation I:
ATP + glycerol ⟶ sn-glycerol 3-phosphate + ADP + H+ - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD(P)/NADPH interconversion:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - glucose and glucose-1-phosphate degradation:
D-glucopyranose + UQ ⟶ D-glucono-1,5-lactone + UQH2 - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - glucose and glucose-1-phosphate degradation:
D-glucopyranose + UQ ⟶ D-glucono-1,5-lactone + UQH2 - NAD(P)/NADPH interconversion:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - glucose and glucose-1-phosphate degradation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - L-proline degradation:
H2O + L-glutamate-5-semialdehyde + NAD+ ⟶ H+ + NADH + glu - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - glycerol-3-phosphate shuttle:
sn-glycerol 3-phosphate + NAD+ ⟶ DHAP + H+ + NADH - glycerol degradation I:
ATP + glycerol ⟶ sn-glycerol 3-phosphate + ADP + H+ - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - glucose and glucose-1-phosphate degradation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast):
ATP + NAD+ ⟶ ADP + H+ + NADP+ - glycerol degradation I:
ATP + glycerol ⟶ sn-glycerol 3-phosphate + ADP + H+ - glycerol-3-phosphate shuttle:
sn-glycerol 3-phosphate + NAD+ ⟶ DHAP + H+ + NADH - L-proline degradation:
H2O + L-glutamate-5-semialdehyde + NAD+ ⟶ H+ + NADH + glu - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - glucose and glucose-1-phosphate degradation:
D-glucopyranose + UQ ⟶ D-glucono-1,5-lactone + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD(P)/NADPH interconversion:
NAD+ + NADPH ⟶ NADH + NADP+ - glucose and glucose-1-phosphate degradation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
D-glucopyranose + UQ ⟶ D-glucono-1,5-lactone + UQH2 - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glycerol-3-phosphate shuttle:
sn-glycerol 3-phosphate + NAD+ ⟶ DHAP + H+ + NADH - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast):
ATP + NAD+ ⟶ ADP + H+ + NADP+ - glucose and glucose-1-phosphate degradation:
D-glucopyranose + UQ ⟶ D-glucono-1,5-lactone + UQH2 - glycerol degradation I:
ATP + glycerol ⟶ sn-glycerol 3-phosphate + ADP + H+ - L-proline degradation:
H2O + L-glutamate-5-semialdehyde + NAD+ ⟶ H+ + NADH + glu - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
ATP + D-glucopyranose ⟶ ADP + D-glucopyranose 6-phosphate + H+ - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD(P)/NADPH interconversion:
H2O + NADP+ ⟶ NAD+ + phosphate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - TCA cycle variation V (plant):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD(P)/NADPH interconversion:
NAD+ + NADPH ⟶ NADH + NADP+ - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD(P)/NADPH interconversion:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD(P)/NADPH interconversion:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - NAD(P)/NADPH interconversion:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - methylglyoxal degradation I:
(R)-lactate + UQ ⟶ UQH2 + pyruvate - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - glycerol degradation I:
ATP + glycerol ⟶ sn-glycerol 3-phosphate + ADP + H+ - glycerol-3-phosphate shuttle:
sn-glycerol 3-phosphate + NAD+ ⟶ DHAP + H+ + NADH - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - L-proline degradation:
H2O + L-glutamate-5-semialdehyde + NAD+ ⟶ H+ + NADH + glu - NAD(P)/NADPH interconversion:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - NAD(P)/NADPH interconversion:
NAD+ + NADPH ⟶ NADH + NADP+ - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - L-proline degradation:
H2O + L-glutamate-5-semialdehyde + NAD+ ⟶ H+ + NADH + glu - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - glycerol degradation I:
ATP + glycerol ⟶ sn-glycerol 3-phosphate + ADP + H+ - glycerol-3-phosphate shuttle:
sn-glycerol 3-phosphate + NAD+ ⟶ DHAP + H+ + NADH - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - UMP biosynthesis I:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
(S)-dihydroorotate + an electron-transfer quinone ⟶ an electron-transfer quinol + orotate - NAD(P)/NADPH interconversion:
NAD+ + NADPH ⟶ NADH + NADP+ - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - aerobic respiration I (cytochrome c):
UQ + succinate ⟶ UQH2 + fumarate - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD(P)/NADPH interconversion:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - NAD(P)/NADPH interconversion:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD(P)/NADPH interconversion:
NAD+ + NADPH ⟶ NADH + NADP+ - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
H2O + NADP+ ⟶ NAD+ + phosphate - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD(P)/NADPH interconversion:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - aerobic respiration I (cytochrome c):
UQH2 + an oxidized c-type cytochrome ⟶ H+ + UQ + a reduced c-type cytochrome - glucose and glucose-1-phosphate degradation:
D-glucopyranose + UQ ⟶ D-glucono-1,5-lactone + UQH2 - aerobic respiration III (alternative oxidase pathway):
UQ + succinate ⟶ UQH2 + fumarate - NAD/NADH phosphorylation and dephosphorylation:
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - NAD/NADH phosphorylation and dephosphorylation:
NAD+ + NADPH ⟶ NADH + NADP+ - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - glycerol degradation I:
ATP + glycerol ⟶ sn-glycerol 3-phosphate + ADP + H+ - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - glucose and glucose-1-phosphate degradation:
D-glucono-1,5-lactone + H2O ⟶ D-gluconate + H+ - L-proline degradation:
H2O + L-glutamate-5-semialdehyde + NAD+ ⟶ H+ + NADH + glu - UMP biosynthesis I:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - NAD/NADH phosphorylation and dephosphorylation:
ATP + NAD+ ⟶ ADP + H+ + NADP+ - L-citrulline biosynthesis:
H2O + arg ⟶ L-ornithine + urea - L-Nδ-acetylornithine biosynthesis:
H2O + arg ⟶ L-ornithine + urea - glycerol-3-phosphate shuttle:
sn-glycerol 3-phosphate + NAD+ ⟶ DHAP + H+ + NADH - superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - superpathway of pyrimidine ribonucleotides de novo biosynthesis:
diphosphate + orotidine 5'-phosphate ⟶ PRPP + orotate - glucose and glucose-1-phosphate degradation:
α-D-glucopyranose 1-phosphate + H2O ⟶ D-glucopyranose + phosphate - aerobic respiration II (cytochrome c) (yeast):
H+ + NADH + UQ ⟶ NAD+ + UQH2 - aerobic respiration I (cytochrome c):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2 - aerobic respiration III (alternative oxidase pathway):
H+ + NADH + UQ ⟶ H+ + NAD+ + UQH2
COVID-19 Disease Map(2)
- @COVID-19 Disease
Map["name"]:
H_sub_2_endsub_O_sub_2_endsub_ + glutathione ⟶ H_sub_2_endsub_O + glutathione disulfide - @COVID-19 Disease
Map["name"]:
cytidine ⟶ uridine
PathBank(25)
- TCA Cycle:
Citric acid ⟶ Water + cis-Aconitic acid - Oxidative Phosphorylation:
Succinic acid + Ubiquinone-1 ⟶ Fumaric acid + Ubiquinol-1 - Oxidative Phosphorylation:
Succinic acid + Ubiquinone-1 ⟶ Fumaric acid + Ubiquinol-1 - TCA Cycle:
Water + cis-Aconitic acid ⟶ D-threo-Isocitric acid - Oxidative Phosphorylation:
Succinic acid + Ubiquinone-1 ⟶ Fumaric acid + Ubiquinol-1 - Betaine Metabolism:
S-Adenosylhomocysteine + Water ⟶ Adenosine + Homocysteine - Proline Metabolism:
Adenosine triphosphate + L-Glutamic acid + Water ⟶ Adenosine diphosphate + Hydrogen Ion + L-Glutamic acid + Phosphate - Glycerol Metabolism:
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water - Glycerol Metabolism II:
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water - Glycerol Metabolism III (sn-Glycero-3-Phosphoethanolamine):
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water - Glycerol Metabolism IV (Glycerophosphoglycerol):
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water - Glycerol Metabolism V (Glycerophosphoserine):
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water - Pyrimidine Metabolism:
Hydrogen Ion + N-carbamoyl-L-aspartate ⟶ 4,5-Dihydroorotic acid + Water - Proline Metabolism:
Adenosine triphosphate + L-Glutamic acid + Water ⟶ Adenosine diphosphate + Hydrogen Ion + L-Glutamic acid + Phosphate - Pyrimidine Metabolism:
Hydrogen Ion + N-carbamoyl-L-aspartate ⟶ 4,5-Dihydroorotic acid + Water - Betaine Metabolism:
S-Adenosylhomocysteine + Water ⟶ Adenosine + Homocysteine - Betaine Metabolism:
S-Adenosylhomocysteine + Water ⟶ Adenosine + Homocysteine - Betaine Metabolism:
S-Adenosylhomocysteine + Water ⟶ Adenosine + Homocysteine - Proline Metabolism:
Adenosine triphosphate + L-Glutamic acid + Water ⟶ Adenosine diphosphate + Hydrogen Ion + L-Glutamic acid + Phosphate - Glycerol Metabolism:
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water - Glycerol Metabolism II:
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water - Glycerol Metabolism III (sn-Glycero-3-Phosphoethanolamine):
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water - Glycerol Metabolism IV (Glycerophosphoglycerol):
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water - Glycerol Metabolism V (Glycerophosphoserine):
Adenosine monophosphate + Hydrogen Ion + Phosphate + Phosphoenolpyruvic acid ⟶ Adenosine triphosphate + Pyruvic acid + Water - Pyrimidine Metabolism:
Hydrogen Ion + N-carbamoyl-L-aspartate ⟶ 4,5-Dihydroorotic acid + Water
PharmGKB(0)
16 个相关的物种来源信息
- 4890 - Ascomycota: LTS0159026
- 33170 - Eremothecium: LTS0159026
- 33173 - Eremothecium coryli: 10.1271/BBB1961.45.2671
- 33173 - Eremothecium coryli: LTS0159026
- 2759 - Eukaryota: LTS0159026
- 4751 - Fungi: LTS0159026
- 9606 - Homo sapiens: -
- 3398 - Magnoliopsida: LTS0159026
- 4891 - Saccharomycetes: LTS0159026
- 4070 - Solanaceae: LTS0159026
- 4107 - Solanum: LTS0159026
- 4081 - Solanum lycopersicum: 10.3390/MOLECULES23123330
- 4081 - Solanum lycopersicum: LTS0159026
- 35493 - Streptophyta: LTS0159026
- 58023 - Tracheophyta: LTS0159026
- 33090 - Viridiplantae: LTS0159026
在这里通过桑基图来展示出与当前的这个代谢物在我们的BioDeep知识库中具有相关联信息的其他代谢物。在这里进行关联的信息来源主要有：
- PubMed: 来源于PubMed文献库中的文献信息，我们通过自然语言数据挖掘得到的在同一篇文献中被同时提及的相关代谢物列表，这个列表按照代谢物同时出现的文献数量降序排序，取前10个代谢物作为相关研究中关联性很高的代谢物集合展示在桑基图中。
- NCBI Taxonomy: 通过文献数据挖掘，得到的代谢物物种来源信息关联。这个关联信息同样按照出现的次数降序排序，取前10个代谢物作为高关联度的代谢物集合展示在桑吉图上。
- Chemical Taxonomy: 在物质分类上处于同一个分类集合中的其他代谢物
- Chemical Reaction: 在化学反应过程中，存在为当前代谢物相关联的生化反应过程中的反应底物或者反应产物的关联代谢物信息。
点击图上的相关代谢物的名称，可以跳转到相关代谢物的信息页面。
文献列表
- Wah-Seng See-Too, Robson Ee, Munusamy Madhaiyan, Soon-Wo Kwon, Jia Yi Tan, Yan Lue Lim, Peter Convey, David A Pearce, Wai Fong Yin, Kok-Gan Chan. Planococcus versutus sp. nov., isolated from soil.
International journal of systematic and evolutionary microbiology.
2017 Apr; 67(4):944-950. doi:
10.1099/ijsem.0.001721. [PMID: 27959786] - Anna Gvozdjáková, Jarmila Kucharská, Jozef Dubravicky, Viliam Mojto, Ram B Singh. Coenzyme Q₁₀, α-tocopherol, and oxidative stress could be important metabolic biomarkers of male infertility.
Disease markers.
2015; 2015(?):827941. doi:
10.1155/2015/827941. [PMID: 25810566] - Beibei Huang, Jing Guo, Lianna Sun, Wansheng Chen. ERG9 and COQ1 disruption reveals isoprenoids biosynthesis is closely related to mitochondrial function in Saccharomyces cerevisiae.
Integrative biology : quantitative biosciences from nano to macro.
2013 Oct; 5(10):1282-96. doi:
10.1039/c3ib40063h. [PMID: 24056878] - Kevork Hagopian, Kristina L Weber, Darren T Hwee, Alison L Van Eenennaam, Guillermo López-Lluch, José M Villalba, Isabel Burón, Plácido Navas, J Bruce German, Steven M Watkins, Yana Chen, Alfreda Wei, Roger B McDonald, Jon J Ramsey. Complex I-associated hydrogen peroxide production is decreased and electron transport chain enzyme activities are altered in n-3 enriched fat-1 mice.
PloS one.
2010 Sep; 5(9):e12696. doi:
10.1371/journal.pone.0012696. [PMID: 20856881] - Muthuvel Jayachandran, Claudia C Preston, Larry W Hunter, Arshad Jahangir, Whyte G Owen, Kenneth S Korach, Virginia M Miller. Loss of estrogen receptor beta decreases mitochondrial energetic potential and increases thrombogenicity of platelets in aged female mice.
Age (Dordrecht, Netherlands).
2010 Mar; 32(1):109-21. doi:
10.1007/s11357-009-9119-y. [PMID: 19908165] - Alejandro K Samhan-Arias, Rui O Duarte, Francisco Javier Martín-Romero, Jose J G Moura, Carlos Gutiérrez-Merino. Reduction of ascorbate free radical by the plasma membrane of synaptic terminals from rat brain.
Archives of biochemistry and biophysics.
2008 Jan; 469(2):243-54. doi:
10.1016/j.abb.2007.10.004. [PMID: 17963686] - Nicholas A Malmquist, Jeffrey Baldwin, Margaret A Phillips. Detergent-dependent kinetics of truncated Plasmodium falciparum dihydroorotate dehydrogenase.
The Journal of biological chemistry.
2007 Apr; 282(17):12678-86. doi:
10.1074/jbc.m609893200. [PMID: 17329250] - Peter Gin, Catherine F Clarke. Genetic evidence for a multi-subunit complex in coenzyme Q biosynthesis in yeast and the role of the Coq1 hexaprenyl diphosphate synthase.
The Journal of biological chemistry.
2005 Jan; 280(4):2676-81. doi:
10.1074/jbc.m411527200. [PMID: 15548532] - Giuseppe Galati, Peter J O'Brien. Cytoprotective and anticancer properties of coenzyme Q versus capsaicin.
BioFactors (Oxford, England).
2003; 18(1-4):195-205. doi:
10.1002/biof.5520180222. [PMID: 14695935] - Tom S Chan, Peter J O'Brien. Hepatocyte metabolism of coenzyme Q1 (ubiquinone-5) to its sulfate conjugate decreases its antioxidant activity.
BioFactors (Oxford, England).
2003; 18(1-4):207-18. doi:
10.1002/biof.5520180223. [PMID: 14695936] - Juan C Rodríguez-Aguilera, Claudio Asencio, Macarena Ruiz-Ferrer, Jordana Vela, Plácido Navas. Caenorhabditis elegans ubiquinone biosynthesis genes.
BioFactors (Oxford, England).
2003; 18(1-4):237-44. doi:
10.1002/biof.5520180226. [PMID: 14695939] - M V Wright, T B Kuhn. CNS neurons express two distinct plasma membrane electron transport systems implicated in neuronal viability.
Journal of neurochemistry.
2002 Nov; 83(3):655-64. doi:
10.1046/j.1471-4159.2002.01176.x. [PMID: 12390527]